|
|
|
|
|
|
|
|
|
| Hinweis: Verwenden Sie die Schlüsselwörter 'nicht leer' und 'leer' (ohne Anführungszeichen) in Freitextfeldern, um nach Ergebnissen mit bzw. ohne Einträge zu suchen. |
| 005-001-00-X |
boron trifluoride |
7637-07-2 |
Press. Gas, Acute Tox. 2 *, Skin Corr. 1A |
H330, H314 |
|
U |
CLP00/ |
| 005-002-00-5 |
boron trichloride |
10294-34-5 |
Press. Gas, Acute Tox. 2 *, Acute Tox. 2 *, Skin Corr. 1B |
H330, H300, H314 |
|
U |
CLP00/ |
| 005-003-00-0 |
boron tribromide |
10294-33-4 |
Acute Tox. 2 *, Acute Tox. 2 *, Skin Corr. 1A |
H330, H300, H314 |
|
|
CLP00/ |
| 005-004-00-6 |
trialkylboranes |
- |
Pyr. Sol. 1, Skin Corr. 1B |
H250, H314 |
|
A |
CLP00/ |
| 005-004-01-3 |
trialkylboranes, liquid |
- |
Pyr. Liq. 1, Skin Corr. 1B |
H250, H314 |
|
A |
CLP00/ |
| 005-005-00-1 |
trimethyl borate |
121-43-7 |
Flam. Liq. 3, Acute Tox. 4 * |
H226, H312 |
|
|
CLP00/ |
| 005-006-00-7 |
dibutyltin hydrogen borate |
75113-37-0 |
Repr. 1B, Muta. 2, STOT RE 1, Acute Tox. 4 *, Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360FD, H341, H372**, H312, H302, H318, H317, H400, H410 |
|
|
CLP00/ATP01 |
| 005-007-00-2 |
boric acid [1], boric acid [2] |
10043-35-3 [1], 11113-50-1 [2] |
Repr. 1B |
H360FD |
|
|
ATP01/ATP17 |
| 005-008-00-8 |
diboron trioxide |
1303-86-2 |
Repr. 1B |
H360FD |
|
|
ATP01/ATP17 |
| 005-009-00-3 |
tetrabutylammonium butyltriphenylborate |
120307-06-4 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 005-010-00-9 |
N,N-dimethylanilinium tetrakis(pentafluorophenyl)borate |
118612-00-3 |
Carc. 2, Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1 |
H351, H302, H315, H318 |
|
|
CLP00/ |
| 005-011-00-4 |
tetraboron disodium heptaoxide, hydrate [1], disodium tetraborate, anhydrous [2], orthoboric acid, sodium salt [3], disodium tetraborate decahydrate [4], disodium tetraborate pentahydrate [5] |
12267-73-1 [1], 1330-43-4 [2], 13840-56-7 [3], 1303-96-4 [4], 12179-04-3 [5] |
Repr. 1B |
H360FD |
|
|
ATP01/ATP17 |
| 005-011-01-1 |
disodium tetraborate decahydrate; borax decahydrate |
1303-96-4 |
Repr. 1B |
H360FD |
Repr. 1B; H360FD: C ≥ 8,5 % |
|
ATP01/ |
| 005-011-02-9 |
disodium tetraborate pentahydrate; borax pentahydrate |
12179-04-3 |
Repr. 1B |
H360FD |
Repr. 1B; H360FD: C ≥ 6,5 % |
|
ATP01/ |
| 005-012-00-X |
diethyl{}{4-[1,5,5-tris(4-diethylaminophenyl)penta-2,4-dienylidene]cyclohexa-2,5-dienylidene}}ammonium butyltriphenylborate |
141714-54-7 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 005-013-00-5 |
diethylmethoxyborane |
7397-46-8 |
Pyr. Liq. 1, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 4 |
H250, H332, H312, H302, H373**, H314, H317, H413 |
|
|
ATP01/ |
| 005-014-00-0 |
4-formylphenylboronic acid |
87199-17-5 |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 005-015-00-6 |
1-chloromethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane bis(tetrafluoroborate) |
140681-55-6 |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H302, H318, H317, H412 |
|
|
ATP01/ |
| 005-016-00-1 |
tetrabutylammonium butyl tris-(4-tert-butylphenyl)borate |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 005-017-00-7 |
sodium perborate; [1] perboric acid, sodium salt; [2] perboric acid, sodium salt, monohydrate; sodium peroxometaborate; perboric acid (HBO(O2)), sodium salt, monohydrate; sodium peroxoborate; [containing < 0.1 % (w/w) of particles with an aerodynamic d |
15120-21-5 [1], 7632-04-4 [2], -, -, -, - |
Oxid. Sol. 2, Repr. 1B, Acute Tox. 4 *, STOT SE 3, Eye Dam. 1 |
H272, H360Df, H302, H335, H318 |
Repr. 1B; H360Df: C ≥ 9 %, Repr. 1B; H360D: 6,5 % ≤ C < 9 %, Eye Dam. 1; H318: C ≥ 22 %, Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
ATP01/ |
| 005-017-01-4 |
sodium perborate; [1] perboric acid, sodium salt; [2] perboric acid, sodium salt, monohydrate; sodium peroxometaborate; perboric acid (HBO(O2)), sodium salt, monohydrate; sodium peroxoborate; [containing ≥ 0.1 % (w/w) of particles with an aerodynamic d |
15120-21-5 [1], 7632-04-4 [2], -, -, -, - |
Oxid. Sol. 2, Repr. 1B, Acute Tox. 3 *, Acute Tox. 4 *, STOT SE 3, Eye Dam. 1 |
H272, H360Df, H331, H302, H335, H318 |
Repr. 1B; H360Df: C ≥ 9 %, Repr. 1B; H360D: 6,5 % ≤ C < 9 %, Eye Dam. 1; H318: C ≥ 22 %, Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
ATP01/ |
| 005-018-00-2 |
perboric acid (H3BO2(O2)), monosodium salt trihydrate; [1] perboric acid, sodium salt, tetrahydrate; [2] perboric acid (HBO(O2)), sodium salt, tetrahydrate; [3] sodium peroxoborate hexahydrate; [containing < 0.1 % (w/w) of particles with an aerodynami |
13517-20-9 [1], 37244-98-7 [2], 10486-00-7 [3], - |
Repr. 1B, STOT SE 3, Eye Dam. 1 |
H360Df, H335, H318 |
Repr. 1B; H360 Df: C ≥ 14 %, Repr. 1B; H360D: 10 % ≤ C < 14 %, Eye Dam. 1; H318: C ≥ 36 %, Eye Irrit. 2; H319: 22 % ≤ C < 36 % |
|
ATP01/ |
| 005-018-01-X |
perboric acid (H3BO2(O2)), monosodium salt, trihydrate; [1] perboric acid, sodium salt, tetrahydrate; [2] perboric acid (HBO(O2)), sodium salt, tetrahydrate; [3] sodium peroxoborate hexahydrate; [containing ≥ 0.1 % (w/w) of particles with an aerodynam |
13517-20-9 [1], 37244-98-7 [2], 10486-00-7 [3], - |
Repr. 1B, Acute Tox. 4 *, STOT SE 3, Eye Dam. 1 |
H360Df, H332, H335, H318 |
Repr. 1B; H360 Df: C ≥ 14 %, Repr. 1B; H360D: 10 % ≤ C < 14 %, Eye Dam. 1; H318: C ≥ 36 %, Eye Irrit. 2; H319: 22 % ≤ C < 36 % |
|
ATP01/ |
| 005-019-00-8 |
perboric acid, sodium salt; [1] perboric acid, sodium salt, monohydrate; [2] perboric acid (HBO(O2)), sodium salt, monohydrate; [3] sodium peroxoborate; [containing < 0.1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
11138-47-9 [1], 12040-72-1 [2], 10332-33-9 [3], - |
Oxid. Sol. 3, Repr. 1B, Acute Tox. 4 *, STOT SE 3, Eye Dam. 1 |
H272, H360Df, H302, H335, H318 |
Repr. 1B; H360Df: C ≥ 9 %, Repr. 1B; H360D: 6,5 % ≤ C < 9 %, Eye Dam. 1; H318: C ≥ 22 %, Eye Irrit. 2; H319: 14 % ≤ C < 22 %, STOT SE 3; H335: C ≥ 20 % |
|
ATP01/ |
| 005-019-01-5 |
perboric acid, sodium salt; [1] perboric acid, sodium salt, monohydrate; [2] perboric acid (HBO(O2)), sodium salt, monohydrate; [3] sodium peroxoborate; [containing ≥ 0.1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
11138-47-9 [1], 12040-72-1 [2], 10332-33-9 [3], - |
Oxid. Sol. 3, Repr. 1B, Acute Tox. 3 *, Acute Tox. 4 *, STOT SE 3, Eye Dam. 1 |
H272, H360Df, H331, H302, H335, H318 |
Repr. 1B; H360Df: C ≥ 9 %, Repr. 1B; H360D: 6,5 % ≤ C < 9 %, Eye Dam. 1; H318: C ≥ 22 %, Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
ATP01/ |
| 005-020-00-3 |
disodium octaborate anhydrous [1]
disodium octaborate tetrahydrate [2]
|
12008-41-2 [1]
12280-03-4 [2]
|
Repr. 1B |
H360FD |
|
|
ATP09 |
| 006-001-00-2 |
carbon monoxide |
630-08-0 |
Flam. Gas 1, Press. Gas, Repr. 1A, Acute Tox. 3 *, STOT RE 1 |
H220, H360D ***, H331, H372 ** |
|
U |
CLP00/ |
| 006-002-00-8 |
phosgene; carbonyl chloride |
75-44-5 |
Press. Gas, Acute Tox. 2 *, Skin Corr. 1B |
H330, H314 |
|
U |
CLP00/ |
| 006-003-00-3 |
carbon disulphide |
75-15-0 |
Flam. Liq. 2, Repr. 2, STOT RE 1, Eye Irrit. 2, Skin Irrit. 2 |
H225, H361fd, H372 **, H319, H315 |
Repr. 2; H361fd: C ≥ 1 %, STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,2 % ≤C < 1 % |
|
CLP00/ |
| 006-004-00-9 |
calcium carbide |
75-20-7 |
Water-react. 1 |
H260 |
|
T |
CLP00/ |
| 006-005-00-4 |
thiram (ISO); tetramethylthiuram disulphide |
137-26-8 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H302, H373 **, H319, H315, H317, H400, H410 |
M = 10: |
|
CLP00/ |
| 006-006-00-X |
hydrogen cyanide; hydrocyanic acid |
74-90-8 |
Flam. Liq. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H224, H330, H400, H410 |
|
|
CLP00/ |
| 006-006-01-7 |
hydrogen cyanide ...%; hydrocyanic acid ...% |
74-90-8 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H310, H300, H400, H410 |
|
B |
CLP00/ |
| 006-007-00-5 |
salts of hydrogen cyanide with the exception of complex cyanides such as ferrocyanides, ferricyanides and mercuric oxycyanide and those specified elsewhere in this Annex |
- |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H310, H300, H400, H410 |
|
A |
CLP00/ATP01 |
| 006-008-00-0 |
antu (ISO); 1-(1-naphthyl)-2-thiourea |
86-88-4 |
Acute Tox. 2 *, Carc. 2 |
H300, H351 |
|
|
CLP00/ |
| 006-009-00-6 |
1-isopropyl-3-methylpyrazol-5-yl dimethylcarbamate; Isolan |
119-38-0 |
Acute Tox. 1, Acute Tox. 2 * |
H310, H300 |
|
|
CLP00/ |
| 006-010-00-1 |
5,5-dimethyl-3-oxocyclohex-1-enyl dimethylcarbamate; 5,5-dimethyldihydroresorcinol dimethylcarbamate; Dimetan |
122-15-6 |
Acute Tox. 3 * |
H301 |
|
|
CLP00/ |
| 006-011-00-7 |
carbaryl (ISO); 1-naphthyl methylcarbamate |
63-25-2 |
Carc. 2, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1 |
H351, H332, H302, H400 |
M=100: |
|
CLP00/ATP01 |
| 006-012-00-2 |
ziram (ISO); zinc bis dimethyldithiocarbamate |
137-30-4 |
Acute Tox. 2 *, Acute Tox. 4 *, STOT RE 2 *, STOT SE 3, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H302, H373 **, H335, H318, H317, H400, H410 |
M = 100: |
|
CLP00/ |
| 006-013-00-8 |
metam-sodium (ISO); sodium methyldithiocarbamate |
137-42-8 |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H314, H317, H400, H410 |
|
|
CLP00/ |
| 006-014-00-3 |
nabam (ISO); disodium ethylenebis(N,N'-dithiocarbamate) |
142-59-6 |
Acute Tox. 4 *, STOT SE 3, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H335, H317, H410 |
|
|
CLP00/ |
| 006-015-00-9 |
diuron (ISO); 3-(3,4-dichlorophenyl)-1,1-dimethylurea |
330-54-1 |
Carc. 2, Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H302, H373**, H400, H410 |
M=10: |
|
CLP00/ATP01 |
| 006-016-00-4 |
propoxur (ISO); 2-isopropyloxyphenyl N-methylcarbamate; 2-isopropoxyphenyl methylcarbamate |
114-26-1 |
Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H400, H410 |
|
|
CLP00/ |
| 006-017-00-X |
aldicarb (ISO); 2-methyl-2-(methylthio)propanal-O-(N-methylcarbamoyl)oxime |
116-06-3 |
Acute Tox. 2 *, Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H300, H311, H400, H410 |
|
|
CLP00/ |
| 006-018-00-5 |
aminocarb (ISO); 4-dimethylamino-3-tolyl methylcarbamate |
2032-59-9 |
Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H311, H301, H400, H410 |
|
|
CLP00/ |
| 006-019-00-0 |
di-allate (ISO); S-(2,3-dichloroallyl)-N,N-diisopropylthiocarbamate |
2303-16-4 |
Carc. 2, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H302, H400, H410 |
|
|
CLP00/ |
| 006-020-00-6 |
barban (ISO); 4-chlorbut-2-ynyl N-(3-chlorophenyl)carbamate |
101-27-9 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
CLP00/ |
| 006-021-00-1 |
linuron (ISO); 3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea |
330-55-2 |
Repr. 1B, Carc. 2, Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H360Df, H351, H302, H373 **, H400, H410 |
|
|
CLP00/ |
| 006-022-00-7 |
decarbofuran (ISO); 2,3-dihydro-2-methylbenzofuran-7-yl methylcarbamate |
1563-67-3 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 * |
H331, H311, H301 |
|
|
CLP00/ |
| 006-023-00-2 |
mercaptodimethur (ISO); methiocarb (ISO); 3,5-dimethyl-4-methylthiophenyl N-methylcarbamate |
2032-65-7 |
Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H400, H410 |
|
|
CLP00/ |
| 006-024-00-8 |
proxan-sodium (ISO); sodium O-isopropyldithiocarbonate |
140-93-2 |
Acute Tox. 4 *, Skin Irrit. 2, Aquatic Chronic 2 |
H302, H315, H411 |
|
|
CLP00/ |
| 006-025-00-3 |
allethrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; bioallethrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarb |
584-79-2 [1], 28434-00-6 [2], 84030-86-4 [3] |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H302, H400, H410 |
|
C |
CLP00/ |
| 006-026-00-9 |
carbofuran (ISO); 2,3-dihydro-2,2-dimethylbenzofuran-7-yl N-methylcarbamate |
1563-66-2 |
Acute Tox. 2 *, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H300, H400, H410 |
|
|
CLP00/ |
| 006-028-00-X |
dinobuton (ISO); 2-(1-methylpropyl)-4,6-dinitrophenyl isopropyl carbonate |
973-21-7 |
Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H400, H410 |
|
|
CLP00/ |
| 006-029-00-5 |
dioxacarb (ISO); 2-(1,3-dioxolan-2-yl)phenyl N-methylcarbamate |
6988-21-2 |
Acute Tox. 3 *, Aquatic Chronic 2 |
H301, H411 |
|
|
CLP00/ |
| 006-030-00-0 |
EPTC (ISO); S-ethyl dipropylthiocarbamate |
759-94-4 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 006-031-00-6 |
formetanate (ISO); 3-[(EZ)-dimethylaminomethyleneamino]phenyl methylcarbamate |
22259-30-9 |
Acute Tox. 2 *, Acute Tox. 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H300, H317, H400, H410 |
|
|
CLP00/ |
| 006-032-00-1 |
monolinuron (ISO); 3-(4-chlorophenyl)-1-methoxy-1-methylurea |
1746-81-2 |
Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373 **, H400, H410 |
|
|
CLP00/ |
| 006-033-00-7 |
metoxuron (ISO); 3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea |
19937-59-8 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 006-034-00-2 |
pebulate (ISO); N-butyl-N-ethyl-S-propylthiocarbamate |
1114-71-2 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 006-035-00-8 |
pirimicarb (ISO); 2-(Dimethylamino)- 5,6-dimethylpyrimidin-4-yl dimethylcarbamat |
23103-98-2 |
Carc. 2, Acute Tox. 3, Acute Tox. 3, Skin Sens 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H331, H301, H317, H400, H410 |
M=10, M=100 |
|
CLP00/ ATP09 |
| 006-036-00-3 |
benzthiazuron (ISO); 1-benzothiazol-2-yl-3-methylurea |
1929-88-0 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 006-037-00-9 |
promecarb (ISO); 3-isopropyl-5-methylphenyl N-methylcarbamate |
2631-37-0 |
Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H400, H410 |
|
|
CLP00/ |
| 006-038-00-4 |
sulfallate (ISO); 2-chloroallyl N,N-dimethyldithiocarbamate |
95-06-7 |
Carc. 1B, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H302, H400, H410 |
|
|
CLP00/ |
| 006-039-00-X |
tri-allate (ISO); S-2,3,3-trichloroallyl diisopropylthiocarbamate |
2303-17-5 |
Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373 **, H317, H400, H410 |
|
|
CLP00/ |
| 006-040-00-5 |
3-methylpyrazol-5-yl-dimethylcarbamate; monometilan |
2532-43-6 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 * |
H331, H311, H301 |
|
|
CLP00/ |
| 006-041-00-0 |
dimethylcarbamoyl chloride |
79-44-7 |
Carc. 1B, Acute Tox. 3 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H350, H331, H302, H319, H335, H315 |
Carc. 1B; H350: C ≥ 0,001 % |
|
CLP00/ |
| 006-042-00-6 |
monuron (ISO); 3-(4-chlorophenyl)-1,1-dimethylurea |
150-68-5 |
Carc. 2, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H302, H400, H410 |
|
|
CLP00/ |
| 006-043-00-1 |
3-(4-chlorophenyl)-1,1-dimethyluronium trichloroacetate; monuron-TCA |
140-41-0 |
Carc. 2, Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H319, H315, H400, H410 |
|
|
CLP00/ |
| 006-044-00-7 |
isoproturon (ISO); 3-(4-isopropylphenyl)-1,1-dimethylurea |
34123-59-6 |
Carc. 2, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H373 (blood), H400, H410 |
M=10, M=10 |
|
CLP00/ATP13 |
| 006-045-00-2 |
methomyl (ISO); 1-(methylthio)ethylideneamino N-methylcarbamate |
16752-77-5 |
Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H300, H400, H410 |
M=100: |
|
CLP00/ATP01 |
| 006-046-00-8 |
bendiocarb (ISO); 2,2-dimethyl-1,3-benzodioxol-4-yl N-methylcarbamate; 2,2-dimethyl-1,3-benzodioxol-4-yl methylcarbamate |
22781-23-3 |
Acute Tox. 2, Acute Tox. 3, Acute Tox. 3, Aquatic Acute 1, Aquatic Chronic 1 |
H300, H331, H311, H400, H410 |
M=10, M=100 |
|
CLP00/ATP10 |
| 006-047-00-3 |
bufencarb (ISO); reaction mass of 3-(1-methylbutyl)phenyl N-methylcarbamate and 3-(1-ethylpropyl)phenyl N-methylcarbamate |
8065-36-9 |
Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H311, H301, H400, H410 |
|
|
CLP00/ |
| 006-048-00-9 |
ethiofencarb (ISO); 2-(ethylthiomethyl)phenyl N-methylcarbamate |
29973-13-5 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 006-049-00-4 |
dixanthogen; O,O-diethyl dithiobis(thioformate) |
502-55-6 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 006-050-00-X |
1,1-dimethyl-3-phenyluronium trichloroacetate; fenuron-TCA |
4482-55-7 |
Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H400, H410 |
|
|
CLP00/ |
| 006-051-00-5 |
ferbam (ISO); iron tris(dimethyldithiocarbamate) |
14484-64-1 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H335, H315, H400, H410 |
|
|
CLP00/ |
| 006-052-00-0 |
formetanate hydrochloride; 3-(N,N-dimethylaminomethyleneamino)phenyl N-methylcarbamate |
23422-53-9 |
Acute Tox. 2 *, Acute Tox. 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H300, H317, H400, H410 |
|
|
CLP00/ |
| 006-053-00-6 |
isoprocarb (ISO); 2-isopropylphenyl N-methylcarbamate |
2631-40-5 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 006-054-00-1 |
mexacarbate (ISO); 3,5-dimethyl-4-dimethylaminophenyl N-methylcarbamate |
315-18-4 |
Acute Tox. 2 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H300, H312, H400, H410 |
|
|
CLP00/ |
| 006-055-00-7 |
xylylcarb (ISO); 3,4-dimethylphenyl N-methylcarbamate; 3,4-xylyl methylcarbamate; MPMC |
2425-10-7 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 006-056-00-2 |
metolcarb (ISO); m-tolyl methylcarbamate; MTMC |
1129-41-5 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 006-057-00-8 |
nitrapyrin (ISO); 2-chloro-6-trichloromethylpyridine |
1929-82-4 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 006-058-00-3 |
noruron (ISO); 1,1-dimethyl-3-(perhydro-4,7-methanoinden-5-yl)urea |
2163-79-3 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 006-059-00-9 |
oxamyl (ISO); N',N'-dimethylcarbamoyl(methylthio)methylenamine N-methylcarbamate |
23135-22-0 |
Acute Tox. 2 *, Acute Tox. 2 *, Acute Tox. 4 *, Aquatic Chronic 2 |
H330, H300, H312, H411 |
|
|
CLP00/ |
| 006-060-00-4 |
oxycarboxin (ISO); 2,3-dihydro-6-methyl-5-(N-phenylcarbamoyl)-1,4-oxothiine 4,4-dioxide |
5259-88-1 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 006-061-00-X |
S-ethyl N-(dimethylaminopropyl)thiocarbamatehydrochloride; prothiocarb hydrochloride |
19622-19-6 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 006-062-00-5 |
methyl 3,4-dichlorophenylcarbanilate; SWEP. |
1918-18-9 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 006-063-00-0 |
thiobencarb (ISO); S-4-chlorobenzyl diethylthiocarbamate |
28249-77-6 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 006-064-00-6 |
thiofanox (ISO); 3,3-dimethyl-1-(methylthio)butanone-O-(N-methylcarbamoyl)oxime |
39196-18-4 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H310, H300, H400, H410 |
|
|
CLP00/ |
| 006-065-00-1 |
3-chloro-6-cyano-bicyclo(2,2,1)heptan-2-one-O-(N-methylcarbamoyl)oxime; triamid |
15271-41-7 |
Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Chronic 2 |
H300, H311, H411 |
|
|
CLP00/ |
| 006-066-00-7 |
vernolate (ISO); S-propyl dipropylthiocarbamate |
1929-77-7 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 006-067-00-2 |
XMC; 3,5-xylyl methylcarbamate |
2655-14-3 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 006-068-00-8 |
diazomethane |
334-88-3 |
Carc. 1B |
H350 |
|
|
CLP00/ |
| 006-069-00-3 |
thiophanate-methyl (ISO); dimethyl (1,2-phenylenedicarbamo-thioyl)biscarbamate; dimethyl 4,4%u2032-(o-phenylene) bis(3-thioallophanate) |
23564-05-8 |
Carc. 2, Muta. 2, Acute Tox. 4, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351,
H341,
H332,
H317,
H400,
H410 |
Inhalation: ATE = 1.7 mg/L (dusts/mists),
M=10,
M=10 |
|
CLP00/ATP17 |
| 006-070-00-9 |
furmecyclox (ISO); N-cyclohexyl-N-methoxy-2,5-dimethyl-3-furamide |
60568-05-0 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H400, H410 |
|
|
CLP00/ |
| 006-071-00-4 |
cyclooct-4-en-1-yl methyl carbonate |
87731-18-8 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 006-072-00-X |
prosulfocarb(ISO); S-benzyl N,N-dipropylthiocarbamate |
52888-80-9 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H302, H317, H411 |
|
|
CLP00/ |
| 006-073-00-5 |
3-(dimethylamino)propylurea |
31506-43-1 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 006-074-00-0 |
2-(3-(prop-1-en-2-yl)phenyl)prop-2-yl isocyanate |
2094-99-7 |
Acute Tox. 2 *, Skin Corr. 1B, STOT RE 2 *, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H314, H373 **, H334, H317, H400, H410 |
|
|
CLP00/ |
| 006-076-00-1 |
mancozeb (ISO);
manganese ethylenebis(dithiocarbamate) (polymeric) complex with zinc salt |
8018-01-7 |
Carc. 2,
Repr. 1B,
STOT RE 2,
Skin Sens. 1,
Aquatic Acute 1,
Aquatic Chronic 1 |
H351,
H360D,
H373 (thyroid, nervous system),
H317,
H400,
H410 |
M=10, M=10 |
|
CLP00/ATP17 |
| 006-077-00-7 |
maneb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) |
12427-38-2 |
Repr. 2, Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361d***, H332, H319, H317, H400, H410 |
M=10: |
|
CLP00/ATP01 |
| 006-078-00-2 |
zineb (ISO); zinc ethylenebis(dithiocarbamate) (polymeric) |
12122-67-7 |
STOT SE 3, Skin Sens. 1 |
H335, H317 |
|
|
CLP00/ |
| 006-079-00-8 |
disulfiram; tetraethylthiuramdisulfide |
97-77-8 |
Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373 **, H317, H400, H410 |
|
|
CLP00/ |
| 006-080-00-3 |
tetramethylthiuram monosulphide |
97-74-5 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H302, H317, H411 |
|
|
CLP00/ |
| 006-081-00-9 |
zinc bis(dibutyldithiocarbamate) |
136-23-2 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H335, H315, H317, H400, H410 |
|
|
CLP00/ |
| 006-082-00-4 |
zinc bis(diethyldithiocarbamate) |
14324-55-1 |
Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H335, H315, H317, H400, H410 |
|
|
CLP00/ |
| 006-083-00-X |
butocarboxim (ISO); 3-(methylthio)-2-butanone O-[(methylamino)carbonyl]oxime |
34681-10-2 |
Flam. Liq. 3, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H226, H331, H311, H301, H319, H400, H410 |
|
|
CLP00/ |
| 006-084-00-5 |
carbosulfan (ISO); 2,3-dihydro-2,2-dimethyl-7-benzofuryl [(dibutylamino)thio]methylcarbamate |
55285-14-8 |
Acute Tox. 2 *, Acute Tox. 3 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H301, H317, H400, H410 |
|
|
CLP00/ATP01 |
| 006-085-00-0 |
fenobucarb (ISO); 2-butylphenyl methylcarbamate |
3766-81-2 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 006-086-00-6 |
fenoxycarb (ISO); ethyl [2-(4-phenoxyphenoxy) ethyl]carbamatefenoxycarb (ISO); ethyl [2-(4-phenoxyphenoxy) ethyl]carbamate |
72490-01-8 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H400, H410 |
M=1, M=10000 |
|
CLP00/ATP06 |
| 006-087-00-1 |
furathiocarb (ISO); 2,3-dihydro-2,2-dimethyl-7-benzofuryl 2,4-dimethyl-6-oxa-5-oxo-3-thia-2,4-diazadecanoate |
65907-30-4 |
Acute Tox. 2 *, Acute Tox. 3 *, STOT RE 2 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H301, H373**, H319, H315, H317, H400, H410 |
M=100: |
|
CLP00/ATP01 |
| 006-088-00-7 |
benfuracarb (ISO); ethyl N-[2,3-dihydro-2,2-dimethylbenzofuran-7-yloxycarbonyl(methyl)aminothio]-N-isopropyl- β-alaninate |
82560-54-1 |
Repr. 2, Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H361f***, H331, H302, H400, H410 |
|
|
CLP00/ATP01 |
| 006-090-00-8 |
2-(3-iodoprop-2-yn-1-yloxy)ethyl phenylcarbamate |
88558-41-2 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 3 |
H332, H318, H412 |
|
|
CLP00/ |
| 006-091-00-3 |
propineb (ISO); polymeric zinc propylenebis(dithiocarbamate) |
9016-72-2 |
Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1 |
H332, H373**, H317, H400 |
|
|
ATP01/ |
| 006-092-00-9 |
tert-butyl (1S)-N-[1-((2S)-2-oxiranyl)-2-phenylethyl]carbamate |
98737-29-2 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 006-093-00-4 |
2,2'-dithio di(ethylammonium)-bis(dibenzyldithiocarbamate) |
- |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
ATP01/ |
| 006-094-00-X |
O-isobutyl-N-ethoxy carbonylthiocarbamate |
103122-66-3 |
Flam. Liq. 3, Carc. 1B, Muta. 1B, Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 2 |
H226, H350, H340, H302, H373**, H317, H411 |
|
|
ATP01/ |
| 006-095-00-5 |
fosetyl-aluminium (ISO); aluminium triethyl triphosphonate |
39148-24-8 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 006-096-00-0 |
chlorpropham (ISO); isopropyl 3-chlorocarbanilate |
101-21-3 |
Carc. 2, STOT RE 2 *, Aquatic Chronic 2 |
H351, H373**, H411 |
|
|
ATP01/ |
| 006-097-00-6 |
1-phenyl-3-(p-toluenesulfonyl)urea |
13909-63-2 |
Acute Tox. 4 *, STOT RE 2 *, Aquatic Chronic 3 |
H302, H373**, H412 |
|
|
ATP01/ |
| 006-098-00-1 |
tert-butyl (1R,5S)-3-azabicyclo[3.1.0]hex-6-ylcarbamate |
134575-17-0 |
Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1 |
H302, H373**, H318, H317 |
|
|
ATP01/ |
| 006-099-00-7 |
N-(p-toluenesulfonyl)-N'-(3-(p-toluenesulfonyloxy)phenyl)urea; 3-({[(4-methylphenyl)sulfonyl]carbamoyl}amino)phenyl 4-methylbenzenesulfonate |
232938-43-1 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 006-101-00-6 |
reaction mass of: N,N''-(methylenedi-4,1-phenylene)bis[N'-phenylurea]; N-(4-[[4-[[(phenylamino)carbonyl]amino]phenylmethyl]phenyl]-N'-cyclohexylurea; N,N''-(methylenedi-4,1-phenylene)bis[N'-cyclohexylurea] |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 006-102-00-1 |
O-hexyl-N-ethoxycarbonylthiocarbamate |
- |
Carc. 1B, Muta. 1B, Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 2 |
H350, H340, H302, H373**, H317, H411 |
|
|
ATP01/ |
| 006-103-00-7 |
N,N''-(methylenedi-4,1-phenylene)bis[N'-octyl]urea |
- |
Eye Dam. 1, Resp. Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H334, H400, H410 |
M=100: |
|
ATP01/ |
| 007-001-00-5 |
ammonia, anhydrous |
7664-41-7 |
Flam. Gas 2, Press. Gas, Acute Tox. 3 *, Skin Corr. 1B, Aquatic Acute 1 |
H221, H331, H314, H400 |
|
U |
CLP00/ |
| 007-001-01-2 |
ammonia ....% |
1336-21-6 |
Skin Corr. 1B, Aquatic Acute 1 |
H314, H400 |
STOT SE 3; H335: C ≥ 5 % |
B |
CLP00/ |
| 007-002-00-0 |
nitrogen dioxide; [1] dinitrogen tetraoxide [2] |
10102-44-0 [1], 10544-72-6 [2] |
Press. Gas, Ox. Gas 1, Acute Tox. 2 *, Skin Corr. 1B |
H270, H330, H314 |
*, STOT SE 3; H335: C ≥ 0,5 % |
5 |
CLP00/ATP01 |
| 007-003-00-6 |
chlormequat chloride (ISO); 2-chloroethyltrimethylammonium chloride |
999-81-5 |
Acute Tox. 4 *, Acute Tox. 4 * |
H312, H302 |
|
|
CLP00/ |
| 007-004-00-1 |
nitric acid ...% [C > 70 %] |
7697-37-2 |
Ox. Liq. 2, Acute Tox. 1, Skin Corr. 1A |
H272, H330, H314 |
Ox. Liq. 2, H272: C ≥ 99 %, Ox. Liq. 3, H272: 70 % ≤ C < 99 % |
B |
CLP00/ATP15 |
| 007-006-00-2 |
ethyl nitrite |
109-95-5 |
Flam. Gas 1, Press. Gas, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H220, H332, H312, H302 |
|
U |
CLP00/ |
| 007-007-00-8 |
ethyl nitrate |
625-58-1 |
Unst. Expl |
H200 |
|
|
CLP00/ATP01 |
| 007-008-00-3 |
hydrazine |
302-01-2 |
Flam. Liq. 3, Carc. 1B, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H226, H350, H331, H311, H301, H314, H317, H400, H410 |
Skin Corr. 1B; H314: C ≥ 10 %, Skin Irrit. 2; H315: 3 % ≤ C < 10 %, Eye Irrit. 2; H319: 3 % ≤ C < 10 % |
|
CLP00/ |
| 007-009-00-9 |
dicyclohexylammonium nitrite |
3129-91-7 |
Acute Tox. 4 *, Acute Tox. 4 * |
H332, H302 |
* |
|
CLP00/ |
| 007-010-00-4 |
sodium nitrite |
7632-00-0 |
Ox. Sol. 3, Acute Tox. 3 *, Aquatic Acute 1 |
H272, H301, H400 |
* |
|
CLP00/ |
| 007-011-00-X |
potassium nitrite |
7758-09-0 |
Ox. Sol. 2, Acute Tox. 3 *, Aquatic Acute 1 |
H272, H301, H400 |
* |
|
CLP00/ |
| 007-012-00-5 |
N,N-dimethylhydrazine |
57-14-7 |
Flam. Liq. 2, Carc. 1B, Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B, Aquatic Chronic 2 |
H225, H350, H331, H301, H314, H411 |
|
|
CLP00/ |
| 007-013-00-0 |
1,2-dimethylhydrazine |
540-73-8 |
Carc. 1B, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Chronic 2 |
H350, H331, H311, H301, H411 |
Carc. 1B; H350: C ≥ 0,01 % |
|
CLP00/ |
| 007-014-00-6 |
salts of hydrazine |
- |
Carc. 1B, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H331, H311, H301, H317, H400, H410 |
|
A |
CLP00/ |
| 007-015-00-1 |
O-ethylhydroxylamine |
624-86-2 |
Flam. Liq. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1 |
H225, H331, H311, H301, H372 **, H319, H317, H400 |
|
|
CLP00/ |
| 007-016-00-7 |
butyl nitrite |
544-16-1 |
Flam. Liq. 2, Acute Tox. 3 *, Acute Tox. 3 * |
H225, H331, H301 |
|
|
CLP00/ |
| 007-017-00-2 |
isobutyl nitrite |
542-56-3 |
Flam. Liq. 2, Carc. 1B, Muta. 2, Acute Tox. 4 *, Acute Tox. 4 * |
H225, H350, H341, H332, H302 |
|
|
CLP00/ |
| 007-018-00-8 |
sec-butyl nitrite |
924-43-6 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 * |
H225, H332, H302 |
|
|
CLP00/ |
| 007-019-00-3 |
tert-butyl nitrite |
540-80-7 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 * |
H225, H332, H302 |
|
|
CLP00/ |
| 007-020-00-9 |
pentyl nitrite; [1] ‘amyl nitrite’, mixed isomers [2] |
463-04-7 [1], 110-46-3 [2] |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 * |
H225, H332, H302 |
|
|
CLP00/ |
| 007-021-00-4 |
hydrazobenzene; 1,2-diphenylhydrazine |
122-66-7 |
Carc. 1B, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H302, H400, H410 |
|
|
CLP00/ |
| 007-022-00-X |
hydrazine bis(3-carboxy-4-hydroxybenzensulfonate) |
- |
Carc. 1B, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 3 |
H350, H302, H314, H317, H412 |
|
|
CLP00/ |
| 007-023-00-5 |
sodium 3,5-bis(3-(2,4-di-tert-pentylphenoxy)propylcarbamoyl)benzenesulfonate |
- |
Skin Irrit. 2, Skin Sens. 1 |
H315, H317 |
|
|
CLP00/ |
| 007-024-00-0 |
2-(decylthio)ethylammonium chloride |
36362-09-1 |
STOT RE 2 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H373 **, H315, H318, H400, H410 |
|
|
CLP00/ |
| 007-025-00-6 |
(4-hydrazinophenyl)-N-methylmethanesulfonamide hydrochloride |
81880-96-8 |
Muta. 2, Acute Tox. 3 *, STOT RE 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H341, H301, H372 **, H317, H400, H410 |
|
|
CLP00/ |
| 007-026-00-1 |
oxo-((2,2,6,6-tetramethylpiperidin-4-yl)amino)carbonylacetohydrazide |
122035-71-6 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
CLP00/ |
| 007-027-00-7 |
1,6-bis(3,3-bis((1-methylpentylidenimino)propyl)ureido)hexane |
771478-66-1 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H373 **, H314, H317, H400, H410 |
|
|
CLP00/ |
| 007-028-00-2 |
hydroxylammonium nitrate |
13465-08-2 |
Expl. 1.1 ****, Carc. 2, Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 2 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1 |
H201, H351, H311, H302, H373**, H319, H315, H317, H400 |
|
|
ATP01/ |
| 007-029-00-8 |
diethyldimethylammonium hydroxide |
95500-19-9 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1A |
H312, H302, H314 |
|
|
ATP01/ |
| 007-030-00-3 |
nitric acid …% [C ≤ 70 %] |
7697-37-2 |
Ox. Liq. 3, Acute Tox. 3, Skin Corr. 1A |
H272, H331, H314 |
Inhalation: ATE = 2.65 mg/L (Vapours), Ox. Liq. 3, H272: C ≥ 65 %, Skin Corr. 1A, H314: C ≥ 20 %, Skin Corr. 1B, H314: 5 % ≤ C < 20 % |
B |
ATP15 |
| 008-001-00-8 |
oxygen |
7782-44-7 |
Ox. Gas 1, Press. Gas |
H270 |
|
U |
CLP00/ |
| 008-003-00-9 |
hydrogen peroxide solution ... % |
7722-84-1 |
Ox. Liq. 1, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1A |
H271, H332, H302, H314 |
Ox. Liq. 1; H271: C ≥ 70 %****, Ox. Liq. 2; H272: 50 % ≤ C < 70 % ****, *, Skin Corr. 1A; H314: C ≥ 70 %, Skin Corr. 1B; H314: 50 % ≤ C < 70 %, Skin Irrit. 2; H315: 35 % ≤ C < 50 %, Eye Dam. 1; H318: 8 % ≤ C < 50 %, Eye Irrit. 2; H319: 5 % ≤ C < 8 %, STOT |
B |
CLP00/ |
| 009-001-00-0 |
fluorine |
7782-41-4 |
Press. Gas, Ox. Gas 1, Acute Tox. 2 *, Skin Corr. 1A |
H270, H330, H314 |
|
|
CLP00/ATP01 |
| 009-002-00-6 |
hydrogen fluoride |
7664-39-3 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Skin Corr. 1A |
H330, H310, H300, H314 |
|
|
CLP00/ |
| 009-003-00-1 |
hydrofluoric acid ... % |
7664-39-3 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Skin Corr. 1A |
H330, H310, H300, H314 |
Skin Corr. 1A; H314: C ≥ 7 %, Skin Corr. 1B; H314: 1 % ≤ C < 7 %, Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
B |
CLP00/ |
| 009-004-00-7 |
sodium fluoride |
7681-49-4 |
Acute Tox. 3 *, Eye Irrit. 2, Skin Irrit. 2 |
H301, H319, H315 |
|
|
CLP00/ |
| 009-005-00-2 |
potassium fluoride |
7789-23-3 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 * |
H331, H311, H301 |
|
|
CLP00/ |
| 009-006-00-8 |
ammonium fluoride |
12125-01-8 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 * |
H331, H311, H301 |
|
|
CLP00/ |
| 009-007-00-3 |
sodium bifluoride; sodium hydrogen difluoride |
1333-83-1 |
Acute Tox. 3 *, Skin Corr. 1B |
H301, H314 |
*, Skin Corr. 1B; H314: C ≥ 1 %, Skin Irrit. 2; H315: 0,1 % ≤ C < 1 %, Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
CLP00/ |
| 009-008-00-9 |
potassium bifluoride; potassium hydrogen difluoride |
7789-29-9 |
Acute Tox. 3 *, Skin Corr. 1B |
H301, H314 |
*, Skin Corr. 1B; H314: C ≥ 1 %, Skin Irrit. 2; H315: 0,1 % ≤ C < 1 %, Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
CLP00/ |
| 009-009-00-4 |
ammonium bifluoride; ammonium hydrogen difluoride |
1341-49-7 |
Acute Tox. 3 *, Skin Corr. 1B |
H301, H314 |
*, Skin Corr. 1B; H314: C ≥ 1 %, Skin Irrit. 2; H315: 0,1 % ≤ C < 1 %, Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
CLP00/ |
| 009-010-00-X |
fluoroboric acid ... % |
16872-11-0 |
Skin Corr. 1B |
H314 |
Skin Corr. 1B; H314: C ≥ 25 %, Skin Irrit. 2; H315: 10 % ≤ C < 25 %, Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
CLP00/ |
| 009-011-00-5 |
fluorosilicic acid ... % |
16961-83-4 |
Skin Corr. 1B |
H314 |
|
B |
CLP00/ |
| 009-012-00-0 |
alkali fluorosilicates(Na); [1] alkali fluorosilicates(K); [2] alkali fluorosilicates(NH4) [3] |
16893-85-9 [1], 16871-90-2 [2], 16919-19-0 [3] |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 * |
H331, H311, H301 |
* |
A |
CLP00/ |
| 009-013-00-6 |
fluorosilicates, with the exception of those specified elsewhere in this annex |
- |
Acute Tox. 4 * |
H302 |
* |
A |
CLP00/ |
| 009-014-00-1 |
lead hexafluorosilicate |
25808-74-6 |
Repr. 1A, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H360Df, H332, H302, H373 **, H400, H410 |
|
1 |
CLP00/ |
| 009-015-00-7 |
sulphuryl difluoride |
2699-79-8 |
Press. Gas, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1 |
H331, H373 **, H400 |
|
U |
CLP00/ |
| 009-016-00-2 |
trisodium hexafluoroaluminate [1] trisodium hexafluoroaluminate (cryolite) [2] |
13775-53-6 [1], 15096-52-3 [2] |
STOT RE 1, Acute Tox. 4 , Aquatic Chronic 2 |
H372, H332, H411 |
|
|
CLP00/ATP03 |
| 009-017-00-8 |
potassium mu-fluoro-bis(triethylaluminium) |
12091-08-6 |
Flam. Sol. 1, Water-react. 1, Skin Corr. 1A, Acute Tox. 4 * |
H228, H270, H314, H332 |
|
T |
CLP00/ |
| 009-018-00-3 |
magnesium hexafluorosilicate |
16949-65-8 |
Acute Tox. 3 * |
H301 |
* |
|
CLP00/ |
| 011-001-00-0 |
sodium |
7440-23-5 |
Water-react. 1, Skin Corr. 1B |
H260, H314 |
|
|
CLP00/ |
| 011-002-00-6 |
sodium hydroxide; caustic soda |
1310-73-2 |
Skin Corr. 1A |
H314 |
Skin Corr. 1A; H314: C ≥ 5 %, Skin Corr. 1B; H314: 2 % ≤ C < 5 %, Skin Irrit. 2; H315: 0,5 % ≤ C < 2 %, Eye Irrit. 2; H319: 0,5 % ≤ C < 2 % |
|
CLP00/ |
| 011-003-00-1 |
sodium peroxide |
1313-60-6 |
Ox. Sol. 1, Skin Corr. 1A |
H271, H314 |
|
|
CLP00/ |
| 011-004-00-7 |
sodium azide |
26628-22-8 |
Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H300, H400, H410 |
|
|
CLP00/ |
| 011-005-00-2 |
sodium carbonate |
497-19-8 |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 011-006-00-8 |
sodium cyanate |
917-61-3 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 011-007-00-3 |
propoxycarbazone-sodium |
181274-15-7 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M = 10: |
|
CLP00/ |
| 012-001-00-3 |
magnesium powder (pyrophoric) |
7439-95-4 |
Water-react. 1, Pyr. Sol. 1 |
H260, H250 |
|
T |
CLP00/ |
| 012-002-00-9 |
magnesium, powder or turnings |
- |
Flam. Sol. 1, Water-react. 2, Self-heat. 1 |
H228, H261, H252 |
|
T |
CLP00/ |
| 012-003-00-4 |
magnesium alkyls |
- |
Pyr. Liq. 1, Water-react. 1, Skin Corr. 1B |
H250, H260, H314 |
|
A |
CLP00/ |
| 012-004-00-X |
aluminium-magnesium-carbonate-hydroxide-perchlorate-hydrate |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 013-001-00-6 |
aluminium powder (pyrophoric) |
7429-90-5 |
Water-react. 2, Pyr. Sol. 1 |
H261, H250 |
|
T |
CLP00/ |
| 013-002-00-1 |
aluminium powder (stabilised) |
7429-90-5 |
Water-react. 2, Flam. Sol. 1 |
H261, H228 |
|
T |
CLP00/ATP01 |
| 013-003-00-7 |
aluminium chloride, anhydrous |
7446-70-0 |
Skin Corr. 1B |
H314 |
|
|
CLP00/ |
| 013-004-00-2 |
aluminium alkyls |
- |
Pyr. Liq. 1, Water-react. 1, Skin Corr. 1B |
H250, H260, H314 |
|
A |
CLP00/ |
| 013-005-00-8 |
diethyl(ethyldimethylsilanolato)aluminium |
55426-95-4 |
Water-react. 1, Pyr. Liq. 1, Skin Corr. 1A |
H260, H250, H314 |
|
|
CLP00/ |
| 013-006-00-3 |
(ethyl-3-oxobutanoato-O'1,O'3)(2-dimethylaminoethanolato)(1-methoxypropan-2-olato)aluminium(III), dimerised |
- |
Flam. Liq. 3, Eye Dam. 1 |
H226, H318 |
|
|
CLP00/ |
| 013-007-00-9 |
poly(oxo(2-butoxyethyl-3-oxobutanoato-O'1,O'3)aluminium) |
- |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 013-008-00-4 |
di-n-octylaluminium iodide |
7585-14-0 |
Pyr. Liq. 1, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H250, H314, H400, H410 |
|
|
CLP00/ |
| 013-009-00-X |
sodium((n-butyl)x(ethyl)y-1,5-dihydro)aluminate) x = 0,5, y = 1,5 |
- |
Flam. Sol. 1, Water-react. 1, Pyr. Sol. 1, Acute Tox. 4 *, Skin Corr. 1A |
H228, H260, H250, H332, H314 |
|
T |
CLP00/ |
| 013-010-00-5 |
hydroxy aluminium bis(2,4,8,10-tetra-tert-butyl-6-hydroxy-12H-dibenzo[d,g][1.3.2]dioxaphosphocin-6-oxide) |
151841-65-5 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 014-001-00-9 |
trichlorosilane |
10025-78-2 |
Flam. Liq. 1, Water-react. 1, Acute Tox. 3, Acute Tox. 4, Skin Corr. 1A, Eye Dam. 1 |
H224, H260, H331, H302, H314, H318 |
inhalation: ATE = 7,6 mg/L (vapour); oral: ATE=1 000 mg/kg bw |
T |
CLP00/ATP18 |
| 014-002-00-4 |
silicon tetrachloride |
10026-04-7 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H319, H335, H315 |
|
|
CLP00/ |
| 014-003-00-X |
dimethyldichlorosilane |
75-78-5 |
Flam. Liq. 2, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H225, H319, H335, H315 |
|
|
CLP00/ |
| 014-004-00-5 |
trichloro(methyl)silane; methyltrichlorosilane |
75-79-6 |
Flam. Liq. 2, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H225, H319, H335, H315 |
Skin Irrit. 2; H315: C ≥ 1 %, Eye Irrit. 2; H319: C ≥ 1 %, STOT SE 3; H335: C ≥ 1 % |
|
CLP00/ |
| 014-005-00-0 |
tetraethyl silicate; ethyl silicate |
78-10-4 |
Flam. Liq. 3, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3 |
H226, H332, H319, H335 |
|
|
CLP00/ |
| 014-006-00-6 |
bis(4-fluorophenyl)-methyl-(1,2,4-triazol-4-ylmethyl)silane hydrochloride |
- |
Eye Irrit. 2, Aquatic Chronic 2 |
H319, H411 |
|
|
CLP00/ |
| 014-007-00-1 |
triethoxyisobutylsilane |
17980-47-1 |
Skin Irrit. 2 |
H315 |
|
|
CLP00/ |
| 014-008-00-7 |
(chloromethyl)bis(4-fluorophenyl)methylsilane |
85491-26-5 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 014-009-00-2 |
isobutylisopropyldimethoxysilane |
111439-76-0 |
Flam. Liq. 3, Acute Tox. 4 *, Skin Irrit. 2 |
H226, H332, H315 |
|
|
CLP00/ |
| 014-010-00-8 |
disodium metasilicate |
6834-92-0 |
Skin Corr. 1B, STOT SE 3 |
H314, H335 |
|
|
CLP00/ |
| 014-011-00-3 |
cyclohexyldimethoxymethylsilane |
17865-32-6 |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ |
| 014-012-00-9 |
bis(3-(trimethoxysilyl)propyl)amine |
- |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 014-013-00-4 |
α-hydroxypoly(methyl-(3-(2,2,6,6-tetramethylpiperidin-4-yloxy)propyl)siloxane) |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B, Aquatic Chronic 2 |
H312, H302, H314, H411 |
|
|
CLP00/ |
| 014-014-00-X |
etacelasil (ISO); 6-(2-chloroethyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane |
37894-46-5 |
Repr. 1B, Acute Tox. 4 *, STOT RE 2 * |
H360D ***, H302, H373 ** |
|
|
CLP00/ |
| 014-015-00-5 |
α-trimethylsilanyl-ω-trimethylsiloxypoly[oxy(methyl-3-(2-(2-methoxypropoxy)propoxy)propylsilanediyl]-co-oxy(dimethylsilane)) |
69430-40-6 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 014-016-00-0 |
reaction mass of: 1,3-dihex-5-en-1-yl-1,1,3,3-tetramethyldisiloxane; 1,3-dihex-n-en-1-yl-1,1,3,3-tetramethyldisiloxane |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 014-017-00-6 |
flusilazole (ISO); bis(4-fluorophenyl)(methyl)(1H-1,2,4-triazol-1-ylmethyl)silane |
85509-19-9 |
Carc. 2, Repr. 1B, Acute Tox. 4 *, Aquatic Chronic 2 |
H351, H360D ***, H302, H411 |
|
|
CLP00/ |
| 014-018-00-1 |
octamethylcyclotetrasiloxane; [D4] |
556-67-2 |
Repr. 2, Aquatic Chronic 1 |
H361f ***, H410 |
M=10 |
|
CLP00/ATP15 |
| 014-019-00-7 |
reaction mass of: 4-[[bis-(4-fluorophenyl)methylsilyl]methyl]-4H-1,2,4-triazole; 1-[[bis-(4-fluorophenyl)methylsilyl]methyl]-1H-1,2,4-triazole |
- |
Carc. 2, Repr. 1B, Acute Tox. 4 *, Aquatic Chronic 2 |
H351, H360D ***, H302, H411 |
|
|
CLP00/ |
| 014-020-00-2 |
bis(1,1-dimethyl-2-propynyloxy)dimethylsilane |
53863-99-3 |
Acute Tox. 4 * |
H332 |
|
|
CLP00/ |
| 014-021-00-8 |
tris(isopropenyloxy)phenyl silane |
52301-18-5 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 014-022-00-3 |
reaction product of: (2-hydroxy-4-(3-propenoxy)benzophenone and triethoxysilane) with (hydrolysis product of silica and methyltrimethoxysilane) |
- |
Flam. Sol. 1, STOT SE 1, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H228, H370 **, H332, H312, H302 |
|
T |
CLP00/ |
| 014-023-00-9 |
α, ω-dihydroxypoly(hex-5-en-1-ylmethylsiloxane)hoxysilane with (hydrolysis product of silica and methyltrimethoxysilane)iazole |
125613-45-8 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 014-024-00-4 |
1-((3-(3-chloro-4-fluorophenyl)propyl)dimethylsilanyl)-4-ethoxybenzene |
121626-74-2 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 014-025-00-X |
4-[3-(diethoxymethylsilylpropoxy)-2,2,6,6-tetramethyl]piperidine |
102089-33-8 |
Acute Tox. 4 *, STOT RE 2 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 3 |
H302, H373 **, H315, H318, H412 |
|
|
CLP00/ |
| 014-026-00-5 |
dichloro-(3-(3-chloro-4-fluorophenyl)propyl)methylsilane |
770722-36-6 |
Skin Corr. 1A |
H314 |
|
|
CLP00/ |
| 014-027-00-0 |
chloro(3-(3-chloro-4-fluorophenyl)propyl)dimethylsilane |
770722-46-8 |
Skin Corr. 1A |
H314 |
|
|
CLP00/ |
| 014-028-00-6 |
α-[3-(1-oxoprop-2-eny)l-1-oxypropyl]dimethoxysilyloxy-ω-[3(1-oxoprop-2-enyl)-1-oxypropyl]dimethoxysilyl poly(dimethylsiloxane) |
193159-06-7 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 014-029-00-1 |
O,O'-(ethenylmethylsilylene)di[(4-methylpentan-2-one)oxime] |
156145-66-3 |
Repr. 2, Acute Tox. 4 *, STOT RE 2 * |
H361f ***, H302, H373 ** |
|
|
CLP00/ |
| 014-030-00-7 |
[(dimethylsilylene)bis((1,2,3,3a,7a-η)-1H-inden-1-ylidene)dimethyl]hafnium |
137390-08-0 |
Acute Tox. 2 * |
H300 |
|
|
CLP00/ |
| 014-031-00-2 |
bis(1-methylethyl)-dimethoxysilane |
18230-61-0 |
Flam. Liq. 3, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 3 |
H226, H315, H317, H412 |
|
|
CLP00/ |
| 014-032-00-8 |
dicyclopentyldimethoxysilane |
126990-35-0 |
Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H400, H410 |
|
|
CLP00/ |
| 014-033-00-3 |
2-methyl-3-(trimethoxysilyl)propyl-2-propenoate hydrolysis product with silica |
125804-20-8 |
Flam. Liq. 2, Eye Irrit. 2, STOT SE 3 |
H225, H319, H336 |
|
|
ATP01/ |
| 014-034-00-9 |
3-hexylheptamethyltrisiloxane |
1873-90-1 |
Acute Tox. 4 *, Aquatic Chronic 4 |
H332, H413 |
|
|
ATP01/ |
| 014-035-00-4 |
2-(3,4-epoxycyclohexyl)ethyltriethoxy silane |
10217-34-2 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
ATP01/ |
| 014-036-00-X |
(4-ethoxyphenyl)(3-(4-fluoro-3-phenoxyphenyl)propyl)dimethylsilane |
105024-66-6 |
Repr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H360F***, H400, H410 |
M=1000: |
|
ATP01/ |
| 014-037-00-5 |
2-butanone-O,O',O''-(phenylsilylidyne)trioxime |
34036-80-1 |
STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 3 |
H373**, H317, H412 |
|
|
ATP01/ |
| 014-038-00-0 |
S-(3-(triethoxysilyl)propyl)octanethioate |
220727-26-4 |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 014-039-00-6 |
(2,3-dimethylbut-2-yl)-trimethoxysilane |
142877-45-0 |
Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 3 |
H315, H318, H412 |
|
|
ATP01/ |
| 014-041-00-7 |
N,N-bis(trimethylsilyl)aminopropylmethyldiethoxysilane |
201290-01-9 |
Acute Tox. 4 *, Skin Sens. 1 |
H302, H317 |
|
|
ATP01/ |
| 014-042-00-2 |
reaction mass of: O,O',O'',O'''-silanetetrayl tetrakis(4-methyl-2-pentanone oxime) (3 stereoisomers) |
- |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 014-043-00-8 |
reaction product of amorphous silica (50-85%), butyl (1-methylpropyl) magnesium (3-15%), tetraethyl orthosilicate (5-15%) and titanium tetrachloride (5-20%) |
- |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 014-044-00-3 |
3-[(4'-acetoxy-3'-methoxyphenyl) propyl]trimethoxysilane |
- |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 014-045-00-9 |
magnesium sodium fluoride silicate |
- |
STOT RE 2 * |
H373** |
|
|
ATP01/ |
| 014-046-00-4 |
e-glass microfibres of representative composition; [Calcium-aluminium-silicate fibres with random orientation with the following representative composition (% given by weight): SiO2 50,0-56,0 %, Al2O3 13,0-16,0 %, B2O3 5,8-10,0 %, Na2O < 0,6 %, K2O < 0,4 |
|
Carc. 1B |
H350i |
|
A |
ATP09 |
| 014-047-00-X |
glass microfibres of representative composition; [Calcium-aluminium-silicate fibres with random orientation with the following composition (% given by weight): SiO2 55,0-60,0 %, Al2O3 4,0-7,0 %, B2O3 8,0-11,0 %, ZrO2 0,0-4,0 %, Na2O 9,5-13,5 %, K2O 0,0-4, |
|
Carc. 2 |
H351 (inhalation) |
|
A |
ATP09 |
| 014-048-00-5 |
silicon carbide fibres (with diameter < 3 μm, length > 5 μm and aspect ratio ≥ 3:1) |
409-21-2 |
Carc. 1B |
H350i |
|
|
ATP15 |
| 014-049-00-0 |
trimethoxyvinylsilane; trimethoxy(vinyl)silane |
2768-02-7 |
Skin Sens. 1B |
H317 |
|
|
ATP15 |
| 014-050-00-6 |
tris(2-methoxyethoxy) vinylsilane; 6-(2-methoxyethoxy)- 6-vinyl-2,5,7,10-tetraoxa-6-silaundecane |
1067-53-4 |
Repr. 1B |
H360FD |
|
|
ATP15 |
| 014-052-00-7 |
silanamine; 1,1,1-trimethyl-N-(trimethylsilyl)-, hydrolysis products with silica; pyrogenic, synthetic amorphous, nano, surface treated silicon dioxide |
68909-20-6 |
STOT RE 2 |
H373 (lungs, inhalation) |
|
|
ATP18 |
| 015-001-00-1 |
white phosphorus |
12185-10-3 |
Pyr. Sol. 1, Acute Tox. 2 *, Acute Tox. 2 *, Skin Corr. 1A, Aquatic Acute 1 |
H250, H330, H300, H314, H400 |
|
|
CLP00/ |
| 015-002-00-7 |
red phosphorus |
7723-14-0 |
Flam. Sol. 1, Aquatic Chronic 3 |
H228, H412 |
|
|
CLP00/ |
| 015-003-00-2 |
calcium phosphide; tricalcium diphosphide |
1305-99-3 |
Water-react. 1, Acute Tox. 2, Acute Tox. 3, Acute Tox. 1, Eye Dam. 1, Aquatic Acute 1 |
H260, H300, H311, H330, H318, H400 |
M=100: |
|
CLP00/ATP07 |
| 015-004-00-8 |
aluminium phosphide |
20859-73-8 |
Water-react. 1, Acute Tox. 2 , Acute Tox. 3 , Acute Tox. 1 , Aquatic Acute 1 |
H260, H300, H311, H330, H400 |
M=100: |
|
CLP00/ATP01/ATP05 |
| 015-005-00-3 |
magnesium phosphide; trimagnesium diphosphide |
12057-74-8 |
Water-react. 1, Acute Tox. 2, Acute Tox. 3, Acute Tox. 1, Aquatic Acute 1 |
H260, H300, H311, H330, H400 |
M=100 |
|
CLP00/ATP01/ATP05 |
| 015-006-00-9 |
trizinc diphosphide; zinc phosphide |
1314-84-7 |
Water-react. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H260, H300, H400, H410 |
M=100: |
T |
CLP00/ATP01 |
| 015-007-00-4 |
phosphorus trichloride |
7719-12-2 |
Acute Tox. 2 *, Acute Tox. 2 *, STOT RE 2 *, Skin Corr. 1A |
H330, H300, H373 **, H314 |
|
|
CLP00/ |
| 015-008-00-X |
phosphorus pentachloride |
10026-13-8 |
Acute Tox. 2 *, Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1B |
H330, H302, H373 **, H314 |
|
|
CLP00/ |
| 015-009-00-5 |
phosphoryl trichloride |
10025-87-3 |
Acute Tox. 2 *, STOT RE 1, Acute Tox. 4 *, Skin Corr. 1A |
H330, H372 **, H302, H314 |
|
|
CLP00/ |
| 015-010-00-0 |
phosphorus pentoxide |
1314-56-3 |
Skin Corr. 1A |
H314 |
|
|
CLP00/ |
| 015-011-00-6 |
phosphoric acid ... %, orthophosphoric acid ... % |
7664-38-2 |
Skin Corr. 1B |
H314 |
Skin Corr. 1B; H314: C ≥ 25 %, Skin Irrit. 2; H315: 10 % ≤ C < 25 %, Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
CLP00/ |
| 015-012-00-1 |
tetraphosphorus trisulphide; phosphorus sesquisulphid |
1314-85-8 |
Flam. Sol. 2, Water-react. 1, Acute Tox. 4 *, Aquatic Acute 1 |
H228, H260, H302, H400 |
|
T |
CLP00/ |
| 015-013-00-7 |
triethyl phosphate |
78-40-0 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 015-014-00-2 |
tributyl phosphate |
126-73-8 |
Carc. 2, Acute Tox. 4 *, Skin Irrit. 2 |
H351, H302, H315 |
|
|
CLP00/ |
| 015-015-00-8 |
tricresyl phosphate (o-o-o-, o-o-m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-); tritolyl phosphate (o-o-o-, o-o-m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-) |
78-30-8 |
STOT SE 1, Aquatic Chronic 2 |
H370 **, H411 |
STOT SE 1; H370: C ≥ 1 %, STOT SE 2; H371: 0,2 % ≤ C < 1 % |
C |
CLP00/ |
| 015-016-00-3 |
tricresyl phosphate (m-m-m-, m-m-p-, m-p-p-, p-p-p-); tritolyl phosphate (m-m-m-, m-m-p-, m-p-p-, p-p-p-) |
78-32-0 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 2 |
H312, H302, H411 |
* |
C |
CLP00/ |
| 015-019-00-X |
dichlorvos (ISO); 2,2-dichlorovinyl dimethyl phosphate |
62-73-7 |
Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Sens. 1, Aquatic Acute 1 |
H330, H311, H301, H317, H400 |
M=1000: |
|
CLP00/ATP01 |
| 015-020-00-5 |
mevinphos (ISO); 2-methoxycarbonyl-1-methylvinyl dimethyl phosphate |
7786-34-7 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H310, H300, H400, H410 |
M = 10000 |
|
CLP00/ |
| 015-021-00-0 |
trichlorfon (ISO); dimethyl 2,2,2-trichloro-1-hydroxyethylphosphonate |
52-68-6 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
M = 1000: |
|
CLP00/ |
| 015-022-00-6 |
phosphamidon (ISO); 2-chloro-2-diethylcarbamoyl-1-methylvinyl dimethyl phosphate |
13171-21-6 |
Muta. 2, Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H341, H300, H311, H400, H410 |
|
|
CLP00/ |
| 015-023-00-1 |
pyrazoxon; diethyl 3-methylpyrazol-5-yl phosphate |
108-34-9 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 * |
H330, H310, H300 |
|
|
CLP00/ |
| 015-024-00-7 |
triamiphos (ISO); 5-amino-3-phenyl-1,2,4-triazol-1-yl-N,N,N',N'-tetramethylphosphonic diamide |
1031-47-6 |
Acute Tox. 1, Acute Tox. 2 * |
H310, H300 |
|
|
CLP00/ |
| 015-025-00-2 |
TEPP (ISO); tetraethyl pyrophosphate |
107-49-3 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1 |
H310, H300, H400 |
|
|
CLP00/ |
| 015-026-00-8 |
schradan (ISO); octamethylpyrophosphoramide |
152-16-9 |
Acute Tox. 1, Acute Tox. 2 * |
H310, H300 |
|
|
CLP00/ |
| 015-027-00-3 |
sulfotep (ISO); O,O,O,O-tetraethyl dithiopyrophosphate |
3689-24-5 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H310, H300, H400, H410 |
M = 1000: |
|
CLP00/ |
| 015-028-00-9 |
demeton-O (ISO); O,O-diethyl-O-2-ethylthioethyl phosphorothioate |
298-03-3 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1 |
H310, H300, H400 |
|
|
CLP00/ |
| 015-029-00-4 |
demeton-S (ISO); diethyl-S-2-ethylthioethyl phosphorothioate |
126-75-0 |
Acute Tox. 1, Acute Tox. 2 * |
H310, H300 |
|
|
CLP00/ |
| 015-030-00-X |
demeton-O-methyl (ISO); O-2-ethylthioethyl O,O-dimethyl phosphorothioate |
867-27-6 |
Acute Tox. 3 * |
H301 |
|
|
CLP00/ |
| 015-031-00-5 |
demeton-S-methyl (ISO); S-2-ethylthioethyl dimethyl phosphorothioate |
919-86-8 |
Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Chronic 2 |
H311, H301, H411 |
|
|
CLP00/ |
| 015-032-00-0 |
prothoate (ISO); O,O-diethyl isopropylcarbamoylmethyl phosphorodithioate |
2275-18-5 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Chronic 3 |
H310, H300, H412 |
|
|
CLP00/ |
| 015-033-00-6 |
phorate (ISO); O,O-diethyl ethylthiomethyl phosphorodithioate |
298-02-2 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H310, H300, H400, H410 |
M = 1000: |
|
CLP00/ |
| 015-034-00-1 |
parathion (ISO); O,O-diethyl O-4-nitrophenyl phosphorothioate |
56-38-2 |
Acute Tox. 2 *, Acute Tox. 2 *, Acute Tox. 3 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H300, H311, H372 **, H400, H410 |
M = 100: |
|
CLP00/ |
| 015-035-00-7 |
parathion - methyl (ISO); O,O-dimethyl O-4-nitrophenyl phosphorothioate |
298-00-0 |
Flam. Liq. 3, Acute Tox. 2 *, Acute Tox. 2 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H226, H330, H300, H311, H373 **, H400, H410 |
M = 100: |
|
CLP00/ |
| 015-036-00-2 |
O-ethyl O-4-nitrophenyl phenylphosphonothioate; EPN |
2104-64-5 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H310, H300, H400, H410 |
|
|
CLP00/ |
| 015-037-00-8 |
phenkapton (ISO); S-(2,5-dichlorophenylthiomethyl) O,O-diethyl phosphorodithioate |
2275-14-1 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H400, H410 |
|
|
CLP00/ |
| 015-038-00-3 |
coumaphos (ISO); O-3-chloro-4-methylcoumarin-7-yl O,O-diethyl phosphorothioate |
56-72-4 |
Acute Tox. 2 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H300, H312, H400, H410 |
|
|
CLP00/ |
| 015-039-00-9 |
azinphos-methyl (ISO); O,O-dimethyl-4-oxobenzotriazin-3-ylmethyl phosphorodithioate |
86-50-0 |
Acute Tox. 2 *, Acute Tox. 2 *, Acute Tox. 3 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H300, H311, H317, H400, H410 |
|
|
CLP00/ |
| 015-040-00-4 |
diazinon (ISO); O,O-diethyl O-2-isopropyl-6-methylpyrimidin-4-yl phosphorothioate |
333-41-5 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 015-041-00-X |
malathion (ISO); 1,2-bis(ethoxycarbonyl)ethyl O,O-dimethyl phosphorodithioate; [containing ≤ 0.03 % isomalathion] |
121-75-5 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
M=1000: |
|
CLP00/ATP01 |
| 015-042-00-5 |
chlorthion; O-(3-chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate |
500-28-7 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H312, H302, H400, H410 |
M = 100: |
|
CLP00/ |
| 015-043-00-0 |
phosnichlor (ISO); O-4-chloro-3-nitrophenyl O,O-dimethyl phosphorothioate |
5826-76-6 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H332, H312, H302 |
|
|
CLP00/ |
| 015-044-00-6 |
carbophenothion (ISO); 4-chlorophenylthiomethyl O,O-diethyl phosphorodithioate |
786-19-6 |
Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H311, H301, H400, H410 |
|
|
CLP00/ |
| 015-045-00-1 |
mecarbam (ISO); N-ethoxycarbonyl-N-methylcarbamoylmethyl O,O-diethyl phosphorodithioate |
2595-54-2 |
Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H311, H301, H400, H410 |
|
|
CLP00/ |
| 015-046-00-7 |
oxydemeton-methyl; S-2-(ethylsulphinyl)ethyl O,O-dimethyl phosphorothioate |
301-12-2 |
Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1 |
H311, H301, H400 |
|
|
CLP00/ |
| 015-047-00-2 |
ethion (ISO); O,O,O',O'-tetraethyl S,S'-methylenedi (phosphorodithioate); diethion |
563-12-2 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H312, H400, H410 |
M = 10000: |
|
CLP00/ |
| 015-048-00-8 |
fenthion (ISO); O,O-dimethyl-O-(4-methylthion-m-tolyl) phosphorothioate |
55-38-9 |
Muta. 2, Acute Tox. 3 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H341, H331, H312, H302, H372**, H400, H410 |
M=100: |
|
CLP00/ATP01 |
| 015-049-00-3 |
endothion (ISO); S-5-methoxy-4-oxopyran-2-ylmethyl dimethyl phosphorothioate |
2778-04-3 |
Acute Tox. 3 *, Acute Tox. 3 * |
H311, H301 |
|
|
CLP00/ |
| 015-050-00-9 |
thiometon (ISO); S-2-ethylthioethyl O,O-dimethyl phosphorodithioate |
640-15-3 |
Acute Tox. 3 *, Acute Tox. 4 * |
H301, H312 |
|
|
CLP00/ |
| 015-051-00-4 |
dimethoate (ISO); O,O-dimethyl methylcarbamoylmethyl phosphorodithioate |
60-51-5 |
Acute Tox. 4 *, Acute Tox. 4 * |
H312, H302 |
|
|
CLP00/ |
| 015-052-00-X |
fenchlorphos (ISO); O,O-dimethyl O-2,4,5-trichlorophenyl phosphorothioate |
299-84-3 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H400, H410 |
|
|
CLP00/ |
| 015-053-00-5 |
menazon (ISO); S-[(4,6-diamino-1,3,5-triazin-2-yl)methyl] O,O-dimethyl phosphorodithioate |
78-57-9 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 015-054-00-0 |
fenitrothion (ISO); O,O-dimethyl O-4-nitro-m-tolyl phosphorothioate |
122-14-5 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 015-055-00-6 |
naled (ISO); 1,2-dibromo-2,2-dichloroethyl dimethyl phosphate |
300-76-5 |
Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1 |
H312, H302, H319, H315, H400 |
M = 1000: |
|
CLP00/ |
| 015-056-00-1 |
azinphos-ethyl (ISO); O,O-diethyl 4-oxobenzotriazin-3-ylmethyl phosphorodithioate |
2642-71-9 |
Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H300, H311, H400, H410 |
M=100: |
|
CLP00/ATP01 |
| 015-057-00-7 |
formothion (ISO); N-formyl-N-methylcarbamoylmethyl O,O-dimethyl phosphorodithioate |
2540-82-1 |
Acute Tox. 4 *, Acute Tox. 4 * |
H312, H302 |
|
|
CLP00/ |
| 015-058-00-2 |
morphothion (ISO); O,O-dimethyl-S-(morpholinocarbonylmethyl) phosphorodithioate |
144-41-2 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H400, H410 |
|
|
CLP00/ |
| 015-059-00-8 |
vamidothion (ISO); O,O-dimethyl S-2-(1-methylcarbamoylethylthio) ethyl phosphorothioate |
2275-23-2 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1 |
H301, H312, H400 |
|
|
CLP00/ |
| 015-060-00-3 |
disulfoton (ISO); O,O-diethyl 2-ethylthioethyl phosphorodithioate |
298-04-4 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H310, H300, H400, H410 |
|
|
CLP00/ |
| 015-061-00-9 |
dimefox (ISO); tetramethylphosphorodiamidic fluoride |
115-26-4 |
Acute Tox. 1, Acute Tox. 2 * |
H310, H300 |
|
|
CLP00/ |
| 015-062-00-4 |
mipafox (ISO); N,N'- di-isopropylphosphorodiamidic fluoride |
371-86-8 |
STOT SE 1 |
H370 ** |
|
|
CLP00/ |
| 015-063-00-X |
dioxathion (ISO); 1,4-dioxan-2,3-diyl-O,O,O',O'-tetraethyl di(phosphorodithioate) |
78-34-2 |
Acute Tox. 2 *, Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H300, H311, H400, H410 |
M = 1000: |
|
CLP00/ |
| 015-064-00-5 |
bromophos-ethyl (ISO); O-4-bromo-2,5-dichlorophenyl O,O-diethyl phosphorothioate |
4824-78-6 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H312, H400, H410 |
|
|
CLP00/ |
| 015-065-00-0 |
S-[2-(ethylsulphinyl)ethyl] O,O-dimethyl phosphorodithioate |
2703-37-9 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Aquatic Chronic 2 |
H330, H310, H300, H411 |
|
|
CLP00/ |
| 015-066-00-6 |
omethoate (ISO); O,O-dimethyl S-methylcarbamoylmethyl phosphorothioate |
1113-02-6 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1 |
H301, H312, H400 |
|
|
CLP00/ |
| 015-067-00-1 |
phosalone (ISO); S-(6-chloro-2-oxobenzoxazolin-3-ylmethyl) O,O-diethyl phosphorodithioate |
2310-17-0 |
Acute Tox. 3 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H332, H312, H317, H400, H410 |
M=1000: |
|
CLP00/ATP01 |
| 015-068-00-7 |
dichlofenthion (ISO); O-,4-dichlorophenyl O,O-diethyl phosphorothioate |
97-17-6 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 015-069-00-2 |
methidathion (ISO); 2,3-dihydro-5-methoxy-2-oxo-1,3,4-thiadiazol-3-ylmethyl-O,O-dimethylphosphorodithioate |
950-37-8 |
Acute Tox. 2 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H300, H312, H400, H410 |
|
|
CLP00/ |
| 015-070-00-8 |
cyanthoate (ISO); S-(N-(1-cyano-1-methylethyl)carbamoylmethyl) O,O-diethyl phosphorothioate |
3734-95-0 |
Acute Tox. 2 *, Acute Tox. 3 * |
H300, H311 |
|
|
CLP00/ |
| 015-071-00-3 |
chlorfenvinphos (ISO); 2-chloro-1-(2,4 dichlorophenyl) vinyl diethyl phosphate |
470-90-6 |
Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H300, H311, H400, H410 |
|
|
CLP00/ |
| 015-072-00-9 |
monocrotophos (ISO); dimethyl-1-methyl-2-(methylcarbamoyl)vinyl phosphate |
6923-22-4 |
Muta. 2, Acute Tox. 2 *, Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H341, H330, H300, H311, H400, H410 |
|
|
CLP00/ |
| 015-073-00-4 |
dicrotophos (ISO); (Z)-2-dimethylcarbamoyl-1-methylvinyl dimethyl phosphate |
141-66-2 |
Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H300, H311, H400, H410 |
|
|
CLP00/ |
| 015-074-00-X |
crufomate (ISO); 4-tert-butyl-2-chlorophenyl methyl methylphosphoramidate |
299-86-5 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H400, H410 |
|
|
CLP00/ |
| 015-075-00-5 |
S-[2-(isopropylsulphinyl)ethyl] O,O-dimethyl phosphorothioate |
2635-50-9 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 * |
H331, H311, H301 |
|
|
CLP00/ |
| 015-076-00-0 |
potasan; O,O-diethyl O-(4-methylcoumarin-7-yl) phosphorothioate |
299-45-6 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H310, H300, H400, H410 |
M = 1000: |
|
CLP00/ |
| 015-077-00-6 |
2,2-dichlorovinyl 2-ethylsulphinylethyl methyl phosphate |
7076-53-1 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 * |
H331, H311, H301 |
|
|
CLP00/ |
| 015-078-00-1 |
demeton-S-methylsulphon (ISO); S-2-ethylsulphonylethyl dimethyl phosphorothioate |
17040-19-6 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Chronic 2 |
H301, H312, H411 |
|
|
CLP00/ |
| 015-079-00-7 |
acephate (ISO); O,S-dimethyl acetylphosphoramidothioate |
30560-19-1 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 015-080-00-2 |
amidithion (ISO); 2-methoxyethylcarbamoylmethyl O,O-dimethyl phosphorodithioate |
919-76-6 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 015-081-00-8 |
O,O,O',O'-tetrapropyl dithiopyrophosphate |
3244-90-4 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H400, H410 |
|
|
CLP00/ |
| 015-082-00-3 |
azothoate (ISO); O-4-(4-chlorophenylazo)phenyl O,O-dimethyl phosphorothioate |
5834-96-8 |
Acute Tox. 4 *, Acute Tox. 4 * |
H332, H302 |
|
|
CLP00/ |
| 015-083-00-9 |
bensulide (ISO); O,O-diisopropyl 2-phenylsulphonylaminoethyl phosphorodithioate |
741-58-2 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 015-084-00-4 |
chlorpyrifos (ISO); O,O-diethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate |
2921-88-2 |
Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H400, H410 |
M = 10000: |
|
CLP00/ |
| 015-085-00-X |
chlorphonium chloride (ISO); tributyl (2,4-dichlorobenzyl) phosphonium chloride |
115-78-6 |
Acute Tox. 3 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2 |
H301, H312, H319, H315 |
|
|
CLP00/ |
| 015-086-00-5 |
coumithoate (ISO); O,O-diethyl O-,8,9,10-tetrahydro-6-oxo-benzo(c)chromen-3-yl phosphorothioate |
572-48-5 |
Acute Tox. 3 * |
H301 |
|
|
CLP00/ |
| 015-087-00-0 |
cyanophos (ISO); O-4-cyanophenyl O,O-dimethyl phosphorothioate |
2636-26-2 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H400, H410 |
|
|
CLP00/ |
| 015-088-00-6 |
dialifos (ISO); 2-chloro-1-phthalimidoethyl O,O-diethyl phosphorodithioate |
10311-84-9 |
Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H300, H311, H400, H410 |
|
|
CLP00/ |
| 015-089-00-1 |
ethoate-methyl (ISO); ethylcarbamoylmethyl O,O-dimethyl phosphorodithioate |
116-01-8 |
Acute Tox. 4 *, Acute Tox. 4 * |
H312, H302 |
|
|
CLP00/ |
| 015-090-00-7 |
fensulfothion (ISO); O,O-diethyl O-4-methylsulfinylphenyl phosphorothioate |
115-90-2 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H310, H300, H400, H410 |
|
|
CLP00/ |
| 015-091-00-2 |
fonofos (ISO); O-ethyl phenyl ethylphosphonodithioate |
944-22-9 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H310, H300, H400, H410 |
|
|
CLP00/ |
| 015-092-00-8 |
phosacetim (ISO); O,O-bis(4-chlorophenyl) N-acetimidoylphosphoramidothioate |
4104-14-7 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H310, H300, H400, H410 |
|
|
CLP00/ |
| 015-093-00-3 |
leptophos (ISO); O-4-bromo-2,5-dichlorophenyl O-methyl phenylphosphorothioate |
21609-90-5 |
Acute Tox. 3 *, STOT SE 1, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H370 **, H312, H400, H410 |
|
|
CLP00/ |
| 015-094-00-9 |
mephosfolan (ISO); diethyl 4-methyl-1,3-dithiolan-2-ylidenephosphoramidate |
950-10-7 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Chronic 2 |
H310, H300, H411 |
|
|
CLP00/ |
| 015-095-00-4 |
methamidophos (ISO); O,S-dimethyl phosphoramidothioate |
10265-92-6 |
Acute Tox. 2 *, Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Acute 1 |
H330, H300, H311, H400 |
|
|
CLP00/ |
| 015-096-00-X |
oxydisulfoton (ISO); O, O-diethyl S-2-ethylsulphinylethyl phosphorodithioate |
2497-07-6 |
Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H300, H311, H400, H410 |
M = 10: |
|
CLP00/ |
| 015-097-00-5 |
phenthoate (ISO); ethyl 2-(dimethoxyphosphinothioylthio)-2-phenylacetate |
2597-03-7 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H400, H410 |
M = 100: |
|
CLP00/ |
| 015-098-00-0 |
trichloronate (ISO); O-ethyl O-2,4,5-trichlorophenyl ethylphosphonothioate |
327-98-0 |
Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H300, H311, H400, H410 |
|
|
CLP00/ |
| 015-099-00-6 |
pirimiphos-ethyl (ISO); O,O-diethyl O-2-diethylamino-6-methylpyrimidin-4-yl phosphorothioate |
23505-41-1 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H312, H400, H410 |
|
|
CLP00/ |
| 015-100-00-X |
phoxim (ISO); α-(diethoxyphosphinothioylimino) phenylacetonitrile |
14816-18-3 |
Repr. 2, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361f***, H302, H317, H400, H410 |
M=1000: |
|
CLP00/ATP01 |
| 015-101-00-5 |
phosmet (ISO); S-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl] O,O-di-methyl phosphorodithioate; O,O-dimethyl-S-phthalimido-methyl phosphorodithioate |
732-11-6 |
Repr. 2, Acute Tox. 3, Acute Tox. 4, STOT SE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361f, H301, H332, H370 (nervous system), H400, H410 |
M=100, M=100 |
|
CLP00/ATP13 |
| 015-102-00-0 |
tris(2-chloroethyl)phosphate |
115-96-8 |
Carc. 2, Repr. 1B, Acute Tox. 4 *, Aquatic Chronic 2 |
H351, H360F***, H302, H411 |
|
|
CLP00/ATP01 |
| 015-103-00-6 |
phosphorus tribromide |
7789-60-8 |
Skin Corr. 1B, STOT SE 3 |
H314, H335 |
|
|
CLP00/ |
| 015-104-00-1 |
diphosphorus pentasulphide; phosphorus pentasulphide |
1314-80-3 |
Flam. Sol. 1, Water-react. 1, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1 |
H228, H260, H332, H302, H400 |
|
T |
CLP00/ |
| 015-105-00-7 |
triphenyl phosphite |
101-02-0 |
Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H315, H400, H410 |
Skin Irrit. 2; H315: C ≥ 5 %, Eye Irrit. 2; H319: C ≥ 5 % |
|
CLP00/ |
| 015-106-00-2 |
hexamethylphosphoric triamide; hexamethylphosphoramide |
680-31-9 |
Carc. 1B, Muta. 1B |
H350, H340 |
Carc. 1B; H350: C ≥ 0,01 % |
|
CLP00/ |
| 015-107-00-8 |
ethoprophos (ISO); ethyl-S,S-dipropyl phosphorodithioate |
13194-48-4 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 3 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H310, H301, H317, H400, H410 |
|
|
CLP00/ |
| 015-108-00-3 |
bromophos (ISO); O-4-bromo-2,5-dichlorophenyl O,O-dimethyl phosphorothioate |
2104-96-3 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
M = 100: |
|
CLP00/ |
| 015-109-00-9 |
crotoxyphos (ISO); 1-phenylethyl 3-(dimethoxyphosphinyloxy) isocrotonate |
7700-17-6 |
Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H311, H301, H400, H410 |
M = 10: |
|
CLP00/ |
| 015-110-00-4 |
cyanofenphos (ISO); O-4-cyanophenyl O-ethyl phenylphosphonothioate |
13067-93-1 |
Acute Tox. 3 *, STOT SE 1, Acute Tox. 4 *, Eye Irrit. 2, Aquatic Chronic 2 |
H301, H370 **, H312, H319, H411 |
|
|
CLP00/ |
| 015-111-00-X |
phosfolan (ISO); diethyl 1,3-dithiolan-2-ylidenephosphoramidate |
947-02-4 |
Acute Tox. 1, Acute Tox. 2 * |
H310, H300 |
|
|
CLP00/ |
| 015-112-00-5 |
thionazin (ISO); O,O-diethyl O-pyrazin-2-yl phosphorothioate |
297-97-2 |
Acute Tox. 1, Acute Tox. 2 * |
H310, H300 |
|
|
CLP00/ |
| 015-113-00-0 |
tolclofos-methyl (ISO);
O-(2,6-dichloro-p-tolyl)-O,O-dimethyl thiophosphate |
57018-04-9 |
Skin Sens. 1B,
Aquatic Acute 1,
Aquatic Chronic 1 |
H317, H400, H410 |
M=1,
M=1 |
|
ATP01/ATP17 |
| 015-114-00-6 |
chlormephos (ISO); S-chloromethyl O,O-diethyl phosphorodithioate |
24934-91-6 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
M=10: |
|
CLP00/ATP01 |
| 015-115-00-1 |
chlorthiophos (ISO); [isomeric reaction mass in which O-2,5-dichlorophenyl-4-methylthiophenyl O,O-diethyl phosphorothioate predominates] |
21923-23-9 |
Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H310, H300, H400, H410 |
M=1000: |
|
CLP00/ATP01 |
| 015-116-00-7 |
demephion-O (ISO); O,O-dimethyl O-2-methylthioethyl phosphorothioate |
682-80-4 |
Acute Tox. 2 *, Acute Tox. 3 * |
H300, H311 |
|
|
CLP00/ |
| 015-117-00-2 |
demephion-S (ISO); O,O-dimethyl S-2-methylthioethyl phosphorothioate |
2587-90-8 |
Acute Tox. 2 *, Acute Tox. 3 * |
H300, H311 |
|
|
CLP00/ |
| 015-118-00-8 |
demeton |
8065-48-3 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1 |
H310, H300, H400 |
|
|
CLP00/ |
| 015-119-00-3 |
dimethyl 4-(methylthio)phenyl phosphate |
3254-63-5 |
Acute Tox. 1, Acute Tox. 2 * |
H310, H300 |
|
|
CLP00/ |
| 015-120-00-9 |
ditalimfos (ISO); O,O-diethyl phthalimidophosphonothioate |
5131-24-8 |
Skin Irrit. 2, Skin Sens. 1 |
H315, H317 |
|
|
CLP00/ |
| 015-121-00-4 |
edifenphos (ISO); O-ethyl S,S-diphenyl phosphorodithioate |
17109-49-8 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H301, H312, H317, H400, H410 |
|
|
CLP00/ |
| 015-122-00-X |
etrimfos (ISO); O-6-ethoxy-2-ethylpyrimidin-4-yl O,O-dimethylphosphorothioate |
38260-54-7 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
M = 10: |
|
CLP00/ |
| 015-123-00-5 |
fenamiphos (ISO); ethyl-4-methylthio-m-tolyl isopropyl phosphoramidate |
22224-92-6 |
Acute Tox. 2, Acute Tox. 2, Acute Tox. 2, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H300, H310, H330, H319, H400, H410 |
M = 100, M = 100 |
|
CLP00/ATP05 |
| 015-124-00-0 |
fosthietan (ISO); diethyl 1,3-dithietan-2-ylidenephosphoramidate |
21548-32-3 |
Acute Tox. 1, Acute Tox. 2 * |
H310, H300 |
|
|
CLP00/ |
| 015-125-00-6 |
glyphosine (ISO); N,N-bis(phosphonomethyl)glycine |
2439-99-8 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 015-126-00-1 |
heptenophos (ISO); 7-chlorobicyclo(3.2.0)hepta-2,6-dien-6-yl dimethyl phosphate |
23560-59-0 |
Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H400, H410 |
M = 100: |
|
CLP00/ |
| 015-127-00-7 |
iprobenfos (ISO); S-benzyl diisopropyl phosphorothioate |
26087-47-8 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 015-128-00-2 |
IPSP; S-ethylsulphinylmethyl O,O-diisopropylphosphorodithioate |
5827-05-4 |
Acute Tox. 1, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H310, H301, H400, H410 |
M = 100: |
|
CLP00/ |
| 015-129-00-8 |
isofenphos (ISO); O-ethyl O-2-isopropoxycarbonylphenyl-isopropylphosphoramidothioate |
25311-71-1 |
Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H311, H301, H400, H410 |
M = 100: |
|
CLP00/ |
| 015-130-00-3 |
isothioate (ISO); S-2-isopropylthioethyl O,O-dimethyl phosphorodithioate |
36614-38-7 |
Acute Tox. 3 *, Acute Tox. 3 * |
H311, H301 |
|
|
CLP00/ |
| 015-131-00-9 |
isoxathion (ISO); O,O-diethyl O-5-phenylisoxazol-3-ylphosphorothioate |
18854-01-8 |
Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H311, H301, H400, H410 |
|
|
CLP00/ |
| 015-132-00-4 |
S-(chlorophenylthiomethyl) O,O-dimethylphosphorodithioate; methylcarbophenothione |
953-17-3 |
Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H311, H301, H400, H410 |
M = 1000: |
|
CLP00/ |
| 015-133-00-X |
piperophos (ISO); S-2-methylpiperidinocarbonylmethyl-O,O-dipropyl phosphorodithioate |
24151-93-7 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
M = 10: |
|
CLP00/ |
| 015-134-00-5 |
pirimiphos-methyl (ISO); O-[2-(diethylamino)-6-methylpyrimidin-4-yl] O,O-dimethyl phosphorothioate |
29232-93-7 |
Acute Tox. 4, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H372 (nervous system), H400, H410 |
Oral: ATE = 1414 mg/kg, M=1000, M=1000 |
|
CLP00/ATP15 |
| 015-135-00-0 |
profenofos (ISO); O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate |
41198-08-7 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H312, H302, H400, H410 |
M = 1000: |
|
CLP00/ |
| 015-136-00-6 |
trans-isopropyl-3-[[(ethylamino)methoxyfosfinothioyl]oxy]crotonate; isopropyl 3-[[(ethylamino)methoxyphosphinothioyl]oxy]isocrotonate; propetamphos (ISO) |
31218-83-4 |
Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H400, H410 |
M = 100: |
|
CLP00/ |
| 015-137-00-1 |
pyrazophos (ISO); O,O-diethyl O-(6-ethoxycarbonyl-5-methylpyrazolo[2,3-a]pyrimidin-2-yl) phosphorothioate |
13457-18-6 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H302, H400, H410 |
|
|
CLP00/ |
| 015-138-00-7 |
quinalphos (ISO); O,O-diethyl-O-quinoxalin-2-yl phosphorothioate |
13593-03-8 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H312, H400, H410 |
M = 1000: |
|
CLP00/ |
| 015-139-00-2 |
terbufos (ISO); S-tert-butylthiomethyl O,O-diethylphosphorodithioate |
13071-79-9 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H310, H300, H400, H410 |
M = 1000: |
|
CLP00/ |
| 015-140-00-8 |
triazophos (ISO); O,O-diethyl-O-1-phenyl-1H-1,2,4-triazol-3-yl phosphorothioate |
24017-47-8 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H301, H312, H400, H410 |
M=100: |
|
CLP00/ATP01 |
| 015-141-00-3 |
ethylenediammonium O,O-bis(octyl) phosphorodithioate, mixed isomers |
- |
Skin Corr. 1B, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H302, H400, H410 |
|
|
CLP00/ |
| 015-142-00-9 |
butyl (dialkyloxy(dibutoxyphosphoryloxy))titanium (trialkyloxy)titanium phosphate |
- |
Flam. Liq. 2, Eye Irrit. 2, Aquatic Chronic 2 |
H225, H319, H411 |
|
T |
CLP00/ |
| 015-143-00-4 |
reaction mass of 2-chloroethyl chloropropyl 2-chloroethylphosphonate, mixture reaction mass of isomers and 2-chloroethyl chloropropyl 2-chloropropylphosphonate, reaction mass of isomers |
- |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 015-144-00-X |
reaction mass of pentyl methylphosphinate and 2-methylbutyl methylphosphinate |
87025-52-3 |
Skin Corr. 1B |
H314 |
|
|
CLP00/ |
| 015-145-00-5 |
reaction mass of copper(I) O,O-diisopropyl phosphorodithioate and copper(I) O-isopropyl O-(4-methylpent-2-yl) phosphorodithioate and copper(I) O,O-bis(4-methylpent-2-yl) phosphorodithioate |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 015-146-00-0 |
S-(tricyclo(5.2.1.02,6)deca-3-en-8(or 9)-yl O-(isopropyl or isobutyl or 2-ethylhexyl) O-(isopropyl or isobutyl or 2-ethylhexyl) phosphorodithioate |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 015-147-00-6 |
reaction mass of C12-14-tert-alkylammonium diphenyl phosphorothioate and dinonyl sulphide (or disulphide) |
- |
Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H315, H318, H317, H411 |
|
|
CLP00/ |
| 015-148-00-1 |
2-(diphosphonomethyl)succinic acid |
51395-42-7 |
Skin Corr. 1B, Skin Sens. 1 |
H314, H317 |
|
|
CLP00/ |
| 015-149-00-7 |
reaction mass of: hexyldioctylphosphineoxide; dihexyloctylphosphineoxide; trioctylphosphineoxide |
- |
Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H400, H410 |
|
|
CLP00/ |
| 015-150-00-2 |
(2-(1,3-dioxolan-2-yl)ethyl)triphenylphosphonium bromide |
86608-70-0 |
Acute Tox. 4 *, Eye Dam. 1, STOT RE 2 *, Aquatic Chronic 3 |
H302, H318, H373 **, H412 |
|
|
CLP00/ |
| 015-151-00-8 |
tris(isopropyl/tert-butylphenyl) phosphate |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 015-152-00-3 |
dioxabenzofos (ISO); 2-methoxy-4H-1,3,2-benzodioxaphosphorin 2-sulphide |
3811-49-2 |
Acute Tox. 3 *, Acute Tox. 3 *, STOT SE 1, Aquatic Chronic 2 |
H311, H301, H370 **, H411 |
|
|
CLP00/ |
| 015-153-00-9 |
isazofos (ISO); O-(5-chloro-1-isopropyl-1,2,4-triazol-3-yl) O,O-diethyl phosphorothioate |
42509-80-8 |
Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H311, H301, H373 **, H317, H400, H410 |
|
|
CLP00/ |
| 015-154-00-4 |
ethephon; 2-chloroethylphosphonic acid |
16672-87-0 |
Acute Tox. 3, Acute Tox. 4, Acute Tox. 4, Skin Corr. 1C, Aquatic Chronic 2 |
H311, H332, H302, H314, H411 |
|
|
CLP00/ATP06 |
| 015-155-00-X |
glufosinate ammonium (ISO); ammonium 2-amino-4-(hydroxymethylphosphinyl)butyrate |
77182-82-2 |
Repr. 1B, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 * |
H360Fd, H332, H312, H302, H373** |
|
|
CLP00/ATP01 |
| 015-156-00-5 |
methyl 3-[(dimethoxyphosphinothioyl)oxy]methacrylate; [1] methacrifos (ISO); methyl (E)-3-[(dimethoxyphosphinothioyl)oxy]methacrylate [2] |
30864-28-9 [1], 62610-77-9 [2] |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
CLP00/ |
| 015-157-00-0 |
phosphonic acid; [1] phosphorous acid [2] |
13598-36-2 [1], 10294-56-1 [2] |
Acute Tox. 4 *, Skin Corr. 1A |
H302, H314 |
|
|
CLP00/ |
| 015-158-00-6 |
(η-cyclopentadienyl)(η-cumenyl)iron(1+)hexafluorophosphate(1-) |
32760-80-8 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 015-159-00-1 |
hydroxyphosphonoacetic acid |
23783-26-8 |
Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1B, Skin Sens. 1 |
H302, H373 **, H314, H317 |
|
|
CLP00/ |
| 015-160-00-7 |
vanadyl pyrophosphate |
58834-75-6 |
Eye Irrit. 2, Skin Sens. 1, Aquatic Chronic 3 |
H319, H317, H412 |
|
|
CLP00/ |
| 015-161-00-2 |
divanadyl pyrophosphate |
65232-89-5 |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H302, H318, H317, H411 |
|
|
CLP00/ |
| 015-162-00-8 |
vanadium(IV) oxide hydrogen phosphate hemihydrate, lithium, zinc, molybdenum, iron and chlorine-doped |
- |
Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Aquatic Chronic 2 |
H332, H373 **, H318, H411 |
|
|
CLP00/ |
| 015-163-00-3 |
bis(2,6-dimethoxybenzoyl)-2,4,4-trimethylpentylphosphinoxide |
145052-34-2 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 015-164-00-9 |
calcium P,P'-(1-hydroxyethylene)bis(hydrogen phosphonate)dihydrate |
36669-85-9 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 015-165-00-4 |
reaction mass of: thiobis(4,1-phenylene)-S,S,S',S'-tetraphenyldisulfonium bishexafluorophosphate; diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate |
- |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
CLP00/ |
| 015-166-00-X |
3,9-bis(2,6-di-tert-butyl-4-methylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
80693-00-1 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 015-167-00-5 |
3-(hydroxyphenylphosphinyl)propanoic acid |
14657-64-8 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 015-168-00-0 |
fosthiazate (ISO); (RS)-S-sec-butyl-O-ethyl-2-oxo-1,3-thiazolidin-3-ylphosphonothioate |
98886-44-3 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H301, H312, H317, H400, H410 |
|
|
CLP00/ |
| 015-169-00-6 |
tributyltetradecylphosphonium tetrafluoroborate |
- |
Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373 **, H314, H317, H400, H410 |
|
|
CLP00/ |
| 015-170-00-1 |
reaction mass of: di-(1-octane-N,N,N-trimethylammonium) octylphosphate; 1-octane-N,N,N-trimethylammonium di-octylphosphate; 1-octane-N,N,N-trimethylammonium octylphosphate |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H312, H302, H314 |
|
|
CLP00/ |
| 015-171-00-7 |
O,O,O-tris(2(or 4)-C9-10-isoalkylphenyl) phosphorothioate |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 015-172-00-2 |
reaction mass of: bis(isotridecylammonium)mono(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate; isotridecylammonium bis(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate |
- |
Flam. Liq. 3, Skin Corr. 1B, Aquatic Chronic 2 |
H226, H314, H411 |
|
|
CLP00/ |
| 015-173-00-8 |
methyl [2-(1,1-dimethylethyl)-6-methoxypyrimidin-4-yl]ethylphosphonothioate |
117291-73-3 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 015-174-00-3 |
1-chloro-N,N-diethyl-1,1-diphenyl-1-(phenylmethyl)phosphoramine |
82857-68-9 |
Acute Tox. 3 *, Eye Dam. 1, Aquatic Chronic 2 |
H301, H318, H411 |
|
|
CLP00/ |
| 015-175-00-9 |
tert-butyl (triphenylphosphoranylidene) acetate |
35000-38-5 |
Acute Tox. 3 *, STOT RE 2 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H301, H373 **, H319, H317, H411 |
|
|
CLP00/ |
| 015-176-00-4 |
P,P,P',P'-tetrakis-(o-methoxyphenyl)propane-1,3-diphosphine |
116163-96-3 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 015-177-00-X |
((4-phenylbutyl)hydroxyphosphoryl)acetic acid |
83623-61-4 |
STOT RE 2 *, Eye Dam. 1, Skin Sens. 1 |
H373 **, H318, H317 |
|
|
CLP00/ |
| 015-178-00-5 |
(R)-α-phenylethylammonium (-)-(1R, 2S)-(1,2-epoxypropyl)phosphonate monohydrate |
25383-07-7 |
Repr. 2, Aquatic Chronic 2 |
H361f ***, H411 |
|
|
CLP00/ |
| 015-179-00-0 |
UVCB condensation product of: tetrakis-hydroxymethylphosphonium chloride, urea and distilled hydrogenated C16-18 tallow alkylamine |
166242-53-1 |
Carc. 2, Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H302, H373 **, H314, H317, H400, H410 |
|
|
CLP00/ |
| 015-180-00-6 |
[R-(R*,S*)]-[[2-methyl-1-(1-oxopropoxy)propoxy]-(4-phenylbutyl)phosphinyl] acetic acid, (-)-cinchonidine (1:1) salt |
137590-32-0 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
|
CLP00/ |
| 015-181-00-1 |
phosphine |
7803-51-2 |
Flam. Gas 1, Press. Gas, Acute Tox. 1, Skin Corr. 1B, Aquatic Acute 1 |
H220, , H330, H314, H400 |
Inhalation: ATE = 10 ppmV (Gases) |
U |
CLP00/ATP15 |
| 015-182-00-7 |
tetraisopropyldichloromethylenebisphosphonate |
10596-22-2 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1 |
H302, H319, H317 |
|
|
ATP01/ |
| 015-183-00-2 |
(1-hydroxydodecylidene)diphosphonic acid |
16610-63-2 |
Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H400, H410 |
|
|
ATP01/ |
| 015-184-00-8 |
Salts of glyphosate, with the exception of those specified elsewhere in this Annex |
- |
Aquatic Chronic 2 |
H411 |
|
A |
CLP00/ |
| 015-186-00-9 |
chlorpyrifos-methyl (ISO),; O, O-dimethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate |
5598-13-0 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
M = 10000: |
|
CLP00/ |
| 015-187-00-4 |
reaction mass of: tetrasodium(((2-hydroxyethyl)imino)bis(methylene))bisphosphonate, N-oxide; trisodium ((tetrahydro-2-hydroxy-4H-1,4,2-oxazaphosphorin-4-yl)-methyl)phosphonate, N-oxide, P-oxide |
- |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 015-189-00-5 |
phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide |
162881-26-7 |
Skin Sens. 1A, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ATP14 |
| 015-190-00-0 |
bis(2,4-dicumylphenyl) neopentyl diphosphite; 3,9-bis[2,4-bis(1-methyl-1-phenylethyl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
154862-43-8 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 015-191-00-6 |
dodecyldiphenyl phosphate |
27460-02-2 |
Skin Irrit. 2, Aquatic Chronic 3 |
H315, H412 |
|
|
ATP01/ |
| 015-193-00-7 |
triphenyl(phenylmethyl)phosphonium 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-1-butanesulfonamide (1:1) |
332350-93-3 |
Acute Tox. 3 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H318, H400, H410 |
|
|
ATP01/ |
| 015-194-00-2 |
tetrabutyl-phosphonium nonafluoro-butane-1-sulfonate |
220689-12-3 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
ATP01/ |
| 015-195-00-8 |
reaction mass of: potassium o-toluenephosphonate; potassium m-toluenephosphonate; potassium p-toluenephosphonate |
- |
Eye Irrit. 2, Skin Sens. 1, Aquatic Chronic 3 |
H319, H317, H412 |
|
|
ATP01/ |
| 015-196-00-3 |
reaction mass of: dimethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate; diethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate; methyl ethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate |
- |
Carc. 1B, Muta. 1B, Skin Sens. 1 |
H350, H340, H317 |
|
|
ATP01/ |
| 015-197-00-9 |
bis(2,4,4-trimethylpentyl)dithiophosphonic acid |
107667-02-7 |
Flam. Liq. 3, Acute Tox. 3 *, Acute Tox. 4 *, Skin Corr. 1B, Aquatic Chronic 2 |
H226, H331, H302, H314, H411 |
|
|
ATP01/ |
| 015-198-00-4 |
(4-phenylbutyl)phosphinic acid |
86552-32-1 |
Carc. 2, Eye Dam. 1 |
H351, H318 |
|
|
ATP01/ |
| 015-199-00-X |
tris[2-chloro-1-chloromethyl)ethyl] phosphate |
13674-87-8 |
Carc. 2 |
H351 |
|
|
ATP03 |
| 015-200-00-3 |
indium phosphide |
22398-80-7 |
Carc. 1B, Repr. 2, STOT RE 1 |
H350, H361f, H372 (Lunge) |
STOT RE 1; H372: C ≥ 0,1 % Carc 1B; H350: C ≥ 0,01 % STOT RE 2; H373: 0,01 % ≤ C < 0,1 % |
|
ATP03 |
| 015-201-00-9 |
trixylyl phosphate |
25155-23-1 |
Repr. 1B |
H360F |
|
|
ATP03 |
| 015-202-00-4 |
tris(nonylphenyl) phosphite |
26523-78-4 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
ATP03 |
| 015-203-00-X |
diphenyl(2,4,6- trimethylbenzoyl)phosphine oxide |
75980-60-8 |
Repr. 2 |
H361f (verursacht Hodenatrophie) |
|
|
ATP03 |
| 016-001-00-4 |
hydrogen sulphide |
7783-06-4 |
Flam. Gas 1, Press. Gas, Acute Tox. 2 *, Aquatic Acute 1 |
H220, H330, H400 |
|
U |
CLP00/ |
| 016-002-00-X |
barium sulphide |
21109-95-5 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1 |
H332, H302, H400 |
|
|
CLP00/ |
| 016-003-00-5 |
barium polysulphides |
50864-67-0 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1 |
H319, H335, H315, H400 |
|
|
CLP00/ |
| 016-004-00-0 |
calcium sulphide |
20548-54-3 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1 |
H319, H335, H315, H400 |
|
|
CLP00/ |
| 016-005-00-6 |
calcium polysulphides |
1344-81-6 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1 |
H319, H335, H315, H400 |
|
|
CLP00/ |
| 016-006-00-1 |
dipotassium sulphide; potassium sulphide |
1312-73-8 |
Skin Corr. 1B, Aquatic Acute 1 |
H314, H400 |
|
|
CLP00/ |
| 016-007-00-7 |
potassium polysulphides |
37199-66-9 |
Skin Corr. 1B, Aquatic Acute 1 |
H314, H400 |
|
|
CLP00/ |
| 016-008-00-2 |
ammonium polysulphides |
9080-17-5 |
Skin Corr. 1B, Aquatic Acute 1 |
H314, H400 |
EUH031: C ≥ 1 % |
|
CLP00/ |
| 016-009-00-8 |
disodium sulfide; sodium sulfide |
1313-82-2 |
Acute Tox. 3 *, Acute Tox. 4 *, Skin Corr. 1B, Aquatic Acute 1 |
H311, H302, H314, H400 |
|
|
CLP00/ATP01 |
| 016-010-00-3 |
sodium polysulphides |
1344-08-7 |
Acute Tox. 3 *, Skin Corr. 1B, Aquatic Acute 1 |
H301, H314, H400 |
|
|
CLP00/ |
| 016-011-00-9 |
sulphur dioxide |
7446-09-5 |
Press. Gas, Acute Tox. 3 *, Skin Corr. 1B |
H331, H314 |
* |
U 5 |
CLP00/ |
| 016-012-00-4 |
disulphur dichloride; sulfur monochloride |
10025-67-9 |
Acute Tox. 3 *, Acute Tox. 4 *, Skin Corr. 1A, Aquatic Acute 1 |
H301, H332, H314, H400 |
STOT SE 3; H335: C ≥ 1 % |
|
CLP00/ |
| 016-013-00-X |
sulphur dichloride |
10545-99-0 |
Skin Corr. 1B, STOT SE 3, Aquatic Acute 1 |
H314, H335, H400 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 016-014-00-5 |
sulphur tetrachloride |
13451-08-6 |
Skin Corr. 1B, Aquatic Acute 1 |
H314, H400 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 016-015-00-0 |
thionyl dichloride; thionyl chloride |
7719-09-7 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1A |
H332, H302, H314 |
STOT SE 3; H335: C ≥ 1 % |
|
CLP00/ |
| 016-016-00-6 |
sulphuryl chloride |
7791-25-5 |
Skin Corr. 1B, STOT SE 3 |
H314, H335 |
|
|
CLP00/ |
| 016-017-00-1 |
chlorosulphonic acid |
7790-94-5 |
Skin Corr. 1A, STOT SE 3 |
H314, H335 |
|
|
CLP00/ |
| 016-018-00-7 |
fluorosulphonic acid |
7789-21-1 |
Acute Tox. 4 *, Skin Corr. 1A |
H332, H314 |
|
|
CLP00/ |
| 016-019-00-2 |
oleum ... % SO3 |
- |
Skin Corr. 1A, STOT SE 3 |
H314, H335 |
|
B |
CLP00/ |
| 016-020-00-8 |
sulphuric acid ... % |
7664-93-9 |
Skin Corr. 1A |
H314 |
Skin Corr. 1A; H314: C ≥ 15 %, Skin Irrit. 2; H315: 5 % ≤ C < 15 %, Eye Irrit. 2; H319: 5 % ≤ C < 15 % |
B |
CLP00/ |
| 016-021-00-3 |
methanethiol; methyl mercaptan |
74-93-1 |
Flam. Gas 1, Press. Gas, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H220, H331, H400, H410 |
|
U |
CLP00/ |
| 016-022-00-9 |
ethanethiol; ethyl mercaptan |
75-08-1 |
Flam. Liq. 2, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H225, H332, H400, H410 |
|
|
CLP00/ |
| 016-023-00-4 |
dimethyl sulphate |
77-78-1 |
Carc. 1B, Muta. 2, Acute Tox. 2 *, Acute Tox. 3 *, Skin Corr. 1B, Skin Sens. 1 |
H350, H341, H330, H301, H314, H317 |
Carc. 1B; H350: C ≥ 0,01 %, Muta. 2; H341: C ≥ 0,01 %, STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 016-024-00-X |
dimexano (ISO); bis(methoxythiocarbonyl) disulphide |
1468-37-7 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 016-025-00-5 |
disul (ISO); 2-(2,4-dichlorophenoxy)ethyl hydrogensulphate; 2,4-DES |
149-26-8 |
Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1 |
H302, H315, H318 |
|
|
CLP00/ |
| 016-026-00-0 |
sulphamidic acid; sulphamic acid; sulfamic acid |
5329-14-6 |
Eye Irrit. 2, Skin Irrit. 2, Aquatic Chronic 3 |
H319, H315, H412 |
|
|
CLP00/ |
| 016-027-00-6 |
diethyl sulphate |
64-67-5 |
Carc. 1B, Muta. 1B, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H350, H340, H332, H312, H302, H314 |
|
|
CLP00/ |
| 016-028-00-1 |
sodium dithionite; sodium hydrosulphite |
7775-14-6 |
Self-heat. 1, Acute Tox. 4 * |
H251, H302 |
|
|
CLP00/ |
| 016-029-00-7 |
p-toluenesulphonic acid, containing more than 5 % H2SO4 |
- |
Skin Corr. 1B |
H314 |
Skin Corr. 1B; H314: C ≥ 25 %, Skin Irrit. 2; H315: 10 % ≤ C < 25 %, Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
|
CLP00/ |
| 016-030-00-2 |
p-toluenesulphonic acid (containing a maximum of 5 % H2SO4) |
104-15-4 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H319, H335, H315 |
STOT SE 3; H335: C ≥ 20 % |
|
CLP00/ |
| 016-031-00-8 |
tetrahydrothiophene-1,1-dioxide; sulpholane |
126-33-0 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 016-032-00-3 |
1,3-propanesultone; 1,2-oxathiolane 2,2-dioxide |
1120-71-4 |
Carc. 1B, Acute Tox. 4 *, Acute Tox. 4 * |
H350, H312, H302 |
Carc. 1B; H350: C ≥ 0,01 % |
|
CLP00/ |
| 016-033-00-9 |
dimethylsulfamoylchloride |
13360-57-1 |
Carc. 1B, Acute Tox. 2 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H350, H330, H312, H302, H314 |
|
|
CLP00/ |
| 016-034-00-4 |
tetrasodium 3,3'-(piperazine-1,4-diylbis((6-chloro-1,3,5-triazine-2,4-diyl)imino(2-acetamido)-4,1-phenyleneazo))bis(naphthalene-1,5-disulphonate) |
81898-60-4 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 016-035-00-X |
pentasodium 5-anilino-3-(4-(4-(6-chloro-4-(3-sulphonatoanilino)-1,3,5-triazin-2-ylamino)-2,5-dimethylphenylazo)-2,5-disulphonatophenylazo)-4-hydroxynaphthalene-2,7-disulphonate |
- |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 016-036-00-5 |
tetrasodium 5-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-4-hydroxy-2,3-azodinaphthalene-1,2,5,7-disulphonate |
- |
Resp. Sens. 1, Aquatic Chronic 2 |
H334, H411 |
|
|
CLP00/ |
| 016-037-00-0 |
disodium 1-amino-4-(4-benzenesulphonamido-3-sulphonatoanilino)anthraquinone-2-sulphonate |
85153-93-1 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
CLP00/ |
| 016-038-00-6 |
disodium 6-((4-chloro-6-(N-methyl)-2-toluidino)-1,3,5-triazin-2-ylamino)-1-hydroxy-2-(4-methoxy-2-sulphonatophenylazo)naphthalene-3-sulphonate |
86393-35-3 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 016-039-00-1 |
tetrasodium 2-(6-chloro-4-(4-(2,5-dimethyl-4-(2,5-disulphonatophenylazo)phenylazo)-3-ureidoanilino)-1,3,5-triazin-2-ylamino)benzene-1,4-disulphonate |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 016-040-00-7 |
reaction mass of disodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(2,4-dihydroxyphenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and disodium 6-(2,4-diaminophenylazo)-3-(4-(4-(2,4-diaminophenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and trisodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(7-(2,4-dihydroxyphenylazo)-1-hydroxy-3-sulphonato-2-naphthylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate |
- |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 016-041-00-2 |
calcium 2,5-dichloro-4-(4-((5-chloro-4-methyl-2-sulphonatophenyl)azo)-5-hydroxy-3-methylpyrazol-1-yl)benzenesulphonate |
- |
Acute Tox. 4 * |
H332 |
|
|
CLP00/ |
| 016-042-00-8 |
tetrasodium 5-benzamido-3-(5-(4-fluoro-6-(1-sulphonato-2-naphthylamino)-1,3,5-triazin-2-ylamino)-2-sulphonatophenylazo)-4-hydroxynaphthalene-2,7- disulphonate |
85665-97-0 |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H319, H315, H317 |
|
|
CLP00/ |
| 016-043-00-3 |
dilithium 6-acetamido-4-hydroxy-3-(4-((2-sulphonatooxy)ethylsulphonyl)phenylazo)naphthalene-2-sulphonate |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 016-044-00-9 |
disodium S,S-hexane-1,6-diyldi(thiosulphate) dihydrate |
- |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 016-045-00-4 |
lithium sodium hydrogen 4-amino-6-(5-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-2-sulphonatophenylazo)-5-hydroxy-3-(4-(2-(sulphonatooxy)ethylsulphonyl)phenylazo)naphthalene-2,7-disulphonate |
108624-00-6 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 016-046-00-X |
sodium hydrogensulphate |
7681-38-1 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 016-047-00-5 |
hexasodium 7-(4-(4-(4-(2,5-disulphonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)-2-methylphenylazo)-7-sulphonatonaphthylazo)naphthalene-1,3,5- trisulphonate |
85665-96-9 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 016-048-00-0 |
sodium 3,5-dichloro-2-(5-cyano-2,6-bis(3-hydroxypropylamino)-4-methylpyridin-3-ylazo)benzenesulphonate |
- |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
CLP00/ |
| 016-049-00-6 |
calcium octadecylxylenesulphonate |
- |
Skin Corr. 1B, Aquatic Chronic 2 |
H314, H411 |
|
|
CLP00/ |
| 016-050-00-1 |
potassium sodium 5-(4-chloro-6-(N-(4-(4-chloro-6-(5-hydroxy-2,7-disulphonato-6-(2-sulphonatophenylazo)-4-naphthylamino)-1,3,5-triazin-2-ylamino) phenyl-N-methyl)amino)-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(2-sulphonatophenylazo)naphthalene-2,7-disulphonat |
- |
Eye Irrit. 2, Skin Sens. 1 |
H319, H317 |
|
|
CLP00/ |
| 016-051-00-7 |
trisodium 7-(4-(6-fluoro-4-(2-(2-vinylsulphonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6- trisulphonate |
106359-91-5 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 016-052-00-2 |
benzyltributylammonium 4-hydroxynaphthalene-1-sulphonate |
102561-46-6 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H332, H411 |
|
|
CLP00/ |
| 016-053-00-8 |
(C16 or C18-n-alkyl)(C16 or C18-n-alkyl)ammonium 2-((C16 or C18-n-alkyl)(C16 or C18-n-alkyl)carbamoyl)benzenesulphonate |
- |
Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 4 |
H315, H317, H413 |
|
|
CLP00/ |
| 016-054-00-3 |
sodium 4-(2,4,4-trimethylpentylcarbonyloxy)benzenesulfonate |
- |
Acute Tox. 3 *, STOT RE 1, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Sens. 1 |
H331, H372 **, H302, H319, H335, H317 |
|
|
CLP00/ |
| 016-055-00-9 |
tetrasodium 4-amino-3,6-bis(5-(6-chloro-4-(2-hydroxyethylamino)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxynaphthalene-2,7-sulfonate (containing > 35 % sodium chloride and sodium acetate) |
- |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
CLP00/ |
| 016-056-00-4 |
potassium hydrogensulphate |
7646-93-7 |
Skin Corr. 1B, STOT SE 3 |
H314, H335 |
|
|
CLP00/ |
| 016-057-00-X |
styrene-4-sulfonyl chloride |
2633-67-2 |
Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1 |
H315, H318, H317 |
|
|
CLP00/ |
| 016-058-00-5 |
thionyl chloride, reaction products with 1,3,4-thiadiazol-2,5-dithiol, tert-nonanethiol and C12-14-tert-alkylamine |
- |
Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 3 |
H315, H317, H412 |
|
|
CLP00/ |
| 016-059-00-0 |
N,N,N',N'-tetramethyldithiobis(ethylene)diamine dihydrochloride |
17339-60-5 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H317, H400, H410 |
|
|
CLP00/ |
| 016-060-00-6 |
diammonium peroxodisulphate; ammonium persulphate |
7727-54-0 |
Ox. Sol. 3, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1, Skin Sens. 1 |
H272, H302, H319, H335, H315, H334, H317 |
|
|
CLP00/ |
| 016-061-00-1 |
dipotassium peroxodisulphate; potassium persulphate |
7727-21-1 |
Ox. Sol. 3, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1, Skin Sens. 1 |
H272, H302, H319, H335, H315, H334, H317 |
|
|
CLP00/ |
| 016-062-00-7 |
bensultap (ISO); 1,3-bis(phenylsulfonylthio)-2-(N,N-dimethylamino)propane |
17606-31-4 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 016-063-00-2 |
sodium metabisulphite |
7681-57-4 |
Acute Tox. 4 *, Eye Dam. 1 |
H302, H318 |
|
|
CLP00/ |
| 016-064-00-8 |
sodium hydrogensulphite … %; sodium bisulphite … % |
7631-90-5 |
Acute Tox. 4 * |
H302 |
|
B |
CLP00/ |
| 016-065-00-3 |
sodium 1-amino-4-[2-methyl-5-(4-methylphenylsulfonylamino)phenylamino]anthraquinone-2-sulfonate |
84057-97-6 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 016-066-00-9 |
tetrasodium [5-((4-amino-6-chloro-1,3,5-triazin-2-yl)amino)-2-((2-hydroxy-3,5-disulfonatophenylazo)-2- sulfonatobenzylidenehydrazino)benzoate]copper(II) |
116912-62-0 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 016-067-00-4 |
(4-methylphenyl)mesitylene sulfonate |
67811-06-7 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 016-068-00-X |
sodium 3,5-bis(tetradecyloxycarbonyl)benzenesulfinate |
155160-86-4 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 016-069-00-5 |
3,5-bis-(tetradecyloxycarbonyl)benzenesulfinic acid |
141915-64-2 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 016-070-00-0 |
4-benzyloxy-4'-(2,3-epoxy-2-methylprop-1-yloxy)diphenylsulfone |
- |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 016-071-00-6 |
trisodium 3-amino-6,13-dichloro-10-((3-((4-chloro-6-(2-sulfophenylamino)-1,3,5-triazin-2-yl)amino)propyl) amino)-4,11-triphenoxydioxazinedisulfonate |
136248-03-8 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 016-072-00-1 |
3-amino-4-hydroxy-N-(2-methoxyethyl)-benzenesulfonamide |
112195-27-4 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H318, H317, H411 |
|
|
CLP00/ |
| 016-073-00-7 |
tetrakis(phenylmethyl)thioperoxydi(carbothioamide) |
10591-85-2 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 016-074-00-2 |
6-fluoro-2-methyl-3-(4-methylthiobenzyl)indene |
- |
Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H315, H318, H317, H411 |
|
|
CLP00/ |
| 016-075-00-8 |
2,2'-diallyl-4,4'-sulfonyldiphenol |
41481-66-7 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 016-076-00-3 |
2,3-bis((2-mercaptoethyl)thio)-1-propanethiol |
131538-00-6 |
Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373 **, H400, H410 |
|
|
CLP00/ |
| 016-077-00-9 |
2-chloro-p-toluenesulfochloride |
42413-03-6 |
Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 3 |
H314, H317, H412 |
|
|
CLP00/ |
| 016-078-00-4 |
4-methyl-N,N-bis(2-(((4-methylphenyl)sulfonyl)amino)ethyl)benzenesulfonamide |
56187-04-3 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 016-079-00-X |
N,N-bis(2-(p-toluenesulfonyloxy)ethyl)-p-toluenesulfonamide |
16695-22-0 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 016-080-00-5 |
sodium 2-anilino-5-(2-nitro-4-(N-phenylsulfamoyl))anilinobenzenesulfonate |
31361-99-6 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
CLP00/ |
| 016-081-00-0 |
hexahydrocyclopenta[c]pyrrole-1-(1H)-ammonium N-ethoxycarbonyl-N-(p-tolylsulfonyl)azanide |
- |
Muta. 2, Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H341, H302, H319, H317, H411 |
|
|
CLP00/ |
| 016-082-00-6 |
ethoxysulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethoxyphenoxysulfonyl)urea |
126801-58-9 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 016-083-00-1 |
acibenzolar-S-methyl; benzo[1,2,3]thiadiazole-7-carbothioic acid S-methyl ester |
135158-54-2 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H335, H315, H317, H400, H410 |
|
|
CLP00/ |
| 016-084-00-7 |
prosulfuron (ISO); 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(3,3,3-trifluoropropyl)phenylsulfonyl]urea |
94125-34-5 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
M=100: |
|
CLP00/ATP01 |
| 016-085-00-2 |
flazasulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-(3-trifluoromethyl-2-pyridylsulfonyl)urea |
104040-78-0 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 016-086-00-8 |
tetrasodium 10-amino-6,13-dichloro-3-(3-(4-(2,5-disulfonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacene-4,11-disulfonate |
109125-56-6 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 016-087-00-3 |
reaction mass of: thiobis(4,1-phenylene)-S,S,S',S'-tetraphenyldisulfonium bishexafluorophosphate; diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate; propylene carbonate |
104558-95-4 |
Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H317, H400, H410 |
|
|
CLP00/ |
| 016-088-00-9 |
4-(bis(4-(diethylamino)phenyl)methyl)benzene-1,2-dimethanesulfonic acid |
71297-11-5 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 016-089-00-4 |
reaction mass of esters of 5,5',6,6',7,7'-hexahydroxy-3,3,3',3'-tetramethyl-1,1'-spirobiindan and 2-diazo-1,2-dihydro-1-oxo-5-sulfonaphthalene |
- |
Self-react. C ****, Aquatic Chronic 4 |
H242, H413 |
|
|
CLP00/ |
| 016-090-00-X |
4-methyl-N-(methylsulfonyl)benzenesulfonamide |
14653-91-9 |
Acute Tox. 4 *, STOT SE 3, Eye Dam. 1 |
H302, H335, H318 |
|
|
CLP00/ |
| 016-091-00-5 |
C12-14-tert-alkyl ammonium 1-amino-9,10-dihydro-9,10-dioxo-4-(2,4,6-trimethylanilino)-anthracen-2-sulfonate |
- |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
CLP00/ |
| 016-092-00-0 |
reaction mass of: 4,7-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol; 4,8-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol; 5,7-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol |
- |
Repr. 1A, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361f, H315, H317, H400, H410 |
|
|
ATP01/ |
| 016-093-00-6 |
reaction mass of: 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinol-4-yl-tris(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate); 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinolbis(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate) (2:1) |
140698-96-0 |
Self-react. C ****, Carc. 2 |
H242, H351 |
|
|
CLP00/ |
| 016-094-00-1 |
sulfur |
7704-34-9 |
Skin Irrit. 2 |
H315 |
|
|
ATP01/ |
| 016-095-00-7 |
reaction mass of: reaction product of 4,4'-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:2); Reaction product of 4,4'-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydr |
- |
Self-react. C ****, Carc. 2 |
H242, H351 |
|
|
CLP00/ |
| 016-096-00-2 |
thifensulfuron-methyl (ISO); methyl 3-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl)thiophene-2-carboxylate |
79277-27-3 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=100, M=100 |
|
CLP00/ATP13 |
| 016-097-00-8 |
1-amino-2-methyl-2-propanethiol hydrochloride |
32047-53-3 |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 3 |
H302, H314, H317, H412 |
|
|
ATP01/ |
| 016-098-00-3 |
dimethyl disulphide |
624-92-0 |
Flam. Liq. 2, Acute Tox. 3, Acute Tox. 3, STOT SE 3, STOT SE 1, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H225, H331, H301, H336, H370 (upper respiratory tract) (Inhalation), H319, H317, H400, H410 |
Inhalation: ATE = 5 mg/L (Vapours), Oral: ATE = 190 mg/kg, M=1, M=10 |
|
ATP15 |
| 017-001-00-7 |
chlorine |
7782-50-5 |
Acute Tox. 3 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1 |
H331, H319, H335, H315, H400 |
M=100: |
|
CLP00/ATP01 |
| 017-002-00-2 |
hydrogen chloride |
7647-01-0 |
Press. Gas, Acute Tox. 3 *, Skin Corr. 1A |
H331, H314 |
|
U 5 |
CLP00/ |
| 017-002-01-X |
hydrochloric acid ... % |
- |
Skin Corr. 1B, STOT SE 3 |
H314, H335 |
Skin Corr. 1B; H314: C ≥ 25 %, Skin Irrit. 2; H315: 10 % ≤ C < 25 %, Eye Irrit. 2; H319: 10 % ≤ C < 25 %, STOT SE 3; H335: C ≥ 10 % |
B |
CLP00/ |
| 017-003-00-8 |
barium chlorate |
13477-00-4 |
Ox. Sol. 1, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 2 |
H271, H332, H302, H411 |
|
|
CLP00/ |
| 017-004-00-3 |
potassium chlorate |
3811-04-9 |
Ox. Sol. 1, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 2 |
H271, H332, H302, H411 |
|
|
CLP00/ |
| 017-005-00-9 |
sodium chlorate |
7775-09-9 |
Ox. Sol. 1, Acute Tox. 4 *, Aquatic Chronic 2 |
H271, H302, H411 |
|
|
CLP00/ |
| 017-006-00-4 |
perchloric acid ... % |
7601-90-3 |
Ox. Liq. 1, Skin Corr. 1A |
H271, H314 |
Skin Corr. 1A; H314: C ≥ 50 %, Skin Corr. 1B; H314: 10 % ≤ C < 50 %, Skin Irrit. 2; H315: 1 % ≤ C < 10 %, Eye Irrit. 2; H319: 1 % ≤ C < 10 %, Ox. Liq. 1; H271: C > 50 %, Ox. Liq. 2; H272: C ≤ 50 % |
B |
CLP00/ |
| 017-007-00-X |
barium perchlorate |
13465-95-7 |
Ox. Sol. 1, Acute Tox. 4 *, Acute Tox. 4 * |
H271, H332, H302 |
|
|
CLP00/ |
| 017-008-00-5 |
potassium perchlorate |
7778-74-7 |
Ox. Sol. 1, Acute Tox. 4 * |
H271, H302 |
|
|
CLP00/ |
| 017-009-00-0 |
ammonium perchlorate; [containing ≥ 80 % of 0-30 µm particles] |
7790-98-9 |
Expl. 1.1, Ox. Sol. 1 |
H201, H271 |
|
T |
CLP00/ATP01 |
| 017-009-01-8 |
ammonium perchlorate; [containing < 80 % of 0-30 µm particles] |
- |
|
|
|
|
ATP01/ |
| 017-010-00-6 |
sodium perchlorate |
7601-89-0 |
Ox. Sol. 1, Acute Tox. 4 * |
H271, H302 |
|
|
CLP00/ |
| 017-011-00-1 |
sodium hypochlorite, solution ... % Cl active |
7681-52-9 |
Skin Corr. 1B, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H318, H400, H410 |
EUH031: C ≥ 5 %, M=10, M=1 |
B |
CLP00/ATP13 |
| 017-012-00-7 |
calcium hypochlorite |
7778-54-3 |
Ox. Sol. 2, Acute Tox. 4 *, Skin Corr. 1B, Aquatic Acute 1 |
H272, H302, H314, H400 |
Skin Corr. 1B; H314: C ≥ 5 %, Skin Irrit. 2; H; 315: 1 % ≤ C < 5 %, Eye Dam. 1; H318: 3 % ≤ C < 5 %, Eye Irrit. 2; H319: 0,5 % ≤ C < 3 %, STOT SE 3; H335: C ≥ 3 %, M=10: |
T |
CLP00/ATP01 |
| 017-013-00-2 |
calcium chloride |
10043-52-4 |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 017-014-00-8 |
ammonium chloride |
12125-02-9 |
Acute Tox. 4 *, Eye Irrit. 2 |
H302, H319 |
|
|
CLP00/ |
| 017-015-00-3 |
(2-(aminomethyl)phenyl)acetylchloride hydrochloride |
61807-67-8 |
Acute Tox. 4 *, Skin Corr. 1A, Skin Sens. 1 |
H302, H314, H317 |
|
|
CLP00/ |
| 017-016-00-9 |
methyltriphenylphosphonium chloride |
1031-15-8 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 2 |
H312, H302, H315, H318, H411 |
|
|
CLP00/ |
| 017-017-00-4 |
(Z)-13-docosenyl-N,N-bis(2-hydroxyethyl)-N-methyl-ammonium-chloride |
120086-58-0 |
Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H400, H410 |
|
|
CLP00/ |
| 017-018-00-X |
N,N,N-trimethyl-2,3-bis(stearoyloxy)propylammonium chloride |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 017-019-00-5 |
(R)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-veratrylisoquinoline hydrochloride |
54417-53-7 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 017-020-00-0 |
ethyl propoxy aluminium chloride |
13014-29-4 |
Water-react. 1, Skin Corr. 1A |
H260, H314 |
|
|
CLP00/ |
| 017-021-00-6 |
behenamidopropyl-dimethyl-(dihydroxypropyl) ammonium chloride |
136920-10-0 |
Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H317, H400, H410 |
|
|
CLP00/ |
| 017-023-00-7 |
[phosphinyldynetris(oxy)] tris[3-aminopropyl-2-hydroxy-N,N-dimethyl-N-(C6-18)-alkyl] trichlorides |
197179-61-6 |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
ATP01/ |
| 017-026-00-3 |
chlorine dioxide |
10049-04-4 |
Press. Gas, Ox. Gas 1, Acute Tox. 2 *, Skin Corr. 1B, Aquatic Acute 1 |
H270, H330, H314, H400 |
M=10: |
5 |
CLP00/ATP01 |
| 017-026-01-0 |
chlorine dioxide ... % |
10049-04-4 |
Acute Tox. 3 *, Skin Corr. 1B, Aquatic Acute 1 |
H301, H314, H400 |
Skin Corr. 1B; H314: C ≥ 5 %, Skin Irrit. 2; H315: 1 % ≤ C < 5 %, Eye Dam. 1; H318: 3 % ≤ C < 5 %, Eye Irrit. 2; H319: 0,3 % ≤ C < 3 %, STOT SE 3; H335: C ≥ 3 %, M=10: |
B |
CLP00/ATP01 |
| 019-001-00-2 |
potassium |
7440-09-7 |
Water-react. 1, Skin Corr. 1B |
H260, H314 |
|
|
CLP00/ |
| 019-002-00-8 |
potassium hydroxide; caustic potash |
1310-58-3 |
Acute Tox. 4 *, Skin Corr. 1A |
H302, H314 |
Skin Corr. 1A; H314: C ≥ 5 %, Skin Corr. 1B; H314: 2 % ≤ C < 5 %, Skin Irrit. 2; H315: 0,5 % ≤ C < 2 %, Eye Irrit. 2; H319: 0,5 % ≤ C < 2 % |
|
CLP00/ |
| 019-003-00-3 |
potassium (E,E)-hexa-2,4-dienoate |
24634-61-5 |
Eye Irrit. 2 |
H319 |
|
|
ATP07 |
| 020-001-00-X |
calcium |
7440-70-2 |
Water-react. 2 |
H261 |
|
|
CLP00/ |
| 020-002-00-5 |
calcium cyanide |
592-01-8 |
Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H300, H400, H410 |
|
|
CLP00/ |
| 020-003-00-0 |
reaction mass of: dicalcium (bis(2-hydroxy-5-tetra-propenylphenylmethyl)methylamine)dihydroxide; tri-calcium (tris(2-hydroxy-5-tetra-propenylphenylmethyl)methylamine)tri-hydroxide; poly[calcium ((2-hydroxy-5-tetra-propenyl-phenylmethyl)methylamine)hydro |
- |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H319, H315, H317 |
|
|
CLP00/ |
| 022-001-00-5 |
titanium tetrachloride |
7550-45-0 |
Skin Corr. 1B |
H314 |
|
|
CLP00/ |
| 022-002-00-0 |
titanium(4+) oxalate |
- |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 022-003-00-6 |
bis(η5-cyclopentadienyl)-bis(2,6-difluoro-3-[pyrrol-1-yl]-phenyl)titanium |
125051-32-3 |
Flam. Sol. 1, Repr. 2, STOT RE 2 *, Aquatic Chronic 2 |
H228, H361f ***, H373 **, H411 |
|
T |
CLP00/ |
| 022-004-00-1 |
potassium titanium oxide (K2Ti6O13) |
12056-51-8 |
Carc. 2 |
H351 |
|
|
ATP01/ |
| 022-005-00-7 |
[N-(1,1-dimethylethyl)-1,1-dimethyl-1-[(1,2,3,4,5-η)-2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl]silanaminato(2-)-κN][(1,2,3,4-η)-1,3-pentadiene]-titanium |
169104-71-6 |
Flam. Sol. 1****, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 4 |
H228, H314, H317, H413 |
|
|
ATP01/ |
| 022-006-00-2 |
titanium dioxide; [in powder form containing 1 % or more of particles with aerodynamic diameter ≤ 10 μm] |
13463-67-7 |
Carc. 2 |
H351 (Inhalation) |
|
V W 10 |
ATP14 |
| 023-001-00-8 |
divanadium pentaoxide; vanadium pentoxide |
1314-62-1 |
Muta. 2, Carc. 1B, Repr. 2, Lact., Acute Tox. 3, Acute Tox. 2, STOT SE 3, STOT RE 1, Aquatic Chronic 2 |
H341 H350 H361fd H362 H301 H330 H335 H372 (respiratory tract, inhalation) H411 |
inhalation: ATE = 0,05 mg/L (dusts or mists) oral: ATE = 220 mg/kg bw |
|
CLP00/ATP18 |
| 024-001-00-0 |
chromium (VI) trioxide |
1333-82-0 |
Ox. Sol. 1, Carc. 1A, Muta. 1B, Repr. 2, Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1, Skin Corr. 1A, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H271, H350, H340, H361f ***, H330, H311, H301, H372 **, H314, H334, H317, H400, H410 |
STOT SE 3; H335: C ≥ 1 % |
|
CLP00/ |
| 024-002-00-6 |
potassium dichromate |
7778-50-9 |
Ox. Sol. 2, Carc. 1B, Muta. 1B, Repr. 1B, Acute Tox. 2 *, Acute Tox. 3 *, STOT RE 1, Acute Tox. 4 *, Skin Corr. 1B, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H272, H350, H340, H360FD, H330, H301, H372 **, H312, H314, H334, H317, H400, H410 |
STOT SE 3; H335: C ≥ 5 % |
3 |
CLP00/ |
| 024-003-00-1 |
ammonium dichromate |
7789-09-5 |
Ox. Sol. 2 ****, Carc. 1B, Muta. 1B, Repr. 1B, Acute Tox. 2 *, Acute Tox. 3 *, STOT RE 1, Acute Tox. 4 *, Skin Corr. 1B, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H272, H350, H340, H360FD, H330, H301, H372 **, H312, H314, H334, H317, H400, H410 |
STOT SE 3; H335: C ≥ 5 %, Resp. Sens.; H334: C ≥ 0,2 %, Skin Sens.; H317: C ≥ 0,2 % |
G 3 |
CLP00/ |
| 024-004-00-7 |
sodium dichromate |
10588-01-9 |
Ox. Sol. 2, Carc. 1B, Muta. 1B, Repr. 1B, Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 1, Skin Corr. 1B, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H272, H350, H340, H360FD, H330, H301, H312, H372**, H314, H334, H317, H400, H410 |
Resp. Sens. 1; H334: C ≥ 0,2 %, Skin Sens. 1; H317: C ≥ 0,2 %, STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ATP01 |
| 024-005-00-2 |
chromyl dichloride; chromic oxychloride |
14977-61-8 |
Ox. Liq. 1, Carc. 1B, Muta. 1B, Skin Corr. 1A, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H271, H350i, H340, H314, H317, H400, H410 |
Skin Corr. 1A; H314: C ≥ 10 %, Skin Corr. 1B; H314: 5 % ≤ C < 10 %, Skin Irrit. 2; H315: 0,5 % ≤ C < 5 %, Eye Irrit. 2; H319: 0,5 % ≤ C < 5 %, STOT SE 3; H335: 0,5 % ≤ C < 5 %, Skin Sens. 1; H317: C ≥ 0,5 % |
T 3 |
CLP00/ |
| 024-006-00-8 |
potassium chromate |
7789-00-6 |
Carc. 1B, Muta. 1B, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H340, H319, H335, H315, H317, H400, H410 |
Skin Sens. 1; H317: C ≥ 0,5 % |
3 |
CLP00/ |
| 024-007-00-3 |
zinc chromates including zinc potassium chromate |
- |
Carc. 1A, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H302, H317, H400, H410 |
|
A |
CLP00/ |
| 024-008-00-9 |
calcium chromate |
13765-19-0 |
Carc. 1B, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H302, H400, H410 |
|
|
CLP00/ |
| 024-009-00-4 |
strontium chromate |
7789-06-2 |
Carc. 1B, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H302, H400, H410 |
|
|
CLP00/ |
| 024-010-00-X |
dichromium tris(chromate); chromium III chromate; chromic chromate |
24613-89-6 |
Ox. Sol. 1, Carc. 1B, Skin Corr. 1A, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H271, H350, H314, H317, H400, H410 |
|
T |
CLP00/ |
| 024-011-00-5 |
ammonium bis(1-(3,5-dinitro-2-oxidophenylazo)-3-(N-phenylcarbamoyl)-2-naphtholato)chromate(1-) |
109125-51-1 |
Self-react. C ****, Aquatic Acute 1, Aquatic Chronic 1 |
H242, H400, H410 |
|
|
CLP00/ |
| 024-012-00-0 |
trisodium bis(7-acetamido-2-(4-nitro-2-oxidophenylazo)-3-sulphonato-1-naphtholato)chromate(1-) |
- |
Muta. 2 |
H341 |
|
|
CLP00/ |
| 024-013-00-6 |
trisodium (6-anilino-2-(5-nitro-2-oxidophenylazo)-3-sulphonato-1-naphtholato)(4-sulphonato-1,1'-azodi-2,2'naphtholato)chromate(1-) |
- |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 024-014-00-1 |
trisodium bis(2-(5-chloro-4-nitro-2-oxidophenylazo)-5-sulphonato-1-naphtholato)chromate(1-) |
93952-24-0 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
CLP00/ |
| 024-015-00-7 |
disodium (3-methyl-4-(5-nitro-2-oxidophenylazo)-1-phenylpyrazololato)(1-(3-nitro-2-oxido-5-sulfonatophenylazo)-2-naphtholato)chromate(1-) |
- |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 2 |
H332, H318, H411 |
|
|
CLP00/ |
| 024-016-00-2 |
tetradecylammonium bis(1-(5-chloro-2-oxidophenylazo)-2-naphtholato)chromate(1-) |
88377-66-6 |
STOT RE 2 *, Aquatic Chronic 4 |
H373 **, H413 |
|
|
CLP00/ |
| 024-017-00-8 |
Chromium (VI) compounds, with the exception of barium chromate and of compounds specified elsewhere in this Annex |
- |
Carc. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H317, H400, H410 |
|
A |
CLP00/ |
| 024-018-00-3 |
sodium chromate |
7775-11-3 |
Carc. 1B, Muta. 1B, Repr. 1B, Acute Tox. 2 *, Acute Tox. 3 *, STOT RE 1, Acute Tox. 4 *, Skin Corr. 1B, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H340, H360FD, H330, H301, H372 **, H312, H314, H334, H317, H400, H410 |
Resp. Sens.; H334: C ≥ 0,2 %, Skin Sens.; H317: C ≥ 0,2 % |
3 |
CLP00/ |
| 024-019-00-9 |
Main component: acetoacetic acid anilide/3-amino-1-hydroxybenzene (ATAN-MAP): trisodium {}{6-[(2 or 3 or 4)-amino-(4 or 5 or 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato}}-{}{6''-[1-(phenylcarbamoyl)ethylazo]- |
- |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 024-020-00-4 |
trisodium bis[(3'-nitro-5'-sulfonato(6-amino-2-[4-(2-hydroxy-1-naphtylazo)phenylsulfonylamino]pyrimidin-5-azo)benzene-2',4-diolato)]chromate (III) |
- |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 024-021-00-X |
potassium tetrasodium bis[(N,N'-n)-1'-(phenylcarbamoyl)-3,5-disulfonatobenzeneazo-1'-prop-1'-ene-2,2'-diolato]chromate(III) |
- |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 025-001-00-3 |
manganese dioxide |
1313-13-9 |
Acute Tox. 4 *, Acute Tox. 4 * |
H332, H302 |
|
|
CLP00/ |
| 025-002-00-9 |
potassium permanganate |
7722-64-7 |
Ox. Sol. 2, Repr. 2, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H272, H361d, H302, H400, H410 |
|
|
CLP00/ATP13 |
| 025-003-00-4 |
manganese sulphate |
7785-87-7 |
STOT RE 2 *, Aquatic Chronic 2 |
H373 **, H411 |
|
|
CLP00/ |
| 025-004-00-X |
bis(N,N',N''-trimethyl-1,4,7-triazacyclononane)-trioxo-dimanganese (IV) di(hexafluorophosphate) monohydrate |
116633-53-5 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 025-005-00-5 |
reaction mass of: tri-sodium [29H, 31H-phthalocyanine-C,C,C-trisulfonato (6-)-N29,N30,N31,N32] manganate (3-); tetrasodium [29H,31H-phthalocyanine-C,C,C,C-tetrasulfonato (6-)-N29,N30,N31,N32], manganate (3-); pentasodium [29H,31H-phthalocyanine-C,C,C,C, |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 026-001-00-6 |
(η-cumene)-(η-cyclopentadienyl)iron(II) hexafluoroantimonate |
100011-37-8 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 3 |
H302, H318, H412 |
|
|
CLP00/ |
| 026-002-00-1 |
(η-cumene)-(η-cyclopentadienyl)iron(II) trifluoromethane-sulfonate |
117549-13-0 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 026-003-00-7 |
iron (II) sulfate |
7720-78-7 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2 |
H302, H319, H315 |
|
|
ATP01/ |
| 026-003-01-4 |
iron (II) sulfate (1:1) heptahydrate; sulfuric acid, iron(II) salt (1:1), heptahydrate; ferrous sulfate heptahydrate |
7782-63-0 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2 |
H302, H319, H315 |
Skin Irrit. 2; H315: C ≥ 25 % |
|
ATP01/ |
| 026-004-00-2 |
potassium ferrite |
12160-44-0 |
Skin Corr. 1B, Skin Sens. 1 |
H314, H317 |
|
|
ATP01/ |
| 027-001-00-9 |
cobalt |
7440-48-4 |
Carc. 1B, Muta. 2, Repr. 1B, Resp. Sens. 1, Skin Sens. 1, Aquatic Chronic 4 |
H350, H341, H360F, H334, H317, H413 |
|
|
CLP00/ATP14 |
| 027-002-00-4 |
cobalt oxide |
1307-96-6 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
M=10: |
|
CLP00/ATP01 |
| 027-003-00-X |
cobalt sulfide |
1317-42-6 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
M=10: |
|
CLP00/ATP01 |
| 027-004-00-5 |
cobalt dichloride |
7646-79-9 |
Carc. 1B, Muta. 2, Repr. 1B, Acute Tox. 4 *, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360F***, H302, H334, H317, H400, H410 |
Carc. 1B; H350i: C ≥ 0,01 %, M=10: |
1 |
CLP00/ATP01 |
| 027-005-00-0 |
cobalt sulfate |
10124-43-3 |
Carc. 1B, Muta. 2, Repr. 1B, Acute Tox. 4 *, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360F***, H302, H334, H317, H400, H410 |
Carc. 1B; H350i: C ≥ 0,01 %, M=10: |
1 |
CLP00/ATP01 |
| 027-006-00-6 |
cobalt acetate |
71-48-7 |
Carc. 1B, Muta. 2, Repr. 1B, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360F***, H334, H317, H400, H410 |
Carc. 1B; H350i: C ≥ 0,01 %, M=10: |
1 |
ATP01/ |
| 027-007-00-1 |
zinc hexacyanocobaltate(III), tertiary butyl alcohol/polypropylene glycol complex |
- |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
ATP01/ |
| 027-008-00-7 |
complex of cobalt(III)-bis(N-phenyl-4-(5-ethylsulfonyl-2-hydroxyphenylazo)-3-hydroxynaphthylamide), hydrated (n H2O, 2<n<3) |
- |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 027-009-00-2 |
cobalt nitrate |
10141-05-6 |
Carc. 1B, Muta. 2, Repr. 1B, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360F***, H334, H317, H400, H410 |
Carc. 1B; H350i: C ≥ 0,01 %, M=10: |
1 |
ATP01/ |
| 027-010-00-8 |
cobalt carbonate |
513-79-1 |
Carc. 1B, Muta. 2, Repr. 1B, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360F***, H334, H317, H400, H410 |
Carc. 1B; H350i: C ≥ 0,01 %, M=10: |
1 |
ATP01/ |
| 028-001-00-1 |
tetracarbonylnickel; nickel tetracarbonyl |
13463-39-3 |
Flam. Liq. 2, Carc. 2, Repr. 1B, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H225, H351, H360D ***, H330, H400, H410 |
|
|
CLP00/ |
| 028-002-00-7 |
nickel |
7440-02-0 |
Carc. 2, STOT RE 1, Skin Sens. 1 |
H351, H372**, H317 |
|
S 7 |
CLP00/ATP01 |
| 028-002-01-4 |
nickel powder; [particle diameter < 1 mm] |
7440-02-0 |
Carc. 2, STOT RE 1, Skin Sens. 1, Aquatic Chronic 3 |
H351, H372**, H317, H412 |
|
|
ATP01/ |
| 028-003-00-2 |
nickel monoxide; [1] nickel oxide; [2] bunsenite [3] |
1313-99-1 [1], 11099-02-8 [2], 34492-97-2 [3] |
Carc. 1A, STOT RE 1, Skin Sens. 1, Aquatic Chronic 4 |
H350i, H372**, H317, H413 |
|
|
CLP00/ATP01 |
| 028-004-00-8 |
nickel dioxide |
12035-36-8 |
Carc. 1A, STOT RE 1, Skin Sens. 1, Aquatic Chronic 4 |
H350i, H372**, H317, H413 |
|
|
CLP00/ATP01 |
| 028-005-00-3 |
dinickel trioxide |
1314-06-3 |
Carc. 1A, STOT RE 1, Skin Sens. 1, Aquatic Chronic 4 |
H350i, H372**, H317, H413 |
|
|
CLP00/ATP01 |
| 028-006-00-9 |
nickel (II) sulfide; [1] nickel sulfide; [2] millerite [3] |
16812-54-7 [1], 11113-75-0 [2], 1314-04-1 [3], - |
Carc. 1A, Muta. 2, STOT RE 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H372**, H317, H400, H410 |
|
|
CLP00/ATP01 |
| 028-007-00-4 |
trinickel disulfide; nickel subsulfide; [1] heazlewoodite [2] |
12035-72-2 [1], 12035-71-1 [2] |
Carc. 1A,
Muta. 2,
Acute Tox. 3,
STOT RE 1,
Skin Sens. 1,
Aquatic Acute 1,
Aquatic Chronic 1 |
H350i,
H341,
H331,
H372 **,
H317,
H400,
H410 |
Inhalation: ATE = 0.92 mg/L (dusts/mists) |
|
CLP00/ATP01/ATP17 |
| 028-008-00-X |
nickel dihydroxide; [1] nickel hydroxide [2] |
12054-48-7 [1], 11113-74-9 [2] |
Carc. 1A, Repr. 1B, Muta. 2, STOT RE 1, Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H360D***, H341, H372**, H332, H302, H315, H334, H317, H400, H410 |
|
|
CLP00/ATP01 |
| 028-009-00-5 |
nickel sulfate |
7786-81-4 |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H332, H302, H315, H334, H317, H400, H410 |
STOT RE 1; H373: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Irrit. 2; H315: C ≥ 20 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
CLP00/ATP01 |
| 028-010-00-0 |
nickel carbonate; basic nickel carbonate; carbonic acid, nickel (2+) salt; [1] carbonic acid, nickel salt; [2] [µ-[carbonato(2-)-O:O’]] dihydroxy trinickel; [3] [carbonato(2-)] tetrahydroxytrinickel [4] |
3333-67-3 [1], 16337-84-1 [2], 65405-96-1 [3], 12607-70-4 [4] |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H332, H302, H315, H334, H317, H400, H410 |
|
|
CLP00/ATP01 |
| 028-011-00-6 |
nickel dichloride |
7718-54-9 |
Carc. 1A, Muta. 2, Repr. 1B, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1, Skin Irrit. 2, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H331, H301, H372**, H315, H334, H317, H400, H410 |
STOT RE. 1; H373: C ≥ 1 %, STOT RE. 2; H373: 0,1 % < C < 1 %, Skin Irrit. 2; H315: C ≥ 20 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
ATP01/ |
| 028-012-00-1 |
nickel dinitrate; [1] nitric acid, nickel salt [2] |
13138-45-9 [1], 14216-75-2 [2] |
Ox. Sol. 2, Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H272, H350i, H341, H360D***, H372**, H332, H302, H318, H315, H317, H400, H410 |
STOT RE. 1; H373: C ≥ 1 %, STOT RE. 2; H373: 0,1 % < C < 1 %, Skin Irrit. 2; H315: C ≥ 20 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
ATP01/ |
| 028-013-00-7 |
nickel matte |
69012-50-6 |
Carc. 1A, STOT RE 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-014-00-2 |
slimes and sludges, copper electrolytic refining, decopperised, nickel sulfate |
92129-57-2 |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H332, H302, H315, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
ATP01/ |
| 028-015-00-8 |
slimes and sludges, copper electrolyte refining, decopperised |
94551-87-8 |
Carc. 1A, Muta. 2, Repr. 1A, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H334, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-016-00-3 |
nickel diperchlorate; perchloric acid, nickel(II) salt |
13637-71-3 |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Skin Corr. 1B, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H314, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
CLP00/ATP02 |
| 028-017-00-9 |
nickel dipotassium bis(sulfate); [1] diammonium nickel bis(sulfate) [2] |
13842-46-1 [1], 15699-18-0 [2] |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Acute Tox. 4 *, Acute Tox. 4 *, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H332, H302, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
CLP00/ATP02 |
| 028-018-00-4 |
nickel bis(sulfamidate); nickel sulfamate |
13770-89-3 |
Carc. 1A, Muta. 2, Repr. 1B, Acute Tox. 4, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D ***, H302, H372 **, H334, H317, H400, H410 |
Oral: ATE = 853 mg/kg bw (anhydrate), Oral: ATE = 1098 mg/kg bw (tetrahydrate), STOT RE 1; H372: C ≥ 1 %
STOT RE 2; H373: ,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ ,01 %, M=1
|
|
ATP01/ATP14 |
| 028-019-00-X |
nickel bis(tetrafluoroborate) |
14708-14-6 |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
CLP00/ATP02 |
| 028-021-00-0 |
nickel diformate; [1] formic acid, nickel salt; [2] formic acid, copper nickel salt [3] |
3349-06-2 [1], 15843-02-4 [2], 68134-59-8 [3] |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
CLP00/ATP02 |
| 028-022-00-6 |
nickel di(acetate); [1] nickel acetate [2] |
373-02-4 [1], 14998-37-9 [2] |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Acute Tox. 4 *, Acute Tox. 4 *, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H332, H302, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
E H |
ATP01/ |
| 028-024-00-7 |
nickel dibenzoate |
553-71-9 |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
CLP00/ATP02 |
| 028-025-00-2 |
nickel bis(4-cyclohexylbutyrate) |
3906-55-6 |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
ATP01/ |
| 028-026-00-8 |
nickel(II) stearate; nickel(II) octadecanoate |
2223-95-2 |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
CLP00/ATP02 |
| 028-027-00-3 |
nickel dilactate |
16039-61-5 |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
CLP00/ATP02 |
| 028-028-00-9 |
nickel(II) octanoate |
4995-91-9 |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Skin Corr. 1A, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H314, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
CLP00/ATP02 |
| 028-029-00-4 |
nickel difluoride; [1] nickel dibromide; [2] nickel diiodide; [3] nickel potassium fluoride [4] |
10028-18-9 [1], 13462-88-9 [2], 13462-90-3 [3], 11132-10-8 [4] |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
CLP00/ATP02 |
| 028-030-00-X |
nickel hexafluorosilicate |
26043-11-8 |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
CLP00/ATP02 |
| 028-031-00-5 |
nickel selenate |
15060-62-5 |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
CLP00/ATP02 |
| 028-032-00-0 |
nickel hydrogen phosphate; [1] nickel bis(dihydrogen phosphate); [2] trinickel bis(orthophosphate); [3] dinickel diphosphate; [4] nickel bis(phosphinate); [5] nickel phosphinate; [6] phosphoric acid, calcium nickel salt; [7] diphosphoric acid, nick |
14332-34-4 [1], 18718-11-1 [2], 10381-36-9 [3], 14448-18-1 [4], 14507-36-9 [5], 36026-88-7 [6], 17169-61-8 [7], 19372-20-4 [8] |
Carc. 1A, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H334, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-033-00-6 |
diammonium nickel hexacyanoferrate |
74195-78-1 |
Carc. 1A, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H334, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-034-00-1 |
nickel dicyanide |
557-19-7 |
Carc. 1A, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H334, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-035-00-7 |
nickel chromate |
14721-18-7 |
Carc. 1A, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H334, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-036-00-2 |
nickel(II) silicate; [1] dinickel orthosilicate; [2] nickel silicate (3:4); [3] silicic acid, nickel salt; [4] trihydrogen hydroxybis[orthosilicato(4-)]trinickelate(3-) [5] |
21784-78-1 [1], 13775-54-7 [2], 31748-25-1 [3], 37321-15-6 [4], 12519-85-6 [5] |
Carc. 1A, STOT RE 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-037-00-8 |
dinickel hexacyanoferrate |
14874-78-3 |
Carc. 1A, STOT RE 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-038-00-3 |
trinickel bis(arsenate); nickel(II) arsenate |
13477-70-8 |
Carc. 1A, STOT RE 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H372**, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-039-00-9 |
nickel oxalate; [1] oxalic acid, nickel salt [2] |
547-67-1 [1], 20543-06-0 [2] |
Carc. 1A, STOT RE 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-040-00-4 |
nickel telluride |
12142-88-0 |
Carc. 1A, STOT RE 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-041-00-X |
trinickel tetrasulfide |
12137-12-1 |
Carc. 1A, STOT RE 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-042-00-5 |
trinickel bis(arsenite) |
74646-29-0 |
Carc. 1A, STOT RE 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-043-00-0 |
cobalt nickel gray periclase; C.I. Pigment Black 25; C.I. 77332; [1] cobalt nickel dioxide; [2] cobalt nickel oxide [3] |
68186-89-0 [1], 58591-45-0 [2], 12737-30-3 [3] |
Carc. 1A, STOT RE 1, Skin Sens. 1 |
H350i, H372**, H317 |
|
|
CLP00/ATP02 |
| 028-044-00-6 |
nickel tin trioxide; nickel stannate |
12035-38-0 |
Carc. 1A, STOT RE 1, Skin Sens. 1 |
H350i, H372**, H317 |
|
|
CLP00/ATP02 |
| 028-045-00-1 |
nickel triuranium decaoxide |
15780-33-3 |
Carc. 1A, STOT RE 1, Skin Sens. 1 |
H350i, H372**, H317 |
|
|
CLP00/ATP02 |
| 028-046-00-7 |
nickel dithiocyanate |
13689-92-4 |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
CLP00/ATP02 |
| 028-047-00-2 |
nickel dichromate |
15586-38-6 |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
CLP00/ATP02 |
| 028-048-00-8 |
nickel(II) selenite |
10101-96-9 |
Carc. 1A, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H334, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-049-00-3 |
nickel selenide |
1314-05-2 |
Carc. 1A, STOT RE 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-050-00-9 |
silicic acid, lead nickel salt |
68130-19-8 |
Carc. 1A, Repr. 1A, STOT RE 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H360Df, H372**, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-051-00-4 |
nickel diarsenide; [1] nickel arsenide [2] |
12068-61-0 [1], 27016-75-7 [2] |
Carc. 1A, STOT RE 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-052-00-X |
nickel barium titanium primrose priderite; C.I. Pigment Yellow 157; C.I. 77900 |
68610-24-2 |
Carc. 1A, STOT RE 1, Skin Sens. 1 |
H350i, H372**, H317 |
|
|
CLP00/ATP02 |
| 028-053-00-5 |
nickel dichlorate; [1] nickel dibromate; [2] ethyl hydrogen sulfate, nickel(II) salt [3] |
67952-43-6 [1], 14550-87-9 [2], 71720-48-4 [3] |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %1, M=1: |
|
CLP00/ATP02 |
| 028-054-00-0 |
nickel(II) trifluoroacetate; [1] nickel(II) propionate; [2] nickel bis(benzenesulfonate); [3] nickel(II) hydrogen citrate; [4] citric acid, ammonium nickel salt; [5] citric acid, nickel salt; [6] nickel bis(2-ethylhexanoate); [7] 2-ethylhexanoic ac |
16083-14-0 [1], 3349-08-4 [2], 39819-65-3 [3], 18721-51-2 [4], 18283-82-4 [5], 22605-92-1 [6], 4454-16-4 [7], 7580-31-6 [8], 93983-68-7 [9], 29317-63-3 [10], 27637-46-3 [11], 84852-37-9 [12], 93920-10-6 [13], 85508-43-6 [14], 85508-44-7 [15], 51818-56-5 [ |
Carc. 1A, Muta. 2, Repr. 1B, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H341, H360D***, H372**, H334, H317, H400, H410 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,1 % ≤ C < 1 %, Skin Sens. 1; H317: C ≥ 0,01 %, M=1: |
|
CLP00/ATP02 |
| 028-055-00-6 |
nickel(II) sulfite; [1] nickel tellurium trioxide; [2] nickel tellurium tetraoxide; [3] molybdenum nickel hydroxide oxide phosphate [4] |
7757-95-1 [1], 15851-52-2 [2], 15852-21-8 [3], 68130-36-9 [4] |
Carc. 1A, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H334, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-056-00-1 |
nickel boride (NiB); [1] dinickel boride; [2] trinickel boride; [3] nickel boride; [4] dinickel silicide; [5] nickel disilicide; [6] dinickel phosphide; [7] nickel boron phosphide [8] |
12007-00-0 [1], 12007-01-1 [2], 12007-02-2 [3], 12619-90-8 [4], 12059-14-2 [5], 12201-89-7 [6], 12035-64-2 [7], 65229-23-4 [8] |
Carc. 1A, STOT RE 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H372**, H317, H400, H410 |
|
|
CLP00/ATP02 |
| 028-057-00-7 |
dialuminium nickel tetraoxide; [1] nickel titanium trioxide; [2] nickel titanium oxide; [3] nickel divanadium hexaoxide; [4] cobalt dimolybdenum nickel octaoxide; [5] nickel zirkonium trioxide; [6] molybdenum nickel tetraoxide; [7] nickel tungsten |
12004-35-2 [1], 12035-39-1 [2], 12653-76-8 [3], 52502-12-2 [4], 68016-03-5 [5], 70692-93-2 [6], 14177-55-0 [7], 14177-51-6 [8], 68515-84-4 [9], 12031-65-1 [10], 12673-58-4 [11] |
Carc. 1A, STOT RE 1, Skin Sens. 1 |
H350i, H372**, H317 |
|
|
CLP00/ATP02 |
| 028-058-00-2 |
cobalt lithium nickel oxide |
- |
Carc. 1A, Acute Tox. 2 *, STOT RE 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350i, H330, H372**, H317, H400, H410 |
|
|
ATP01/ |
| 029-001-00-4 |
copper chloride; copper (I) chloride; cuprous chloride |
7758-89-6 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 029-002-00-X |
dicopper oxide; copper (I) oxide |
1317-39-1 |
Acute Tox. 4
Acute Tox. 4,
Eye Dam. 1,
Aquatic Acute 1,
Aquatic Chronic 1 |
H332,
H302,
H318,
H400,
H410 |
Inhalation: ATE = 3.34 mg/L (dusts/mists),
Oral: ATE = 500 mg/kg bw,
M=100,
M=10 |
|
CLP00/ATP09/ATP17 |
| 029-003-00-5 |
Naphthenic acids, copper salts; copper naphthenate |
1338-02-9 |
Flam. Liq. 3, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H226, H302, H400, H410 |
|
|
CLP00/ |
| 029-004-00-0 |
copper sulphate |
7758-98-7 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H315, H400, H410 |
|
|
CLP00/ |
| 029-005-00-6 |
(tris(chloromethyl)phthalocyaninato)copper(II), reaction products with N-methylpiperazine and methoxyacetic acid |
- |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 029-006-00-1 |
tris(octadec-9-enylammonium) (trisulfonatophthalocyaninato)copper(II) |
- |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 029-007-00-7 |
(trisodium (2-((3-(6-(2-chloro-5-sulfonato)anilino)-4-(3-carboxypyridinio)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)phenylmethylazo)-4-sulfonatobenzoato)copper(3-)) hydroxide |
89797-01-3 |
Skin Sens. 1 |
H317 |
|
G |
CLP00/ |
| 029-008-00-2 |
copper(II) methanesulfonate |
54253-62-2 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H318, H400, H410 |
|
|
CLP00/ |
| 029-009-00-8 |
phthalocyanine-N-[3-(diethylamino)propyl]sulfonamide copper complex |
93971-95-0 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 029-010-00-3 |
reaction mass of compounds from (dodecakis(p-tolylthio)phthalocyaninato)copper(II) to (hexadecakis(p-tolylthio)phthalocyaninato)copper(II) |
101408-30-4 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 029-011-00-9 |
sodium [29H,31H-phthalocyaninato-(2-)-N29,N30,N31,N32]-((3-(N-methyl-N-(2-hydroxyethyl)amino)propyl)amino)sulfonyl-sulfonato, copper complex |
150522-10-4 |
Skin Corr. 1B |
H314 |
|
|
CLP00/ |
| 029-012-00-4 |
sodium ((N-(3-trimethylammoniopropyl)sulfamoyl)methylsulfonatophthalocyaninato)copper(II) |
124719-24-0 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 029-013-00-X |
trisodium(2-(α-(3-(4-chloro-6-(2-(2-(vinylsulfonyl)ethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)benzylidenehydrazino)-4-sulfonatobenzoato)copper(II) |
130201-51-3 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ATP01 |
| 029-014-00-5 |
reaction mass of: 2,2'-[[cis-1,2-cyclohexanediylbis(nitrilomethylidene)]bis[phenolate]](2-)N,N',O,O'-copper complex; 2,2'-[[trans-1,2-cyclohexanediylbis(nitrilomethylidyne)]bis[phenolate]](2-)N,N',O,O'-copper complex |
171866-24-3 |
STOT RE 2 *, Aquatic Chronic 2 |
H373**, H411 |
|
|
ATP01/ |
| 029-015-00-0 |
copper thiocyanate |
1111-67-7 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=10,
M=10 |
|
ATP09/ATP17 |
| 029-016-00-6 |
copper(II) oxide |
1317-38-0 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=100,
M=10 |
|
ATP09/ATP17 |
| 029-017-00-1 |
dicopper chloride trihydroxide |
1332-65-6 |
Acute Tox. 3,
Acute Tox. 4,
Aquatic Acute 1,
Aquatic Chronic 1 |
H301,
H332,
H400,
H410 |
Oral: ATE = 299 mg/kg bw, Inhalation: ATE = 2.83 mg/L (dusts/mists), M=10, M=10 |
|
ATP09/ATP17 |
| 029-018-00-7 |
tetracopper hexahydroxide sulphate [1] tetracopper hexahydroxide sulphate hydrate [2] |
1333-22-8 [1] 12527-76-3 [2] |
Acute Tox. 4, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
Oral: ATE = 500 mg/kg bw, M=10, M=10 |
|
ATP09/ATP17 |
| 029-019-01-X |
copper flakes (coated with aliphatic acid) |
|
Acute Tox. 3,
Acute Tox. 4,
Eye Irrit. 2,
Aquatic Acute 1,
Aquatic Chronic 1 |
H331,
H302,
H319,
H400,
H410 |
Inhalation: ATE = 0.733 mg/L (dusts/mists),
Oral: ATE = 500 mg/kg bw,
M=10,
M=10 |
|
ATP09/ATP17 |
| 029-020-00-8 |
copper(II) carbonate--copper(II) hydroxide (1:1) |
12069-69-1 |
Acute Tox. 4, Acute Tox. 4, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H302, H319, H400, H410 |
Inhalation: ATE = 1.2 mg/L (dusts/mists),
Oral: ATE = 500 mg/kg bw,
M=10,
M=10 |
|
ATP09/ATP17 |
| 029-021-00-3 |
copper dihydroxide; copper(II) hydroxide |
20427-59-2 |
Acute Tox. 2, Acute Tox. 4, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H302, H318 , H400, H410 |
Inhalation: ATE = 0.47 mg/L (dusts/mists),
Oral: ATE = 500 mg/kg bw,
M=10,
M=10 |
|
ATP09/ATP17 |
| 029-022-00-9 |
bordeaux mixture; reaction products of copper sulphate with calcium dihydroxide |
8011-63-0 |
Acute Tox. 4, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H318, H400, H410 |
Inhalation: ATE = 1.97 mg/L (dusts/mists),
M=10,
M=1 |
|
ATP09/ATP17 |
| 029-023-00-4 |
copper sulphate pentahydrate |
7758-99-8 |
Acute Tox. 4, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H318, H400, H410 |
Oral: ATE = 481 mg/kg bw,
M=10,
M=1 |
|
ATP09/ATP17 |
| 029-024-00-X |
granulated copper; [particle length: from 0,9 mm to 6,0 mm; particle width: from 0,494 to 0,949 mm] |
7440-50-8 |
Aquatic Chronic 2 |
H411 |
|
|
ATP15 |
| 029-025-00-5 |
bis(N-hydroxy-N-nitrosocyclohexylaminato-O,O’)copper; bis(N-cyclohexyl-diazenium-dioxy)-copper; [Cu-HDO] |
312600-89-8 |
Flam. Sol. 1, Acute Tox. 4, STOT RE 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H228, H302, H373 (liver), H318, H400, H410 |
Oral: ATE = 360 mg/kg, M=1, M=1 |
|
ATP15 |
| 030-001-00-1 |
zinc powder - zinc dust (pyrophoric) |
7440-66-6 |
Water-react. 1, Pyr. Sol. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H260, H250, H400, H410 |
|
T |
CLP00/ |
| 030-001-01-9 |
zinc powder - zinc dust (stabilised) |
7440-66-6 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 030-003-00-2 |
zinc chloride |
7646-85-7 |
Acute Tox. 4 *, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H314, H400, H410 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 030-004-00-8 |
dimethylzinc; [1] diethylzinc [2] |
544-97-8 [1], 557-20-0 [2] |
Pyr. Liq. 1, Water-react. 1, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H250, H260, H314, H400, H410 |
|
|
CLP00/ |
| 030-005-00-3 |
diamminediisocyanatozinc |
- |
Acute Tox. 4 *, Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1 |
H302, H318, H334, H317, H400 |
|
|
CLP00/ |
| 030-006-00-9 |
zinc sulphate (hydrous) (mono-, hexa- and hepta hydrate); [1] zinc sulphate (anhydrous) [2] |
7446-19-7 [1], 7733-02-0 [2] |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H318, H400, H410 |
|
|
CLP00/ |
| 030-007-00-4 |
bis(3,5-di-tert-butylsalicylato-O1,O2)zinc |
42405-40-3 |
Flam. Sol. 1, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H228, H302, H400, H410 |
|
T |
CLP00/ |
| 030-008-00-X |
hydroxo(2-(benzenesulfonamido)benzoato)zinc(II) |
113036-91-2 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H332, H411 |
|
|
CLP00/ |
| 030-009-00-5 |
zinc-bis(4-(n-octyloxycarbonylamino)salicylate) dihydrate |
- |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
ATP01/ |
| 030-010-00-0 |
2-dodec-1-enylbutanedioic acid, 4-methyl ester zinc salt |
- |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 030-011-00-6 |
trizinc bis(orthophosphate) |
7779-90-0 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 030-012-00-1 |
aluminium-magnesium-zinc-carbonate-hydroxide |
169314-88-9 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 030-013-00-7 |
zinc oxide |
1314-13-2 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 030-015-00-8 |
tetrazinc(2+)bis(hexacyanocobalt(3+))diacetate |
- |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 031-001-00-4 |
gallium arsenide |
1303-00-0 |
Repr. 1B, Carc. 1B, STOT RE 1 |
H360F, H350, H372 (respiratory and haematopoietic systems) |
|
|
ATP07 |
| 033-001-00-X |
arsenic |
7440-38-2 |
Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H301, H400, H410 |
|
|
CLP00/ |
| 033-002-00-5 |
arsenic compounds, with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H301, H400, H410 |
* |
A 1 |
CLP00/ |
| 033-003-00-0 |
diarsenic trioxide; arsenic trioxide |
1327-53-3 |
Carc. 1A, Acute Tox. 2 *, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H300, H314, H400, H410 |
|
|
CLP00/ |
| 033-004-00-6 |
diarsenic pentaoxide; arsenic pentoxide; arsenic oxide |
1303-28-2 |
Carc. 1A, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H331, H301, H400, H410 |
|
|
CLP00/ |
| 033-005-00-1 |
arsenic acid and its salts with the exception of those specified elsewhere in this Annex |
- |
Carc. 1A, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H331, H301, H400, H410 |
|
A |
CLP00/ATP01 |
| 033-006-00-7 |
arsine |
7784-42-1 |
Flam. Gas 1, Press. Gas, Acute Tox. 2 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H220, H330, H373 **, H400, H410 |
|
U |
CLP00/ |
| 033-007-00-2 |
tert-butylarsine |
4262-43-5 |
Pyr. Liq. 1, Acute Tox. 2 * |
H250, H330 |
|
|
CLP00/ |
| 034-001-00-2 |
selenium |
7782-49-2 |
Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 4 |
H331, H301, H373 **, H413 |
|
|
CLP00/ |
| 034-002-00-8 |
selenium compounds with the exception of cadmium sulphoselenide and those specified elsewhere in this Annex |
- |
Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H301, H373**, H400, H410 |
|
A |
CLP00/ATP01 |
| 034-003-00-3 |
sodium selenite |
10102-18-8 |
Acute Tox. 2 *, Acute Tox. 3 *, Skin Sens. 1, Aquatic Chronic 2 |
H300, H331, H317, H411 |
|
|
CLP00/ |
| 035-001-00-5 |
bromine |
7726-95-6 |
Acute Tox. 2 *, Skin Corr. 1A, Aquatic Acute 1 |
H330, H314, H400 |
|
|
CLP00/ |
| 035-002-00-0 |
hydrogen bromide |
10035-10-6 |
Press. Gas, Skin Corr. 1A, STOT SE 3 |
H314, H335 |
|
U |
CLP00/ |
| 035-002-01-8 |
hydrobromic acid ... % |
- |
Skin Corr. 1B, STOT SE 3 |
H314, H335 |
Skin Corr. 1B; H314: C ≥ 40 %, Skin Irrit. 2; H315: 10 % ≤ C < 40 %, Eye Irrit. 2; H319: 10 % ≤ C < 40 %, STOT SE 3; H335: C ≥ 10 % |
B |
CLP00/ |
| 035-003-00-6 |
potassium bromate |
7758-01-2 |
Ox. Sol. 1, Carc. 1B, Acute Tox. 3 * |
H271, H350, H301 |
|
|
CLP00/ |
| 035-004-00-1 |
2-hydroxyethylammonium perbromide |
- |
Ox. Sol. 2 ****, Acute Tox. 4 *, Skin Corr. 1A, Skin Sens. 1, Aquatic Acute 1 |
H272, H302, H314, H317, H400 |
|
|
CLP00/ |
| 035-005-00-7 |
ammonium bromide |
12124-97-9 |
Repr. 1B, Lact., STOT SE 3, STOT RE 1, Eye Irrit. 2 |
H360FD, H362, H336, H372 (nervous system), H319 |
|
|
ATP18 |
| 040-001-00-3 |
zirconium powder (pyrophoric) |
7440-67-7 |
Water-react. 1, Pyr. Sol. 1 |
H260, H250 |
|
T |
CLP00/ |
| 040-002-00-9 |
zirconium powder (non pyrophoric) |
- |
Self-heat. 1 |
H251 |
|
T |
CLP00/ |
| 040-003-00-4 |
reaction product of 3,5-di-tert-butylsalicylic acid and zirconium oxychloride, dehydrated, basic Zr : DTBS = 1.0 : 1.0 to 1.0 : 1.5 |
226996-19-6 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 042-001-00-9 |
molybdenum trioxide |
1313-27-5 |
Carc. 2, Eye Irrit. 2, STOT SE 3 |
H351, H319, H335 |
|
|
CLP00/ATP01 |
| 042-002-00-4 |
tetrakis(dimethylditetradecylammonium) hexa-μ-oxotetra-μ3-oxodi-μ5-oxotetradecaoxooctamolybdate(4-) |
117342-25-3 |
Acute Tox. 3 *, Eye Dam. 1 |
H331, H318 |
|
|
CLP00/ATP01 |
| 042-003-00-X |
tetrakis(trimethylhexadecylammonium) hexa-mu-oxotetra-mu3-oxodi-mu5-oxotetradecaoxooctamolybdate(4-) |
116810-46-9 |
Flam. Sol. 1, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H228, H318, H400, H410 |
|
T |
CLP00/ |
| 042-004-00-5 |
Reaction product of ammonium molybdate and C12-C24-diethoxylated alkylamine (1:5-1:3) |
- |
Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H315, H317, H411 |
|
|
CLP00/ |
| 042-005-00-0 |
reaction mass of: mono- and di-glycerols of canola oil; canola oil acid amide of branched 1,3-propanediamine,N-[3-(tridecyloxy)-propyl]; N,N-diorgano dithiocarbamate molybdenum complex |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 046-001-00-X |
tetraammine palladium (II) hydrogen carbonate |
134620-00-1 |
Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373**, H318, H317, H400, H410 |
|
|
ATP01/ |
| 047-001-00-2 |
silver nitrate |
7761-88-8 |
Ox. Sol. 2, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H272, H314, H400, H410 |
|
|
CLP00/ATP01 |
| 047-002-00-8 |
polyphosphoric acid, copper, sodium, magnesium, calcium, silver and zinc salt |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 047-003-00-3 |
silver zinc zeolite |
130328-20-0 |
Repr. 2, Skin Irrit. 2, Eye, Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361d, H315, H318, H400, H410 |
M=100, M=100 |
|
ATP10 |
| 048-001-00-5 |
cadmium compounds, with the exception of cadmium sulphoselenide (xCdS.yCdSe), reaction mass of cadmium sulphide with zinc sulphide (xCdS.yZnS), reaction mass of cadmium sulphide with mercury sulphide (xCdS.yHgS), and those specified elsewhere in this Annex |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H312, H302, H400, H410 |
* |
A 1 |
CLP00/ |
| 048-002-00-0 |
cadmium (non-pyrophoric); [1] cadmium oxide (non-pyrophoric) [2] |
7440-43-9 [1], 1306-19-0 [2] |
Carc. 1B, Muta. 2, Repr. 2, Acute Tox. 2 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H341, H361fd, H330, H372 **, H400, H410 |
|
|
CLP00/ |
| 048-003-00-6 |
cadmium diformate; cadmiumformate |
4464-23-7 |
Acute Tox. 3 *, Acute Tox. 3 *, Carc. 2, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H301, H351, H373 **, H400, H410 |
*, STOT RE 2; H373: C ≥ 0,25 % |
|
CLP00/ |
| 048-004-00-1 |
cadmium cyanide |
542-83-6 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Carc. 2, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H310, H300, H351, H373 **, H400, H410 |
STOT RE 2; H373: C ≥ 0,1 %, EUH032: C ≥ 1 % |
|
CLP00/ |
| 048-005-00-7 |
cadmiumhexafluorosilicate(2-); cadmium fluorosilica |
17010-21-8 |
Acute Tox. 3 *, Acute Tox. 3 *, Carc. 2, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H301, H351, H373 **, H400, H410 |
*, STOT RE 2; H373: C ≥ 0,1 % |
|
CLP00/ |
| 048-006-00-2 |
cadmium fluoride |
7790-79-6 |
Carc. 1B, Muta. 1B, Repr. 1B, Acute Tox. 2 *, Acute Tox. 3 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H340, H360FD, H330, H301, H372 **, H400, H410 |
Carc. 1B; H350: C ≥ 0,01 %, * oral, STOT RE 1; H372: C ≥ 7 %, STOT RE 2: 0,1 % ≤ C < 7 % |
|
CLP00/ |
| 048-007-00-8 |
cadmium iodide |
7790-80-9 |
Acute Tox. 3 *, Acute Tox. 3 *, Carc. 2, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H301, H351, H373 **, H400, H410 |
*, STOT RE 2; H373: C ≥ 0,1 % |
|
CLP00/ |
| 048-008-00-3 |
cadmium chloride |
10108-64-2 |
Carc. 1B, Muta. 1B, Repr. 1B, Acute Tox. 2 *, Acute Tox. 3 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H340, H360FD, H330, H301, H372 **, H400, H410 |
Carc. 1B; H350: C ≥ 0,01 %, * oral, STOT RE 1; H372: C ≥ 7 %, STOT RE 2; H373: 0,1 % ≤ C < 7 % |
|
CLP00/ |
| 048-009-00-9 |
cadmium sulphate |
10124-36-4 |
Carc. 1B, Muta. 1B, Repr. 1B, Acute Tox. 2 *, Acute Tox. 3 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H340, H360FD, H330, H301, H372 **, H400, H410 |
Carc. 1B; H350: C ≥ 0,01 %, * oral, STOT RE 1; H372: C ≥ 7 %, STOT RE 2; H373: 0,1 % ≤ C < 7 % |
|
CLP00/ |
| 048-010-00-4 |
cadmium sulphide |
1306-23-6 |
Carc. 1B, Muta. 2, Repr. 2, STOT RE 1, Acute Tox. 4 *, Aquatic Chronic 4 |
H350, H341, H361fd, H372 **, H302, H413 |
*, STOT RE 1; H372: C ≥ 10 %, STOT RE 2; H373: 0,1 % ≤ C < 10 % |
1 |
CLP00/ |
| 048-011-00-X |
cadmium (pyrophoric) |
7440-43-9 |
Pyr. Sol. 1, Carc. 1B, Muta. 2, Repr. 2, Acute Tox. 2 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H250, H350, H341, H361fd, H330, H372 **, H400, H410 |
|
|
CLP00/ |
| 048-012-00-5 |
cadmium carbonate |
513-78-0 |
Carc. 1B, Muta. 1B, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H340, H332, H312, H302, H372 (kidney, bone), H400, H410 |
|
A 1 |
ATP10 |
| 048-013-00-0 |
cadmium hydroxide; cadmium dihydroxide |
21041-95-2 |
Carc. 1B, Muta. 1B, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H340, H332, H312, H302, H372 (kidney, bone), H400, H410 |
|
A 1 |
ATP10 |
| 048-014-00-6 |
cadmium nitrate; cadmium dinitrate |
10325-94-7 |
Carc. 1B, Muta. 1B, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H340, H332, H312, H302, H372 (kidney, bone), H400, H410 |
Carc. 1B; H350: C ≥ 0,01 % |
A 1 |
ATP10 |
| 050-001-00-5 |
tin tetrachloride; stannic chloride |
7646-78-8 |
Skin Corr. 1B, Aquatic Chronic 3 |
H314, H412 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 050-002-00-0 |
cyhexatin (ISO); hydroxytricyclohexylstannane; tri(cyclohexyl)tin hydroxide |
13121-70-5 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H312, H302, H400, H410 |
M=1000: |
|
CLP00/ATP01 |
| 050-003-00-6 |
fentin acetate (ISO); triphenyltin acetate |
900-95-8 |
Carc. 2, Repr. 2, Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H361d***, H330, H311, H301, H372**, H335, H315, H318, H400, H410 |
M=10: |
|
CLP00/ATP01 |
| 050-004-00-1 |
fentin hydroxide (ISO); triphenyltin hydroxide |
76-87-9 |
Carc. 2, Repr. 2, Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H361d***, H330, H311, H301, H372**, H335, H315, H318, H400, H410 |
M=10: |
|
CLP00/ATP01 |
| 050-005-00-7 |
trimethyltin compounds, with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H310, H300, H400, H410 |
* |
A 1 |
CLP00/ |
| 050-006-00-2 |
triethyltin compounds, with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H310, H300, H400, H410 |
* |
A 1 |
CLP00/ |
| 050-007-00-8 |
tripropyltin compounds, with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H400, H410 |
* |
A 1 |
CLP00/ |
| 050-008-00-3 |
tributyltin compounds, with the exception of those specified elsewhere in this Annex |
- |
Repr. 1B, Acute Tox. 3, Acute Tox. 4 *, STOT RE 1, Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H360FD, H301, H312, H372**, H319, H315, H400, H410 |
*, STOT RE 1; H372: C >= 1 %, STOT RE 2; H373: 0,25 % <= C < 1 %, Skin Irrit. 2; H315: C >= 1 %, Eye Irrit. 2; H319: C >= 1 %, M=10: |
A 1 |
CLP00/ATP07 |
| 050-009-00-9 |
fluorotripentylstannane; [1] hexapentyldistannoxane [2] |
20153-49-5 [1], 25637-27-8 [2] |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H312, H302, H400, H410 |
* |
1 |
CLP00/ |
| 050-010-00-4 |
fluorotrihexylstannane |
20153-50-8 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H312, H302, H400, H410 |
* |
1 |
CLP00/ |
| 050-011-00-X |
triphenyltin compounds, with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H400, H410 |
*, M=100: |
A 1 |
CLP00/ATP01 |
| 050-012-00-5 |
tetracyclohexylstannane; [1] chlorotricyclohexylstannane; [2] butyltricyclohexylstannane [3] |
1449-55-4 [1], 3091-32-5 [2], 7067-44-9 [3] |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H312, H302, H400, H410 |
* |
A 1 |
CLP00/ |
| 050-013-00-0 |
trioctyltin compounds, with the exception of those specified elsewhere in this Annex |
- |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Chronic 4 |
H319, H335, H315, H413 |
Skin Irrit. 2; H315: C ≥ 1 %, Eye Irrit. 2; H319: C ≥ 1 %, STOT SE 3; H335: C ≥ 1 % |
A 1 |
CLP00/ |
| 050-017-00-2 |
fenbutatin oxide (ISO); bis(tris(2-methyl-2-phenylpropyl)tin)oxide |
13356-08-6 |
Acute Tox. 2 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H319, H315, H400, H410 |
|
|
CLP00/ |
| 050-018-00-8 |
tin(II) methanesulphonate |
53408-94-9 |
Skin Corr. 1B, Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H314, H302, H317, H411 |
|
|
CLP00/ATP01 |
| 050-019-00-3 |
azocyclotin (ISO); 1-(tricyclohexylstannyl)-1H-1,2,4-triazole |
41083-11-8 |
Acute Tox. 2 *, Acute Tox. 3 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H301, H335, H315, H318, H400, H410 |
|
|
CLP00/ |
| 050-020-00-9 |
trioctylstannane |
869-59-0 |
STOT RE 1, Skin Irrit. 2, Aquatic Chronic 4 |
H372 **, H315, H413 |
|
|
CLP00/ |
| 050-021-00-4 |
dichlorodioctylstannane |
3542-36-7 |
Repr. 1B, Acute Tox. 2, STOT RE 1, Aquatic Chronic 3 |
H360D, H330, H372 **, H412 |
Inhalation: ATE = 0.098 mg/L (dusts/mists), Repr. 1B, H360D: C ≥ 0,03 % |
|
ATP01/ATP15 |
| 050-022-00-X |
dibutyltin dichloride; (DBTC) |
683-18-1 |
Muta. 2, Repr. 1B, Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 1, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H341, H360FD, H330, H301, H312, H372**, H314, H400, H410 |
Skin Corr. 1B; H314: C ≥ 5 %, Skin Irrit. 2; H315: 0,01 % ≤ C < 5 %, Eye Dam. 1; H318: 3 % ≤ C < 5 %, Eye Irrit. 2; H319: 0,01 % ≤ C < 3 %, M=10: |
|
ATP01/ |
| 050-023-00-5 |
reaction mass of: bis[(2-ethyl-1-oxohexyl)oxy]dioctyl stannane; bis[((2-ethyl-1-oxohexyl)oxy)dioctylstannyl]oxide; bis(1-phenyl-1,3-decanedionyl)dioctyl stannane; ((2-ethyl-1-oxohexyl)oxy)-(1-phenyl-1,3-decanedionyl)dioctyl stannane |
- |
STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H373**, H400, H410 |
M=10: |
|
ATP01/ |
| 050-024-00-0 |
reaction mass of: tri-p-tolyltin hydroxide; hexa-p-tolyl-distannoxane |
- |
STOT RE 1, Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H372**, H302, H315, H318, H317, H400, H410 |
|
|
ATP01/ |
| 050-025-00-6 |
trichloromethylstannane |
993-16-8 |
Repr. 2 |
H361d |
|
|
ATP05 |
| 050-026-00-1 |
2-ethylhexyl 10-ethyl-4-[[2-[(2- ethylhexyl)oxy]-2-oxoethyl]thio]- 4-methyl-7-oxo-8-oxa-3,5-dithia- 4-stannatetradecanoate |
57583-34-3 |
Repr. 2 |
H361d |
|
|
ATP05 |
| 050-027-00-7 |
2-ethylhexyl 10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate; [DOTE] |
15571-58-1 |
Repr. 1B, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360D, H372 (immune system), H400, H410 |
|
|
ATP05/ATP15 |
| 050-028-00-2 |
2-ethylhexyl 10-ethyl- 4,4-dimethyl-7-oxo-8- oxa-3,5-dithia-4-stannatetradecanoate |
57583-35-4 |
Repr. 2, Acute Tox. 4, STOT RE 1, Skin Sens. 1A |
361d, H302, H372 (Nervensystem, Immunsystem), H317 |
|
|
ATP06 |
| 050-029-00-8 |
dimethyltin dichloride |
753-73-1 |
Repr. 2, Acute Tox. 2, Acute Tox. 3, Acute Tox. 3, STOT RE 1, Skin Corr. 1B |
H361d, H330, H301, H311, H372 (Nervensystem, Immunsystem), H314 |
|
|
ATP06 |
| 050-030-00-3 |
dibutyltin dilaurate; dibutyl[bis(dodecanoyloxy)]stannane |
77-58-7 |
Muta. 2, Repr. 1B, STOT RE 1 |
H341, H360FD, H372 (immune system) |
|
|
ATP10 |
| 050-031-00-9 |
dioctyltin dilaurate [1] stannane, dioctyl-, bis (coco acyloxy) derivs. [2] |
3648-18-8 [1]
91648-39-4 [2]
|
Repr. 1B, STOT RE 1 |
H360D, H372 (immune system) |
|
|
ATP15 |
| 050-032-00-4 |
dibutyltin bis (2-ethylhexanoate) |
2781-10-4 |
Muta. 2, Repr. 1B, STOT RE 1 |
H341, H360FD, H372 (immune system) |
|
|
ATP18 |
| 050-033-00-X |
dibutyltin di(acetate) |
1067-33-0 |
Muta 2, Repr. 1B, STOT RE 1 |
H341, H360FD, H372 (immune system) |
|
|
ATP18 |
| 051-001-00-8 |
antimony trichloride |
10025-91-9 |
Skin Corr. 1B, Aquatic Chronic 2 |
H314, H411 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 051-002-00-3 |
antimony pentachloride |
7647-18-9 |
Skin Corr. 1B, Aquatic Chronic 2 |
H314, H411 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 051-003-00-9 |
antimony compounds, with the exception of the tetroxide (Sb2O4), pentoxide (Sb2O5), trisulphide (Sb2S3), pentasulphide (Sb2S5) and those specified elsewhere in this Annex |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 2 |
H332, H302, H411 |
* |
A 1 |
CLP00/ |
| 051-004-00-4 |
antimony trifluoride |
7783-56-4 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Chronic 2 |
H331, H311, H301, H411 |
|
|
CLP00/ |
| 051-005-00-X |
antimony trioxide |
1309-64-4 |
Carc. 2 |
H351 |
|
|
CLP00/ |
| 051-006-00-5 |
diphenyl(4-phenylthiophenyl)sulfonium hexafluoroantimonate |
- |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 051-007-00-0 |
bis(4-dodecylphenyl)iodonium hexafluoroantimonate |
71786-70-4 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 052-001-00-0 |
tellurium |
13494-80-9 |
Repr. 1B, Lact. |
H360Df, H362 |
|
|
ATP18 |
| 052-002-00-6 |
tellurium dioxide |
7446-07-3 |
Repr. 1B, Lact. |
H360Df, H362 |
|
|
ATP18 |
| 053-001-00-3 |
iodine |
7553-56-2 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1 |
H332, H312, H400 |
|
|
CLP00/ |
| 053-002-00-9 |
hydrogen iodide |
10034-85-2 |
Press. Gas, Skin Corr. 1A |
H314 |
Skin Corr. 1A; H314: C ≥ 10 %, Skin Corr. 1B; H314: 0,2 % ≤ C < 10 %, Skin Irrit. 2; H315: 0,02 % ≤ C < 0,2 %, Eye Irrit. 2; H319: 0,02 % ≤ C < 0,2 %, STOT SE 3; H335: C ≥ 0,02 % |
U 5 |
CLP00/ |
| 053-002-01-6 |
hydriodic acid ... % |
- |
Skin Corr. 1B |
H314 |
Skin Corr. 1B; H314: C ≥ 25 %, Skin Irrit. 2; H315: 10 % ≤ C < 25 %, Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
CLP00/ |
| 053-003-00-4 |
iodoxybenzene |
696-33-3 |
|
|
|
|
CLP00/ATP01 |
| 053-004-00-X |
calcium iodoxybenzoate |
- |
|
|
|
C |
CLP00/ATP01 |
| 053-005-00-5 |
(4-(1-methylethyl)phenyl)-(4-methylphenyl)iodonium tetrakis(pentafluorophenyl)borate (1-) |
178233-72-2 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H373 **, H400, H410 |
|
|
CLP00/ |
| 056-001-00-1 |
barium peroxide |
1304-29-6 |
Ox. Sol. 2, Acute Tox. 4 *, Acute Tox. 4 * |
H272, H332, H302 |
|
|
CLP00/ |
| 056-002-00-7 |
barium salts, with the exception of barium sulphate, salts of 1-azo-2-hydroxynaphthalenyl aryl sulphonic acid, and of salts specified elsewhere in this Annex |
- |
Acute Tox. 4 *, Acute Tox. 4 * |
H332, H302 |
* |
A 1 |
CLP00/ |
| 056-003-00-2 |
barium carbonate |
513-77-9 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 056-004-00-8 |
barium chloride |
10361-37-2 |
Acute Tox. 3 *, Acute Tox. 4 * |
H301, H332 |
|
|
CLP00/ |
| 056-005-00-3 |
barium diboron tetraoxide |
13701-59-2 |
Repr. 1B, Acute Tox. 4, Acute Tox. 3 |
H360FD, H332, H301 |
inhalation: ATE = 1,5 mg/L (dusts or mists); oral: ATE = 100 mg/kg bw |
|
ATP18 |
| 064-001-00-8 |
gadolinium(III)sulfite trihydrate |
51285-81-5 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 072-001-00-4 |
hafnium tetra-n-butoxide |
22411-22-9 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
CLP00/ |
| 074-001-00-X |
hexasodium tungstate hydrate |
12141-67-2 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 3 |
H302, H318, H412 |
|
|
CLP00/ |
| 074-002-00-5 |
Reaction products of tungsten hexachloride with 2-methylpropan-2-ol, nonylphenol and pentane-2,4-dione |
- |
Flam. Liq. 2, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H225, H332, H314, H317, H400, H410 |
|
|
CLP00/ |
| 076-001-00-5 |
osmium tetraoxide; osmic acid |
20816-12-0 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Skin Corr. 1B |
H330, H310, H300, H314 |
|
|
CLP00/ |
| 078-001-00-0 |
tetrachloroplatinates with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 3 *, Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H301, H318, H334, H317 |
|
A |
CLP00/ |
| 078-002-00-6 |
diammonium tetrachloroplatinate |
13820-41-2 |
Acute Tox. 3 *, Skin Irrit. 2, Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H301, H315, H318, H334, H317 |
|
|
CLP00/ |
| 078-003-00-1 |
disodium tetrachloroplatinate |
10026-00-3 |
Acute Tox. 3 *, Skin Irrit. 2, Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H301, H315, H318, H334, H317 |
|
|
CLP00/ |
| 078-004-00-7 |
dipotassium tetrachloroplatinate |
10025-99-7 |
Acute Tox. 3 *, Skin Irrit. 2, Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H301, H315, H318, H334, H317 |
|
|
CLP00/ |
| 078-005-00-2 |
hexachloroplatinates with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 3 *, Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H301, H318, H334, H317 |
|
A |
CLP00/ |
| 078-006-00-8 |
disodium hexachloroplatinate |
16923-58-3 |
Acute Tox. 3 *, Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H301, H318, H334, H317 |
|
|
CLP00/ |
| 078-007-00-3 |
dipotassium hexachloroplatinate |
16921-30-5 |
Acute Tox. 3 *, Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H301, H318, H334, H317 |
|
|
CLP00/ |
| 078-008-00-9 |
diammonium hexachloroplatinate |
16919-58-7 |
Acute Tox. 3 *, Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H301, H318, H334, H317 |
|
|
CLP00/ |
| 078-009-00-4 |
hexachloroplatinic acid |
16941-12-1 |
Acute Tox. 3 *, Skin Corr. 1B, Resp. Sens. 1, Skin Sens. 1 |
H301, H314, H334, H317 |
|
|
CLP00/ |
| 078-010-00-X |
tetraammine platinum (II) hydrogen carbonate |
123439-82-7 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 3 |
H302, H318, H412 |
|
|
ATP01/ |
| 078-011-00-5 |
hydroxydisulfito platinum(II) acid |
61420-92-6 |
Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1A, Resp. Sens. 1, Skin Sens. 1, Aquatic Chronic 3 |
H302, H373, H314, H334, H317, H412 |
|
|
ATP01/ |
| 078-012-00-0 |
platinum(IV) nitrate/nitric acid solution |
- |
Skin Corr. 1A, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H400, H410 |
|
|
ATP01/ |
| 080-001-00-0 |
mercury |
7439-97-6 |
Repr. 1B, Acute Tox. 2 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360D***, H330, H372**, H400, H410 |
|
|
CLP00/ATP01 |
| 080-002-00-6 |
inorganic compounds of mercury with the exception of mercuric sulphide and those specified elsewhere in this Annex |
- |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H310, H300, H373 **, H400, H410 |
*, STOT RE 2; H373: C ≥ 0,1 % |
A 1 |
CLP00/ |
| 080-003-00-1 |
dimercury dichloride; mercurous chloride; calomel |
10112-91-1 |
Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H335, H315, H400, H410 |
|
|
CLP00/ |
| 080-004-00-7 |
organic compounds of mercury with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H310, H300, H373 **, H400, H410 |
*, STOT RE 2; H373: C ≥ 0,1 % |
A 1 |
CLP00/ |
| 080-005-00-2 |
mercury difulminate; mercuric fulminate; fulminate of mercury |
628-86-4 |
Unst. Expl., Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H200, H331, H311, H301, H373 **, H400, H410 |
|
|
CLP00/ |
| 080-005-01-X |
mercury difulminate; mercuric fulminate; fulminate of mercury [≥ 20 % phlegmatiser] |
628-86-4 |
Expl. 1.1, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H201, H331, H311, H301, H373 **, H400, H410 |
|
|
CLP00/ |
| 080-006-00-8 |
dimercury dicyanide oxide; mercuric oxycyanide |
1335-31-5 |
Expl. 1.1, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H201, H331, H311, H301, H373**, H400, H410 |
|
|
CLP00/ATP01 |
| 080-007-00-3 |
dimethylmercury; [1] diethylmercury [2] |
593-74-8 [1], 627-44-1 [2] |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H310, H300, H373 **, H400, H410 |
*, STOT RE 2; H373: C ≥ 0,05 % |
1 |
CLP00/ |
| 080-008-00-9 |
phenylmercury nitrate; [1] phenylmercury hydroxide; [2] basic phenylmercury nitrate [3] |
55-68-5 [1], 100-57-2 [2], 8003-05-2 [3] |
Acute Tox. 3 *, STOT RE 1, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H372 **, H314, H400, H410 |
|
|
CLP00/ |
| 080-009-00-4 |
2-methoxyethylmercury chloride |
123-88-6 |
Acute Tox. 3 *, STOT RE 1, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H372 **, H314, H400, H410 |
|
|
CLP00/ |
| 080-010-00-X |
mercury dichloride; mercuric chloride |
7487-94-7 |
Muta. 2, Repr. 2, Acute Tox. 2 *, STOT RE 1, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H341, H361f***, H300, H372**, H314, H400, H410 |
|
|
CLP00/ATP01 |
| 080-011-00-5 |
phenylmercury acetate |
62-38-4 |
Acute Tox. 3 *, STOT RE 1, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H372 **, H314, H400, H410 |
|
|
CLP00/ |
| 080-012-00-0 |
methylmercuric chloride |
115-09-3 |
Carc. 2, Repr. 1A, Lact., Acute Tox. 2, Acute Tox. 2, Acute Tox. 2, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H360Df, H362, H330, H310, H300, H372 (nervous system, kidneys), H400, H410 |
Inhalation: ATE = 0.05 mg/L (dusts/mists), Dermal: ATE = 50 mg/kg, Oral: ATE = 5 mg/kg
|
1 |
ATP14 |
| 081-001-00-3 |
thallium |
7440-28-0 |
Acute Tox. 2 *, Acute Tox. 2 *, STOT RE 2 *, Aquatic Chronic 4 |
H330, H300, H373 **, H413 |
|
|
CLP00/ |
| 081-002-00-9 |
thallium compounds, with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 2 *, Acute Tox. 2 *, STOT RE 2 *, Aquatic Chronic 2 |
H330, H300, H373 **, H411 |
|
A |
CLP00/ |
| 081-003-00-4 |
dithallium sulphate; thallic sulphate |
7446-18-6 |
Acute Tox. 2 *, STOT RE 1, Skin Irrit. 2, Aquatic Chronic 2 |
H300, H372 **, H315, H411 |
|
|
CLP00/ |
| 082-001-00-6 |
lead compounds with the exception of those specified elsewhere in this Annex |
- |
Repr. 1A, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H360Df, H332, H302, H373 **, H400, H410 |
Repr. 2; H361f: C ≥ 2,5 %, *, STOT RE 2; H373: C ≥ 0,5 % |
A 1 |
CLP00/ |
| 082-002-00-1 |
lead alkyls |
- |
Repr. 1A, Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H360Df, H330, H310, H300, H373 **, H400, H410 |
Repr. 1A; H360D: C ≥ 0,1 %, *, STOT RE 2; H373: C ≥ 0,05 % |
A 1 |
CLP00/ |
| 082-003-00-7 |
lead diazide; lead azide |
13424-46-9 |
Unst. Expl., Repr. 1A, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H200, H360Df, H332, H302, H373 **, H400, H410 |
|
1 |
CLP00/ |
| 082-003-01-4 |
lead diazide; lead azide [≥ 20 % phlegmatiser] |
13424-46-9 |
Expl. 1.1, Repr. 1A, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H201, H360Df, H332, H302, H373 **, H400, H410 |
|
1 |
CLP00/ |
| 082-004-00-2 |
lead chromate |
7758-97-6 |
Carc. 1B, Repr. 1A, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H360Df, H373**, H400, H410 |
|
1 |
CLP00/ATP01 |
| 082-005-00-8 |
lead di(acetate) |
301-04-2 |
Repr. 1A, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H360Df, H373 **, H400, H410 |
|
1 |
CLP00/ |
| 082-006-00-3 |
trilead bis(orthophosphate) |
7446-27-7 |
Repr. 1A, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H360Df, H373 **, H400, H410 |
|
1 |
CLP00/ |
| 082-007-00-9 |
lead acetate, basic |
1335-32-6 |
Carc. 2, Repr. 1A, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H360Df, H373 **, H400, H410 |
|
1 |
CLP00/ |
| 082-008-00-4 |
lead(II) methanesulphonate |
17570-76-2 |
Repr. 1A, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Irrit. 2, Eye Dam. 1 |
H360Df, H332, H302, H373 **, H315, H318 |
|
1 |
CLP00/ |
| 082-009-00-X |
lead sulfochromate yellow; C.I. Pigment Yellow 34; [This substance is identified in the Colour Index by Colour Index Constitution Number, C.I. 77603.] |
1344-37-2 |
Carc. 1B, Repr. 1A, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H360Df, H373**, H400, H410 |
|
1 |
CLP00/ATP01 |
| 082-010-00-5 |
lead chromate molybdate sulfate red; C.I. Pigment Red 104; [This substance is identified in the Colour Index by Colour Index Constitution Number, C.I. 77605.] |
12656-85-8 |
Carc. 1B, Repr. 1A, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H360Df, H373**, H400, H410 |
|
1 |
CLP00/ATP01 |
| 082-011-00-0 |
lead hydrogen arsenate |
7784-40-9 |
Carc. 1A, Repr. 1A, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H360Df, H331, H301, H373 **, H400, H410 |
|
1 |
CLP00/ |
| 082-012-00-6 |
barium calcium cesium lead samarium strontium bromide chloride fluoride iodide europium doped |
199876-46-5 |
Acute Tox. 4 *, STOT RE 2 *, Aquatic Chronic 2 |
H302, H373**, H411 |
|
|
ATP01/ |
| 082-013-00-1 |
lead powder; [particle diameter < 1 mm] |
7439-92-1 |
Repr. 1A, Lact., Aquatic Acute 1, Aquatic Chronic 1 |
H360FD, H362, H400, H410 |
Repr. 1A : C ≥ 0,03 %, M=1, M=10 |
|
ATP09/ATP15 |
| 082-014-00-7 |
lead massive:
[particle diameter ≥ 1 mm] |
7439-92-1 |
Repr. 1 A, Lakt. |
H360FD, H362 |
|
|
ATP09 |
| 092-001-00-8 |
uranium |
7440-61-1 |
Acute Tox. 2 *, Acute Tox. 2 *, STOT RE 2 *, Aquatic Chronic 4 |
H330, H300, H373 **, H413 |
|
|
CLP00/ |
| 092-002-00-3 |
uranium compounds with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 2 *, Acute Tox. 2 *, STOT RE 2, Aquatic Chronic 2 |
H330, H300, H373**, H411 |
|
A |
CLP00/ATP01 |
| 601-001-00-4 |
methane |
74-82-8 |
Flam. Gas 1, Press. Gas |
H220 |
|
U |
CLP00/ |
| 601-002-00-X |
ethane |
74-84-0 |
Flam. Gas 1, Press. Gas |
H220 |
|
U |
CLP00/ |
| 601-003-00-5 |
propane |
74-98-6 |
Flam. Gas 1, Press. Gas |
H220 |
|
U |
CLP00/ |
| 601-004-00-0 |
butane; [1] and isobutane [2] |
106-97-8 [1], 75-28-5 [2] |
Flam. Gas 1, Press. Gas |
H220 |
|
C U |
CLP00/ |
| 601-004-01-8 |
butane (containing ≥ 0,1 % butadiene (203-450-8)); [1] isobutane (containing ≥ 0,1 % butadiene (203-450-8)) [2] |
106-97-8 [1], 75-28-5 [2] |
Flam. Gas 1, Press. Gas, Carc. 1A, Muta. 1B |
H220, H350, H340 |
|
C S U |
CLP00/ |
| 601-005-00-6 |
2,2-dimethylpropane; neopentane |
463-82-1 |
Flam. Gas 1, Press. Gas, Aquatic Chronic 2 |
H220, H411 |
|
U |
CLP00/ |
| 601-006-00-1 |
pentane; isopentane; 2-methylbutane |
109-66-0, - |
Flam. Liq. 2, Asp. Tox. 1, STOT SE 3, Aquatic Chronic 2 |
H225, H304, H336, H411 |
|
C |
CLP00/ |
| 601-007-00-7 |
hexane (containing < 5 % n-hexane (203-777-6)); 2-methylpentane; [1] 3-methylpentane; [2] 2,2-dimethylbutane; [3] 2,3-dimethylbutane [4] |
107-83-5 [1], 96-14-0 [2], 75-83-2 [3], 79-29-8 [4] |
Flam. Liq. 2, Asp. Tox. 1, Skin Irrit. 2, STOT SE 3, Aquatic Chronic 2 |
H225, H304, H315, H336, H411 |
|
C |
CLP00/ATP01 |
| 601-008-00-2 |
heptane; n-heptane; [1] 2,4-dimethylpentane; [2] 2,2,3-trimethylbutane; [3] 3,3-dimethylpentane; [4] 2,3-dimethylpentane; [5] 3-methylhexane; [6] 2,2-dimethylpentane; [7] 2-methylhexane; [8] 3-ethylpentane; [9] isoheptane; [10] |
142-82-5 [1], 108-08-7 [2], 464-06-2 [3], 562-49-2 [4], 565-59-3 [5], 589-34-4 [6], 590-35-2 [7], 591-76-4 [8], 617-78-7 [9], 31394-54-4 [10] |
Flam. Liq. 2, Asp. Tox. 1, Skin Irrit. 2, STOT SE 3, Aquatic Acute 1, Aquatic Chronic 1 |
H225, H304, H315, H336, H400, H410 |
|
C |
CLP00/ATP01 |
| 601-009-00-8 |
octane; n-octane; [1] 2,2,4-trimethylpentane; [2] 2,3,3-trimethylpentane; [3] 3,3-dimethylhexane; [4] 2,2,3-trimethylpentane; [5] 2,3,4-trimethylpentane; [6] 3,4-dimethylhexane; [7] 2,3-dimethylhexane; [8] 2,4-dimethylhexane; [9] 4-methylheptane |
111-65-9 [1], 540-84-1 [2], 560-21-4 [3], 563-16-6 [4], 564-02-3 [5], 565-75-3 [6], 583-48-2 [7], 584-94-1 [8], 589-43-5 [9], 589-53-7 [10], 589-81-1 [11], 590-73-8 [12], 592-13-2 [13], 592-27-8 [14], 594-82-1 [15], 609-26-7 [16], 619-99-8 [17], 1067-08-9 |
Flam. Liq. 2, Asp. Tox. 1, Skin Irrit. 2, STOT SE 3, Aquatic Acute 1, Aquatic Chronic 1 |
H225, H304, H315, H336, H400, H410 |
|
C |
CLP00/ATP01 |
| 601-010-00-3 |
ethylene |
74-85-1 |
Flam. Gas 1, Press. Gas, STOT SE 3 |
H220, H336 |
|
U |
CLP00/ |
| 601-011-00-9 |
propene; propylene |
115-07-1 |
Flam. Gas 1, Press. Gas |
H220 |
|
U |
CLP00/ |
| 601-012-00-4 |
but-1-ene; [1] butene, mixed-1-and-2-isomers; [2] 2-methylpropene; [3] (Z)-but-2-ene; [4] (E)-but-2-ene [5] |
106-98-9 [1], 107-01-7 [2], 115-11-7 [3], 590-18-1 [4], 624-64-6 [5] |
Flam. Gas 1, Press. Gas |
H220 |
|
C U |
CLP00/ |
| 601-013-00-X |
1,3-butadiene; buta-1,3-diene |
106-99-0 |
Flam. Gas 1, Press. Gas, Carc. 1A, Muta. 1B |
H220, H350, H340 |
|
D U |
CLP00/ |
| 601-014-00-5 |
isoprene (stabilised); 2-methyl-1,3-butadiene |
78-79-5 |
Flam. Liq. 1, Carc. 1B, Muta. 2, Aquatic Chronic 3 |
H224, H350, H341, H412 |
|
D |
CLP00/ |
| 601-015-00-0 |
acetylene; ethyne |
74-86-2 |
Flam. Gas 1, Press. Gas |
H220 |
|
U |
CLP00/ATP04 |
| 601-016-00-6 |
cyclopropane |
75-19-4 |
Flam. Gas 1, Press. Gas |
H220 |
|
U |
CLP00/ |
| 601-017-00-1 |
cyclohexane |
110-82-7 |
Flam. Liq. 2, Asp. Tox. 1, Skin Irrit. 2, STOT SE 3, Aquatic Acute 1, Aquatic Chronic 1 |
H225, H304, H315, H336, H400, H410 |
|
|
CLP00/ |
| 601-018-00-7 |
methylcyclohexane |
108-87-2 |
Flam. Liq. 2, Asp. Tox. 1, Skin Irrit. 2, STOT SE 3, Aquatic Chronic 2 |
H225, H304, H315, H336, H411 |
|
|
CLP00/ |
| 601-019-00-2 |
1,4-dimethylcyclohexane |
589-90-2 |
Flam. Liq. 2, Asp. Tox. 1, Skin Irrit. 2, STOT SE 3, Aquatic Chronic 2 |
H225, H304, H315, H336, H411 |
|
|
CLP00/ |
| 601-020-00-8 |
benzene |
71-43-2 |
Flam. Liq. 2, Carc. 1A, Muta. 1B, STOT RE 1, Asp. Tox. 1, Eye Irrit. 2, Skin Irrit. 2 |
H225, H350, H340, H372 **, H304, H319, H315 |
|
E |
CLP00/ |
| 601-021-00-3 |
toluene |
108-88-3 |
Flam. Liq. 2, Repr. 2, Asp. Tox. 1, STOT RE 2 *, Skin Irrit. 2, STOT SE 3 |
H225, H361d ***, H304, H373 **, H315, H336 |
|
|
CLP00/ |
| 601-022-00-9 |
o-xylene; [1] p-xylene; [2] m-xylene; [3] xylene [4] |
95-47-6 [1], 106-42-3 [2], 108-38-3 [3], 1330-20-7 [4] |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2 |
H226, H332, H312, H315 |
* |
C |
CLP00/ |
| 601-023-00-4 |
ethylbenzene |
100-41-4 |
Flam. Liq. 2, Acute Tox. 4 *, STOT RE 2, Asp. Tox. 1 |
H225, H332, H373 (Hörorgane), H304 |
|
|
CLP00/ATP06 |
| 601-024-00-X |
Cumene |
98-82-8 |
Flam. Liq. 3, Carc. 1B, Asp. Tox. 1, STOT SE 3, Aquatic Chronic 2 |
H226, H350, H304, H335, H411 |
|
C |
CLP00/ATP18 |
| 601-025-00-5 |
mesitylene; 1,3,5-trimethylbenzene |
108-67-8 |
Flam. Liq. 3, STOT SE 3, Aquatic Chronic 2 |
H226, H335, H411 |
STOT SE 3; H335: C ≥ 25 % |
|
CLP00/ |
| 601-026-00-0 |
styrene |
100-42-5 |
Flam. Liq. 3, Repr. 2, Acute Tox. 4*, STOT RE 1, Skin Irrit. 2, Eye Irrit. 2 |
H226, H361d, H332, H372 (Hörorgane), H315, H319 |
* |
D |
CLP00/ATP06 |
| 601-027-00-6 |
2-phenylpropene; α-methylstyrene |
98-83-9 |
Flam. Liq. 3, Eye Irrit. 2, STOT SE 3, Aquatic Chronic 2 |
H226, H319, H335, H411 |
STOT SE 3; H335: C ≥ 25 % |
|
CLP00/ |
| 601-028-00-1 |
2-methylstyrene; 2-vinyltoluene |
611-15-4 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H332, H411 |
|
|
CLP00/ |
| 601-029-00-7 |
dipentene; limonene; [1] (S)-p-mentha-1,8-diene; l-limonene; [2] trans-1-methyl-4-(1-methylvinyl)cyclohexene; [3] (±)-1-methyl-4-(1-methylvinyl)cyclohexene [4] |
138-86-3 [1],
5989-54-8 [2],
6876-12-6 [3],
7705-14-8 [4] |
Flam. Liq. 3,
Skin Irrit. 2,
Skin Sens. 1,
Aquatic Acute 1,
Aquatic Chronic 1 |
H226,
H315,
H317,
H400,
H410 |
|
C |
CLP00/ATP17 |
| 601-030-00-2 |
cyclopentane |
287-92-3 |
Flam. Liq. 2, Aquatic Chronic 3 |
H225, H412 |
|
|
CLP00/ |
| 601-031-00-8 |
2,4,4-trimethylpent-1-ene |
107-39-1 |
Flam. Liq. 2, Aquatic Chronic 2 |
H225, H411 |
|
|
CLP00/ |
| 601-032-00-3 |
benzo[a]pyrene; benzo[def]chrysene |
50-32-8 |
Carc. 1B, Muta. 1B, Repr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H340, H360FD, H317, H400, H410 |
Carc. 1B; H350: C ≥ 0,01 % |
|
CLP00/ |
| 601-033-00-9 |
benz[a]anthracene |
56-55-3 |
Carc. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H400, H410 |
M=100: |
|
CLP00/ATP01 |
| 601-034-00-4 |
benz[e]acephenanthrylene |
205-99-2 |
Carc. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H400, H410 |
|
|
CLP00/ |
| 601-035-00-X |
benzo[j]fluoranthene |
205-82-3 |
Carc. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H400, H410 |
|
|
CLP00/ |
| 601-036-00-5 |
benzo[k]fluoranthene |
207-08-9 |
Carc. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H400, H410 |
|
|
CLP00/ |
| 601-037-00-0 |
n-hexane |
110-54-3 |
Flam. Liq. 2, Repr. 2, Asp. Tox. 1, STOT RE 2 *, Skin Irrit. 2, STOT SE 3, Aquatic Chronic 2 |
H225, H361f ***, H304, H373 **, H315, H336, H411 |
STOT RE 2; H373: C ≥ 5 % |
|
CLP00/ |
| 601-041-00-2 |
dibenz[a,h]anthracene |
53-70-3 |
Carc. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H400, H410 |
Carc. 1B; H350: C ≥ 0,01 %, M=100: |
|
CLP00/ATP01 |
| 601-042-00-8 |
biphenyl; diphenyl |
92-52-4 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H335, H315, H400, H410 |
|
|
CLP00/ |
| 601-043-00-3 |
1,2,4-trimethylbenzene |
95-63-6 |
Flam. Liq. 3, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Chronic 2 |
H226, H332, H319, H335, H315, H411 |
|
|
CLP00/ |
| 601-044-00-9 |
3a,4,7,7a-tetrahydro-4,7-methanoindene |
77-73-6 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Chronic 2 |
H225, H332, H302, H319, H335, H315, H411 |
|
|
CLP00/ |
| 601-045-00-4 |
1,2,3,4-tetrahydronaphthalene |
119-64-2 |
Eye Irrit. 2, Skin Irrit. 2, Aquatic Chronic 2 |
H319, H315, H411 |
|
|
CLP00/ |
| 601-046-00-X |
7-methylocta-1,6-diene |
42152-47-6 |
Flam. Liq. 3, Aquatic Acute 1, Aquatic Chronic 1 |
H226, H400, H410 |
|
|
CLP00/ |
| 601-047-00-5 |
m-mentha-1,3(8)-diene |
17092-80-7 |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ |
| 601-048-00-0 |
chrysene |
218-01-9 |
Carc. 1B, Muta. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H341, H400, H410 |
|
|
CLP00/ |
| 601-049-00-6 |
benzo[e]pyrene |
192-97-2 |
Carc. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H400, H410 |
|
|
CLP00/ |
| 601-051-00-7 |
4-phenylbut-1-ene |
768-56-9 |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ |
| 601-052-00-2 |
naphthalene |
91-20-3 |
Carc. 2, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H302, H400, H410 |
|
|
CLP00/ |
| 601-053-00-8 |
nonylphenol; [1] 4-nonylphenol, branched [2] |
25154-52-3 [1], 84852-15-3 [2] |
Repr. 2, Acute Tox. 4 *, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H361fd, H302, H314, H400, H410 |
|
|
CLP00/ |
| 601-054-00-3 |
reaction mass of isomers of: dibenzylbenzene; dibenzyl(methyl)benzene; dibenzyl(dimethyl)benzene; dibenzyl(trimethyl)benzene |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 601-055-00-9 |
reaction mass of isomers of: mono-(2-tetradecyl)naphthalenes; di-(2-tetradecyl)naphthalenes; tri-(2-tetradecyl)naphthalenes |
132983-41-6 |
Eye Irrit. 2, Aquatic Chronic 4 |
H319, H413 |
|
|
CLP00/ |
| 601-056-00-4 |
reaction mass of isomers of: methyldiphenylmethane; dimethyldiphenylmethane |
73807-39-3 |
Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H400, H410 |
|
|
CLP00/ |
| 601-057-00-X |
N-dodecyl-[3-(4-(dimethylamino)benzamido)-propyl]dimethylammonium tosylate |
156679-41-3 |
Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H317, H400, H410 |
|
|
CLP00/ |
| 601-058-00-5 |
di-L-para-menthene |
83648-84-4 |
Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H317, H400, H410 |
|
|
CLP00/ |
| 601-059-00-0 |
methyl 2-benzylidene-3-oxobutyrate |
15768-07-7 |
Eye Irrit. 2, Skin Irrit. 2, Aquatic Chronic 2 |
H319, H315, H411 |
|
|
CLP00/ |
| 601-060-00-6 |
1,2-bis[4-fluoro-6-{}{4-sulfo-5-(2-(4-sulfonaphtalene-3-ylazo)-1-hydroxy-3,6-disulfo-8-aminonaphthalene-7-ylazo)phenylamino}}-1,3,5-triazin-2ylamino]ethane; x-sodium, y-potassium salts x = 7,755 y = 0,245 |
155522-09-1 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 601-061-00-1 |
(ethyl-1,2-ethanediyl)[-2-[[[(2-hydroxyethyl)methylamino]acetyl]-propyl]ω-(nonylphenoxy)poly]oxy-(methyl-1,2-ethanediyl) |
- |
Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 2 |
H314, H317, H411 |
|
|
CLP00/ |
| 601-062-00-7 |
reaction mass of: branched triacontane; branched dotriacontane; branched tetratriacontane; branched hexatriacontane |
151006-59-6 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 601-063-00-2 |
reaction mass of isomers of branched tetracosane |
151006-61-0 |
Acute Tox. 4 *, Aquatic Chronic 4 |
H332, H413 |
|
|
CLP00/ |
| 601-065-00-3 |
reaction mass of: (1'α,3'α,6'α)-2,2,3',7',7'-pentamethylspiro(1,3-dioxane-5,2'-norcarane); (1'α,3'β,6'α)-2,2,3',7',7'-pentamethylspiro(1,3-dioxane-5,2'-norcarane) |
- |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ATP01 |
| 601-066-00-9 |
1-(4-(trans-4-heptylcyclohexyl)phenyl)ethanone |
78531-60-9 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 601-067-00-4 |
triethyl arsenate |
15606-95-8 |
Carc. 1A, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H331, H301, H400, H410 |
|
|
CLP00/ |
| 601-068-00-X |
1,2-diacetoxybut-3-ene |
18085-02-4 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 601-069-00-5 |
2-ethyl-1-(2-(1,3-dioxanyl)ethyl)-pyridinium bromide |
287933-44-2 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 601-070-00-0 |
reaction mass of: branched icosane; branched docosane; branched tetracosane |
151006-58-5 |
Acute Tox. 4 *, Aquatic Chronic 4 |
H332, H413 |
|
|
ATP01/ |
| 601-071-00-6 |
1-dimethoxymethyl-2-nitro-benzene |
20627-73-0 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 601-072-00-1 |
reaction mass of: 1-(4-isopropylphenyl)-1-phenylethane; 1-(3-isopropylphenyl)-1-phenylethane; 1-(2-isopropylphenyl)-1-phenylethane |
52783-21-8 |
Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H400, H410 |
|
|
ATP01/ |
| 601-073-00-7 |
1-bromo-3,5-difluorobenzene |
461-96-1 |
Flam. Liq. 3, Acute Tox. 4 *, STOT RE 2 *, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H226, H302, H373 **, H315, H317, H400, H410 |
|
|
CLP00/ |
| 601-074-00-2 |
reaction mass of: 4-(2,2,3-trimethylcyclopent-3-en-1-yl)-1-methyl-2-oxabicyclo[2.2.2]octane; 1-(2,2,3-trimethylcyclopent-3-en-1-yl)-5-methyl-6-oxabicyclo[3.2.1]octane; spiro[cyclohex-3-en-1-yl-[(4,5,6,6a-tetrahydro-3,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2 |
- |
Eye Irrit. 2, Skin Irrit. 2, Aquatic Chronic 2 |
H319, H315, H411 |
|
|
CLP00/ |
| 601-075-00-8 |
4,4'-bis(N-carbamoyl-4-methylbenzenesulfonamide)diphenylmethane |
151882-81-4 |
Carc. 2 |
H351 |
|
|
ATP01/ |
| 601-076-00-3 |
ethynyl cyclopropane |
6746-94-7 |
Flam. Liq. 2, Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 3 |
H225, H315, H318, H412 |
|
|
ATP01/ |
| 601-077-00-9 |
reaction mass of: 1-heptyl-4-ethyl-2,6,7-trioxabicyclo[2.2.2]octane; 1-nonyl-4-ethyl-2,6,7-trioxabicyclo[2.2.2]octane |
196965-91-0 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 601-078-00-4 |
reaction mass of: 1,7-dimethyl-2-[(3-methylbicyclo[2.2.1]hept-2-yl)methyl]bicyclo[2.2.1]heptane; 2,3-dimethyl-2-[(3-methylbicyclo[2.2.1]hept-2-yl)methyl]bicyclo[2.2.1]heptane |
- |
Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H400, H410 |
|
|
ATP01/ |
| 601-079-00-X |
reaction mass of: trans-trans-cyclohexadeca-1,9-diene; cis-trans-cyclohexadeca-1,9-diene |
- |
Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 4 |
H315, H317, H413 |
|
|
ATP01/ |
| 601-080-00-5 |
reaction mass of: sec-butylphenyl(phenyl)methane, mixed isomers; 1-(sec-butylphenyl(phenyl)-2-phenylethane, mixed isomers; 1-(sec-butylphenyl-1-phenylethane, mixed isomers |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 601-081-00-0 |
cyclohexadeca-1,9-diene |
4277-06-9 |
Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 4 |
H315, H317, H413 |
|
|
ATP01/ |
| 601-082-00-6 |
reaction mass of: endo-2-methyl-exo-3-methyl-exo-2-[(exo-3-methylbicyclo[2.2.1]hept-exo-2-yl)methyl]bicyclo[2.2.1]heptane; exo-2-methyl-exo-3-methyl-endo-2-[(endo-3-methylbicyclo[2.2.1]hept-exo-2-yl)methyl]bicyclo[2.2.1]heptane |
- |
Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H400, H410 |
|
|
ATP01/ |
| 601-083-00-1 |
5-endo-hexyl-bicyclo[2.2.1]hept-2-ene |
22094-83-3 |
Asp. Tox. 1, Skin Irrit. 2, Aquatic Chronic 4 |
H304, H315, H413 |
|
|
ATP01/ |
| 601-084-00-7 |
reaction mass of: 5-endo-butyl-bicyclo[2.2.1]hept-2-ene; 5-exo-butyl-bicyclo[2.2.1]hept-2-ene (80:20) |
- |
Asp. Tox. 1, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H304, H315, H400, H410 |
|
|
ATP01/ |
| 601-085-00-2 |
isopentane; 2-methylbutane |
78-78-4 |
Flam. Liq. 1, Asp. Tox. 1, STOT SE 3, Aquatic Chronic 2 |
H224, H304, H336, H411 |
|
|
CLP00/ |
| 601-087-00-3 |
2,4,4-trimethylpentene |
25167-70-8 |
Flam. Liq. 2, Asp. Tox. 1, STOT SE 3 |
H225, H304, H336 |
|
D |
ATP05 |
| 601-088-00-9 |
4-vinylcyclohexene |
100-40-3 |
Carc. 2 |
H351 |
|
|
ATP06 |
| 601-089-00-4 |
muscalure; cis-tricos-9- ene |
27519-02-4 |
Skin Sens. 1B |
H317 |
|
|
ATP06 |
| 601-090-00-X |
benzo[rst]pentaphene |
189-55-9 |
Carc. 1B, Muta. 2 |
H350, H341 |
|
|
ATP14 |
| 601-091-00-5 |
dibenzo[b,def]chrysene; dibenzo[a,h]pyrene |
189-64-0 |
Carc. 1B, Muta. 2 |
H350, H341 |
|
|
ATP14 |
| 601-092-00-0 |
dibenzo[def,p]chrysene; dibenzo[a,l]pyrene |
191-30-0 |
Carc. 1B, Muta. 2 |
H350, H341 |
Carc. 1B, H350: C ≥ 0,001 % |
|
ATP15 |
| 601-093-00-6 |
1,4-dimethylnaphthalene |
571-58-4 |
Acute Tox. 4,
Asp. Tox. 1,
Eye Irrit. 2,
Aquatic Acute 1,
Aquatic Chronic 3 |
H302,
H304,
H319,
H400,
H412 |
Oral: ATE = 1300 mg/kg bw,
M=1 |
|
ATP17 |
| 601-094-00-1 |
1-isopropyl-4-methylbenzene; p-cymene |
99-87-6 |
Flam. Liq. 3,
Acute Tox. 3,
Asp. Tox. 1,
Aquatic Chronic 2 |
H226,
H331,
H304,
H411 |
Inhalation: ATE = 3 mg/L (Vapours) |
|
ATP17 |
| 601-095-00-7 |
p-mentha-1,3-diene; 1-isopropyl-4-methylcyclohexa-1,3-diene;
alpha-terpinene |
99-86-5 |
Flam. Liq. 3,
Acute Tox. 4,
Asp. Tox. 1,
Skin Sens. 1,
Aquatic Chronic 2 |
H226,
H302,
H304,
H317,
H411 |
Oral: ATE = 680 mg/kg bw |
|
ATP17 |
| 601-096-00-2 |
(R)-p-mentha-1,8-diene;d-limonene |
5989-27-5 |
Flam. Liq. 3,
Asp. Tox. 1,
Skin Irrit. 2,
Skin Sens. 1B,
Aquatic Acute 1,
Aquatic Chronic 3 |
H226,
H304,
H315,
H317,
H400,
H412 |
M=1 |
|
ATP17 |
| 601-097-00-8 |
Propylbenzene |
103-65-1 |
Flam. Liq. 3, Asp. Tox. 1, STOT SE 3, Aquatic Chronic 2 |
H226, H304, H335, H411 |
|
|
ATP18 |
| 602-001-00-7 |
chloromethane; methyl chloride |
74-87-3 |
Flam. Gas 1, Press. Gas, Carc. 2, STOT RE 2 * |
H220, H351, H373 ** |
|
U |
CLP00/ |
| 602-002-00-2 |
bromomethane; methylbromide |
74-83-9 |
Press. Gas, Muta. 2, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1, Ozone 1 |
H341,H331, H301, H373, **, H319, H335, H315, H400, H420 |
|
U |
CLP00/ATP02 |
| 602-003-00-8 |
dibromomethane |
74-95-3 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H332, H412 |
* |
|
CLP00/ |
| 602-004-00-3 |
dichloromethane; methylene chloride |
75-09-2 |
Carc. 2 |
H351 |
|
|
CLP00/ |
| 602-005-00-9 |
methyl iodide; iodomethane |
74-88-4 |
Carc. 2, Acute Tox. 4 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT SE 3, Skin Irrit. 2 |
H351, H312, H331, H301, H335, H315 |
|
|
CLP00/ |
| 602-006-00-4 |
trichloromethane; chloroform |
67-66-3 |
Carc. 2, Repr. 2, Acute Tox. 3, Acute Tox. 4, STOT RE 1, Eye Irrit. 2, Skin Irrit. 2 |
H351, H361d, H331, H302, H372, H319, H315 |
|
|
CLP00/ATP05 |
| 602-007-00-X |
bromoform; tribromomethane |
75-25-2 |
Acute Tox. 3 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Chronic 2 |
H331, H302, H319, H315, H411 |
|
|
CLP00/ATP01 |
| 602-008-00-5 |
carbon tetrachloride; tetrachloromethane |
56-23-5 |
Carc. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1, Aquatic Chronic 3, Ozone 1 |
H351, H331, H311, H301, H372 **, H412, H420 |
*, STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,2 % ≤ C < 1 % |
|
CLP00/ATP02 |
| 602-009-00-0 |
chloroethane |
75-00-3 |
Flam. Gas 1, Press. Gas, Carc. 2, Aquatic Chronic 3 |
H220, H351, H412 |
|
U |
CLP00/ |
| 602-010-00-6 |
1,2-dibromoethane |
106-93-4 |
Carc. 1B, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Chronic 2 |
H350, H331, H311, H301, H319, H335, H315, H411 |
* |
|
CLP00/ |
| 602-011-00-1 |
1,1-dichloroethane |
75-34-3 |
Flam. Liq. 2, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Aquatic Chronic 3 |
H225, H302, H319, H335, H412 |
* |
|
CLP00/ |
| 602-012-00-7 |
1,2-dichloroethane; ethylene dichloride |
107-06-2 |
Flam. Liq. 2, Carc. 1B, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H225, H350, H302, H319, H335, H315 |
|
|
CLP00/ |
| 602-013-00-2 |
1,1,1-trichloroethane; methyl chloroform |
71-55-6 |
Acute Tox. 4 *, Ozone 1 |
H332, H420 |
|
F |
CLP00/ATP02 |
| 602-014-00-8 |
1,1,2-trichloroethane |
79-00-5 |
Carc. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H351, H332, H312, H302 |
* |
|
CLP00/ |
| 602-015-00-3 |
1,1,2,2-tetrachloroethane |
79-34-5 |
Acute Tox. 2 *, Acute Tox. 1, Aquatic Chronic 2 |
H330, H310, H411 |
|
|
CLP00/ |
| 602-016-00-9 |
1,1,2,2-tetrabromoethane |
79-27-6 |
Acute Tox. 2 *, Eye Irrit. 2, Aquatic Chronic 3 |
H330, H319, H412 |
|
|
CLP00/ |
| 602-017-00-4 |
pentachloroethane |
76-01-7 |
Carc. 2, STOT RE 1, Aquatic Chronic 2 |
H351, H372 **, H411 |
STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,2 % ≤ C < 1 % |
|
CLP00/ |
| 602-018-00-X |
1-chloropropane; [1] 2-chloropropane [2] |
540-54-5 [1], 75-29-6 [2] |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H225, H332, H312, H302 |
|
C |
CLP00/ |
| 602-019-00-5 |
1-bromopropane; n-propyl bromide |
106-94-5 |
Flam. Liq. 2, Repr. 1B, STOT RE 2 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, STOT SE 3 |
H225, H360FD, H373 **, H319, H335, H315, H336 |
|
|
CLP00/ |
| 602-020-00-0 |
1,2-dichloropropane; propylene dichloride |
78-87-5 |
Flam. Liq. 2, Carc. 1B Acute Tox. 4 *, Acute Tox. 4 * |
H225, H350, H332, H302 |
|
|
CLP00/ |
| 602-021-00-6 |
1,2-dibromo-3-chloropropane |
96-12-8 |
Carc. 1B, Muta. 1B, Repr. 1A, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 3 |
H350, H340, H360F ***, H301, H373 **, H412 |
|
|
CLP00/ |
| 602-022-00-1 |
1-chloropentane; [1] 2-chloropentane; [2] 3-chloropentane [3] |
543-59-9 [1], 625-29-6 [2], 616-20-6 [3] |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H225, H332, H312, H302 |
|
C |
CLP00/ |
| 602-023-00-7 |
vinyl chloride; chloroethylene |
75-01-4 |
Press. Gas, Flam. Gas 1, Carc. 1A |
H220, H350 |
|
D U |
CLP00/ |
| 602-024-00-2 |
bromoethylene |
593-60-2 |
Press. Gas, Flam. Gas 1, Carc. 1B |
H220, H350 |
|
U |
CLP00/ |
| 602-025-00-8 |
1,1-dichloroethylene; vinylidene chloride |
75-35-4 |
Flam. Liq. 1, Carc. 2, Acute Tox. 4 * |
H224, H351, H332 |
* |
D |
CLP00/ |
| 602-026-00-3 |
1,2-dichloroethylene; [1] cis-dichloroethylene; [2] trans-dichloroethylene [3] |
540-59-0 [1], 156-59-2 [2], 156-60-5 [3] |
Flam. Liq. 2, Acute Tox. 4 *, Aquatic Chronic 3 |
H225, H332, H412 |
* |
C |
CLP00/ |
| 602-027-00-9 |
trichloroethylene; trichloroethene |
79-01-6 |
Carc. 1B, Muta. 2, Eye Irrit. 2, Skin Irrit. 2, STOT SE 3, Aquatic Chronic 3 |
H350, H341, H319, H315, H336, H412 |
|
|
CLP00/ |
| 602-028-00-4 |
tetrachloroethylene |
127-18-4 |
Carc. 2, Aquatic Chronic 2 |
H351, H411 |
|
|
CLP00/ |
| 602-029-00-X |
3-chloropropene; allyl chloride |
107-05-1 |
Flam. Liq. 2, Carc. 2, Muta. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1 |
H225, H351, H341, H332, H312, H302, H373 **, H319, H335, H315, H400 |
|
D |
CLP00/ |
| 602-030-00-5 |
1,3-dichloropropene; [1] (Z)-1,3-dichloropropene [2] |
542-75-6 [1], 10061-01-5 [2] |
Flam. Liq. 3, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 4 *, Asp. Tox. 1, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H226, H311, H301, H332, H304, H319, H335, H315, H317, H400, H410 |
|
C D |
CLP00/ATP01 |
| 602-031-00-0 |
1,1-dichloropropene |
563-58-6 |
Flam. Liq. 2, Acute Tox. 3 *, Aquatic Chronic 3 |
H225, H301, H412 |
|
|
CLP00/ |
| 602-032-00-6 |
3-chloro-2-methylpropene |
563-47-3 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 2 |
H225, H332, H302, H314, H317, H411 |
|
|
CLP00/ |
| 602-033-00-1 |
chlorobenzene |
108-90-7 |
Flam. Liq. 3, Acute Tox. 4, Skin Irrit. 2, Aquatic Chronic 2 |
H226, H332, H315, H411 |
|
|
CLP00/ATP09 |
| 602-034-00-7 |
1,2-dichlorobenzene; o-dichlorobenzene |
95-50-1 |
Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H335, H315, H400, H410 |
* |
|
CLP00/ |
| 602-035-00-2 |
1,4-dichlorobenzene; p-dichlorobenzene |
106-46-7 |
Carc. 2, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H319, H400, H410 |
|
|
CLP00/ |
| 602-036-00-8 |
chloroprene (stabilised); 2-chlorobuta-1,3-diene (stabilised) |
126-99-8 |
Flam. Liq. 2, Carc. 1B, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H225, H350, H332, H302, H373 **, H319, H335, H315 |
|
D |
CLP00/ |
| 602-037-00-3 |
α-chlorotoluene; benzyl chloride |
100-44-7 |
Carc. 1B, Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 2 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1 |
H350, H331, H302, H373 **, H335, H315, H318 |
|
|
CLP00/ |
| 602-038-00-9 |
α,α,α-trichlorotoluene; benzotrichloride |
98-07-7 |
Carc. 1B, Acute Tox. 3 *, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1 |
H350, H331, H302, H335, H315, H318 |
|
|
CLP00/ |
| 602-039-00-4 |
polychlorobiphenyls; PCB |
1336-36-3 |
STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H373 **, H400, H410 |
STOT RE 2; H373: C ≥ 0,005 % |
C |
CLP00/ |
| 602-040-00-X |
2-chlorotoluene; [1] 3-chlorotoluene; [2] 4-chlorotoluene; [3] chlorotoluene [4] |
95-49-8 [1], 108-41-8 [2], 106-43-4 [3], 25168-05-2 [4] |
Acute Tox. 4 *, Aquatic Chronic 2 |
H332, H411 |
|
C |
CLP00/ |
| 602-041-00-5 |
penthachloronaphthalene |
1321-64-8 |
Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H319, H315, H400, H410 |
|
C |
CLP00/ |
| 602-042-00-0 |
1,2,3,4,5,6-hexachlorcyclohexanes with the exception of those specified elsewhere in this Annex |
- |
Carc. 2, Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H301, H312, H400, H410 |
|
A C |
CLP00/ |
| 602-043-00-6 |
lindane (ISO); γ-HCH or γ-BHC; γ-1,2,3,4,5,6-hexachlorocyclohexane |
58-89-9 |
Acute Tox. 3 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Lact., Aquatic Acute 1, Aquatic Chronic 1 |
H301, H332, H312, H373 **, H362, H400, H410 |
M=10: |
|
CLP00/ |
| 602-044-00-1 |
camphechlor (ISO); toxaphene |
8001-35-2 |
Carc. 2, Acute Tox. 3 *, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H301, H312, H335, H315, H400, H410 |
|
|
CLP00/ |
| 602-045-00-7 |
DDT (ISO); clofenotane (INN); dicophane; 1,1,1-trichloro-2,2-bis(4-chlorophenyl)ethane; dichlorodiphenyltrichloroethane |
50-29-3 |
Carc. 2, Acute Tox. 3 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H301, H372 **, H400, H410 |
|
|
CLP00/ |
| 602-046-00-2 |
heptachlor (ISO); 1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-4,7-methanoindene |
76-44-8 |
Carc. 2, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H311, H301, H373 **, H400, H410 |
|
|
CLP00/ |
| 602-047-00-8 |
chlordane (ISO); 1,2,4,5,6,7,8,8-octachloro-3a,4,7,7a-tetrahydro-4,7-methanoindan |
57-74-9 |
Carc. 2, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H312, H302, H400, H410 |
|
|
CLP00/ |
| 602-048-00-3 |
aldrin (ISO) |
309-00-2 |
Carc. 2, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H311, H301, H372 **, H400, H410 |
|
|
CLP00/ |
| 602-049-00-9 |
dieldrin (ISO) |
60-57-1 |
Carc. 2, Acute Tox. 1, Acute Tox. 3 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H310, H301, H372 **, H400, H410 |
|
|
CLP00/ |
| 602-050-00-4 |
isodrin; (1α,4α,4aβ,5β,8β,8aβ)-1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-1,4:5,8-dimethanonaphthalene |
465-73-6 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H310, H300, H400, H410 |
M=100: |
|
CLP00/ATP01 |
| 602-051-00-X |
endrin (ISO); 1,2,3,4,10,10-hexachloro-6,7-epoxy-1,4,4a,5,6,7,8,8a-octahydro-1,4:5,8-dimethanonaphthalene |
72-20-8 |
Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H300, H311, H400, H410 |
|
|
CLP00/ |
| 602-052-00-5 |
endosulfan (ISO); 1,2,3,4,7,7-hexachloro-8,9,10-trinorborn-2-en-5,6-ylenedimethylene sulfite; 1,4,5,6,7,7-hexachloro-8,9,10-trinorborn-5-en-2,3-ylenedimethylene sulfite |
115-29-7 |
Acute Tox. 2 *, Acute Tox. 2 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H300, H312, H400, H410 |
|
|
CLP00/ATP01 |
| 602-053-00-0 |
isobenzan (ISO); 1,3,4,5,6,7,8,8-octachloro-1,3,3a,4,7,7a-hexahydro-4,7-methanoisobenzofuran |
297-78-9 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1 |
H310, H300, H400 |
|
|
CLP00/ |
| 602-054-00-6 |
3-iodpropene; allyl iodide |
556-56-9 |
Flam. Liq. 2, Skin Corr. 1B |
H225, H314 |
|
|
CLP00/ATP01 |
| 602-055-00-1 |
bromoethane; ethyl bromide |
74-96-4 |
Flam. Liq. 2, Carc. 2, Acute Tox. 4 *, Acute Tox. 4 * |
H225, H351, H332, H302 |
|
|
CLP00/ |
| 602-056-00-7 |
α,α,α-trifluorotoluene; benzotrifluoride |
98-08-8 |
Flam. Liq. 2, Aquatic Chronic 2 |
H225, H411 |
|
|
CLP00/ |
| 602-057-00-2 |
α-bromotoluene; benzyl bromide |
100-39-0 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H319, H335, H315 |
|
|
CLP00/ |
| 602-058-00-8 |
α,α-dichlorotoluene; benzylidene chloride; benzal chloride |
98-87-3 |
Carc. 2, Acute Tox. 3 *, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1 |
H351, H331, H302, H335, H315, H318 |
|
|
CLP00/ |
| 602-059-00-3 |
1-chlorobutane; butyl chloride |
109-69-3 |
Flam. Liq. 2 |
H225 |
|
|
CLP00/ |
| 602-060-00-9 |
bromobenzene |
108-86-1 |
Flam. Liq. 3, Skin Irrit. 2, Aquatic Chronic 2 |
H226, H315, H411 |
|
|
CLP00/ |
| 602-061-00-4 |
hexafluoropropene; hexafluoropropylene |
116-15-4 |
Press. Gas, Acute Tox. 4 *, STOT SE 3 |
H332, H335 |
|
U |
CLP00/ |
| 602-062-00-X |
1,2,3-trichloropropane |
96-18-4 |
Carc. 1B, Repr. 1B, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H350, H360F ***, H332, H312, H302 |
|
D |
CLP00/ |
| 602-063-00-5 |
heptachlor epoxide; 2,3-epoxy-1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-4,7-methanoindane |
1024-57-3 |
Carc. 2, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H301, H373 **, H400, H410 |
|
|
CLP00/ |
| 602-064-00-0 |
1,3-dichloro-2-propanol |
96-23-1 |
Carc. 1B, Acute Tox. 3 *, Acute Tox. 4 * |
H350, H301, H312 |
|
|
CLP00/ |
| 602-065-00-6 |
hexachlorobenzene |
118-74-1 |
Carc. 1B, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H372 **, H400, H410 |
|
|
CLP00/ |
| 602-066-00-1 |
tetrachloro-p-benzoquinone |
118-75-2 |
Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H315, H400, H410 |
|
|
CLP00/ |
| 602-067-00-7 |
1,3-dichlorbenzene |
541-73-1 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 602-068-00-2 |
ethylene bis(trichloroacetate) |
2514-53-6 |
Skin Irrit. 2 |
H315 |
|
|
CLP00/ |
| 602-069-00-8 |
dichloroacetylene |
7572-29-4 |
Unst. Expl., Carc. 2, STOT RE 2 * |
H200, H351, H373 ** |
|
|
CLP00/ |
| 602-070-00-3 |
3-chloro-4,5,α, α,α-pentafluorotoluene |
77227-99-7 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1 |
H226, H332, H302, H400 |
|
|
CLP00/ |
| 602-071-00-9 |
bromobenzylbromotoluene, reaction mass of isomers |
99688-47-8 |
STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H373 **, H317, H400, H410 |
|
|
CLP00/ |
| 602-072-00-4 |
dichloro [(dichlorophenyl)methyl]methylbenzene, reaction mass of isomers; (dichlorophenyl)(dichlorotolyl)methane, reaction mass of isomers (IUPAC) |
76253-60-6 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 602-073-00-X |
1,4-dichlorobut-2-ene |
764-41-0 |
Carc. 1B, Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H330, H311, H301, H314, H400, H410 |
Carc. 1B; H350: C ≥ 0,01 %, STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 602-074-00-5 |
pentachlorobenzene |
608-93-5 |
Flam. Sol. 1, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H228, H302, H400, H410 |
|
T |
CLP00/ |
| 602-075-00-0 |
4,4,5,5-tetrachloro-1,3-dioxolan-2-one |
22432-68-4 |
Acute Tox. 2 *, Acute Tox. 4 *, Skin Corr. 1B |
H330, H302, H314 |
|
|
CLP00/ |
| 602-076-00-6 |
2,3,4-trichlorobut-1-ene |
2431-50-7 |
Carc. 2, Acute Tox. 3 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H331, H302, H319, H335, H315, H400, H410 |
Carc. 2; H351: C ≥ 0,1 % |
|
CLP00/ATP01 |
| 602-077-00-1 |
dodecachloropentacyclo[5.2.1.02,6.03,9.05,8]decane; mirex |
2385-85-5 |
Carc. 2, Repr. 2, Lact., Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H361fd, H362, H312, H302, H400, H410 |
|
|
CLP00/ |
| 602-078-00-7 |
hexachlorocyclopentadiene |
77-47-4 |
Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 4 *, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H311, H302, H314, H400, H410 |
|
|
CLP00/ |
| 602-079-00-2 |
2,3-dichloropropene; 2,3-dichloropropylene |
78-88-6 |
Flam. Liq. 2, Muta. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 3 |
H225, H341, H332, H312, H302, H335, H315, H318, H412 |
|
|
CLP00/ |
| 602-080-00-8 |
alkanes, C10-13, chloro; chlorinated paraffins, C10-13 |
85535-84-8 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H400, H410 |
|
|
CLP00/ATP01 |
| 602-081-00-3 |
2-chloro-4,5-difluorobenzoic acid |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1 |
H312, H302, H318, H317 |
|
|
CLP00/ |
| 602-082-00-9 |
2,2,6,6-tetrakis(bromomethyl)-4-oxaheptane-1,7-diol |
109678-33-3 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 602-083-00-4 |
diphenyl ether, pentabromo derivative pentabromodiphenyl ether |
32534-81-9 |
STOT RE 2 *, Lact., Aquatic Acute 1, Aquatic Chronic 1 |
H373 **, H362, H400, H410 |
|
|
CLP00/ |
| 602-084-00-X |
1,1-dichloro-1-fluoroethane |
1717-00-6 |
Aquatic Chronic 3, Ozone 1 |
H412, H420 |
|
|
CLP00/ATP02 |
| 602-085-00-5 |
2-bromopropane |
75-26-3 |
Flam. Liq. 2, Repr. 1A, STOT RE 2 * |
H225, H360F ***, H373 ** |
|
|
CLP00/ |
| 602-086-00-0 |
trifluoroiodomethane; trifluoromethyl iodide |
2314-97-8 |
Muta. 2 |
H341 |
|
|
CLP00/ |
| 602-087-00-6 |
1,2,4-trichlorobenzene |
120-82-1 |
Acute Tox. 4 *, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H315, H400, H410 |
|
|
CLP00/ |
| 602-088-00-1 |
2,3-dibromopropan-1-ol; 2,3-dibromo-1-propanol |
96-13-9 |
Carc. 1B, Repr. 2, Acute Tox. 3 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 3 |
H350, H361f ***, H311, H332, H302, H412 |
|
|
CLP00/ |
| 602-089-00-7 |
4-bromo-2-chlorofluorobenzene |
60811-21-4 |
Acute Tox. 4 *, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H315, H400, H410 |
|
|
CLP00/ |
| 602-090-00-2 |
1-allyl-3-chloro-4-fluorobenzene |
121626-73-1 |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ |
| 602-091-00-8 |
1,3-dichloro-4-fluorobenzene |
1435-48-9 |
Acute Tox. 4 *, STOT RE 2 *, Skin Irrit. 2, |
H302, H373 **, H315, H411 |
|
|
CLP00/ |
| 602-092-00-3 |
1-bromo-3,4,5-trifluorobenzene |
138526-69-9 |
Flam. Liq. 3, Carc. 2, Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 2 |
H226, H351, H315, H318, H411 |
|
|
CLP00/ |
| 602-093-00-9 |
α, α,α,4-tetrachlorotoluene; p-chlorobenzotrichloride |
5216-25-1 |
Carc. 1B, Repr. 2, STOT RE 1, Acute Tox. 4 *, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2 |
H350, H361f ***, H372 **, H312, H302, H335, H315 |
|
|
CLP00/ |
| 602-094-00-4 |
diphenylether; octabromo derivate |
32536-52-0 |
Repr. 1B |
H360Df |
|
|
CLP00/ |
| 602-095-00-X |
alkanes, C14-17, chloro; chlorinated paraffins, C14-17 |
85535-85-9 |
Lact., Aquatic Acute 1, Aquatic Chronic 1 |
H362, H400, H410 |
|
|
ATP01/ |
| 602-096-00-5 |
malachite green hydrochloride; [1] malachite green oxalate [2] |
569-64-2 [1], 2437-29-8 [2] |
Repr. 2, Acute Tox. 4 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361d ***, H302, H318, H400, H410 |
|
|
CLP00/ |
| 602-097-00-0 |
1-bromo-9-(4,4,5,5,5-pentafluoropentylthio)nonane |
148757-89-5 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 602-098-00-6 |
2-(3-bromophenoxy)tetrahydro-2H-pyran |
57999-49-2 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 602-099-00-1 |
3-(4-fluorophenyl)-2-methylpropionylchloride |
- |
Skin Corr. 1A, Acute Tox. 4 *, Aquatic Chronic 3 |
H314, H302, H412 |
|
|
ATP01/ |
| 602-100-00-5 |
reaction mass of: (R,R)-1,1,1,2,2,3,4,5,5,5-decafluoropentane; (S,S)-1,1,1,2,2,3,4,5,5,5-decafluoropentane |
- |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 602-101-00-0 |
2-chloro-4-fluoro-5-nitrophenyl (isobutyl)carbonate |
141772-37-4 |
STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H373**, H317, H400, H410 |
|
|
ATP01/ |
| 602-102-00-6 |
1,1,1,3,3-pentafluorobutane |
406-58-6 |
Flam. Liq. 2 |
H225 |
|
|
ATP01/ |
| 602-103-00-1 |
1-(chlorophenylmethyl)-2-methylbenzene |
41870-52-4 |
Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H400, H410 |
|
|
ATP01/ |
| 602-104-00-7 |
1,1,2,2,3,3,4-heptafluorocyclopentane |
15290-77-4 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 602-105-00-2 |
sodium 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfinate |
102061-82-5 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
ATP01/ |
| 602-106-00-8 |
2-bromo-4,6-difluoroaniline |
444-14-4 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
ATP01/ |
| 602-107-00-3 |
3,3,4,4-tetrafluoro-4-iodo-1-butene |
33831-83-3 |
Acute Tox. 4 *, Skin Irrit. 2, Aquatic Chronic 2 |
H302, H315, H411 |
|
|
ATP01/ |
| 602-108-00-9 |
(2,3,5,6-tetrafluorophenyl)methanol |
4084-38-2 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1 |
H302, H319, H317 |
|
|
ATP01/ |
| 602-109-00-4 |
Hexabromocyclododecane [1]; 1,2,5,6,9,10- hexabromocyclododecane [2] |
25637-99-4[1]; 3194-55-6[2] |
Repr. 2, Lact. |
H361, H362 |
|
|
ATP03 |
| 602-110-00-X |
tetrafluoroethylene |
116-14-3 |
Carc. 1B |
H350 |
|
|
ATP17 |
| 603-001-00-X |
methanol |
67-56-1 |
Flam. Liq. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT SE 1 |
H225, H331, H311, H301, H370 ** |
*, STOT SE 1; H370: C ≥ 10 %, STOT SE 2; H371: 3 % ≤ C < 10 % |
|
CLP00/ |
| 603-002-00-5 |
ethanol; ethyl alcohol |
64-17-5 |
Flam. Liq. 2 |
H225 |
|
|
CLP00/ |
| 603-003-00-0 |
propan-1-ol; n-propanol |
71-23-8 |
Flam. Liq. 2, Eye Dam. 1, STOT SE 3 |
H225, H318, H336 |
|
|
CLP00/ |
| 603-004-00-6 |
butan-1-ol; n-butanol |
71-36-3 |
Flam. Liq. 3, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, STOT SE 3 |
H226, H302, H335, H315, H318, H336 |
|
|
CLP00/ |
| 603-005-00-1 |
2-methylpropan-2-ol; tert-butyl alcohol |
75-65-0 |
Flam. Liq. 2, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3 |
H225, H332, H319, H335 |
|
|
CLP00/ATP01 |
| 603-006-00-7 |
pentanol isomers, with the exception fo those specified elsewhere in this Annex |
- |
Flam. Liq. 3, Acute Tox. 4 *, STOT SE 3 |
H226, H332, H335 |
|
C |
CLP00/ |
| 603-007-00-2 |
2-methylbutan-2-ol; tert-pentanol |
75-85-4 |
Flam. Liq. 2, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2 |
H225, H332, H335, H315 |
|
|
CLP00/ |
| 603-008-00-8 |
4-methylpentan-2-ol; methyl isobutyl carbinol |
108-11-2 |
Flam. Liq. 3, STOT SE 3 |
H226, H335 |
STOT SE 3; H335: C ≥ 25 % |
|
CLP00/ |
| 603-009-00-3 |
cyclohexanol |
108-93-0 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2 |
H332, H302, H335, H315 |
|
|
CLP00/ |
| 603-010-00-9 |
2-methylcyclohexanol, mixed isomers; [1] cis-2-methylcyclohexanol; [2] trans-2-methylcyclohexanol [3] |
583-59-5 [1], 7443-70-1 [2], 7443-52-9 [3] |
Acute Tox. 4 * |
H332 |
|
C |
CLP00/ |
| 603-011-00-4 |
2-methoxyethanol; ethylene glycol monomethyl ether |
109-86-4 |
Flam. Liq. 3, Repr. 1B, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H226, H360FD, H332, H312, H302 |
|
|
CLP00/ |
| 603-012-00-X |
2-ethoxyethanol; ethylene glycol monoethyl ether |
110-80-5 |
Flam. Liq. 3, Repr. 1B, Acute Tox. 3, Acute Tox. 4 |
H226, H360FD, H331, H302 |
|
|
CLP00/ATP03 |
| 603-013-00-5 |
2-isopropoxyethanol; ethylene glycol monoisopropyl ether |
109-59-1 |
Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2 |
H332, H312, H319 |
|
|
CLP00/ |
| 603-014-00-0 |
2-butoxyethanol; ethylene glycol monobutyl ether |
111-76-2 |
Acute Tox. 3, Acute Tox. 4, Skin Irrit. 2, Eye Irrit. 2 |
H331, H302, H315, H319 |
inhalation: ATE = 3 mg/L (Vapours); oral: ATE = 1200 mg/kg |
|
CLP00/ATP15/ATP18 |
| 603-015-00-6 |
allyl alcohol |
107-18-6 |
Flam. Liq. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1 |
H225, H331, H311, H301, H319, H335, H315, H400 |
|
|
CLP00/ |
| 603-016-00-1 |
4-hydroxy-4-methylpentan-2-one; diacetone alcohol |
123-42-2 |
Eye Irrit. 2 |
H319 |
Eye Irrit. 2; H319: C ≥ 10 % |
|
CLP00/ |
| 603-018-00-2 |
furfuryl alcohol |
98-00-0 |
Carc. 2, Acute Tox. 3 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Eye Irrit. 2, STOT SE 3 |
H351, H331, H312, H302, H373**, H319, H335 |
|
|
CLP00/ATP01 |
| 603-019-00-8 |
dimethyl ether |
115-10-6 |
Flam. Gas 1, Press. Gas |
H220 |
|
U |
CLP00/ |
| 603-020-00-3 |
ethyl methyl ether |
540-67-0 |
Flam. Gas 1, Press. Gas |
H220 |
|
U |
CLP00/ |
| 603-021-00-9 |
methyl vinyl ether |
107-25-5 |
Flam. Gas 1, Press. Gas |
H220 |
|
D U |
CLP00/ |
| 603-022-00-4 |
diethyl ether; ether |
60-29-7 |
Flam. Liq. 1, Acute Tox. 4 *, STOT SE 3 |
H224, H302, H336 |
|
|
CLP00/ |
| 603-023-00-X |
ethylene oxide; oxirane |
75-21-8 |
Flam. Gas 1, Press. Gas, Carc. 1B, Muta. 1B, Repr. 1B, Acute Tox. 3, Acute Tox. 3, STOT SE 3, STOT SE 3, STOT RE 1, Skin Corr. 1, Eye Dam. 1 |
H220, , H350, H340, H360Fd, H331, H301, H335, H336, H372 (nervous system), H314, H318 |
Inhalation: ATE = 700 ppmV (Gases)
Oral: ATE = 100 mg/kg
|
U |
CLP00/ATP14 |
| 603-024-00-5 |
1,4-dioxane |
123-91-1 |
Flam. Liq. 2,
Carc. 1B,
STOT SE 3,
Eye Irrit. 2 |
H225,
H350,
H335,
H319 |
|
D |
CLP00/ATP17 |
| 603-025-00-0 |
tetrahydrofuran |
109-99-9 |
Flam. Liq. 2, Carc. 2, Eye Irrit. 2, STOT SE 3 |
H225, H351, H319, H335, EUH019 |
Eye Irrit. 2; H319: C ≥ 25 %, STOT SE 3; H335: C ≥ 25 % |
|
CLP00/ATP03 |
| 603-026-00-6 |
1-chloro-2,3-epoxypropane; epichlorhydrin |
106-89-8 |
Flam. Liq. 3, Carc. 1B, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B, Skin Sens. 1 |
H226, H350, H331, H311, H301, H314, H317 |
* |
|
CLP00/ |
| 603-027-00-1 |
ethanediol; ethylene glycol |
107-21-1 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 603-028-00-7 |
2-chloroethanol; ethylene chlorohydrin |
107-07-3 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 * |
H330, H310, H300 |
|
|
CLP00/ |
| 603-029-00-2 |
bis(2-chloroethyl) ether |
111-44-4 |
Carc. 2, Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 * |
H351, H330, H310, H300 |
|
|
CLP00/ATP01 |
| 603-030-00-8 |
2-aminoethanol; ethanolamine |
141-43-5 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H332, H312, H302, H314 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 603-031-00-3 |
1,2-dimethoxyethane; ethylene glycol dimethyl ether; EGDME |
110-71-4 |
Flam. Liq. 2, Repr. 1B, Acute Tox. 4 * |
H225, H360FD, H332 |
|
|
CLP00/ |
| 603-032-00-9 |
ethylene dinitrate; ethylene glycol dinitrate |
628-96-6 |
Unst. Expl., Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2 |
H200, H330, H310, H300, H373** |
|
|
CLP00/ATP01 |
| 603-033-00-4 |
oxydiethylene dinitrate; diethylene glycol dinitrate; digol dinitrate |
693-21-0 |
Unst. Expl, Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2 *, Aquatic Chronic 3 |
H200, H330, H310, H300, H373 **, H412 |
|
|
CLP00/ |
| 603-033-01-1 |
oxydiethylene dinitrate; diethylene glycol dinitrate; digol dinitrate; [>25 % phlegmatiser] |
693-21-0 |
Expl. 1.1, Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2 *, Aquatic Chronic 3 |
H201, H330, H310, H300, H373 **, H412 |
|
|
CLP00/ |
| 603-034-00-X |
glycerol trinitrate; nitroglycerine |
55-63-0 |
Unst. Expl., Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2 *, Aquatic Chronic 2 |
H200, H330, H310, H300, H373 **, H411 |
|
|
CLP00/ |
| 603-034-01-7 |
glycerol trinitrate; nitroglycerine; [>40 % phlegmatiser] |
55-63-0 |
Expl. 1.1, Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2 *, Aquatic Chronic 2 |
H201, H330, H310, H300, H373 **, H411 |
|
|
CLP00/ |
| 603-035-00-5 |
pentaerythritol tetranitrate; P.E.T.N. |
78-11-5 |
Unst. Expl. |
H200 |
|
|
CLP00/ |
| 603-035-01-2 |
pentaerythritol tetranitrate; pentaerythrite tetranitrate; P.E.T.N.; [>20 % phlegmatiser] |
78-11-5 |
Expl. 1.1 |
H201 |
|
T |
CLP00/ |
| 603-036-00-0 |
mannitol hexanitrate; nitromannite |
15825-70-4 |
Unst. Expl. |
H200 |
|
|
CLP00/ |
| 603-036-01-8 |
mannitol hexanitrate; nitromannite; [>40 % phlegmatiser] |
15825-70-4 |
Expl. 1.1 |
H201 |
|
|
CLP00/ |
| 603-037-00-6 |
cellulose nitrate; nitrocellulose |
- |
Expl. 1.1 |
H201 |
|
T |
CLP00/ATP01 |
| 603-038-00-1 |
allyl glycidyl ether; allyl 2,3-epoxypropyl ether; prop-2-en-1-yl 2,3-epoxypropyl ether |
106-92-3 |
Flam. Liq. 3, Carc. 2, Muta. 2, Repr. 2, Acute Tox. 4 *, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H226, H351, H341, H361f ***, H332, H302, H335, H315, H318, H317, H412 |
|
|
CLP00/ |
| 603-039-00-7 |
butyl glycidyl ether; butyl 2,3-epoxypropyl ether |
2426-08-6 |
Flam. Liq. 3, Carc. 2, Muta. 2, Acute Tox. 4 *, Acute Tox. 4 *, STOT SE 3, Skin Sens. 1, Aquatic Chronic 3 |
H226, H351, H341, H332, H302, H335, H317, H412 |
|
|
CLP00/ |
| 603-040-00-2 |
sodium methanolate; sodium methoxide; [1] potassium methanolate; potassium methoxide; [2] lithium methanolate; lithium methoxide [3] |
124-41-4 [1], 865-33-8 [2], 865-34-9 [3] |
Self-heat 1, Skin Corr. 1B |
H251, H314 |
|
T |
CLP00/ |
| 603-041-00-8 |
potassium ethanolate; potassium ethoxide; [1] sodium ethanolate; sodium ethoxide [2] |
917-58-8 [1], 141-52-6 [2] |
Self-heat 1, Skin Corr. 1B |
H251, H314 |
|
T |
CLP00/ |
| 603-042-00-3 |
aluminium-tri-isopropoxide |
555-31-7 |
Flam. Sol. 1 |
H228 |
|
T |
CLP00/ |
| 603-043-00-9 |
triarimol (ISO); 2,4-dichloro-α-(pyrimidin-5-yl) benzhydryl alcohol |
26766-27-8 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 603-044-00-4 |
dicofol (ISO); 2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethanol |
115-32-2 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H315, H317, H400, H410 |
|
|
CLP00/ |
| 603-045-00-X |
diisopropyl ether; [1] dipropyl ether [2] |
108-20-3 [1], 111-43-3 [2] |
Flam. Liq. 2, STOT SE 3 |
H225, H336 |
|
C |
CLP00/ |
| 603-046-00-5 |
bis(chloromethyl) ether; oxybis(chloromethane) |
542-88-1 |
Flam. Liq. 2, Carc. 1A, Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 4 * |
H225, H350, H330, H311, H302 |
Carc. 1A; H350: C ≥ 0,001 % |
|
CLP00/ATP01 |
| 603-047-00-0 |
2-dimethylaminoethanol; N,N-dimethylethanolamine |
108-01-0 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H226, H332, H312, H302, H314 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 603-048-00-6 |
2-diethylaminoethanol; N,N-diethylethanolamine |
100-37-8 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H226, H332, H312, H302, H314 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 603-049-00-1 |
chlorfenethol (ISO); 1,1-bis (4-chlorophenyl) ethanol |
80-06-8 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 603-050-00-7 |
1-(2-Butoxypropoxy)propan-2-ol |
24083-03-2 |
Acute Tox. 4 *, Acute Tox. 4 * |
H312, H302 |
|
|
CLP00/ |
| 603-051-00-2 |
2-ethylbutan-1-ol |
97-95-0 |
Acute Tox. 4 *, Acute Tox. 4 * |
H312, H302 |
|
|
CLP00/ |
| 603-052-00-8 |
3-butoxypropan-2-ol; propylene glycol monobutyl ether |
5131-66-8 |
Eye Irrit. 2, Skin Irrit. 2 |
H319, H315 |
|
|
CLP00/ |
| 603-053-00-3 |
2-methylpentane-2,4-diol |
107-41-5 |
Eye Irrit. 2, Skin Irrit. 2 |
H319, H315 |
|
|
CLP00/ |
| 603-054-00-9 |
di-n-butyl ether; dibutyl ether |
142-96-1 |
Flam. Liq. 3, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Chronic 3 |
H226, H319, H335, H315, H412 |
STOT SE 3; H335: C ≥ 10 % |
|
CLP00/ |
| 603-055-00-4 |
propylene oxide; 1,2-epoxypropane; methyloxirane |
75-56-9 |
Flam. Liq. 1, Carc. 1B, Muta. 1B, Acute Tox. 3, Acute Tox. 3, Acute Tox. 4, STOT SE 3, Eye Irrit. 2 |
H224, H350, H340, H331, H311, H302, H335, H319 |
|
|
CLP00/ATP09 |
| 603-056-00-X |
[(p-tolyloxy)methyl]oxirane; [1] [(m-tolyloxy)methyl]oxirane; [2] 2,3-epoxypropyl o-tolyl ether; [3] [(tolyloxy)methyl]oxirane; cresyl glycidyl ether [4] |
2186-24-5 [1], 2186-25-6 [2], 2210-79-9 [3], 26447-14-3 [4] |
Muta. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H341, H315, H317, H411 |
|
C |
CLP00/ |
| 603-057-00-5 |
benzyl alcohol |
100-51-6 |
Acute Tox. 4 *, Acute Tox. 4 * |
H332, H302 |
|
|
CLP00/ |
| 603-058-00-0 |
1,3-propylene oxide |
503-30-0 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H225, H332, H312, H302 |
|
|
CLP00/ |
| 603-059-00-6 |
hexan-1-ol |
111-27-3 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 603-060-00-1 |
2,2'-bioxirane; 1,2:3,4-diepoxybutane |
1464-53-5 |
Carc. 1B, Muta. 1B, Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B |
H350, H340, H330, H311, H301, H314 |
|
|
CLP00/ |
| 603-061-00-7 |
tetrahydro-2-furylmethanol; tetrahydrofurfuryl alcohol |
97-99-4 |
Repr. 1B, Eye Irrit. 2 |
H360Df, H319 |
|
|
CLP00/ATP06 |
| 603-062-00-2 |
tetrahydrofuran-2,5-diyldimethanol |
104-80-3 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H319, H335, H315 |
STOT SE 3; H335: C ≥ 10 % |
|
CLP00/ |
| 603-063-00-8 |
2,3-epoxypropan-1-ol; glycidol; oxiranemethanol |
556-52-5 |
Carc. 1B, Muta. 2, Repr. 1B, Acute Tox. 3 *, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H350, H341, H360F ***, H331, H312, H302, H319, H335, H315 |
|
|
CLP00/ |
| 603-064-00-3 |
1-methoxy-2-propanol; monopropylene glycol methyl ether |
107-98-2 |
Flam. Liq. 3, STOT SE 3 |
H226, H336 |
|
|
CLP00/ATP01 |
| 603-065-00-9 |
m-bis(2,3-epoxypropoxy)benzene; resorcinol diglycidyl ether |
101-90-6 |
Carc. 1B, Muta. 2, Acute Tox. 3, Acute Tox. 4, Skin Irrit. 2, Eye Irrit. 2, Skin Sens. 1, Aquatic Chronic 3 |
H350, H341, H311, H302, H315, H319, H317, H412 |
Dermal: ATE = 300 mg/kg, Oral: ATE = 500 mg/kg |
|
CLP00/ATP15 |
| 603-066-00-4 |
7-oxa-3-oxiranylbicyclo [4.1.0]heptane; 1,2-epoxy- 4-epoxyethylcyclohexane; 4-vinylcyclohexene diepoxide |
106-87-6 |
Carc. 1B,
Muta. 2,
Repr. 1B,
Acute Tox. 3,
Acute Tox. 4 |
H350,
H341,
H360F,
H331,
H302 |
Inhalation: ATE = 0.5 mg/L (dusts/mists),
Oral: ATE = 847 mg/kg bw |
|
CLP00/ATP01/ATP17 |
| 603-067-00-X |
phenyl glycidyl ether; 2,3-epoxypropyl phenyl ether; 1,2-epoxy-3-phenoxypropane |
122-60-1 |
Carc. 1B, Muta. 2, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 3 |
H350, H341, H332, H335, H315, H317, H412 |
|
|
CLP00/ |
| 603-068-00-5 |
2,3-epoxypropyl-2-ethylcyclohexyl ether; ethylcyclohexylglycidyl ether |
130014-35-6 |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H319, H315, H317 |
|
|
CLP00/ |
| 603-069-00-0 |
2,4,6-tris(dimethylaminomethyl)phenol |
90-72-2 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2 |
H302, H319, H315 |
|
|
CLP00/ |
| 603-070-00-6 |
2-amino-2-methylpropanol |
124-68-5 |
Eye Irrit. 2, Skin Irrit. 2, Aquatic Chronic 3 |
H319, H315, H412 |
|
|
CLP00/ |
| 603-071-00-1 |
2,2'-iminodiethanol; diethanolamine |
111-42-2 |
Acute Tox. 4 *, STOT RE 2 *, Skin Irrit. 2, Eye Dam. 1 |
H302, H373 **, H315, H318 |
|
|
CLP00/ |
| 603-072-00-7 |
1,4-bis(2,3 epoxypropoxy)butane; butanedioldiglycidyl ether |
2425-79-8 |
Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H332, H312, H319, H315, H317 |
|
|
CLP00/ |
| 603-073-00-2 |
bis-[4-(2,3-epoxipropoxi)phenyl]propane |
1675-54-3 |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H319, H315, H317 |
Eye Irrit. 2; H319: C ≥ 5 %, Skin Irrit. 2; H315: C ≥ 5 % |
|
CLP00/ |
| 603-074-00-8 |
reaction product: bisphenol-A-(epichlorhydrin); epoxy resin (number average molecular weight ≤ 700) |
25068-38-6 |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H319, H315, H317, H411 |
Eye Irrit. 2; H319: C ≥ 5 %, Skin Irrit. 2; H315: C ≥ 5 % |
|
CLP00/ |
| 603-075-00-3 |
chlormethyl methyl ether; chlorodimethyl ether |
107-30-2 |
Flam. Liq. 2, Carc. 1A, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H225, H350, H332, H312, H302 |
|
|
CLP00/ |
| 603-076-00-9 |
but-2-yne-1,4-diol; 2-butyne-1,4-diol |
110-65-6 |
Skin Corr. 1B, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1 |
H314, H331, H301, H312, H373 **, H317 |
Skin Corr. 1B; H314: C ≥ 50 %, Skin Irrit. 2; H315: 25 % ≤ C < 50 %, Eye Irrit. 2; H319: 25 % ≤ C < 50 % |
D |
CLP00/ |
| 603-077-00-4 |
1-dimethylaminopropan-2-ol; dimepranol (INN) |
108-16-7 |
Flam. Liq. 3, Acute Tox. 4 *, Skin Corr. 1B |
H226, H302, H314 |
|
|
CLP00/ |
| 603-078-00-X |
prop-2-yn-1-ol; propargyl alcohol |
107-19-7 |
Flam. Liq. 3, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B, Aquatic Chronic 2 |
H226, H331, H311, H301, H314, H411 |
|
|
CLP00/ |
| 603-079-00-5 |
2,2'-(methylimino)diethanol; N-methyldiethanolamine |
105-59-9 |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 603-080-00-0 |
2-methylaminoethanol; N-methylethanolamine; N-methyl-2-ethanolamine; N-methyl-2-amino ethanol; 2-(methylamino)ethanol |
109-83-1 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H312, H302, H314 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 603-081-00-6 |
2,2'-thiodiethanol; thiodiglycol |
111-48-8 |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 603-082-00-1 |
1-aminopropan-2-ol; isopropanolamine |
78-96-6 |
Skin Corr. 1B |
H314 |
|
|
CLP00/ |
| 603-083-00-7 |
1,1'-iminodipropan-2-ol; di-isopropanolamine |
110-97-4 |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 603-084-00-2 |
styrene oxide; (epoxyethyl)benzene; phenyloxirane |
96-09-3 |
Carc. 1B, Acute Tox. 4 *, Eye Irrit. 2 |
H350, H312, H319 |
|
|
CLP00/ |
| 603-085-00-8 |
bronopol (INN); 2-bromo-2-nitropropane-1,3-diol |
52-51-7 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1 |
H312, H302, H335, H315, H318, H400 |
M=10: |
|
CLP00/ATP01 |
| 603-086-00-3 |
ethirimol (ISO); 5-butyl-2-ethylamino-6-methylpyrimidin-4-ol |
23947-60-6 |
Acute Tox. 4 * |
H312 |
|
|
CLP00/ |
| 603-087-00-9 |
2-ethylhexane-1,3-diol; octylene glycol; ethoexadiol |
94-96-2 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 603-088-00-4 |
2-(octylthio)ethanol; 2-hydroxyethyl octyl sulphide |
3547-33-9 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 603-089-00-X |
7,7-dimethyl-3-oxa-6-azaoctan-1-ol |
- |
Skin Corr. 1A, Acute Tox. 4 * |
H314, H302 |
|
|
CLP00/ |
| 603-090-00-5 |
2-(2-bromoethoxy)anisole |
4463-59-6 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 603-091-00-0 |
exo-1-methyl-4-(1-methylethyl)-7-oxabicyclo[2.2.1]heptan-2-ol |
87172-89-2 |
Acute Tox. 4 *, Eye Dam. 1 |
H302, H318 |
|
|
CLP00/ |
| 603-092-00-6 |
2-methyl-4-phenylpentanol |
92585-24-5 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 603-093-00-1 |
cinmethylin (ISO); exo-(±)-1-methyl-2-(2-methylbenzyloxy)-4-isopropyl-7-oxabicyclo(2.2.1)heptane |
87818-31-3 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H332, H411 |
|
|
CLP00/ |
| 603-094-00-7 |
1,3-bis(2,3-epoxypropoxy)-2,2-dimethylpropane |
17557-23-2 |
Skin Irrit. 2, Skin Sens. 1 |
H315, H317 |
|
|
CLP00/ |
| 603-095-00-2 |
2-(propyloxy)ethanol; EGPE |
2807-30-9 |
Acute Tox. 4 *, Eye Irrit. 2 |
H312, H319 |
|
|
CLP00/ |
| 603-096-00-8 |
2-(2-butoxyethoxy)ethanol; diethylene glycol monobutyl ether |
112-34-5 |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 603-097-00-3 |
1,1',1''-nitrilotripropan-2-ol; triisopropanolamine |
122-20-3 |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ATP05 |
| 603-098-00-9 |
2-phenoxyethanol |
122-99-6 |
Acute Tox. 4,
STOT SE 3,
Eye Dam. 1 |
H302,
H335,
H318 |
Oral: ATE = 1394 mg/kg bw |
|
CLP00/ATP17 |
| 603-099-00-4 |
3-(N-methyl-N-(4-methylamino-3-nitrophenyl)amino)propane-1,2-diol hydrochloride |
93633-79-5 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 603-100-00-8 |
1,2-dimethoxypropane |
7778-85-0 |
Flam. Liq. 2 |
H225 |
|
|
CLP00/ |
| 603-101-00-3 |
tetrahydro-2-isobutyl-4-methylpyran-4-ol, mixed isomers (cis and trans) |
- |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 603-102-00-9 |
1,2-epoxybutane |
106-88-7 |
Flam. Liq. 2, Carc. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Eye Irrit. 2 |
H225, H351, H302, H312, H332, H335, H315, H319 |
|
|
CLP00/ATP07 |
| 603-103-00-4 |
oxirane, mono[(C12-14-alkyloxy)methyl] derivs. |
68609-97-2 |
Skin Irrit. 2, Skin Sens. 1 |
H315, H317 |
|
|
CLP00/ |
| 603-104-00-X |
fenarimol (ISO); 2,4'-dichloro-α-(pyrimidin-5-yl)benzhydryl alcohol |
60168-88-9 |
Repr. 2, Lact., Aquatic Chronic 2 |
H361fd, H362, H411 |
|
|
CLP00/ |
| 603-105-00-5 |
furan |
110-00-9 |
Flam. Liq. 1, Carc. 1B, Muta. 2, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Irrit. 2, Aquatic Chronic 3 |
H224, H350, H341, H332, H302, H373 **, H315, H412 |
|
|
CLP00/ |
| 603-106-00-0 |
2-methoxypropanol |
1589-47-5 |
Flam. Liq. 3, Repr. 1B, STOT SE 3, Skin Irrit. 2, Eye Dam. 1 |
H226, H360D ***, H335, H315, H318 |
|
|
CLP00/ |
| 603-107-00-6 |
2-(2-methoxyethoxy)ethanol; diethylene glycol monomethyl ether |
111-77-3 |
Repr. 1B |
H360D |
Repr. 1B; H360D: C >= 3 % |
|
CLP00/ATP18 |
| 603-108-00-1 |
2-methylpropan-1-ol; iso-butanol |
78-83-1 |
Flam. Liq. 3, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, STOT SE 3 |
H226, H335, H315, H318, H336 |
|
|
CLP00/ |
| 603-109-00-7 |
reaction mass of: 1-ethoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane; 1-ethoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 603-110-00-2 |
reaction mass of: cis-2-isobutyl-5-methyl 1,3-dioxane; trans-2-isobutyl-5-methyl 1,3-dioxane |
166301-21-9 |
Skin Irrit. 2, Aquatic Chronic 3 |
H315, H412 |
|
|
ATP01/ |
| 603-111-00-8 |
reaction mass of: 1-(1,1-dimethylpropyl)-4-ethoxy-cis-cyclohexane; 1-(1,1-dimethylpropyl)-4-ethoxy-trans-cyclohexane |
- |
Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H400, H410 |
|
|
ATP01/ |
| 603-112-00-3 |
cyclopentyl 2-phenylethyl ether |
- |
Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H400, H410 |
|
|
ATP01/ |
| 603-113-00-9 |
6-glycidyloxynapht-1-yl oxymethyloxirane |
27610-48-6 |
Muta. 2, Acute Tox. 4 *, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 3 |
H341, H312, H315, H317, H412 |
|
|
ATP01/ |
| 603-114-00-4 |
9-(2-propenyloxy)tricyclo[5.2.1.0(2,6)]dec-3(or-4-)-ene |
26912-64-1 |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
ATP01/ |
| 603-115-00-X |
reaction mass of: O,O',O''-(methylsilanetriyl)tris(4-methyl-2-pentanone oxime) (3 stereoisomers) |
- |
STOT RE 2 *, Aquatic Chronic 4 |
H373**, H413 |
|
|
ATP01/ |
| 603-116-00-5 |
(Z)-(2,4-difluorophenyl)piperidin-4-ylmethanone oxime monohydrochloride |
138271-16-6 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 3 |
H302, H318, H412 |
|
|
ATP01/ |
| 603-117-00-0 |
propan-2-ol; isopropyl alcohol; isopropanol |
67-63-0 |
Flam. Liq. 2, Eye Irrit. 2, STOT SE 3 |
H225, H319, H336 |
|
|
CLP00/ |
| 603-118-00-6 |
6-dimethylaminohexan-1-ol |
1862-07-3 |
Acute Tox. 4 *, Skin Corr. 1B, Aquatic Chronic 3 |
H302, H314, H412 |
|
|
CLP00/ |
| 603-119-00-1 |
1,1'-(1,3-phenylenedioxy)bis(3-(2-(prop-2-enyl)phenoxy)propan-2-ol) |
- |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 603-120-00-7 |
2-methyl-5-phenylpentanol |
25634-93-9 |
Eye Irrit. 2, Skin Irrit. 2 |
H319, H315 |
|
|
CLP00/ |
| 603-121-00-2 |
4-[4-(1,3-dihydroxyprop-2-yl)phenylamino]-1,8-dihydroxy-5-nitroanthraquinone |
114565-66-1 |
Carc. 2, Skin Sens. 1, Aquatic Chronic 4 |
H351, H317, H413 |
|
|
CLP00/ |
| 603-122-00-8 |
sodium 2-ethylhexanolate |
38411-13-1 |
Flam. Sol. 1, Skin Corr. 1B, Aquatic Chronic 3 |
H228, H314, H412 |
|
T |
CLP00/ |
| 603-123-00-3 |
4-methyl-8-methylenetricyclo[3.3.1.13,7]decan-2-ol |
122760-84-3 |
Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H315, H317, H411 |
|
|
CLP00/ |
| 603-124-00-9 |
1,4-bis[2-(vinyloxy)ethoxy]benzene |
84563-49-5 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 603-125-00-4 |
2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)pent-4-en-2-ol |
89544-40-1 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 2 |
H302, H318, H411 |
|
|
CLP00/ |
| 603-126-00-X |
2-((4-methyl-2-nitrophenyl)amino)ethanol |
100418-33-5 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 3 |
H302, H317, H412 |
|
|
CLP00/ |
| 603-127-00-5 |
butan-2-ol; [1] (S)-butan-2-ol; [2] (R)-butan-2-ol; [3] (±)-butan-2-ol [4] |
78-92-2 [1], 4221-99-2 [2], 14898-79-4 [3], 15892-23-6 [4] |
Flam. Liq. 3, Eye Irrit. 2, STOT SE 3, STOT SE 3 |
H226, H319, H335, H336 |
|
C |
CLP00/ATP01 |
| 603-128-00-0 |
2-(phenylmethoxy)naphthalene |
613-62-7 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 603-129-00-6 |
1-tert-butoxypropan-2-ol |
57018-52-7 |
Flam. Liq. 3, Eye Dam. 1 |
H226, H318 |
|
|
CLP00/ |
| 603-130-00-1 |
reaction mass of isomers of: α-((dimethyl)biphenyl)-ω-hydroxypoly(oxyethylene) |
- |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 603-131-00-7 |
reaction mass of: 1-deoxy-1-[methyl-(1-oxododecyl)amino]-D-glucitol; 1-deoxy-1-[methyl-(1-oxotetradecyl)amino]-D-glucitol (3:1) |
- |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 603-132-00-2 |
2-hydroxymethyl-9-methyl-6-(1-methylethyl)-1,4-dioxaspiro[4.5]decane |
63187-91-7 |
Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 3 |
H315, H318, H412 |
|
|
CLP00/ |
| 603-133-00-8 |
reaction mass of: 3-[(4-amino-2-chloro-5-nitrophenyl)amino]-propane-1,2-diol; 3,3'-(2-chloro-5-nitro-1,4-phenylenediimino)bis(propan-1,2-diol) |
- |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 603-134-00-3 |
reaction mass of substituted dodecyl and/or tetradecyl, diphenyl ethers. The substance is produced by the Friedel Crafts reaction. The catalyst is removed from the reaction product. Diphenyl ether is substituted by C1-C10 alkyl groups. The alkyl groups are bonded randomly between C1 and C6. Linear C12 and C14, 50/50 used. |
- |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 603-135-00-9 |
bis[[2,2',2''-nitrilotris-[ethanolato]]-1-N,O]-bis[2-(2-methoxyethoxy)ethoxy]-titanium |
- |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 603-136-00-4 |
3-((4-(bis(2-hydroxyethyl)amino)-2-nitrophenyl)amino)-1-propanol |
104226-19-9 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 603-137-00-X |
reaction mass of: 1-deoxy-1-[methyl-(1-oxohexadecyl)amino]-D-glucitol; 1-deoxy-1-[methyl-(1-oxooctadecyl)amino]-D-glucitol |
- |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 603-138-00-5 |
3-(2,2-dimethyl-3-hydroxypropyl)toluene; (alt.): 2,2-dimethyl-3-(3-methylphenyl)propanol |
103694-68-4 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 603-139-00-0 |
bis(2-methoxyethyl) ether |
111-96-6 |
Flam. Liq. 3, Repr. 1B |
H226, H360FD |
|
|
CLP00/ |
| 603-140-00-6 |
2,2' -oxybisethanol; diethylene glycol |
111-46-6 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 603-141-00-1 |
reaction mass of: dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethylethanoxy)]pentadecane; dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethylethanoxy)]heptadecane |
- |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 603-142-00-7 |
2-(2-(2-hydroxyethoxy)ethyl)-2-aza-bicyclo[2.2.1]heptane |
116230-20-7 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Irrit. 2, Eye Dam. 1 |
H312, H302, H373 **, H315, H318 |
|
|
CLP00/ |
| 603-143-00-2 |
R-2,3-epoxy-1-propanol |
57044-25-4 |
Self-react. C ****, Carc. 1B, Muta. 2, Repr. 1B, Acute Tox. 3 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H242, H350, H341, H360F ***, H331, H312, H302, H314 |
|
|
CLP00/ |
| 603-144-00-8 |
reaction mass of: 2,6,9-trimethyl-2,5,9-cyclododecatrien-1-ol; 6,9-dimethyl-2-methylen-5,9-cyclododecadien-1-ol |
111850-00-1 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 603-145-00-3 |
2-isopropyl-2-(1-methylbutyl)-1,3-dimethoxypropane |
129228-11-1 |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ |
| 603-146-00-9 |
2-[(2-[2-(dimethylamino)ethoxy]ethyl)methylamino]ethanol |
83016-70-0 |
Acute Tox. 4 *, Skin Corr. 1B, Aquatic Chronic 3 |
H302, H314, H412 |
|
|
CLP00/ |
| 603-147-00-4 |
(-)-trans-4-(4'-fluorophenyl)-3-hydroxymethyl-N-methylpiperidine |
105812-81-5 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 2 |
H302, H318, H411 |
|
|
CLP00/ |
| 603-148-00-X |
1,4-bis[(vinyloxy)methyl]cyclohexane |
17351-75-6 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 603-149-00-5 |
reaction mass of diastereoisomers of 1-(1-hydroxyethyl)-4-(1-methylethyl)cyclohexane |
63767-86-2 |
Eye Irrit. 2, Skin Irrit. 2, Aquatic Chronic 2 |
H319, H315, H411 |
|
|
CLP00/ |
| 603-150-00-0 |
(±) trans-3,3-dimethyl-5-(2,2,3-trimethyl-cyclopent-3-en-1-yl)-pent-4-en-2-ol |
107898-54-4 |
Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H400, H410 |
|
|
CLP00/ |
| 603-151-00-6 |
(±)-2-(2,4-dichlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propan-1-ol |
- |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 603-152-00-1 |
2-(4-tert-butylphenyl)ethanol |
5406-86-0 |
Repr. 2, STOT RE 2 *, Eye Dam. 1, Aquatic Chronic 2 |
H361f ***, H373 **, H318, H411 |
|
|
CLP00/ |
| 603-153-00-7 |
3-((2-nitro-4-(trifluoromethyl)phenyl)amino)propane-1,2-diol |
104333-00-8 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 603-154-00-2 |
1-[(2-tert-butyl)cyclohexyloxy]-2-butanol |
139504-68-0 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 603-156-00-3 |
2-(2,4-dichlorophenyl)-2-(2-propenyl)oxirane |
89544-48-9 |
Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H317, H400, H410 |
|
|
CLP00/ |
| 603-157-00-9 |
6,9-bis(hexadecyloxymethyl)-4,7-dioxanonane-1,2,9-triol |
143747-72-2 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 603-158-00-4 |
reaction mass of 4 diastereoisomers of 2,7-dimethyl-10-(1-methylethyl)-1-oxaspiro[4.5]deca-3,6-diene |
- |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ |
| 603-159-00-X |
2-cyclododecylpropan-1-ol |
118562-73-5 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 603-160-00-5 |
1,2-diethoxypropane |
10221-57-5 |
Flam. Liq. 2 |
H225 |
|
|
CLP00/ |
| 603-161-00-0 |
1,3-diethoxypropane |
3459-83-4 |
Flam. Liq. 3 |
H226 |
|
|
CLP00/ |
| 603-162-00-6 |
α[2-[[[(2-hydroxyethyl)methylamino]acetyl]amino]propyl]-ω-(nonylphenoxy)poly[oxo(methyl-1,2-ethanediyl)] |
144736-29-8 |
Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 2 |
H314, H317, H411 |
|
|
CLP00/ |
| 603-163-00-1 |
2-phenyl-1,3-propanediol |
1570-95-2 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 603-164-00-7 |
2-butyl-4-chloro-4,5-dihydro-5-hydroxymethyl-1-[2'-(2-triphenylmethyl-1,2,3,4-2H-tetrazol-5-yl)-1,1'-biphenyl-4-methyl]-1H-imidazole |
133909-99-6 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 603-165-00-2 |
reaction mass of: 4-allyl-2,6-bis(2,3-epoxypropyl)phenol; 4-allyl-6-[3-[6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3 |
- |
Muta. 2, Skin Sens. 1 |
H341, H317 |
|
|
CLP00/ |
| 603-166-00-8 |
R-1-chloro-2,3-epoxypropane |
51594-55-9 |
Flam. Liq. 3, Carc. 1B, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B, Skin Sens. 1 |
H226, H350, H331, H311, H301, H314, H317 |
|
|
CLP00/ |
| 603-167-00-3 |
3,3',5,5'-tetra-tert-butylbiphenyl-2,2'-diol |
6390-69-8 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 603-168-00-9 |
3-(2-ethylhexyloxy)propane-1,2-diol |
70445-33-9 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
CLP00/ |
| 603-169-00-4 |
(±)-trans-4-(4-fluorophenyl)-3-hydroxymethyl-N-methylpiperidine |
109887-53-8 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 2 |
H302, H318, H411 |
|
|
CLP00/ |
| 603-170-00-X |
reaction mass of: 2-methyl-1-(6-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol; 2-methyl-1-(1-methylbicyclo[2.2.1]hept-5-en-2-yl)-pent-1-en-3-ol; 2-methyl-1-(5-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol |
67739-11-1 |
Eye Irrit. 2, Aquatic Chronic 2 |
H319, H411 |
|
|
CLP00/ |
| 603-171-00-5 |
5-thiazolylmethanol |
38585-74-9 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
CLP00/ |
| 603-172-00-0 |
mono-2-[2-(4-dibenzo[b,f][1,4]thiazepin-11-yl)piperazinium-1-yl]ethoxy)ethanol trans-butenedioate |
773058-82-5 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 2 |
H302, H318, H411 |
|
|
CLP00/ |
| 603-173-00-6 |
4,4-dimethyl-3,5,8-trioxabicyclo[5.1.0]octane |
57280-22-5 |
Eye Irrit. 2, Skin Sens. 1 |
H319, H317 |
|
|
CLP00/ |
| 603-174-00-1 |
4-cyclohexyl-2-methyl-2-butanol |
83926-73-2 |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 603-175-00-7 |
2-(2-hexyloxyethoxy)ethanol; DEGHE; diethylene glycol monohexyl ether; 3,6-dioxa-1-dodecanol; hexyl carbitol; 3,6-dioxadodecan-1-ol |
112-59-4 |
Acute Tox. 4 *, Eye Dam. 1 |
H312, H318 |
|
|
CLP00/ |
| 603-176-00-2 |
1,2-bis(2-methoxyethoxy)ethane; TEGDME; triethylene glycol dimethyl ether; triglyme |
112-49-2 |
Repr. 1B |
H360Df |
|
|
CLP00/ |
| 603-177-00-8 |
1-ethoxypropan-2-ol; 2PG1EE; 1-ethoxy-2-propanol; propylene glycol monoethyl ether; [1] 2-ethoxy-1-methylethyl acetate; 2PG1EEA [2] |
1569-02-4 [1], 54839-24-6 [2] |
Flam. Liq. 3, STOT SE 3 |
H226, H336 |
|
|
CLP00/ |
| 603-178-00-3 |
2-hexyloxyethanol; ethylene glycol monohexyl ether; n-hexylglycol |
112-25-4 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H312, H302, H314 |
|
|
CLP00/ |
| 603-179-00-9 |
ergocalciferol (ISO); Vitamin D2 |
50-14-6 |
Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1 |
H330, H311, H301, H372 ** |
|
|
CLP00/ |
| 603-180-00-4 |
colecalciferol; cholecalciferol; Vitamin D3 |
67-97-0 |
Acute Tox. 2, Acute Tox. 2, Acute Tox. 2, STOT RE 1 |
H330, H310, H300, H372 |
Inhalation: ATE = 0.05 mg/L (dusts/mists), Dermal: ATE = 50 mg/kg bw, Oral: ATE = 35 mg/kg bw, STOT RE 1; H372: C ≥ 3 %, STOT RE 2; H373: 0,3 % ≥ C < 3 % |
|
CLP00/ATP13 |
| 603-181-00-X |
tert-butyl methyl ether; MTBE; 2-methoxy-2-methylpropane |
1634-04-4 |
Flam. Liq. 2, Skin Irrit. 2 |
H225, H315 |
|
|
CLP00/ |
| 603-182-00-5 |
reaction product of: saturated, monounsaturated and multiple unsaturated long-chained partly estrified alcohols of vegetable origin (Brassica napus L., Brassica rapa L., Helianthus annuus L., Glycine hispida, Gossypium hirsutum L., Cocos nucifera L., Elaeis guineensis) with O,O-diisobutyldithiophosphate and 2-ethylhexylamine and hydrogen peroxide |
- |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 603-183-00-0 |
2-[2-(2-butoxyethoxy)ethoxy]ethanol; TEGBE; triethylene glycol monobutyl ether; butoxytriethylene glycol |
143-22-6 |
Eye Dam. 1 |
H318 |
Eye Dam. 1; H318: C ≥ 30 %, Eye Irrit. 2; H319: 20 % ≤ C < 30 % |
|
CLP00/ |
| 603-184-00-6 |
2-(hydroxymethyl)-2-[[2-hydroxy-3-(isooctadecyloxy)propoxy]methyl]-1,3-propanediol |
146925-83-9 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 603-185-00-1 |
2,4-dichloro-3-ethyl-6-nitrophenol |
99817-36-4 |
Acute Tox. 3 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H318, H317, H400, H410 |
|
|
CLP00/ |
| 603-186-00-7 |
trans-(5RS,6SR)-6-amino-2,2-dimethyl-1,3-dioxepan-5-ol |
79944-37-9 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 603-187-00-2 |
2-((4,6-bis(4-(2-(1-methylpyridinium-4-yl)vinyl)phenylamino)-1,3,5-triazin-2-yl)(2-hydroxyethyl)amino)ethanol dichloride |
163661-77-6 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 603-188-00-8 |
reaction mass of: 6,7-epoxy-1,2,3,4,5,6,7,8-octahydro-1,1,2,4,4,7-hexamethylnaphthalene; 7,8-epoxy-1,2,3,4,6,7,8,8a-octahydro-1,1,2,4,4,7-hexamethylnaphthalene |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 603-189-00-3 |
reaction mass of complexes of: titanium, 2,2'-oxydiethanol, ammonium lactate, nitrilotris(2-propanol) and ethylene glycol |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 603-190-00-9 |
8,8-dimethyl-7-isopropyl-6,10-dioxaspiro[4.5]decane |
62406-73-9 |
Skin Irrit. 2, Aquatic Chronic 3 |
H315, H412 |
|
|
ATP01/ |
| 603-191-00-4 |
2-(4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)-5-(3-((2-ethylhexyl)oxy)-2-hydroxypropoxy)phenol |
137658-79-8 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 603-192-00-X |
(E,E)-3,7,11-trimethyldodeca-1,4,6,10-tetraen-3-ol |
125474-34-2 |
Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H317, H400, H410 |
|
|
ATP01/ |
| 603-193-00-5 |
disodium 9,10-anthracenedioxide |
46492-07-3 |
Skin Corr. 1A |
H314 |
|
|
ATP01/ |
| 603-194-00-0 |
2-(2-aminoethylamino)ethanol; (AEEA) |
111-41-1 |
Repr. 1B, Skin Corr. 1B, Skin Sens. 1, |
H360Fd, H361, H314, H317 |
STOT SE 3; H335: C ≥ 5 % |
|
ATP01/ |
| 603-195-00-6 |
2-[4-(4-methoxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]-phenol |
154825-62-4 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 603-196-00-1 |
2-(7-ethyl-1H-indol-3-yl)ethanol |
41340-36-7 |
Acute Tox. 4 *, STOT RE 2 *, Aquatic Chronic 2 |
H302, H373 **, H411 |
|
|
CLP00/ |
| 603-197-00-7 |
tebuconazole (ISO); 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol |
107534-96-3 |
Repr. 2, Acute Tox. 4, Aquatic Acute 1, Aquatic Chronic 1 |
H361d ***, H302, H400, H410 |
M=1 , M=10 |
|
CLP00/ATP07 |
| 603-199-00-8 |
etoxazol (ISO); (RS)-5-tert-butyl-2-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenetole |
153233-91-1 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M = 100: |
|
CLP00/ |
| 603-200-00-1 |
1-pentanol; [1] 3-pentanol [2] |
71-41-0 [1], 584-02-1 [2] |
Flam. Liq. 3, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2 |
H226, H332, H335, H315 |
|
|
ATP01/ |
| 603-201-00-7 |
(E)-(7R,11R)-3,7,11,15-tetramethylhexadec-2-ene-1-ol |
- |
Skin Irrit. 2, Aquatic Chronic 4 |
H315, H413 |
|
|
ATP01/ |
| 603-202-00-2 |
4,4,5,5,5-pentafluoropentan-1-ol |
148043-73-6 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
ATP01/ |
| 603-203-00-8 |
(1R,3S,7R,8R,10R,13R)-5,5,7,9,9,13-hexamethyl-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane |
- |
Skin Irrit. 2 |
H315 |
|
|
ATP01/ |
| 603-204-00-3 |
reaction mass of: 2,2'-(heptane-1,7-diyl)bis-1,3-dioxolane; 2,2'-(heptane-1,6-diyl)bis-1,3-dioxolane |
- |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 603-205-00-9 |
(1S-cis)-4-(2-amino-6-chloro-9H-purin-9-yl)-2-cyclopentene-1-methanol hydrochloride |
172015-79-1 |
STOT RE 1, Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H372**, H302, H318, H317, H412 |
|
|
ATP01/ |
| 603-206-00-4 |
2,2-dichloro-1,3-benzodioxol |
2032-75-9 |
Flam. Liq. 3, Skin Corr. 1A, Acute Tox. 4 *, Skin Sens. 1 |
H226, H314, H302, H317 |
|
|
ATP01/ |
| 603-207-00-X |
2-isobutyl-2-isopropyl-1,3-dimethoxypropane |
129228-21-3 |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
ATP01/ |
| 603-208-00-5 |
1,2-diethoxyethane |
629-14-1 |
Flam. Liq. 2, Repr. 1A, Eye Irrit. 2 |
H225, H360Df, H319 |
|
|
ATP01/ |
| 603-209-00-0 |
spinosad (ISO) (reaction mass of spinosyn A and spinosyn D in ratios between 95:5 to 50:50); reaction mass of 50-95% of (2R,3aS,5aR,5bS,9S,13S,14R,16aS,16bR)-2-(6-deoxy-2,3,4-tri-O-methyl-α-l-mannopyranosyloxy)-13-(4-dimethylamino-2,3,4,6-tetradeoxy-β-d- |
- [1], 131929-60-7 [2], 131929-63-0 [3], - |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=10: |
|
ATP01/ |
| 603-210-00-6 |
2,4-diethyl-1,5-pentanediol |
57987-55-0 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 603-211-00-1 |
2,3-epoxypropyltrimethylammonium chloride ...%; glycidyl trimethylammonium chloride ...% |
3033-77-0 |
Carc. 1B, Muta. 2, Repr. 2, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H350, H341, H361f***, H312, H302, H373**, H318, H317, H412 |
|
B |
ATP01/ |
| 603-212-00-7 |
1,3,4,6,7,8-hexahydro-4,6,6,7,8,8-hexamethylindeno[5,6-c]pyran; galaxolide; (HHCB) |
1222-05-5 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 603-213-00-2 |
2-methoxy-2-methylbutane; tert-amyl methyl ether |
994-05-8 |
Flam. Liq. 2, Acute Tox. 4 *, STOT SE 3 |
H225, H302, H336 |
|
|
ATP01/ |
| 603-214-00-8 |
1,1-diisopropoxycyclohexane |
1132-95-2 |
Skin Corr. 1B |
H314 |
|
|
ATP01/ |
| 603-215-00-3 |
1-hydroxy-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane bis(tetrafluoroborate) |
162241-33-0 |
Expl. 1.1****, Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H201, H302, H373**, H318, H317, H400, H410 |
|
|
ATP01/ |
| 603-216-00-9 |
cis-1-amino-2,3-dihydro-1H-inden-2-ol |
7480-35-5 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
|
ATP01/ |
| 603-217-00-4 |
2,4,6-tri-tert-butylphenyl 2-butyl-2-ethyl-1,3-propanediolphosphite |
161717-32-4 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 603-220-00-0 |
1-{benzyl[2-(2-methoxyphenoxy)ethyl]amino}-3-(9H-carbazol-4-yloxy)propan-2-ol |
72955-94-3 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 603-221-00-6 |
1-(2-amino-5-chlorophenyl)-2,2,2-trifluoro-1,1-ethanediol, hydrochloride; [containing < 0.1 % 4-chloroaniline (EC No 203-401-0)] |
214353-17-0 |
Acute Tox. 4 *, Skin Corr. 1B, Aquatic Chronic 2 |
H302, H314, H411 |
|
|
ATP01/ |
| 603-221-01-3 |
1-(2-amino-5-chlorophenyl)-2,2,2-trifluoro-1,1-ethanediol, hydrochloride; [containing ≥ 0.1 % 4-chloroaniline (EC No 203-401-0)] |
214353-17-0 |
Carc. 1B, Acute Tox. 4 *, Skin Corr. 1B, Aquatic Chronic 2 |
H350, H302, H314, H411 |
|
|
ATP01/ |
| 603-222-00-1 |
(2R,3S,4R,5R,7R,9R,10R,11S,12S,13R)-10-[(4-dimethylamino-3-hydroxy-6-methyltetrahydropyran-2-yl)oxy]-2-ethyl-3,4,12-trihydroxy-9-methoxy-3,5,7,9,11,13-hexamethyl-6,14-dioxo-1-oxacyclotetradecane |
118058-74-5 |
Eye Irrit. 2 |
H319 |
|
|
ATP01/ |
| 603-223-00-7 |
2-cyclopentylidene cyclopentanol; 1,1'-bi(cyclopentyliden)-2-ol |
6261-30-9 |
Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 3 |
H315, H318, H412 |
|
|
ATP01/ |
| 603-224-00-2 |
3-ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)-hexane |
297730-93-9 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 603-225-00-8 |
erythromycin A9-oxime (E); (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-4-((2,6-didesoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopiranosyl)oxy)-14-ethyl-7,12,13-trihydroxy-3,5,7,9,11,13-hexamethyl-6-((3,4,6-tridesoxy-3-dimethylamino-β-d-xylohexapiranosyl)oxy)oxacyclot |
13127-18-9 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 603-226-00-3 |
4,4'(4-(4-methoxyphenyl)-1,3,5-triazin-2,4-diyl)bisbenzene-1,3-diol |
1440-00-2 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 603-227-00-9 |
α-hydro-ω-[[[(1,1-dimethylethyl)dioxy]carbonyl]oxy]-poly[oxy(methyl-1,2-ethanediyl)] ether with 2,2-bis(hydroxymethyl)-1,3-propanediol (4:1); reaction product of: α-hydro-ω-((chlorocarbonyl)oxy)-poly(oxy(methyl-1,2-ethanediyl)) ether with 2,2-bis(hydroxy |
203574-04-3 |
****, Aquatic Acute 1, Aquatic Chronic 1 |
****, H400, H410 |
|
|
ATP01/ |
| 603-228-00-4 |
(+/-)-(R*,R*)-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran; 6-fluoro-2-(2-oxiranyl)chromane |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 603-229-00-X |
sodium (Z)-3-chloro-3-(4-chlorophenyl)-1-hydroxy-2-propene-1-sulfonate |
- |
Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H317, H400, H410 |
|
|
ATP01/ |
| 603-230-00-5 |
2,6,6,7,8,8-hexamethyldecahydro-2H-indeno[4,5-b]furan |
- |
Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 4 |
H315, H318, H413 |
|
|
ATP01/ |
| 603-231-00-0 |
(S)-1,1-diphenyl-1,2-propanediol |
- |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 603-232-00-6 |
3,3,8,8,10,10-hexamethyl-9-[1-(4-oxiranylmethoxy-phenyl)-ethoxy]-1,5-dioxa-9-aza-spiro[5.5]undecane |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 603-233-00-1 |
reaction mass of: 4-(1,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-ylidene)-3-methylbutan-2-ol; 4-(3,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-ylidene)-3-methylbutan-2-ol; 1-(1,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-ylidene)pentan-3-ol; 1-(3,3a,4,6,7,7a- |
- |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 603-234-00-7 |
(1R,4R)-4-methoxy-2,2,7,7-tetramethyltricyclo(6.2.1.0(1,6))undec-5-ene |
- |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
ATP01/ |
| 603-235-00-2 |
linalool; 3,7-dimethyl-1,6-octadien-3-ol; dl-linalool [1] coriandrol; (S)-3,7-dimethyl-1,6-octadien-3-ol; d-linalool [2] licareol; (R)-3,7-dimethyl-1,6-octadien-3-ol; l-linalool [3] |
78-70-6 [1] 126-90-9 [2] 126-91-0 [3] |
Skin Sens. 1B |
H317 |
|
|
ATP10 |
| 603-236-00-8 |
ethanol, 2,2'-iminobis-, N-(C13-15-branched and linear alkyl) derivs. |
97925-95-6 |
Repr. 1B |
H360D |
|
|
ATP14 |
| 603-237-00-3 |
ipconazole (ISO); (1RS,2SR,5RS;1RS,2SR,5SR)-2-(4-chlorobenzyl)-5-isopropyl-1- (1H-1,2,4-triazol-1-ylmethyl)cyclopentanol |
125225-28-7 |
Repr. 1B, Acute Tox. 4, STOT RE 2, Aquatic Chronic 1 |
H360D, H302, H373 (eyes, skin, liver), H410 |
Oral: ATE = 500 mg/kg, M=100 |
|
ATP15 |
| 603-238-00-9 |
bis(2-(2-methoxyethoxy)ethyl)ether; tetraglyme |
143-24-8 |
Repr. 1B |
H360FD |
|
|
ATP15 |
| 603-239-00-4 |
paclobutrazol (ISO); (2RS,3RS)-1-(4-chlorophenyl)-4,4-dimethyl- 2-(1H-1,2,4-triazol-1-yl)pentan-3-ol |
76738-62-0 |
Repr. 2, Acute Tox. 4, Acute Tox. 4, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H361d, H332, H302, H319, H400, H410 |
Inhalation: ATE = 3.13 mg/L (dusts/mists), Oral: ATE = 490 mg/kg, M=10, M=10 |
|
ATP15 |
| 603-240-00-X |
2,2-bis(bromomethyl) propane-1,3-diol |
3296-90-0 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
|
ATP15 |
| 603-241-00-5 |
geraniol; (2E)-3,7-dimethylocta-2,6-dien-1-ol |
106-24-1 |
Skin Sens. 1 |
H317 |
|
|
ATP15 |
| 603-243-00-6 |
2,2-dimethylpropan-1-ol, tribromo derivative; 3-bromo-2,2-bis(bromomethyl)propan-1-ol |
36483-57-5; 1522-92-5 |
Carc. 1B, Muta. 2 |
H350, H341 |
|
|
ATP18 |
| 604-001-00-2 |
phenol; carbolic acid; monohydroxybenzene; phenylalcohol |
108-95-2 |
Muta. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Skin Corr. 1B |
H341, H331, H311, H301, H373 **, H314 |
*, Skin Corr. 1B; H314: C ≥ 3 %, Skin Irrit. 2; H315: 1 % ≤ C < 3 %, Eye Irrit. 2; H319: 1 % ≤ C < 3 % |
|
CLP00/ |
| 604-002-00-8 |
pentachlorophenol |
87-86-5 |
Carc. 2, Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 3 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H330, H311, H301, H319, H335, H315, H400, H410 |
|
|
CLP00/ |
| 604-003-00-3 |
sodium pentachlorophenolate; [1] potassium pentachlorophenolate [2] |
131-52-2 [1], 7778-73-6 [2] |
Carc. 2, Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 3 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H330, H311, H301, H319, H335, H315, H400, H410 |
|
|
CLP00/ |
| 604-004-00-9 |
m-cresol; [1] o-cresol; [2] p-cresol; [3] mix-cresol [4] |
108-39-4 [1], 95-48-7 [2], 106-44-5 [3], 1319-77-3 [4] |
Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B |
H311, H301, H314 |
* |
C |
CLP00/ |
| 604-005-00-4 |
1,4-dihydroxybenzene; hydroquinone; quinol |
123-31-9 |
Carc. 2, Muta. 2, Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1 |
H351, H341, H302, H318, H317, H400 |
M=10: |
|
CLP00/ATP01 |
| 604-006-00-X |
3,4-xylenol; [1] 2,5-xylenol; [2] 2,4-xylenol; [3] 2,3-xylenol; [4] 2,6-xylenol; [5] xylenol; [6] 2,4(or 2,5)-xylenol [7] |
95-65-8 [1], 95-87-4 [2], 105-67-9 [3], 526-75-0 [4], 576-26-1 [5], 1300-71-6 [6], 71975-58-1 [7] |
Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B, Aquatic Chronic 2 |
H311, H301, H314, H411 |
|
C |
CLP00/ |
| 604-007-00-5 |
2-naphthol |
135-19-3 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1 |
H332, H302, H400 |
|
|
CLP00/ |
| 604-008-00-0 |
2-chlorophenol; [1] 4-chlorophenol; [2] 3-chlorophenol; [3] chlorophenol [4] |
95-57-8 [1], 106-48-9 [2], 108-43-0 [3], 25167-80-0 [4] |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 2 |
H332, H312, H302, H411 |
|
C |
CLP00/ |
| 604-009-00-6 |
pyrogallol; 1,2,3-trihydroxybenzene |
87-66-1 |
Muta. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 3 |
H341, H332, H312, H302, H412 |
* |
|
CLP00/ |
| 604-010-00-1 |
resorcinol; 1,3-benzenediol |
108-46-3 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1 |
H302, H319, H315, H400 |
* |
|
CLP00/ |
| 604-011-00-7 |
2,4-dichlorophenol |
120-83-2 |
Acute Tox. 3 *, Acute Tox. 4 *, Skin Corr. 1B, Aquatic Chronic 2 |
H311, H302, H314, H411 |
|
|
CLP00/ |
| 604-012-00-2 |
4-chloro-o-cresol; 4-chloro-2-methyl phenol |
1570-64-5 |
Acute Tox. 3 *, Skin Corr. 1A, Aquatic Acute 1 |
H331, H314, H400 |
STOT SE 3; H335: C ≥ 1 % |
|
CLP00/ |
| 604-013-00-8 |
2,3,4,6-tetrachlorophenol |
58-90-2 |
Acute Tox. 3 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H319, H315, H400, H410 |
*, Eye Irrit. 2; H319: C ≥ 5 %, Skin Irrit. 2; H315: C ≥ 5 % |
|
CLP00/ |
| 604-014-00-3 |
chlorocresol; 4-chloro-m-cresol; 4-chloro-3-methylphenol |
59-50-7 |
Acute Tox. 4, STOT SE 3, Skin Corr. 1C, Eye Dam. 1, Skin Sens. 1B, Aquatic Acute 1, Aquatic Chronic 3 |
H302, H335, H314, H318, H317, H400, H412 |
M=1 |
|
CLP00/ATP13 |
| 604-015-00-9 |
2,2'-methylenebis-(3,4,6-trichlorophenol); hexachlorophene |
70-30-4 |
Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H311, H301, H400, H410 |
* |
|
CLP00/ |
| 604-016-00-4 |
1,2-dihydroxybenzene; pyrocatechol |
120-80-9 |
Carc. 1B, Muta. 2, Acute Tox. 3, Acute Tox. 3, Skin Irrit. 2, Eye Irrit. 2 |
H350, H341, H311, H301, H315, H319 |
Dermal: ATE = 600 mg/kg bw, Oral: ATE = 300 mg/kg bw |
|
CLP00/ATP13 |
| 604-017-00-X |
2,4,5-trichlorophenol |
95-95-4 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H315, H400, H410 |
*, Eye Irrit. 2; H319: C ≥ 5 %, Skin Irrit. 2; H315: C ≥ 5 % |
|
CLP00/ |
| 604-018-00-5 |
2,4,6-trichlorophenol |
88-06-2 |
Carc. 2, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H302, H319, H315, H400, H410 |
|
|
CLP00/ |
| 604-019-00-0 |
dichlorophen (ISO) |
97-23-4 |
Acute Tox. 4 *, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H400, H410 |
|
|
CLP00/ |
| 604-020-00-6 |
2-phenylphenol (ISO); biphenyl-2-ol; 2-hydroxybiphenyl |
90-43-7 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1 |
H319, H335, H315, H400 |
|
|
CLP00/ |
| 604-021-00-1 |
sodium 2-biphenylate; 2-phenylphenol, sodium salt |
132-27-4 |
Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1 |
H302, H335, H315, H318, H400 |
|
|
CLP00/ |
| 604-022-00-7 |
2,2-dimethyl-1,3-benzodioxol-4-ol |
22961-82-6 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 604-023-00-2 |
2,4-dichloro-3-ethylphenol |
- |
Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H400, H410 |
|
|
CLP00/ |
| 604-024-00-8 |
4,4-isobutylethylidenediphenol |
6807-17-6 |
Repr. 1B, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H360F ***, H319, H400, H410 |
|
|
CLP00/ |
| 604-025-00-3 |
2,5-bis(1,1-dimethylbutyl)hydroquinone |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 604-026-00-9 |
2,2-spirobi(6-hydroxy-4,4,7-trimethylchromane) |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 604-027-00-4 |
2-methyl-5-(1,1,3,3-tetramethylbutyl)hydroquinone |
- |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H318, H317, H411 |
|
|
CLP00/ |
| 604-028-00-X |
4-amino-3-fluorophenol |
399-95-1 |
Carc. 1B, Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H350, H302, H317, H411 |
|
|
CLP00/ |
| 604-029-00-5 |
1-naphtol |
90-15-3 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1 |
H312, H302, H335, H315, H318 |
|
|
CLP00/ |
| 604-030-00-0 |
4,4'-isopropylidenediphenol; bisphenol A |
80-05-7 |
Repr. 1B, STOT SE 3, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360F, H335, H318, H317, H400, H410 |
M = 1, M = 10 |
|
CLP00/ATP09/ATP18 |
| 604-031-00-6 |
guaiacol |
90-05-1 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2 |
H302, H319, H315 |
|
|
CLP00/ |
| 604-032-00-1 |
thymol |
89-83-8 |
Acute Tox. 4 *, Skin Corr. 1B, Aquatic Chronic 2 |
H302, H314, H411 |
|
|
CLP00/ |
| 604-033-00-7 |
isobutyl but-3-enoate |
24342-03-8 |
Flam. Liq. 3 |
H226 |
|
|
CLP00/ |
| 604-034-00-2 |
4,4'-thiodi-o-cresol |
24197-34-0 |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
CLP00/ |
| 604-035-00-8 |
4-nonylphenol, reaction products with formaldehyde and dodecane-1-thiol |
- |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 604-036-00-3 |
4,4'-oxybis(ethylenethio)diphenol |
90884-29-0 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 604-037-00-9 |
3,5-xylenol; 3,5-dimethylphenol |
108-68-9 |
Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B |
H311, H301, H314 |
|
|
CLP00/ |
| 604-038-00-4 |
4-chloro-3,5-dimethylphenol; [1] chloroxylenol [2] |
88-04-0 [1], 1321-23-9 [2] |
Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H302, H319, H315, H317 |
|
|
CLP00/ |
| 604-039-00-X |
ethyl 2-[4-[(6-chlorobenzoxazol-2-yl)oxy]phenoxy]propionate; fenoxaprop-ethyl |
66441-23-4 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 604-040-00-5 |
fomesafen (ISO); 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulphonyl)-2-nitrobenzamide |
72178-02-0 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 604-041-00-0 |
acifluorfen (ISO); 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid; [1] sodium 5-[2-chloro-4-(trifluoromethyl) phenoxy]-2-nitrobenzoate; acifluorfen-sodium [2] |
50594-66-6 [1], 62476-59-9 [2] |
Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H315, H318, H400, H410 |
|
|
CLP00/ |
| 604-042-00-6 |
4-nitrosophenol |
104-91-6 |
Muta. 2, Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 2 |
H341, H302, H318, H411 |
|
|
CLP00/ |
| 604-043-00-1 |
monobenzone; 4-hydroxyphenyl benzyl ether; hydroquinone monobenzyl ether |
103-16-2 |
Eye Irrit. 2, Skin Sens. 1 |
H319, H317 |
|
|
CLP00/ |
| 604-044-00-7 |
mequinol; 4-methoxyphenol; hydroquinone monomethyl ether |
150-76-5 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1 |
H302, H319, H317 |
|
|
CLP00/ |
| 604-045-00-2 |
2,3,5-trimethylhydroquinone |
700-13-0 |
Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H335, H315, H318, H317, H400, H410 |
|
|
CLP00/ |
| 604-046-00-8 |
4-(4-isopropoxyphenylsulfonyl)phenol |
95235-30-6 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 604-047-00-3 |
4-(4-tolyloxy)biphenyl |
51601-57-1 |
STOT RE 2 *, Aquatic Chronic 4 |
H373 **, H413 |
|
|
CLP00/ |
| 604-048-00-9 |
4,4',4''-(ethan-1,1,1-triyl)triphenol |
27955-94-8 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 604-049-00-4 |
4-4'-methylenebis(oxyethylenethio)diphenol |
93589-69-6 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 604-051-00-5 |
3,5-bis((3,5-di-tert-butyl-4-hydroxy)benzyl)-2,4,6-trimethylphenol |
87113-78-8 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 604-052-00-0 |
2,2'-methylenebis(6-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol) |
103597-45-1 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 604-053-00-6 |
2-methyl-4-(1,1-dimethylethyl)-6-(1-methyl-pentadecyl)-phenol |
157661-93-3 |
Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H317, H400, H410 |
|
|
CLP00/ |
| 604-054-00-1 |
reaction mass of: 2-methoxy-4-(tetrahydro-4-methylene-2H-pyran-2-yl)-phenol; 4-(3,6-dihydro-4-methyl-2H-pyran-2-yl)-2-methoxyphenol |
- |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 604-055-00-7 |
2,2'-((3,3',5,5'-tetramethyl-(1,1'-biphenyl)-4,4'-diyl)-bis(oxymethylene))-bis-oxirane |
85954-11-6 |
Carc. 2, Skin Sens. 1 |
H351, H317 |
|
|
CLP00/ATP01 |
| 604-056-00-2 |
2-(2-hydroxy-3,5-dinitroanilino)ethanol |
99610-72-7 |
Flam. Sol. 2, Repr. 2, Acute Tox. 4 * |
H228, H361f ***, H302 |
|
|
CLP00/ |
| 604-057-00-8 |
reaction mass of: isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-(n)-dodecylphenol; isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-(n)-tetracosylphenol; isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-5,6-didodecyl-phenol. n = 5 or 6 |
|
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ATP10 |
| 604-058-00-3 |
1,2-bis(3-methylphenoxy)ethane |
54914-85-1 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 604-059-00-9 |
2-n-hexadecylhydroquinone |
- |
STOT RE 2 *, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 4 |
H373 **, H315, H317, H413 |
|
|
CLP00/ |
| 604-060-00-4 |
9,9-bis(4-hydroxyphenyl)fluorene |
3236-71-3 |
Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H315, H400, H410 |
|
|
CLP00/ |
| 604-061-00-X |
reaction mass of: 2-chloro-5-sec-tetradecylhydroquinones where sec-tetradecyl = 1-methyltridecyl; 1-ethyldodecyl; 1-propylundecyl; 1-butyldecyl; 1-pentylnonyl; 1-hexyloctyl |
- |
Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 3 |
H315, H317, H412 |
|
|
CLP00/ |
| 604-062-00-5 |
2,4-dimethyl-6-(1-methyl-pentadecyl)phenol |
- |
Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H317, H400, H410 |
|
|
CLP00/ |
| 604-063-00-0 |
5,6-dihydroxyindole |
3131-52-0 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 2 |
H302, H318, H411 |
|
|
CLP00/ |
| 604-064-00-6 |
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-((hexyl)oxy)-phenol |
147315-50-2 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 604-065-00-1 |
4,4',4''-(1-methylpropan-1-yl-3-ylidene)tris(2-cyclohexyl-5-methylphenol) |
111850-25-0 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 604-066-00-7 |
reaction mass of: phenol, 6-(1,1-dimethylethyl)-4-tetrapropyl-2-[(2-hydroxy-5-tetra-propylphenyl)methyl (C41-compound) and methane, 2,2'-bis[6-(1,1-dimethyl-ethyl)-1-hydroxy-4-tetrapropyl-phenyl)]- (C45-compound); 2,6-bis(1,1-dimethylethyl)-4-tetra-propy |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 604-067-00-2 |
reaction mass of: 2,2'-[[(2-hydroxyethyl)imino]bis(methylene)bis[4-dodecylphenol]; formaldehyde, oligomer with 4-dodecyl phenol and 2-aminoethanol(n = 2); formaldehyde, oligomer with 4-dodecyl phenol and 2-aminoethanol(n = 3, 4 and higher) |
- |
Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H400, H410 |
|
|
CLP00/ |
| 604-068-00-8 |
(±)-4-[2-[[3-(4-hydroxyphenyl)-1-methylpropyl]amino]-1-hydroxyethyl]phenol hydrochloride |
90274-24-1 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Sens. 1 |
H332, H302, H317 |
|
|
CLP00/ |
| 604-069-00-3 |
2-(1-methylpropyl)-4-tert-butylphenol |
51390-14-8 |
Skin Corr. 1B, Aquatic Chronic 2 |
H314, H411 |
|
|
CLP00/ |
| 604-070-00-9 |
triclosan; 2,4,4'-trichloro-2'-hydroxy-diphenyl-ether; 5-chloro-2-(2,4-dichlorophenoxy)phenol |
3380-34-5 |
Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H315, H400, H410 |
M = 100: |
|
CLP00/ |
| 604-071-00-4 |
4,4'-(1-{4-[1-(4-hydroxyphenyl)-1-methylethyl]phenyl}ethylidene)diphenol |
110726-28-8 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 604-072-00-X |
1,2-bis(phenoxymethyl)benzene |
10403-74-4 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 604-073-00-5 |
(E)-3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
82413-20-5 |
Carc. 2, Repr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H360F***, H317, H400, H410 |
|
|
ATP01/ |
| 604-074-00-0 |
tetrabromobisphenol-A; 2,2',6,6'-tetrabromo-4,4'-isopropylidenediphenol |
79-94-7 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 604-075-00-6 |
4-(1,1,3,3-tetramethylbutyl)phenol; 4-tert-octylphenol |
140-66-9 |
Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H400, H410 |
M=10: |
|
ATP01/ |
| 604-076-00-1 |
phenolphthalein |
77-09-8 |
Carc. 1B, Muta. 2, Repr. 2 |
H350, H341, H361f*** |
Carc. 1A; H350: C ≥ 1 % |
|
ATP01/ |
| 604-077-00-7 |
2-benzotriazol-2-yl-4-methyl-6-(2-methylallyl)phenol |
98809-58-6 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 604-079-00-8 |
4,4'-(1,3-phenylene-bis(1-methylethylidene))bis-phenol |
13595-25-0 |
Repr. 2, Skin Sens. 1, Aquatic Chronic 2 |
H361f***, H317, H411 |
|
|
ATP01/ |
| 604-080-00-3 |
4-fluoro-3-trifluoromethylphenol |
61721-07-1 |
Acute Tox. 4 *, Skin Corr. 1A, Skin Sens. 1, Aquatic Chronic 2 |
H332, H314, H317, H411 |
|
|
ATP01/ |
| 604-081-00-9 |
1,1-bis(4-hydroxyphenyl)-1-phenylethane |
1571-75-1 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 604-082-00-4 |
2-chloro-6-fluoro-phenol |
2040-90-6 |
Muta. 1B, Repr. 2, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 2 |
H340, H361f***, H302, H314, H317, H411 |
|
|
ATP01/ |
| 604-084-00-5 |
1-ethoxy-2,3-difluorobenzene |
121219-07-6 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
ATP01/ |
| 604-087-00-1 |
reaction mass of: 1,2-naphthoquinonediazide-5-sulfonylchloride (or sulfonic acid)monoester with 4,4'-(1-(4-(1-(4-hydroxyphenyl)-1-methylethyl)phenyl)ethylidene)bisphenol; 1,2-naphthoquinonediazide-5-sulfonylchloride (or sulfonic acid)diester with 4,4'-(1 |
- |
Pyr. Sol. 1, Aquatic Chronic 4 |
H250, H413 |
|
|
ATP01/ |
| 604-089-00-2 |
2-methyl-5-tert-butylthiophenol |
- |
Flam. Liq. 3, Repr. 2, STOT RE 2 *, Asp. Tox. 1, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, STOT SE 3, Aquatic Acute 1, Aquatic Chronic 1 |
H226, H361d***, H373**, H304, H319, H315, H317, H336, H400, H410 |
|
|
ATP01/ |
| 604-090-00-8 |
4-tert-butylphenol |
98-54-4 |
Repr. 2, Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 1 |
H361f, H315, H318, H410 |
M=1 |
|
ATP06/ATP13 |
| 604-091-00-3 |
etofenprox (ISO); 2-(4- ethoxyphenyl)-2-methylpropyl
3-phenoxybenzyl ether |
80844-07-1 |
Lact., Aquatic Acute 1, Aquatic Chronic 1 |
H362, H400, H410 |
M=100, M=1000 |
|
ATP06 |
| 604-092-00-9 |
phenol, dodecyl-, branched [1]; phenol, 2-dodecyl-, branched; phenol, 3-dodecyl-, branched; phenol, 4-dodecyl-, branched; phenol, (tetrapropenyl) derivatives [2] |
121158-58-5 [1], 74499-35-7 [2] |
Repr. 1B, Skin Corr. 1C, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360F, H314, H318, H400, H410 |
M=10, M=10 |
|
ATP09 |
| 604-093-00-4 |
clorofene; chlorophene; 2-benzyl-4-chlorophenol |
120-32-1 |
Carc. 2, Repr. 2, Acute Tox. 4, STOT RE 2, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H361f, H332, H373 (kidney), H315, H318, H317, H400, H410 |
M=1, M=100 |
|
ATP10 |
| 604-094-00-X |
isoeugenol [1] (E)-2-methoxy-4-(prop-1-enyl) phenol [2] (Z)-2-methoxy-4-(prop-1-enyl) phenol [3] |
97-54-1 [1]
5932-68-3 [2]
5912-86-7 [3]
|
Skin Sens. 1A |
H317 |
Skin Sens. 1A; H317: C ≥ 0,01 % |
|
ATP13 |
| 604-095-00-5 |
6,6’-di-tert-butyl-2,2’-methylenedi-p-cresol; [DBMC] |
119-47-1 |
Repr. 1B |
H360F |
|
|
ATP17 |
| 604-096-00-0 |
piperonyl butoxide (ISO); 2-(2-butoxyethoxy)ethyl 6-propylpiperonyl ether |
51-03-6 |
STOT SE 3, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H335, H319, H400, H410 |
M=1, M=1 |
|
ATP18 |
| 604-097-00-6 |
2,4,6-tri-tert-butylphenol |
732-26-3 |
Repr. 1B, Acute Tox. 4, STOT RE 2, Skin Sens. 1B |
H360D, H302, H373 (liver), H317 |
oral: ATE = 500 mg/kg bw |
|
ATP18 |
| 604-098-00-1 |
4,4'-sulphonyldiphenol; bisphenol S |
80-09-1 |
Repr. 1B |
H360FD |
|
|
ATP18 |
| 605-001-00-5 |
formaldehyde … % |
50-00-0 |
Carc. 1B, Muta. 2, Acute Tox. 3*, Acute Tox. 3*, Acute Tox. 3*, Skin Corr. 1B, Skin Sens. 1 |
H350, H341, H301, H311, H331, H314, H317 |
*, Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 5 % ≤ C < 25 % Eye Irrit. 2; H319: 5 % ≤ C < 25 % STOT SE 3; H335: C ≥ 5 % Skin Sens. 1; H317: C ≥ 0,2 % |
B D |
CLP00/ATP06 |
| 605-002-00-0 |
1,3,5-trioxan; trioxymethylene |
110-88-3 |
Flam. Sol. 1, Repr. 2, STOT SE 3 |
H228, H361d ***, H335 |
|
T |
CLP00/ |
| 605-003-00-6 |
acetaldehyde; ethanal |
75-07-0 |
Flam. Liq. 1, Carc. 1B, Muta. 2, STOT SE 3, Eye Irrit. 2 |
H224, H350, H341, H335, H319 |
|
|
CLP00/ATP13 |
| 605-004-00-1 |
2,4,6-trimethyl-1,3,5-trioxane; paraldehyde |
123-63-7 |
Flam. Liq. 3 |
H226 |
|
|
CLP00/ATP01 |
| 605-005-00-7 |
metaldehyde (ISO); 2,4,6,8-tetramethyl- 1,3,5,7-tetraoxacyclooctane |
108-62-3 |
Flam. Sol. 2, Repr. 2, Acute Tox. 3, Aquatic Chronic 3 |
H228, H361f, H301, H412 |
Oral: ATE = 283 mg/kg
|
|
CLP00/ATP14 |
| 605-006-00-2 |
butyraldehyde |
123-72-8 |
Flam. Liq. 2 |
H225 |
|
|
CLP00/ |
| 605-007-00-8 |
1,1-dimethoxyethane; dimethyl acetal |
534-15-6 |
Flam. Liq. 2 |
H225 |
|
|
CLP00/ |
| 605-008-00-3 |
acrolein; prop-2-enal; acrylaldehyde |
107-02-8 |
Flam. Liq. 2, Acute Tox. 1, Acute Tox. 2, Acute Tox. 3, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H225, H330, H300, H311, H314, H400, H410 |
Skin Corr. 1B; H314: C ≥ 0,1 %, M=100, M=1 |
D |
CLP00/ATP05/ATP06 |
| 605-009-00-9 |
crotonaldehyde; 2-butenal; [1] (E)-2-butenal; (E)-crotonaldehyde [2] |
4170-30-3 [1], 123-73-9 [2] |
Flam. Liq. 2, Muta. 2, Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1 |
H225, H341, H330, H311, H301, H373 **, H335, H315, H318, H400 |
|
|
CLP00/ |
| 605-010-00-4 |
2-furaldehyde |
98-01-1 |
Carc. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H351, H331, H301, H312, H319, H335, H315 |
|
|
CLP00/ATP01 |
| 605-011-00-X |
2-chlorobenzaldehyde; o-chlorobenzaldehyde |
89-98-5 |
Skin Corr. 1B |
H314 |
|
|
CLP00/ |
| 605-012-00-5 |
benzaldehyde |
100-52-7 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 605-013-00-0 |
chloralose (INN); (R)-1,2-O-(2,2,2-trichloroethylidene)-α-D-glucofuranose; glucochloralose; anhydroglucochloral |
15879-93-3 |
Acute Tox. 4 *, Acute Tox 3, STOT SE 3, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H301, H336, H410 |
M=10, M=10 |
|
CLP00/ATP09 |
| 605-014-00-6 |
chloral hydrate; 2,2,2-trichloroethane-1,1-diol |
302-17-0 |
Acute Tox. 3 *, Eye Irrit. 2, Skin Irrit. 2 |
H301, H319, H315 |
|
|
CLP00/ |
| 605-015-00-1 |
1,1-diethoxyethane; acetal |
105-57-7 |
Flam. Liq. 2, Eye Irrit. 2, Skin Irrit. 2 |
H225, H319, H315 |
|
|
CLP00/ |
| 605-016-00-7 |
glyoxal … %; ethandial … % |
107-22-2 |
Muta. 2, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H341, H332, H319, H315, H317 |
* |
B |
CLP00/ |
| 605-017-00-2 |
1,3-dioxolane |
646-06-0 |
Flam. Liq. 2 |
H225 |
|
|
CLP00/ |
| 605-018-00-8 |
propanal; propionaldehyde |
123-38-6 |
Flam. Liq. 2, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H225, H319, H335, H315 |
|
|
CLP00/ |
| 605-019-00-3 |
citral |
5392-40-5 |
Skin Irrit. 2, Skin Sens. 1 |
H315, H317 |
|
|
CLP00/ |
| 605-020-00-9 |
safrole; 5-allyl-1,3-benzodioxole |
94-59-7 |
Carc. 1B, Muta. 2, Acute Tox. 4 * |
H350, H341, H302 |
|
|
CLP00/ |
| 605-021-00-4 |
formaldehyde, reaction products with butylphenol |
91673-30-2 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 605-022-00-X |
glutaral; glutaraldehyde; 1,5-pentanedial |
111-30-8 |
Acute Tox. 2, Acute Tox. 3 , STOT SE 3, Skin Corr. 1B, Resp. Sens. 1, Skin Sens. 1A, Aquatic Acute 1, Aquatic Chronic 2 |
H332, H301, H336, H400, H410 |
*, Skin Corr. 1B; H314: C ≥ 10 %, Skin Irrit. 2; H315: 0,5 % ≤ C < 10 %, Eye Dam. ; H318: 2 % ≤ C < 10 %, Eye Irrit. 2; H319: 0,5 % ≤ C < 2 %, STOT SE; H335: C ≥ 0,5 %, Skin Sens. 1; H317: C ≥ 0,5 % |
|
CLP00/ATP09 |
| 605-023-00-5 |
5-chloro-2-(4-chlorophenoxy)phenol; [DCPP] |
3380-30-1 |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
M=10, M=10 |
|
ATP01/ATP10 |
| 605-024-00-0 |
2-bromo-5-hydroxy-4-methoxybenzaldehyde |
2973-59-3 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 605-025-00-6 |
chloroacetaldehyde |
107-20-0 |
Carc. 2, Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B, Aquatic Acute 1 |
H351, H330, H311, H301, H314, H400 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 605-026-00-1 |
2,5,7,7-tetramethyloctanal |
114119-97-0 |
Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H315, H317, H411 |
|
|
CLP00/ |
| 605-027-00-7 |
reaction mass of: 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indene-6-carboxaldehyde; 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indene-5-carboxaldehyde |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 605-028-00-2 |
β-methyl-3-(1-methylethyl)-benzenepropanal |
125109-85-5 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 605-029-00-8 |
2-cyclohexylpropanal |
2109-22-0 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 605-030-00-3 |
1-(p-methoxyphenyl)acetaldehyde oxime |
3353-51-3 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 605-031-00-9 |
reaction mass of: 2,2-dimethoxyethanal [(this component is considered to be anhydrous in terms of identity, structure and composition. However, 2,2-dimethoxyethanal will exist in a hydrated form. 60 % anhydrous is equivalent to 70.4 % hydrate; water(Incl |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 605-032-00-4 |
3-[3-(4-fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl]-(E)-2-propenal |
93957-50-7 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
ATP01/ |
| 605-033-00-X |
reaction mass of: 3,7,11-trimethyl-cis-6,10-dodecadienal; 3,7,11-trimethyl-trans-6,10-dodecadienal |
32480-08-3 |
Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H400, H410 |
|
|
ATP01/ |
| 605-034-00-5 |
reaction mass of: (1RS,2RS,3SR,6RS,9SR)-9-methoxytricyclo[5.2.1.0(2,6)]decane-3-carbaldehyde; (1RS,2RS,3RS,6RS,8SR)-8-methoxytricyclo[5.2.1.0(2,6)]decane-3-carbaldehyde; (1RS,2RS,4SR,6RS,8SR)-8-methoxytricyclo[5.2.1.0(2,6)]decane-4-carbaldehyde |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 605-035-00-0 |
(E)-3-(4-(4-fluorophenyl)-5-methoxymethyl-2,6-bis(1-methoxymethyl)pyridin-3-yl)prop-2-enal |
177964-68-0 |
Eye Irrit. 2, Skin Sens. 1, Aquatic Chronic 4 |
H319, H317, H413 |
|
|
ATP01/ |
| 605-036-00-6 |
2-bromomalonaldehyde |
2065-75-0 |
Acute Tox. 4 *, Eye Dam. 1 |
H302, H318 |
|
|
ATP01/ |
| 605-037-00-1 |
trans-3-[2-(7-chloro-2-quinolinyl)vinyl]benzaldehyde; 3-[(E)-2-(7-chloro-2-quinolinyl)vinyl]benzaldehyde |
120578-03-2 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 605-038-00-7 |
3-methyl-5-phenylpentan-1-al |
55066-49-4 |
Acute Tox. 4 *, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H302, H315, H317, H411 |
|
|
ATP01/ |
| 605-039-00-2 |
3,4-dihydroxy-5-nitrobenzaldehyde |
116313-85-0 |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1 |
H302, H318, H317 |
|
|
ATP01/ |
| 605-040-00-8 |
hydroxyisohexyl 3-cyclohexene carboxaldehyde (INCI); reaction mass of 4-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde and 3-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde [1]
4-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde [2] |
130066-44-3 [1]
31906-04-4 [2]
51414-25-6 [3]
|
Skin Sens. 1 A |
H317 |
|
|
ATP09 |
| 605-041-00-3 |
2-(4-tert-butylbenzyl) propionaldehyde |
80-54-6 |
Repr. 1B |
H360Fd |
|
|
ATP15 |
| 606-001-00-8 |
acetone; propan-2-one; propanone |
67-64-1 |
Flam. Liq. 2, Eye Irrit. 2, STOT SE 3 |
H225, H319, H336 |
|
|
CLP00/ |
| 606-002-00-3 |
butanone; ethyl methyl ketone |
78-93-3 |
Flam. Liq. 2, Eye Irrit. 2, STOT SE 3 |
H225, H319, H336 |
|
|
CLP00/ |
| 606-003-00-9 |
heptan-3-one; butyl ethyl ketone |
106-35-4 |
Flam. Liq. 3, Acute Tox. 4 *, Eye Irrit. 2 |
H226, H332, H319 |
|
|
CLP00/ |
| 606-004-00-4 |
4-methylpentan-2-one; isobutyl methyl ketone |
108-10-1 |
Flam. Liq. 2,
Carc. 2,
Acute Tox. 4,
STOT SE 3,
Eye Irrit. 2 |
H225,
H351,
H332,
H336,
H319 |
Inhalation: ATE = 11 mg/L (Vapours) |
|
CLP00/ATP17 |
| 606-005-00-X |
2,6-dimethylheptan-4-one; di-isobutyl ketone |
108-83-8 |
Flam. Liq. 3, STOT SE 3 |
H226, H335 |
STOT SE 3; H335: C ≥ 10 % |
|
CLP00/ |
| 606-006-00-5 |
pentan-3-one; diethyl ketone |
96-22-0 |
Flam. Liq. 2, STOT SE 3, STOT SE 3 |
H225, H335, H336 |
|
|
CLP00/ |
| 606-007-00-0 |
3-methylbutan-2-one; methyl isopropyl ketone |
563-80-4 |
Flam. Liq. 2 |
H225 |
|
|
CLP00/ |
| 606-009-00-1 |
4-methylpent-3-en-2-one; mesityl oxide |
141-79-7 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H226, H332, H312, H302 |
* |
|
CLP00/ |
| 606-010-00-7 |
cyclohexanone |
108-94-1 |
Flam. Liq. 3, Acute Tox. 4 * |
H226, H332 |
|
|
CLP00/ |
| 606-011-00-2 |
2-methylcyclohexanone |
583-60-8 |
Flam. Liq. 3, Acute Tox. 4 * |
H226, H332 |
|
|
CLP00/ |
| 606-012-00-8 |
3,5,5-trimethylcyclohex-2-enone; isophorone |
78-59-1 |
Carc. 2, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3 |
H351, H312, H302, H319, H335 |
STOT SE 3; H335: C ≥ 10 % |
|
CLP00/ |
| 606-013-00-3 |
p-benzoquinone; quinone |
106-51-4 |
Acute Tox. 3 *, Acute Tox. 3 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1 |
H331, H301, H319, H335, H315, H400 |
M=10: |
|
CLP00/ATP01 |
| 606-014-00-9 |
chlorophacinone (ISO); 2-(2-(4-chlorophenyl)phenylacetyl)indan-1,3-dione |
3691-35-8 |
Repr. 1B, Acute Tox. 1, Acute Tox. 1, Acute Tox. 1, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360D, H330, H310, H300, H372 (Blood), H400, H410 |
|
|
CLP00/ATP09 |
| 606-016-00-X |
pindone (ISO); 2-pivaloylindan-1,3-dione |
83-26-1 |
Acute Tox. 3 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H372 **, H400, H410 |
|
|
CLP00/ |
| 606-017-00-5 |
diketene; diketen |
674-82-8 |
Flam. Liq. 3, Acute Tox. 4 * |
H226, H332 |
|
D |
CLP00/ |
| 606-018-00-0 |
dichlone (ISO); 2,3-dichloro-1,4-naphthoquinone |
117-80-6 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H315, H400, H410 |
|
|
CLP00/ |
| 606-019-00-6 |
chlordecone (ISO); perchloropentacyclo[5,3,0,02,6,03,9,04,8]decan-5-one; decachloropentacyclo[5,2,1,02,6,03,9,05,8]decan-4-one |
143-50-0 |
Carc. 2, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H311, H301, H400, H410 |
|
|
CLP00/ |
| 606-020-00-1 |
5-methylheptan-3-one |
541-85-5 |
Flam. Liq. 3, Eye Irrit. 2, STOT SE 3 |
H226, H319, H335 |
STOT SE 3; H335: C ≥ 10 % |
|
CLP00/ |
| 606-021-00-7 |
N-methyl-2-pyrrolidone; 1-methyl-2-pyrrolidone |
872-50-4 |
Repr. 1B STOT SE 3, Skin Irrit. 2, Eye Irrit. 2 |
H360D***, H335, H315, H319 |
STOT SE 3; H335: C ≥ 10 % |
|
CLP00/ATP09 |
| 606-022-00-2 |
1-phenyl-3-pyrazolidone |
92-43-3 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 606-023-00-8 |
4-methoxy-4-methylpentan-2-one |
107-70-0 |
Flam. Liq. 3, Acute Tox. 4 * |
H226, H332 |
|
|
CLP00/ |
| 606-024-00-3 |
heptan-2-one; methyl amyl ketone |
110-43-0 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 * |
H226, H332, H302 |
|
|
CLP00/ |
| 606-025-00-9 |
cyclopentanone |
120-92-3 |
Flam. Liq. 3, Eye Irrit. 2, Skin Irrit. 2 |
H226, H319, H315 |
|
|
CLP00/ |
| 606-026-00-4 |
5-methylhexan-2-one; isoamyl methyl ketone |
110-12-3 |
Flam. Liq. 3, Acute Tox. 4 * |
H226, H332 |
|
|
CLP00/ |
| 606-027-00-X |
heptan-4-one; di-n-propyl ketone |
123-19-3 |
Flam. Liq. 3, Acute Tox. 4 * |
H226, H332 |
|
|
CLP00/ |
| 606-028-00-5 |
2,4-dimethylpentan-3-one; di-isopropyl ketone |
565-80-0 |
Flam. Liq. 2, Acute Tox. 4 * |
H225, H332 |
|
|
CLP00/ |
| 606-029-00-0 |
pentane-2,4-dione; acetylacetone |
123-54-6 |
Flam. Liq. 3, Acute Tox. 4 * |
H226, H302 |
|
|
CLP00/ |
| 606-030-00-6 |
hexan-2-one; methyl butyl ketone; butyl methyl ketone; methyl-n-butyl ketone |
591-78-6 |
Flam. Liq. 3, Repr. 2, STOT RE 1, STOT SE 3 |
H226, H361f ***, H372 **, H336 |
|
|
CLP00/ |
| 606-031-00-1 |
3-propanolide; 1,3-propiolactone |
57-57-8 |
Carc. 1B, Acute Tox. 2 *, Eye Irrit. 2, Skin Irrit. 2 |
H350, H330, H319, H315 |
|
|
CLP00/ |
| 606-032-00-7 |
hexachloroacetone |
116-16-5 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 606-033-00-2 |
2-(3,4-dichlorophenyl)-4-methyl-1,2,4-oxadiazolidinedione; methazole |
20354-26-1 |
Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Chronic 2 |
H312, H302, H319, H315, H411 |
|
|
CLP00/ |
| 606-034-00-8 |
metribuzin (ISO); 4-amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5(4H)-one; 4-amino-4,5-dihydro-6-(1,1-dimethylethyl)-3-methylthio-1,2,4-triazin-5-one |
21087-64-9 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
M=10: |
|
CLP00/ATP01 |
| 606-035-00-3 |
chloridazon (ISO); 5-amino-4-chloro-2-phenylpyridazine-3-(2H)-one; pyrazon |
1698-60-8 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 606-036-00-9 |
quinomethionate; chinomethionat (ISO); 6-methyl-1,3-dithiolo(4,5-b)quinoxalin-2-one |
2439-01-2 |
Repr. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361f ***, H332, H312, H302, H373 **, H319, H317, H400, H410 |
|
|
CLP00/ |
| 606-037-00-4 |
triadimefon (ISO); 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butanone |
43121-43-3 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H302, H317, H411 |
|
|
CLP00/ |
| 606-038-00-X |
diphacinone (ISO); 2-diphenylacetylindan-1,3-dione |
82-66-6 |
Acute Tox. 2 *, STOT RE 1 |
H300, H372 ** |
|
|
CLP00/ |
| 606-039-00-5 |
5(or 6)-tert-butyl-2'-chloro-6'-ethylamino-3',7'-dimethylspiro(isobenzofuran-1(1H),9'-xanthene)-3-one |
- |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H400, H410 |
|
|
CLP00/ |
| 606-040-00-0 |
(N-benzyl-N-ethyl)amino-3-hydroxyacetophenone hydrochloride |
55845-90-4 |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 606-041-00-6 |
2-methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-one |
71868-10-5 |
Repr. 1B, Acute Tox. 4 *, Aquatic Chronic 2 |
H360FD, H302, H411 |
|
|
CLP00/ATP10 |
| 606-042-00-1 |
acetophenone |
98-86-2 |
Acute Tox. 4 *, Eye Irrit. 2 |
H302, H319 |
|
|
CLP00/ |
| 606-043-00-7 |
2,4-di-tert-butylcyclohexanone |
13019-04-0 |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ |
| 606-044-00-2 |
2,4,6-trimethylbenzophenone |
954-16-5 |
Acute Tox. 4 *, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H400, H410 |
|
|
CLP00/ |
| 606-045-00-8 |
oxadiazon (ISO); 3-[2,4-dichloro-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one |
19666-30-9 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 606-046-00-3 |
reaction mass of cis- and trans-cyclohexadec-8-en-1-one |
3100-36-5 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 606-047-00-9 |
2-benzyl-2-dimethylamino-4'-morpholinobutyrophenone |
119313-12-1 |
Repr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H360D, H400, H410 |
|
|
CLP00/ATP14 |
| 606-048-00-4 |
2'-anilino-3'-methyl-6'-dipentylaminospiro(isobenzofuran-1(1H),9'-xanthen)-3-one |
- |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 606-049-00-X |
4-(trans-4-propylcyclohexyl)acetophenone |
78531-61-0 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 606-050-00-5 |
6-anilino-1-benzoyl-4-(4-tert-pentylphenoxy)naphto[1,2,3-de]quinoline-2,7-(3H)-dione |
72453-58-8 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 606-051-00-0 |
4-pentylcyclohexanone |
61203-83-6 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 606-052-00-6 |
4-(N,N-dibutylamino)-2-hydroxy-2'-carboxybenzophenone |
54574-82-2 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 606-053-00-1 |
flurtamone (ISO); (RS)-5-methylamino-2-phenyl-4-(α, α,α-trifluoro-m-tolyl)furan-3(2H)-one |
96525-23-4 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 606-054-00-7 |
isoxaflutole (ISO); 5-cyclopropyl-1,2-oxazol-4-yl α, α,α-trifluoro-2-mesyl-p-tolyl ketone |
141112-29-0 |
Repr. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H361d ***, H400, H410 |
M=10 , M=100 |
|
CLP00/ATP07 |
| 606-055-00-2 |
1-(2,3-dihydro-1,3,3,6-tetramethyl-1-(1-methylethyl)-1H-inden-5-yl)ethanone |
92836-10-7 |
Acute Tox. 4 *, STOT RE 2 *, Aquatic Chronic 2 |
H302, H373 **, H411 |
|
|
CLP00/ |
| 606-056-00-8 |
4-chloro-3',4'-dimethoxybenzophenone |
116412-83-0 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 606-057-00-3 |
4-propylcyclohexanone |
40649-36-3 |
Skin Irrit. 2, Aquatic Chronic 3 |
H315, H412 |
|
|
CLP00/ |
| 606-058-00-9 |
4'-fluoro-2,2-dimethoxyacetophenone |
21983-80-2 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 606-059-00-4 |
2,4-difluoro-α-(1H-1,2,4-triazol-1-yl)acetophenone hydrochloride |
86386-75-6 |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1 |
H302, H318, H317 |
|
|
CLP00/ |
| 606-060-00-X |
reaction mass of: trans-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-naphthalene-2-yl)-1,3-dioxolane; cis-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-naphthalene-2-yl)-1,3-dioxolane |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 606-061-00-5 |
(3-chlorophenyl)-(4-methoxy-3-nitrophenyl)methanone |
66938-41-8 |
Muta. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H341, H400, H410 |
|
|
CLP00/ |
| 606-062-00-0 |
tetrahydrothiopyran-3-carboxaldehyde |
61571-06-0 |
Repr. 1B, Eye Dam. 1, Aquatic Chronic 3 |
H360D ***, H318, H412 |
|
|
CLP00/ |
| 606-063-00-6 |
(E)-3-(2-chlorophenyl)-2-(4-fluorophenyl)propenal |
112704-51-5 |
Eye Irrit. 2, Skin Sens. 1 |
H319, H317 |
|
|
CLP00/ |
| 606-064-00-1 |
pregn-5-ene-3,20-dione bis(ethylene ketal) |
7093-55-2 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 606-065-00-7 |
1-(4-morpholinophenyl)butan-1-one |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 606-066-00-2 |
(E)-5[(4-chlorophenyl)methylene]-2,2-dimethylcyclopentanone |
164058-20-2 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 606-067-00-8 |
reaction mass of: 1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-4-yl)ethanone; 1-(2,3,5,6,7,8-hexahydro-1,1-dimethyl-1H-benz(f)inden-4-yl)ethanone; 1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-5-yl)ethanone; 1-(2,3,6,7,8,9-hexahydro-3, |
96792-67-5 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 606-068-00-3 |
2,7,11-trimethyl-13-(2,6,6-trimethylcyclohex-1-en-1-yl)tridecahexaen-2,4,6,8,10,12-al |
1638-05-7 |
STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 3 |
H373 **, H317, H412 |
|
|
CLP00/ |
| 606-069-00-9 |
spiro[1,3-dioxolane-2,5'-(4',4',8',8'-tetramethyl-hexahydro-3',9'-methanonaphthalene)] |
154171-76-3 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 606-070-00-4 |
butroxydim (ISO); 5-(3-butyryl-2,4,6-trimethylphenyl)-2-[1-(ethoxyimino)propyl]-3-hydroxycyclohex-2-en-1-one |
138164-12-2 |
Repr. 2, Acute Tox. 4 *, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H361fd, H302, H315, H400, H410 |
|
|
CLP00/ |
| 606-071-00-X |
17-spiro(5,5-dimethyl-1,3-dioxan-2-yl)androsta-1,4-diene-3-one |
13258-43-0 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 606-072-00-5 |
3-acetyl-1-phenyl-pyrrolidine-2,4-dione |
719-86-8 |
STOT RE 2 *, Aquatic Chronic 2 |
H373 **, H411 |
|
|
CLP00/ |
| 606-073-00-0 |
4,4'-bis(dimethylamino)benzophenone; Michler's ketone |
90-94-8 |
Carc. 1B, Muta. 2, Eye Dam. 1 |
H350, H341, H318 |
|
|
CLP00/ |
| 606-074-00-6 |
reaction mass of: (1R*,2S*)-2-acetyl-1,2,3,4,5,6,7,8-octahydro-1,2,8,8-tetramethylnaphthalene; (2R*,3S*)-2-acetyl-1,2,3,4,5,6,7,8-octahydro-2,3,8,8-tetramethylnaphthalene |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 606-075-00-1 |
1-benzyl-5-ethoxyimidazolidine-2,4-dione |
65855-02-9 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 606-076-00-7 |
1-((2-quinolinyl-carbonyl)oxy)-2,5-pyrrolidinedione |
136465-99-1 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
CLP00/ |
| 606-077-00-2 |
(3S,4S)-3-hexyl-4-[(R)-2-hydroxytridecyl]-2-oxetanone |
104872-06-2 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 606-078-00-8 |
1-octylazepin-2-one |
59227-88-2 |
Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 2 |
H314, H317, H411 |
|
|
CLP00/ |
| 606-079-00-3 |
2-n-butyl-benzo[d]isothiazol-3-one |
4299-07-4 |
Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H317, H400, H410 |
|
|
CLP00/ |
| 606-081-00-4 |
(3β, 5α, 6β)-3-(acetyloxy)-5-bromo-6-hydroxy-androstan-17-one |
4229-69-0 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 606-082-00-X |
reaction mass of: butan-2-one oxime; syn-O,O'-di(butan-2-one oxime)diethoxysilane |
- |
STOT RE 1, Skin Sens. 1, Aquatic Chronic 3 |
H372 **, H317, H412 |
|
|
CLP00/ |
| 606-083-00-5 |
2-chloro-5-sec-hexadecylhydroquinone |
137193-60-3 |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 3 |
H319, H315, H317, H412 |
|
|
CLP00/ |
| 606-084-00-0 |
1-(4-methoxy-5-benzofuranyl)-3-phenyl-1,3-propanedione |
484-33-3 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 606-085-00-6 |
(1R,4S)-2-azabicyclo[2.2.1]hept-5-en-3-one |
79200-56-9 |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1 |
H302, H318, H317 |
|
|
CLP00/ |
| 606-086-00-1 |
1-(3,3-dimethylcyclohexyl)pent-4-en-1-one |
56973-87-6 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 606-087-00-7 |
6-ethyl-5-fluoro-4(3H)-pyrimidone |
137234-87-8 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 606-088-00-2 |
2,4,4,7-tetramethyl-6-octen-3-one |
74338-72-0 |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ |
| 606-089-00-8 |
reaction mass of: 1,4-diamino-2-chloro-3-phenoxyanthraquinone; 1,4-diamino-2,3-bis-phenoxyanthraquinone |
12223-77-7 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 606-090-00-3 |
1-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]ethanone |
73096-98-7 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 3 |
H302, H318, H412 |
|
|
ATP01/ |
| 606-091-00-9 |
6-chloro-5-(2-chloroethyl)-1,3-dihydroindol-2-one |
118289-55-7 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 606-092-00-4 |
reaction mass of: (E)-oxacyclohexadec-12-en-2-one; (E)-oxacyclohexadec-13-en-2-one; a) (Z)-oxacyclohexadec-(12)-en-2-one and b) (Z)-oxacyclohexadec-(13)-en-2-one |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 606-093-00-X |
5-ethyl-2,4-dihydro-4-(2-phenoxyethyl)-3H-1,2,4-triazol-3-one |
95885-13-5 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
ATP01/ |
| 606-094-00-5 |
N-[ethyl(3-methylbutyl)amino]-3-methyl-1-phenyl-spiro[[1]benzo-pyrano[2,3-c]pyrazole-4(1H),1'(3'H)-isobenzofuran]-3'-one |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 606-095-00-0 |
(R,S)-2-azabicyclo[2.2.1]hept-5-en-3-one |
49805-30-3 |
Acute Tox. 4 *, Skin Sens. 1 |
H302, H317 |
|
|
ATP01/ |
| 606-096-00-6 |
3-(6-O-(6-desoxy-α-l-mannopyranosyl-O-(α-d-glucopyranosyl)-(β-d-glucopyranosyl)oxy)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one |
130603-71-3 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 606-097-00-1 |
2,2''-dihydroxy-4,4''-(2-hydroxy-propane-1,3-diyldioxy)dibenzophenone |
23911-85-5 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 606-098-00-7 |
1-benzyl-5-(hexadecyloxy)-2,4-imidazolidinedione |
158574-65-3 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 606-099-00-2 |
5-methoxy-4'-(trifluoromethyl)valerophenone |
61718-80-7 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 606-100-00-6 |
2-butyryl-3-hydroxy-5-thiocyclohexan-3-yl-cyclohex-2-en-1-one |
94723-86-1 |
Repr. 1B, Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 3 |
H360F***, H302, H317, H412 |
|
|
ATP01/ |
| 606-101-00-1 |
reaction mass of: 1,5-bis[(2-ethylhexyl)amino]-9,10-anthracenedione; 1-[(2-ethylhexyl)amino]-5-[3-[(2-ethylhexyl)oxy]propyl]amino-9,10-anthracenedione; 1,5-bis[3-[(2-ethylhexyl)oxy]propyl]amino-9,10-anthracenedione; 1-[(2-ethylhexyl)amino]-5-[(3-methox |
165038-51-7 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 606-102-00-7 |
4-(3-triethoxysilylpropoxy)-2-hydroxybenzophenone |
79876-59-8 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 606-103-00-2 |
1-(4-(trans-4-ethylcyclohexyl)phenyl)ethanone |
- |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 606-104-00-8 |
1-(4-(trans-4-pentylcyclohexyl)phenyl)ethanone |
78531-59-6 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 606-105-00-3 |
3,4,3',4'-tetraphenyl-1,1'-ethandiylbispyrol-2,5-dione |
226065-73-2 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 606-106-00-9 |
1-(4-(trans-4-butylcyclohexyl)phenyl)ethanone |
83626-30-6 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 606-107-00-4 |
8-azaspiro[4.5]decane-7,9-dione |
1075-89-4 |
Acute Tox. 3 *, Aquatic Chronic 2 |
H301, H411 |
|
|
ATP01/ |
| 606-108-00-X |
1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl )-3-pentanone |
756-13-8 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 606-109-00-5 |
2-(4-methyl-3-pentenyl)anthraquinone |
71308-16-2 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 4 |
H302, H317, H314 |
|
|
ATP01/ |
| 606-110-00-0 |
5-ethoxy-5H-furan-2-one |
2833-30-9 |
Skin Corr. 1B, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1 |
H314, H312, H302, H373**, H317 |
|
|
ATP01/ |
| 606-111-00-6 |
5-amino-6-methyl-1,3-dihydrobenzoimidazol-2-one |
67014-36-2 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H302, H317, H411 |
|
|
ATP01/ |
| 606-112-00-1 |
(4aR*,8aR*)-4a,5,9,10,11,12-hexahydro-3-methoxy-11-methyl-6H-benzofuro[3a,3,2-ef][2]benzazepin-6-one |
1668-86-6 |
Acute Tox. 4 *, Eye Irrit. 2, Aquatic Chronic 3 |
H302, H319, H412 |
|
|
ATP01/ |
| 606-113-00-7 |
1-[4-(4-benzoylphenylsulfanyl)phenyl]-2-methyl-2-(4-methylphenylsulfonyl)propan-1-one |
272460-97-6 |
Eye Dam. 1, Aquatic Chronic 4 |
H318, H314 |
|
|
ATP01/ |
| 606-114-00-2 |
4,4',5,5',6,6',7,7'-octachloro-(2,2')biisoindolyl-1,1',3,3'-tetraone |
67887-47-2 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 606-115-00-8 |
profoxydim (ISO); 2-{(EZ)-1-[(2RS)-2-(4-chlorophenoxy)propoxyimino]butyl}-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one |
139001-49-3 |
Carc. 2, Repr. 2, Skin Sens. 1 |
H351, H361d, H317 |
|
|
ATP01/ |
| 606-116-00-3 |
tepraloxydim (ISO); (RS)-(EZ)-2-{1-[(2E)-3-chloroallyloxyimino]propyl}-3-hydroxy-5-perhydropyran-4-ylcyclohex-2-en-1-one |
149979-41-9 |
Carc. 2, Repr. 2 |
H351, H361fd |
|
|
ATP01/ |
| 606-117-00-9 |
2,6-bis(1,1-dimethylethyl)-4-(phenylenemethylene)cyclohexa-2,5-dien-1-one |
7078-98-0 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 606-118-00-4 |
N-(1,3-dimethylbutyl)-N'-(phenyl)-1,4-benzoquinonediimine |
52870-46-9 |
Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H400, H410 |
|
|
ATP01/ |
| 606-119-00-X |
(E)-3-methyl-5-cyclopentadecen-1-one |
- |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
ATP01/ |
| 606-120-00-5 |
2,5-dihydroxy-5-methyl-3-(morpholin-4-yl)-2-cyclopenten-1-one |
114625-74-0 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
ATP01/ |
| 606-121-00-0 |
(+)-(1S,2S,3S,5R)-2,6,6-trimethylbicyclo[3.1.1]heptane-3-spiro-1'-(cyclohex-2'-en-4'-one) |
133636-82-5 |
Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H317, H400, H410 |
|
|
ATP01/ |
| 606-122-00-6 |
3-(2-bromopropionoyl)-4,4-dimethyl-1,3-oxazolan-2-one |
114341-88-7 |
Acute Tox. 4 *, STOT RE 2 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373**, H315, H318, H317, H400, H410 |
|
|
ATP01/ |
| 606-123-00-1 |
4-hexadecyl-1-phenylpyrazolidin-3-one |
- |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 606-124-00-7 |
1-cyclopropyl-3-(2-methylthio-4-trifluoromethylphenyl)-1,3-propanedione |
161462-35-7 |
STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H373**, H400, H410 |
|
|
ATP01/ |
| 606-125-00-2 |
1-benzylimidazolidine-2,4-dione |
6777-05-5 |
Acute Tox. 4 * |
H302 |
|
|
ATP01/ |
| 606-126-00-8 |
1,4-bis(2,3-dihydroxypropylamino)anthraquinone |
99788-75-7 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 606-128-00-9 |
2,2'-(1,3-phenylene)bis[5-chloro-1H-isoindole]-1,3(2H)-dione |
148935-94-8 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 606-129-00-4 |
5-amino-[2S-di(methylphenyl)amino]-1,6-diphenyl-4Z-hexen-3-one; (2S,4Z)-5-amino-2-(dibenzylamino)-1,6-diphenylhex-4-en-3-one |
156732-13-7 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 606-130-00-X |
4-(1,4-dioxa-spiro[4.5]dec-8-yl)-cyclohexanone |
56309-94-5 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
ATP01/ |
| 606-131-00-5 |
cyclic 3-(1,2-ethanediylacetale)-estra-5(10),9(11)-diene-3,17-dione |
5571-36-8 |
Repr. 1B, STOT RE 2 *, Aquatic Chronic 2 |
H360F***, H373**, H411 |
|
|
ATP01/ |
| 606-132-00-0 |
(6β)-6,19-epoxyandrost-4-ene-3,17-dione |
6563-83-3 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
ATP01/ |
| 606-134-00-1 |
androsta-1,4,9(11)-triene-3,17-dione |
15375-21-0 |
Repr. 2 |
H361f*** |
|
|
ATP01/ |
| 606-135-00-7 |
cyclohexadecanone |
2550-52-9 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 606-136-00-2 |
(3S,6R,9S,12R,15S,18R,21S,24R)-6,18-dibenzyl-3,9,15,21-tetraisobutyl-4,10,12,16,22,24-hexamethyl-1,7,13,19-tetraoxa-4,10,16,22-tetraazacyclo-tetracosane-2,5,8,11,14,17,20,23-octaone |
133413-70-4 |
Eye Irrit. 2, Aquatic Chronic 4 |
H319, H413 |
|
|
ATP01/ |
| 606-137-00-8 |
trans-7,7'-dimethyl-(4H,4H')-(2,2')bi[benzo[1,4]thiazinylidene]-3,3'-dione |
211387-26-7 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 606-138-00-3 |
(2-butyl-5-nitrobenzofuran-3-yl)[4-(3-dibutylaminopropoxy)phenyl]methanone |
141645-23-0 |
Flam. Liq. 3, Acute Tox. 4 *, STOT RE 2 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H226, H302, H373**, H315, H318, H317, H400, H410 |
M=10: |
|
ATP01/ |
| 606-139-00-9 |
(S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one |
124379-29-9 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 606-140-00-4 |
2-hydroxy-1-(4-(4-(2-hydroxy-2-methylpropionyl)benzyl)phenyl)-2-methylpropan-1-one |
474510-57-1 |
STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H373**, H400, H410 |
|
|
ATP01/ |
| 606-141-00-X |
sodium 3-(methoxycarbonyl)-4-oxo-3,4,5,6-tetrahydro-2-pyridinolate |
- |
Eye Irrit. 2 |
H319 |
|
|
ATP01/ |
| 606-142-00-5 |
reaction mass of: (1RS,2SR,7SR,8SR,E) 9 and 10-ethylidene-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-one; (1RS,2SR,7SR,8SR,Z)-10-ethylidene-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-one; (1RS,2SR,7SR,8SR,Z)-9-ethylidene-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-one |
- |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
ATP01/ |
| 606-143-00-0 |
abamectin (combination of avermectin B1a and avermectin B1b) (ISO) [1]; avermectin B1a (purity ≥ 80 %); [2] |
71751-41-2 [1]; 65195-55-3 [2] |
Repr. 2, Acute Tox. 2, Acute Tox. 1, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361d, H300, H330, H372 (Nervensystem), H400, H410 |
STOT RE 1; H372: C ≥ 5 % STOT RE 2; H373: 0,5 % ≤ C < 5 %, M=10000 |
|
ATP03 |
| 606-144-00-6 |
acequinocyl (ISO); 3-dodecyl-1,4-dioxo-1,4- dihydronaphthalen-2-yl acetate |
57960-19-7 |
Skin Sens. 1, STOT SE 1, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H370 (Lunge) (Einatmung), H373 (Blutkreislauf), H400, H410 |
M=1000 |
|
ATP03 |
| 606-145-00-1 |
sulcotrione (ISO); 2-[2-chloro-4-(methylsulfonyl) benzoyl]cyclohexane-1,3-dione |
99105-77-8 |
Repr. 2, STOT RE 2, Skin Sens. 1A, Aquatic Acute 1, Aquatic Chronic 1 |
H361d, H373 (kidneys), H317, H400, H410 |
M=1, M=10 |
|
ATP05 |
| 606-146-00-7 |
tralkoxydim (ISO); 2-(N- ethoxypropanimidoyl)- 3-hydroxy-5-mesitylcyclohex-2-en-1-one |
87820-88-0 |
Carc. 2, Acute Tox. 4, Aquatic Chronic 2 |
H351, H302, H411 |
|
|
ATP06 |
| 606-147-00-2 |
cycloxydim (ISO); 2-(N- ethoxybutanimidoyl)-3- hydroxy-5-(tetrahydro- 2H-thiopyran-3-yl)cyclohex-2-en-1-one |
101205-02-1 |
Repr. 2 |
H361d |
|
|
ATP06 |
| 606-148-00-8 |
carvone (ISO); 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one; [1] d-arvone;
(5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one; [2] l-carvone; (5R)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one [3] |
99-49-0 [1], 2244-16-8 [2], 6485-40-1 [3] |
Skin Sens. 1 |
H317 |
|
|
ATP07 |
| 606-149-00-3 |
tembotrione (ISO); 2-{2-chloro-4-(methylsulfonyl)-3-[(2,2,2-trifluoroethoxy)methyl] benzoyl}cyclohexane-1,3-dione |
335104-84-2 |
Repr. 2, STOT RE 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361d, H373 (eyes, kidneys, liver) H317, H400, H410 |
M=100, M=10 |
|
ATP07 |
| 606-150-00-9 |
clethodim (ISO); (5RS)-2-{(1EZ)-1-[(2E)-3-chloroallyloxyimino]propyl}-5-[(2RS)-2-(ethylthio)propyl]-3-hydroxycyclohex-2-en-1-one |
99129-21-2 |
Acute Tox. 4, Skin Sens. 1, Aquatic Chronic 3 |
H302, H317, H412 |
|
|
ATP10 |
| 606-151-00-4 |
anthraquinone |
84-65-1 |
Carc. 1B |
H350 |
|
|
ATP10 |
| 606-152-00-X |
(5-chloro-2-methoxy-4-methyl-3-pyridyl)(4,5,6-trimethoxy-o-tolyl)methanone; pyriofenone |
688046-61-9 |
Carc. 2,
Aquatic Chronic 1 |
H351,
H410 |
M=1 |
|
ATP17 |
| 606-153-00-5 |
benzophenone |
119-61-9 |
Carc. 1B |
H350 |
|
|
ATP18 |
| 606-154-00-0 |
quinoclamine (ISO); 2-amino-3-chloro-1,4-naphthoquinone |
2797-51-5 |
Carc. 2, Repr. 2, Acute Tox. 4, STOT RE 2, Eye Irrit. 2, Skin Sens. 1A, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H361d, H302, H373 (blood system, kidney), H319, H317, H400, H410 |
oral: ATE = 500 mg/kg bw; M=10, M=10 |
|
ATP18 |
| 607-001-00-0 |
formic acid … % |
64-18-6 |
Skin Corr. 1A |
H314 |
Skin Corr. 1A; H314: C ≥ 90 %, Skin Corr. 1B; H314: 10 % ≤ C < 90 %, Skin Irrit. 2; H315: 2 % ≤ C < 10 %, Eye Irrit. 2; H319: 2 % ≤ C < 10 % |
B |
CLP00/ |
| 607-002-00-6 |
acetic acid … % |
64-19-7 |
Flam. Liq. 3, Skin Corr. 1A |
H226, H314 |
Skin Corr. 1A; H314: C ≥ 90 %, Skin Corr. 1B; H314: 25 % ≤ C < 90 %, Skin Irrit. 2; H315: 10 % ≤ C < 25 %, Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
CLP00/ |
| 607-003-00-1 |
chloroacetic acid |
79-11-8 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B, Aquatic Acute 1 |
H331, H311, H301, H314, H400 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ATP01 |
| 607-004-00-7 |
TCA (ISO); trichloroacetic acid |
76-03-9 |
Skin Corr. 1A, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H400, H410 |
STOT SE 3; H335: C ≥ 1 % |
|
CLP00/ |
| 607-005-00-2 |
TCA-sodium (ISO); sodium trichloroacetate |
650-51-1 |
STOT SE 3, Aquatic Acute 1, Aquatic Chronic 1 |
H335, H400, H410 |
|
|
CLP00/ |
| 607-006-00-8 |
oxalic acid |
144-62-7 |
Acute Tox. 4 *, Acute Tox. 4 * |
H312, H302 |
* |
|
CLP00/ |
| 607-007-00-3 |
salts of oxalic acid with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 4 *, Acute Tox. 4 * |
H312, H302 |
* |
A |
CLP00/ATP01 |
| 607-008-00-9 |
acetic anhydride |
108-24-7 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H226, H332, H302, H314 |
Skin Corr. 1B; H314: C ≥ 25 %, Skin Irrit. 2; H315: 5 % ≤ C < 25 %, Eye Dam. 1; H318: 5 % ≤ C < 25 %, Eye Irrit. 2; H319: 1 % ≤ C < 5 %, STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 607-009-00-4 |
phthalic anhydride |
85-44-9 |
Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H302, H335, H315, H318, H334, H317 |
|
|
CLP00/ |
| 607-010-00-X |
propionic anhydride |
123-62-6 |
Skin Corr. 1B |
H314 |
Skin Corr. 1B; H314: C ≥ 25 %, Skin Irrit. 2; H315: 10 % ≤ C < 25 %, Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
|
CLP00/ |
| 607-011-00-5 |
acetyl chloride |
75-36-5 |
Flam. Liq. 2, Skin Corr. 1B |
H225, H314 |
|
|
CLP00/ |
| 607-012-00-0 |
benzoyl chloride |
98-88-4 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1 |
H332, H312, H302, H314, H317 |
|
|
CLP00/ATP01 |
| 607-013-00-6 |
dimethyl carbonate |
616-38-6 |
Flam. Liq. 2 |
H225 |
|
|
CLP00/ |
| 607-014-00-1 |
methyl formate |
107-31-3 |
Flam. Liq. 1, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3 |
H224, H332, H302, H319, H335 |
|
|
CLP00/ |
| 607-015-00-7 |
ethyl formate |
109-94-4 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3 |
H225, H332, H302, H319, H335 |
|
|
CLP00/ |
| 607-016-00-2 |
propyl formate; [1] isopropyl formate [2] |
110-74-7 [1], 625-55-8 [2] |
Flam. Liq. 2, Eye Irrit. 2, STOT SE 3, STOT SE 3 |
H225, H319, H335, H336 |
|
C |
CLP00/ |
| 607-017-00-8 |
butyl formate; [1] tert-butyl formate; [2] isobutyl formate [3] |
592-84-7 [1], 762-75-4 [2], 542-55-2 [3] |
Flam. Liq. 2, Eye Irrit. 2, STOT SE 3 |
H225, H319, H335 |
|
C |
CLP00/ |
| 607-018-00-3 |
isopentyl formate; [1] pentyl formate; [2] 2-methylbutyl formate |
110-45-2 [1], 35073-27-9 [2], - |
Flam. Liq. 2, Eye Irrit. 2, STOT SE 3 |
H225, H319, H335 |
|
C |
CLP00/ |
| 607-019-00-9 |
methyl chloroformate |
79-22-1 |
Flam. Liq. 2, Acute Tox. 2 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H225, H330, H312, H302, H314 |
|
|
CLP00/ |
| 607-020-00-4 |
ethyl chloroformate |
541-41-3 |
Flam. Liq. 2, Acute Tox. 2 *, Acute Tox. 4 *, Skin Corr. 1B |
H225, H330, H302, H314 |
|
|
CLP00/ |
| 607-021-00-X |
methyl acetate |
79-20-9 |
Flam. Liq. 2, Eye Irrit. 2, STOT SE 3 |
H225, H319, H336 |
|
|
CLP00/ |
| 607-022-00-5 |
ethyl acetate |
141-78-6 |
Flam. Liq. 2, Eye Irrit. 2, STOT SE 3 |
H225, H319, H336 |
|
|
CLP00/ |
| 607-023-00-0 |
vinyl acetate |
108-05-4 |
Flam. Liq. 2, Carc. 2, Acute Tox. 4, STOT SE 3 |
H225, H351, H332, H335 |
|
D |
CLP00/ATP05 |
| 607-024-00-6 |
propyl acetate; [1] isopropyl acetate [2] |
109-60-4 [1], 108-21-4 [2] |
Flam. Liq. 2, Eye Irrit. 2, STOT SE 3 |
H225, H319, H336 |
|
C |
CLP00/ |
| 607-025-00-1 |
n-butyl acetate |
123-86-4 |
Flam. Liq. 3, STOT SE 3 |
H226, H336 |
|
|
CLP00/ |
| 607-026-00-7 |
sec-butyl acetate; [1] isobutyl acetate; [2] tert-butyl acetate [3] |
105-46-4 [1], 110-19-0 [2], 540-88-5 [3] |
Flam. Liq. 2 |
H225 |
|
C |
CLP00/ |
| 607-027-00-2 |
methyl propionate |
554-12-1 |
Flam. Liq. 2, Acute Tox. 4 * |
H225, H332 |
|
|
CLP00/ |
| 607-028-00-8 |
ethyl propionate |
105-37-3 |
Flam. Liq. 2 |
H225 |
|
|
CLP00/ |
| 607-029-00-3 |
n-butyl propionate; [1] sec-butyl propionate; [2] tert-butyl propionate; [3] iso-butyl propionate |
590-01-2 [1], 591-34-4 [2], 540-42-1 [3], - |
Flam. Liq. 3 |
H226 |
|
C |
CLP00/ |
| 607-030-00-9 |
propyl propionate |
106-36-5 |
Flam. Liq. 3, Acute Tox. 4 * |
H226, H332 |
|
|
CLP00/ |
| 607-031-00-4 |
butyl butyrate |
109-21-7 |
Flam. Liq. 3 |
H226 |
|
C |
CLP00/ |
| 607-032-00-X |
ethyl acrylate |
140-88-5 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1 |
H225, H332, H312, H302, H319, H335, H315, H317 |
Skin Irrit. 2; H315: C ≥ 5 %, Eye Irrit. 2; H319: C ≥ 5 %, STOT SE 3; H335: C ≥ 5 % |
D |
CLP00/ |
| 607-033-00-5 |
n-butyl methacrylate |
97-88-1 |
Flam. Liq. 3, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1 |
H226, H319, H335, H315, H317 |
|
D |
CLP00/ |
| 607-034-00-0 |
methyl acrylate; methyl propenoate |
96-33-3 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1 |
H225, H332, H312, H302, H319, H335, H315, H317 |
|
D |
CLP00/ |
| 607-035-00-6 |
methyl methacrylate; methyl 2-methylprop-2-enoate; methyl 2-methylpropenoate |
80-62-6 |
Flam. Liq. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1 |
H225, H335, H315, H317 |
|
D |
CLP00/ |
| 607-036-00-1 |
2-methoxyethyl acetate; methylglycol acetate |
110-49-6 |
Repr. 1B, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H360FD, H332, H312, H302 |
|
|
CLP00/ |
| 607-037-00-7 |
2-ethoxyethyl acetate; ethylglycol acetate |
111-15-9 |
Flam. Liq. 3, Repr. 1B, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H226, H360FD, H332, H312, H302 |
|
|
CLP00/ATP01 |
| 607-038-00-2 |
2-butoxyethyl acetate; butylglycol acetate |
112-07-2 |
Acute Tox. 4 *, Acute Tox. 4 * |
H332, H312 |
|
|
CLP00/ |
| 607-039-00-8 |
2,4-D (ISO); 2,4-dichlorophenoxyacetic acid |
94-75-7 |
Acute Tox. 4 *, STOT SE 3, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H302, H335, H318, H317, H412 |
|
|
CLP00/ |
| 607-040-00-3 |
salts of 2,4-D |
- |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H302, H318, H317, H411 |
|
A |
CLP00/ |
| 607-041-00-9 |
2,4,5-T (ISO); 2,4,5-trichlorophenoxy acetic acid |
93-76-5 |
Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H335, H315, H400, H410 |
|
|
CLP00/ |
| 607-042-00-4 |
salts and esters of 2,4,5-T; salts and esters of 2,4,5-trichlorophenoxy acetic acid |
- |
Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H335, H315, H400, H410 |
|
A |
CLP00/ |
| 607-043-00-X |
dicamba (ISO); 2,5-dichloro-6-methoxybenzoic acid; 3,6-dichloro-2-methoxybenzoic acid |
1918-00-9 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 3 |
H302, H318, H412 |
|
|
CLP00/ |
| 607-044-00-5 |
3,6-dichloro-o-anisic acid, compound with dimethylamine (1:1); [1] potassium 3,6-dichloro-o-anisate [2] |
2300-66-5 [1], 10007-85-9 [2] |
Eye Irrit. 2, Aquatic Chronic 3 |
H319, H412 |
|
|
CLP00/ |
| 607-045-00-0 |
dichlorprop (ISO); 2-(2,4-dichlorophenoxy) propionic acid |
120-36-5 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1 |
H312, H302, H315, H318 |
|
|
CLP00/ |
| 607-046-00-6 |
salts of dichlorprop |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H332, H312, H302 |
|
A |
CLP00/ |
| 607-047-00-1 |
fenoprop (ISO); 2-(2,4,5-trichlorophenoxy)propionic acid |
93-72-1 |
Acute Tox. 4 *, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H315, H400, H410 |
|
|
CLP00/ |
| 607-048-00-7 |
salts of fenoprop; salts of 2-(2,4,5-trichlorophenoxy)propionic acid |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H312, H302, H400, H410 |
|
A |
CLP00/ |
| 607-049-00-2 |
mecoprop (ISO); 2-(4-chloro-o-tolyloxy) propionic acid; (RS)-2-(4-chloro-o-tolyloxy)propionic acid; [1] 2-(4-chloro-2-methylphenoxy)propionic acid [2] |
7085-19-0 [1], - [2] |
Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H315, H318, H400, H410 |
M=100: |
|
CLP00/ |
| 607-050-00-8 |
salts of mecoprop |
- |
Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H315, H318, H400, H410 |
|
A |
CLP00/ |
| 607-051-00-3 |
MCPA (ISO); 4-chloro-o-tolyloxyacetic acid |
94-74-6 |
Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H315, H318, H400, H410 |
|
|
CLP00/ATP01 |
| 607-052-00-9 |
salts and esters of MCPA |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H312, H302, H400, H410 |
|
A |
CLP00/ATP01 |
| 607-053-00-4 |
MCPB (ISO); 4-(4-chloro-o-tolyloxy) butyric acid |
94-81-5 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 607-054-00-X |
salts and esters of MCPB |
- |
Acute Tox. 4 * |
H302 |
|
A |
CLP00/ |
| 607-055-00-5 |
endothal-sodium (ISO); disodium 7-oxabicyclo(2,2,1)heptane-2,3-dicarboxylate |
129-67-9 |
Acute Tox. 3 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H301, H312, H319, H335, H315 |
|
|
CLP00/ |
| 607-056-00-0 |
warfarin (ISO); [1] (S)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone; [2] (R)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone [3] |
81-81-2 [1], 5543-57-7 [2], 5543-58-8 [3] |
Repr. 1A, Acute Tox. 1, Acute Tox. 1, Acute Tox. 2, STOT RE 1, Aquatic Chronic 2 |
H360D, H330, H310, H300, H372 (blood), H411 |
Repr. 1 A; H360D: C ≥ 0,003% , STOT RE 1; H372 (blood): C ≥ 0,5 % , STOT RE 2; H373 (blood): 0,05 % ≤ C < 0,5 % |
|
CLP00/ATP09 |
| 607-057-00-6 |
coumachlor (ISO); 3-[1-(4-chlorophenyl)-3-oxobutyl]-4-hydroxycoumarin |
81-82-3 |
STOT RE 2 *, Aquatic Chronic 3 |
H373 **, H412 |
|
|
CLP00/ |
| 607-058-00-1 |
coumafuryl (ISO); fumarin; (RS)-3-(1-(2-furyl)-3-oxobutyl)4-hydroxycoumarin; 4-hydroxy-3-[3-oxo-1-(2-furyl) butyl]coumarin |
117-52-2 |
Acute Tox. 3 *, STOT RE 1, Aquatic Chronic 3 |
H301, H372 **, H412 |
|
|
CLP00/ |
| 607-059-00-7 |
coumatetralyl; 4-hydroxy-3-(1,2,3,4-tetrahydro-1-naphthyl)coumarin |
5836-29-3 |
Repr. 1B, Acute Tox. 2, Acute Tox. 3, Acute Tox. 2, STOT RE 1, Aquatic Chronic 1 |
H360D, H330, H310, H300, H372 (blood), H410 |
Repr. 1B; H360D: C ≥ 0,003 % , STOT RE 1; H372 (blood): C ≥ 1,0 % , STOT RE 2; H373 (blood) 0,1 % ≤ C < 1,0 % M = 10 |
|
CLP00/ATP09 |
| 607-060-00-2 |
dicoumarol; 4,4'-dihydroxy-3,3'-methylenebis(2H-chromen-2-one) |
66-76-2 |
STOT RE 1, Acute Tox. 4 *, Aquatic Chronic 2 |
H372 **, H302, H411 |
|
|
CLP00/ |
| 607-061-00-8 |
acrylic acid; prop-2-enoic acid |
79-10-7 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1A, Aquatic Acute 1 |
H226, H332, H312, H302, H314, H400 |
STOT SE 3; H335: C ≥ 1 % |
D |
CLP00/ |
| 607-062-00-3 |
n-butyl acrylate |
141-32-2 |
Flam. Liq. 3, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1 |
H226, H319, H335, H315, H317 |
|
D |
CLP00/ |
| 607-063-00-9 |
isobutyric acid |
79-31-2 |
Acute Tox. 4 *, Acute Tox. 4 * |
H312, H302 |
|
|
CLP00/ |
| 607-064-00-4 |
benzyl chloroformate |
501-53-1 |
Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H400, H410 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 607-065-00-X |
bromoacetic acid |
79-08-3 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1A, Skin Sens. 1, Aquatic Acute 1 |
H331, H311, H301, H314, H317, H400 |
|
|
CLP00/ATP01 |
| 607-066-00-5 |
dichloroacetic acid |
79-43-6 |
Skin Corr. 1A, Aquatic Acute 1 |
H314, H400 |
|
|
CLP00/ |
| 607-067-00-0 |
dichloroacetyl chloride |
79-36-7 |
Skin Corr. 1A, Aquatic Acute 1 |
H314, H400 |
|
|
CLP00/ |
| 607-068-00-6 |
iodoacetic acid |
64-69-7 |
Acute Tox. 3 *, Skin Corr. 1A |
H301, H314 |
|
|
CLP00/ |
| 607-069-00-1 |
ethyl bromoacetate |
105-36-2 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 * |
H330, H310, H300 |
|
|
CLP00/ |
| 607-070-00-7 |
ethyl chloroacetate |
105-39-5 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1 |
H331, H311, H301, H400 |
|
|
CLP00/ |
| 607-071-00-2 |
ethyl methacrylate |
97-63-2 |
Flam. Liq. 2, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1 |
H225, H319, H335, H315, H317 |
|
D |
CLP00/ |
| 607-072-00-8 |
2-hydroxyethyl acrylate |
818-61-1 |
Acute Tox. 3 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1 |
H311, H314, H317, H400 |
*, Skin Sens. 1; H317: C ≥ 0,2 % |
D |
CLP00/ |
| 607-073-00-3 |
4-CPA (ISO); 4-chlorophenoxyacetic acid |
122-88-3 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 607-074-00-9 |
chlorfenac (ISO); 2,3,6-trichlorophenylacetic acid |
85-34-7 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 607-075-00-4 |
chlorfenprop-methyl; methyl 2-chloro-3-(4-chlorophenyl)propionate |
14437-17-3 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H400, H410 |
|
|
CLP00/ |
| 607-076-00-X |
dodine (ISO); dodecylguanidinium acetate |
2439-10-3 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H315, H400, H410 |
|
|
CLP00/ |
| 607-077-00-5 |
erbon (ISO); 2-(2,4,5-trichlorophenoxy)ethyl 2,2-dichloropropionate |
136-25-4 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 607-078-00-0 |
fluenetil (ISO); 2-fluoroethyl biphenyl-4-ylacetate |
4301-50-2 |
Acute Tox. 1, Acute Tox. 2 * |
H310, H300 |
|
|
CLP00/ |
| 607-079-00-6 |
kelevan (ISO); ethyl 5-(perchloro-5-hydroxypentacyclo[5,3,0,02,6,03,9,04,8]decan-5-yl)-4-oxopentanoate; ethyl 5-(1,2,3,5,6,7,8,9,10,10-decachloro-4-hydroxypentacyclo(5,2,1,02,6,03,9,05,8)dec-4-yl)-4-oxovalerate |
4234-79-1 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Chronic 2 |
H311, H302, H411 |
|
|
CLP00/ |
| 607-080-00-1 |
chloroacetyl chloride |
79-04-9 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1, Skin Corr. 1A, Aquatic Acute 1 |
H331, H311, H301, H372 **, H314, H400 |
|
|
CLP00/ |
| 607-081-00-7 |
fluoroacetic acid |
144-49-0 |
Acute Tox. 2 *, Aquatic Acute 1 |
H300, H400 |
|
|
CLP00/ |
| 607-082-00-2 |
fluoroacetates, soluble |
- |
Acute Tox. 2 *, Aquatic Acute 1 |
H300, H400 |
|
A |
CLP00/ |
| 607-083-00-8 |
2,4-DB (ISO); 4-(2,4-dichlorophenoxy)butyric acid |
94-82-6 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 607-084-00-3 |
salts of 2,4-DB |
- |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 2 |
H302, H318, H411 |
|
A |
CLP00/ |
| 607-085-00-9 |
benzyl benzoate |
120-51-4 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ATP01 |
| 607-086-00-4 |
diallyl phthalate |
131-17-9 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 607-088-00-5 |
methacrylic acid; 2-methylpropenoic acid |
79-41-4 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1A |
H312, H302, H314 |
STOT SE 3; H335: C ≥ 1 % |
D |
CLP00/ |
| 607-089-00-0 |
propionic acid … % |
79-09-4 |
Skin Corr. 1B |
H314 |
Skin Corr. 1B; H314: C ≥ 25 %, Skin Irrit. 2; H319: 10 % ≤ C < 25 %, Eye Irrit. 2; H319: 10 % ≤ C < 25 %, STOT SE 3; H335: C ≥ 10 % |
B |
CLP00/ |
| 607-090-00-6 |
thioglycolic acid |
68-11-1 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B |
H331, H311, H301, H314 |
* |
|
CLP00/ |
| 607-091-00-1 |
trifluoroacetic acid . . . % |
76-05-1 |
Acute Tox. 4 *, Skin Corr. 1A, Aquatic Chronic 3 |
H332, H314, H412 |
* |
B |
CLP00/ |
| 607-092-00-7 |
methyl lactate; [1] methyl (±)-lactate; [2] methyl (R)-lactate; [3] methyl (S)-(-)-lactate [4] |
547-64-8 [1], 2155-30-8 [2], 17392-83-5 [3], 27871-49-4 [4] |
Flam. Liq. 3, Eye Irrit. 2, STOT SE 3 |
H226, H319, H335 |
|
C |
CLP00/ |
| 607-093-00-2 |
propionyl chloride |
79-03-8 |
Flam. Liq. 2, Skin Corr. 1B |
H225, H314 |
|
B D |
CLP00/ |
| 607-094-00-8 |
peracetic acid . . . % |
79-21-0 |
Flam. Liq. 3, Org. Perox. D ****, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1A, Aquatic Acute 1 |
H226, H242, H332, H312, H302, H314, H400 |
*, STOT SE 3; H335: C ≥ 1 % |
B D |
CLP00/ |
| 607-095-00-3 |
maleic acid |
110-16-7 |
Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1 |
H302, H319, H335, H315, H317 |
Skin Sens. 1; H317: C ≥ 0,1 % |
|
CLP00/ATP01 |
| 607-096-00-9 |
maleic anhydride |
108-31-6 |
Acute Tox. 4, STOT RE 1, Skin Corr. 1B, Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1A |
H302, H372 (respiratory system, inhalation), H314, H318, H334, H317 |
Skin Sens. 1A; H317: C ≥ 0,001 % |
|
CLP00/ATP13 |
| 607-097-00-4 |
benzene-1,2,4-tricarboxylic acid 1,2-anhydride; trimellitic anhydride |
552-30-7 |
STOT SE 3, Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H335, H318, H334, H317 |
|
|
CLP00/ |
| 607-098-00-X |
benzene-1,2:4,5-tetracarboxylic dianhydride; benzene-1,2:4,5-tetracarboxylic dianhydride; pyromellitic dianhydride |
89-32-7 |
Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H318, H334, H317 |
|
|
CLP00/ |
| 607-099-00-5 |
1,2,3,6-tetrahydrophthalic anhydride; [1] cis-1,2,3,6-tetrahydrophthalic anhydride; [2] 3,4,5,6-tetrahydrophthalic anhydride; [3] tetrahydrophthalic anhydride [4] |
85-43-8 [1], 935-79-5 [2], 2426-02-0 [3], 26266-63-7 [4] |
Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H334, H317, H412 |
|
C |
CLP00/ |
| 607-100-00-9 |
benzophenone-3,3',4,4'-tetracarboxylic dianhydride; 4,4'-carbonyldi(phthalic anhydride) |
2421-28-5 |
Eye Irrit. 2, STOT SE 3 |
H319, H335 |
Eye Irrit. 2; H319: C ≥ 1 %, STOT SE 3; H335: C ≥ 1 % |
|
CLP00/ |
| 607-101-00-4 |
1,4,5,6,7,7-hexachlorobicyclo [2,2,1]hept-5-ene-2,3-dicarboxylic anhydride chlorendic anhydride |
115-27-5 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H319, H335, H315 |
Skin Irrit. 2; H315: C ≥ 1 %, Eye Irrit. 2; H319: C ≥ 1 %, STOT SE 3; H335: C ≥ 1 % |
|
CLP00/ |
| 607-102-00-X |
cyclohexane-1,2-dicarboxylic anhydride; [1] cis-cyclohexane-1,2-dicarboxylic anhydride; [2] trans-cyclohexane-1,2-dicarboxylic anhydride [3] |
85-42-7 [1], 13149-00-3 [2], 14166-21-3 [3] |
Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H318, H334, H317 |
|
C |
CLP00/ |
| 607-103-00-5 |
succinic anhydride |
108-30-5 |
Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3 |
H302, H319, H335 |
*, Eye Irrit. 2; H319: C ≥ 1 %, STOT SE 3; H335: C ≥ 1 % |
|
CLP00/ATP01 |
| 607-104-00-0 |
cyclopentane-1,2,3,4-tetracarboxylic dianhydride |
6053-68-5 |
Eye Irrit. 2, STOT SE 3 |
H319, H335 |
Eye Irrit. 2; H319: C ≥ 1 %, STOT SE 3; H335: C ≥ 1 % |
|
CLP00/ |
| 607-105-00-6 |
8,9,10-trinorborn-5-ene-2,3-dicarboxylic anhydride; [1] 1,2,3,6-tetrahydro-3,6-methanophthalic anhydride; [2] (1α,2α,3β,6β)-1,2,3,6-tetrahydro-3,6-methanophthalic anhydride [3] |
129-64-6 [1], 826-62-0 [2], 2746-19-2 [3] |
Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H318, H334, H317 |
|
C |
CLP00/ |
| 607-106-00-1 |
8,9-dinorborn-5-ene-2,3-dicarboxylic anhydride |
123748-85-6 |
Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1 |
H302, H319, H335, H315, H334 |
STOT SE 3; H335: C ≥ 10 % |
C |
CLP00/ |
| 607-107-00-7 |
2-ethylhexyl acrylate |
103-11-7 |
STOT SE 3, Skin Irrit. 2, Skin Sens. 1 |
H335, H315, H317 |
|
D |
CLP00/ |
| 607-108-00-2 |
2-hydroxy-1-methylethylacrylate; [1] 2-hydroxypropylacrylate; [2] acrylic acid, monoester with propane-1,2-diol [3] |
2918-23-2 [1], 999-61-1 [2], 25584-83-2 [3] |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B, Skin Sens. 1 |
H331, H311, H301, H314, H317 |
*, Skin Sens. 1; H317: C ≥ 0,2 % |
C D |
CLP00/ |
| 607-109-00-8 |
hexamethylene diacrylate; hexane-1,6-diol diacrylate |
13048-33-4 |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H319, H315, H317 |
|
D |
CLP00/ |
| 607-110-00-3 |
pentaerythritol triacrylate |
3524-68-3 |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H319, H315, H317 |
|
D |
CLP00/ |
| 607-111-00-9 |
2-ethyl-2-[[(1-oxoallyl)oxy] methyl]-1,3-propanediyl diacrylate; 2,2-bis(acryloyloxymethyl)butyl acrylate; trimethylolpropane triacrylate |
15625-89-5 |
Carc. 2, Skin Irrit. 2, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H315, H319, H317, H400, H410 |
M = 1, M = 1 |
D |
CLP00/ATP18 |
| 607-112-00-4 |
2,2-dimethyltrimethylene diacrylate; neopentyl glycol diacrylate |
2223-82-7 |
Acute Tox. 3 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H311, H319, H315, H317 |
* |
D |
CLP00/ |
| 607-113-00-X |
isobutyl methacrylate |
97-86-9 |
Flam. Liq. 3, STOT SE 3, Skin Irrit. 2, Skin Sens. 1B, |
H226, H335, H315, H317, |
|
D |
CLP00/ATP13 |
| 607-114-00-5 |
ethylene dimethacrylate |
97-90-5 |
STOT SE 3, Skin Sens. 1 |
H335, H317 |
STOT SE 3; H335: C ≥ 10 % |
D |
CLP00/ |
| 607-115-00-0 |
isobutyl acrylate |
106-63-8 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Skin Sens. 1 |
H226, H332, H312, H315, H317 |
|
D |
CLP00/ |
| 607-116-00-6 |
cyclohexyl acrylate |
3066-71-5 |
STOT SE 3, Skin Irrit. 2, Aquatic Chronic 2 |
H335, H315, H411 |
STOT SE 3; H335: C ≥ 10 % |
D |
CLP00/ |
| 607-117-00-1 |
2,3-epoxypropyl acrylate; glycidyl acrylate |
106-90-1 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B, Skin Sens. 1 |
H331, H311, H301, H314, H317 |
*, Skin Sens. 1; H317: C ≥ 0,2 % |
D |
CLP00/ |
| 607-118-00-7 |
1-methyltrimethylene diacrylate; 1,3-butylene glycol diacrylate |
19485-03-1 |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1 |
H312, H314, H317 |
|
D |
CLP00/ |
| 607-119-00-2 |
tetramethylene diacrylate; 1,4-butyleneglycol diacrylate |
1070-70-8 |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1 |
H312, H314, H317 |
|
D |
CLP00/ |
| 607-120-00-8 |
2,2'-oxydiethyl diacrylate; diethylene glycol diacrylate |
4074-88-8 |
Acute Tox. 3 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H311, H319, H315, H317 |
*, Skin Sens. 1; H317: C ≥ 0,2 % |
D |
CLP00/ |
| 607-121-00-3 |
8,9,10-trinorborn-2-yl acrylate |
10027-06-2 |
Acute Tox. 4 *, Skin Irrit. 2, Skin Sens. 1 |
H312, H315, H317 |
|
D |
CLP00/ |
| 607-122-00-9 |
pentaerythritol tetraacrylate |
4986-89-4 |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H319, H315, H317 |
|
D |
CLP00/ |
| 607-123-00-4 |
2,3-epoxypropyl methacrylate; glycidyl methacrylate |
106-91-2 |
Carc. 1B, Muta. 2, Repr. 1B, Acute Tox. 3, Acute Tox. 4, STOT SE 3, STOT RE 1, Skin Corr. 1C, Eye Dam. 1, Skin Sens. 1 |
H350, H341, H360F, H311, H302, H335, H372 (respiratory tract) (Inhalation), H314, H318, H317 |
|
D |
CLP00/ATP10 |
| 607-124-00-X |
2-hydroxyethyl methacrylate |
868-77-9 |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H319, H315, H317 |
|
D |
CLP00/ |
| 607-125-00-5 |
2-hydroxypropyl methacrylate; [1] 3-hydroxypropyl methacrylate [2] |
923-26-2 [1], 2761-09-3 [2] |
Eye Irrit. 2, Skin Sens. 1 |
H319, H317 |
|
C D |
CLP00/ |
| 607-126-00-0 |
2,2'-(ethylenedioxy)diethyl diacrylate; triethylene glycol diacrylate |
1680-21-3 |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H319, H315, H317 |
|
D |
CLP00/ |
| 607-127-00-6 |
2-diethylaminoethyl methacrylate |
105-16-8 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H332, H319, H315, H317 |
|
D |
CLP00/ |
| 607-128-00-1 |
2-tert-butylaminoethyl methacrylate |
3775-90-4 |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H319, H315, H317 |
|
D |
CLP00/ |
| 607-129-00-7 |
ethyl lactate; ethyl DL-lactate; [1] ethyl (S)-2-hydroxypropionate; ethyl L-lactate; ethyl-(S)-lactate [2] |
97-64-3 [1], 687-47-8 [2] |
Flam. Liq. 3, STOT SE 3, Eye Dam. 1 |
H226, H335, H318 |
|
C |
CLP00/ |
| 607-130-00-2 |
pentyl acetate; [1] isopentyl acetate; [2] 1-methylbutyl acetate; [3] 2-methylbutyl acetat; [4] 2(or 3)-methylbutyl acetate [5] |
628-63-7 [1], 123-92-2 [2], 626-38-0 [3], 624-41-9 [4], 84145-37-9 [5] |
Flam. Liq. 3 |
H226 |
|
C |
CLP00/ |
| 607-131-00-8 |
isopentyl propionate; [1] pentyl propionate; [2] 2-methylbutyl propionate [3] |
105-68-0 [1], 624-54-4 [2], 2438-20-2 [3] |
Flam. Liq. 3 |
H226 |
|
C |
CLP00/ |
| 607-132-00-3 |
2-dimethylaminoethyl methacrylate |
2867-47-2 |
Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H312, H302, H319, H315, H317 |
|
D |
CLP00/ |
| 607-133-00-9 |
monoalkyl or monoaryl or monoalkylaryl esters of acrylic acid with the exception of those specified elsewhere in this Annex |
- |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Chronic 2 |
H319, H335, H315, H411 |
STOT SE 3; H335: C ≥ 10 % |
A |
CLP00/ |
| 607-134-00-4 |
monoalkyl or monoaryl or monoalkyaryl esters of methacrylic acid with the exception of those specified elsewhere in this Annex |
- |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H319, H335, H315 |
STOT SE 3; H335: C ≥ 10 % |
A |
CLP00/ |
| 607-135-00-X |
butyric acid |
107-92-6 |
Skin Corr. 1B |
H314 |
|
|
CLP00/ |
| 607-136-00-5 |
butyryl chloride |
141-75-3 |
Flam. Liq. 2, Skin Corr. 1B |
H225, H314 |
|
|
CLP00/ |
| 607-137-00-0 |
methyl acetoacetate |
105-45-3 |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 607-138-00-6 |
butyl chloroformate; chloroformic acid butyl ester |
592-34-7 |
Flam. Liq. 3, Acute Tox. 3 *, Skin Corr. 1B |
H226, H331, H314 |
|
|
CLP00/ |
| 607-139-00-1 |
2-chloropropionic acid |
598-78-7 |
Acute Tox. 4 *, Skin Corr. 1A |
H302, H314 |
|
|
CLP00/ |
| 607-140-00-7 |
isobutyryl chloride |
79-30-1 |
Flam. Liq. 2, Skin Corr. 1A |
H225, H314 |
|
|
CLP00/ |
| 607-141-00-2 |
oxydiethylene bis(chloroformate) |
106-75-2 |
Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 2 |
H302, H315, H318, H411 |
|
|
CLP00/ |
| 607-142-00-8 |
propyl chloroformate; chloroformic acid propylester; n-propyl chloroformate |
109-61-5 |
Flam. Liq. 2, Acute Tox. 3 *, Skin Corr. 1B |
H225, H331, H314 |
|
|
CLP00/ATP01 |
| 607-143-00-3 |
valeric acid |
109-52-4 |
Skin Corr. 1B, Aquatic Chronic 3 |
H314, H412 |
|
|
CLP00/ |
| 607-144-00-9 |
adipic acid |
124-04-9 |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 607-145-00-4 |
methanesulphonic acid |
75-75-2 |
Skin Corr. 1B |
H314 |
|
|
CLP00/ |
| 607-146-00-X |
fumaric acid |
110-17-8 |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 607-147-00-5 |
oxalic acid diethylester; diethyl oxalate |
95-92-1 |
Acute Tox. 4 *, Eye Irrit. 2 |
H302, H319 |
|
|
CLP00/ |
| 607-148-00-0 |
guanidinium chloride; guanadine hydrochloride |
50-01-1 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2 |
H302, H319, H315 |
|
|
CLP00/ |
| 607-149-00-6 |
urethane (INN); ethyl carbamate |
51-79-6 |
Carc. 1B |
H350 |
|
|
CLP00/ |
| 607-150-00-1 |
endothal (ISO); 7-oxabicyclo(2,2,1)heptane-2,3-dicarboxylic acid |
145-73-3 |
Acute Tox. 3 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H301, H312, H319, H335, H315 |
|
|
CLP00/ |
| 607-151-00-7 |
propargite (ISO); 2-(4-tert-butylphenoxy) cyclohexyl prop-2-ynyl sulphite |
2312-35-8 |
Carc. 2, Acute Tox. 3 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H331, H315, H318, H400, H410 |
M = 10: |
|
CLP00/ |
| 607-152-00-2 |
2,3,6-TBA (ISO); 2,3,6-trichlorobenzoic acid |
50-31-7 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 607-153-00-8 |
benazolin (ISO); 4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetic acid |
3813-05-6 |
Eye Irrit. 2, Skin Irrit. 2, Aquatic Chronic 3 |
H319, H315, H412 |
|
|
CLP00/ |
| 607-154-00-3 |
ethyl N-benzoyl-N-(3,4-dichlorophenyl)-DL-alaninate; benzoylprop-ethyl (ISO) |
22212-55-1 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 607-155-00-9 |
3-(3-amino-5-(1-methylguanidino)-1-oxopentylamino-6-(4-amino-2-oxo-2,3-dihydro-pyrimidin-1-yl)-2,3-dihydro-(6H)-pyran-2-carboxylic acid; blasticidin-s |
2079-00-7 |
Acute Tox. 2 * |
H300 |
|
|
CLP00/ |
| 607-156-00-4 |
chlorfenson (ISO); 4-chlorophenyl 4-chlorobenzenesulfonate |
80-33-1 |
Acute Tox. 4 *, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H315, H400, H410 |
|
|
CLP00/ |
| 607-157-00-X |
3-(3-biphenyl-4-yl-1,2,3,4-tetrahydro-1-naphthyl)-4-hydroxycoumarin; difenacoum |
56073-07-5 |
Repr. 1B, Acute Tox. 1, Acute Tox. 1, Acute Tox. 1, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360D, H330, H310, H300, H372 (blood), H400, H410 |
Repr. 1B; H360D: C ≥ 0,003 % , STOT RE 1; H372 (blood): C ≥ 0,02 % , STOT RE 2; H373 (blood): 0,002 % ≤ C < 0,02 % M = 10, M = 10 |
|
CLP00/ATP09 |
| 607-158-00-5 |
sodium salt of chloroacetic acid; sodium chloroacetate |
3926-62-3 |
Acute Tox. 3 *, Skin Irrit. 2, Aquatic Acute 1 |
H301, H315, H400 |
|
|
CLP00/ |
| 607-159-00-0 |
chlorobenzilate (ISO); ethyl 2,2-di(4-chlorophenyl)-2-hydroxyacetate; ethyl 4,4'-dichlorobenzilate |
510-15-6 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 607-160-00-6 |
isobutyl 2-(4-(4-chlorophenoxy)phenoxy)propionate; clofop-isobutyl (ISO) |
51337-71-4 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 607-161-00-1 |
diethanolamine salt of 4-CPA |
- |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 607-162-00-7 |
dalapon; 2,2-dichloropropionic acid; [1] dalapon-sodium; sodium 2,2-dichloropropionate [2] |
75-99-0 [1], 127-20-8 [2] |
Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 3 |
H315, H318, H412 |
|
|
CLP00/ATP01 |
| 607-163-00-2 |
3-acetyl-6-methyl-2H-pyran-2,4(3H)-dione; dehydracetic acid |
520-45-6 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 607-164-00-8 |
sodium 1-(3,4-dihydro-6-methyl-2,4-dioxo-2H-pyran-3-ylidene)ethonolate; sodium dehydracetate |
4418-26-2 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 607-165-00-3 |
diclofop-methyl (ISO); methyl 2-(4-(2,4-dichlorophenoxy)phenoxy)propionate; methyl (RS)-2-[4-(2,4-dichlorophenoxy)phenoxy]propionate |
51338-27-3 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
CLP00/ |
| 607-166-00-9 |
medinoterb acetate (ISO); 6-tert-butyl-3-methyl-2,4-dinitrophenyl acetate |
2487-01-6 |
Acute Tox. 3 *, Acute Tox. 4 * |
H301, H312 |
|
|
CLP00/ |
| 607-167-00-4 |
sodium 3-chloroacrylate |
4312-97-4 |
Acute Tox. 4 *, Acute Tox. 4 * |
H312, H302 |
|
|
CLP00/ |
| 607-168-00-X |
dipropyl 6,7-methylenedioxy-1,2,3,4-tetrahydro-3-methylnaphthalene-1,2-dicarboxylate; propylisome |
83-59-0 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H311, H302, H400, H410 |
|
|
CLP00/ |
| 607-169-00-5 |
sodium fluoroacetate |
62-74-8 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1 |
H330, H310, H300, H400 |
|
|
CLP00/ |
| 607-170-00-0 |
bis(1,2,3-trithiacyclohexyldimethylammonium) oxalate; thiocyclam-oxalate |
31895-22-4 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H400, H410 |
|
|
CLP00/ |
| 607-172-00-1 |
4-hydroxy-3-(3-(4'-bromo-4-biphenylyl)-1,2,3,4-tetrahydro-1-naphthyl)coumarin; brodifacoum |
56073-10-0 |
H360D, Acute Tox. 1, Acute Tox. 1, Acute Tox. 1, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360D, H330, H310, H300, H372 (blood), H400, H410 |
Repr. 1 A; H360D: C ≥ 0,003 % , STOT RE 1; H372 (blood): C ≥ 0,02 % , STOT RE 2; H373 (blood): 0,002 % ≤ C < 0,02 %, M = 10, M = 10 |
|
CLP00/ATP09 |
| 607-173-00-7 |
dimethyl (3-methyl-4-(5-nitro-3-ethoxycarbonyl-2-thienyl)azo)phenylnitrilodipropionate |
- |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 607-174-00-2 |
reaction mass of dodecyl 3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionate and tetradecyl 3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionate |
- |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ |
| 607-175-00-8 |
methyl 2-(2-nitrobenzylidene)acetoacetate |
39562-27-1 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 607-176-00-3 |
reaction mass of α-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-hydroxypoly(oxyethylene) and α-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyloxypoly(oxyethylene) |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 607-177-00-9 |
tribenuron-methyl (ISO); methyl 2-[N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-N-methylcarbamoylsulfamoyl]benzoate |
101200-48-0 |
STOT RE 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H373, H317, H400, H410 |
M=100, M=100 |
|
CLP00/ATP15 |
| 607-178-00-4 |
methyl α-((4,6-dimethoxypyrimidin-2-yl)ureidosulphonyl)-o-toluate |
83055-99-6 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 607-179-00-X |
(benzothiazol-2-ylthio)succinic acid |
95154-01-1 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-180-00-5 |
potassium 2-hydroxycarbazole-1-carboxylate |
96566-70-0 |
Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Aquatic Chronic 3 |
H302, H319, H335, H412 |
|
|
CLP00/ |
| 607-181-00-0 |
3,5-dichloro-2,4-difluorobenzoyl fluoride |
101513-70-6 |
Acute Tox. 3 *, Skin Corr. 1B, Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 3 |
H331, H314, H302, H317, H412 |
|
|
CLP00/ |
| 607-182-00-6 |
methyl 3-sulphamoyl-2-thenoate |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-183-00-1 |
zinc 2-hydroxy-5-C13-18alkylbenzoate |
- |
Eye Irrit. 2, Skin Irrit. 2, Aquatic Chronic 2 |
H319, H315, H411 |
|
|
CLP00/ |
| 607-184-00-7 |
S-(3-trimethoxysilyl)propyl 19-isocyanato-11-(6-isocyanatohexyl)-10,12-dioxo-2,9,11,13-tetraazanonadecanethioate |
85702-90-5 |
Flam. Liq. 3, Resp. Sens. 1, Skin Sens. 1 |
H226, H334, H317 |
|
|
CLP00/ |
| 607-185-00-2 |
ethyl trans-3-dimethylaminoacrylate |
1117-37-9 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-186-00-8 |
quinclorac (ISO); 3,7-dichloroquinoline-8-carboxylic acid |
84087-01-4 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-187-00-3 |
bis(2,2,6,6-tetramethyl-4-piperidyl) succinate |
62782-03-0 |
Eye Irrit. 2, Aquatic Chronic 3 |
H319, H412 |
|
|
CLP00/ |
| 607-188-00-9 |
hydrogen sodium N-carboxylatoethyl-N-octadec-9-enylmaleamate |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 607-189-00-4 |
trimethylenediaminetetraacetic acid |
1939-36-2 |
Acute Tox. 4 *, Eye Dam. 1 |
H302, H318 |
|
|
CLP00/ATP01 |
| 607-190-00-X |
methyl acrylamidomethoxyacetate (containing ≥ 0,1 % acrylamid) |
77402-03-0 |
Carc. 1B, Muta. 1B, Acute Tox. 4 *, Eye Irrit. 2 |
H350, H340, H302, H319 |
|
|
CLP00/ |
| 607-191-00-5 |
isobutyl 3,4-epoxybutyrate |
100181-71-3 |
Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H317, H400, H410 |
|
|
CLP00/ |
| 607-192-00-0 |
disodium N-carboxymethyl-N-(2-(2-hydroxyethoxy)ethyl)glycinate |
92511-22-3 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 607-194-00-1 |
propylene carbonate |
108-32-7 |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 607-195-00-7 |
2-methoxy-1-methylethyl acetate |
108-65-6 |
Flam. Liq. 3 |
H226 |
|
|
CLP00/ATP01 |
| 607-196-00-2 |
heptanoic acid |
111-14-8 |
Skin Corr. 1B |
H314 |
|
|
CLP00/ |
| 607-197-00-8 |
nonanoic acid |
112-05-0 |
Skin Irrit. 2, Eye Irrit. 2, Aquatic Chronic 3 |
H315, H319, H412 |
|
|
CLP00/ATP07 |
| 607-198-00-3 |
propyl 3,4,5-trihydroxybenzoate |
121-79-9 |
Acute Tox. 4 *, Skin Sens. 1 |
H302, H317 |
|
|
CLP00/ |
| 607-199-00-9 |
octyl 3,4,5-trihydroxybenzoate |
1034-01-1 |
Acute Tox. 4 *, Skin Sens. 1 |
H302, H317 |
|
|
CLP00/ |
| 607-200-00-2 |
dodecyl 3,4,5-trihydroxybenzoate |
1166-52-5 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-201-00-8 |
thiocarbonyl chloride |
463-71-8 |
Acute Tox. 3 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H331, H302, H319, H335, H315 |
|
|
CLP00/ |
| 607-203-00-9 |
2-ethylhexyl[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]thio]acetate |
80387-97-9 |
Repr. 1B, Skin Sens. 1, Aquatic Chronic 3 |
H360D ***, H317, H412 |
|
|
CLP00/ |
| 607-204-00-4 |
(chlorophenyl)(chlorotolyl)methane, mixed isomers |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 607-205-00-X |
methyl chloroacetate |
96-34-4 |
Flam. Liq. 3, Acute Tox. 3 *, Acute Tox. 3 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1 |
H226, H331, H301, H335, H315, H318 |
|
|
CLP00/ |
| 607-206-00-5 |
isopropyl chloroacetate |
105-48-6 |
Flam. Liq. 3, Acute Tox. 3 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H226, H301, H319, H335, H315 |
|
|
CLP00/ |
| 607-207-00-0 |
haloxyfop-etotyl (ISO); 2-ethoxyethyl 2-(4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy)propionate; haloxyfop-(2-ethoxyethyl) |
87237-48-7 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 607-208-00-6 |
4,8,12-trimethyltrideca-3,7,11-trienoic acid, mixed isomers |
91853-67-7 |
Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H400, H410 |
|
|
CLP00/ |
| 607-209-00-1 |
reaction mass of O,O'-diisopropyl (pentathio)dithioformate and O,O'-diisopropyl (trithio)dithioformate and O,O'-diisopropyl (tetrathio)dithioformate |
- |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
CLP00/ |
| 607-210-00-7 |
methyl acrylamidoglycolate (containing ≥ 0,1 % acrylamide) |
77402-05-2 |
Carc. 1B, Muta. 1B, Skin Corr. 1B, Skin Sens. 1 |
H350, H340, H314, H317 |
|
|
CLP00/ |
| 607-211-00-2 |
methyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionate |
6386-39-6 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 607-212-00-8 |
poly(oxypropylenecarbonyl-co-oxy(ethylethylene)carbonyl), containing 27 % hydroxyvalerate |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-213-00-3 |
ethyl 3,3-bis(tert-pentylperoxy)butyrate |
67567-23-1 |
Org. Perox. D****, Flam. Liq. 3, Aquatic Chronic 2 |
H242, H226, H411 |
|
|
CLP00/ATP01 |
| 607-214-00-9 |
N,N-hydrazinodiacetic acid |
19247-05-3 |
Acute Tox. 3 *, STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 3 |
H301, H373 **, H317, H412 |
|
|
CLP00/ |
| 607-215-00-4 |
3-(3-tert-butyl-4-hydroxyphenyl)propionic acid |
107551-67-7 |
Acute Tox. 4 *, Eye Irrit. 2 |
H302, H319 |
|
|
CLP00/ |
| 607-216-00-X |
glutamic acid, reaction products with N-(C12-14-alkyl)propylenediamine |
- |
Acute Tox. 2 *, Acute Tox. 4 *, Skin Corr. 1B, Aquatic Acute 1 |
H330, H302, H314, H400 |
|
|
CLP00/ATP01 |
| 607-217-00-5 |
2-ethoxyethyl 2-(4-(2,6-dihydro-2,6-dioxo-7-phenyl-1,5-dioxaindacen-3-yl)phenoxy)acetate |
- |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 607-218-00-0 |
dichlorprop-P (ISO); (+)-R-2-(2,4-dichlorophenoxy)propionic acid |
15165-67-0 |
Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1 |
H302, H315, H318, H317 |
|
|
CLP00/ |
| 607-219-00-6 |
bis(2-ethylhexyl) dithiodiacetate |
62268-47-7 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H302, H317, H411 |
|
|
CLP00/ |
| 607-221-00-7 |
6-docosyloxy-1-hydroxy-4-(1-(4-hydroxy-3-methylphenanthren-1-yl)-3-oxo-2-oxaphenalen-1-yl)naphthalene-2-carboxylic acid |
- |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 607-222-00-2 |
6-(2,3-dimethylmaleimido)hexyl methacrylate |
63740-41-0 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 607-223-00-8 |
transfluthrin (ISO); 2,3,5,6-tetrafluorobenzyl trans-2-(2,2-dichlorovinyl)-3,3-dimethylcyclopropanecarboxylate |
118712-89-3 |
Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H400, H410 |
|
|
CLP00/ |
| 607-224-00-3 |
methyl 2-(3-nitrobenzylidene)acetoacetate |
39562-17-9 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 607-225-00-9 |
3-azidosulfonylbenzoic acid |
15980-11-7 |
Self-React. C ****, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1 |
H241, H373 **, H318, H317 |
|
|
CLP00/ |
| 607-226-00-4 |
reaction mass of 2-acryloyloxyethyl hydrogen cyclohexane-1,2-dicarboxylate and 2-methacryloyloxyethyl hydrogen cyclohexane-1,2-dicarboxylate |
- |
Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H315, H318, H317, H412 |
|
|
CLP00/ |
| 607-227-00-X |
potassium 2-amino-2-methylpropionate octahydrate |
120447-91-8 |
Acute Tox. 4 *, Skin Corr. 1A |
H302, H314 |
|
|
CLP00/ |
| 607-228-00-5 |
bis(2-methoxyethyl) phthalate |
117-82-8 |
Repr. 1B |
H360Df |
|
|
CLP00/ |
| 607-229-00-0 |
diethylcarbamoyl chloride |
88-10-8 |
Carc. 2, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H351, H332, H302, H319, H335, H315 |
|
|
CLP00/ |
| 607-230-00-6 |
2-ethylhexanoic acid and its salts, with the exception of those specified elsewhere in this Annex |
|
Repr. 1B |
H360D |
|
A X 12 |
CLP00/ATP18/ATP20 |
| 607-231-00-1 |
clopyralid (ISO); 3,6-dichloropyridine-2-carboxylic acid |
1702-17-6 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ATP01 |
| 607-232-00-7 |
pyridate (ISO); O-(6-chloro-3-phenylpyridazin-4-yl) S-octyl thiocarbonate |
55512-33-9 |
Acute Tox. 4, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H315, H317, H400, H410 |
Oral: ATE = 500 mg/kg, M=1, M=10
|
|
CLP00/ATP14 |
| 607-233-00-2 |
hexyl acrylate |
2499-95-8 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H319, H335, H315, H317, H411 |
|
|
CLP00/ |
| 607-234-00-8 |
flurenol (ISO); 9-hydroxy-9H-fluorene-9-carboxylic acid |
467-69-6 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-235-00-3 |
mecrilate; methyl 2-cyanoacrylate |
137-05-3 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H319, H335, H315 |
STOT SE 3; H335: C ≥ 10 % |
|
CLP00/ |
| 607-236-00-9 |
ethyl 2-cyanoacrylate |
7085-85-0 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H319, H335, H315 |
STOT SE 3; H335: C ≥ 10 % |
|
CLP00/ |
| 607-237-00-4 |
benzyl 2-chloro-4-(trifluoromethyl)thiazole-5-carboxylate; flurazole |
72850-64-7 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-238-00-X |
tau-fluvalinate (ISO); cyano-(3-phenoxyphenyl)methyl N-[2-chloro-4-(trifluoromethyl)phenyl]-D-valinate |
102851-06-9 |
Acute Tox. 4 *, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H315, H400, H410 |
|
|
CLP00/ |
| 607-239-00-5 |
fenpropathrin (ISO); α-cyano-3-phenoxybenzyl 2,2,3,3-tetramethylcyclopropanecarboxylate |
39515-41-8 |
Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H301, H312, H400, H410 |
|
|
CLP00/ |
| 607-240-00-0 |
cis-1,2,3,6-tetrahydro-4-methylphthalic anhydride; [1] 1,2,3,6-tetrahydro-4-methylphthalic anhydride; [2] 1,2,3,6-tetrahydro-3-methylphthalic anhydride; [3] tetrahydromethylphthalic anhydride; [4] 1,2,3,6-tetrahydromethylphthalic anhydride; [5] tetra |
1694-82-2 [1], 3425-89-6 [2], 5333-84-6 [3], 11070-44-3 [4], 26590-20-5 [5], 34090-76-1 [6], 42498-58-8 [7] |
Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H318, H334, H317 |
|
C |
CLP00/ |
| 607-241-00-6 |
hexahydro-4-methylphthalic anhydride; [1] hexahydromethylphthalic anhydride; [2] hexahydro-1-methylphthalic anhydride; [3] hexahydro-3-methylphthalic anhydride [4] |
19438-60-9 [1], 25550-51-0 [2], 48122-14-1 [3], 57110-29-9 [4] |
Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H318, H334, H317 |
|
C |
CLP00/ |
| 607-242-00-1 |
tetrachlorophthalic anhydride |
117-08-8 |
Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H334, H317, H400, H410 |
|
|
CLP00/ |
| 607-243-00-7 |
sodium 3,6-dichloro-o-anisate; [1] 3,6-dichloro-o-anisic acid, compound with 2,2'-iminodiethanol (1:1); [2] 3,6-dichloro-o-anisic acid, compound with 2-aminoethanol (1:1) [3] |
1982-69-0 [1], 25059-78-3 [2], 53404-28-7 [3] |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-244-00-2 |
isooctyl acrylate |
29590-42-9 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H335, H315, H400, H410 |
STOT SE 3; H335: C ≥ 10 % |
|
CLP00/ |
| 607-245-00-8 |
tert-butyl acrylate |
1663-39-4 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H225, H332, H312, H302, H335, H315, H317, H411 |
|
D |
CLP00/ATP01 |
| 607-246-00-3 |
allyl methacrylate; 2-methyl-2-propenoic acid 2-propenyl ester |
96-05-9 |
Flam. Liq. 3, Acute Tox. 3 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1 |
H226, H331, H312, H302, H400 |
|
|
CLP00/ |
| 607-247-00-9 |
dodecyl methacrylate |
142-90-5 |
STOT SE 3 |
H335 |
STOT SE 3; H335: C ≥ 10 %
|
|
CLP00/ATP14 |
| 607-248-00-4 |
naptalam-sodium (ISO); sodium N-naphth-1-ylphthalamate |
132-67-2 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 607-249-00-X |
(1-methyl-1,2-ethanediyl)bis[oxy(methyl-2,1-ethanediyl)] diacrylate |
42978-66-5 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H319, H335, H315, H317, H411 |
STOT SE 3; H335: C ≥ 10 % |
|
CLP00/ |
| 607-250-00-5 |
4H-3,1-benzoxazine-2,4(1H)-dione |
118-48-9 |
Eye Irrit. 2, Skin Sens. 1 |
H319, H317 |
|
|
CLP00/ |
| 607-251-00-0 |
2-methoxypropyl acetate |
70657-70-4 |
Flam. Liq. 3, Repr. 1B, STOT SE 3 |
H226, H360D ***, H335 |
|
|
CLP00/ |
| 607-252-00-6 |
lambda-cyhalothrin (ISO); reaction mass of (S)-α-cyano-3-phenoxybenzyl(Z)-(1R)-cis-3-(2-chloro-3,3,3-trifluoropropenyl)-2,2-dimethylcyclopropanecarboxylate and (R)-α-cyano-3-phenoxybenzyl (Z)-(1S)-cis-3-(2-chloro-3,3,3-trifluoropropenyl)-2,2-dimethylcycl |
91465-08-6 |
Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H301, H312, H400, H410 |
M=10000: |
|
CLP00/ATP01 |
| 607-253-00-1 |
cyfluthrin (ISO); %u03B1-cyano-4-fluoro-3-phenoxybenzyl-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
68359-37-5 |
Lact., Acute Tox. 2, Acute Tox. 2, STOT SE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H362, H330, H300, H370 (nervous system), H400, H410 |
inhalation: ATE = 0,14 mg/L (dusts or mists); oral: ATE = 14 mg/kg bw; M = 1000000, M = 1000000 |
|
CLP00/ATP01/ATP18 |
| 607-254-00-7 |
beta-cyfluthrin (ISO); reaction mass of rel-(R)-cyano(4-fluoro-3-phenoxyphenyl)methyl(1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate and rel-(R)-cyano(4-fluoro-3-phenoxyphenyl)methyl(1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
1820573-27-0 |
Lact., Acute Tox. 2, Acute Tox. 2, STOT SE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H362, H330, H300, H370 (nervous system), H400, H410 |
inhalation: ATE = 0,081 mg/L (dusts or mists); oral: ATE = 11 mg/kg bw; M = 1000000, M = 1000000 |
|
CLP00/ATP18 |
| 607-255-00-2 |
fluroxypyr (ISO); 4-amino-3,5-dichloro-6-fluoro-2-pyridyloxyacetic acid |
69377-81-7 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-256-00-8 |
azoxystrobin (ISO); methyl (E)-2-{2-[6-(2-cyanophenoxy)pyrimidin-4-yloxy]phenyl}-3-methoxyacrylate |
131860-33-8 |
Acute Tox. 3, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H400, H410 |
Inhalation: ATE = 0.7 mg/L (dusts/mists), M=10, M=10 |
|
CLP00/ATP15 |
| 607-257-00-3 |
isopropyl propionate |
637-78-5 |
Flam. Liq. 2 |
H225 |
|
|
CLP00/ |
| 607-258-00-9 |
dodecyl 3-(2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-(4-methoxybenzoyl)acetamido)-4-chlorobenzoate |
70950-45-7 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-259-00-4 |
methyl 2R,3S-(-)-3-(4-methoxyphenyl)oxiranecarboxylate |
105560-93-8 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
|
CLP00/ |
| 607-260-00-X |
ethyl 2-(3-nitrobenzylidene)acetoacetate |
39562-16-8 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
|
CLP00/ |
| 607-261-00-5 |
iso(C10-C14)alkyl (3,5-di-tert-butyl-4-hydroxyphenyl)methylthioacetate |
118832-72-7 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 607-262-00-0 |
7-chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid |
86393-33-1 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 607-263-00-6 |
potassium iron(III) 1,3-propanediamine-N,N,N',N'-tetraacetate hemihydrate |
- |
Self-heat. 2 ****, Aquatic Chronic 2 |
H252, H411 |
|
|
CLP00/ |
| 607-264-00-1 |
2-chloro-4-(methylsulfonyl)benzoic acid |
53250-83-2 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 607-265-00-7 |
ethyl-2-chloro-2,2-diphenylacetate |
52460-86-3 |
Skin Irrit. 2, Aquatic Chronic 3 |
H315, H412 |
|
|
CLP00/ |
| 607-266-00-2 |
reaction mass of: hydroxyaluminium bis[2-hydroxy-3,5-di-tert-butylbenzoate]; 3,5-di-tert-butyl-salicylic acid |
130296-87-6 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 607-267-00-8 |
tert-butyl (5S,6R,7R)-3-bromomethyl-5,8-dioxo-7-(2-(2-phenylacetamido)-5-thia-1-azabicyclo[4.2.0] oct-2-ene-2-carboxylate |
33610-13-8 |
Resp. Sens. 1, Skin Sens. 1, Aquatic Chronic 3 |
H334, H317, H412 |
|
|
CLP00/ |
| 607-268-00-3 |
2-methylpropyl (R)-2-hydroxypropanoate |
61597-96-4 |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 607-269-00-9 |
(R)-2-(4-hydroxyphenoxy)propanoic acid |
94050-90-5 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 607-270-00-4 |
3,9-bis(2-(3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionyloxy-1,1-dimethylethyl)-2,4,8,10- tetraoxaspiro[5.5]undecane |
90498-90-1 |
Acute Tox. 4 * |
H312 |
|
|
CLP00/ |
| 607-271-00-X |
2-isopropyl-5-methylcyclohexyloxycarbonyloxy-2-hydroxypropane |
156324-82-2 |
Eye Irrit. 2, Aquatic Chronic 2 |
H319, H411 |
|
|
CLP00/ |
| 607-272-00-5 |
fluroxypyr-meptyl (ISO); methylheptyl, O-(4-amino-3,5-dichloro-6-fluoro-2-pyridyloxy) acetate; [1] fluroxypyr-butometyl (ISO); 2-butoxy-1-methylethyl, O-(4-amino-3,5-dichloro-6-fluoro-2-pyridyloxy) acetate [2] |
81406-37-3 [1], 154486-27-8 [2] |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 607-273-00-0 |
ammonium 7-(2,6-dimethyl-8-(2,2-dimethylbutyryloxy)-1,2,6,7,8,8a-hexahydro-1-naphthyl)-3,5-dihydroxyheptanoate |
- |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-274-00-6 |
2-(N-benzyl-N-methylamino)ethyl 3-amino-2-butenoate |
54527-73-0 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 607-275-00-1 |
sodium benzoyloxybenzene-4-sulfonate |
66531-87-1 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-276-00-7 |
bis[(1-methylimidazol)-(2-ethyl-hexanoate)], zinc complex |
- |
Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H400, H410 |
|
|
CLP00/ |
| 607-277-00-2 |
reaction mass of: 2-(hexylthio)ethylamine hydrochloride; sodium propionate |
- |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H302, H318, H317, H411 |
|
|
CLP00/ |
| 607-278-00-8 |
reaction mass of isomers of: sodium phenethylnaphthalenesulfonate; sodium naphthylethylbenzenesulfonate |
- |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
|
CLP00/ |
| 607-279-00-3 |
reaction mass of n-octadecylaminodiethyl bis(hydrogen maleate); n-octadecylaminodiethyl hydrogen maleate hydrogenphthalate |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 607-280-00-9 |
sodium 4-chloro-1-hydroxybutane-1-sulfonate |
54322-20-2 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1 |
H302, H319, H317 |
|
|
CLP00/ |
| 607-281-00-4 |
reaction mass of branched and linear C7-C9 alkyl 3-[3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxyphenyl]propionates |
127519-17-9 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-282-00-X |
2-acetoxymethyl-4-benzyloxybut-1-yl acetate |
131266-10-9 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-283-00-5 |
E-ethyl-4-oxo-4-phenylcrotonate |
15121-89-8 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H315, H318, H317, H400, H410 |
|
|
CLP00/ |
| 607-284-00-0 |
reaction mass of: sodium 3,3'-(1,4-phenylenebis(carbonylimino-3,1-propanediylimino))bis(10-amino-6,13-dichloro-4,11-triphenodioxazinedisulfonate); lithium 3,3'-(1,4-phenylenebis-(carbonylimino-3,1-propanediyl-imino))bis(10-amino-6,13-dichloro)-4,11-triph |
136213-76-8 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-285-00-6 |
reaction mass of: 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonic acid; sodium 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonate; potassium 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonate |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-286-00-1 |
reaction mass of: sodium/potassium 7-[[[3-[[4-((2-hydroxy-naphthyl)azo)phenyl]azo]phenyl]sulfonyl]amino]-naphthalene-1,3-disulfonate |
141880-36-6 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 607-287-00-7 |
O'-methyl O-(1-methyl-2-methacryloyloxy-ethyl)-1,2,3,6-tetrahydrophthalate |
- |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-288-00-2 |
Tetrasodium (c-(3-(1-(3-(e-6-dichloro-5-cyanopyrimidin-f-yl(methyl)amino)propyl)-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo)-4-sulfonatophenylsulfamoyl)phthalocyanine-a,b,d-trisulfonato(6-))nickelato II, where a is 1 or 2 or 3 or 4,b is 8 or 9 or 10 or 11,c is 15 or 16 or 17 or 18, d is 22 or 23 or 24 or 25 and where e and f together are 2 and 4 or 4 and 2 respectively |
148732-74-5 |
Eye Irrit. 2, Skin Sens. 1, Aquatic Chronic 3 |
H319, H317, H412 |
|
|
CLP00/ |
| 607-289-00-8 |
3-(3-(4-(2,4-bis(1,1-dimethylpropyl)phenoxy)butylaminocarbonyl-4-hydroxy-1-naphthalenyl)thio)propanoic acid |
105488-33-3 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-290-00-3 |
reaction mass (ratio not known) of: ammonium 1-C14-C18-alkyloxycarbonyl-2-(3-allyloxy-2-hydroxypropoxycarbonyl)ethane-1-sulfonate; ammonium 2-C14-C18-alkyloxycarbonyl-1-(3-allyloxy-2-hydroxypropoxycarbonyl)ethane-1-sulfonate |
- |
Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H317, H400, H410 |
|
|
CLP00/ |
| 607-291-00-9 |
dodecyl-ω-(C5/C6-cycloalkyl)alkyl carboxylate |
104051-92-5 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-292-00-4 |
reaction mass of: [1-(methoxymethyl)-2-(C12-alkoxy)-ethoxy]acetic acid; [1-(methoxymethyl)-2-(C14-alkoxy)-ethoxy]acetic acid |
- |
Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H400, H410 |
|
|
CLP00/ |
| 607-293-00-X |
reaction mass of: N-aminoethylpiperazonium mono-2,4,6-trimethylnonyldiphenyl ether di-sulfonate; N-aminoethylpiperazonium di-2,4,6-trimethylnonyldiphenyl ether di-sulfonate |
- |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H318, H317, H411 |
|
|
CLP00/ |
| 607-294-00-5 |
sodium 2-benzoyloxy-1-hydroxyethane-sulfonate |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-295-00-0 |
reaction mass of: tetrasodium phosphonoethane-1,2-dicarboxylate; hexasodium phosphonobutane-1,2,3,4-tetracarboxylate |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 607-296-00-6 |
reaction mass of: pentaerythriol tetraesters with heptanoic acid and 2-ethylhexanoic acid |
- |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-297-00-1 |
(E-E)-3,3'-(1,4-phenylenedimethylidene)bis(2-oxobornane-10-sulfonic acid) |
92761-26-7 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 607-298-00-7 |
2-(trimethylammonium)ethoxycarboxybenzene-4-sulfonate |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-299-00-2 |
methyl 3-(acetylthio)-2-methyl-propanoate |
97101-46-7 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
CLP00/ |
| 607-300-00-6 |
trisodium [2-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-5-(b-sulfamoyl-c, d-sulfonatophthalocyanin-a-yl-K4,N29,N30,N31,N32-sulfonylamino)benzoato(5-)]cuprate(II) where a = 1,2,3,4 b = 8,9,10,11 c = 15,16,17,18 d = 22,23,24,25 |
- |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
CLP00/ |
| 607-301-00-1 |
reaction mass of: dodecanoic acid; poly(1-7)lactate esters of dodecanoic acid |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 607-302-00-7 |
reaction mass of: tetradecanoic acid; poly(1-7)lactate esters of tetradecanoic acid |
- |
Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H315, H318, H317, H411 |
|
|
CLP00/ |
| 607-303-00-2 |
1-cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid |
93107-30-3 |
Repr. 2, Aquatic Chronic 3 |
H361f ***, H412 |
|
|
CLP00/ |
| 607-304-00-8 |
fluazifop-butyl (ISO); butyl (RS)-2-[4-(5-trifluoromethyl-2-pyridyloxy)phenoxy]propionate |
69806-50-4 |
Repr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H360D ***, H400, H410 |
|
|
CLP00/ |
| 607-305-00-3 |
fluazifop-P-butyl (ISO); butyl (R)-2-[4-(5-trifluoromethyl-2-pyridyloxy)phenoxy]propionate |
79241-46-6 |
Repr. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H361d ***, H400, H410 |
|
|
CLP00/ |
| 607-306-00-9 |
chlozolinate (ISO); ethyl (RS)-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxo-oxazolidine-5-carboxylate |
84332-86-5 |
Carc. 2, Aquatic Chronic 2 |
H351, H411 |
|
|
CLP00/ |
| 607-307-00-4 |
vinclozolin (ISO); N-3,5-dichlorophenyl-5-methyl-5-vinyl-1,3-oxazolidine-2,4-dione |
50471-44-8 |
Carc. 2, Repr. 1B, Skin Sens. 1, Aquatic Chronic 2 |
H351, H360FD, H317, H411 |
|
|
CLP00/ |
| 607-308-00-X |
esters of 2,4-D |
- |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
A |
CLP00/ |
| 607-309-00-5 |
carfentrazone-ethyl (ISO); ethyl (RS)-2-chloro-3-[2-chloro-4-fluoro-5-[4-difluoromethyl-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]propionate |
128639-02-1 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 607-310-00-0 |
kresoxim-methyl (ISO); methyl (E)-2-methoxyimino-[2-(o-tolyloxymethyl)phenyl]acetate |
143390-89-0 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H400, H410 |
|
|
CLP00/ |
| 607-311-00-6 |
benazolin-ethyl; ethyl 4-chloro-2-oxo-2H-benzothiazole-3-acetate |
25059-80-7 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-312-00-1 |
methoxyacetic acid |
625-45-6 |
Repr. 1B, Acute Tox. 4 *, Skin Corr. 1B |
H360FD, H302, H314 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 607-313-00-7 |
neodecanoyl chloride |
40292-82-8 |
Acute Tox. 2 *, Acute Tox. 4 *, Skin Corr. 1B |
H330, H302, H314 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 607-314-00-2 |
ethofumesate (ISO); (RS)-2-ethoxy-2,3-dihydro-3,3-dimethylbenzofuran-5-yl methanesulfonate |
26225-79-6 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1, M=1 |
|
CLP00/ATP15 |
| 607-315-00-8 |
glyphosate (ISO); N-(phosphonomethyl)glycine |
1071-83-6 |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 607-316-00-3 |
glyphosate-trimesium; glyphosate-trimethylsulfonium |
81591-81-3 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 607-317-00-9 |
bis(2-ethylhexyl) phthalate; di-(2-ethylhexyl) phthalate; DEHP |
117-81-7 |
Repr. 1B |
H360FD |
|
|
CLP00/ |
| 607-318-00-4 |
dibutyl phthalate; DBP |
84-74-2 |
Repr. 1B, Aquatic Acute 1 |
H360Df, H400 |
|
|
CLP00/ |
| 607-319-00-X |
deltamethrin (ISO); (S)-α-cyano-3-phenoxybenzyl (1R, 3R)-3-(2,2-dibromovinyl)-2,2-dimethylcyclopropanecarboxylate |
52918-63-5 |
Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H301, H400, H410 |
M=1000000: |
|
CLP00/ATP01 |
| 607-320-00-5 |
bis[4-(ethenyloxy)butyl] 1,3-benzenedicarboxylate |
130066-57-8 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 607-321-00-0 |
(S)-methyl-2-chloropropionate |
73246-45-4 |
Flam. Liq. 3, STOT RE 2 *, Eye Irrit. 2 |
H226, H373 **, H319 |
|
|
CLP00/ |
| 607-322-00-6 |
4-(4,4-dimethyl-3-oxo-pyrazolidin-1-yl)-benzoic acid |
107144-30-9 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 607-323-00-1 |
2-(1-(2-hydroxy-3,5-di-tert-pentyl-phenyl)ethyl)-4,6-di-tert-pentylphenyl acrylate |
123968-25-2 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-324-00-7 |
reaction mass of: N,N-di(hydrogenated alkyl C14-C18)phtalamic acid; dihydrogenated alkyl (C14-C18)amine |
- |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-325-00-2 |
(S)-2-chloropropionic acid |
29617-66-1 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1A |
H312, H302, H314 |
|
|
CLP00/ |
| 607-326-00-8 |
reaction mass of: isobutyl hydrogen 2-(α-2,4,6-trimethylnon-2-enyl)succinate; isobutyl hydrogen 2-(ß-2,4,6-trimetyhylnon-2-enyl)succinate |
141847-13-4 |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 607-327-00-3 |
2-(2-iodoethyl)-1,3-propanediol diacetate |
127047-77-2 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 607-328-00-9 |
methyl 4-bromomethyl-3-methoxybenzoate |
70264-94-7 |
Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H317, H400, H410 |
|
|
CLP00/ |
| 607-329-00-4 |
reaction mass of: sodium 2-(C12-18-n-alkyl)amino-1,4-butandioate; sodium 2-octadecenyl-amino-1,4-butandioate |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-330-00-X |
(S)-2,3-dihydro-1H-indole-2-carboxylic acid |
79815-20-6 |
Repr. 2, STOT RE 2 *, Skin Sens. 1 |
H361f ***, H373 **, H317 |
|
|
CLP00/ |
| 607-332-00-0 |
cyclopentyl chloroformate |
50715-28-1 |
Flam. Liq. 3, Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1 |
H226, H331, H302, H373 **, H318, H317 |
|
|
CLP00/ |
| 607-333-00-6 |
reaction mass of: dodecyl N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninate; tetradecyl N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninate |
- |
Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373 **, H314, H400, H410 |
|
|
CLP00/ |
| 607-334-00-1 |
ethyl 1-ethyl-6,7,8-trifluoro-1,4-dihydro-4-oxoquinoline-3-carboxylate |
100501-62-0 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 607-335-00-7 |
methyl (R)-2-(4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy)propionate |
72619-32-0 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 607-336-00-2 |
4-methyl-8-methylenetricyclo[3.3.1.13,7]dec-2-yl acetate |
122760-85-4 |
Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H315, H317, H411 |
|
|
CLP00/ |
| 607-337-00-8 |
di-tert-(C12-14)-alkylammonium 2-benzothiazolylthiosuccinate |
125078-60-6 |
Flam. Liq. 3, Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 2 |
H226, H302, H315, H318, H411 |
|
|
CLP00/ |
| 607-338-00-3 |
2-methylpropyl 2-hydroxy-2-methylbut-3-enoate |
72531-53-4 |
Eye Irrit. 2, Skin Irrit. 2 |
H319, H315 |
|
|
CLP00/ |
| 607-339-00-9 |
2,3,4,5-tetrachlorobenzoylchloride |
42221-52-3 |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1 |
H302, H314, H317 |
|
|
CLP00/ |
| 607-340-00-4 |
1,3-bis(4-benzoyl-3-hydroxyphenoxy)prop-2-yl acetate |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-341-00-X |
(9S)-9-amino-9-deoxyerythromycin |
26116-56-3 |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
CLP00/ |
| 607-342-00-5 |
4-chlorobutyl veratrate |
69788-75-6 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 607-343-00-0 |
4,7-methanooctahydro-1H-indene-diyldimethyl bis(2-carboxybenzoate) |
- |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-344-00-6 |
reaction mass of: 3-(N-(3-dimethylaminopropyl)-(C4-8)perfluoroalkylsulfonamido)propionic acid; N-[dimethyl-3-(C4-8-perfluoroalkylsulfonamido)propylammonium propionate; 3-(N-(3-dimethyl-propylammonium)-(C4-8)perfluoroalkylsulfonamido)propionic acid propi |
- |
STOT RE 2 * |
H373 ** |
|
|
CLP00/ |
| 607-345-00-1 |
potassium 2-(2,4-dichlorophenoxy)-(R)-propionate |
113963-87-4 |
Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1 |
H302, H315, H318, H317 |
|
|
CLP00/ |
| 607-346-00-7 |
3-icosyl-4-henicosylidene-2-oxetanone |
83708-14-9 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-347-00-2 |
sodium (R)-2-(2,4-dichlorophenoxy)propionate |
119299-10-4 |
Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1 |
H302, H315, H318, H317 |
|
|
CLP00/ |
| 607-348-00-8 |
magnesium bis((R)-2-(2,4-dichlorophenoxy)propionate) |
- |
Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1 |
H302, H315, H318, H317 |
|
|
CLP00/ |
| 607-349-00-3 |
mono-(tetrapropylammonium) hydrogen 2,2'-dithiobisbenzoate |
- |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-350-00-9 |
bis(4-(1,2-bis(ethoxycarbonyl)ethylamino)-3-methylcyclohexyl)methane |
136210-32-7 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 607-351-00-4 |
methyl O-(4-amino-3,5-dichloro-6-fluoropyridin-2-yloxy)acetate |
69184-17-4 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-352-00-X |
4,4'-oxydiphthalic anhydride |
1823-59-2 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-353-00-5 |
reaction mass of: ethyl exo-tricyclo[5.2.1.02,6]decane-endo-2-carboxylate; ethyl endo-tricyclo[5.2.1.02,6]decane-exo-2-carboxylate |
80657-64-3 |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ |
| 607-354-00-0 |
ethyl 2-cyclohexylpropionate |
2511-00-4 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-355-00-6 |
p-tolyl 4-chlorobenzoate |
15024-10-9 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 607-356-00-1 |
ethyl trans-2,2,6-trimethylcyclohexanecarboxylate |
- |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ |
| 607-357-00-7 |
reaction mass of: trans-4-acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran; cis-4-acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran |
131766-73-9 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-358-00-2 |
(1S,3S,5R,6R)-(4-nitrophenylmethyl)-1-dioxo-6-phenylacetamido-penam-3-carboxylate |
54275-93-3 |
Resp. Sens. 1 |
H334 |
|
|
CLP00/ |
| 607-359-00-8 |
(1S,4R,6R,7R)-(4-nitrophenylmethyl)3-methylene-1-oxo-7-phenylacetamido-cepham-4-carboxylateido-penam-3-carboxylate |
76109-32-5 |
Resp. Sens. 1 |
H334 |
|
|
CLP00/ |
| 607-360-00-3 |
sodium 3-acetoacetylamino-4-methoxytolyl-6-sulfonate |
133167-77-8 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-361-00-9 |
methyl (R)-2-(4-hydroxyphenoxy)propionate |
96562-58-2 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
CLP00/ |
| 607-362-00-4 |
reaction mass of: (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethyl)hexadec-4-enoate; (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethy |
- |
Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 2 |
H315, H318, H411 |
|
|
CLP00/ |
| 607-363-00-X |
methyl-3-methoxyacrylate |
5788-17-0 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-364-00-5 |
3-phenyl-7-[4-(tetrahydrofurfuryloxy)phenyl]-1,5-dioxa-s-indacen-2,6-dione |
134724-55-3 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-365-00-0 |
2-(2-amino-1,3-thiazol-4-yl)-(Z)-2-methoxyiminoacetyl chloride hydrochloride |
119154-86-8 |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1 |
H302, H314, H317 |
|
|
CLP00/ |
| 607-366-00-6 |
3,5-dimethylbenzoyl chloride |
6613-44-1 |
Skin Corr. 1B, Skin Sens. 1 |
H314, H317 |
|
|
CLP00/ |
| 607-367-00-1 |
potassium bis(N-carboxymethyl)-N-methyl-glycinato-(2-)N,O,O,N)-ferrate-(1-) monohydrate |
153352-59-1 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 607-368-00-7 |
1-(N,N-dimethylcarbamoyl)-3-tert-butyl-5-carbethoxymethylthio-1H-1,2,4-triazole |
110895-43-7 |
Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H301, H400, H410 |
|
|
CLP00/ |
| 607-369-00-2 |
reaction mass of: trans-(2R)-5-acetoxy-1,3-oxathiolane-2-carboxylic acid; cis-(2R)-5-acetoxy-1,3-oxathiolane-2-carboxylic acid |
147027-04-1 |
Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1 |
H302, H315, H318, H317 |
|
|
CLP00/ |
| 607-370-00-8 |
2-[[2-(acetyloxy)-3-(1,1-dimethyl-ethyl)-5-methylphenyl]methyl]-6-(1,1-dimethylethyl)-4-methylphenol |
41620-33-1 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 607-371-00-3 |
3-ethyl 5-methyl 4-(2-chlorophenyl)-1,4-dihydro-2-[2-(1,3-dihydro-1,3-dioxo-(2H)isoindol-2-yl)-ethoxymethyl]-6-methyl-3,5-pyridinedicarboxylate |
88150-62-3 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-372-00-9 |
ethoxylated bis phenol A di-(norbornene carboxylate) |
- |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-373-00-4 |
quizalofop-P-tefuryl (ISO); (+/-) tetrahydrofurfuryl (R)-2-[4-(6-chloroquinoxalin-2-yloxy)phenyloxy]propionate |
119738-06-6 |
Carc. 2, Repr. 2, Acute Tox. 4, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H361fd, H302, H373, H400, H410 |
M=1, M=1 |
|
CLP00/ATP13 |
| 607-374-00-X |
5-amino-2,4,6-triiodo-1,3-benzenedicarbonyldichloride |
37441-29-5 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 607-375-00-5 |
reaction mass of: cis-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin; trans-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin |
90035-08-8 |
Repr. 1B, Acute Tox. 1, Acute Tox. 1, Acute Tox. 1, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360D, H330, H310, H300, H372 (blood), H400, H410 |
Repr. 1B; H360D: C ≥ 0,003 % , STOT RE 1; H372 (blood): C ≥ 0,05 % , STOT RE 2; H373 (blood): 0,005 % ≤ C < 0,05 %, M = 10, M = 10 |
|
CLP00/ATP09 |
| 607-376-00-0 |
benzyl 2,4-dibromobutanoate |
23085-60-1 |
Repr. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361f ***, H315, H317, H400, H410 |
|
|
CLP00/ |
| 607-377-00-6 |
trans-4-cyclohexyl-L-proline monohydrochloride |
90657-55-9 |
Repr. 2, Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1 |
H361f ***, H302, H315, H318, H317 |
|
|
CLP00/ |
| 607-378-00-1 |
ammonium (Z)-α-methoxyimino-2-furylacetate |
97148-39-5 |
Flam. Sol. 2 |
H228 |
|
T |
CLP00/ |
| 607-379-00-7 |
reaction mass of: 2-[N-(2-hydroxyethyl)stearamido]ethyl stearate; sodium [bis[2-(stearoyloxy)ethyl]amino]methylsulfonate; sodium [bis(2-hydroxyethyl)amino]methylsulfonate; N,N-bis(2-hydroxyethyl)stearamide |
- |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-380-00-2 |
reaction mass of: ammonium-1,2-bis(hexyloxycarbonyl)ethanesulfonate; ammonium-1-hexyloxycarbonyl-2-octyloxycarbonylethanesulfonate; ammonium-2-hexyloxycarbonyl-1-octyloxycarbonylethanesulfonate |
- |
Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 3 |
H315, H318, H412 |
|
|
CLP00/ |
| 607-381-00-8 |
reaction mass of triesters of 2,2-bis(hydroxymethyl)butanol with C7-alkanoic acids and 2-ethylhexanoic acid |
- |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-382-00-3 |
2-((4-amino-2-nitrophenyl)amino)benzoic acid |
117907-43-4 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
|
CLP00/ |
| 607-383-00-9 |
reaction mass of: 2,2,6,6-tetramethylpiperidin-4-yl-hexadecanoate; 2,2,6,6-tetramethylpiperidin-4-yl-octadecanoate |
86403-32-9 |
Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H317, H400, H410 |
|
|
CLP00/ |
| 607-384-00-4 |
reaction mass of: esters of C14-C15 branched alcohols with 3,5-di-t-butyl-4-hydroxyphenyl propionic acid; C15 branched and linear alkyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoate; C13 branched and linear alkyl 3,5-bis(1,1-dimethylethyl)-4-hyd |
171090-93-0 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-385-00-X |
Copolymer of vinyl-alcohol and vinyl acetate partially acetilized with 4-(2-(4-formylphenyl)ethenyl)-1-methylpyridinium methylsulfate |
125229-74-5 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-386-00-5 |
reaction mass of: tetradecanoic acid (42.5-47.5 %); poly(1-7)lactate esters of tetradecanoic acid (52.5-57.5 %) |
174591-51-6 |
Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H317, H400, H410 |
|
|
CLP00/ |
| 607-387-00-0 |
reaction mass of: dodecanoic acid (35-40 %); poly(1-7)lactate esters of dodecanoic acid (60-65 %) |
58856-63-6 |
Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H317, H400, H410 |
|
|
CLP00/ |
| 607-388-00-6 |
4-ethylamino-3-nitrobenzoic acid |
2788-74-1 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 3 |
H302, H317, H412 |
|
|
CLP00/ |
| 607-389-00-1 |
trisodium N,N-bis(carboxymethyl)-3-amino-2-hydroxypropionate |
119710-96-2 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 607-390-00-7 |
1,2,3,4-tetrahydro-6-nitro-quinoxaline |
41959-35-7 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 607-391-00-2 |
dimethylcyclopropane-1,1-dicarboxylate |
6914-71-2 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-392-00-8 |
2-phenoxyethyl 4-((5-cyano-1,6-dihydro-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)azo)benzoate |
88938-37-8 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-393-00-3 |
3-(cis-1-propenyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
106447-44-3 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-394-00-9 |
5-methylpyrazine-2-carboxylic acid |
5521-55-1 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 607-395-00-4 |
reaction mass of: sodium 1-tridecyl-4-allyl-(2 or 3)-sulfobutanedioate; sodium 1-dodecyl-4-allyl-(2 or 3)-sulfobutanedioate |
- |
Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 2 |
H314, H317, H411 |
|
|
CLP00/ |
| 607-396-00-X |
bis(1,2,2,6,6-pentamethyl-4-piperidinyl) 2-(4-methoxybenzylidene)malonate |
147783-69-5 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 607-397-00-5 |
reaction mass of: Ca salicylates (branched C10-14 and C18-30 alkylated); Ca phenates (branched C10-14 and C18-30 alkylated); Ca sulfurised phenates (branched C10-14 and C18-30 alkylated) |
- |
Repr. 2, Skin Sens. 1 |
H361f***, H317 |
|
|
CLP00/ATP01 |
| 607-398-00-0 |
ethyl N-(5-chloro-3-(4-(diethylamino)-2-methylphenylimino)-4-methyl-6-oxo-1,4-cyclohexadienyl)carbamate |
125630-94-6 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 607-399-00-6 |
2,2-dimethyl 3-methyl-3-butenyl propanoate |
104468-21-5 |
Skin Irrit. 2, Aquatic Chronic 3 |
H315, H412 |
|
|
CLP00/ |
| 607-400-00-X |
methyl 3-[[(dibutylamino)thioxomethyl]thio]propanoate |
32750-89-3 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 607-401-00-5 |
ethyl 3-hydroxy-5-oxo-3-cyclohexene-1-carboxylate |
88805-65-6 |
Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1 |
H315, H318, H317 |
|
|
CLP00/ |
| 607-402-00-0 |
methyl N-(phenoxycarbonyl)-L-valinate |
153441-77-1 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-403-00-6 |
reaction mass of: bis(1S,2S,4S)-(1-benzyl-4-tert-butoxycarboxamido-2-hydroxy-5-phenyl)pentylammonium succinate; isopropyl alcohol |
- |
STOT RE 2 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H373 **, H318, H400, H410 |
|
|
CLP00/ |
| 607-404-00-1 |
reaction mass of: ((Z)-3,7-dimethyl-2,6-octadienyl)oxycarbonylpropanoic acid; di-((E)-3,7-dimethyl-2,6-octadienyl) butandioate; di-((Z)-3,7-dimethyl-2,6-octadienyl) butandioate; (Z)-3,7-dimethyl-2,6-octadienyl butandioate; ((E)-3,7-dimethyl-2,6-octadi |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-405-00-7 |
2-hexyldecyl-p-hydroxybenzoate |
148348-12-3 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-406-00-2 |
potassium 2,5-dichlorobenzoate |
184637-62-5 |
Acute Tox. 4 *, Eye Dam. 1 |
H302, H318 |
|
|
CLP00/ |
| 607-407-00-8 |
ethyl 2-carboxy-3-(2-thienyl)propionate |
143468-96-6 |
Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1 |
H315, H318, H317 |
|
|
CLP00/ |
| 607-408-00-3 |
potassium N-(4-fluorophenyl)glycinate |
184637-63-6 |
STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H373 **, H318, H317, H412 |
|
|
CLP00/ |
| 607-409-00-9 |
reaction mass of: (3R)-[1S-(1α, 2α, 6β-((2S)-2-methyl-1-oxo-butoxy)-8aγ)hexahydro-2,6-dimethyl-1-naphthalene]-3,5-dihydroxyheptanoic acid; inert biomass from Aspergillus terreus |
- |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 607-410-00-4 |
mono[2-(dimethylamino)ethyl]monohydrogen-2-(hexadec-2-enyl)butanedioate and/or mono[2-(dimethylamino)ethyl]monohydrogen-3-(hexadec-2-enyl)butanedioate |
779343-34-9 |
Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H317, H400, H410 |
|
|
CLP00/ |
| 607-411-00-X |
oxiranemethanol, 4-methylbenzene-sulfonate, (S)- |
70987-78-9 |
Carc. 1B, Muta. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H350, H341, H318, H317, H411 |
|
|
CLP00/ |
| 607-412-00-5 |
ethyl 2-(1-cyanocyclohexyl)acetate |
133481-10-4 |
Acute Tox. 4 *, STOT RE 2 *, Aquatic Chronic 3 |
H302, H373 **, H412 |
|
|
CLP00/ |
| 607-413-00-0 |
trans-4-phenyl-L-proline |
96314-26-0 |
Repr. 2, Skin Sens. 1 |
H361f ***, H317 |
|
|
CLP00/ |
| 607-415-00-1 |
poly-(methyl methacrylate)-co-(butylmethacrylate)-co-(4-acryloxybutyl-isopropenyl-α, α-dimethylbenzyl carbamate)-co-(maleicanhydride) |
- |
Flam. Sol. 1, Skin Sens. 1 |
H228, H317 |
|
T |
CLP00/ |
| 607-416-00-7 |
4-(2-carboxymethylthio)ethoxy-1-hydroxy-5-isobutyloxycarbonylamino-N-(3-dodecyloxypropyl)-2-naphthamide |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 607-417-00-2 |
3-chloropropyl chloroformiate |
628-11-5 |
Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 2 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1 |
H331, H302, H373**, H315, H318, H317 |
|
|
ATP01/ |
| 607-418-00-8 |
2-ethylhexyl 4-aminobenzoate |
26218-04-2 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 607-419-00-3 |
(3'-carboxymethyl-5-(2-(3-ethyl-3H-benzothiazol-2-ylidene)-1-methyl-ethylidene)-4,4'-dioxo-2'-thioxo-(2,5')bithiazolidinyliden-3-yl)-acetic acid |
166596-68-5 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
CLP00/ |
| 607-420-00-9 |
2,2-bis(hydroxymethyl)butanoic acid |
10097-02-6 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
CLP00/ |
| 607-421-00-4 |
cypermethrin (ISO); %u03B1-cyano-3-phenoxybenzyl 3-(2,2-dichlorovi-nyl)-2,2-dimethylcyclopro-panecarboxylate;cypermethrin cis/trans /- 40/60 |
52315-07-8 |
Acute Tox. 4,
Acute Tox. 4,
STOT SE 3,
STOT RE 2,
Aquatic Acute 1,
Aquatic Chronic 1 |
H332,
H302,
H335,
H373 (nervous system),
H400,
H410 |
Inhalation: ATE = 3.3 mg/L (dusts/mists),
Oral: ATE = 500 mg/kg bw,
M=100000,
M=100000 |
|
CLP00/ATP17 |
| 607-422-00-X |
α-cypermethrin (ISO); racemate comprising (R)-α-cyano-3-phenoxybenzyl (1S,3S)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate; (S)-α-cyano-3-phenoxybenzyl (1R,3R)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
67375-30-8 |
Acute Tox. 3 *, STOT RE 2 *, STOT SE 3, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H373**, H335, H400, H410 |
M=1000: |
|
CLP00/ATP01 |
| 607-423-00-5 |
esters of mecoprop and of mecoprop-P |
- |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
A |
CLP00/ |
| 607-424-00-0 |
trifloxystrobin (ISO); (E,E)-%u03B1-methoxyimino-{}{2-[[[[1-[3-(trifluoromethyl)phenyl]ethylidene]amino]oxy]methyl]benzeneacetic acid methyl ester |
141517-21-7 |
Lact.,
Skin Sens. 1,
Aquatic Acute 1,
Aquatic Chronic 1 |
H362,
H317,
H400,
H410 |
M=100,
M=10 |
|
CLP00/ATP17 |
| 607-425-00-6 |
metalaxyl (ISO); methyl-N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-DL-alaninate |
57837-19-1 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 3 |
H302, H317, H412 |
|
|
CLP00/ |
| 607-426-00-1 |
1,2-benzenedicarboxylic acid, dipentylester, branched and linear; [1] n-pentyl-isopentylphthalate; [2] di-n-pentyl phthalate; [3] diisopentylphthalate [4] |
84777-06-0 [1], - [2], 131-18-0 [3], 605-50-5 [4] |
Repr. 1B, Aquatic Acute 1 |
H360FD, H400 |
|
|
CLP00/ |
| 607-427-00-7 |
bromoxynil heptanoate (ISO); 2,6-dibromo-4-cyanophenyl heptanoate |
56634-95-8 |
Repr. 2, Acute Tox. 4 *, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361d ***, H332, H302, H317, H400, H410 |
|
|
CLP00/ |
| 607-428-00-2 |
tetrasodium ethylene diamine tetraacetate |
64-02-8 |
Acute Tox. 4 *, Eye Dam. 1 |
H302, H318 |
|
|
ATP01/ |
| 607-429-00-8 |
edetic acid; (EDTA) |
60-00-4 |
Eye Irrit. 2 |
H319 |
|
|
ATP01/ |
| 607-430-00-3 |
BBP; benzyl butyl phthalate |
85-68-7 |
Repr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H360Df, H400, H410 |
|
|
CLP00/ |
| 607-431-00-9 |
prallethrin (ISO); ETOC; 2-methyl-4-oxo-3-(prop-2-ynyl)cyclopent-2-en-1-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
23031-36-9 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H302, H400, H410 |
|
|
CLP00/ |
| 607-432-00-4 |
S-metolachlor; reaction mass of (S)-2-chloro-N-(2-ethyl-6-methyl-phenyl)-N-(2-methoxy-1-methyl-ethyl)-acetamide (80-100 %); [1] (R)-2-chloro-N-(2-ethyl-6-methyl-phenyl)-N-(2-methoxy-1-methyl-ethyl)-acetamide (0-20 %) [2] |
87392-12-9 [1], 178961-20-1 [2] |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 607-433-00-X |
cypermethrin cis/trans +/- 80/20; (RS)-α-cyano-3-phenoxybenzyl (1RS; 3RS; 1RS, 3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
52315-07-8 |
Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H335, H315, H317, H400, H410 |
|
|
CLP00/ |
| 607-434-00-5 |
mecoprop-P [1] and its salts; (R)-2-(4-chloro-2-methylphenoxy)propionic acid and its salts |
16484-77-8 |
Acute Tox. 4,
Eye Dam. 1,
Aquatic Acute 1,
Aquatic Chronic 1 |
H302,
H318,
H400,
H410 |
Oral: ATE = 431 mg/kg bw,
M=10,
M=10 |
|
CLP00/ATP17 |
| 607-435-00-0 |
2S-isopropyl-5R-methyl-1R-cyclohexyl 2,2-dihydroxyacetate |
111969-64-3 |
STOT RE 2 *, Eye Dam. 1, Aquatic Chronic 2 |
H373 **, H318, H411 |
|
|
CLP00/ |
| 607-436-00-6 |
2-hydroxy-3-(2-ethyl-4-methylimidazoyl)propyl neodecanoate |
- |
Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H400, H410 |
|
|
CLP00/ |
| 607-437-00-1 |
3-(4-aminophenyl)-2-cyano-2-propenoic acid |
252977-62-1 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-438-00-7 |
methyl-2-[(aminosulfonyl)methyl]benzoate |
112941-26-1 |
Acute Tox. 4 *, Eye Irrit. 2 |
H302, H319 |
|
|
CLP00/ |
| 607-439-00-2 |
methyl tetrahydro-2-furancarboxylate |
37443-42-8 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 607-440-00-8 |
methyl 2-aminosulfonyl-6-(trifluoromethyl)pyridine-3-c arboxylate |
144740-59-0 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 607-441-00-3 |
3-[3-(2-dodecyloxy-5-methylphenylcarbamoyl)-4-hydroxy-1-naphthylthio]propionic acid |
167684-63-1 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-442-00-9 |
benzyl [hydroxy-(4-phenylbutyl)phosphinyl] acetate |
87460-09-1 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 607-444-00-X |
reaction mass of: cis-1,4-dimethylcyclohexyl dibenzoate; trans-1,4-dimethylcyclohexyl dibenzoate |
35541-81-2 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-445-00-5 |
Iron (III) tris(4-methylbenzenesulfonate) |
77214-82-5 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 607-446-00-0 |
methyl 2-[4-(2-chloro-4-nitrophenylazo)-3-(1-oxopropyl)amino]phenylaminopropionate |
155522-12-6 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 607-447-00-6 |
sodium 4-[4-(4-hydroxyphenylazo)phenylamino]-3-nitrobenzenesulfonate |
156738-27-1 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 607-448-00-1 |
2,3,5,6-tetrafluorobenzoic acid |
652-18-6 |
Skin Irrit. 2, Eye Dam. 1 |
H315, H318 |
|
|
CLP00/ |
| 607-449-00-7 |
reaction mass of: 4,4',4''-[(2,4,6-trioxo-1,3,5(2H,4H,6H)-triazine-1,3,5-triyl)tris[methylene(3,5,5-trimethyl-3,1-cyclohexanediyl)iminocarbonyloxy-2,1-ethanediyl(ethyl)amino]]trisbenzenediazoniumtri[bis(2-methylpropyl)naphthalenesulfonate]; 4,4',4'',4''' |
- |
Self-react. D ****, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H242, H317, H400, H410 |
|
|
CLP00/ |
| 607-450-00-2 |
2-mercaptobenzothiazolyl-(Z)-(2-aminothiazol-4-yl)-2-(tert-butoxycarbonyl) isopropoxyiminoacetate |
89604-92-2 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-451-00-8 |
4-[4-amino-5-hydroxy-3-(4-(2-sulfoxyethylsulfonyl)phenylazo)-2,7-disulfonapht-6-ylazo]-6-[3-(4-amino-5-hydroxy-3-(4-(2-sulfoxyethylsulfonyl)phenylazo)-2,7-disulfonapht-6-ylazo]phenylcarbonylamino]benzenesulfonic acid, sodium salt |
161935-19-9 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
CLP00/ |
| 607-453-00-9 |
4-benzyl-2,6-dihydroxy-4-aza-heptylene bis(2,2-dimethyloctanoate) |
172964-15-7 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 607-454-00-4 |
reaction mass of: trans-2-(1-methylethyl)-1,3-dioxane-5-carboxylic acid; cis-2-(1-methylethyl)-1,3-dioxane-5-carboxylic acid |
116193-72-7 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
CLP00/ |
| 607-455-00-X |
1-amino-4-(3-[4-chloro-6-(2,5-di-sulfophenylamino)-1,3,5-triazin-2-ylamino]-2,2-dimethyl-propylamino)-anthraquinone-2-sulfonic acid, sodium/lithiumsalt |
172890-93-6 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-456-00-5 |
3-amino-4-chlorobenzoic acid, hexadecyl ester |
143269-74-3 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-457-00-0 |
tetrasodium dihydrogen 1,1''-dihydroxy-8,8''-[p-phenylbis(imino-{}{6-[4-(2-aminoethyl)piperazin-1-yl]}}-1,3,5-triazine-4,2-diyl-imino)]bis(2,2'-azonaphthalene-1',3,6-trisulfonate) |
172277-97-3 |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 607-458-00-6 |
reaction mass of: 2-ethyl-[2,6-dibromo-4-[1-[3,5-dibromo-4-(2-hydroxyethoxy)phenyl]-1-methylethyl]phenoxy]propenoate; 2,2'-diethyl-[4,4'-bis(2,6-dibromophenoxy)-1-methylethylidene] dipropenoate; 2,2'-[(1-methylethylidene)bis[[2,6-dibromo-4,1-phenylene)o |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-459-00-1 |
isopentyl 4-{}{2-[5-cyano-1,2,3,6-tetrahydro-1-(2-isopropoxyethoxy-carbonylmethyl)-4-methyl-2,6-dioxo-3-pyridylidene]hydrazino}}benzoate |
- |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-460-00-7 |
3-tridecyloxy-propyl-ammonium 9-octadecenoate |
778577-53-0 |
STOT RE 2 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H373 **, H319, H315, H400, H410 |
|
|
CLP00/ |
| 607-461-00-2 |
reaction mass of: pentasodium 2-{}{4-{}{3-methyl-4-[6-sulfonato-4-(2-sulfonato-phenylazo)-naphthalen-1-ylazo]-phenylamino}}-6-[3-(2-sulfato-ethanesulfonyl)-phenylamino]-1,3,5-triazin-2-ylamino}}-benzene-1,4-disulfonate; pentasodium 2-{}{4-{}{3-methyl-4-[ |
- |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-462-00-8 |
reaction mass of: 1-hexyl acetate; 2-methyl-1-pentyl acetate; 3-methyl-1-pentyl acetate; 4-methyl-1-pentyl acetate; other mixed linear and branched C6-alkyl acetates |
88230-35-7 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-463-00-3 |
3-(phenothiazin-10-yl)propionic acid |
362-03-8 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-464-00-9 |
reaction mass of: 7-chloro-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid; 5-chloro-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid |
- |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-465-00-4 |
tris(2-hydroxyethyl)ammonium 7-{}{4-[4-(2-cyanoamino-4-hydroxy-6-oxidopyrimidin-5-ylazo)benzamido]-2-ethoxy-phenylazo}}naphthalene-1,3-disulfonate |
778583-04-3 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-466-00-X |
reaction mass of: phenyl 1-(1-[2-chloro-5-(hexadecyloxycarbonyl)phenylcarbamoyl]-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazole-5-carboxylate; phenyl 2-(1-(2-chloro-5-(hexadecyloxycarbonyl)phenylcarbamoyl)-3,3-dimethyl-2-oxobutyl)-1H-2,3,3 |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-467-00-5 |
1,1,3,3-tetrabutyl-1,3-ditinoxydicaprylate |
56533-00-7 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H373 **, H314, H400, H410 |
|
|
CLP00/ |
| 607-468-00-0 |
reaction mass of: monosodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonate; disodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6- |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-469-00-6 |
disodium 7-((4,6-bis(3-diethylaminopropylamino)-1,3,5-triazine-2-yl)amino)-4-hydroxy-3-(4-(4-sulfonatophenylazo)phenylazo)-2-naphthalene sulfonate |
120029-06-3 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-470-00-1 |
potassium sodium 6,13-dichloro-3,10-bis{}{2-[4-[3-(2-hydroxysulphonyloxyethanesulfonyl)phenylamino]-6-(2,5-disulfonatophenylamino)-1,3,5-triazin-2-ylamino]ethylamino}}benzo[5,6][1,4]oxazino[2,3-b]phenoxazine-4,11-disulfonate |
154336-20-6 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
CLP00/ |
| 607-471-00-7 |
1,6-bis((dibenzylthiocarbamoyl)disulfanyl)hexane |
151900-44-6 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-473-00-8 |
pentaerythritol, dipentaerythritol, fatty acids, C6-10, mixed esters with adipic acid, heptanoic acid and isostearic acid |
187412-41-5 |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 607-474-00-3 |
(4-(4-(4-dimethylaminobenzyliden-1-yl)-3-methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid |
117573-89-4 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-475-00-9 |
reaction mass of: tetrasodium 7-(4-[4-chloro-6-[methyl-(3-sulfonatophenyl)amino]-1,3,5-triazin-2-ylamino]-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate; tetrasodium 7-(4-[4-chloro-6-[methyl-(4-sulfonatophenyl)amino]-1,3,5-triazin-2-ylamino]-2-ureidoph |
148878-18-6 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-476-00-4 |
trisodium N,N-bis(carboxymethyl)-β-alanine |
129050-62-0 |
Skin Corr. 1B, Aquatic Chronic 3 |
H314, H412 |
|
|
CLP00/ |
| 607-477-00-X |
(1α5α6α)-6-nitro-3-benzyl-3-azabicyclo[3.1.0]hexane methanesulfonate salt |
- |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 2 |
H302, H318, H411 |
|
|
ATP01/ |
| 607-478-00-5 |
tetramethylammonium hydrogen phthalate |
79723-02-7 |
Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1 |
H301, H373 **, H400 |
|
|
CLP00/ |
| 607-479-00-0 |
hexadecyl 4-chloro-3-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentamido]benzoate |
168689-49-4 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-480-00-6 |
1,2-benzenedicarboxylic acid; di-C7-11-branched and linear alkylesters |
68515-42-4 |
Repr. 1B |
H360Df |
|
|
CLP00/ |
| 607-481-00-1 |
reaction mass of: trihexyl citrate; dihexyloctyl citrate; dioctylhexyl citrate; dihexyldecyl citrate |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-482-00-7 |
N-[1-(S)-ethoxycarbonyl-3-phenylpropyl]-l-alanyl-N-carboxyanhydride |
84793-24-8 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
ATP01/ |
| 607-483-00-2 |
1,2-benzenedicarboxylic acid; di-C6-8-branched alkylesters, C7-rich |
71888-89-6 |
Repr. 1B |
H360D*** |
|
|
ATP01/ |
| 607-484-00-8 |
ethyl 2-{[3-acetylamino-4-(6-bromo-2-methyl-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)phenyl]ethylamino}propionate |
221452-67-1 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-485-00-3 |
(3S-trans)-phenyl-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)-1-piperidinecarboxylate |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-486-00-9 |
potassium sodium 5'-(6-chloro-4-(2-(2-vinylsulfonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-4'-hydroxy-2,3'-azodinaphthalene-1,2',5,7'-disulfonate |
110081-40-8 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 607-487-00-4 |
reaction mass of: disodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-hydroxy-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate; trisodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-oxido-1-(4-sul |
- |
Repr. 1B, Aquatic Chronic 3 |
H360D ***, H412 |
|
|
CLP00/ |
| 607-488-00-X |
ethyl (2-acetylamino-5-fluoro-4-isothiocyanatophenoxy)acetate |
147379-38-2 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 607-489-00-5 |
reaction mass of: 2-ethylhexyl linolenate, linoleate and oleate; 2-ethylhexyl epoxyoleate; 2-ethylhexyl diepoxylinoleate; 2-ethylhexyl triepoxylinolenate |
71302-79-9 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-490-00-0 |
N-[2-hydroxy-3-(C12-16-alkyloxy)propyl]-N-methyl glycinate |
- |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
CLP00/ |
| 607-491-00-6 |
reaction mass of: diester of 4,4'-methylenebis[2-(2-hydroxy-5-methylbenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxonaphthalene-1-sulfonic acid (1:2); triester of 4,4'-methylenebis[2-(2-hydroxy-5-methylbenzyl)-3,6-dimethylphenol] and 6-diazo-5,6 |
- |
Carc. 2 |
H351 |
|
|
ATP01/ |
| 607-492-00-1 |
2-(1-(3',3'-dimethyl-1'-cyclohexyl)ethoxy)-2-methyl propyl propanoate |
141773-73-1 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-493-00-7 |
methyl (3aR,4R,7aR)-2-methyl-4-(1S,2R,3-triacetoxypropyl)-3a,7a-dihydro-4H-pyrano[3,4-d]oxazole-6-carboxylate |
78850-37-0 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 607-494-00-2 |
bis(2-ethylhexyl)octylphosphonate |
52894-02-7 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 607-495-00-8 |
sodium 4-sulfophenyl-6-((1-oxononyl)amino)hexanoate |
168151-92-6 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 607-496-00-3 |
2,2'-methylenebis(4,6-di-tert-butyl-phenyl)-2-ethylhexyl phosphite |
126050-54-2 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-497-00-9 |
cerium oxide isostearate |
- |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-498-00-4 |
(E)-3,7-dimethyl-2,6-octadienylhexadecanoate |
3681-73-0 |
Skin Irrit. 2, Aquatic Chronic 4 |
H315, H413 |
|
|
CLP00/ |
| 607-499-00-X |
bis(dimethyl-(2-hydroxyethyl)ammonium) 1,2-ethanediyl-bis(2-hexadecenylsuccinate) |
- |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H318, H317, H411 |
|
|
CLP00/ |
| 607-500-00-3 |
calcium 2,2,bis[(5-tetrapropylene-2-hydroxy)phenyl]ethanoate |
- |
Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H400, H410 |
|
|
CLP00/ |
| 607-501-00-9 |
reaction mass of: triphenylthiophosphate and tertiary butylated phenyl derivatives |
192268-65-8 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 607-502-00-4 |
(N-benzyl-N,N,N-tributyl)ammonium 4-dodecylbenzenesulfonate |
178277-55-9 |
Skin Corr. 1B, Acute Tox. 4 *, Aquatic Chronic 2 |
H314, H302, H411 |
|
|
CLP00/ |
| 607-503-00-X |
2,4,6-tri-n-propyl-2,4,6-trioxo-1,3,5,2,4,6-trioxatriphosphorinane |
68957-94-8 |
Skin Corr. 1B |
H314 |
|
|
CLP00/ |
| 607-504-00-5 |
diammonium 1-hydroxy-2-(4-(4-carboxyphenylazo)-2,5-dimethoxyphenylazo)-7-amino-3-naphthalenesulfonate |
- |
Repr. 1A, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H361f, H301, H373**, H400, H410 |
|
|
ATP01/ |
| 607-505-00-0 |
pentasodium 7-(4-(4-(5-amino-4-sulfonato-2-(4-((2-(sulfonato-ethoxy)sulfonyl)phenylazo)phenylamino)-6-chloro-1,3,5-triazin-2-yl)amino-2-ureidophenylazo)naphtalene-1,3,6-trisulfonate |
- |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-506-00-6 |
reaction mass of: strontium (4-chloro-2-((4,5-dihydro-3-methyl-5-oxo-1-(3-sulfonatophenyl)-1H-pyrazol-4-yl)azo)-5-methyl)benzenesulfonate; disodium (4-chloro-2-((4,5-dihydro-3-methyl-5-oxo-1-(3-sulfonatophenyl)-1H-pyrazol-4-yl)azo)-5-methyl)benzenesulfon |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 607-507-00-1 |
potassium,sodium 2,4-diamino-3-[4-(2-sulfonatoethoxysulfonyl)phenylazo]-5-[4-(2-sulfonatoethoxysulfonyl)-2-sulfonatophenylazo]-benzenesulfonate |
187026-95-5 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 607-508-00-7 |
disodium 3,3'-[iminobis[sulfonyl-4,1-phenylene-(5-hydroxy-3-methylpyrazole-1,4-diyl)azo-4,1-phenylenesulfonylimino-(4-amino-6-hydroxypyrimidine-2,5-diyl)azo-4,1-phenylenesulfonylimino(4-amino-6-hydroxypyrimidine-2,5-diyl)azo]bis(benzenesulfonate)] |
- |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 607-509-00-2 |
2-phenoxyethyl 4-aminobenzoate |
88938-23-2 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 607-510-00-8 |
(2S,5R)-6,6-dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide |
76646-91-8 |
Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1 |
H302, H315, H318, H317 |
|
|
ATP01/ |
| 607-511-00-3 |
reaction mass of: 4-[(3-decyloxypropyl)(3-isobutoxy-1-isobutoxycarbonyl-3-oxopropyl)amino]-4-oxobutyric acid; 4-[(3-isobutoxy-1-isobutoxycarbonyl-3-oxopropyl)(3-octyloxypropyl)amino]-4-oxobutyric acid |
- |
Eye Irrit. 2, Aquatic Chronic 2 |
H319, H411 |
|
|
ATP01/ |
| 607-512-00-9 |
trisodium 2,4-diamino-3,5-bis-[4-(2-sulfonatoethoxy)sulfonyl)phenylazo]benzenesulfonate |
182926-43-8 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 607-513-00-4 |
reaction mass of: Trisodium 4-benzoylamino-6-(6-ethenesulfonyl-1-sulfato-naphthalen-2-ylazo)-5-hydroxynaphthalene-2,7-disulfonate; 5-(benzoylamino)-4-hydroxy-3-((1-sulfo-6-((2-(sulfooxy)ethyl)sulfonyl)-2-naphthyl)azo)naphthalene-2,7-disulfonic acid sodiu |
- |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
|
CLP00/ |
| 607-514-00-X |
potassium N-(1-methoxy-1-oxobut-2-en-3-yl)valinate |
134841-35-3 |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 607-515-00-5 |
reaction mass of: disodium hexyldiphenyl ether disulphonate; disodium dihexyldiphenyl ether disulphonate |
147732-60-3 |
Eye Irrit. 2, Aquatic Chronic 2 |
H319, H411 |
|
|
CLP00/ |
| 607-516-00-0 |
N,N'-bis(trifluoroacetyl)-S,S'-bis L-homocysteine |
105996-54-1 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
CLP00/ |
| 607-517-00-6 |
(S)-α-(acetylthio)benzenepropanoic acid |
76932-17-7 |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1 |
H302, H318, H317 |
|
|
CLP00/ |
| 607-518-00-1 |
3-oxoandrost-4-ene-17-β-carboxylic acid |
302-97-6 |
Repr. 1A, Aquatic Chronic 4 |
H361f, H413 |
|
|
ATP01/ |
| 607-519-00-7 |
poly-[((4-((4-ethyl-ethylene)amino)phenyl)-((4-(ethyl-(2-oxyethylene)amino)phenyl)methinyl)cyclohexa-2,5-dienylidene)-N-ethyl-N-(2-hydroxyethyl)ammonium acetate] |
176429-27-9 |
STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H335, H315, H318, H400, H410 |
|
|
ATP01/ |
| 607-520-00-2 |
reaction mass of: sodium 4,5-dihydro-2-[(propionato)(C6-18)alkyl]-3H-imidazolium-N-ethylphosphate; disodium 4,5-dihydro-2-[(dipropionato)(C6-18)alkyl]-3H-imidazolium-N-ethylphosphate |
- |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
ATP01/ |
| 607-521-00-8 |
tetraethyl N,N'-(methylenedicyclohexane-4,1-diyl)bis-dl-aspartate |
136210-30-5 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
ATP01/ |
| 607-522-00-3 |
sodium salt of the polymer of: sodium 2-methyl-buta-1,3-diene-1-sulfonate with acrylic acid and 2-hydroxyethyl-2-methylacrylate |
184246-86-4 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 607-523-00-9 |
reaction mass of mono to tetra(lithium and/or sodium)3-amino-10-[4-(4-amino-3-sulfonatoanilino)-6-[methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2-ylamino]-6-13-dichlorobenzo[1,2-B:4,5-B']di[1,4]benzoxazine-4,11-disulfonate; mono to tetra(lithium and/or sodium)3-amino-10-[4,6-bis(4-amino-3-sulfonatoanilino)-1,3,5-triazin-2-ylamino]-6-13-dichlorobenzo[1,2-B:4,5-B']di[1,4]benzoxazine-4,11-disulfonate; mono to penta(lithium and/or sodium)10,10´-diamino-6,6',13,13´-tetrachloro-3,3'-[6-[methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2,4-diyldiimino]bis[benzo[1,2-B:4,5-B']di[1,4]benzoxazine-4,11-disulfonate; mono to hepta(lithium and/or sodium)10-amino-6,6',13,13'-tetrachloro-10´[4-(4-amino-3-sulfonatoanilino)-[6-methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2,4-diimino]bis[benzo[1,2-B:4,5-B']di[1,4]benzoxazine-4,11-disulfonate; mono to hepta(lithium and/or sodium)10,10'-diamino-6,6',3,3'[(2-sulfonato)-1,4-phenylenediiminobis[6-methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2,4-diyldiimino]bis[benzo[1,2-B:4,5-B']di[1,4]benzoxazine-4,11-disulfonate |
- |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
ATP01/ |
| 607-524-00-4 |
tall oil 2-[(tetrahydro-2H-pyran-2-yl) thio]ethyl esters |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-525-00-X |
(Z)-2-methoxymino-2-[2-(tritylamino)thiazol-4-yl]acetic acid |
64485-90-1 |
Flam. Sol. 1****, Carc. 2, Aquatic Chronic 3 |
H228, H351, H412 |
|
|
ATP01/ |
| 607-526-00-5 |
cartap (ISO); 1,3-bis(carbamoylthio)-2-(dimethylamino)propane |
15263-53-3 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 607-527-00-0 |
reaction mass of: 1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-tridecafluorooctyl)dodecanedioate; 1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-heptdecafluorodecyl)dodecanedioate; 1-(1'H,1'H,2'H,2'H-tridecafluorooctyl) |
- |
STOT RE 2 * |
H373 ** |
|
|
CLP00/ |
| 607-528-00-6 |
(S)-3-methyl-2-(2-oxotetrahydropyrimidine-1-yl)butyric acid |
192725-50-1 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-529-00-1 |
benzyl cis-4-ammonium-4'-toluenesulfonato-1-cyclohexanecarboxylate |
67299-45-0 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 607-530-00-7 |
reaction mass of isomers of: C7-9-alkyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate |
125643-61-0 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-531-00-2 |
methyl 3-amino-4,6-dibromo-2-methyl-benzoate |
119916-05-1 |
STOT RE 2 *, Aquatic Chronic 2 |
H373**, H411 |
|
|
ATP01/ |
| 607-532-00-8 |
(S)-1-[2-tert-butoxycarbonyl-3-(2-methoxyethoxy)propyl]-1-cyclopentanecarboxylic acid, cyclohexylamine salt |
167944-94-7 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 607-533-00-3 |
pentasodium monohydrogen 6-chloro-3,10-bis[2-[4-chloro-6-(2,4-disulfophenylamino)-1,3,5-triazin-2-yl-amino]ethylamino]-13-ethylbenzo[5.6][1.4]oxazino[2,3-b]phenoxazine-4,11-disulfonate |
- |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
ATP01/ |
| 607-534-00-9 |
ethyl 2-(3-benzoylphenyl)propanoate |
60658-04-0 |
Acute Tox. 3 *, STOT RE 1, Skin Sens. 1, Aquatic Chronic 2 |
H301, H372**, H317, H411 |
|
|
ATP01/ |
| 607-535-00-4 |
potassium 4-iodo-2-sulfonato-benzoic acid |
- |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
ATP01/ |
| 607-536-00-X |
(2,6-xylyloxy) acetic acid |
13335-71-2 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 3 |
H302, H318, H412 |
|
|
ATP01/ |
| 607-537-00-5 |
isopropylammonium 2-(3-benzoylphenyl)propionate |
- |
Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 1, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H312, H372**, H318, H400, H410 |
|
|
ATP01/ |
| 607-539-00-6 |
propyl((4-(5-oxo-3-propylisoxazolidin-4-ylidenmethin)phenyl)propoxycarbonylmethyleneamino)acetate |
198705-81-6 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-540-00-1 |
1-(mercaptomethyl)cyclopropylacetic acid |
162515-68-6 |
Skin Corr. 1B, Acute Tox. 4 *, Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H314, H312, H302, H317, H411 |
|
|
ATP01/ |
| 607-541-00-7 |
[(1-methyl-1,2-ethanediyl)bis[nitrilobis(methylene)]]tetrakis(phosphonic acid) |
28698-31-9 |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
ATP01/ |
| 607-542-00-2 |
methyl 2-(4-butanesulfonamidophenoxy)tetradecanoate |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 607-543-00-8 |
poly-[((4-((4-(ethyl-ethylene)amino)phenyl)-(4-(ethyl-(2-oxyethylene)amino)phenyl)methinyl)-3-methylcyclohexa-2,5-dienylidene)-N-ethyl-N-(2-hydroxyethyl)ammonium acetate] |
176429-22-4 |
STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H335, H315, H318, H400, H410 |
|
|
ATP01/ |
| 607-544-00-3 |
ethyl 6,8-difluoro-1-(formylmethylamino)-1,4-dihydro-7-(4-methyl)piperazin-1-yl)-4-oxo-quinoline-3-carboxylate |
158585-86-5 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 607-545-00-9 |
1,2-dimethyl-3-(1-methylethenyl)cyclopentyl acetate |
94346-09-5 |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
ATP01/ |
| 607-546-00-4 |
reaction mass of: methyl {[5-acetylamino-4-(2-chloro-4-nitrophenylazo)phenyl]methoxycarbonylmethylamino}acetate; methyl {[5-acetylamino-4-(2-chloro-4-nitrophenylazo)phenyl]ethoxycarbonylmethylamino}acetate |
188070-47-5 |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 607-547-00-X |
18-methylnonadecyl 2,2 -dimethylpropanoate |
125496-22-2 |
Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic |
H315, H317, H413 |
|
|
ATP01/ |
| 607-548-00-5 |
1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethanone methanesulfonate |
154486-26-7 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 2 |
H302, H318, H411 |
|
|
ATP01/ |
| 607-549-00-0 |
methyl (E)-2((3-(1,3-benzodioxol-5-yl)-2-methyl-1-propenyl)amino)benzoate |
125778-19-0 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 607-550-00-6 |
2-amino-4-bromo-5-chlorobenzoic acid |
- |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H410 |
|
|
ATP01/ |
| 607-551-00-1 |
tetrabutylammonium 2-amino-6-iodopurinate |
156126-48-6 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H312, H302, H373**, H315, H318, H317, H411 |
|
|
ATP01/ |
| 607-552-00-7 |
hexadecyl 3-amino-4-isopropoxybenzoate |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-553-00-2 |
7-amino-4-hydroxy-2-naphthalenesulfonic acid, coupled with 5 (or 8) -amino-8 (or 5)-[[4-[[4-[[4-amino-6(or 7)-sulfo-1-naphthyl]azo]phenyl]amino]-3-sulfophenyl]azo]-2-naphthalenesulfonic acid and 4-hydroxy-7-(phenylamino)-2-naphthalenesulfonic acid, sodium salt |
- |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-554-00-8 |
2,4-diamino-5-[4-[(2-sulfoxyl ethyl)sulfonyl]phenylazo]benzenesulfonic acid |
27624-67-5 |
Expl. 1.1, Eye Dam. 1, Aquatic Chronic 3 |
H201, H318, H412 |
|
|
ATP01/ |
| 607-555-00-3 |
1,1,3,3-tetramethylbutylperoxypivalate |
22288-41-1 |
Flam. Liq. 2, Org. Perox. D, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H225, H242, H315, H317, H411 |
|
|
ATP01/ |
| 607-556-00-9 |
2-acetoxymethylene-4-acetylphenylacetate |
24085-06-1 |
Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373**, H318, H317, H400, H410 |
|
|
ATP01/ |
| 607-557-00-4 |
salt of: (1S-cis)-1-amino-2,3-dihydro-1H-inden-2-ol and [R-[R*R*]]-2,3-dihydroxybutanedioic acid |
169939-84-8 |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 607-558-00-X |
2S-isopropyl-5R-methyl-1R-cyclohexyl (2R,5S)-5-(4-amino-2-oxo-2H-pyrimidin-1-yl)-[1.3]-oxathiolane-2-carboxylate |
147027-10-9 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 607-559-00-5 |
coconut oil, reaction products with glycerol esters of 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid |
179986-09-5 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-560-00-0 |
(R,S)-2-butyloctanedioic acid |
50905-10-7 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-561-00-6 |
sodium 4-hydroxy-3-(N'-(2-(2-hydroxyethylenesulfonyl)ethylene)ureido)-5-nitrobenzenesulfonate |
- |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
ATP01/ |
| 607-562-00-1 |
reaction mass of: (2R,3R)-3-(2-ethoxyphenoxy)-2-hydroxy-3-phenylpropylammonium methanesulfonate; (2S,3S)-3-(2-ethoxyphenoxy)-2-hydroxy-3-phenylpropylammonium methanesulfonate |
98769-75-6 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 2 |
H302, H318, H411 |
|
|
ATP01/ |
| 607-563-00-7 |
5,7-dichloro-4-hydroxyquinoline-3-carboxylic acid |
171850-30-9 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 607-564-00-2 |
1,6-hexanediammonium, sodium 5-sulfato-1,3-benzenedicarboxylate |
51178-75-7 |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 607-565-00-8 |
3-ethyl 5-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-3,5-pyridinedicarboxylate |
88150-42-9 |
Acute Tox. 3 *, STOT RE 2 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H373**, H318, H400, H410 |
|
|
ATP01/ |
| 607-566-00-3 |
reaction mass of: dodecylphenyl dodecylhydroxybenzenecarboxylate; bis(dodecylphenyl)dodecyl hydroxybenzenedicarboxylate |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-567-00-9 |
potassium 3-iodo-6-methylbenzenesulfonate |
- |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-568-00-4 |
potassium 2-chloro-3-(benzyloxy)propionate |
138666-92-9 |
Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1 |
H302, H373**, H318, H317 |
|
|
ATP01/ |
| 607-569-00-X |
reaction mass of: sodium 2-amino-4-(2,6-difluoropyrimidin-4-ylamino)benzenesulfonate; sodium 2-amino-4-(4,6-difluoropyrimidin-4-ylamino)benzenesulfonate |
- |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 607-570-00-5 |
sodium (6R-trans)-7-amino-8-oxo-3-[[[1-(sulfomethyl)-1H-tetrazol-5-yl]thio]methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate monohydrate |
71420-85-4 |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 607-571-00-0 |
2-cyclopentene-1-acetic acid, 3-hydroxy-2-pentyl-, methyl ester acetate |
57374-49-9 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 607-572-00-6 |
diethyl thiophosphoryl (Z)-(2-aminothiazol-4-yl)methoxyimino acetate |
162208-27-7 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H373**, H317, H400, H410 |
|
|
ATP01/ |
| 607-573-00-1 |
reaction mass of: disodium 7-(2,4-difluoropyrimidin-6-ylamino)-4-hydroxy-3-(4-methoxy-2-sulfonatophenylazo)naphthalene-2-sulfonate; disodium 7-(4,6-difluoropyrimidin-2-ylamino)-4-hydroxy-3-(4-methoxy-2-sulfonatophenylazo)naphthalene-2-sulfonate |
- |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-574-00-7 |
[1R-(1-α,2β,5α)]-mono[5-methyl-2-(1-methylethyl)cyclohexyl]butanedioate |
77341-67-4 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-575-00-2 |
4-(5-(5-[1-(4-carboxyphenyl)hexahydro-2,4,6-trioxopyrimidin-5-ylidene]penta-1,3-dienyl)-1,2,3,4-tetrahydro-6-hydroxy-2,4-dioxopyrimidin-1-yl)benzoic acid-triethylamine salt |
- |
STOT SE 3, Aquatic Chronic 3 |
H335, H412 |
|
|
ATP01/ |
| 607-576-00-8 |
branched, octyl 3-[3,5-di(tert-butyl)-4-hydroxyphenyl]propanoate |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 607-577-00-3 |
(2R*,3S*)-2-(2,4-difluorophenyl)-3-(5-fluoro-4-pyrimidinyl)-1-(1H-1,2,4-triazol-1-yl)butan-2-ol (1R)-10-camphorsulfonate |
- |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H302, H318, H317, H412 |
|
|
ATP01/ |
| 607-578-00-9 |
ethyl 4-((4-diethylamino-2-methylphenyl)imino)-4,5-dihydro-1-isopropyl-5-oxo-1H-pyrazole-3-carboxylate |
- |
Acute Tox. 4 *, STOT RE 2 *, Aquatic Chronic 4 |
H302, H373**, H413 |
|
|
ATP01/ |
| 607-579-00-4 |
diethyl[(p-ethoxyanilino)methylene]malonate |
103976-28-9 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
ATP01/ |
| 607-580-00-X |
ethyl 7-chloro-1-(2,4-difluorophenyl)-6-fluoro-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylate |
100491-29-0 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 607-581-00-5 |
ethyl 2-ethoxy-4-carboxymethylbenzoate |
99469-99-5 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-582-00-0 |
reaction mass of: tetrasodium 7-(4-(4-fluoro-6-(4-(2-sulfonatoethylsulfonyl)phenylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate; tetrasodium 7-(4-(4-hydroxy-6-(4-(2-sulfonatoethylsulfonyl)phenylamino)-1,3,5-triazin-2-yl |
- |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 607-583-00-6 |
4-amino-3-[[4-[[2-(sulfooxy)ethyl]sulfonyl]phenyl]azo]-1-naphthalene sulfonic acid |
188907-52-0 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
|
ATP01/ |
| 607-584-00-1 |
trisodium 3-[2-acetylamino-4-[4-chloro-6-[4-(2-sulfonatoxyethylsulfonyl)phenylamino]-1,3,5-triazine-2-ylamino]phenylazo]naphthalene-1,5-disulfonate |
215612-56-9 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
|
ATP01/ |
| 607-585-00-7 |
strontium 2-[(2-hydroxy-6-sulfonato-1-naphthyl)azo]naphthalene-1-sulfonate |
- |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 607-586-00-2 |
dodecyl 3-amino-4-chlorobenzoate |
6195-20-6 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 607-587-00-8 |
ethyl cis-4-[4-[[2-(2,4-dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine-1-carboxylate |
67914-69-6 |
Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373**, H400, H410 |
|
|
ATP01/ |
| 607-588-00-3 |
reaction mass of: 2-ethylhexyl 2,3,4,5-tetrabromobenzoate; bis(2-ethylhexyl) 3,4,5,6-tetrabromophthalate |
- |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
ATP01/ |
| 607-589-00-9 |
tetrakis(1,2,2,6,6-pentamethyl-4-piperidyl)-1,2,3,4-butanetetracarboxylate |
91788-83-9 |
STOT RE 1, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H372**, H302, H400, H410 |
|
|
ATP01/ |
| 607-590-00-4 |
hexadecyl 3-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxovaleramido]-4-isopropoxybenzoate |
210706-50-6 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-591-00-X |
reaction mass of: trisodium 5-(4-fluoro-6-morpholin-4-yl-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(4-(2-sulfooxyethanesulfonyl)phenylazo)naphthalene-2,7-disulfonate; disodium 3-(4-ethenesulfonylphenylazo)-5-(4-fluoro-6-morpholin-4-yl-1,3,5-triazin-2-ylamino) |
- |
Eye Dam. |
H318 |
|
|
ATP01/ |
| 607-592-00-5 |
di(C9-11-alkyl) cyclohexane-1,4-dicarboxylate |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-593-00-0 |
4-(2-methylacryloyloxy)phenyl 4-allyloxybenzoate |
159235-16-2 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
ATP01/ |
| 607-594-00-6 |
ethyl (1S,5R,6S)-5-(1-ethylpropoxy)-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate |
204254-96-6 |
STOT RE 2 *, Skin Sens. 1 |
H373**, H317 |
|
|
ATP01/ |
| 607-595-00-1 |
N-amidino-N-methylglycine-2-oxopropionate |
208535-04-0 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-596-00-7 |
ethyl 2-(4-phenoxyphenyl)lactate |
132584-17-9 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
ATP01/ |
| 607-597-00-2 |
tetrasodium 4,4'-bis{4-[4-(2-hydroxyethylamino)-6-(4-sulfonatoanilino)-1,3,5-triazin-2-ylamino]phenylazo}stilbene-2,2'-disulfonate |
- |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-598-00-8 |
trisodium 3-amino-4-[4-[4-(2-(2-ethenylsulfonylethoxy)ethylamino)-6-fluoro-1,3,5-triazine-2-ylamino]-2-sulfophenylazo]-5-hydroxynaphthalene-2,7-disulfonate |
212652-59-0 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-599-00-3 |
1,1-dimethylpropyl 3,5,5-trimethylperoxyhexanoate |
68860-54-8 |
Org. Perox. D, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H242, H317, H400, H410 |
|
|
ATP01/ |
| 607-600-00-7 |
(1S,1'R)-[1-(3',3'-dimethyl-1'-cyclohexyl)ethoxycarbonyl]methyl propanoate |
- |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 607-601-00-2 |
1,4-dihydroxy-2,2,6,6-tetramethyl piperidinium-2-hydroxy-1,2,3-propanetricarboxylate |
220410-74-2 |
Acute Tox. 4 * |
H302 |
|
|
ATP01/ |
| 607-602-00-8 |
ethyl (3-cyanomethyl-3,4-dihydro-4-oxophthalazin-1-yl)acetate |
122665-86-5 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
ATP01/ |
| 607-603-00-3 |
lithium sodium 4,4',4''-(nitrilotris(ethane-2,1-diylimino(6-chloro-1,3,5-triazine-4,2-diyl)imino))tris(5-hydroxy-6-(1-sulfonaphthalene-2-ylazo)-2,7-naphthalene)disulfonate |
193562-37-7 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
ATP01/ |
| 607-604-00-9 |
guanidinium benzoate |
26739-54-8 |
Acute Tox. 4 * |
H302 |
|
|
ATP01/ |
| 607-605-00-4 |
methyl 4-iodo-2-(3-(4-methoxy-6-methyl-1,3,5-triazine-2-yl)ureidosulfonyl)benzoate |
144550-06-1 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 607-606-00-X |
(Z)-2-(2-t-butoxycarbonylamino-4-thiazolyl)pent-2-enoic acid |
86978-24-7 |
Acute Tox. 4 * |
H302 |
|
|
ATP01/ |
| 607-607-00-5 |
reaction mass of: calcium bis(C10-14 branched alkyl salicylate); calcium bis(C18-30-alkyl salicylate); calcium C10-14 branched alkylsalicylato-C18-30-alkyl salicylate; calcium bis (C10-14 branched alkyl phenolate); calcium bis (C18-30-alkyl phenolate) |
- |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
ATP01/ |
| 607-608-00-0 |
pentapotassium 2-(4-{5-[1-(2,5-disulfophenyl)-4,5-dihydro-3-methylcarbamoyl-5-oxopyrazol-4-ylidene]-3-(2-pyrrolidinone-1-yl)-1,3-pentadienyl}-3-methylcarbamoyl-5-oxopyrazol-1-yl)benzene-1,4-disulfonate |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 607-609-00-6 |
ethyl (3R)-4-cyano-3-hydroxybutanoate |
141942-85-0 |
Eye Irrit. 2 |
H319 |
|
|
ATP01/ |
| 607-610-00-1 |
trisodium 4-hydroxy-6-(sulfonatomethylamino)-5-(2-(2-sulfatoethylsulfonyl)phenylazo)naphthalene-2-sulfonate |
- |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 607-611-00-7 |
methyl 3-amino-2,2,3-trimethylbutyrate |
90886-53-6 |
Skin Corr. 1B, Acute Tox. 4 *, Aquatic Chronic 3 |
H314, H302, H412 |
|
|
ATP01/ |
| 607-612-00-2 |
reaction mass of: 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octanesulfonic acid; ammonium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octanesulfonate |
182176-52-9 |
Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1 |
H302, H373**, H318 |
|
|
ATP01/ |
| 607-613-00-8 |
reaction mass of: succinic acid, monopersuccinic acid, dipersuccinic acid, monomethyl ester of succinic acid, monomethyl ester of persuccinic acid, dimethyl succinate glutaric acid, monoperglutaric acid, diperglutaric acid, monomethyl ester of glutaric acid, monomethyl ester of perglutaric acid, dimethyl glutarate adipic acid, monoperadipic acid, diperadipic acid, monomethyl ester of adipic acid, monomethyl ester of peradipic acid, dimethyl adipate, hydrogen peroxide, methanol, water |
- |
Acute Tox. 4*, Acute Tox. 4*, Acute Tox. 4*, Skin Corr. 1B, STOT SE 2 |
H332, H312, H302, H314, H371 (eyes) |
|
|
ATP01/ATP05 |
| 607-614-00-3 |
2-(10-oxo-10H-9-oxa-10-phosphaphenanthren-10-ylmethyl)succinic acid |
63562-33-4 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
ATP01/ |
| 607-615-00-9 |
reaction product of thioglycerol and mercaptoacetic acid consisting mainly of 3-mercapto-1,2-bismercaptoacetoxypropane and oligomers of this substance |
- |
Acute Tox. 3 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1 |
H331, H302, H319, H317 |
|
|
ATP01/ |
| 607-616-00-4 |
2,4-dichloro-5-fluorobenzoylchloride |
86393-34-2 |
STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H335, H315, H318, H317, H412 |
|
|
ATP01/ |
| 607-617-00-X |
bis(2-ethylhexyl)-4,5-epoxycyclohexane-1,2-dicarboxylate |
10138-36-0 |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 607-618-00-5 |
menadione sodium bisulfite; 2-naphthalenesulfonic acid,1,2,3,4-tetrahydro-2-methyl-1,4-dioxo-, sodium salt |
130-37-0 |
Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H315, H400, H410 |
|
|
ATP01/ |
| 607-619-00-0 |
menadione nicotinamide bisulfite; 1,2,3,4-tetrahydro-2-methyl-1,4-dioxonaphthalene-2-sulfonic acid, compound with nicotin-3-amide (1:1) |
73581-79-0 |
Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H315, H400, H410 |
|
|
ATP01/ |
| 607-620-00-6 |
trisodium nitrilotriacetate |
5064-31-3 |
Carc. 2, Acute Tox. 4 *, Eye Irrit. 2 |
H351, H302, H319 |
Carc. 2; H351: C ≥ 5 % |
|
ATP01/ |
| 607-621-00-1 |
milbemectin (ISO); [reaction mass of milbemycin A3 (CAS No 51596-10-2) and milbemycin A4 (CAS No 51596-11-3) (30:70)] |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H302, H400, H410 |
M=100: |
|
ATP01/ |
| 607-622-00-7 |
2-ethylhexyl-2-ethylhexanoate |
7425-14-1 |
Repr. 2 |
H361d*** |
|
|
ATP01/ |
| 607-623-00-2 |
diisobutyl phthalate |
84-69-5 |
Repr. 1B |
H360Df |
|
|
ATP01/ATP09 |
| 607-624-00-8 |
perfluorooctane sulfonic acid; heptadecafluorooctane-1-sulfonic acid; [1] potassium perfluorooctanesulfonate; potassium heptadecafluorooctane-1-sulfonate; [2] diethanolamine perfluorooctane sulfonate; [3] ammonium perfluorooctane sulfonate; ammonium |
1763-23-1 [1], 2795-39-3 [2], 70225-14-8 [3], 29081-56-9 [4], 29457-72-5 [5] |
Carc. 2, Repr. 1B, STOT RE 1, Acute Tox. 4 *, Acute Tox. 4 *, Lact., Aquatic Chronic 2 |
H351, H360D***, H372**, H332, H302, H362, H411 |
|
|
ATP01/ |
| 607-625-00-3 |
clodinafop-propargyl (ISO) |
105512-06-9 |
Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373**, H317, H400, H410 |
Skin Sens. 1; H317: C ≥ 0,001 %, M=1: |
|
ATP01/ |
| 607-626-00-9 |
ethyl 1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1H-1,2,4-triazole-3-carboxylate |
103112-35-2 |
Carc. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H400, H410 |
|
|
ATP01/ |
| 607-627-00-4 |
[(4S,5S)-4-benzyl-2-oxo-5-oxazolidinyl]methyl 4-nitrobenzenesulfonate |
162221-28-5 |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 607-628-00-X |
4-oxo-4-(p-tolyl)butyric acid adduct with 4-ethylmorpholine |
171054-89-0 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-629-00-5 |
[[2-methyl-1-(1-oxopropoxy)propoxy](4-phenylbutyl)phosphinyl] acetic acid |
123599-82-6 |
Eye Irrit. 2 |
H319 |
|
|
ATP01/ |
| 607-630-00-0 |
acrylic acid, 3-(trimethoxysilyl)propyl ester |
4369-14-6 |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 3 |
H332, H314, H317, H412 |
|
|
ATP01/ |
| 607-631-00-6 |
reaction mass of: 2-(2-((oxo(phenyl)acetyl)oxy)ethoxy)ethyl oxo(phenyl)acetate; (2-(2-hydroxyethoxy)ethyl) oxo(phenyl)acetate |
- |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 607-632-00-1 |
N-[3-(2,4-di-(1,1-dimethyl-propyl)phenoxy)-propyl]-1-hydroxy-5-(2-methylpropyl-oxycarbonylamino)-naphthamide |
111244-14-5 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-633-00-7 |
trisodium 5-{[4-chloro-6-(1-naphthylamino)-1,3,5-triazin-2-yl]amino}-4-hydroxy-3-[(E)-(4-methoxy-2-sulfonatophenyl)diazenyl]-2,7-naphthalenedisulfonate |
341026-59-3 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
ATP01/ |
| 607-634-00-2 |
(S)-(-)-2-acetoxypropionylchloride; (1S)-2-chloro-1-methyl-2-oxoethyl acetate |
36394-75-9 |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1 |
H302, H314, H317 |
|
|
ATP01/ |
| 607-635-00-8 |
trisodium N-(3-propionato)-l-aspartate |
172737-80-3 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-636-00-3 |
1-bromo-2-methylpropyl propionate |
158894-67-8 |
Flam. Liq. 3, Carc. 2, Skin Corr. 1B, Skin Sens. 1 |
H226, H351, H314, H317 |
|
|
ATP01/ |
| 607-637-00-9 |
disodium 8-amino-5-{4-[2-(sulfonatoethoxy)sulfonyl]phenylazo}naphthalene-2-sulfonate |
250688-43-8 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-638-00-4 |
2-hydroxybenzoic acid 2-butyloctyl ester |
190085-41-7 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-639-00-X |
2-(2-oxo-5-(1,1,3,3-tetramethylbutyl)-2,3-dihydro-1-benzofuran-3-yl)-4-(1,1,3,3-tetramethylbutyl)phenyl acetate |
216698-07-6 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-641-00-0 |
2-(formylamino)-3-thiophenecarboxylic acid; 2-formamido-3-thiophenecarboxylic acid |
43028-69-9 |
Acute Tox. 4 *, Skin Sens. 1 |
H302, H317 |
|
|
ATP01/ |
| 607-642-00-6 |
3,6,9-trithiaundecamethylene-1,11-dimethacrylate |
141631-22-3 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 607-643-00-1 |
dimethyl (2S)-2-hydroxysuccinate |
617-55-0 |
Flam. Liq. 3, Eye Dam. 1, Skin Sens. 1 |
H226, H318, H317 |
|
|
ATP01/ |
| 607-644-00-7 |
methyl 2,2-dimethyl-6-methylenecyclohexanecarboxylate |
81752-87-6 |
Skin Irrit. 2 |
H315 |
|
|
ATP01/ |
| 607-645-00-2 |
tetrasodium 2-(4-fluoro-6-(methyl-(2-(sulfatoethylsulfonyl)ethyl)amino)-1,3,5-triazin-2-ylamino)-5-hydroxy-6-(4-methyl-2-sulfonatophenylazo)naphthalene-1,7-disulfonate |
243858-01-7 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-646-00-8 |
d-erythro-hexanoic acid 2,4-dideoxy-3,5-O-(1-methylethylidene)-1,1-dimethylethylester; tert-butyl 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
124655-09-0 |
Acute Tox. 4 * |
H302 |
|
|
ATP01/ |
| 607-647-00-3 |
5-acetoxy-2-(R,S)butyryloxymethyl-1,3-oxathiolane |
143446-73-5 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1 |
H302, H317, H400 |
|
|
ATP01/ |
| 607-649-00-4 |
[3-(chlorocarbonyl)-2-methylphenyl]acetate |
167678-46-8 |
Skin Corr. 1A, Skin Sens. 1 |
H314, H317 |
|
|
ATP01/ |
| 607-650-00-X |
2-methyl-1,5-pentanediamine-1,3-benzenedicarboxylate |
145153-52-2 |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 607-651-00-5 |
sodium 2-(nonanoyloxy)benzenesulfonate |
91125-43-8 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
ATP01/ |
| 607-652-00-0 |
ethyl N2-dodecanoyl-l-argininate hydrochloride |
60372-77-2 |
Eye Dam. 1, Aquatic Acute 1 |
H318, H400 |
|
|
ATP01/ |
| 607-653-00-6 |
tetrakis(bis(2-hydroxyethyl)methylammonium) 3-(4-(7-acetylamino-1-hydroxy-3-sulfonatonaphthalen-2-ylazo)-5-methoxy-2-sulfonatophenylazo)-7-(4-amino-3-sulfonatophenylamino)-4-hydroxynaphthalene-2-sulfonate |
225786-91-4 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 607-654-00-1 |
(S)-3-hydroxy-γ-butyrolactone |
7331-52-4 |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 607-655-00-7 |
ethyl 6,8-dichlorooctanoate |
1070-64-0 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 607-656-00-2 |
sodium salt of 4-amino-3,6-bis[[5-[[4-chloro-6-[(2-methyl-4-sulfophenyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]azo]-5-hydroxy-2,7-naphthalenedisulfonic acid |
141250-43-3 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
ATP01/ |
| 607-657-00-8 |
pentasodium 7-(4-(4-(3-(2-sulfatoethanesulfonyl)phenylamino)-6-(4-(2-sulfatoethanesulfonyl)phenylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate |
172399-10-9 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-658-00-3 |
3,10-diamino-6,13-dichloro-2-((6-(((4-(1,1-dimethylethyl)phenyl)sulfonyl)amino)-2-naphthalenyl)sulfonyl)-4,11-triphenodioxazinedisulfonic acid, lithium potassium sodium salt |
371921-63-0 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
ATP01/ |
| 607-659-00-9 |
pentasodium N-[5-[[4-[[3-[(aminocarbonyl)amino]-4-[(3,6,8-trisulfonatonaphthalen-2-yl)azo]phenyl]amino]-6-chloro-1,3,5-triazin-2-yl]amino]-2-sulfonato-4-[[4-[[-2-(oxysulfonato)ethyl] sulfonyl]phenyl]azo]phenyl]-3-aminopropanoic acid |
321912-47-4 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-660-00-4 |
2-{4-[4-[4-fluoro-6-(2-(2-vinylsulfonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino]phenylazo]phenylazo}naphthalene-4,6,8-trisulfonate, trisodium salt |
321679-52-1 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 607-661-00-X |
1,1-dimethylethyl 4'-(bromomethyl)biphenyl-2-carboxylate |
114772-40-6 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 607-662-00-5 |
methyl 2-(acetylamino)-3-chloropropionate |
87333-22-0 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
ATP01/ |
| 607-663-00-0 |
bis(2-ethylhexyl) naphthalene-2,6-dicarboxylate |
127474-91-3 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-664-00-6 |
methyl 2-chlorosulfonyl-4-(methanesulfonylaminomethyl) benzoate |
393509-79-0 |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
ATP01/ |
| 607-665-00-1 |
trans-methyl-2-ethyl-but-2-enoate |
101226-85-1 |
Flam. Liq. 3 |
H226 |
|
|
ATP01/ |
| 607-666-00-7 |
(2S)-5-(benzyloxy)-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-5-oxopentanoic acid |
88784-33-2 |
Eye Irrit. 2 |
H319 |
|
|
ATP01/ |
| 607-667-00-2 |
chloro-1-ethylcyclohexyl carbonate |
99464-83-2 |
Muta. 2, Skin Sens. 1 |
H341, H317 |
|
|
ATP01/ |
| 607-668-00-8 |
trans-2-isopropyl-5-carboxy-1,3-dioxane |
42031-28-7 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
ATP01/ |
| 607-669-00-3 |
methyl (9-acetoxy-3,8,10-triethyl-7,8,10-trimethyl-1,5-dioxa-9-aza-spiro[5.5]undec-3-yl)octadecanoate |
376588-17-9 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 607-670-00-9 |
dibutyl-3-(4-(5-ammonio-2-butyl)benzofuran-3-yl)carbonyl)phenoxy)propyl ammonium oxalate; (5-amino-2-butylbenzofuran-3-yl) [4-(3-dibutylaminopropoxy)phenyl]methanone, dioxalate |
500791-70-8 |
STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H373**, H318, H317, H400, H410 |
M=10: |
|
ATP01/ |
| 607-671-00-4 |
diethyl 1,4-cyclohexanedicarboxylate |
72903-27-6 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 607-672-00-X |
reaction mass of: 2-hydroxy-3-(methacryloyloxy)propyl (2-benzoyl)benzoate; 1-hydroxymethyl-2-(methacryloyloxy)ethyl (2-benzoyl)benzoate; x-hydroxy-y-(methacryloyloxy)propyl(or -ethyl) (2-benzoyl)benzoate |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 607-673-00-5 |
1-ethyl-5,6,7,8-tetrahydroquinolinium tosylate |
- |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
ATP01/ |
| 607-675-00-6 |
reaction mass of: cis-9-octadecenedioic acid; cis-9-cis-12-octadecadienedioic acid; hexadecanedioic acid; octadecanedioic acid |
- |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
ATP01/ |
| 607-676-00-1 |
reaction mass of: 2-methylnonanedioic acid; 2,4-dimethyl-4-methoxycarbonylundecanedioic acid; 2,4,6-trimethyl-4,6-dimethoxycarbonyltridecanedioic acid; 8,9-dimethyl-8,9-dimethoxycarbonylhexadecanedioic acid |
- |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
ATP01/ |
| 607-677-00-7 |
2,5-dioxopyrrolidin-1-yl N-{[methyl[[2-(1-methylethyl)-4-thiazolyl]methyl]amino]carbonyl}-l-valinate |
- |
STOT RE 2 *, Eye Dam. 1, Skin Sens. 1 |
H373**, H318, H317 |
|
|
ATP01/ |
| 607-678-00-2 |
reaction mass of: ethyl (2R,3R)-3-isopropylbicyclo[2.2.1]hept-5-ene-2-carboxylate; ethyl (2S,3S)-3-isopropylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 607-679-00-8 |
reaction mass of: 3-{5-[3-(4-{1,6-dihydro-2-hydroxy-4-methyl-1-[3-(methylammonio)propyl]-6-oxo-3-pyridylazo}benzamido)phenylazo]-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-1-pyridyl}propyl(methyl)ammonium di(acetate); 3-{5-[4-(3-{1,6-dihydro-2-hydroxy-4-methyl |
- |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
ATP01/ |
| 607-680-00-3 |
tert-butyl(6-{2-[4-(4-fluorophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]pyrimidin-5-yl]vinyl}(4S,6S)-2,2-dimethyl[1,3]dioxan-4-yl)acetate |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-681-00-9 |
reaction mass of: 9-nonyl-10-octyl-19-carbonyloxyhexadecylnonadecanoic acid; 9-nonyl-10-octyl-19-carbonyloxyoctadecylnonadecanoic acid; dihexadecyl 9-nonyl-10-octylnonadecandioate; 1-octadecyl,19-hexadecyl 9-nonyl-10-octylnonadecandioate; dioctadecyl |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-682-00-4 |
complex reaction mass of Chinese gum rosin post reacted with acrylic acid |
144413-22-9 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-683-00-X |
reaction mass of: methyl 3-((1E)-2-methylprop-1-enyl)-2,2-dimethylcyclopropanecarboxylate; methyl 3-((1Z)-2-methylprop-1-enyl)-2,2-dimethylcyclopropanecarboxylate (20:80) |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 607-684-00-5 |
alkenes, C12-14, hydroformylation products, distn. residues, C-(hydrogen sulfobutanedioates), disodium salts |
243662-67-1 |
Skin Irrit. 2, Skin Sens. 1 |
H315, H317 |
|
|
ATP01/ |
| 607-685-00-0 |
ammonium 2-cocoyloxyethanesulfonate |
- |
Skin Irrit. 2, Eye Dam. 1 |
H315, H318 |
|
|
ATP01/ |
| 607-686-00-6 |
6,6'-bis(diazo-5,5',6,6'-tetrahydro-5,5'-dioxo)[methylene-bis(5-(6-diazo-5,6-dihydro-5-oxo-1-naphthylsulphonyloxy)-6-methyl-2-phenylene]di(naphthalene-1-sulfonate) |
- |
Self-react. C ****, Carc. 2 |
H242, H351 |
|
|
ATP01/ |
| 607-687-00-1 |
reaction mass of: 2-{3,6-bis-[(2-ethylphenyl)-methylamino]-xanthylium-9-yl}-benzenesulfonate (2-10%); 2-{3,6-bis-[(2,3-dimethylphenyl)-methylamino]-xanthylium-9-yl}-benzenesulfonate (2-10%); 2-{3,6-bis-[(2,4-dimethylphenyl)-methylamino]-xanthylium-9-yl} |
- |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
ATP01/ |
| 607-688-00-7 |
(R)-1-cyclohexa-1,4-dienyl-1-methoxycarbonyl-methylammoniumchloride |
- |
Acute Tox. 4 * |
H302 |
|
|
ATP01/ |
| 607-689-00-2 |
reaction mass of: methyl 1,4-dimethylcyclohexanecarboxylate ("para-isomer" including cis- and trans- isomers); methyl 1,3-dimethylcyclohexanecarboxylate ("meta-isomer" including cis- and trans-isomers) |
- |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 607-690-00-8 |
dimethyl[2S,2S']-6,6,6'6'-tetramethoxy-2,2'-[N,N'-bis(trifluoracetyl)-S,S'-bi(L-homocysteinyl) diimino]dihexanoate |
255387-46-3 |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 607-691-00-3 |
magnesium salts, fatty acids, C16-18 and C18 unsaturated, branched and linear |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-692-00-9 |
zinc salts, fatty acids, C16-18 and C18 unsaturated, branched and linear |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 607-694-00-X |
ethyl 5,5-diphenyl-2-isoxazoline-3-carboxylate |
163520-33-0 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
ATP01/ |
| 607-696-00-0 |
pentyl formate |
638-49-3 |
Flam. Liq. 3, Eye Irrit. 2, STOT SE 3 |
H226, H319, H335 |
|
C |
CLP00/ |
| 607-697-00-6 |
tert-butyl propionate |
20487-40-5 |
Flam. Liq. 2 |
H225 |
|
C |
CLP00/ |
| 607-698-00-1 |
4-tert-butylbenzoic acid |
98-73-7 |
Repr. 1B, STOT RE 1, Acute Tox. 4 |
H360F, H372, H302 |
|
|
ATP03 |
| 607-699-00-7 |
bifenthrin (ISO); (2-methylbiphenyl-3-yl)methyl rel-(1R,3R)-3-[(1Z)-2-chloro- 3,3,3-trifluoroprop-1-en-1-yl]- 2,2-dimethylcyclopropanecarboxylate |
82657-04-3 |
Carc. 2, Acute Tox. 3, Acute Tox. 2, STOT RE 1, Skin Sens. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H331, H300, H372 (nervous system), H317, H400, H410 |
M=10000, M=100000 |
|
ATP05 |
| 607-700-00-0 |
indoxacarb (ISO); methyl (4aS)-7-chloro-2-{(methoxycarbonyl)[4-(trifluoromethoxy)phenyl]carbamoyl}-2,5- dihydroindeno[1,2- e][1,3,4]oxadiazine-4a(3H)-carboxylate [1]; reaction mass of (S)-Indoxacarb and (R)- Indoxacarb 75:25; methyl 7-chloro-2-{(methoxyca |
173584-44-6 [1]; 144171-61-9 [2] |
Acute Tox. 3, Acute Tox. 4, STOT RE 1, Skin Sens. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H332, H372 (blood, nervous system, heart), H317, H400, H410 |
M=1, M=1 |
|
ATP05 |
| 607-702-00-1 |
dihexyl phthalate |
84-75-3 |
Repr. 1B |
H360FD |
|
|
ATP05 |
| 607-703-00-7 |
ammoniumpentadeca- fluorooctanoate |
3825-26-1 |
Carc. 2, Repr. 1B, Lact., Acute Tox. 4, Acute Tox. 4, STOT RE 1, Eye Dam.1 |
H351, H360D, H362, H332, H302, H372 (liver), H318 |
|
|
ATP05 |
| 607-704-00-2 |
perfluorooctanoic acid |
335-67-1 |
Carc. 2, Repr. 1B, Lact., Acute Tox. 4, Acute Tox. 4, STOT RE 1, Eye Dam. 1 |
H351, H360D, H362, H332, H302, H372 (liver), H318 |
|
|
ATP05 |
| 607-705-00-8 |
benzoic acid |
65-85-0 |
STOT RE 1, Skin Irrit. 2, Eye Dam. 1 |
H372 (Lunge) (Einatmen), H315, H318 |
|
|
ATP06 |
| 607-706-00-3 |
methyl 2,5-dichlorobenzoate |
2905-69-3 |
Acute Tox. 4, STOT SE 3, Aquatic Chronic 2 |
H302, H336, H411 |
|
|
ATP06 |
| 607-707-00-9 |
fenoxaprop-P-ethyl (ISO); ethyl (2R)-2-{4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy}propanoate |
71283-80-2 |
STOT RE 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H373 (kidneys), H317, H400, H410 |
M=1, M=1 |
|
ATP07 |
| 607-708-00-4 |
octanoic acid |
124-07-2 |
Skin Corr. 1C, Aquatic Chronic 3 |
H314, H412 |
|
|
ATP07 |
| 607-709-00-X |
decanoic acid |
334-48-5 |
Skin Irrit. 2, Eye Irrit. 2, Aquatic Chronic 3 |
H315, H319, H412 |
|
|
ATP07 |
| 607-710-00-5 |
1,2-benzenedicarboxylic acid, dihexylester, branched and linear |
68515-50-4 |
Repr. 1B |
H360FD |
|
|
ATP07 |
| 607-711-00-0 |
spirotetramat (ISO); (5s,8s)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4,5]dec-3-en-4-yl ethyl carbonate |
203313-25-1 |
Repr. 2, STOT SE 3, Eye Irrit. 2,Skin Sens. 1A, Aquatic Acute 1, Aquatic Chronic 1 |
H361fd, H335, H319, H317, H400, H410 |
M=1, M=1 |
|
ATP07 |
| 607-712-00-6 |
dodemorph acetate; 4-cyclododecyl-2,6-dimethylmorpholin-4-ium acetate |
31717-87-0 |
Repr. 2, STOT RE 2, Skin Corr. 1C, Skin Sens. 1A, Aquatic Chronic 1 |
H361d, H373 (liver), H314, H317, H410 |
M=1 |
|
ATP07 |
| 607-713-00-1 |
fenpyroximate (ISO); tert-butyl 4-[({(E)-[(1,3-dimethyl-5-phenoxy-1H-pyrazol-4-yl)methylene]amino}oxy)methyl]benzoate |
134098-61-6 |
Acute Tox. 3, Acute Tox. 2, Skin Sens. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H330, H317, H400, H410 |
M=100, M=1000 |
|
ATP07 |
| 607-714-00-7 |
triflusulfuron-methyl; methyl2-({[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]carbamoyl}sulfamoyl)-3-methylbenzoate |
126535-15-7 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H400, H410 |
M=100, M=10 |
|
ATP07 |
| 607-715-00-2 |
bifenazate (ISO); isopropyl 2-(4-methoxybiphenyl-3-yl)hydrazinecarboxylate |
149877-41-8 |
STOT RE 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H373, H317, H400, H410 |
M=1, M=1 |
|
ATP07 |
| 607-716-00-8 |
bromadiolone (ISO); 3-[3-(4′-bromobiphenyl-4-yl)-3-hydroxy-1-phenylpropyl]-4-hydroxy-2H-chromen-2-one |
28772-56-7 |
Repr. 1B, Acute Tox. 1, Acute Tox. 1, Acute Tox. 1, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360D, H330, H310, H300, H372 (blood), H400, H410 |
Repr. 1B; H360D: C ≥ 0,003 % , STOT RE 1; H372 (blood): C ≥ 0,005 % , STOT RE 2; H373 (blood): 0,0005 % ≤ C < 0,005 %, M = 1, M = 1 |
|
ATP09 |
| 607-717-00-3 |
difethialone (ISO);
3-[3-(4′-bromobiphenyl-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-hydroxy-2H-1-benzothiopyran-2-one |
104653-34-1 |
Repr. 1B, Acute Tox. 1, Acute Tox. 1, Acute Tox. 1, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360D, H330, H310, H300, H372 (blood), H400, H410 |
Repr. 1B; H360D: C ≥ 0,003 % , STOT RE 1; H372 (blood): C ≥ 0,02 % , STOT RE 2; H373 (blood): 0,002 % ≤ C < 0,02 %, M = 100, M = 100 |
|
ATP09 |
| 607-718-00-9 |
perfluorononan-1-oic acid [1]
perfluorononan-1-oic acid sodium salts [2]
perfluorononan-1-oic acid ammonium salts [3]
|
375-95-1 [1]
21049-39-8 [2]
4149-60-4 [3]
|
Carc. 2, Repr. 1B, Lakt., Acute Tox. 4, Acute Tox. 4, STOT RE 1, Eye Dam. 1 |
H351, H360Df, H362, H332, H302, H372 (liver, thymus, spleen), H318 |
|
|
ATP09 |
| 607-719-00-4 |
dicyclohexyl phthalate |
84-61-7 |
Repr. 1B, Skin Sens. 1 |
H360D, H317 |
|
|
ATP09 |
| 607-720-00-X |
nonadecafluorodecanoic acid [1] ammonium nonadecafluorodecanoate [2] sodium nonadecafluorodecanoate [3] |
335-76-2 [1] 3108-42-7 [2] 3830-45-3 [3] |
Carc. 2, Repr. 1B Lact. |
H351, H360Df, H362 |
|
|
ATP10 |
| 607-721-00-5 |
N,N′-methylenedimorpholine; N,N′-methylenebismorpholine; [formaldehyde released from N,N′-methylenebismorpholine]; [MBM] |
5625-90-1 |
Carc. 1B, Muta. 2, Acute Tox. 4, Acute Tox. 4, Acute Tox. 4, STOT RE 2, Skin Corr. 1B, Eye Dam. 1, Skin Sens. 1 |
H350, H341, H332, H312, H302, H373 (gastrointestinal tract, respiratory tract), H314, H318, H317 |
|
8, 9 |
ATP10 |
| 607-722-00-0 |
2,3,5,6-tetrafluoro-4-(methoxymethyl)benzyl (Z)-(1R,3R)-3-(2-cyanoprop-1-enyl)-2,2-dimethylcyclopropanecarboxylate; epsilon-momfluorothrin |
1065124-65-3 |
Acute Tox. 4, STOT SE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H371 (nervous system), H400, H410 |
M=100, M=100 |
|
ATP10 |
| 607-723-00-6 |
tefluthrin (ISO); 2,3,5,6-tetrafluoro-4-methylbenzyl (1RS,3RS)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropanecarboxylate |
79538-32-2 |
Acute Tox. 1, Acute Tox. 2, Acute Tox. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H310, H300, H400, H410 |
M=10000, M=10000 |
|
ATP10 |
| 607-724-00-1 |
2,3,5,6-tetrafluoro-4-(methoxymethyl)benzyl (1R,3R)-2,2-dimethyl-3-[(1Z)-prop-1-en-1-yl] cyclopropanecarboxylate; epsilon-metofluthrin |
240494-71-7 |
Acute Tox. 3, Acute Tox. 4, STOT SE 1, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H332, H370 (nervous system), H373, H400, H410 |
M=100, M=100 |
|
ATP13 |
| 607-725-00-7 |
isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate; S-methoprene |
65733-16-6 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1, M=1 |
|
ATP13 |
| 607-726-00-2 |
pinoxaden (ISO); 8-(2,6-diethyl-4-methylphenyl)-7-oxo-1,2,4,5-tetrahydro-7H-pyrazolo[1,2-d][1,4,5]oxadiazepin-9-yl 2,2-dimethylpropanoate |
243973-20-8 |
Repr. 2, Acute Tox. 4, Acute Tox. 4, STOT SE 3, Eye Irrit. 2, Skin Sens. 1A, Aquatic Acute 1, Aquatic Chronic 3 |
H361d, H332, H302, H335, H319, H317, H400, H412 |
Inhalation: ATE = 4.63 mg/L (dusts/mists), Oral: ATE = 500 mg/kg bw, M=1 |
|
ATP13 |
| 607-727-00-8 |
tetramethrin (ISO); (1,3-dioxo-1,3,4,5,6,7-hexahydro-2H-isoindol-2-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate |
7696-12-0 |
Carc. 2, Acute Tox. 4, STOT SE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H302, H371 (nervous system) (Inhalation), H400, H410 |
M=100, M=100 |
|
ATP13 |
| 607-728-00-3 |
(1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl (1R-trans)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
1166-46-7 |
Carc. 2, Acute Tox. 4, STOT SE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H302, H371 (nervous system) (Inhalation), H400, H410 |
M=100, M=100 |
|
ATP13 |
| 607-729-00-9 |
mesosulfuron-methyl (ISO); methyl 2-[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-α-(methanesulfonamido)-p-toluate; |
208465-21-8 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=100, M=100 |
|
ATP13 |
| 607-730-00-4 |
spirodiclofen (ISO); 3-(2,4-dichlorophenyl)-2-oxo-1-oxaspiro[4.5]dec-3-en-4-yl 2,2-dimethylbutyrate |
148477-71-8 |
Carc. 1B, Repr. 2, STOT RE 2, Skin Sens. 1B, Aquatic Chronic 1 |
H350, H361f, H373, H317, H410 |
M=10 |
|
ATP13 |
| 607-731-00-X |
sodium methyl [(4-aminophenyl)sulphonyl]carbamate; sodium methyl (EZ)-sulfanilylcarbonimidate; asulam-sodium |
2302-17-2 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
M=1, M=1 |
|
ATP13 |
| 607-732-00-5 |
salicylic acid |
69-72-7 |
Repr. 2, Acute Tox. 4, Eye Dam. 1 |
H361d, H302, H318 |
|
|
ATP13 |
| 607-733-00-0 |
cyflumetofen (ISO); 2-methoxyethyl (RS)-2-(4- tert-butylphenyl)-2-cyano-3-oxo-3-(α,α,α-trifluoro-o-tolyl)propionate |
400882-07-7 |
Carc. 2, Skin Sens. 1A |
H351, H317 |
|
|
ATP14 |
| 607-734-00-6 |
pentapotassium 2,2',2'',2''',2''''-(ethane-1,2-diylnitrilo)pentaacetate |
7216-95-7 |
Repr. 1B, Acute Tox. 4, STOT RE 2, Eye Irrit. 2 |
H360D, H332, H373 (Inhalation), H319 |
Repr. 1B; H360D: C >= 3 %; Inhalation: ATE = 1.5 mg/L (dusts/mists) |
|
ATP14/ATP18 |
| 607-735-00-1 |
N-carboxymethyliminobis(ethylenenitrilo)tetra(acetic acid) |
67-43-6 |
Repr. 1B, Acute Tox. 4, STOT RE 2, Eye Irrit. 2 |
H360D, H332, H373 (Inhalation), H319 |
Repr. 1B; H360D: C >= 3 %; Inhalation: ATE = 1.5 mg/L (dusts/mists) |
|
ATP14/ATP18 |
| 607-736-00-7 |
pentasodium (carboxylatomethyl)iminobis(ethylenenitrilo)tetraacetate |
140-01-2 |
Repr. 1B, Acute Tox. 4, STOT RE 2 |
H360D, H332, H373 (Inhalation) |
Repr. 1B; H360D: C >= 3 %; Inhalation: ATE = 1.5 mg/L (dusts/mists) |
|
ATP14/ATP18 |
| 607-737-00-2 |
diisohexyl phthalate |
71850-09-4 |
Repr. 1B |
H360FD |
|
|
ATP14 |
| 607-738-00-8 |
MCPA-thioethyl (ISO); S-ethyl (4-chloro-2- methylphenoxy)ethanethioate; S-ethyl 4- chloro-o-tolyloxythioacetate |
25319-90-8 |
Acute Tox. 4, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373 (liver), H400, H410 |
Oral: ATE = 450 mg/kg, M=10, M=10 |
|
ATP15 |
| 607-740-00-9 |
diisooctyl phthalate |
27554-26-3 |
Repr. 1B |
H360FD |
|
|
ATP15 |
| 607-741-00-4 |
4-{[(6-chloropyridin-3-yl)methyl](2,2-difluoroethyl)amino}furan-2(5H)-one; flupyradifurone |
951659-40-8 |
Acute Tox. 4, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373 (muscle), H400, H410 |
Oral: ATE = 500 mg/kg, M=10, M=10 |
|
ATP15 |
| 607-742-00-X |
thiencarbazone-methyl (ISO); methyl 4-[(4,5-dihydro-3-methoxy-4- methyl-5-oxo-1H-1,2,4-triazol-1-yl)carbonylsulfamoyl]-5- methylthiophene-3- carboxylate |
317815-83-1 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1000, M=1000 |
|
ATP15 |
| 607-743-00-5 |
L-(+)-lactic acid; (2S)-2-hydroxypropanoic acid |
79-33-4 |
Skin Corr. 1C, Eye Dam. 1, |
H314, H318 |
|
|
ATP15 |
| 607-744-00-0 |
2-methoxyethyl acrylate |
3121-61-7 |
Flam. Liq. 3, Muta. 2, Repr. 1B, Acute Tox. 3, Acute Tox. 4, Skin Corr. 1C, Eye Dam. 1, Skin Sens. 1 |
H226, H341, H360FD, H331, H302, H314, H318, H317 |
Inhalation: ATE = 2.7 mg/L (Vapours), Oral: ATE = 404 mg/kg |
|
ATP15 |
| 607-745-00-6 |
glyoxylic acid ...% |
298-12-4 |
Eye Dam. 1, Skin Sens. 1B |
H318, H317 |
|
B |
ATP15 |
| 607-746-00-1 |
sodium N-(hydroxymethyl)glycinate; [formaldehyde released from sodium N-(hydroxymethyl)glycinate] |
70161-44-3 |
Carc. 1B, Muta. 2, Acute Tox. 4, Acute Tox. 4, STOT SE 3, Skin Irrit. 2, Eye Irrit. 2, Skin Sens. 1 |
H350, H341, H332, H302, H335, H315, H319, H317 |
Inhalation: ATE = 3 mg/L (dusts/mists), Oral: ATE = 1100 mg/kg |
8 9 |
ATP15 |
| 607-747-00-7 |
2,2-dibromo-2-cyanoacetamide; [DBNPA] |
10222-01-2 |
Acute Tox. 2,
Acute Tox. 3,
STOT RE 1,
Skin Irrit. 2,
Eye Dam. 1,
Skin Sens. 1,
Aquatic Acute 1,
Aquatic Chronic 1 |
H330,
H301,
H372 (respiratory tract, inhalation),
H315,
H318,
H317,
H400,
H410 |
Inhalation: ATE = 0.24 mg/L (dusts/mists),
Oral: ATE = 118 mg/kg bw,
M=1,
M=1 |
|
ATP17 |
| 607-748-00-2 |
[S-(Z,E)]-5-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid;
S-abscisic acid |
21293-29-8 |
Aquatic Acute 1,
Aquatic Chronic 1 |
H400, H410 |
M=1, M=1 |
|
ATP17 |
| 607-749-00-8 |
methyl salicylate |
119-36-8 |
Repr. 2,
Acute Tox. 4,
Skin Sens. 1B,
Aquatic Chronic 3 |
H361d,
H302,
H317,
H412 |
Oral: ATE = 890 mg/kg bw |
|
ATP17 |
| 607-750-00-3 |
citric acid |
77-92-9 |
STOT SE 3,
Eye Irrit. 2 |
H335,
H319 |
|
|
ATP17 |
| 607-751-00-9 |
ethametsulfuron-methyl (ISO);
methyl 2-({[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]carbamoyl}sulfamoyl)benzoate |
97780-06-8 |
Eye Irrit. 2,
Aquatic Acute 1,
Aquatic Chronic 1 |
H319,
H400,
H410 |
M=1000,
M=100 |
|
ATP17 |
| 607-752-00-4 |
trinexapac-ethyl (ISO);
ethyl 4-[cyclopropyl(hydroxy)methylene]-3,5-dioxocyclohexanecarboxylate |
95266-40-3 |
STOT RE 2,
Skin Sens. 1B,
Aquatic Chronic 1 |
H373 (gastrointestinal tract),
H317,
H410 |
M=1 |
|
ATP17 |
| 607-753-00-X |
(3aS,5S,6R,7aR,7bS,9aS,10R,12aS,12bS)-10-[(2S,3R,4R,5R)-3,4-dihydroxy-5,6-dimethylheptan-2-yl]-5,6-dihydroxy-7a,9a-dimethylhexadecahydro-3H-benzo[c]indeno[5,4-e]oxepin-3-one; 24-epibrassinolide |
78821-43-9 |
Aquatic Chronic 4 |
H413 |
|
|
ATP17 |
| 607-754-00-5 |
benzyl salicylate |
118-58-1 |
Skin Sens. 1B |
H317 |
|
|
ATP17 |
| 607-755-00-0 |
(RS)-1-{1-ethyl-4-[4-mesyl-3-(2-methoxyethoxy)-o-toluoyl]pyrazol-5-yloxy}ethyl methyl carbonate;
tolpyralate |
1101132-67-5 |
Carc. 2,
Repr. 2,
STOT RE 2,
Aquatic Acute 1,
Aquatic Chronic 1 |
H351,
H361fd,
H373 (eye),
H400,
H410 |
M=10,
M=100 |
|
ATP17 |
| 607-756-00-6 |
exo-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl acrylate; isobornyl acrylate |
5888-33-5 |
Skin Sens. 1A |
H317 |
|
|
ATP18 |
| 607-757-00-1 |
daminozide (ISO); 4-(2,2-dimethylhydrazino)-4-oxobutanoic acid; N-dimethylaminosuccinamic acid |
1596-84-5 |
Carc. 2 |
H351 |
|
|
ATP18 |
| 607-758-00-7 |
4,4'-oxydi(benzenesulphonohydrazide) |
80-51-3 |
Self-react. D, Aquatic Acute 1, Aquatic Chronic 1 |
H242, H400, H410 |
M=1, M=1 |
|
ATP18 |
| 607-759-00-2 |
toluene-4-sulphonohydrazide |
1576-35-8 |
Self-react. D |
H242 |
|
|
ATP18 |
| 607-760-00-8 |
2-[N-ethyl-4-[(5-nitrothiazol-2-yl)azo]-m-toluidino]ethyl acetate; C.I. Disperse Blue 124 |
15141-18-1 |
Skin Sens. 1A |
H317 |
Skin Sens. 1A; H317: C >= 0,001% |
|
ATP18 |
| 607-761-00-3 |
Perfluoroheptanoic acid; tridecafluoroheptanoic acid |
375-85-9 |
Repr. 1B, STOT RE 1 |
H360D, H372 (liver) |
|
|
ATP18 |
| 607-762-00-9 |
methyl N-(isopropoxycarbonyl)-L-valyl-(3RS)-3-(4-chlorophenyl)-%u03B2-alaninate; valifenalate |
283159-90-0 |
Carc. 2, Aquatic Chronic 2 |
H351, H411 |
|
|
ATP18 |
| 607-763-00-4 |
6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid, sodium and tris(2-hydroxyethyl)ammonium salts |
|
Repr. 1B, Eye Irrit. 2 |
H360FD, H319 |
|
|
ATP18 |
| 607-764-00-X |
6-[(C10-C13)-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid |
2156592-54-8 |
Repr. 1B, Eye Irrit. 2 |
H360FD, H319 |
|
|
ATP18 |
| 607-765-00-5 |
6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid |
|
Repr. 1B |
H360FD |
|
|
ATP18 |
| 608-001-00-3 |
acetonitrile; cyanomethane |
75-05-8 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2 |
H225, H332, H312, H302, H319 |
|
|
CLP00/ |
| 608-002-00-9 |
trichloroacetonitrile |
545-06-2 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Chronic 2 |
H331, H311, H301, H411 |
|
|
CLP00/ |
| 608-003-00-4 |
acrylonitrile |
107-13-1 |
Flam. Liq. 2, Carc. 1B, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H225, H350, H331, H311, H301, H335, H315, H318, H317, H411 |
* |
D |
CLP00/ |
| 608-004-00-X |
2-hydroxy-2-methylpropionitrile; 2-cyanopropan-2-ol; acetone cyanohydrin |
75-86-5 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H310, H300, H400, H410 |
|
|
CLP00/ |
| 608-005-00-5 |
n-butyronitrile |
109-74-0 |
Flam. Liq. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 * |
H225, H331, H311, H301 |
|
|
CLP00/ATP01 |
| 608-006-00-0 |
bromoxynil (ISO); 3,5-dibromo-4-hydroxybenzonitrile; bromoxynil phenol |
1689-84-5 |
Repr. 2, Acute Tox. 2 *, Acute Tox. 3 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361d ***, H330, H301, H317, H400, H410 |
M = 10: |
|
CLP00/ |
| 608-007-00-6 |
ioxynil (ISO); 4-hydroxy-3,5-diiodobenzonitrile |
1689-83-4 |
Repr. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 2 *, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H361d ***, H331, H301, H312, H373 **, H319, H400, H410 |
M = 10: |
|
CLP00/ |
| 608-008-00-1 |
chloroacetonitrile |
107-14-2 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Chronic 2 |
H331, H311, H301, H411 |
|
|
CLP00/ |
| 608-009-00-7 |
malononitrile |
109-77-3 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H400, H410 |
|
|
CLP00/ |
| 608-010-00-2 |
methacrylonitrile; 2-methyl-2-propene nitrile |
126-98-7 |
Flam. Liq. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Sens. 1 |
H225, H331, H311, H301, H317 |
*, Skin Sens. 1; H317: C ≥ 0,2 % |
D |
CLP00/ |
| 608-011-00-8 |
oxalonitrile; cyanogen |
460-19-5 |
Press. Gas, Flam. Gas 1, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H220, H331, H400, H410 |
|
|
CLP00/ATP01 |
| 608-012-00-3 |
benzonitrile |
100-47-0 |
Acute Tox. 4 *, Acute Tox. 4 * |
H312, H302 |
|
|
CLP00/ |
| 608-013-00-9 |
2-chlorobenzonitrile |
873-32-5 |
Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2 |
H312, H302, H319 |
|
|
CLP00/ |
| 608-014-00-4 |
chlorothalonil (ISO); tetrachloroisophthalonitrile |
1897-45-6 |
Carc. 2, Acute Tox. 2 *, STOT SE 3, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H330, H335, H318, H317, H400, H410 |
M=10: |
|
CLP00/ATP01 |
| 608-015-00-X |
dichlobenil (ISO); 2,6-dichlorobenzonitrile |
1194-65-6 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H312, H411 |
|
|
CLP00/ |
| 608-016-00-5 |
1,4-Dicyano-2,3,5,6-tetra-chloro-benzene |
1897-41-2 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 608-017-00-0 |
bromoxynil octanoate (ISO); 2,6-dibromo-4-cyanophenyl octanoate |
1689-99-2 |
Repr. 2, Acute Tox. 3 *, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361d ***, H331, H302, H317, H400, H410 |
M = 10: |
|
CLP00/ |
| 608-018-00-6 |
ioxynil octanoate (ISO); 4-cyano-2,6-diiodophenyl octanoate |
3861-47-0 |
Repr. 2, Acute Tox. 3 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361d ***, H301, H319, H317, H400, H410 |
M = 10: |
|
CLP00/ |
| 608-019-00-1 |
2,2'-dimethyl-2,2'-azodipropiononitrile; ADZN |
78-67-1 |
Self-react. C, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 3 |
H242, H332, H302, H412 |
|
T |
CLP00/ |
| 608-020-00-7 |
diphenoxymethylenecyanamide |
79463-77-7 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
ATP01/ |
| 608-021-00-2 |
3-(2-(diaminomethyleneamino)thiazol-4-ylmethylthio)propionitrile |
76823-93-3 |
Acute Tox. 4 *, Skin Sens. 1 |
H302, H317 |
|
|
CLP00/ |
| 608-022-00-8 |
3,7-dimethyloctanenitrile |
40188-41-8 |
Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H315, H317, H411 |
|
|
CLP00/ |
| 608-023-00-3 |
fenbuconazole (ISO); 4-(4-chlorophenyl)-2-phenyl-2-[(1H-1,2,4-triazol-1-yl)methyl]butanenitrile |
114369-43-6 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 608-024-00-9 |
2-(4-(N-butyl-N-phenethylamino)phenyl)ethylene-1,1,2-tricarbonitrile |
97460-76-9 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 608-025-00-4 |
2-nitro-4,5-bis(benzyloxy)phenylacetonitrile |
117568-27-1 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 608-026-00-X |
3-cyano-3,5,5-trimethylcyclohexanone |
7027-11-4 |
Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 3 |
H302, H373 **, H317, H412 |
|
|
CLP00/ |
| 608-027-00-5 |
reaction mass of: 3-(4-ethylphenyl)-2,2-dimethylpropanenitrile; 3-(2-ethylphenyl)-2,2-dimethylpropanenitrile; 3-(3-ethylphenyl)-2,2-dimethylpropanenitrile |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 608-028-00-0 |
4-(2-cyano-3-phenylamino-acryloyloxymethyl)-cyclohexyl-methyl 2-cyano-3-phenylamino)-acrylate |
147374-67-2 |
STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 2 |
H373 **, H317, H411 |
|
|
CLP00/ |
| 608-029-00-6 |
1,2-dihydro-6-hydroxy-4-methyl-1-[3-(1-methylethoxy)propyl]-2-oxo-3-pyridinecarbonitrile |
68612-94-2 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 608-030-00-1 |
N-acetyl-N-[5-cyano-3-(2-dibutylamino-4-phenylthyazol-5-yl-methylene)-4-methyl-2,6-dioxo-1,2,3,6-tetrahydropyridin-1-yl]benzamide |
147741-93-3 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 608-031-00-7 |
2-benzyl-2-methyl-3-butenitrile |
97384-48-0 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 608-032-00-2 |
acetamiprid (ISO); (1E)-N-[(6-chloropyridin-3-yl) methyl]-N'-cyano-N-methylethanimidamide; (E)-N1-[(6-chloro-3-pyridyl)methyl]-N2-cyano-N1-methylacetamidine |
135410-20-7; 160430-64-8 |
Repr. 2, Acute Tox. 3, Aquatic Acute 1, Aquatic Chronic 1 |
H361d, H301, H400, H410 |
oral: ATE = 140 mg/kg bw; M = 10, M = 10 |
|
ATP01/ATP18 |
| 608-033-00-8 |
N-butyl-3-(2-chloro-4-nitrophenylhydrazono)-1-cyano-2-methylprop-1-ene-1,3-dicarboximide |
75511-91-0 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 608-034-00-3 |
chlorfenapyr (ISO); 4-bromo-2-(4-chlorophenyl)-1-ethoxymethyl-5-trifluoromethylpyrrole-3-carbonitrile |
122453-73-0 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H302, H400, H410 |
M=100: |
|
CLP00/ATP01 |
| 608-035-00-9 |
(±)-α-[(2-acetyl-5-methylphenyl)-amino]-2,6-dichlorobenzene-aceto-nitrile |
- |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 608-036-00-4 |
3-(2-{}{4-[2-(4-cyanophenyl)vinyl]phenyl}}vinyl)benzonitrile |
79026-02-1 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 608-037-00-X |
reaction mass of: (E)-2,12-tridecadiennitrile; (E)-3,12-tridecadiennitrile; (Z)-3,12-tridecadiennitrile |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 608-038-00-5 |
2,2,4-trimethyl-4-phenyl-butane-nitrile |
75490-39-0 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 608-039-00-0 |
2-phenylhexanenitrile |
3508-98-3 |
Acute Tox. 4, Aquatic Chronic 2 |
H302, H411 |
Oral: ATE = 500 mg/kg
|
|
CLP00/ATP14 |
| 608-040-00-6 |
4,4'-dithiobis(5-amino-1-(2,6-dichloro-4-(trifluoromethyl)phenyl)-1H-pyrazole-3-carbonitrile) |
130755-46-3 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 608-041-00-1 |
4'-((2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-ene-3-yl)methyl)(1,1'-biphenyl)-2-carbonitrile |
138401-24-8 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 608-042-00-7 |
(S)-2,2-diphenyl-2-(3-pyrrolidinyl)acetonitrile hydrobromide |
194602-27-2 |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H302, H318, H317, H411 |
|
|
ATP01/ |
| 608-043-00-2 |
3-(cis-3-hexenyloxy)propanenitril |
142653-61-0 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H302, H400, H410 |
|
|
CLP00/ |
| 608-044-00-8 |
2-cyclohexylidene-2-phenylacetonitrile |
10461-98-0 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
ATP01/ |
| 608-046-00-9 |
5-(4-chloro-2-nitro-phenylazo)-1,2-dihydro-6-hydroxy-1,4-dimethyl-2-oxo-pyridine-3-carbonitrile |
77889-90-8 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 608-047-00-4 |
2-piperidin-1-yl-benzonitrile |
72752-52-4 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 608-048-00-X |
1-(3-cyclopentyloxy-4-methoxyphenyl)-4-oxo-cyclohexanecarbonitrile |
152630-47-2 |
Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 2 |
H302, H373**, H317, H411 |
|
|
ATP01/ |
| 608-049-00-5 |
2-(4-(4-(butyl-(1-methylhexyl)amino)phenyl)-3-cyano-5-oxo-1,5-dihydropyrrol-2-ylidene)propandinitrile |
157362-53-3 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
ATP01/ |
| 608-050-00-0 |
reaction mass of: 5-(2-cyano-4-nitrophenylazo)-2-(2-(2-hydroxyethoxy)ethylamino)-4-methyl-6-phenylaminonicotinonitrile; 5-(2-cyano-4-nitrophenylazo)-6-(2-(2-hydroxyethoxy)ethylamino)-4-methyl-2-phenylaminonicotinonitrile |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 608-051-00-6 |
(R)-4-(4-dimethylamino-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile |
219861-18-4 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H302, H317, H411 |
|
|
ATP01/ |
| 608-052-00-1 |
(S)-4-(4-dimethylamino-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile |
128173-52-4 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H302, H317, H411 |
|
|
ATP01/ |
| 608-053-00-7 |
(R,S)-4-(4-dimethylamino-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile |
103146-25-4 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H302, H317, H411 |
|
|
ATP01/ |
| 608-054-00-2 |
(R,S)-4-(4-dimethylamino-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile hemisulfate |
- |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H302, H318, H317, H411 |
|
|
ATP01/ |
| 608-055-00-8 |
fipronil (ISO); (±)-5-amino-1-(2,6-dichloro-α,α,α-trifluoro-para-tolyl)-4-trifluoromethylsulfinyl-pyrazole-3-carbonitrile |
120068-37-3 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H372 *, H400, H410 |
M=1000, M=10000 |
|
ATP01/ATP10 |
| 608-056-00-3 |
N-methyl-N-cyanomethylmorpholiniummethylsulfate |
- |
Acute Tox. 4 *, Eye Dam. 1 |
H302, H318 |
|
|
ATP01/ |
| 608-057-00-9 |
4-cyanomethyl-4-methylmorpholin-4-iumhydrogene sulfate |
208538-34-5 |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1 |
H302, H318, H317 |
|
|
ATP01/ |
| 608-058-00-4 |
esfenvalerate (ISO);
(S)-%u03B1-cyano- 3-phenoxybenzyl-(S)- 2-(4-chlorophenyl)- 3-methylbutyrate |
66230-04-4 |
Acute Tox. 3,
Acute Tox. 3,
STOT SE 1,
STOT RE 2,
Skin Sens. 1,
Aquatic Acute 1,
Aquatic Chronic 1 |
H331,
H301,
H370 (nervous system),
H373,
H317,
H400,
H410 |
Inhalation: ATE = 0.53 mg/L (dusts/mists),
Oral: ATE = 88.5 mg/kg bw,
M=10000,
M=10000 |
|
CLP00/ATP01/ATP17 |
| 608-059-00-X |
5-amino-1-(2,6-dichloro-4-(trifluoromethyl)phenyl)-1H-pyrazole-3-carbonitrile |
120068-79-3 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 608-060-00-5 |
5-methyl-2-[(2-nitrophenyl)amino]-3-thiophenecarbonitrile |
138564-59-7 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 608-062-00-6 |
2-fluoro-4-hydroxybenzonitrile |
82380-18-5 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 2 |
H302, H318, H411 |
|
|
ATP01/ |
| 608-063-00-1 |
(S)-α-hydroxy-3-phenoxy-benzeneacetonitrile |
61826-76-4 |
Acute Tox. 3 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H318, H317, H400, H410 |
|
|
ATP01/ |
| 608-064-00-7 |
cyanomethyltrimethylammoniummethylsulfate |
- |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 608-065-00-2 |
salts of bromoxynil with the exception of those specified elsewhere in this Annex |
- |
Repr. 2, Acute Tox. 2 *, Acute Tox. 3 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361d ***, H330, H301, H317, H400, H410 |
M = 10: |
A |
CLP00/ |
| 608-066-00-8 |
salts of ioxynil with the exception of those specified elsewhere in this Annex |
- |
Repr. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 2 *, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H361d ***, H331, H301, H312, H373 **, H319, H400, H410 |
M = 10: |
A |
CLP00/ |
| 608-067-00-3 |
3,7-dimethylocta-2,6-dienenitrile |
5146-66-7 |
Muta. 1B |
H340 |
|
|
ATP09 |
| 608-068-00-9 |
flutianil (ISO); (2Z)-{[2-fluoro-5-(trifluoromethyl)phenyl]thio}[3-(2-methoxyphenyl)-1,3-thiazolidin-2-ylidene]acetonitrile |
958647-10-4 |
Aquatic Chronic 1 |
H410 |
M=100 |
|
ATP13 |
| 608-069-00-4 |
fludioxonil (ISO); 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1H-pyrrole-3-carbonitrile |
131341-86-1 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1, M=10
|
|
ATP14 |
| 609-001-00-6 |
1-nitropropane |
108-03-2 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H226, H332, H312, H302 |
* |
|
CLP00/ |
| 609-002-00-1 |
2-nitropropane |
79-46-9 |
Flam. Liq. 3, Carc. 1B, Acute Tox. 4 *, Acute Tox. 4 * |
H226, H350, H332, H302 |
|
|
CLP00/ |
| 609-003-00-7 |
nitrobenzene |
98-95-3 |
Carc. 2., Repr. 1B, Acute Tox. 3, Acute Tox. 3, Acute Tox. 3, STOT RE 1, Aquatic Chronic 3Carc. 2., Repr. 1B, Acute Tox. 3, Acute Tox. 3, Acute Tox. 3, STOT RE 1, Aquatic Chronic 3 |
H351, H360F, H301, H331, H311, H372 (blood), H412 |
|
|
CLP00/ATP05 |
| 609-004-00-2 |
dinitrobenzene; [1] 1,4-dinitrobenzene; [2] 1,3-dinitrobenzene; [3] 1,2-dinitrobenzene [4] |
25154-54-5 [1], 100-25-4 [2], 99-65-0 [3], 528-29-0 [4] |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H310, H300, H373 **, H400, H410 |
|
|
CLP00/ |
| 609-005-00-8 |
1,3,5-trinitrobenzene |
99-35-4 |
Expl. 1.1, Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H201, H330, H310, H300, H373**, H400, H410 |
|
|
CLP00/ATP01 |
| 609-006-00-3 |
4-nitrotoluene |
99-99-0 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 2 |
H331, H311, H301, H373 **, H411 |
|
|
CLP00/ |
| 609-007-00-9 |
2,4-dinitrotoluene; [1] dinitrotoluene [2] |
121-14-2 [1], 25321-14-6 [2], - |
Carc. 1B, Muta. 2, Repr. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H341, H361f***, H331, H311, H301, H373**, H400, H410 |
|
|
CLP00/ATP01 |
| 609-008-00-4 |
2,4,6-trinitrotoluene; TNT |
118-96-7 |
Expl. 1.1, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 2 |
H201, H331, H311, H301, H373 **, H411 |
|
|
CLP00/ |
| 609-009-00-X |
2,4,6-trinitrophenol; picric acid |
88-89-1 |
Expl. 1.1, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 * |
H201, H331, H311, H301 |
|
|
CLP00/ATP01 |
| 609-010-00-5 |
salts of picric acid |
- |
Unst. Expl, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 * |
H201, H331, H311, H301 |
|
T |
CLP00/ |
| 609-011-00-0 |
2,4,6-trinitroanisole |
606-35-9 |
Expl. 1.1, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 2 |
H201, H332, H312, H302, H411 |
|
|
CLP00/ |
| 609-012-00-6 |
2,4,6-trinitro-m-cresol |
602-99-3 |
Expl. 1.1, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H201, H332, H312, H302 |
|
|
CLP00/ |
| 609-013-00-1 |
2,4,6-trinitro-m-xylene |
632-92-8 |
Expl. 1.1, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 * |
H201, H332, H312, H302, H373 ** |
|
|
CLP00/ |
| 609-015-00-2 |
4-nitrophenol; p-nitrophenol |
100-02-7 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 * |
H332, H312, H302, H373 ** |
|
|
CLP00/ |
| 609-016-00-8 |
dinitrophenol (reaction mass of isomers); [1] 2,4(or 2,6)-dinitrophenol [2] |
25550-58-7 [1], 71629-74-8 [2] |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H373 **, H400, H410 |
|
|
CLP00/ |
| 609-018-00-9 |
2,4,6-trinitroresorcinol; styphnic acid |
82-71-3 |
Expl. 1.1, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H201, H332, H312, H302 |
|
|
CLP00/ATP01 |
| 609-019-00-4 |
lead 2,4,6-trinitro-m-phenylene dioxide; lead 2,4,6-trinitroresorcinoxide; lead styphnate |
15245-44-0 |
Unst. Expl, Repr. 1A, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H200, H360Df, H332, H302, H373 **, H400, H410 |
|
1 |
CLP00/ |
| 609-019-01-1 |
lead 2,4,6-trinitro-m-phenylene dioxide; lead 2,4,6-trinitroresorcinoxide; lead styphnate (≥ 20 % phlegmatiser) |
15245-44-0 |
Expl. 1.1, Repr. 1A, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H201, H360Df, H332, H302, H373 **, H400, H410 |
|
1 |
CLP00/ |
| 609-020-00-X |
DNOC (ISO); 4,6-dinitro-o-cresol |
534-52-1 |
Muta. 2, Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H341, H330, H310, H300, H315, H318, H317, H400, H410 |
|
|
CLP00/ |
| 609-021-00-5 |
sodium salt of DNOC; sodium 4,6-dinitro-o-cresolate; [1] potassium salt of DNOC; potassium 4,6-dinitro-o-cresolate [2] |
2312-76-7 [1], 5787-96-2 [2] |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H373 **, H400, H410 |
|
|
CLP00/ |
| 609-022-00-0 |
ammonium salt of DNOC; ammonium 4,6-dinitro-o-tolyl oxide |
2980-64-5 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H310, H300, H373 **, H400, H410 |
|
|
CLP00/ |
| 609-023-00-6 |
dinocap (ISO); (RS)-2,6-dinitro-4-octylphenyl crotonates and (RS)-2,4-dinitro-6-octylphenyl crotonates in which “octyl” is a reaction mass of 1-methylheptyl, 1-ethylhexyl and 1-propylpentyl groups |
39300-45-3 |
Repr. 1B, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360D***, H332, H302, H373**, H315, H317, H400, H410 |
M=100: |
|
CLP00/ATP01 |
| 609-024-00-1 |
binapacryl (ISO); 2-sec-butyl-4,6-dinitrophenyl-3-methylcrotonate |
485-31-4 |
Repr. 1B, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H360D ***, H312, H302, H400, H410 |
|
|
CLP00/ |
| 609-025-00-7 |
dinoseb (ISO); 6-sec-butyl-2,4-dinitrophenol |
88-85-7 |
Repr. 1B, Acute Tox. 3 *, Acute Tox. 3 *, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H360Df, H311, H301, H319, H400, H410 |
|
|
CLP00/ |
| 609-026-00-2 |
salts and esters of dinoseb, with the exception of those specified elsewhere in this Annex |
- |
Repr. 1B, Acute Tox. 3 *, Acute Tox. 3 *, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H360Df, H311, H301, H319, H400, H410 |
|
A |
CLP00/ |
| 609-027-00-8 |
dinocton; reaction mass of isomers: methyl 2-octyl-4,6-dinitrophenyl carbonate, methyl 4-octyl-2,6-dinitrophenyl carbonate |
63919-26-6 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 609-028-00-3 |
dinex (ISO); 2-cyclohexyl-4,6-dinitrophenol |
131-89-5 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H400, H410 |
|
|
CLP00/ |
| 609-029-00-9 |
salts and esters of dinex |
- |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H400, H410 |
|
A |
CLP00/ |
| 609-030-00-4 |
dinoterb (ISO); 2-tert-butyl-4,6-dinitrophenol |
1420-07-1 |
Repr. 1B, Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H360D ***, H300, H311, H400, H410 |
|
|
CLP00/ |
| 609-031-00-X |
salts and esters of dinoterb |
- |
Repr. 1B, Acute Tox. 2 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H360D ***, H300, H311, H400, H410 |
|
A |
CLP00/ |
| 609-032-00-5 |
bromofenoxim (ISO); 3,5-dibromo-4-hydroxybenzaldehyde-O-(2,4-dinitrophenyl)-oxime |
13181-17-4 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 609-033-00-0 |
dinosam (ISO); 2-(1-methylbutyl)-4,6-dinitrophenol |
4097-36-3 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H400, H410 |
|
|
CLP00/ |
| 609-034-00-6 |
salts and esters of dinosam |
- |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H400, H410 |
|
A |
CLP00/ |
| 609-035-00-1 |
nitroethane |
79-24-3 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 * |
H226, H332, H302 |
* |
|
CLP00/ |
| 609-036-00-7 |
nitromethane |
75-52-5 |
Flam. Liq. 3, Acute Tox. 4 * |
H226, H302 |
* |
|
CLP00/ |
| 609-037-00-2 |
5-nitroacenaphthene |
602-87-9 |
Carc. 1B |
H350 |
|
|
CLP00/ |
| 609-038-00-8 |
2-nitronaphthalene |
581-89-5 |
Carc. 1B, Aquatic Chronic 2 |
H350, H411 |
|
|
CLP00/ |
| 609-039-00-3 |
4-nitrobiphenyl |
92-93-3 |
Carc. 1B, Aquatic Chronic 2 |
H350, H411 |
|
|
CLP00/ |
| 609-040-00-9 |
nitrofen (ISO); 2,4-dichlorophenyl 4-nitrophenyl ether |
1836-75-5 |
Carc. 1B, Repr. 1B, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H360D ***, H302, H400, H410 |
|
|
CLP00/ |
| 609-041-00-4 |
2,4-dinitrophenol |
51-28-5 |
Acute Tox. 2, Acute Tox. 3 *, Acute Tox. 3, STOT RE 1, Aquatic Acute 1 |
H300, H331, H311, H372, H400 |
Oral: ATE = 30 mg/kg, Dermal: ATE = 300 mg/kg |
|
CLP00/ATP15 |
| 609-042-00-X |
pendimethalin (ISO); N-(1-ethylpropyl)-2,6-dinitro-3,4-xylidine |
40487-42-1 |
Repr. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H361d, H400, H410 |
M = 100, M = 10 |
|
CLP00/ATP18 |
| 609-043-00-5 |
quintozene (ISO); pentachloronitrobenzene |
82-68-8 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 609-044-00-0 |
tecnazene (ISO); 1,2,4,5-tetrachloro-3-nitrobenzene |
117-18-0 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
CLP00/ |
| 609-045-00-6 |
reaction mass of: 4,6-dinitro-2-(3-octyl)phenyl methyl carbonate and 4,6-dinitro-2-(4-octyl)phenyl methyl carbonate; dinocton-6 |
8069-76-9 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 609-046-00-1 |
trifluralin (ISO) (containing < 0.5 ppm NPDA); α,α,α-trifluoro-2,6-dinitro-N,N-dipropyl-p-toluidine (containing < 0.5 ppm NPDA); 2,6-dinitro-N,N-dipropyl-4-trifluoromethylaniline (containing < 0.5 ppm NPDA); N,N-dipropyl-2,6-dinitro-4-trifluoromethylan |
1582-09-8 |
Carc. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H317, H400, H410 |
M=10: |
|
CLP00/ATP01 |
| 609-047-00-7 |
2-nitroanisole |
91-23-6 |
Carc. 1B, Acute Tox. 4 * |
H350, H302 |
|
|
CLP00/ |
| 609-048-00-2 |
sodium 3-nitrobenzenesulphonate |
127-68-4 |
Eye Irrit. 2, Skin Sens. 1 |
H319, H317 |
|
|
CLP00/ |
| 609-049-00-8 |
2,6-dinitrotoluene |
606-20-2 |
Carc. 1B, Muta. 2, Repr. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 3 |
H350, H341, H361f ***, H331, H311, H301, H373 **, H412 |
|
|
CLP00/ |
| 609-050-00-3 |
2,3-dinitrotoluene |
602-01-7 |
Carc. 1B, Muta. 2, Repr. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H341, H361f ***, H331, H311, H301, H373 **, H400, H410 |
|
|
CLP00/ |
| 609-051-00-9 |
3,4-dinitrotoluene |
610-39-9 |
Carc. 1B, Muta. 2, Repr. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 2 |
H350, H341, H361f ***, H331, H311, H301, H373 **, H411 |
|
|
CLP00/ |
| 609-052-00-4 |
3,5-dinitrotoluene |
618-85-9 |
Carc. 1B, Muta. 2, Repr. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 3 |
H350, H341, H361f ***, H331, H311, H301, H373 **, H412 |
|
|
CLP00/ |
| 609-053-00-X |
hydrazine-trinitromethane |
- |
Expl. 1.1 ****, Self-react. A, Carc. 1B, Acute Tox. 3 *, Acute Tox. 3 *, Skin Sens. 1 |
H201, H240, H350, H331, H301, H317 |
|
|
CLP00/ |
| 609-054-00-5 |
2,3-dinitrophenol; [1] 2,5-dinitrophenol; [2] 2,6-dinitrophenol; [3] 3,4-dinitrophenol; [4] salts of dinitrophenol [5] |
66-56-8 [1], 329-71-5 [2], 573-56-8 [3], 577-71-9 [4], - [5] |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 2 |
H331, H311, H301, H373 **, H411 |
|
|
CLP00/ |
| 609-055-00-0 |
2,5-dinitrotoluene |
619-15-8 |
Carc. 1B, Muta. 2, Repr. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 2 |
H350, H341, H361f ***, H331, H311, H301, H373 **, H411 |
|
|
CLP00/ |
| 609-056-00-6 |
2,2-dibromo-2-nitroethanol |
69094-18-4 |
Expl. 1.1, Carc. 2, Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1A, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H201, H351, H302, H373 **, H314, H317, H400, H410 |
*, STOT SE 3; H335: C ≥ 1 % |
T |
CLP00/ |
| 609-057-00-1 |
3-chloro-2,4-difluoronitrobenzene |
3847-58-3 |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H314, H317, H400, H410 |
|
|
CLP00/ |
| 609-058-00-7 |
2-nitro-2-phenyl-1,3-propanediol |
5428-02-4 |
STOT RE 1, Acute Tox. 4 *, Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H372 **, H312, H302, H317, H411 |
|
|
CLP00/ |
| 609-059-00-2 |
2-chloro-6-(ethylamino)-4-nitrophenol |
131657-78-8 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H302, H317, H411 |
|
|
CLP00/ |
| 609-060-00-8 |
4-[(3-hydroxypropyl)amino]-3-nitrophenol |
92952-81-3 |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ |
| 609-061-00-3 |
(E,Z)-4-chlorophenyl(cyclopropyl)ketone O-(4-nitrophenylmethyl)oxime |
94097-88-8 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 609-062-00-9 |
2-bromo-2-nitropropanol |
24403-04-1 |
Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H311, H302, H373 **, H314, H317, H400, H410 |
|
|
CLP00/ |
| 609-063-00-4 |
2-[(4-chloro-2-nitrophenyl)amino]ethanol |
59320-13-7 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 609-064-00-X |
mesotrione (ISO); 2-[4-(methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione |
104206-82-8 |
Repr. 2, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H361d, H373 (eyes, nervous system), H400, H410 |
M=10, M=10 |
|
CLP00/ATP15 |
| 609-065-00-5 |
2-nitrotoluene |
88-72-2 |
Carc. 1B, Muta. 1B, Repr. 2, Acute Tox. 4 *, Aquatic Chronic 2 |
H350, H340, H361f ***, H302, H411 |
|
|
CLP00/ |
| 609-067-00-6 |
sodium and potassium 4-(3-aminopropylamino)-2,6-bis[3-(4-methoxy-2-sulfophenylazo)-4-hydroxy-2-sulfo-7-naphthylamino]-1,3,5-triazine |
156769-97-0 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 609-068-00-1 |
musk xylene; 5-tert-butyl-2,4,6-trinitro-m-xylene |
81-15-2 |
Expl. 1.1, Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H201, H351, H400, H410 |
|
T |
CLP00/ |
| 609-069-00-7 |
musk ketone; 3,5-dinitro-2,6-dimethyl-4-tert-butylacetophenone; 4'-tert-butyl-2',6'-dimethyl-3',5'-dinitroacetophenone |
81-14-1 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H400, H410 |
|
|
ATP01/ |
| 609-070-00-2 |
1,4-dichloro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-nitrobenzene |
130841-23-5 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
CLP00/ |
| 609-071-00-8 |
reaction mass of: 2-methylsulfanyl-4,6-bis-(2-hydroxy-4-methoxy-phenyl)-1,3,5-triazine; 2-(4,6-bis-methylsulfanyl-1,3,5-triazin-2-yl)-5-methoxy-phenol |
156137-33-6 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 609-072-00-3 |
4-mesyl-2-nitrotoluene |
1671-49-4 |
Repr. 2, Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 3 |
H361f***, H302, H317, H412 |
|
|
ATP01/ |
| 609-073-00-9 |
lithium potassium sodium N,N''-bis{6-[7-[4-(4-chloro-1,3,5-triazin-2-yl)amino-4-(2-ureidophenylazo)]naphthalene-1,3,6-trisulfonato]}-N'-(2-aminoethyl)piperazine |
- |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 610-001-00-3 |
trichloronitromethane; chloropicrin |
76-06-2 |
Acute Tox. 2 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H330, H302, H319, H335, H315 |
|
|
CLP00/ |
| 610-002-00-9 |
1,1-dichloro-1-nitroethane |
594-72-9 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 * |
H331, H311, H301 |
|
|
CLP00/ |
| 610-003-00-4 |
chlorodinitrobenzene |
- |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H373 **, H400, H410 |
|
C |
CLP00/ |
| 610-004-00-X |
2-chloro-1,3,5-trinitrobenzene |
88-88-0 |
Expl. 1.1, Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H201, H330, H310, H300, H400, H410 |
|
|
CLP00/ |
| 610-005-00-5 |
1-chloro-4-nitrobenzene |
100-00-5 |
Carc. 2, Muta. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 2 |
H351, H341, H331, H311, H301, H373 **, H411 |
|
|
CLP00/ |
| 610-006-00-0 |
chloronitroanilines with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2 *, Aquatic Chronic 2 |
H330, H310, H300, H373 **, H411 |
|
A C |
CLP00/ |
| 610-007-00-6 |
1-chloro-1-nitropropane |
600-25-9 |
Acute Tox. 4 *, Acute Tox. 4 * |
H332, H302 |
* |
|
CLP00/ |
| 610-008-00-1 |
2,6-dichloro-4-nitroanisole |
17742-69-7 |
Acute Tox. 3 *, Aquatic Chronic 2 |
H301, H411 |
|
|
CLP00/ |
| 610-009-00-7 |
2-chloro-4-nitroaniline |
121-87-9 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 610-010-00-2 |
2-bromo-1-(2-furyl)-2-nitroethylene |
35950-52-8 |
Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373 **, H314, H317, H400, H410 |
|
|
CLP00/ |
| 611-001-00-6 |
azobenzene |
103-33-3 |
Carc. 1B, Muta. 2, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H341, H332, H302, H373 **, H400, H410 |
|
|
CLP00/ |
| 611-002-00-1 |
azoxybenzene |
495-48-7 |
Acute Tox. 4 *, Acute Tox. 4 * |
H332, H302 |
|
|
CLP00/ |
| 611-003-00-7 |
fenaminosulf (ISO); sodium 4-dimethylaminobenzenediazosulphonate |
140-56-7 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Chronic 3 |
H301, H312, H412 |
|
|
CLP00/ |
| 611-004-00-2 |
methyl-ONN-azoxymethyl acetate; methyl azoxy methyl acetate |
592-62-1 |
Carc. 1B, Repr. 1B |
H350, H360D *** |
|
|
CLP00/ |
| 611-005-00-8 |
disodium {}{5-[(4'-((2,6-hydroxy-3-((2-hydroxy-5-sulphophenyl)azo)phenyl)azo)(1,1'-biphenyl)-4-yl)azo]salicylato(4-)}}cuprate(2-); CI Direct Brown 95 |
16071-86-6 |
Carc. 1B |
H350 |
|
|
CLP00/ |
| 611-006-00-3 |
4-o-tolylazo-o-toluidine; 4-amino-2',3-dimethylazobenzene; fast garnet GBC base; AAT; o-aminoazotoluene |
97-56-3 |
Carc. 1B, Skin Sens. 1 |
H350, H317 |
|
|
CLP00/ |
| 611-007-00-9 |
tricyclazole (ISO); 5-methyl-1,2,4-triazolo(3,4-b)benzo-1,3-thiazole |
41814-78-2 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 611-008-00-4 |
4-aminoazobenzene; 4-phenylazoaniline |
60-09-3 |
Carc. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H400, H410 |
|
|
CLP00/ |
| 611-009-00-X |
sodium (1-(5-(4-(4-anilino-3-sulphophenylazo)-2-methyl-5-methylsulphonamidophenylazo)-4-hydroxy-2-oxido-3-(phenylazo)phenylazo)-5-nitro-4-sulphonato-2-naphtholato)iron(II) |
- |
Acute Tox. 4 *, Aquatic Chronic 3 |
H332, H412 |
|
|
CLP00/ |
| 611-010-00-5 |
2'-(2-cyano-4,6-dinitrophenylazo)-5'-(N,N-dipropylamino)propionanilide |
106359-94-8 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 611-011-00-0 |
N,N,N',N'-tetramethyl-3,3'-(propylenebis(iminocarbonyl-4,1-phenylenazo(1,6-dihydro-2-hydroxy-4-methyl-6-oxopyridine-3,1-diyl)))di(propylammonium) dilactate |
- |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 611-012-00-6 |
reaction mass of 2,2-iminodiethanol 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazole-7-sulfonate and 2-methylaminoethanol 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazole-7-sulfonate and N,N-diethylpropane-1,3-diamine 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazole-7-sulfonate |
114565-65-0 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-013-00-1 |
trilithium-1-hydroxy-7-(3-sulfonatoanilino)-2-(3-methyl-4-(2-methoxy-4-(3-sulfonatophenylazo)phenylazo)phenylazo)naphthalene-3-sulfonate |
117409-78-6 |
Expl. 1.3 ****, Aquatic Chronic 2 |
H203, H411 |
|
|
CLP00/ |
| 611-014-00-7 |
(tetrasodium 1-(4-(3-acetamido-4-(4'-nitro-2,2'-disulfonatostilben-4-ylazo)anilino)-6-(2,5-disulfonatoanilino)-1,3,5-triazin-2-yl)-3-carboxypyridinium) hydroxide |
115099-55-3 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-015-00-2 |
tetrasodium 4-amino-5-hydroxy-6-(4-(2-(2-(sulfonatooxy)ethylsulfonyl)ethylcarbamoyl)phenylazo)-3-(4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo)naphthalene-2,7-disulfonate |
116889-78-2 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-016-00-8 |
reaction mass of 1,1'-((dihydroxyphenylene)bis(azo-3,1-phenylenazo(1-(3-dimethylaminopropyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3-diyl)))dipyridinium dichloride dihydrochloride, mixed isomers and 1-(1-(3-dimethylaminopropyl)-5-(3-((4-(1-(3-dimethylaminopropyl)-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-5-pyridinio-3-pyridylazo)phenylazo)-2,4(or2,6 or3,5)-dihydroxyphenylazo)phenylazo)-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-3-pyridyl)pyridinium dichloride |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-017-00-3 |
2-(4-(diethylaminopropylcarbamoyl)phenylazo)-3-oxo-N-(2,3-dihydro-2-oxobenzimidazol-5-yl)butyramide |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 611-018-00-9 |
tetraammonium 5-(4-(7-amino-1-hydroxy-3-sulfonato-2-naphthylazo)-6-sulfonato-1-naphthylazo)isophthalate |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-019-00-4 |
tetralithium 6-amino-4-hydroxy-3-(7-sulfonato-4-(4-sulfonatophenylazo)-1-naphthylazo)naphthalene-2,7-disulfonate |
106028-58-4 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-020-00-X |
tetrakis(tetramethylammonium) 6-amino-4-hydroxy-3-(7-sulfonato-4-(4-sulfonatophenylazo)-1-naphthylazo)naphthalene-2,7-disulfonate |
116340-05-7 |
Acute Tox. 3 *, Skin Sens. 1, Aquatic Chronic 3 |
H301, H317, H412 |
|
|
CLP00/ |
| 611-021-00-5 |
2-(4-(4-cyano-3-methylisothiazol-5-ylazo)-N-ethyl-3-methylanilino)ethyl acetate |
- |
Acute Tox. 4 *, STOT RE 2 *, Skin Irrit. 2, Aquatic Chronic 4 |
H302, H373 **, H315, H413 |
|
|
CLP00/ |
| 611-022-00-0 |
4-dimethylaminobenzenediazonium 3-carboxy-4-hydroxybenzenesulfonate |
- |
Self-react. C, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H242, H331, H301, H312, H373 **, H318, H317, H400, H410 |
|
T |
CLP00/ |
| 611-023-00-6 |
disodium 7-(4,6-dichloro-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo) naphthalene-2-sulfonate |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-024-00-1 |
Benzidine based azo dyes; 4,4'-diarylazobiphenyl dyes, with the exception of those specified elsewhere in this Annex |
- |
Carc. 1B |
H350 |
|
A |
CLP00/ |
| 611-025-00-7 |
disodium 4-amino-3-[[4'-[(2,4-diaminophenyl)azo][1,1'-biphenyl]-4-yl]azo]-5-hydroxy-6-(phenylazo)naphtalene-2,7-disulphonate; C.I. Direct Black 38 |
1937-37-7 |
Carc. 1B, Repr. 2 |
H350, H361d *** |
|
|
CLP00/ |
| 611-026-00-2 |
tetrasodium 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis[5-amino-4-hydroxynaphthalene-2,7-disulphonate]; C.I. Direct Blue 6 |
2602-46-2 |
Carc. 1B, Repr. 2 |
H350, H361d *** |
|
|
CLP00/ |
| 611-027-00-8 |
disodium 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis(4-aminonaphthalene-1-sulphonate); C.I. Direct Red 28 |
573-58-0 |
Carc. 1B, Repr. 2 |
H350, H361d *** |
|
|
CLP00/ |
| 611-028-00-3 |
C,C'-azodi(formamide) |
123-77-3 |
Resp. Sens. 1 |
H334 |
|
|
CLP00/ATP01 |
| 611-029-00-9 |
o-dianisidine based azo dyes; 4,4'-diarylazo-3,3'-dimethoxybiphenyl dyes with the exception of those mentioned elsewhere in this Annex |
- |
Carc. 1B |
H350 |
|
A H |
CLP00/ |
| 611-030-00-4 |
o-tolidine based dyes; 4,4'-diarylazo-3,3'-dimethylbiphenyl dyes, with the exception of those mentioned elsewhere in this Annex |
- |
Carc. 1B |
H350 |
|
A H |
CLP00/ |
| 611-031-00-X |
4,4'-(4-iminocyclohexa-2,5-dienylidenemethylene)dianiline hydrochloride; C.I. Basic Red 9 |
569-61-9 |
Carc. 1B |
H350 |
|
|
CLP00/ |
| 611-032-00-5 |
1,4,5,8-tetraaminoanthraquinone; C.I. Disperse Blue 1 |
2475-45-8 |
Carc. 1B, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1 |
H350, H315, H318, H317 |
|
|
CLP00/ |
| 611-033-00-0 |
hexasodium [4,4''-azoxybis(2,2'-disulfonatostilbene-4,4'-diylazo)]-bis[5'-sulfonatobenzene-2,2'- diolato-O(2),O(2),N(1)]-copper(II) |
82027-60-9 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 611-034-00-6 |
N-(5-(bis(2-methoxyethyl)amino)-2-((5-nitro-2,1-benzisothiazol-3-yl)azo)phenylacetamide |
105076-77-5 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 611-035-00-1 |
tetralithium 6-amino-4-hydroxy-3-[7-sulfonato-4-(5-sulfonato-2-naphthylazo)-1-naphthylazo]naphthalene-2,7-disulfonate |
107246-80-0 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ATP01 |
| 611-036-00-7 |
2-(4-(5,6(or 6,7)-dichloro-1,3-benzothiazol-2-ylazo)-N-methyl-m-toluidino)ethyl acetate |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-037-00-2 |
3(or 5)-(4-(N-benzyl-N-ethylamino)-2-methylphenylazo)-1,4-dimethyl-1,2,4-triazolium methylsulphate |
124584-00-5 |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H302, H318, H317, H411 |
|
|
CLP00/ |
| 611-038-00-8 |
trisodium 1-hydroxynaphthalene-2-azo-4'(5',5''-dimethylbiphenyl)-4''-azo(4''-phenylsulfonyloxybenzene)- 2',2'',4-trisulfonate |
- |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 611-039-00-3 |
7-[((4,6-dichloro-1,3,5-triazin-2-yl)amino)-4-hydroxy-3-(4-((2-sulfoxy)ethyl)sulfonyl)phenylazo]naphthalene-2-sulfonic acid |
117715-57-8 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-040-00-9 |
3-(5-acetylamino-4-(4-[4,6-bis(3-diethylaminopropylamino)-1,3,5-triazin-2-ylamino]phenylazo)-2-(2-methoxyethoxy)phenylazo)-6-amino-4-hydroxy-2-naphthalenesulfonic acid |
115099-58-6 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 611-041-00-4 |
2-[[4[[4,6-bis[[3-(diethylamino)propyl]amino]-1,3,5-triazine-2-yl]amino]phenyl]azo]-N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-oxobutanamide |
98809-11-1 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H318, H317, H411 |
|
|
CLP00/ |
| 611-042-00-X |
trisodium 5-amino-3-[5-(2-bromoacryloylamino)-2-sulfonatophenylazo]-4-hydroxy-6-(4-vinylsulfonylphenylazo)naphthalene-2,7-disulfonate |
136213-71-3 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 611-043-00-5 |
reaction mass of: trisodium N(1')-N(2):N(1''')-N(2'')-η-6-[2-amino-4-(or 6)-hydroxy-(or 4-amino-2-hydroxy)phenylazo]-6''-(1-carbaniloyl-2-hydroxyprop-1-enylazo)-5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalene-2,1'-azobenzene-1,2'-diolato-O(1),O(2'))- |
- |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
CLP00/ |
| 611-044-00-0 |
reaction mass of: tert-alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-); tert-alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-); tert-alkyl(C12-C14)ammonium bis |
117527-94-3 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 611-045-00-6 |
2-[4-[N-(4-acetoxybutyl)-N-ethyl]amino-2-methylphenylazo]-3-acetyl-5-nitrothiophene |
- |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 611-046-00-1 |
4,4'-diamino-2-methylazobenzene |
43151-99-1 |
Acute Tox. 3 *, STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H373 **, H317, H400, H410 |
|
|
CLP00/ |
| 611-047-00-7 |
reaction mass of: 2-[[4-[N-ethyl-N-(2-acetoxyethyl)amino]phenyl]azo]-5,6-dichlorobenzothiazole; 2-[[4-[N-ethyl-N-(2-acetoxyethyl)amino]phenyl]azo]-6,7-dichlorobenzothiazole (1:1) |
111381-11-4 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 611-048-00-2 |
reaction mass of: 2-[[4-[bis(2-acetoxyethyl)amino]phenyl]azo]-5,6-dichlorobenzothiazole; 2-[[4-[bis(2-acetoxyethyl)amino]phenyl]azo]-6,7-dichlorobenzothiazole (1:1) |
111381-12-5 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 611-049-00-8 |
reaction mass of 7-[4-(3-diethylaminopropylamino)-6-(3-diethylammoniopropylamino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(4-phenylazophenylazo)-naphthalene-2-sulfonate, acetic acid, lactic acid (2:1:1) |
118658-98-3 |
STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 3 |
H373 **, H317, H412 |
|
|
CLP00/ |
| 611-050-00-3 |
reaction mass of: pentasodium 7-amino-3-[[4-[[4-[[4-[[4-[(6-amino-1-hydroxy-3-sulfonato-2-naphthyl)azo]-7-sulfonato-1-naphthyl]azo]phenyl]amino]-3-sulfonatophenyl]azo]-6-sulfonato-1-naphthyl]azo]-4-hydroxynaphthalen-2-sulfonate; pentasodium 7-amino-8-[4- |
- |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
ATP01/ |
| 611-051-00-9 |
2-(4-(N-ethyl-N-(2-hydroxy)ethyl)amino-2-methylphenyl)azo-6-methoxy-3-methyl-benzothiazolium chloride |
136213-74-6 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 611-052-00-4 |
monosodium aqua-[5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)azo]phenyl]azo]-2-naphthalensulfonate], iron complex |
- |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 611-053-00-X |
2,2'-azobis[2-methylpropionamidine] dihydrochloride |
2997-92-4 |
Acute Tox. 4 *, Skin Sens. 1 |
H302, H317 |
|
|
CLP00/ |
| 611-055-00-0 |
C.I. Disperse Yellow 3; N-[4-[(2-hydroxy-5-methylphenyl)azo]phenyl]acetamide |
2832-40-8 |
Carc. 2, Skin Sens. 1 |
H351, H317 |
|
|
CLP00/ |
| 611-056-00-6 |
C.I. Solvent Yellow 14; 1-phenylazo-2-naphthol |
842-07-9 |
Carc. 2, Muta. 2, Skin Sens. 1, Aquatic Chronic 4 |
H351, H341, H317, H413 |
|
|
CLP00/ |
| 611-057-00-1 |
6-hydroxy-1-(3-isopropoxypropyl)-4-methyl-2-oxo-5-[4-(phenylazo)phenylazo]-1,2-dihydro-3-pyridinecarbonitrile |
85136-74-9 |
Carc. 1B, Aquatic Chronic 4 |
H350, H413 |
|
|
CLP00/ |
| 611-058-00-7 |
(6-(4-hydroxy-3-(2-methoxyphenylazo)-2-sulfonato-7-naphthylamino)-1,3,5-triazin-2,4-diyl)bis[(amino-1-methylethyl)ammonium] formate |
108225-03-2 |
Carc. 1B, Eye Dam. 1, Aquatic Chronic 2 |
H350, H318, H411 |
|
|
CLP00/ |
| 611-059-00-2 |
octasodium 2-(6-(4-chloro-6-(3-(N-methyl-N-(4-chloro-6-(3,5-disulfonato-2-naphthylazo)-1-hydroxy-6-naphthylamino)-1,3,5-triazin-2-yl)aminomethyl)phenylamino)-1,3,5-triazin-2-ylamino)-3,5-disulfonato-1-hydroxy-2-naphthylazo)naphthalene-1,5-disulfonate |
148878-21-1 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
|
CLP00/ |
| 611-060-00-8 |
reaction mass of: sodium 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonatonaphthalen-2-ylazo] |
187285-15-0 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 611-061-00-3 |
disodium 5-[5-[4-(5-chloro-2,6-difluoropyrimidin-4-ylamino)benzamido]-2-sulfonatophenylazo]-1-ethyl-6-hydroxy-4-methyl-2-oxo-3-pyridylmethylsulfonate |
- |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
CLP00/ |
| 611-062-00-9 |
octasodium 2-(8-(4-chloro-6-(3-((4-chloro-6-(3,6-disulfonato-2-(1,5-disulfonatonaphthalen-2-ylazo)-1-hydroxynaphthalen-8-ylamino)-1,3,5-triazin-2-yl)aminomethyl)phenylamino)-1,3,5-triazin-2-ylamino)-3,6-disulfonato-1-hydroxynaphthalen-2-ylazo)naphthalene-1,5-disulfonate |
- |
Skin Irrit. 2, Eye Dam. 1 |
H315, H318 |
|
|
CLP00/ |
| 611-063-00-4 |
trisodium [4'-(8-acetylamino-3,6-disulfonato-2-naphthylazo)-4''-(6-benzoylamino-3-sulfonato-2-naphthylazo)-biphenyl-1,3',3'',1'''-tetraolato-O,O',O'',O''']copper(II) |
164058-22-4 |
Carc. 1B |
H350 |
|
|
CLP00/ |
| 611-064-00-X |
4-(3,4-dichlorophenylazo)-2,6-di-sec-butyl-phenol |
124719-26-2 |
STOT RE 2 *, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H373 **, H315, H400, H410 |
|
|
CLP00/ |
| 611-065-00-5 |
4-(4-nitrophenylazo)-2,6-di-sec-butyl-phenol |
111850-24-9 |
STOT RE 2 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H373 **, H319, H315, H317, H400, H410 |
|
|
CLP00/ |
| 611-066-00-0 |
tetrasodium 5-[4-chloro-6-(N-ethyl-anilino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(1,5-disulfonatonaphthalen-2-ylazo)-naphthalene-2,7-disulfonate |
130201-57-9 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H318, H317, H411 |
|
|
CLP00/ |
| 611-067-00-6 |
reaction mass of: bis(tris(2-(2-hydroxy(1-methyl)ethoxy)ethyl)ammonium) 7-anilino-4-hydroxy-3-(2-methoxy-5-methyl-4-(4-sulfonatophenylazo)phenylazo)naphthalene-2-sulfonate; bis(tris(2-(2-hydroxy(2-methyl)ethoxy)ethyl)ammonium) 7-anilino-4-hydroxy-3-(2-me |
- |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ATP01 |
| 611-068-00-1 |
tetrasodium 4-amino-3,6-bis(5-[4-chloro-6-(2-hydroxyethylamino)-1,3,5-triazin-2-ylamino]-2-sulfonatophenylazo)-5-hydroxynaphthalene-2,7-disulfonate |
85665-98-1 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 611-069-00-7 |
N,N-di-[poly(oxyethylene)-co-poly(oxypropylene)]-4-[(3,5-dicyano-4-methyl-2-thienyl)azo)]-3-methylaniline |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 611-070-00-2 |
reaction mass of: disodium (6-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)(1-(5-chloro-2-oxidophenylazo)-2-naphtholato)chromate(1-); trisodium bis(5-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)chr |
- |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 611-071-00-8 |
tris(tetramethylammonium) 5-hydroxy-1-(4-sulphonatophenyl)-4-(4-sulphonatophenylazo)pyrazole-3-carboxylate |
131013-81-5 |
Acute Tox. 3 *, Aquatic Chronic 3 |
H301, H412 |
|
|
CLP00/ |
| 611-072-00-3 |
2,4-bis[2,2'-[2-(N,N-dimethylamino)ethyloxycarbonyl]phenylazo]-1,3-dihydroxybenzene, dihydrochloride |
118208-02-9 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 2 |
H302, H318, H411 |
|
|
CLP00/ |
| 611-073-00-9 |
dimethyl 3,3'-(N-(4-(4-bromo-2,6-dicyanophenylazo)-3-hydroxyphenyl)imino)dipropionate |
122630-55-1 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 611-074-00-4 |
reaction mass of: sodium/potassium (3-(4-(5-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-2-methoxy-3-sulfonatophenylazo)-2-oxidophenylazo)-2,5,7-trisulfonato-4-naphtholato)copper(II); sodium/potassium (3-(4-(5-(5-chloro-4,6-difluoropyrimidin-2-ylamino)-2-m |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-075-00-X |
reaction mass of: tris(3,5,5-trimethylhexylammonium) 4-amino-3-(4-(4-(2-amino-4-hydroxyphenylazo)anilino)-3-sulfonatophenylazo)-5,6-dihydro-5-oxo-6-phenylhydrazononaphthalene-2,7-disulfonate; tris(3,5,5-trimethylhexylammonium) 4-amino-3-(4-(4-(4-amino-2- |
- |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 611-076-00-5 |
3-(2,6-dichloro-4-nitrophenylazo)-1-methyl-2-phenylindole |
117584-16-4 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 611-077-00-0 |
dilithium disodium (5,5'-diamino-(μ-4,4'-dihydroxy-1:2-κ-2,O4,O4',-3,3'-[3,3'-dihydroxy-1:2-κ-2-O3,O3'-biphenyl-4,4'-ylenebisazo-1:2-(N3,N4-η:N3',N4'-η)]-dinaphthalene-2,7-disulfonato(8)))dicuprate(2-) |
126637-70-5 |
Acute Tox. 4 *, Skin Sens. 1 |
H302, H317 |
|
|
CLP00/ |
| 611-078-00-6 |
(2,2'-(3,3'-dioxidobiphenyl-4,4'-diyldiazo)bis(6-(4-(3-(diethylamino)propylamino)-6-(3-(diethylammonio)propylamino)-1,3,5-triazin-2-ylamino)-3-sulfonato-1-naphtholato))dicopper(II) acetate lactate |
159604-94-1 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 611-079-00-1 |
disodium 7-[4-chloro-6-(N-ethyl-o-toluidino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(4-methoxy-2-sulfonatophenylazo)-2-naphthalenesulfonate |
147703-64-8 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 611-080-00-7 |
sodium 3-(2-acetamido-4-(4-(2-hydroxybutoxy)phenylazo)phenylazo)benzenesulfonate |
147703-65-9 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-081-00-2 |
tetrasodium [7-(2,5-dihydroxy-KO2-7-sulfonato-6-[4-(2,5,6-trichloro-pyrimidin-4-ylamino)phenylazo]-(N1,N7-N)-1-naphthylazo)-8-hydroxy-KO8-naphthalene-1,3,5-trisulfonato(6-)]cuprate(II) |
141048-13-7 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 611-082-00-8 |
reaction mass of: pentasodium bis(1-(3(or 5)-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2-naphtholato)ferrate(1-); pentasodium [(1-(3-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2 |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 611-083-00-3 |
reaction mass of: 2-[N-ethyl-4-[(5,6-dichlorobenzothiazol-2-yl)azo]-m-toludino]ethyl acetate; 2-[N-ethyl-4-[(6,7-dichlorobenzothiazol-2-yl)azo]-m-toludino]ethyl acetate (1:1) |
- |
STOT RE 1, Skin Sens. 1, Aquatic Chronic 2 |
H372 **, H317, H411 |
|
|
CLP00/ |
| 611-085-00-4 |
reaction mass of: 3-cyano-5-(2-cyano-4-nitro-phenylazo)-2-(2-hydroxy-ethylamino)-4-methyl-6-[3-(2-phenoxyethoxy)propylamino]pyridine; 3-cyano-5-(2-cyano-4-nitro-phenylazo)-6-(2-hydroxy-ethylamino)-4-methyl-2-[3-(2-phenoxyethoxy)propylamino]pyridine; 3-c |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 611-086-00-X |
monolithium 5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)azo]phenyl]azo]-2-naphthalenesulfonate], iron complex, monohydrate |
- |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 611-087-00-5 |
reaction mass of: 3-((5-cyano-1,6-dihydro-1,4-dimethyl-2-hydroxyl-6-oxo-3-pyridinyl)azo)-benzoyloxy-2-phenoxyethane; 3-((5-cyano-1,6-dihydro-1,4-dimethyl-2-hydroxy-6-oxo-3-pyridinyl)azo)-benzoyloxy-2-ethyloxy-2-(ethylphenol) |
- |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 611-088-00-0 |
reaction mass of: trilithium 4-amino-3-((4-((4-((2-amino-4-hydroxyphenyl)azo)phenyl)amino)-3-sulfophenyl)azo)-5-hydroxy-6-(phenylazo)naphthalene-2,7-disulfonate; trilithium 4-amino-3-((4-((4-((4-amino-2-hydroxyphenyl)azo)phenyl)amino)-3-sulfophenyl)azo)- |
- |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 3 |
H302, H318, H412 |
|
|
CLP00/ |
| 611-089-00-6 |
2-((4-(ethyl-(2-hydroxyethyl)amino)-2-methylphenyl)azo)-6-methoxy-3-methyl-benzothiazolium methylsulfate |
136213-73-5 |
STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H373 **, H317, H400, H410 |
|
|
CLP00/ |
| 611-090-00-1 |
2,5-dibutoxy-4-(morpholin-4-yl)benzenediazonium 4-methylbenzenesulfonate |
93672-52-7 |
Self-react. C, Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H242, H302, H318, H317, H412 |
|
T |
CLP00/ |
| 611-091-00-7 |
sodium (1.0-1.95)/lithium (0.05-1) 5-((5-((5-chloro-6-fluoro-pyrimidin-4-yl)amino)-2-sulfonatophenyl)azo)-1,2-dihydro-6-hydroxy-1,4-dimethyl-2-oxo-3-pyridinemethylsulfonate |
134595-59-8 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-092-00-2 |
tert-(dodecyl/tetradecyl)-ammonium bis(3-(4-((5-(1,1-dimethyl-propyl)-2-hydroxy-3-nitrophenyl)azo)-3-methyl-5-hydroxy-(1H)pyrazol-1-yl)benzenesulfonamidato)chromate |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 611-093-00-8 |
sodium 2-(4-(4-fluoro-6-(2-sulfo-ethylamino)-[1,3,5]triazin-2-ylamino)-2-ureido-phenylazo)-5-(4-sulfophenylazo)benzene-1-sulfonate |
146177-84-6 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-094-00-3 |
reaction mass of: 2-[2-acetylamino-4-[N,N-bis[2-ethoxy-carbonyloxy)ethyl]amino]phenylazo]-5,6-dichloro-1,3-benzothiazole; 2-[2-acetylamino-4-[N,N-bis[2-ethoxy-carbonyloxy)ethyl]amino]phenylazo]-6,7-dichloro-1,3-benzotriazole (1:1) |
143145-93-1 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 611-095-00-9 |
hexasodium 1,1'-[(1-amino-8-hydroxy-3,6-disulfonate-2,7-naphthalenediyl)bis(azo(4-sulfonate-1,3-phenyl)imino[6-[(4-chloro-3-sulfonatophenyl)amino]-1,3,5-triazin-2,4-diyl]]]bis[3-carboxypyridinium] dihydroxide |
89797-03-5 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 611-096-00-4 |
methyl N-[3-acetylamino)-4-(2-cyano-4-nitrophenylazo)phenyl]-N-[(1-methoxy)acetyl]glycinate |
149850-30-6 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-097-00-X |
reaction mass of iron complexes of: 1,3-dihydroxy-4-[(5-phenylaminosulfonyl)-2-hydroxyphenylazo]-n-(5-amino-sulfonyl-2-hydroxyphenylazo)benzene and: 1,3-dihydroxy-4-[(5-phenylaminosulfonyl)-2-hydroxyphenylazo]-n-[4-(4-nitro-2-sulfophenylamino)phenylazo]benzene (n=2,5,6) |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 611-098-00-5 |
tetrakis(tetramethylammonium)3,3'-(6-(2-hydroxyethylamino)1,3,5-triazine-2,4-diylbisimino(2-methyl-4,1-phenyleneazo))bisnaphthalene-1,5-disulfonate |
131013-83-7 |
Acute Tox. 3 *, Aquatic Chronic 3 |
H301, H412 |
|
|
CLP00/ |
| 611-099-00-0 |
(methylenebis(4,1-phenylenazo(1-(3-(dimethylamino)propyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3-diyl)))-1,1'-dipyridinium dichloride dihydrochloride |
118658-99-4 |
Carc. 1B, Aquatic Chronic 2 |
H350, H411 |
|
|
CLP00/ |
| 611-100-00-4 |
potassium sodium 3,3'-(3(or4)-methyl-1,2-phenylenebis(imino(6-chloro)-1,3,5-triazine-4,2-diylimino(2-acetamido-5-methoxy)-4,1-phenylenazo)dinaphthalene-1,5-disulfonate |
140876-13-7 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 611-101-00-X |
2'-(4-chloro-3-cyano-5-formyl-2-thienyl)azo-5'-diethylaminoacetanilide |
104366-25-8 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-102-00-5 |
reaction product of: C.I. Leuco Sulfur Black 1 and reaction mass of: disodium-4-{4-[8-amino-1-hydroxy-7-(4-sulfamoylphenylazo)-3,6-disulfonato-2-naphthylazo]phenylsulfonylamino}benzendiazoniumchlorid; disodium-4-{4-[2,6-dihydroxy-3-(8-hydroxy-3,6-disulfo |
- |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 611-103-00-0 |
trisodium (1-(3-carboxylato-2-oxido-5-sulfonatophenylazo)-5-hydroxy-7-sulfonatonaphthalen-2-amido)nickel(II) |
- |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H318, H317, H411 |
|
|
CLP00/ |
| 611-104-00-6 |
reaction mass of: trisodium (2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(or 4or 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(or 2or 6)-(4-(4-nitro-2-sulfonatoanilino)phenylazo)phenolato)ferrate(1-); trisodium bis(2,4(or 2, |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 611-105-00-1 |
sodium 4-(4-chloro-6-(N-ethylanilino)-1,3,5-triazin-2-ylamino)-2-(1-(2-chlorophenyl)-5-hydroxy-3-methyl-1H-pyrazol-4-ylazo)benzenesulfonate |
136213-75-7 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 611-106-00-7 |
hexasodium 4,4'-dihydroxy-3,3'-bis[2-sulfonato-4-(4-sulfonatophenylazo)phenylazo]-7,7'[p-phenylenebis[imino(6-chloro-1,3,5-triazine-4,2-diyl)imino]]dinaphthalene-2-sulfonate |
157627-99-1 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 611-107-00-2 |
potassium sodium 4-(4-chloro-6-(3,6-disulfonato-7-(5,8-disulfonato-naphthalen-2-ylazo)-8-hydroxy-naphthalen-1-ylamino)-1,3,5-triazin-2-ylamino)-5-hydroxy-6-(4-(2-sulfatoethanesulfonyl)-phenylazo)-naphthalene-1,7-disulfonate |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-108-00-8 |
disodium 5-((4-((4-chloro-3-sulfonatophenyl)azo)-1-naphthyl)azo)-8-(phenylamino)-1-naphthalenesulfonate |
6527-62-4 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 611-109-00-3 |
Reaction products of: copper(II) sulfate and tetrasodium 2,4-bis[6-(2-methoxy-5-sulfonatophenylazo)-5-hydroxy-7-sulfonato-2-naphthylamino]-6-(2-hydroxyethylamino)-1,3,5-triazine (2:1) |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 611-110-00-9 |
tetra-sodium/lithium 4,4'-bis-(8-amino-3,6-disulfonato-1-naphthol-2-ylazo)-3-methylazobenzene |
124605-82-9 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 611-111-00-4 |
disodium 2-[[4-(2-chloroethylsulfonyl)phenyl]-[(2-hydroxy-5-sulfo-3-[3-[2-(2-(sulfooxy)ethylsulfonyl)ethylazo]-4-sulfobenzoato(3-)cuprate(1-) |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-112-00-X |
tetrasodium 4-hydroxy-5-[4-[3-(2-sulfatoethanesulfonyl)phenylamino]-6-morpholin-4-yl-1,3,5-triazin-2-ylamino]-3-(1-sulfonatonaphthalen-2-ylazo)naphthalene-2,7-disulfonate |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-113-00-5 |
lithium sodium (2-(((5-((2,5-dichlorophenyl)azo)-2-hydroxyphenyl)methylene)amino)benzoato(2-))(2-((4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo)-5-sulfobenzoato(3-)) chromate(2-) |
149626-00-6 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 611-114-00-0 |
lithium sodium (4-((5-chloro-2-hydroxyphenyl)azo)-2,4-dihydro-5-methyl-3H-pyrazol-3-onato(2-))(3-((4,5-dihydro-3-methyl-1-(4-methylphenyl)-5-oxo-1H-pyrazol-4-yl)azo)-4-hydroxy-5-nitrobenzenesulfonato(3-)) chromate(2-) |
149564-66-9 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 3 |
H302, H318, H412 |
|
|
CLP00/ |
| 611-115-00-6 |
trilithium bis(4-((4-(diethylamino)-2-hydroxyphenyl)azo)-3-hydroxy-1-naphthalenesulfonato(3-))chromate(3-) |
149564-65-8 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 611-116-00-1 |
reaction mass of: trisodium 5-{}{4-chloro-6-[2-(2,6-dichloro-5-cyanopyrimidin-4-ylamino)-propylamino]-1,3,5-triazin-2-ylamino}}-4-hydroxy-3-(1-sulfonatonaphthalene-2-ylazo)-naphthalene-2,7-disulfonate; trisodium 5-{}{4-chloro-6-[2-(2,6-dichloro-5-cyanopy |
- |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
CLP00/ |
| 611-117-00-7 |
1,3-bis{}{6-fluoro-4-[1,5-disulfo-4-(3-aminocarbonyl-1-ethyl-6-hydroxy-4-methyl-pyrid-2-on-5-ylazo)-phenyl-2-ylamino]-1,3,5-triazin-2-ylamino}}propane lithium-, sodium salt |
149850-29-3 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-118-00-2 |
sodium 1,2-bis[4-[4-{}{4-(4-sulfophenylazo)-2-sulfophenylazo}}-2-ureido-phenyl-amino]-6-fluoro-1,3,5-triazin-2-ylamino]-propane, sodium salt |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 611-119-00-8 |
tetrasodium 4-[4-chloro-6-(4-methyl-2-sulfophenylamino)-1,3,5-triazin-2-ylamino]-6-(4,5-dimethyl-2-sulfophenylazo)-5-hydroxynaphthalene-2,7-disulfonate |
148878-22-2 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
CLP00/ |
| 611-120-00-3 |
5-{}{4-[5-amino-2-[4-(2-sulfoxyethylsulfonyl)phenylazo]-4-sulfo-phenylamino]-6-chloro-1,3,5-triazin-2-ylamino}}-4-hydroxy-3-(1-sulfo-naphthalen-2-ylazo)-naphthalene-2,7-disulfonicacid sodium salt |
157707-94-3 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
CLP00/ |
| 611-121-00-9 |
Main component 6 (isomer): asym. 1:2 Cr(III)-complex of: A: 3-hydroxy-4-(2-hydroxy-naphthalene-1-ylazo)naphthalene-1-sulfonic acid, Na-salt and B: 1-[2-hydroxy-5-(4-methoxy-phenylazo)phenylazo]naphthalene-2-ol; Main component 8 (isomer): asym. 1:2 Cr-com |
30785-74-1 |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
CLP00/ |
| 611-122-00-4 |
hexasodium (di[N-(3-(4-[5-(5-amino-3-methyl-1-phenylpyrazol-4-yl-azo)-2,4-disulfo-anilino]-6-chloro-1,3,5-triazin-2-ylamino)phenyl)-sulfamoyl](di-sulfo)-phthalocyaninato)nickel |
151436-99-6 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
CLP00/ |
| 611-123-00-X |
3-(2,4-bis(4-((5-(4,6-bis(2-aminopropylamino)-1,3,5-triazin-2-ylamino)-4-hydroxy-2,7-disulfonaphthalen-3-yl)azo)phenylamino)-1,3,5-triazin-6-ylamino)propyldiethylammonium lactate |
178452-66-9 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 611-124-00-5 |
reaction mass of: pentasodium 5-amino-3-(5-{}{4-chloro-6-[4-(2-sulfoxyethoxysulfonato)phenylamino]-1,3,5-triazin-2-ylamino}}-2-sulfonatophenylazo)-6-[5-(2,3-dibromopropionylamino)-2-sulfonatophenylazo]-4-hydroxynaphthalene-2,7-disulfonate; pentasodium 5- |
- |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 611-125-00-0 |
reaction mass of: Disodium 6-[3-carboxy-4,5-dihydro-5-oxo-4-sulfonatophenyl)pyrazolin-4-yl-azo]-3-[2-oxido-4-(ethensulfonyl)-5-methoxyphenylazo]-4-oxidonaphthalene-2-sulfonate copper (II) complex; Disodium 6-[3-carboxy-4,5-dihydro-5-oxo-4-sulfonatophenyl |
- |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 611-126-00-6 |
2,6-bis-(2-(4-(4-amino-phenylamino)-phenylazo)-1,3-dimethyl-3H-imidazolium)-4-dimethylamino-1,3,5-triazine, dichloride |
174514-06-8 |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
CLP00/ |
| 611-127-00-1 |
pentasodium 4-amino-6-(5-(4-(2-ethyl-phenylamino)-6-(2-sulfatoethanesulfonyl)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxy-3-(4-(2-sulfatoethanesulfonyl)phenylazo)naphthalene-2,7-disulfonate |
- |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
G |
CLP00/ |
| 611-128-00-7 |
N,N'-bis{}{6-chloro-4-[6-(4-vinylsulfonylphenylazo)-2,7-disulfonicacid-5-hydroxynapht-4-ylamino]-1,3,5-triazin-2-yl}}-N-(2-hydroxyethyl)ethane-1,2-diamine, sodium salt |
171599-85-2 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
CLP00/ |
| 611-129-00-2 |
reaction mass of: 5-[(4-[(7-amino-1-hydroxy-3-sulfo-2-naphthyl)azo]-2,5-diethoxyphenyl)azo]-2-[(3-phosphonophenyl)azo]benzoic acid; 5-[(4-[(7-amino-1-hydroxy-3-sulfo-2-naphthyl)azo]-2,5-diethoxyphenyl)azo]-3-[(3-phosphonophenyl)azo]benzoic acid |
163879-69-4 |
Expl. 1.3 ****, Repr. 2, STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 2 |
H203, H361f ***, H373 **, H317, H411 |
|
|
CLP00/ |
| 611-130-00-8 |
tetra-ammonium 2-[6-[7-(2-carboxylato-phenylazo)-8-hydroxy-3,6-disulfonato-1-naphthylamino]-4-hydroxy-1,3,5-triazin-2-ylamino]benzoate |
183130-96-3 |
Eye Irrit. 2, Aquatic Chronic 3 |
H319, H412 |
|
|
CLP00/ATP01 |
| 611-131-00-3 |
2-[2-hydroxy-3-(2-chlorophenyl)carbamoyl-1-naphthylazo]-7-[2-hydroxy-3-(3-methylphenyl)carbamoyl-1-naphthylazo]fluoren-9-one |
151798-26-4 |
Repr. 1B, Aquatic Chronic 4 |
H360D ***, H413 |
|
|
CLP00/ |
| 611-132-00-9 |
pentasodium bis{}{7-[4-(1-butyl-5-cyano-1,2-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo)phenylsulfonylamino]-5'-nitro-3,3'-disulfonatonaphthalene-2-azobenzene-1,2'-diolato}} chromate (III) |
178452-71-6 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
CLP00/ |
| 611-133-00-4 |
Product by process iron complex of azo dyestuffs obtained by coupling a mixture of diazotized 2-amino-1-hydroxybenzene-4-sulfanilide and 2-amino-1-hydroxybenzene-4-sulfonamide with resorcin, the obtained mixture being subsequently submitted to a second coupling reaction with a mixture of diazotized 3-aminobenzene-1-sulfonic acid (metanilic acid) and 4'-amino-4-nitro-1,1'-diphenylamine-2-sulfonic acid and metallization with ferric chloride, sodium salt |
- |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 611-134-00-X |
trisodium 2-{}{α[2-hydroxy-3-[4-chloro-6-[4-(2,3-dibromopropionylamino)-2-sulfonatophenylamino]-1,3,5-triazin-2-ylamino]-5-sulfonatophenylazo]-benzylidenehydrazino}}-4-sulfonatobenzoate, copper complex |
- |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
CLP00/ |
| 611-135-00-5 |
Reaction product of: 2-[[4-amino-2-ureidophenylazo]-5-[(2-(sulfooxy)ethyl)sulfonyl]]benzenesulfonic acid with 2,4,6-trifluoropyrimidine and partial hydrolysis to the corresponding vinylsulfonyl derivative,mixed potassium/sodium salt |
- |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
CLP00/ |
| 611-136-00-0 |
2-{}{4-(2-ammoniopropylamino)-6-[4-hydroxy-3-(5-methyl-2-methoxy-4-sulfamoylphenylazo)-2-sulfonatonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}}-2-aminopropyl formate |
- |
Repr. 2, Eye Dam. 1, Aquatic Chronic 2 |
H361f ***, H318, H411 |
|
|
CLP00/ |
| 611-137-00-6 |
6-tert-butyl-7-chloro-3-tridecyl-7,7a-dihydro-1H-pyrazolo[5,1-c]-1,2,4-triazole |
159038-16-1 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 611-138-00-1 |
2-(4-aminophenyl)-6-tert-butyl-1H-pyrazolo[1,5-b][1,2,4]triazole |
152828-25-6 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 611-139-00-7 |
reaction product of: C.I. Leuco Sulfur Black 1 with (3-chloro-2-hydroxypropyl)trimethylammonium chloride |
- |
Eye Dam. 1, Aquatic Chronic 2 |
H318, H411 |
|
|
ATP01/ |
| 611-140-00-2 |
azafenidin (ISO); 2-(2,4-dichloro-5-prop-2-ynyloxyphenyl)-5,6,7,8-tetrahydro-1,2,4-triazolo[4,3-a]pyridin-3(2H)-one |
68049-83-2 |
Repr. 1B, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H360Df, H373 **, H400, H410 |
M = 1000: |
|
CLP00/ |
| 611-141-00-8 |
5-(4-[4-[4-(3,5-dicarboxy-phenyl-azo)phenylamino]-6-morpholin-4-yl-1,3,5-triazin-2-ylamino]phenylazo)isophthalic acid, mixed monosodium and diammonium salt |
- |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
ATP01/ |
| 611-142-00-3 |
product-by-process definition polyazodyestuff obtained by coupling 4-[4-(1-amino-8-hydroxy-3,6-disulfo-2-naphthylazo)phenylsulfonylamino]benzenediazonium with reaction mass of 4-carboxybenzenediazonium and diphenylamine-3-sulfo-4,4'-bisdiazonium, and furt |
- |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
ATP01/ |
| 611-143-00-9 |
reaction mass of: trisodium 2-(2-[α-(2-carboxylato-κ-O-4-sulfonatophenylazo)benzylidene]hydrazino-κ-N')-6-(2,6-difluoropyrimidin-4-ylamino)-4-sulfonatophenolatocuprate (II); trisodium 2-(2-[α-(2-carboxylato-κ-O-4-sulfonatophenylazo)benzylidene]hydrazino- |
- |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 611-144-00-4 |
reaction mass of: 7-amino-3,8-bis-[4-(2-sulfoxyethylsulfonyl)phenylazo]-4-hydroxynaphthalene-2-sulfonic acid, Na/K salt; 7-amino-3-[4-(2-sulfoxyethylsulfonyl)phenylazo]-4-hydroxy-8-[4-(2-sulfoxyethylsulfonyl)-2-sulfophenylazo]naphthalene-2-sulfonic acid, |
214362-06-8 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 611-145-00-X |
reaction mass of: tetrasodium 3-(1,5-disulfonatonaphthalene-2-ylazo)-4-hydroxy-7-{4-chloro-6-[4-(2-sulfoxyethylsulfonyl)phenylamino]-1,3,5-triazine-2-ylamino}naphthalene-2-sulfonate; 3-(2,5-disulfophenylazo)-4-hydroxy-7-{4-chloro-6-[4-(2-sulfoxyethylsulf |
- |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 611-146-00-5 |
reaction mass of: pentasodium 3-(4-(4-(7-(2,4-diamino-5-sulfonato-3-(4-sulfonatophenylazo)phenylazo)-1-hydroxy-3-sulfonatonaphthalen-2-ylazo)-2-sulfonatophenylamino)phenylazo)-4-hydroxy-6-(2-oxo-1-phenylcarbamoylpropylazo)naphthalene-2-sulfonate; pentaso |
- |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 611-147-00-0 |
sodium, potassium, lithium 5-amino-3,6-bis(5-(4-chloro-6-(methyl-(2-methylaminoacetyl)amino)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-4-hydroxynaphthalene-2,7-disulfonate |
205764-96-1 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
ATP01/ |
| 611-148-00-6 |
reaction mass of: 2-(3-(2,6-dichloro-4-nitrophenylazo)carbazol-9-yl)ethanol; 2-(2-(3-(2,6-dichloro-4-nitro-phenylazo)-carbazol-9-yl)-ethoxy)ethanol; 3-(2,6-dichloro-4-nitrophenylazo)carbazol |
- |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
ATP01/ |
| 611-149-00-1 |
2-(2-chloroacetoxy)ethyl 3-((4-(2,5-dichloro-4-fluorosulfonylphenylazo)-3-methylphenyl)ethylamino)propionate |
193486-83-8 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 611-150-00-7 |
tetralithium 2-[6-[7-[2-(carboxylato)phenylazo]-8-hydroxy-3,6-disulfonato-1-naphthylamino]-4-hydroxy-1,3,5-triazine-2-ylamino]benzoate |
- |
Eye Irrit. 2, Aquatic Chronic 3 |
H319, H412 |
|
|
ATP01/ |
| 611-151-00-2 |
chrysoidine; 4-(phenylazo)benzene-1,3-diamine |
495-54-5 |
Muta. 2, Acute Tox. 4 *, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H341, H302, H315, H400, H410 |
|
|
ATP01/ |
| 611-152-00-8 |
chrysoidine monohydrochloride; 4-phenylazophenylene-1,3-diamine monohydrochloride; [1] chrysoidine monoacetate; 4-(phenylazo)benzene-1,3-diamine monoacetate; [2] chrysoidine acetate; 4-(phenylazo)benzene-1,3-diamine acetate; [3] chrysoidine-p-dodecy |
532-82-1 [1], 75660-25-2 [2], 79234-33-6 [3], 63681-54-9 [4], 83968-67-6 [5], 84196-22-5 [6] |
Muta. 2, Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H341, H302, H315, H318, H400, H410 |
|
|
ATP01/ |
| 611-153-00-3 |
chrysoidine C10-14-alkyl derivatives; benzenesulfonic acid, mono-C10-14-alkyl derivatives, compounds with 4-(phenylazo)-1,3-benzenediamine; [1] chrysoidine compound with dibutylnaphthalene sulfonic acid; dibutylnaphthalenesulfonic acid, compound with 4 |
85407-90-5 [1], 94247-67-3 [2] |
Muta. 2, Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1 |
H341, H302, H315, H318 |
|
|
ATP01/ |
| 611-154-00-9 |
trisodium 5-benzamido-4-hydroxy-3-(4-methyl-2-sulfonatophenylazo)naphthalene-2,7-disulfonate |
92408-46-3 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 611-155-00-4 |
4,4'-oxybis(benzenesulfonylazide) |
7456-68-0 |
Expl. 1.1****, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H201, H373**, H400, H410 |
|
|
ATP01/ |
| 611-156-00-X |
triammonium 4-[4-[7-(4-carboxylatoanilino)-1-hydroxy-3-sulfonato-2-naphthylazo]-2,5-dimethoxyphenylazo]benzoate |
221354-37-6 |
Repr. 2, STOT RE 2 *, Aquatic Chronic 2 |
H361f***, H373**, H411 |
|
|
ATP01/ |
| 611-157-00-5 |
benzenesulfonic acid, 3,3'-(methylenebis((dihydroxyphenylene)azo))bis-, potassium sodium salt; potassium sodium 3-[(E)-(6-{3,4-dihydroxy-2-[(Z)-(3-sulfonatophenyl)diazenyl]benzyl}-2,3-dihydroxyphenyl)diazenyl]benzenesulfonate |
243869-48-9 |
Eye Irrit. 2, Aquatic Chronic 3 |
H319, H412 |
|
|
ATP01/ |
| 611-158-00-0 |
reaction product of: 2,3,4,2',3',4'-hexahydroxy-5,5'-diacethyl-diphenylmethane and 6-diazo-5,6-dihydro-5-oxo-1-naphthalenesulfonylchloride and 3-diazo-3,4-dihydro-6-methoxy-4-oxo-1-naphthalenesulfonylchloride |
- |
****, Aquatic Chronic 4 |
****, H413 |
|
|
ATP01/ |
| 611-160-00-1 |
reaction mass of: 1,1,1-tris(phenyl-4'-(3''-diazo-3'',4''-dihydro-4''-oxo-naphthalene-1''-sulfonato)ethane; 1,1,1-tris(phenyl-4'-(6''-diazo-5'',6''-dihydro-5''-oxo-naphthalene-1''-sulfonato)ethane; reaction product of 1,1,1-tris(p-hydroxyphenyl)ethane w |
- |
****, Aquatic Chronic 4 |
****, H413 |
|
|
ATP01/ |
| 611-161-00-7 |
trisodium [1,2'-(2-(8-amino-3,5-disulfonatonaphthalene)azo)-(4'-nitrobenzene)diolato-O,O,N][(Z)-2,2-((phenylcarbamoylprop-1'-enyl)azo)-5-sulfamoylbenzene)diolato-O,O,N]chromate(III) |
- |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 611-162-00-2 |
2,4-bis(((2-(dimethylammonio)ethyloxy)carbonyl)phen-2-ylazo)benzene-1,3-diolbis(methanesulfonate) |
- |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 2 |
H302, H318, H411 |
|
|
ATP01/ |
| 611-163-00-8 |
2,4-bis(((2-(dimethylammonio)ethyloxy)carbonyl)phen-2-ylazo)benzene-1,3-diol sulfate |
- |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 2 |
H302, H318, H411 |
|
|
ATP01/ |
| 611-164-00-3 |
reaction mass of: 2,2'-dimethyl-2,2'-azobutanenitrile; 2-methylpentanenitrile-2-azo-2'-(2'-methylpropanenitrile); 2,2'-dimethyl-2,2'-azoheptanenitrile; 2-methylheptanenitrile-2-azo-2'-(2'-methylpropanenitrile); 2-methylheptanenitrile-2-azo-2'-(2'-meth |
- |
Self React D, Acute Tox. 4 *, Aquatic Chronic 2 |
H242, H302, H411 |
|
|
ATP01/ |
| 611-165-00-9 |
reaction mass of: tetrasodium 4-amino-6-(5-(2,6-difluoropyrimidin-4-ylamino)-2-sulfonatophenylazo)-5-hydroxy-3-(4-(sulfatoethylsulfonyl)phenylazo)naphthalene-2,7-disulfonate; tetrasodium 4-amino-6-(5-(4,6-difluoropyrimidin-2-ylamino)-2-sulfonatophenylazo |
- |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 611-166-00-4 |
reaction mass of: pentasodium 4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-6-{(E)-2-sulfonato-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}naphthalene-2,7-disulfonate; tetrasodium 4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsul |
- |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
ATP01/ |
| 611-167-00-X |
sodium bis[tris(2-hydroxyethyl)ammonium][6-anilino-4'-(4,8-disulfonato-2-naphthylazo)-5'-methyl-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato]cuprate(II) |
- |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 611-168-00-5 |
reaction mass of: 3-[[4-chloro-6-[[7-[(1,5-disulfo-2-naphthalenyl)azo]-8-hydroxy-3,6-disulfo-1-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]-5-[[4-chloro-6-[[8-hydroxy-3,6-disulfo-7-[(2-sulfophenyl)azo]-1-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]benzo |
- |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 611-169-00-0 |
sodium 5-(2-carboxyphenylazo)-6-hydroxynaphthalene-2-sulfonate |
- |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 611-170-00-6 |
reaction mass of: trisodium 2-((1-(2-hydroxy-κ-O-5-(2-sulfonatoethansulfonyl)phenylazo-κ-N2)-1-phenylmethyl)azo-κ-N1)-4-sulfonatobenzoate(5-)-κ-O)cuprate(II); disodium 2-((1-(5-ethenesulfonyl-2-hydroxy-κ-O-phenylazo-κ-N2)-1-phenylmethyl)azo-κ-N1)-4-sulfo |
- |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 611-171-00-1 |
reaction mass of: trisodium 3-(5-(2,6-difluoropyrimidin-4-ylamino)-2-sulfonatophenylazo)-5-(4-fluoro-6-morpholin-4-yl-1,3,5-triazin-2-ylamino)-4-hydroxy-2,7-naphthalenedisulfonate; trisodium 3-(5-(4,6-difluoropyrimidin-2-ylamino)-2-sulfonatophenylazo)-5- |
- |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
ATP01/ |
| 611-172-00-7 |
reaction mass of: triammonium 6-amino-3-((2,5-diethoxy-4-(3-phosphonophenyl)azo)phenyl)azo-4-hydroxy-2-naphthalenesulfonate; diammonium 3-((4-((7-amino-1-hydroxy-3-sulfo-naphthalen-2-yl)azo)-2,5-diethoxyphenyl)azo)benzoate |
- |
Self-react. C****, Repr. 2, Acute Tox. 4 *, STOT RE 2 *, Aquatic Chronic 3 |
H242, H361f***, H302, H373**, H412 |
|
|
ATP01/ |
| 611-173-00-2 |
reaction mass of: 3-[3-carbamoyl-5-(5-{4-chloro-6-[4-(2-sulfonatooxyethylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-1-pyridyl]propanoic acid, trisodium salt; 3-[3-carbamoyl-5-(5-{4-chloro-6-[4-(v |
- |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
ATP01/ |
| 611-174-00-8 |
reaction mass of: 3-[5-(4-ethenesulfonylbutyrylamino)-2-sulfophenylazo]-5-{4-chloro-[6-(4-(3-amino-5-hydroxy-2,7-disulfonaphthalene-4-ylazo)-3-sulfophenylamino]-1,3,5-triazin-2-ylamino}-4-hydroxynaphthalene-2,7-disulfonic acid, sodium salt; 3-[5-(4-(2-ch |
457624-86-1 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 611-175-00-3 |
reaction mass of: trisodium 5-{4-chloro-6-[N-ethyl-(3-(2-sulfonatooxy)ethylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-[4-(vinylsulfonyl)phenylazo]naphthalene-2,7-disulfonate; trisodium 5-{4-chloro-6-[N-ethyl-3-(vinylsulfonyl)anilino]-1,3,5-tr |
- |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
ATP01/ |
| 611-176-00-9 |
2,6-bis(2,3,4-trihydroxybenzyl)-p-cresol ester with 6-diazo-5,6-dihydro-5-oxo-1-naphthalenesulfonate |
- |
Self-react. C****, Aquatic Chronic 2 |
H242, H411 |
|
|
ATP01/ |
| 611-177-00-4 |
reaction mass of: pentasodium bis[6-anilino-3,5'-disulfonatonaphthalene-2-azobenzene-1,2'-diolato]cobaltate(III); tetrasodium [6-anilino-3,5'-disulfonatonaphthalene-2-azobenzene-1,2'-diolato][6-anilino-5'-sulfamoyl-3-sulfonatonaphthalene-2-azobenzene-1, |
508202-43-5 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
|
ATP01/ |
| 611-178-00-X |
reaction mass of: pentasodium 4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-6-{(E)-2-sulfonato-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}naphthalene-2,7-disulfonate; tetrasodium 4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsul |
- |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
|
ATP01/ |
| 611-179-00-5 |
reaction mass of: pentasodium 2-[[8-[[4-chloro-6-[[4-(2-sulfonato ethylsulfonyl)]phenyl]amino]-1,3,5-triazin-2-yl]amino-1- hydroxy-3,6-disulfonato-2-naphthalenyl]azo]naphthalene-1,5-disulfonate; 2-[[8-[[4-chloro-6-[[4-[[2-ethenyl]sulfonyl]phenyl]amino]-1 |
- |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
ATP01/ |
| 611-180-00-0 |
iron, complexes with diazotised 4-aminobenzenesulfonamide,diazotised 3-aminobenzenesulfonic acid, diazotised 3-amino-4-hydroxybenzenesulfonamide,diazotised 3-amino-4-hydroxy-N-phenylbenzenesulfonamide, diazotised 5-amino-2-(phenylamino)benzenesulfonic acid and resorcinol, sodium salts |
- |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 611-181-00-6 |
potassium (oxido-NNO-azoxy)cyclohexane; cyclohexylhydroxydiazene 1-oxide, potassium salt; [K-HDO] |
66603-10-9 |
Flam. Sol. 1, Acute Tox. 3, STOT RE 2, Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 2 |
H228, H301, H373 (liver), H315, H318, H411 |
Oral: ATE = 136 mg/kg |
|
ATP15 |
| 612-001-00-9 |
mono-methylamine; [1] di-methylamine; [2] tri-methylamine [3] |
74-89-5 [1], 124-40-3 [2], 75-50-3 [3] |
Flam. Gas 1, Press. Gas, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1 |
H220, H332, H335, H315, H318 |
*, Skin Irrit. 2; H315: C ≥ 5 %, Eye Dam. 1; H318: C ≥ 5 %, Eye Irrit. 2; H319: 0,5 % ≤ C < 5 %, STOT SE 3; H335: C ≥ 5 % |
U 5 |
CLP00/ |
| 612-001-01-6 |
mono-methylamine ... %; [1] di-methylamine ... %; [2] tri-methylamine ... % [3] |
74-89-5 [1], 124-40-3 [2], 75-50-3 [3] |
Flam. Liq. 1, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H224, H332, H302, H314 |
*, STOT SE 3; H335: C ≥ 5 % |
B |
CLP00/ |
| 612-002-00-4 |
ethylamine |
75-04-7 |
Flam. Gas 1, Press. Gas, Eye Irrit. 2, STOT SE 3 |
H220, H319, H335 |
|
U |
CLP00/ |
| 612-003-00-X |
diethylamine |
109-89-7 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1A |
H225, H332, H312, H302, H314 |
STOT SE 3; H335: C ≥ 1 % |
|
CLP00/ |
| 612-004-00-5 |
triethylamine |
121-44-8 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1A |
H225, H332, H312, H302, H314 |
STOT SE 3; H335: C ≥ 1 % |
|
CLP00/ |
| 612-005-00-0 |
butylamine |
109-73-9 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1A |
H225, H332, H312, H302, H314 |
STOT SE 3; H335: C ≥ 1 % |
|
CLP00/ |
| 612-006-00-6 |
ethylenediamine; 1,2-diaminoethane |
107-15-3 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B, Resp. Sens. 1, Skin Sens. 1 |
H226, H312, H302, H314, H334, H317 |
|
|
CLP00/ |
| 612-007-00-1 |
2-aminopropane; isopropylamine |
75-31-0 |
Flam. Liq. 1, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H224, H319, H335, H315 |
|
|
CLP00/ |
| 612-008-00-7 |
aniline |
62-53-3 |
Carc. 2, Muta. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1 |
H351, H341, H331, H311, H301, H372 **, H318, H317, H400 |
*, STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,2 % ≤ C < 1 % |
|
CLP00/ |
| 612-009-00-2 |
salts of aniline |
- |
Carc. 2, Muta. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1 |
H351, H341, H331, H311, H301, H372 **, H318, H317, H400 |
*, STOT RE 1; H372: C ≥ 1 %, STOT RE 2; H373: 0,2 % ≤ C < 1 % |
A |
CLP00/ |
| 612-010-00-8 |
chloroanilines, with exception of those specified elsewhere in this Annex |
- |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H373 **, H400, H410 |
|
C |
CLP00/ |
| 612-011-00-3 |
4-nitrosoaniline |
659-49-4 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H332, H312, H302 |
|
|
CLP00/ |
| 612-012-00-9 |
o-nitroaniline; [1] m-nitroaniline; [2] p-nitroaniline [3] |
88-74-4 [1], 99-09-2 [2], 100-01-6 [3] |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 3 |
H331, H311, H301, H373 **, H412 |
|
C |
CLP00/ |
| 612-013-00-4 |
3-aminobenzene sulphonic acid; metanilic acid |
121-47-1 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H332, H312, H302 |
|
|
CLP00/ |
| 612-014-00-X |
sulphanilic acid; 4-aminobenzenesulphonic acid |
121-57-3 |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H319, H315, H317 |
|
|
CLP00/ |
| 612-015-00-5 |
N-methylaniline |
100-61-8 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H373 **, H400, H410 |
|
|
CLP00/ |
| 612-016-00-0 |
N,N-dimethylaniline |
121-69-7 |
Carc. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Chronic 2 |
H351, H331, H311, H301, H411 |
|
|
CLP00/ |
| 612-017-00-6 |
N-methyl-N-2,4,6-tetranitroaniline; tetryl |
479-45-8 |
Expl. 1.1, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 |
H201, H331, H311, H301, H373** |
|
|
CLP00/ATP01 |
| 612-018-00-1 |
bis(2,4,6-trinitrophenyl)amine; hexyl |
131-73-7 |
Expl. 1.1, Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2, Aquatic Chronic 2 |
H201, H330, H310, H300, H373**, H411 |
|
|
CLP00/ATP01 |
| 612-019-00-7 |
dipicrylamine, ammonium salt |
2844-92-0 |
Expl. 1.1, Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2, Aquatic Chronic 2 |
H201, H330, H310, H300, H373**, H411 |
|
|
CLP00/ATP01 |
| 612-020-00-2 |
1-naphthylamine |
134-32-7 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 612-022-00-3 |
2-naphthylamine |
91-59-8 |
Carc. 1A, Acute Tox. 4 *, Aquatic Chronic 2 |
H350, H302, H411 |
Carc. 1A; H350: C ≥ 0,01 % |
|
CLP00/ |
| 612-023-00-9 |
phenylhydrazine; [1] phenylhydrazinium chloride; [2] phenylhydrazine hydrochloride; [3] phenylhydrazinium sulphate (2:1) [4] |
100-63-0 [1], 59-88-1 [2], 27140-08-5 [3], 52033-74-6 [4] |
Carc. 1B, Muta. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1 |
H350, H341, H331, H311, H301, H372 **, H319, H315, H317, H400 |
|
|
CLP00/ |
| 612-024-00-4 |
m-toluidine; 3-aminotoluene |
108-44-1 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1 |
H331, H311, H301, H373 **, H400 |
|
|
CLP00/ |
| 612-025-00-X |
nitrotoluidines, with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 2 |
H331, H311, H301, H373 **, H411 |
|
C |
CLP00/ |
| 612-026-00-5 |
diphenylamine |
122-39-4 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H373 **, H400, H410 |
|
|
CLP00/ |
| 612-027-00-0 |
xylidines with the exception of those specified elsewhere in this Annex; dimethyl anilines with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 2 |
H331, H311, H301, H373 **, H411 |
|
C |
CLP00/ |
| 612-028-00-6 |
p-phenylenediamine |
106-50-3 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H319, H317, H400, H410 |
|
|
CLP00/ |
| 612-029-00-1 |
benzene-1,4-diamine dihydrochloride; p-phenylenediamine dihydrochloride |
624-18-0 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H319, H317, H400, H410 |
|
|
CLP00/ |
| 612-030-00-7 |
2-methyl-p-phenylenediamine sulphate [1] |
615-50-9 [1], 6369-59-1 [2] |
Acute Tox. 3 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H301, H332, H312, H317, H411 |
|
|
CLP00/ |
| 612-031-00-2 |
N,N-dimethylbenzene-1,3-diamine; [1] 4-amino-N,N-dimethylaniline; 3-amino-N,N'-dimethylaniline [2] |
2836-04-6 [1], 99-98-9 [2] |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 * |
H331, H311, H301 |
|
C |
CLP00/ |
| 612-032-00-8 |
N,N,N',N'-tetramethyl-p-phenylenediamine |
100-22-1 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H332, H312, H302 |
|
|
CLP00/ |
| 612-033-00-3 |
2-aminophenol |
95-55-6 |
Muta. 2, Acute Tox. 4 *, Acute Tox. 4 * |
H341, H332, H302 |
|
|
CLP00/ |
| 612-034-00-9 |
2-amino-4,6-dinitrophenol; picramic acid |
96-91-3 |
Expl. 1.1, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 3 |
H201, H332, H312, H302, H412 |
|
|
CLP00/ATP01 |
| 612-034-01-6 |
2-amino-4,6-dinitrophenol; picramic acid; [≥ 20 % water] |
96-91-3 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 3 |
H332, H312, H302, H412 |
|
G |
CLP00/ |
| 612-035-00-4 |
2-methoxyaniline; o-anisidine |
90-04-0 |
Carc. 1B, Muta. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 * |
H350, H341, H331, H311, H301 |
|
|
CLP00/ |
| 612-036-00-X |
3,3'-dimethoxybenzidine; o-dianisidine |
119-90-4 |
Carc. 1B, Acute Tox. 4 * |
H350, H302 |
|
|
CLP00/ |
| 612-037-00-5 |
salts of 3,3'-dimethoxybenzidine; salts of o-dianisidine |
- |
Carc. 1B, Acute Tox. 4 * |
H350, H302 |
|
A |
CLP00/ |
| 612-038-00-0 |
2-nitro-p-anisidine; 4-methoxy-2-nitroaniline |
96-96-8 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2 *, Aquatic Chronic 3 |
H330, H310, H300, H373 **, H412 |
|
|
CLP00/ |
| 612-039-00-6 |
2-ethoxyaniline; o-phenetidine |
94-70-2 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 * |
H331, H311, H301, H373 ** |
|
|
CLP00/ |
| 612-040-00-1 |
2,4-dinitroaniline |
97-02-9 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2 *, Aquatic Chronic 2 |
H330, H310, H300, H373 **, H411 |
|
|
CLP00/ |
| 612-041-00-7 |
4,4'-bi-o-toluidine |
119-93-7 |
Carc. 1B, Acute Tox. 4 *, Aquatic Chronic 2 |
H350, H302, H411 |
|
|
CLP00/ |
| 612-042-00-2 |
benzidine; 1,1'-biphenyl-4,4'-diamine; 4,4'-diaminobiphenyl; biphenyl-4,4'-ylenediamine |
92-87-5 |
Carc. 1A, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H302, H400, H410 |
Carc. 1A; H350: C ≥ 0,01 % |
|
CLP00/ |
| 612-043-00-8 |
N,N'-dimethylbenzidine |
2810-74-4 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H332, H312, H302 |
|
|
CLP00/ |
| 612-044-00-3 |
N,N'-diacetylbenzidine |
613-35-4 |
Carc. 1B, Muta. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H350, H341, H332, H312, H302 |
|
|
CLP00/ATP01 |
| 612-046-00-4 |
allylamine |
107-11-9 |
Flam. Liq. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Chronic 2 |
H225, H331, H311, H301, H411 |
|
|
CLP00/ |
| 612-047-00-X |
benzylamine |
100-46-9 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H312, H302, H314 |
|
|
CLP00/ |
| 612-048-00-5 |
dipropylamine |
142-84-7 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1A |
H225, H332, H312, H302, H314 |
STOT SE 3; H335: C ≥ 1 % |
|
CLP00/ |
| 612-049-00-0 |
di-n-butylamine; [1] di-sec-butylamine [2] |
111-92-2 [1], 626-23-3 [2] |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H226, H332, H312, H302 |
|
|
CLP00/ |
| 612-050-00-6 |
cyclohexylamine |
108-91-8 |
Flam. Liq. 3, Repr. 2, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H226, H361f***, H312, H302, H314 |
|
|
CLP00/ATP01 |
| 612-051-00-1 |
4,4'-diaminodiphenylmethane; 4,4'-methylenedianiline |
101-77-9 |
Carc. 1B, Muta. 2, STOT SE 1, STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 2 |
H350, H341, H370 **, H373 **, H317, H411 |
|
|
CLP00/ |
| 612-052-00-7 |
(S)-sec-butylamine; (S)-2-aminobutane; [1] (R)-sec-butylamine; (R)-2-aminobutane; [2] sec-butylamine; 2-aminobutane [3] |
513-49-5 [1], 13250-12-9 [2], 13952-84-6 [3] |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1A, Aquatic Acute 1 |
H225, H332, H302, H314, H400 |
|
C |
CLP00/ |
| 612-053-00-2 |
N-ethylaniline |
103-69-5 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 * |
H331, H311, H301, H373 ** |
|
|
CLP00/ |
| 612-054-00-8 |
N,N-diethylaniline |
91-66-7 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 2 |
H331, H311, H301, H373 **, H411 |
* |
|
CLP00/ |
| 612-055-00-3 |
N-methyl-o-toluidine; [1] N-methyl-m-toluidine; [2] N-methyl-p-toluidine [3] |
611-21-2 [1], 696-44-6 [2], 623-08-5 [3] |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 3 |
H331, H311, H301, H373 **, H412 |
|
C |
CLP00/ |
| 612-056-00-9 |
N,N-dimethyl-p-toluidine; [1] N,N-dimethyl-m-toluidine; [2] N,N-dimethyl-o-toluidine [3] |
99-97-8 [1], 121-72-2 [2], 609-72-3 [3] |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 3 |
H331, H311, H301, H373 **, H412 |
* |
C |
CLP00/ |
| 612-057-00-4 |
piperazine; [solid] |
110-85-0 |
Repr. 2, Skin Corr. 1B, Resp. Sens. 1, Skin Sens. 1 |
H361fd, H314, H334, H317 |
|
|
CLP00/ATP01 |
| 612-057-01-1 |
piperazine; [liquid] |
110-85-0 |
Repr. 2, Skin Corr. 1B, Resp. Sens. 1, Skin Sens. 1 |
H361fd, H314, H334, H317 |
|
|
ATP01/ |
| 612-058-00-X |
2,2'-iminodiethylamine; diethylenetriamine |
111-40-0 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1 |
H312, H302, H314, H317 |
|
|
CLP00/ |
| 612-059-00-5 |
3,6-diazaoctanethylenediamin; triethylenetetramine |
112-24-3 |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 3 |
H312, H314, H317, H412 |
|
|
CLP00/ |
| 612-060-00-0 |
3,6,9-triazaundecamethylenediamine; tetraethylenepentamine |
112-57-2 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 2 |
H312, H302, H314, H317, H411 |
|
|
CLP00/ |
| 612-061-00-6 |
3-aminopropyldimethylamine; N,N-dimethyl-1,3-diaminopropane |
109-55-7 |
Flam. Liq. 3, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1 |
H226, H302, H314, H317 |
|
|
CLP00/ |
| 612-062-00-1 |
3-aminopropyldiethylamine; N,N-diethyl-1,3-diaminopropane |
104-78-9 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1 |
H226, H312, H302, H314, H317 |
|
|
CLP00/ |
| 612-063-00-7 |
3,3'-iminodi(propylamine); dipropylenetriamine |
56-18-8 |
Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 4 *, Skin Corr. 1A, Skin Sens. 1 |
H330, H311, H302, H314, H317 |
|
|
CLP00/ |
| 612-064-00-2 |
3,6,9,12-tetra-azatetradecamethylenediamine; pentacthylenehexamine |
4067-16-7 |
Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H317, H400, H410 |
|
|
CLP00/ |
| 612-065-00-8 |
polyethlyenepolyamines with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H314, H317, H400, H410 |
|
|
CLP00/ |
| 612-066-00-3 |
dicyclohexylamine |
101-83-7 |
Acute Tox. 4 *, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H314, H400, H410 |
|
|
CLP00/ |
| 612-067-00-9 |
3-aminomethyl-3,5,5-trimethylcyclohexylamine |
2855-13-2 |
Acute Tox. 4, Skin Corr. 1B, Eye Dam. 1, Skin Sens. 1A |
H302, H314, H318, H317 |
Oral: ATE = 1030 mg/kg bw, Skin Sens. 1A; H317: C ≥ 0,001 % |
|
CLP00/ATP17 |
| 612-068-00-4 |
3,3'-dichlorobenzidine; 3,3'-dichlorobiphenyl-4,4'-ylenediamine |
91-94-1 |
Carc. 1B, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H312, H317, H400, H410 |
|
|
CLP00/ |
| 612-069-00-X |
salts of 3,3'-dichlorobenzidine; salts of 3,3'-dichlorobiphenyl-4,4'-ylenediamine |
- |
Carc. 1B, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H312, H317, H400, H410 |
|
A |
CLP00/ |
| 612-070-00-5 |
salts of benzidine |
531-85-1, 531-86-2, 21136-70-9, 36341-27-2 |
Carc. 1A, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H302, H400, H410 |
|
A |
CLP00/ |
| 612-071-00-0 |
salts of 2-naphthylamine |
553-00-4, 612-52-2 |
Carc. 1A, Acute Tox. 4 *, Aquatic Chronic 2 |
H350, H302, H411 |
|
A |
CLP00/ |
| 612-072-00-6 |
biphenyl-4-ylamine; xenylamine; 4-aminobiphenyl |
92-67-1 |
Carc. 1A, Acute Tox. 4 * |
H350, H302 |
|
|
CLP00/ |
| 612-073-00-1 |
salts of biphenyl-4-ylamine; salts of xenylamine; salts of 4-aminobiphenyl |
- |
Carc. 1A, Acute Tox. 4 * |
H350, H302 |
|
A |
CLP00/ |
| 612-074-00-7 |
benzyldimethylamine |
103-83-3 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B, Aquatic Chronic 3 |
H226, H332, H312, H302, H314, H412 |
|
|
CLP00/ |
| 612-075-00-2 |
2-aminoethyldimethylamine; 2-dimethylaminoethylamine |
108-00-9 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1A |
H225, H312, H302, H314 |
|
|
CLP00/ |
| 612-076-00-8 |
ethyldimethylamine |
598-56-1 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H225, H332, H302, H314 |
|
|
CLP00/ATP01 |
| 612-077-00-3 |
dimethylnitrosoamine; N-nitrosodimethylamine |
62-75-9 |
Carc. 1B, Acute Tox. 2 *, Acute Tox. 3 *, STOT RE 1, Aquatic Chronic 2 |
H350, H330, H301, H372 **, H411 |
Carc. 1B; H350: C ≥ 0,001 % |
|
CLP00/ |
| 612-078-00-9 |
2,2'-dichloro-4,4'-methylenedianiline; 4,4'-methylene bis(2-chloroaniline) |
101-14-4 |
Carc. 1B, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H302, H400, H410 |
|
|
CLP00/ |
| 612-079-00-4 |
salts of 2,2'-dichloro-4,4'-methylenedianiline; salts of 4,4'-methylenebis(2-chloroaniline) |
- |
Carc. 1B, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H302, H400, H410 |
|
A |
CLP00/ |
| 612-080-00-X |
4-amino-N,N-diethylaniline; N,N-diethyl-p-phenylendiamine |
93-05-0 |
Acute Tox. 3 *, Skin Corr. 1B |
H301, H314 |
|
|
CLP00/ |
| 612-081-00-5 |
salts of 4,4'-bi-o-toluidine; salts of 3,3'-dimethylbenzidine; salts of o-tolidine |
612-82-8, 64969-36-4, 74753-18-7 |
Carc. 1B, Acute Tox. 4 *, Aquatic Chronic 2 |
H350, H302, H411 |
|
A |
CLP00/ |
| 612-082-00-0 |
thiourea; thiocarbamide |
62-56-6 |
Carc. 2, Repr. 2, Acute Tox. 4 *, Aquatic Chronic 2 |
H351, H361d ***, H302, H411 |
|
|
CLP00/ |
| 612-083-00-6 |
1-methyl-3-nitro-1-nitrosoguanidine |
70-25-7 |
Carc. 1B, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Chronic 2 |
H350, H332, H319, H315, H411 |
Carc. 1B; H350: C ≥ 0,01 % |
|
CLP00/ATP01 |
| 612-084-00-1 |
dapsone; 4,4'-diamino diphenyl sulfone |
80-08-0 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 612-085-00-7 |
4,4'-methylenedi-o-toluidine |
838-88-0 |
Carc. 1B, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H302, H317, H400, H410 |
|
|
CLP00/ |
| 612-086-00-2 |
amitraz (ISO); N,N-bis(2,4-xylyliminomethyl) methylamine |
33089-61-1 |
Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373 **, H317, H400, H410 |
M = 10: |
|
CLP00/ |
| 612-087-00-8 |
guazatine (ISO) |
108173-90-6 |
Acute Tox. 2 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H312, H302, H335, H315, H318, H400, H410 |
|
|
CLP00/ |
| 612-088-00-3 |
simazine (ISO); 6-chloro-N,N'-diethyl-1,3,5-triazine-2,4-diamine |
122-34-9 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H400, H410 |
|
|
CLP00/ |
| 612-089-00-9 |
1,5-naphthylenediamine |
2243-62-1 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H400, H410 |
|
|
CLP00/ |
| 612-090-00-4 |
2,2'-(nitrosoimino)bisethanol |
1116-54-7 |
Carc. 1B |
H350 |
|
|
CLP00/ |
| 612-091-00-X |
o-toluidine; 2-aminotoluene |
95-53-4 |
Carc. 1B, Acute Tox. 3 *, Acute Tox. 3 *, Eye Irrit. 2, Aquatic Acute 1 |
H350, H331, H301, H319, H400 |
|
|
CLP00/ |
| 612-092-00-5 |
N,N'-(2,2-dimethylpropylidene)hexamethylenediamine |
1000-78-8 |
Skin Irrit. 2, Skin Sens. 1 |
H315, H317 |
|
|
CLP00/ |
| 612-093-00-0 |
3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline |
104147-32-2 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 612-094-00-6 |
4-(2-chloro-4-trifluoromethyl)phenoxy-2-fluoroaniline hydrochloride |
113674-95-6 |
STOT RE 1, Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H372**, H302, H373**, H318, H317, H400, H410 |
|
|
CLP00/ATP01 |
| 612-095-00-1 |
benzyl-2-hydroxydodecyldimethylammonium benzoate |
113694-52-3 |
Skin Corr. 1B, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H302, H400, H410 |
|
|
CLP00/ |
| 612-096-00-7 |
4,4'-carbonimidoylbis[N,N-dimethylaniline] |
492-80-8 |
Carc. 2, Acute Tox. 4 *, Eye Irrit. 2, Aquatic Chronic 2 |
H351, H302, H319, H411 |
|
|
CLP00/ |
| 612-097-00-2 |
salts of 4,4'-carbonimidoylbis[N,N-dimethylaniline] |
- |
Carc. 2, Acute Tox. 4 *, Eye Irrit. 2, Aquatic Chronic 2 |
H351, H302, H319, H411 |
|
A |
CLP00/ |
| 612-098-00-8 |
nitrosodipropylamine |
621-64-7 |
Carc. 1B, Acute Tox. 4 *, Aquatic Chronic 2 |
H350, H302, H411 |
Carc. 1B; H350: C ≥ 0,001 % |
|
CLP00/ATP01 |
| 612-099-00-3 |
4-methyl-m-phenylenediamine; 2,4-toluenediamine |
95-80-7 |
Carc. 1B, Muta. 2, Repr. 2, Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 2 |
H350, H341, H361f***, H301, H312, H373**, H317, H411 |
|
|
CLP00/ATP01 |
| 612-100-00-7 |
propylenediamine |
78-90-0 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1A |
H226, H312, H302, H314 |
|
|
CLP00/ |
| 612-101-00-2 |
methenamine; hexamethylenetetramine |
100-97-0 |
Flam. Sol. 2, Skin Sens. 1 |
H228, H317 |
|
|
CLP00/ATP01 |
| 612-102-00-8 |
N,N-bis(3-aminopropyl)methylamine |
105-83-9 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 4 *, Skin Corr. 1B |
H331, H311, H302, H314 |
|
|
CLP00/ |
| 612-103-00-3 |
N,N,N',N'-tetramethylethylenediamine |
110-18-9 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H225, H332, H302, H314 |
|
|
CLP00/ |
| 612-104-00-9 |
hexamethylenediamine |
124-09-4 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT SE 3, Skin Corr. 1B |
H312, H302, H335, H314 |
|
|
CLP00/ |
| 612-105-00-4 |
2-piperazin-1-ylethylamine |
140-31-8 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 3 |
H312, H302, H314, H317, H412 |
|
|
CLP00/ |
| 612-106-00-X |
2,6-diethylaniline |
579-66-8 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 612-107-00-5 |
1-phenylethylamine; [1] Dl-α-methylbenzylamine [2] |
98-84-0 [1], 618-36-0 [2] |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H312, H302, H314 |
|
|
CLP00/ |
| 612-108-00-0 |
3-aminopropyltriethoxysilane |
919-30-2 |
Acute Tox. 4 *, Skin Corr. 1B |
H302, H314 |
|
|
CLP00/ |
| 612-109-00-6 |
bis(2-dimethylaminoethyl)(methyl)amine |
3030-47-5 |
Acute Tox. 3 *, Acute Tox. 4 *, Skin Corr. 1B |
H311, H302, H314 |
|
|
CLP00/ |
| 612-110-00-1 |
2,2'-dimethyl-4,4'-methylenebis(cyclohexylamine) |
6864-37-5 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 4 *, Skin Corr. 1A, Aquatic Chronic 2 |
H331, H311, H302, H314, H411 |
|
|
CLP00/ |
| 612-111-00-7 |
2-methyl-m-phenylenediamine; 2,6-toluenediamine |
823-40-5 |
Muta. 2, Acute Tox. 4 *, Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H341, H312, H302, H317, H411 |
|
|
CLP00/ |
| 612-112-00-2 |
p-anisidine; 4-methoxyaniline |
104-94-9 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, STOT RE 2 *, Aquatic Acute 1 |
H330, H310, H300, H373 **, H400 |
|
|
CLP00/ |
| 612-113-00-8 |
6-methyl-2,4-bis(methylthio)phenylene-1,3-diamine |
106264-79-3 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
CLP00/ |
| 612-114-00-3 |
R,R-2-hydroxy-5-(1-hydroxy-2-(4-phenylbut-2-ylamino)ethyl)benzamide hydrogen 2,3-bis(benzoyloxy)succinate |
- |
Flam. Sol. 1, Skin Sens. 1, Aquatic Chronic 3 |
H228, H317, H412 |
|
|
CLP00/ |
| 612-115-00-9 |
dimethyldioctadecylammonium hydrogen sulfate |
123312-54-9 |
Eye Irrit. 2, Aquatic Chronic 4 |
H319, H413 |
|
|
CLP00/ |
| 612-116-00-4 |
C8-18alkylbis(2-hydroxyethyl)ammonium bis(2-ethylhexyl)phosphate |
68132-19-4 |
Acute Tox. 3 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H314, H317, H400, H410 |
|
|
CLP00/ |
| 612-117-00-X |
C12-14-tert-alkylamine, methylphosphonic acid salt |
119415-07-5 |
Acute Tox. 4 *, Skin Corr. 1B, Aquatic Chronic 2 |
H302, H314, H411 |
|
|
CLP00/ |
| 612-118-00-5 |
A reaction mass of: (1,3-dioxo-2H-benz(de)isoquinolin-2-ylpropyl)hexadecyldimethylammonium 4-toluenesulfonate; (1,3-dioxo-2H-benz(de)isoquinolin-2-ylpropyl)hexadecyldimethylammonium bromide |
- |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
CLP00/ |
| 612-119-00-0 |
benzyldimethyloctadecylammonium 3-nitrobenzenesulfonate |
- |
Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H400, H410 |
|
|
CLP00/ |
| 612-120-00-6 |
aclonifen (ISO); 2-chloro-6-nitro-3-phenoxyaniline |
74070-46-5 |
Carc. 2, Skin Sens. 1A, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H317, H400, H410 |
M=100, M=10 |
|
CLP00/ATP05 |
| 612-121-00-1 |
amines, polyethylenepoly-; HEPA |
68131-73-7 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H314, H317, H400, H410 |
|
|
CLP00/ |
| 612-122-00-7 |
hydroxylamine ....% [> 55 % in aqueous solution] |
7803-49-8 |
Unst. Expl., Met. Corr. 1, Carc. 2, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1 |
H200, H290, H351, H312, H302, H373**, H335, H315, H318, H317, H400 |
|
B |
CLP00/ATP01 |
| 612-122-01-4 |
hydroxylamine ...% [≤ 55% in aqueous solution] |
7803-49-8 |
Met. Corr. 1, Carc. 2, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1 |
H290, H351, H312, H302, H373**, H335, H315, H318, H317, H400 |
|
B |
ATP01/ |
| 612-123-00-2 |
hydroxylammonium chloride; hydroxylamine hydrochloride; [1] bis(hydroxylammonium) sulfate; hydroxylamine sulfate (2:1) [2] |
5470-11-1 [1], 10039-54-0 [2] |
Met. Corr. 1, Carc. 2, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1 |
H290, H351, H312, H302, H373**, H319, H315, H317, H400 |
|
|
CLP00/ATP01 |
| 612-124-00-8 |
N,N,N-trimethylanilinium chloride |
138-24-9 |
Acute Tox. 3 *, Acute Tox. 3 * |
H311, H301 |
|
|
CLP00/ |
| 612-125-00-3 |
2-methyl-p-phenylenediamine; 2,5-toluenediamine |
95-70-5 |
Acute Tox. 3 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H301, H332, H312, H317, H411 |
|
|
CLP00/ |
| 612-126-00-9 |
toluene-2,4-diammonium sulphate; 4-methyl-m-phenylenediamine sulfate |
65321-67-7 |
Carc. 1B, Acute Tox. 3 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H350, H301, H312, H319, H317, H411 |
|
|
CLP00/ |
| 612-127-00-4 |
3-aminophenol |
591-27-5 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 2 |
H332, H302, H411 |
|
|
CLP00/ |
| 612-128-00-X |
4-aminophenol |
123-30-8 |
Muta. 2, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H341, H332, H302, H400, H410 |
|
|
CLP00/ |
| 612-129-00-5 |
diisopropylamine |
108-18-9 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H225, H332, H302, H314 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 612-130-00-0 |
2,6-diamino-3,5-diethyltoluene; 4,6-diethyl-2-methyl-1,3-benzenediamine; [1] 2,4-diamino-3,5-diethyltoluene; 2,4-diethyl-6-methyl-1,3-benzenediamine; [2] diethylmethylbenzenediamine [3] |
2095-01-4 [1], 2095-02-5 [2], 68479-98-1 [3] |
Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H373 **, H319, H400, H410 |
|
C |
CLP00/ |
| 612-131-00-6 |
didecyldimethylammonium chloride |
7173-51-5 |
Acute Tox. 4 *, Skin Corr. 1B |
H302, H314 |
|
|
CLP00/ |
| 612-132-00-1 |
N,N'-diphenyl-p-phenylenediamine; N,N'-diphenyl-1,4-benzenediamine |
74-31-7 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 612-133-00-7 |
(4-ammonio-m-tolyl)ethyl(2-hydroxyethyl)ammonium sulphate; 4-(N-ethyl-N-2-hydroxyethyl)-2-methylphenylenediamine sulphate |
25646-77-9 |
Acute Tox. 3 *, STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H373 **, H317, H400, H410 |
|
|
CLP00/ |
| 612-134-00-2 |
N-(2-(4-amino-N-ethyl-m-toluidino)ethyl)methanesulphonamide sesquisulphate; 4-(N-ethyl-N-2-methanesulphonylaminoethyl)-2-methylphenylenediamine sesquisulphate monohydrate |
25646-71-3 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
CLP00/ |
| 612-135-00-8 |
N-2-naphthylaniline; N-phenyl-2-naphthylamine |
135-88-6 |
Carc. 2, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H351, H319, H315, H317, H411 |
|
|
CLP00/ |
| 612-136-00-3 |
N-isopropyl-N'-phenyl-p-phenylenediamine |
101-72-4 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
Skin Sens. 1; H317: C ≥ 0,1 % |
|
CLP00/ |
| 612-137-00-9 |
4-chloroaniline |
106-47-8 |
Carc. 1B, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H331, H311, H301, H317, H400, H410 |
|
|
CLP00/ |
| 612-138-00-4 |
furalaxyl (ISO); methyl N-(2,6-dimethylphenyl)-N-(2-furylcarbonyl)-Dl-alaninate |
57646-30-7 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 612-139-00-X |
mefenacet (ISO); 2-(benzothiazol-2-yloxy)-N-methyl-N-phenylacetamide |
73250-68-7 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 612-140-00-5 |
quaternary ammonium compounds, benzyl-C8-18-alkyldimethyl, chlorides |
63449-41-2 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B, Aquatic Acute 1 |
H312, H302, H314, H400 |
|
|
CLP00/ |
| 612-141-00-0 |
4,4'-methylenebis(2-ethylaniline); 4,4'-methylenebis(2-ethylbenzeneamine) |
19900-65-3 |
Carc. 2, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H302, H400, H410 |
|
|
CLP00/ |
| 612-142-00-6 |
biphenyl-2-ylamine |
90-41-5 |
Carc. 2, Acute Tox. 4 *, Aquatic Chronic 3 |
H351, H302, H412 |
|
|
CLP00/ |
| 612-143-00-1 |
N5,N5-diethyltoluene-2,5-diamine monohydrochloride; 4-diethylamino-2-methylaniline monohydrochloride |
2051-79-8 |
Acute Tox. 3 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H319, H317, H400, H410 |
|
|
CLP00/ |
| 612-144-00-7 |
flumetralin (ISO); N-(2-chloro-6-fluorobenzyl)-N-ethyl-α,α,α-trifluoro-2,6-dinitro-p-toluidine |
62924-70-3 |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H315, H317, H400, H410 |
|
|
CLP00/ |
| 612-145-00-2 |
o-phenylenediamine |
95-54-5 |
Carc. 2, Muta. 2, Acute Tox. 3 *, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H341, H301, H332, H312, H319, H317, H400, H410 |
|
|
CLP00/ |
| 612-146-00-8 |
o-phenylenediamine dihydrochloride |
615-28-1 |
Carc. 2, Muta. 2, Acute Tox. 3 *, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H341, H301, H332, H312, H319, H317, H400, H410 |
|
|
CLP00/ |
| 612-147-00-3 |
m-phenylenediamine |
108-45-2 |
Muta. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H341, H331, H311, H301, H319, H317, H400, H410 |
|
|
CLP00/ |
| 612-148-00-9 |
m-phenylenediamine dihydrochloride |
541-69-5 |
Muta. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H341, H331, H311, H301, H319, H317, H400, H410 |
|
|
CLP00/ |
| 612-149-00-4 |
1,3-diphenylguanidine |
102-06-7 |
Repr. 2, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Chronic 2 |
H361f ***, H302, H319, H335, H315, H411 |
|
|
CLP00/ |
| 612-150-00-X |
spiroxamine (ISO); 8-tert-butyl-1,4-dioxaspiro[4.5]decan-2-ylmethyl(ethyl)(propyl)amine |
118134-30-8 |
Repr. 2, Acute Tox. 4, Acute Tox. 4, Acute Tox. 4, STOT RE 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361d, H332, H312, H302, H373 (eye), H315, H317, H400, H410 |
M=100, M=100 |
|
CLP00/ATP10 |
| 612-151-00-5 |
methyl-phenylene diamine; diaminotoluene; [technical product – reaction mass of 4-methyl-m-phenylene diamine (EC No 202-453-1) and 2-methyl-m-phenylene diamine (EC No 212-513-9)] |
- |
Carc. 1B, Muta. 2, Repr. 2, Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 2 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H350, H341, H361f***, H301, H312, H373**, H319, H317, H411 |
|
|
CLP00/ATP01 |
| 612-152-00-0 |
N,N-diethyl-N',N'-dimethylpropan-1,3-diyl-diamine |
62478-82-4 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1A, Aquatic Chronic 3 |
H226, H332, H302, H373 **, H314, H412 |
|
|
CLP00/ |
| 612-153-00-6 |
4-[N-ethyl-N-(2-hydroxyethyl)amino]-1-(2-hydroxyethyl)amino-2-nitrobenzene, monohydrochloride |
132885-85-9 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 3 |
H302, H317, H412 |
|
|
CLP00/ |
| 612-154-00-1 |
6'-(isobutylethylamino)-3'-methyl-2'-phenylamino-spiro[isobenzo-2-oxofuran-7,9'-[9H]-xanthene] |
95235-29-3 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 612-155-00-7 |
2'-anilino-6'-((3-ethoxypropyl)ethylamino)-3'-methylspiro(isobenzo-3-oxofuran)-1-(1H)-9'-xanthene |
93071-94-4 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 612-156-00-2 |
reaction mass of: trihexadecylmethylammonium chloride; dihexadecyldimethylammonium chloride |
- |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
CLP00/ |
| 612-157-00-8 |
(Z)-1-benzo[b]thien-2-ylethanone oxime hydrochloride |
- |
Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H302, H373 **, H318, H317, H411 |
|
|
CLP00/ |
| 612-158-00-3 |
reaction mass of: bis(5-dodecyl-2-hydroxybenzald-oximate) copper (II) C12-alkyl group is branched; 4-dodecylsalicylaldoxime |
- |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 612-159-00-9 |
Reaction products of: trimethylhexamethylene diamine (a mixture of 2,2,4-trimethyl-1,6-hexanediamine and 2,4,4-trimethyl-1,6-hexanediamine, EINECS listed), Epoxide 8 (mono[(C10-C16-alkyloxy)methyl]oxirane derivatives) and p-toluene-sulfonic acid |
- |
Acute Tox. 4 *, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H314, H400, H410 |
|
|
CLP00/ |
| 612-160-00-4 |
p-toluidine; 4-aminotoluene; [1] toluidinium chloride; [2] toluidine sulphate (1:1) [3] |
106-49-0 [1], 540-23-8 [2], 540-25-0 [3] |
Carc. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1 |
H351, H331, H311, H301, H319, H317, H400 |
|
|
CLP00/ |
| 612-161-00-X |
2,6-xylidine; 2,6-dimethylaniline |
87-62-7 |
Carc. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Aquatic Chronic 2 |
H351, H332, H312, H302, H335, H315, H411 |
|
|
CLP00/ |
| 612-162-00-5 |
dimethyldioctadecylammonium chloride; DODMAC |
107-64-2 |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
CLP00/ |
| 612-163-00-0 |
metalaxyl-M (ISO); mefenoxam; (R)-2-[(2,6-dimethylphenyl)-methoxyacetylamino]propionic acid methyl ester |
70630-17-0 |
Acute Tox. 4 *, Eye Dam. 1 |
H302, H318 |
|
|
CLP00/ |
| 612-164-00-6 |
2-butyl-2-ethyl-1,5-diaminopentane |
137605-95-9 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 3 |
H312, H302, H373 **, H314, H317, H412 |
|
|
CLP00/ |
| 612-165-00-1 |
N,N'-diphenyl-N,N'-bis(3-methylphenyl)-(1,1'-diphenyl)-4,4'-diamine |
65181-78-4 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 612-166-00-7 |
reaction mass of: cis-(5-ammonium-1,3,3-trimethyl)-cyclohexanemethylammonium phosphate (1:1); trans-(5-ammonium-1,3,3-trimethyl)-cyclohexanemethylammonium phosphate (1:1) |
114765-88-7 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
|
CLP00/ |
| 612-167-00-2 |
5-acetyl-3-amino-10,11-dihydro-5H-dibenz[b,f]azepine-hydrochloride |
- |
Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H302, H373 **, H318, H317, H411 |
|
|
CLP00/ |
| 612-168-00-8 |
3,5-dichloro-2,6-difluoropyrdine-4-amine |
2840-00-8 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 2 |
H312, H302, H411 |
|
|
CLP00/ |
| 612-169-00-3 |
bis(N-methyl-N-phenylhydrazine)sulfate |
618-26-8 |
Flam. Liq. 2, STOT RE 1, Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H225, H372**, H302, H318, H317, H400, H410 |
|
|
ATP01/ |
| 612-170-00-9 |
4-chlorophenyl cyclopropyl ketone O-(4-aminobenzyl)oxime |
- |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
CLP00/ |
| 612-171-00-4 |
N,N,N',N'-tetraglycidyl-4,4'-diamino-3,3'-diethyldiphenylmethane |
130728-76-6 |
Muta. 2, Skin Sens. 1, Aquatic Chronic 2 |
H341, H317, H411 |
|
|
CLP00/ |
| 612-172-00-X |
4,4'-methylenebis(N,N'-dimethylcyclohexanamine |
13474-64-1 |
Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1A, Aquatic Chronic 3 |
H302, H373 **, H314, H412 |
|
|
CLP00/ |
| 612-173-00-5 |
lithium 1-amino-4-(4-tert-butylanilino)anthraquinone-2-sulfonate |
125328-86-1 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H318, H317, H411 |
|
|
CLP00/ |
| 612-174-00-0 |
4,4-dimethoxybutylamine |
19060-15-2 |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 3 |
H302, H314, H317, H412 |
|
|
CLP00/ |
| 612-175-00-6 |
2-(O-aminooxy)ethylamine dihydrochloride |
37866-45-8 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 612-176-00-1 |
Polymer of 1,3-dibromopropane and N,N-diethyl-N',N'-dimethyl-1,3-propanediamine |
143747-73-3 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 612-177-00-7 |
2-naphthylamino-6-sulfomethylamide |
104295-55-8 |
STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 2 |
H373 **, H317, H411 |
|
|
CLP00/ |
| 612-178-00-2 |
1,4,7,10-tetraazacyclododecane disulfate |
112193-77-8 |
Acute Tox. 4 *, STOT SE 3, Eye Dam. 1, Aquatic Chronic 3 |
H302, H335, H318, H412 |
|
|
CLP00/ |
| 612-179-00-8 |
1-(2-propenyl)pyridinium chloride |
25965-81-5 |
Acute Tox. 4 *, Skin Sens. 1 |
H302, H317 |
|
|
CLP00/ |
| 612-180-00-3 |
3-aminobenzylamine |
4403-70-7 |
Acute Tox. 4 *, Skin Corr. 1B, Aquatic Chronic 2 |
H302, H314, H411 |
|
|
CLP00/ |
| 612-181-00-9 |
2-phenylthioaniline |
1134-94-7 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 612-182-00-4 |
1-ethyl-1-methylmorpholinium bromide |
65756-41-4 |
Muta. 2 |
H341 |
|
|
CLP00/ |
| 612-183-00-X |
1-ethyl-1-methylpyrrolidinium bromide |
69227-51-6 |
Muta. 2 |
H341 |
|
|
CLP00/ |
| 612-184-00-5 |
6'-(dibutylamino)-3'-methyl-2'-(phenylamino)spiro[isobenzofuran-1(3H),9-(9H)-xanthen]-3-one |
89331-94-2 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 612-185-00-0 |
1-[3-[4-((heptadecafluorononyl)oxy)-benzamido]propyl]-N,N,N-trimethylammonium iodide |
59493-72-0 |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
CLP00/ |
| 612-186-00-6 |
bis(N-(7-hydroxy-8-methyl-5-phenylphenazin-3-ylidene)dimethylammonium) sulfate |
149057-64-7 |
STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H373 **, H318, H317, H400, H410 |
|
|
CLP00/ |
| 612-187-00-1 |
2,3,4-trifluoroaniline |
3862-73-5 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 2 |
H312, H302, H373 **, H315, H318, H411 |
|
|
CLP00/ |
| 612-188-00-7 |
4,4'-(9H-fluoren-9-ylidene)bis(2-chloroaniline) |
107934-68-9 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 612-189-00-2 |
4-amino-2-(aminomethyl)phenol dihydrochloride |
135043-64-0 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
CLP00/ |
| 612-190-00-8 |
4,4'-methylenebis(2-isopropyl-6-methylaniline) |
16298-38-7 |
STOT RE 2 *, Aquatic Chronic 2 |
H373 **, H411 |
|
|
CLP00/ |
| 612-191-00-3 |
Polymer of allylamine hydrochloride |
71550-12-4 |
Acute Tox. 4 *, Skin Sens. 1 |
H302, H317 |
|
|
CLP00/ |
| 612-192-00-9 |
2-isopropyl-4-(N-methyl)aminomethylthiazole |
154212-60-9 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 2 |
H312, H302, H315, H318, H411 |
|
|
CLP00/ |
| 612-193-00-4 |
3-methylaminomethylphenylamine |
18759-96-1 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H314, H317, H400, H410 |
|
|
CLP00/ |
| 612-194-00-X |
2-hydroxy-3-[(2-hydroxyethyl)-[2-(1-oxotetradecyl)amino]ethyl]amino]-N,N,N-trimethyl-1-propanammonium chloride |
141890-30-4 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H318, H400, H410 |
|
|
CLP00/ |
| 612-195-00-5 |
bis[tributyl 4-(methylbenzyl)ammonium] 1,5-naphthalenedisulfonate |
160236-81-7 |
Acute Tox. 4 *, Acute Tox. 4 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H302, H318, H400, H410 |
|
|
CLP00/ |
| 612-196-00-0 |
4-chloro-o-toluidine; [1] 4-chloro-o-toluidine hydrochloride [2] |
95-69-2 [1], 3165-93-3 [2] |
Carc. 1B, Muta. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H341, H331, H311, H301, H400, H410 |
|
|
CLP00/ |
| 612-197-00-6 |
2,4,5-trimethylaniline; [1] 2,4,5-trimethylaniline hydrochloride [2] |
137-17-7 [1], 21436-97-5 [2] |
Carc. 1B, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Chronic 2 |
H350, H331, H311, H301, H411 |
|
|
CLP00/ |
| 612-198-00-1 |
4,4'-thiodianiline and its salts |
139-65-1 |
Carc. 1B, Acute Tox. 4 *, Aquatic Chronic 2 |
H350, H302, H411 |
|
|
CLP00/ |
| 612-199-00-7 |
4,4'-oxydianiline and its salts; p-aminophenyl ether |
101-80-4 |
Carc. 1B, Muta. 1B, Repr. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Chronic 2 |
H350, H340, H361f ***, H331, H311, H301, H411 |
|
|
CLP00/ |
| 612-200-00-0 |
2,4-diaminoanisole; 4-methoxy-m-phenylenediamine; [1] 2,4-diaminoanisole sulphate [2] |
615-05-4 [1], 39156-41-7 [2] |
Carc. 1B, Muta. 2, Acute Tox. 4 *, Aquatic Chronic 2 |
H350, H341, H302, H411 |
|
|
CLP00/ |
| 612-201-00-6 |
N,N,N',N'-tetramethyl-4,4'-methylendianiline |
101-61-1 |
Carc. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H400, H410 |
|
|
CLP00/ |
| 612-202-00-1 |
3,4-dichloroaniline |
95-76-1 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H311, H301, H318, H317, H400, H410 |
|
|
CLP00/ |
| 612-203-00-7 |
C8-10 alkyl dimethyl hydroxyethyl ammoniumchloride (chain < C8: <3%, chain = C8: 15%-70%, chain = C10: 30%-85%, chain > C10: <3%) |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2 |
H312, H302, H315 |
|
|
ATP01/ |
| 612-204-00-2 |
C.I. Basic Violet 3; 4-[4,4'-bis(dimethylamino) benzhydrylidene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride |
548-62-9 |
Carc. 2, Acute Tox. 4 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H302, H318, H400, H410 |
|
|
CLP00/ |
| 612-205-00-8 |
C.I. Basic Violet 3 with ≥ 0.1 % of Michler's ketone (EC no. 202-027-5) |
548-62-9 |
Carc. 1B, Acute Tox. 4 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H302, H318, H400, H410 |
|
|
CLP00/ |
| 612-206-00-3 |
famoxadone (ISO); 3-anilino-5-methyl-5-(4-phenoxyphenyl)-1,3-oxazolidine-2,4-dione |
131807-57-3 |
STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H373 **, H400, H410 |
|
|
CLP00/ |
| 612-207-00-9 |
4-ethoxyaniline; p-phenetidine |
156-43-4 |
Muta. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1 |
H341, H332, H312, H302, H319, H317 |
|
|
CLP00/ |
| 612-208-00-4 |
N-methylbenzene-1,2-diammonium hydrogen phosphate |
- |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H302, H317, H411 |
|
|
ATP01/ |
| 612-209-00-X |
6-methoxy-m-toluidine; p-cresidine |
120-71-8 |
Carc. 1B, Acute Tox. 4 * |
H350, H302 |
|
|
CLP00/ |
| 612-210-00-5 |
5-nitro-o-toluidine; [1] 5-nitro-o-toluidine hydrochloride [2] |
99-55-8 [1], 51085-52-0 [2] |
Carc. 2, Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, Aquatic Chronic 3 |
H351, H331, H311, H301, H412 |
|
|
CLP00/ |
| 612-211-00-0 |
N-[(benzotriazole-1-yl)methyl)]-4-carboxybenzenesulfonamide |
170292-97-4 |
Eye Irrit. 2, Aquatic Chronic 2 |
H319, H411 |
|
|
CLP00/ |
| 612-212-00-6 |
2,6-dichloro-4-trifluoromethylaniline |
24279-39-8 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H302, H315, H317, H400, H410 |
|
|
CLP00/ |
| 612-213-00-1 |
isobutylidene-(2-(2-isopropyl-4,4-dimethyloxazolidine-3-yl)-1,1-dimethylethyl)amine |
148348-13-4 |
Skin Corr. 1B, Aquatic Chronic 3 |
H314, H412 |
|
|
CLP00/ |
| 612-214-00-7 |
4-(2,2-diphenylethenyl)-N,N-di-phenylbenzenamine |
89114-90-9 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 612-215-00-2 |
3-chloro-2-(isopropylthio)aniline |
179104-32-6 |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ |
| 612-216-00-8 |
1-amino-1-cyanamino-2,2-dicyanoethylene, sodium salt |
19450-38-5 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
ATP01/ |
| 612-217-00-3 |
1-methoxy-2-propylamine |
37143-54-7 |
Flam. Liq. 2, Skin Corr. 1B, Acute Tox. 4 *, Aquatic Chronic 3 |
H225, H314, H302, H412 |
|
|
CLP00/ |
| 612-219-00-4 |
(2-hydroxy-3-(3,4-dimethyl-9-oxo-10-thiaanthracen-2-yloxy)propyl)trimethylammonium chloride |
- |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 612-220-00-X |
N-nitro-N-(3-methyl-3,6-dihydro-2H-1,3,5-oxadiazin-4-yl)amine |
153719-38-1 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 3 |
H302, H317, H412 |
|
|
ATP01/ |
| 612-221-00-5 |
2-amino-4-(trifluoromethyl)benzenethiol hydrochloride |
4274-38-8 |
Skin Corr. 1B, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1 |
H314, H332, H312, H302, H373**, H317, H400 |
|
|
ATP01/ |
| 612-222-00-0 |
cis-1-(3-(4-fluorophenoxy)propyl)-3-methoxy-4-piperidinamine |
104860-26-6 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H373**, H318, H400, H410 |
|
|
ATP01/ |
| 612-223-00-6 |
N-benzyl-N-ethyl-(4-(5-nitro-benzo[c]isothiazol-3-ylazo)phenyl)amine |
186450-73-7 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 612-224-00-1 |
N2,N4,N6-tris{4-[(1,4-dimethylpentyl)amino]phenyl}-1,3,5-triazine-2,4,6-triamine |
121246-28-4 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
ATP01/ |
| 612-225-00-7 |
1,4,7,10-tetraazacyclododecane |
294-90-6 |
Skin Corr. 1B, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H312, H302, H400, H410 |
|
|
ATP01/ |
| 612-226-00-2 |
3-(2'-phenoxyethoxy)propylamine |
6903-18-0 |
Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 3 |
H302, H315, H318, H412 |
|
|
ATP01/ |
| 612-227-00-8 |
benzyl-N-(2-(2-methoxyphenoxy)ethyl)amine hydrochloride |
120606-08-8 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H318, H400, H410 |
|
|
ATP01/ |
| 612-228-00-3 |
reaction mass of: N-(3-(trimethoxysilyl)propyl)ethylenediamine; N-benzyl-N-(3-(trimethoxysilyl)propyl)ethylenediamine; N-benzyl-N'-[3-(trimethoxysilyl)propyl]ethylenediamine; N,N'-bis-benzyl-N'-[3-(trimethoxysilyl)propyl]ethylenediamine; N,N,N'-tris-b |
- |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT SE 2, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H226, H332, H312, H302, H371, H318, H317, H412 |
|
|
ATP01/ |
| 612-229-00-9 |
mepanipyrim; 4-methyl-N-phenyl-6-(1-propynyl)-2-pyrimidinamine |
110235-47-7 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H400, H410 |
|
|
ATP01/ |
| 612-230-00-4 |
N,N-bis(cocoyl-2-oxypropyl)-N,N-dibutylammonium bromide |
- |
Skin Corr. 1A, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H317, H400, H410 |
|
|
ATP01/ |
| 612-231-00-X |
3-((C12-18)-acylamino)-N-(2-((2-hydroxyethyl)amino)-2-oxoethyl)-N,N-dimethyl-1-propanaminium chloride |
164288-56-6 |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
ATP01/ |
| 612-232-00-5 |
reaction mass of: triisopropanolamine salt of 1-amino-4-(3-propionamidoanilino)anthraquinone-2-sulfonic acid; triisopropanolamine salt of 1-amino-4-[3,4-dimethyl-5-(2-hydroxyethylaminosulfonyl)anilino]anthraquinone-2-sulfonic acid |
186148-38-9 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 612-237-00-2 |
hydroxylammonium hydrogensulfate; hydroxylamine sulfate(1:1); [1] hydroxylamine phosphate; [2] hydroxylamine dihydrogenphosphate; [3] hydroxylamine 4-methylbenzenesulfonate [4] |
10046-00-1 [1], 20845-01-6 [2], 19098-16-9 [3], 53933-48-5 [4] |
Expl. 1.1, Carc. 2, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1 |
H201, H351, H312, H302, H373**, H319, H315, H317, H400 |
|
T |
ATP01/ |
| 612-238-00-8 |
(3-chloro-2-hydroxypropyl) trimethylammonium chloride ...% |
3327-22-8 |
Carc. 2, Aquatic Chronic 3 |
H351, H412 |
|
B |
ATP01/ |
| 612-239-00-3 |
biphenyl-3,3',4,4'-tetrayltetraamine; diaminobenzidine |
91-95-2 |
Carc. 1B, Muta. 2 |
H350, H341 |
|
|
ATP01/ |
| 612-240-00-9 |
pyrimethanil (ISO); N-(4,6-dimethylpyrimidin-2-yl)aniline |
53112-28-0 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 612-241-00-4 |
piperazine hydrochloride; [1] piperazine dihydrochloride; [2] piperazine phosphate [3] |
6094-40-2 [1], 142-64-3 [2], 1951-97-9 [3] |
Repr. 2, Eye Irrit. 2, Skin Irrit. 2, Resp. Sens. 1, Skin Sens. 1, Aquatic Chronic 3 |
H361fd, H319, H315, H334, H317, H412 |
|
|
ATP01/ |
| 612-242-00-X |
cyprodinil (ISO); 4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine |
121552-61-2 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
M=10: |
|
ATP01/ |
| 612-243-00-5 |
(1S-cis)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenamine 2-hydroxy-2-phenylacetate |
79617-97-3 |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
M=10: |
|
ATP01/ |
| 612-244-00-0 |
3-(piperazin-1-yl)-benzo[d]isothiazole hydrochloride |
87691-88-1 |
Repr. 2, Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361f***, H302, H319, H317, H400, H410 |
|
|
ATP01/ |
| 612-245-00-6 |
2-ethylphenylhydrazine hydrochloride |
19398-06-2 |
Carc. 2, STOT RE 1, Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H372**, H302, H318, H317, H400, H410 |
M=10: |
|
ATP01/ |
| 612-246-00-1 |
(2-chloroethyl)(3-hydroxypropyl)ammonium chloride |
40722-80-3 |
Carc. 1B, Muta. 1B, STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 3 |
H350, H340, H373**, H317, H412 |
|
|
ATP01/ |
| 612-247-00-7 |
N-[3-(1,1-dimethylethyl)-1H-pyrazol-5-yl]-N'-hydroxy-4-nitrobenzenecarboximidamide |
152828-23-4 |
STOT RE 1, Acute Tox. 4 *, Aquatic Chronic 3 |
H372**, H302, H412 |
|
|
ATP01/ |
| 612-248-00-2 |
reaction product of diphenylamine, phenothiazine, and alkenes, branched (C8-10, C9-rich) |
- |
Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 4 |
H315, H317, H413 |
|
|
ATP01/ |
| 612-249-00-8 |
4-[(3-chlorophenyl)(1H-imidazol-1-yl)methyl]-1,2-benzenediamine dihydrochloride |
159939-85-2 |
Repr. 2, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 2 |
H361f***, H302, H314, H317, H411 |
|
|
ATP01/ |
| 612-250-00-3 |
chloro-N,N-dimethylformiminium chloride |
3724-43-4 |
Repr. 1B, Acute Tox. 4 *, Skin Corr. 1A |
H360D***, H302, H314 |
|
|
ATP01/ |
| 612-251-00-9 |
cis-1-(3-chloroallyl)-3,5,7-triaza-1-azoniaadamantane chloride |
51229-78-8 |
Flam. Sol. 2, Repr. 2, Acute Tox. 4 *, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H228, H361d***, H302, H315, H317, H411 |
|
|
ATP01/ |
| 612-252-00-4 |
imidacloprid (ISO); (E)-1-(6-chloro- 3-pyridylmethyl)-N-nitroimidazolidin-2-ylideneamine;(2E)-1-[(6-chloropyridin- 3-yl) methyl]-N-nitroimidazolidin-2-imine |
138261-41-3 |
Acute Tox. 3, Aquatic Acute 1, Aquatic Chronic 1 |
H301,
H400,
H410 |
Oral: ATE = 131 mg/kg bw, M=100, M=1000 |
|
ATP01/ATP17 |
| 612-253-00-X |
7-methoxy-6-(3-morpholin-4-yl-propoxy)-3H-quinazolin-4-one; [containing < 0.5 % formamide (EC No 200-842-0)] |
199327-61-2 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 612-253-01-7 |
7-methoxy-6-(3-morpholin-4-yl-propoxy)-3H-quinazolin-4-one; [containing ≥ 0.5 % formamide (EC No 200-842-0) ] |
199327-61-2 |
Repr. 1B, Aquatic Chronic 3 |
H360D***, H412 |
|
|
ATP01/ |
| 612-254-00-5 |
reaction products of diisopropanolamine with formaldehyde (1:4) |
220444-73-5 |
Carc. 2, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 2 |
H351, H302, H314, H317, H411 |
|
|
ATP01/ |
| 612-255-00-0 |
1-(3-methoxypropyl)-4-piperidinamine |
179474-79-4 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B, Aquatic Chronic 3 |
H312, H302, H314, H412 |
|
|
ATP01/ |
| 612-256-00-6 |
benzyl(S)-2-[(2'-cyanobiphenyl-4-ylmethyl)pentanoylamino]-3-methylbutyrate |
137864-22-3 |
Acute Tox. 4 *, Skin Sens. 1 |
H302, H317 |
|
|
ATP01/ |
| 612-257-00-1 |
tripropylammonium dihydrogenphosphate |
35687-90-2 |
Acute Tox. 4 * |
H302 |
|
|
ATP01/ |
| 612-259-00-2 |
N-ethyl-3-trimethoxysilyl-2-methyl-propanamine |
227085-51-0 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 612-261-00-3 |
3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)aniline |
121451-05-6 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
M=10: |
|
ATP01/ |
| 612-265-00-5 |
bis(2-hydroxyethyl)-(2-hydroxypropyl)ammonium acetate |
191617-13-7 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 612-266-00-0 |
3-chloro-4-(3-fluorobenzyloxy)aniline |
202197-26-0 |
Muta. 2, Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H341, H302, H373**, H400, H410 |
|
|
ATP01/ |
| 612-267-00-6 |
bis(hydrogenated tallow C16-18-alkyl)hydroxylamine |
- |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 612-269-00-7 |
reaction mass of: 1-[di(4-octylphenyl)aminomethyl]-5-methyl-1H-benzotriazole; 1-[di(4-octylphenyl)aminomethyl]-4-methyl-1H-benzotriazole; reaction mass of: N-[(5-methyl-1H-benzotriazol-1-yl)methyl]-4-octyl-N-(4-octylphenyl)aniline; N-[(4-methyl-1H-benz |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 612-270-00-2 |
(S)-azetidine-2-carboxylic acid 4-cyanobenzylamide hydrochloride |
- |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 3 |
H302, H317, H412 |
|
|
ATP01/ |
| 612-271-00-8 |
reaction mass of: ethyl 2-((4-(5,6-dichlorobenzothiazol-2-ylazo)phenyl)ethylamino)benzoate; ethyl 2-((4-(6,7-dichlorobenzothiazol-2-ylazo)phenyl)ethylamino)benzoate |
160987-57-5 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 612-272-00-3 |
ammonium (η-6-2-(2-(1,2-dicarboxylatoethylamino)ethylamino)butane-1,4-dioato(4-))iron(3+) monohydrate |
- |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 612-273-00-9 |
alkyl(rapeseed oil), bis(2-hydroxyethyl)ammonium fluoride |
- |
Acute Tox. 4 *, Skin Corr. 1A, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H314, H400, H410 |
|
|
ATP01/ |
| 612-274-00-4 |
(R,S)-1-[2-amino-1(4-methoxyphenyl)ethyl]cyclohexanol acetate |
- |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H302, H318, H317, H412 |
|
|
ATP01/ |
| 612-275-00-X |
fatty acids, C18-unsatd., dimers, reaction products with 1-piperazineethanamine and tall oil |
206565-89-1 |
Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H317, H400, H410 |
M=10: |
|
ATP01/ |
| 612-276-00-5 |
1-amino-4-[(4-amino-2-sulfofenyl)amino]-9,10-dihydro-9,10-dioxo-2-anthracenesulfonic acid, disodium salt, reaction products with 2-[[3-[(4,6-dichloro-1,3,5-triazin-2-yl)ethylamino]phenyl]sulfonyl]ethyl hydrogen sulfate, sodium salts |
500717-36-2 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
|
ATP01/ |
| 612-277-00-0 |
reaction mass of: 4-amino-3-(4-ethenesulfonyl-2-sulfonatophenylazo)-5-hydroxy-6-(5-{4-chloro-6-[4-(2-sulfonatooxyethanesulfonyl)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)naphthalene-2,7-disulfonate potassium/sodium; 4-amino-5-hydroxy-6-( |
586372-44-3 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 612-278-00-6 |
ethidium bromide; 3,8-diamino-1-ethyl-6-phenylphenantridinium bromide |
1239-45-8 |
Muta. 2, Acute Tox. 2 *, Acute Tox. 4 * |
H341, H330, H302 |
|
|
ATP01/ |
| 612-279-00-1 |
(R,S)-2-amino-3,3-dimethylbutane amide |
144177-62-8 |
Repr. 2, STOT RE 2 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H361f***, H373**, H319, H315, H317 |
|
|
ATP01/ |
| 612-280-00-7 |
3-amino-9-ethyl carbazole; 9-ethylcarbazol-3-ylamine |
132-32-1 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 612-281-00-2 |
leucomalachite green; N,N,N',N'-tetramethyl-4,4'- benzylidenedianiline |
129-73-7 |
Carc. 2, Muta. 2 |
H351, H341 |
|
|
ATP03 |
| 612-282-00-8 |
octadecylamine |
124-30-1 |
Asp. Tox. 1, STOT RE 2, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H304, H373 (gastro-intestinal tract, liver, immune system), H315, H318, H400, H410 |
M=10, M=10 |
|
ATP05 |
| 612-283-00-3 |
(Z)-octadec-9-enylamine |
112-90-3 |
Acute Tox. 4, Asp Tox. 1, STOT SE 3, STOT RE 2, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H304, H335, H373 (gastro-intestinal tract, liver, immune system), H314, H400, H410 |
M=10, M=10 |
|
ATP05 |
| 612-284-00-9 |
amines, hydrogenated tallow alkyl |
61788-45-2 |
Asp Tox. 1, STOT RE 2, Skin Irrit. 2, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H304, H373 (gastro-intestinal tract, liver, immune system), H315, H318, H400, H410 |
M=10, M=10 |
|
ATP05 |
| 612-285-00-4 |
amines, coco alkyl |
61788-46-3 |
Acute Tox. 4, Asp. Tox. 1, STOT SE 3, STOT RE 2, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H304, H335, H373 (gastro-intestinal tract, liver, immune system), H314, H400, H410 |
M=10, M=10 |
|
ATP05 |
| 612-286-00-X |
amines, tallow alkyl |
61790-33-8 |
Acute Tox. 4, Asp. Tox. 1, STOT RE 2, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H304, H373 (gastro-intestinal tract, liver, immune system), H314, H400, H410 |
M=10, M=10 |
|
ATP05 |
| 612-287-00-5 |
fluazinam (ISO); 3-chloro-N-[3-chloro- 2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2- amine |
79622-59-6 |
Repr. 2, Acute Tox. 4, Eye Dam. 1, Skin Sens. 1A, Aquatic Acute 1, Aquatic Chronic 1 |
H361d, H332, H318, H317, H400, H410 |
M=10, M=10 |
|
ATP06 |
| 612-288-00-0 |
bupirimate (ISO); 5-butyl-2-ethylamino-6-methylpyrimidin-4-yl dimethylsulphamate |
41483-43-6 |
Carc. 2, Skin Sens. 1B, Aquatic Chronic 1 |
H351, H317, H410 |
M=1 |
|
ATP09 |
| 612-289-00-6 |
triflumizole (ISO); (1E)-N-[4-chloro-2-(trifluoromethyl)phenyl]-1-(1H-imidazol-1-yl)-2-propoxyethanimine |
68694-11-1 |
Repr. 1B, Acute Tox. 4, STOT RE 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360D, H302, H373 (liver), H317, H400, H410 |
M=1,
M=1 |
|
ATP09 |
| 612-290-00-1 |
reaction products of paraformaldehyde and 2-hydroxypropylamine (ratio 3:2); [formaldehyde released from 3,3′-methylenebis[5-methyloxazolidine]; [formaldehyde released from oxazolidin]; [MBO] |
|
Carc. 1B, Muta. 2, Acute Tox. 3, Acute Tox. 4, Acute Tox. 4, STOT RE 2, Skin Corr. 1B, Eye Dam. 1, Skin Sens. 1A, Aquatic Chronic 2 |
H350, H341, H311, H332, H302, H373 (gastrointestinal tract, respiratory tract), H314, H318, H317, H4 |
|
8, 9 |
ATP10 |
| 612-291-00-7 |
reaction products of paraformaldehyde with 2-hydroxypropylamine (ratio 1:1); [formaldehyde released from α,α,α-trimethyl-1,3,5-triazine-1,3,5(2H,4H,6H)-triethanol]; [HPT] |
|
Carc. 1B, Muta. 2, Acute Tox. 4, Acute Tox. 4, STOT RE 2, Skin Corr. 1C, Eye Dam. 1, Skin Sens. 1A, Aquatic Chronic 2 |
H350, H341, H332, H302, H373 (gastrointestinal tract, respiratory tract), H314, H318, H317, H411 |
|
8, 9 |
ATP10 |
| 612-292-00-2 |
methylhydrazine |
60-34-4 |
Carc. 1B |
H350 |
|
|
ATP10 |
| 612-293-00-8 |
reaction mass of 1-[2-(2-aminobutoxy)ethoxy]but-2-ylamine and 1-({[2-(2-aminobutoxy)ethoxy]methyl}propoxy)but-2-ylamine |
|
Repr. 2, Acute Tox. 4, Skin Corr. 1B, Eye Dam. 1 |
H361f, H302, H314, H318 |
|
|
ATP13 |
| 612-294-00-3 |
mecetronium etilsulfate; N-ethyl-N,N-dimethylhexadecan-1-aminium ethyl sulfate; mecetronium ethyl sulphate; [MES] |
3006-10-8 |
Skin Corr. 1, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H318, H400, H410, |
M=100, M=1000 |
|
ATP15 |
| 613-001-00-1 |
ethyleneimine; aziridine |
151-56-4 |
Flam. Liq. 2, Carc. 1B, Muta. 1B, Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Skin Corr. 1B, Aquatic Chronic 2 |
H225, H350, H340, H330, H310, H300, H314, H411 |
|
D |
CLP00/ |
| 613-002-00-7 |
pyridine |
110-86-1 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H225, H332, H312, H302 |
* |
|
CLP00/ |
| 613-003-00-2 |
1,2,3,4-tetranitrocarbazole |
6202-15-9 |
Expl. 1.1, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 * |
H201, H332, H312, H302 |
|
|
CLP00/ATP01 |
| 613-004-00-8 |
crimidine (ISO); 2-chloro-6-methylpyrimidin-4-yldimethylamine |
535-89-7 |
Acute Tox. 2 * |
H300 |
|
|
CLP00/ |
| 613-007-00-4 |
desmetryne (ISO); 6-isopropylamino-2-methylamino-4-methylthio-1,3,5-triazine |
1014-69-3 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H400, H410 |
|
|
CLP00/ |
| 613-008-00-X |
dazomet (ISO); tetrahydro-3,5-dimethyl-1,3,5-thiadiazine-2-thione |
533-74-4 |
Acute Tox. 4 *, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H400, H410 |
|
|
CLP00/ |
| 613-009-00-5 |
2,4,6-trichloro-1,3,5-triazine; cyanuric chloride |
108-77-0 |
Acute Tox. 2 *, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1 |
H330, H302, H314, H317 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 613-010-00-0 |
ametryn (ISO); 2-ethylamino-4-isopropylamino-6-methylthio-1,3,5-triazine |
834-12-8 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
M=100: |
|
CLP00/ATP01 |
| 613-011-00-6 |
amitrole (ISO); 1,2,4-triazol-3-ylamine |
61-82-5 |
Repr. 2, STOT RE 2 *, Aquatic Chronic 2 |
H361d ***, H373 **, H411 |
|
|
CLP00/ |
| 613-012-00-1 |
bentazone (ISO); 3-isopropyl-2,1,3-benzothiadiazine-4-one-2,2-dioxide |
25057-89-0 |
Repr. 2, Acute Tox. 4, Eye Irrit. 2, Skin Sens. 1 |
H361d, H302, H319, H317 |
oral: ATE = 1 600 mg/kg bw |
|
CLP00/ATP18 |
| 613-013-00-7 |
cyanazine (ISO); 2-(4-chloro-6-ethylamino-1,3,5-triazine-2-ylamino)-2-methylpropionitrile |
21725-46-2 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 613-014-00-2 |
ethoxyquin (ISO); 6-ethoxy-1,2-dihydro-2,2,4-trimethylquinoline |
91-53-2 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 613-015-00-8 |
fenazaflor (ISO); phenyl 5,6-dichloro-2-trifluoromethylbenzimidazole-1-carboxylate |
14255-88-0 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H400, H410 |
|
|
CLP00/ |
| 613-016-00-3 |
fuberidazole (ISO); 2-(2-furyl)-1H-benzimidazole |
3878-19-1 |
Carc. 2, Acute Tox. 4, STOT RE 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H302, H373 (Herz), H317, H400, H410, |
M=1 |
|
CLP00/ATP03 |
| 613-017-00-9 |
bis (8-hydroxyquinolinium) sulphate |
134-31-6 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 613-018-00-4 |
morfamquat (ISO); 1,1'-bis(3,5-dimethylmorpholinocarbonylmethyl)-4,4'-bipyridilium ion |
7411-47-4 |
Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Chronic 3 |
H302, H319, H335, H315, H412 |
|
|
CLP00/ |
| 613-019-00-X |
thioquinox (ISO); 2-thio-1,3-dithiolo(4,5,b)quinoxaline |
93-75-4 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 613-020-00-5 |
tridemorph (ISO); 2,6-dimethyl-4-tridecylmorpholine |
24602-86-6 |
Repr. 1B, Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H360D ***, H332, H302, H315, H400, H410 |
|
|
CLP00/ |
| 613-021-00-0 |
dithianon (ISO); 5,10-dihydro-5,10-dioxonaphtho(2,3-b)(1,4)dithiazine-2,3-dicarbonitrile |
3347-22-6 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 613-022-00-6 |
pyrethrins including cinerins, with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H312, H302, H400, H410 |
|
A |
CLP00/ |
| 613-023-00-1 |
2-methyl-4-oxo-3-(penta-2,4-dienyl)cyclopent-2-enyl [1R-[1α[S*(Z)],3β]]-chrysanthemate; pyrethrin I |
121-21-1 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H312, H302, H400, H410 |
|
|
CLP00/ |
| 613-024-00-7 |
2-methyl-4-oxo-3-(penta-2,4-dienyl)cyclopent-2-enyl[1R-[1α[S*(Z)](3β)]]-3-(3-methoxy-2-methyl-3-oxoprop-1-enyl)-2,2-dimethylcyclopropanecarboxylate; pyrethrin II |
121-29-9 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H312, H302, H400, H410 |
|
|
CLP00/ |
| 613-025-00-2 |
cinerin I; 3-(but-2-enyl)-2-methyl-4-oxocyclopent-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
25402-06-6 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 613-026-00-8 |
cinerin II; 3-(but-2-enyl)-2-methyl-4-oxocyclopent-2-enyl 2,2-dimethyl-3-(3-methoxy-2-methyl-3-oxoprop-1-enyl)cyclopropanecarboxylate |
121-20-0 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 613-027-00-3 |
piperidine |
110-89-4 |
Flam. Liq. 2, Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B |
H225, H331, H311, H314 |
* |
|
CLP00/ |
| 613-028-00-9 |
morpholine |
110-91-8 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H226, H332, H312, H302, H314 |
|
|
CLP00/ |
| 613-029-00-4 |
dichloro-1,3,5-triazinetrione; dichloroisocyanuric acid |
2782-57-2 |
Ox. Sol. 2, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Aquatic Acute 1, Aquatic Chronic 1 |
H272, H302, H319, H335, H400, H410 |
|
T |
CLP00/ |
| 613-030-00-X |
troclosene potassium; [1] troclosene sodium [2] |
2244-21-5 [1], 2893-78-9 [2] |
Ox. Sol. 2, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Aquatic Acute 1, Aquatic Chronic 1 |
H272, H302, H319, H335, H400, H410 |
*, STOT SE 3; H335: C ≥ 10 %, EUH031: C ≥ 10 % |
G |
CLP00/ATP01 |
| 613-030-01-7 |
troclosene sodium, dihydrate |
51580-86-0 |
Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H335, H400, H410 |
|
|
CLP00/ |
| 613-031-00-5 |
symclosene; trichloroisocyanuric acid; trichloro-1,3,5-triazinetrion |
87-90-1 |
Ox. Sol. 2, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Aquatic Acute 1, Aquatic Chronic 1 |
H272, H302, H319, H335, H400, H410 |
|
|
CLP00/ |
| 613-032-00-0 |
methyl-2,3,5,6-tetrachloro-4-pyridylsulphone; 2,3,5,6-tetrachloro-4-(methylsulphonyl)pyridine |
13108-52-6 |
Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1 |
H312, H302, H319, H317 |
|
|
CLP00/ |
| 613-033-00-6 |
2-methylaziridine; propyleneimine |
75-55-8 |
Flam. Liq. 2, Carc. 1B, Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Eye Dam. 1, Aquatic Chronic 2 |
H225, H350, H330, H310, H300, H318, H411 |
Carc. 1B; H350: C ≥ 0,01 % |
|
CLP00/ |
| 613-034-00-1 |
1,2-dimethylimidazole |
1739-84-0 |
Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1 |
H302, H315, H318 |
|
|
CLP00/ |
| 613-035-00-7 |
1-methylimidazole |
616-47-7 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1B |
H312, H302, H314 |
|
|
CLP00/ |
| 613-036-00-2 |
2-methylpyridine; 2-picoline |
109-06-8 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3 |
H226, H332, H312, H302, H319, H335 |
|
|
CLP00/ |
| 613-037-00-8 |
4-methylpyridine; 4-picoline |
108-89-4 |
Flam. Liq. 3, Acute Tox. 3 *, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H226, H311, H332, H302, H319, H335, H315 |
|
|
CLP00/ |
| 613-038-00-3 |
6-phenyl-1,3,5-triazine-2,4-diyldiamine; 6-phenyl-1,3,5-triazine-2,4-diamine; benzoguanamine |
91-76-9 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 613-039-00-9 |
ethylene thiourea; imidazolidine-2-thione; 2-imidazoline-2-thiol |
96-45-7 |
Repr. 1B, Acute Tox. 4 * |
H360D ***, H302 |
|
|
CLP00/ |
| 613-040-00-4 |
azaconazole (ISO); 1-{}{[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl}}-1H-1,2.4-triazole |
60207-31-0 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 613-041-00-X |
morpholine-4-carbonyl chloride |
15159-40-7 |
Carc. 2, Eye Irrit. 2, Skin Irrit. 2 |
H351, H319, H315 |
|
|
CLP00/ |
| 613-042-00-5 |
imazalil (ISO); 1-[2-(allyloxy)-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole |
35554-44-0 |
Carc. 2, Acute Tox. 3, Acute Tox. 4, Eye Dam. 1, Aquatic Chronic 1 |
H351, H301, H332, H318, H410 |
M=10 |
|
CLP00/ATP07 |
| 613-043-00-0 |
imazalil sulphate (ISO) powder; 1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate; [1] (±)-1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate [2] |
58594-72-2 [1], 83918-57-4 [2] |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
CLP00/ |
| 613-043-01-8 |
imazalil sulphate (ISO), aqueous solution; 1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate; [1] (±)-1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate [2] |
58594-72-2 [1], 83918-57-4 [2] |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H314, H317, H400, H410 |
Skin Corr. 1B; H314: C ≥ 50 %, Skin Irrit. 2; H315: 30 % ≤ C < 50 %, Eye Dam. 1; H318: 15 % ≤ C < 50 %, Eye Irrit. 2; H319: 5 % ≤ C < 15 % |
|
CLP00/ |
| 613-044-00-6 |
captan (ISO); 1,2,3,6-tetrahydro-N-(trichloromethylthio)phthalimide |
133-06-2 |
Carc. 2, Acute Tox. 3 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1 |
H351, H331, H318, H317, H400 |
M=10: |
|
CLP00/ATP01 |
| 613-045-00-1 |
folpet (ISO); N-(trichloromethylthio)phthalimide |
133-07-3 |
Carc. 2, Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1 |
H351, H332, H319, H317, H400 |
M=10: |
|
CLP00/ATP01 |
| 613-046-00-7 |
captafol (ISO); 1,2,3,6-tetrahydro-N-(1,1,2,2-tetrachloroethylthio)phthalimide |
2425-06-1 |
Carc. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H350, H317, H400, H410 |
|
|
CLP00/ |
| 613-047-00-2 |
1-dimethylcarbamoyl-5-methylpyrazol-3-yl dimethylcarbamate; dimetilan (ISO) |
644-64-4 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H312, H400, H410 |
|
|
CLP00/ |
| 613-048-00-8 |
carbendazim (ISO);
methyl benzimidazol-2-ylcarbamate |
10605-21-7 |
Muta. 1B,
Repr. 1B,
Skin Sens. 1,
Aquatic Acute 1,
Aquatic Chronic 1 |
H340,
H360FD,
H317,
H400,
H410 |
M=10,
M=10 |
|
CLP00/ATP17 |
| 613-049-00-3 |
benomyl (ISO); methyl 1-(butylcarbamoyl)benzimidazol-2-ylcarbamate |
17804-35-2 |
Muta. 1B, Repr. 1B, STOT SE 3, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H340, H360FD, H335, H315, H317, H400, H410 |
M = 10: |
|
CLP00/ |
| 613-050-00-9 |
carbadox (INN); methyl 3-(quinoxalin-2-ylmethylene)carbazate 1,4-dioxide; 2-(methoxycarbonylhydrazonomethyl)quinoxaline 1,4-dioxide |
6804-07-5 |
Flam. Sol. 1, Carc. 1B, Acute Tox. 4 * |
H228, H350, H302 |
|
T |
CLP00/ |
| 613-051-00-4 |
molinate (ISO); S-ethyl 1-perhydroazepinecarbothioate; S-ethyl perhydroazepine-1-carbothioate |
2212-67-1 |
Carc. 2, Repr. 2, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H361f ***, H332, H302, H373 **, H317, H400, H410 |
M = 100: |
|
CLP00/ |
| 613-052-00-X |
trifenmorph (ISO); 4-tritylmorpholine |
1420-06-0 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 613-053-00-5 |
anilazine (ISO); 2-chloro-N-(4,6-dichloro-1,3,5-triazin-2-yl)aniline |
101-05-3 |
Eye Irrit. 2, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H315, H400, H410 |
|
|
CLP00/ |
| 613-054-00-0 |
thiabendazole (ISO); 2-(thiazol-4-yl)benzimidazole |
148-79-8 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1, M=1
|
|
CLP00/ATP14 |
| 613-056-00-1 |
1,2-dimethyl-3,5-diphenylpyrazolium methylsulphate; difenzoquat methyl sulfate |
43222-48-6 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 613-057-00-7 |
dodemorph (ISO); 4-cyclododecyl-2,6-dimethylmorpholine |
1593-77-7 |
Repr. 2, STOT RE 2, Skin Corr. 1C, Skin Sens. 1A, Aquatic Acute 1, Aquatic Chronic 1 |
H361d, H373 (liver), H314, H317, H400, H410 |
M=1 , M=1 |
|
CLP00/ATP07 |
| 613-058-00-2 |
permethrin (ISO); m-phenoxybenzyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
52645-53-1 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H302, H317, H400, H410 |
M = 1000: |
|
CLP00/ |
| 613-059-00-8 |
profluralin (ISO); N-(cyclopropylmethyl)-α,α,α-trifluoro-2,6-dinitro-N-propyl-p-toluidine |
26399-36-0 |
Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H400, H410 |
|
|
CLP00/ |
| 613-060-00-3 |
resmethrin (ISO); 5-benzyl-3-furylmethyl (±)-cis-trans-chrysanthemate |
10453-86-8 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
M=1000: |
|
CLP00/ATP01 |
| 613-061-00-9 |
6-(1α,5aβ,8aβ,9-pentahydroxy-7β-isopropyl-2β,5β,8β-trimethylperhydro-8bα,9-epoxy-5,8-ethanocyclopenta[1,2-b]indenyl) pyrrole-2-carboxylate; ryania |
15662-33-6 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H400, H410 |
|
|
CLP00/ |
| 613-062-00-4 |
sabadilla (ISO); veratrine |
8051-02-3 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H319, H335, H315 |
|
|
CLP00/ |
| 613-063-00-X |
secbumeton (ISO); 2-sec-butylamino-4-ethylamino-6-methoxy-1,3,5-triazine |
26259-45-0 |
Acute Tox. 4 *, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H400, H410 |
|
|
CLP00/ |
| 613-064-00-5 |
5-(3,6,9-trioxa-2-undecyloxy)benzo(d)-1,3-dioxolane; sesamex |
51-14-9 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 613-065-00-0 |
simetryn (ISO); 2,4-bis(ethylamino)-6-methylthio-1,3,5-triazine |
1014-70-6 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 613-066-00-6 |
terbumeton (ISO); 2-tert-butylamino-4-ethylamino-6-methoxy-1,3,5-triazine |
33693-04-8 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 613-067-00-1 |
propazine (ISO); 2-chloro-4,6-bis(isopropylamino)-1,3,5-triazine |
139-40-2 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H400, H410 |
|
|
CLP00/ |
| 613-068-00-7 |
atrazine (ISO); 2-chloro-4-ethylamine-6-isopropylamine-1,3,5-triazine |
1912-24-9 |
STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H373 **, H317, H400, H410 |
|
|
CLP00/ |
| 613-069-00-2 |
ε-caprolactam |
105-60-2 |
Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2 |
H332, H302, H319, H335, H315 |
|
|
CLP00/ |
| 613-070-00-8 |
propylenethiourea |
2122-19-2 |
Repr. 2, Acute Tox. 4 *, Aquatic Chronic 3 |
H361d ***, H302, H412 |
|
|
CLP00/ |
| 613-071-00-3 |
2-fluoro-5-trifluoromethylpyridine |
69045-82-5 |
Flam. Liq. 3, Skin Sens. 1, Aquatic Chronic 3 |
H226, H317, H412 |
|
|
CLP00/ |
| 613-072-00-9 |
N,N-bis(2-ethylhexyl)-((1,2,4-triazol-1-yl)methyl)amine |
91273-04-0 |
Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 2 |
H314, H317, H411 |
|
|
CLP00/ |
| 613-073-00-4 |
N,N-dimethyl-2-(3-(4-chlorophenyl)-4,5-dihydropyrazol-1-ylphenylsulphonyl)ethylamine |
10357-99-0 |
STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 2 |
H373 **, H317, H411 |
|
|
CLP00/ |
| 613-074-00-X |
3-(3-methylpent-3-yl)isoxazol-5-ylamine |
82560-06-3 |
Acute Tox. 3 *, Acute Tox. 3 *, Eye Dam. 1, Aquatic Chronic 3 |
H331, H301, H318, H412 |
|
|
CLP00/ |
| 613-075-00-5 |
1,3-dichloro-5-ethyl-5-methylimidazolidine-2,4-dione |
89415-87-2 |
Ox. Sol. 1 ****, Acute Tox. 3 *, Skin Corr. 1B, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1 |
H271, H331, H314, H302, H317, H400 |
|
|
CLP00/ |
| 613-076-00-0 |
3-chloro-5-trifluoromethyl-2-pyridylamine |
79456-26-1 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 613-077-00-6 |
reaction mass of 5-heptyl-1,2,4-triazol-3-ylamine and 5-nonyl-1,2,4-triazol-3-ylamine |
- |
Acute Tox. 4 *, Eye Irrit. 2, Aquatic Chronic 2 |
H302, H319, H411 |
|
|
CLP00/ |
| 613-078-00-1 |
N,N,N,N-tetrakis(4,6-bis(butyl-(N-methyl-2,2,6,6-tetramethylpiperidin-4-yl)amino)triazin-2-yl)-4,7-diazadecane-1,10-diamine |
106990-43-6 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 613-079-00-7 |
4-(1(or 4 or 5 or 6)-methyl-8,9,10-trinorborn-5-en-2-yl)pyridine, reaction mass of isomers |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H315, H317, H400, H410 |
|
|
CLP00/ |
| 613-080-00-2 |
3-(bis(2-ethylhexyl)aminomethyl)benzothiazole-2(3H)-thione |
105254-85-1 |
Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H317, H400, H410 |
|
|
CLP00/ |
| 613-081-00-8 |
1-butyl-2-methylpyridinium bromide |
26576-84-1 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 613-082-00-3 |
2-methyl-1-pentylpyridinium bromide |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 3 |
H312, H302, H412 |
|
|
CLP00/ |
| 613-083-00-9 |
2-(4-(3-(4-chlorophenyl)-2-pyrazolin-1-yl)phenylsulfonyl)ethyldimethylammonium formate |
- |
Skin Corr. 1B, STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H373 **, H317, H400, H410 |
|
|
CLP00/ |
| 613-084-00-4 |
2-(4-(3-(4-chlorophenyl)-4,5-dihydropyrazolyl)phenylsulphonyl)ethyldimethylammonium hydrogen phosphonate |
106359-93-7 |
Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H400, H410 |
|
|
CLP00/ |
| 613-085-00-X |
reaction mass of 1,1'-(methylenebis(4,1-phenylene))dipyrrole-2,5-dione and N-(4-(4-(2,5-dioxopyrrol-1-yl)benzyl)phenyl)acetamide and 1-(4-(4-(5-oxo-2H-2-furylidenamino)benzyl)phenyl)pyrrole-2,5-dione |
- |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 613-086-00-5 |
caffeine |
58-08-2 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 613-087-00-0 |
tetrahydrothiophene |
110-01-0 |
Flam. Liq. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Chronic 3 |
H225, H332, H312, H302, H319, H315, H412 |
|
|
CLP00/ |
| 613-088-00-6 |
1,2-benzisothiazol-3(2H)-one; 1,2-benzisothiazolin-3-one |
2634-33-5 |
Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1 |
H302, H315, H318, H317, H400 |
Skin Sens. 1; H317: C ≥ 0,05 % |
|
CLP00/ |
| 613-089-00-1 |
diquat dibromide; [1] diquat dichloride; [2] 6,7-dihydrodipyrido[1,2-α:2',1'-c]pyrazinediylium dihydroxide [3] |
85-00-7 [1], 4032-26-2 [2], 94021-76-8 [3] |
Acute Tox. 2 *, STOT RE 1, Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H372 **, H302, H319, H335, H315, H317, H400, H410 |
|
|
CLP00/ |
| 613-090-00-7 |
paraquat dichloride; 1,1-dimethyl-4,4'-bipyridinium dichloride; [1] paraquat dimethylsulfate; 1,1-dimethyl-4,4'-bipyridinium dimethyl sulphate [2] |
1910-42-5 [1], 2074-50-2 [2] |
Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H311, H301, H372 **, H319, H335, H315, H400, H410 |
|
|
CLP00/ |
| 613-091-00-2 |
morfamquat dichloride; [1] morfamquat sulfate [2] |
4636-83-3 [1], 29873-36-7 [2] |
Acute Tox. 4 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Chronic 3 |
H302, H319, H335, H315, H412 |
|
|
CLP00/ |
| 613-092-00-8 |
1,10-phenanthroline |
66-71-7 |
Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H400, H410 |
|
|
CLP00/ |
| 613-093-00-3 |
hexasodium 6,13-dichloro-3,10-bis((4-(2,5-disulfonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacene-4,11-disulfonate |
85153-92-0 |
Resp. Sens. 1, Skin Sens. 1 |
H334, H317 |
|
|
CLP00/ |
| 613-094-00-9 |
4-methoxy-N,6-dimethyl-1,3,5-triazin-2-ylamine |
5248-39-5 |
Acute Tox. 4 *, STOT RE 2 * |
H302, H373 ** |
|
|
CLP00/ |
| 613-095-00-4 |
sodium 3-(2H-benzotriazol-2-yl)-5-sec-butyl-4-hydroxybenzenesulfonate |
92484-48-5 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 613-096-00-X |
2-amino-6-ethoxy-4-methylamino-1,3,5-triazine |
62096-63-3 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 613-097-00-5 |
7-amino-3-((5-carboxymethyl-4-methyl-1,3-thiazol-2-ylthio)methyl)-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-ene-2-carboxylic acid |
111298-82-9 |
Resp. Sens. 1, Skin Sens. 1, Aquatic Chronic 3 |
H334, H317, H412 |
|
|
CLP00/ |
| 613-098-00-0 |
N-(n-octyl)-2-pyrrolidone |
2687-94-7 |
Skin Corr. 1B, Aquatic Chronic 2 |
H314, H411 |
|
|
CLP00/ |
| 613-099-00-6 |
1-dodecyl-2-pyrrolidone |
2687-96-9 |
Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H317, H400, H410 |
|
|
CLP00/ |
| 613-100-00-X |
2,9-bis(3-(diethylamino)propylsulfamoyl)quino(2,3-b)acridine-7,14-dione |
- |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 613-101-00-5 |
N-tert-pentyl-2-benzothiazolesulfenamide |
110799-28-5 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 613-102-00-0 |
dimethomorph (ISO);
(E,Z)- 4-(3-(4-chlorophenyl)- 3-(3,4-dimethoxyphenyl) acryloyl)morpholine |
110488-70-5 |
Repr. 1B,
Aquatic Chronic 2 |
H360F,
H411 |
|
|
CLP00/ATP17 |
| 613-103-00-6 |
sodium 5-n-butylbenzotriazole |
118685-34-0 |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 2 |
H302, H314, H317, H411 |
|
|
CLP00/ |
| 613-104-00-1 |
5-tert-butyl-3-isoxazolylamine hydrochloride |
- |
Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Aquatic Chronic 3 |
H302, H373 **, H318, H412 |
|
|
CLP00/ |
| 613-105-00-7 |
hexakis(tetramethylammonium) 4,4'-vinylenebis((3-sulfonato-4,1-phenylene)imino(6-morpholino-1,3,5-triazine-4,2-diyl)imino)bis(5-hydroxy-6-phenylazonaphthalene-2,7-disulfonate) |
124537-30-0 |
Acute Tox. 3 *, Skin Sens. 1, Aquatic Chronic 3 |
H301, H317, H412 |
|
|
CLP00/ |
| 613-106-00-2 |
tetrapotassium 2-(4-(5-(1-(2,5-disulfonatophenyl)-3-ethoxycarbonyl-5-hydroxypyrazol-4-yl)penta-2,4-dienylidene)-3-ethoxycarbonyl-5-oxo-2-pyrazolin-1-yl)benzene-1,4-disulfonate |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 613-107-00-8 |
hexasodium 2,2'-vinylenebis((3-sulfonato-4,1-phenylene)imino(6-(N-cyanoethyl-N-(2-hydroxypropyl)amino)-1,3,5-triazine-4,2-diyl)imino)dibenzene-1,4-disulfonate |
76508-02-6 |
Eye Irrit. 2 |
H319 |
|
|
CLP00/ |
| 613-108-00-3 |
benzothiazole-2-thiol |
149-30-4 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 613-109-00-9 |
bis(piperidinothiocarbonyl) disulphide |
94-37-1 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1 |
H319, H335, H315, H317 |
|
|
CLP00/ |
| 613-110-00-4 |
dimepiperate (ISO); S-(1-methyl-1-phenylethyl) piperidine-1-carbothioate |
61432-55-1 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 613-111-00-X |
1,2,4-triazole |
288-88-0 |
Repr. 1B, Acute Tox. 4, Eye Irrit. 2 |
H360FD, H302, H319 |
Oral: ATE = 1320 mg/kg bw |
|
CLP00/ATP17 |
| 613-112-00-5 |
octhilinone (ISO); 2-octyl-2H-isothiazol-3-one; [OIT] |
26530-20-1 |
Acute Tox. 2, Acute Tox. 3, Acute Tox. 3, Skin Corr. 1, Eye Dam. 1, Skin Sens. 1A, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H311, H301, H314, H318, H317, H400, H410 |
Inhalation: ATE = 0.27 mg/L (dusts/mists), Dermal: ATE = 311 mg/kg, Oral: ATE = 125 mg/kg, Skin Sens. 1A : C ≥ ,0015 %, M=100, M=100 |
|
CLP00/ATP15 |
| 613-113-00-0 |
2-(morpholinothio)benzothiazole |
102-77-2 |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H319, H315, H317, H411 |
|
|
CLP00/ |
| 613-114-00-6 |
2,2',2"-(hexahydro-1,3,5-triazine-1,3,5-triyl)triethanol; 1,3,5-tris(2-hydroxyethyl)hexahydro-1,3,5-triazine |
4719-04-4 |
Acute Tox. 4 *, Skin Sens. 1 |
H302, H317 |
Skin Sens. 1; H317: C ≥ 0,1 % |
|
CLP00/ |
| 613-115-00-1 |
hymexazol (ISO); 3-hydroxy-5-methylisoxazole |
10004-44-1 |
Repr. 2, Acute Tox. 4, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H361d, H302, H318, H317, H411 |
Oral: ATE = 1600 mg/kg |
|
CLP00/ATP15 |
| 613-116-00-7 |
tolylfluanid (ISO); dichloro-N-[(dimethylamino)sulphonyl]fluoro-N-(p-tolyl)methanesulphenamide; [containing ≥ 0.1% (w/w) of particles with an aerodynamic diameter of below 50 μm] |
731-27-1 |
Acute Tox. 2 *, STOT RE 1, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1 |
H330, H372**, H319, H335, H315, H317, H400 |
M=10: |
|
CLP00/ATP01 |
| 613-116-01-4 |
tolylfluanid (ISO); dichloro-N-[(dimethylamino)sulphonyl]fluoro-N-(p-tolyl)methanesulphenamide; [containing < 0.1% (w/w) of particles with an aerodynamic diameter of below 50 μm] |
731-27-1 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1 |
H319, H335, H315, H317, H400 |
M=10: |
|
ATP01/ |
| 613-117-00-2 |
diniconazole (ISO); (E)-β-[(2,4-dichlorophenyl)methylene]-α-(1,1-dimethylethyl)-1H-1,2,4-triazol-1-ethanol; (E)-(RS)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol |
76714-88-0 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 613-118-00-8 |
flubenzimine (ISO); N-[3-phenyl-4,5-bis[(trifluoromethyl)imino]thiazolidin-2-ylidene]aniline |
37893-02-0 |
Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H319, H400, H410 |
|
|
CLP00/ |
| 613-119-00-3 |
(benzothiazol-2-ylthio)methyl thiocyanate; TCMTB |
21564-17-0 |
Acute Tox. 2 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H302, H319, H315, H317, H400, H410 |
|
|
CLP00/ |
| 613-120-00-9 |
bioresmethrin (ISO); (5-benzylfur-3-yl)methyl(1R)-trans-2,2-dimethyl-3-(2-methylpropenyl)cyclopropanecarboxylate |
28434-01-7 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1000: |
|
CLP00/ATP01 |
| 613-121-00-4 |
chlorsulfuron (ISO); 2-chloro-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]benzenesulphonamide |
64902-72-3 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1000, M=100 |
|
CLP00/ATP09 |
| 613-122-00-X |
diclobutrazole (ISO); (R*, R*)-(±)-β-[(2,4-dichlorophenyl)methyl]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol; (2RS, 3RS)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1yl)pentan-3-ol |
75736-33-3 |
Eye Irrit. 2, Aquatic Chronic 2 |
H319, H411 |
|
|
CLP00/ |
| 613-123-00-5 |
5,6-dihydro-3H-imidazo[2,1-c]-1,2,4-dithiazole-3-thione; etem |
33813-20-6 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 613-124-00-0 |
fenpropimorph (ISO); cis-4-[3-(p-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine |
67564-91-4 |
Repr. 2, Acute Tox. 4 *, Skin Irrit. 2, Aquatic Chronic 2 |
H361d ***, H302, H315, H411 |
|
|
CLP00/ |
| 613-125-00-6 |
hexythiazox (ISO); trans-5-(4-chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-3-thiazolidine-carboxamide |
78587-05-0 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1, M=1 |
|
CLP00/ATP15 |
| 613-126-00-1 |
imazapyr (ISO); 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-3-pyridine carboxylate |
81334-34-1 |
Eye Irrit. 2, Aquatic Chronic 3 |
H319, H412 |
|
|
CLP00/ |
| 613-127-00-7 |
1,1-dimethylpiperidinium chloride; mepiquat chloride |
24307-26-4 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 613-128-00-2 |
prochloraz (ISO); N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide |
67747-09-5 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 613-129-00-8 |
metamitron (ISO); 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one |
41394-05-2 |
Acute Tox. 4 *, Aquatic Acute 1 |
H302, H400 |
|
|
CLP00/ |
| 613-131-00-9 |
pyroquilon (ISO); 1,2,5,6-tetrahydropyrrolo[3,2,1-ij]quinolin-4-one |
57369-32-1 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 613-132-00-4 |
hexazinone (ISO); 3-cyclohexyl-6-dimethylamino-1-methyl-1,2,3,4-tetrahydro-1,3,5-triazine-2,4-dione |
51235-04-2 |
Acute Tox. 4 *, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H400, H410 |
|
|
CLP00/ |
| 613-133-00-X |
etridiazole (ISO); 5-ethoxy-3-trichloromethyl-1,2,4-thiadiazole |
2593-15-9 |
Carc. 2, Acute Tox. 4, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H302, H317, H400, H410 |
M=1 , M=1 |
|
CLP00/ATP07 |
| 613-134-00-5 |
myclobutanil (ISO); 2-(4-chlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)hexanenitrile |
88671-89-0 |
Repr. 2, Acute Tox. 4 *, Eye Irrit. 2, Aquatic Chronic 2 |
H361d ***, H302, H319, H411 |
|
|
CLP00/ |
| 613-135-00-0 |
di(benzothiazol-2-yl) disulphide |
120-78-5 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 613-136-00-6 |
N-cyclohexylbenzothiazole-2-sulphenamide |
95-33-0 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 613-137-00-1 |
methabenzthiazuron (ISO); 1-(1,3-benzothiazol-2-yl)1,3-dimethylurea |
18691-97-9 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 613-138-00-7 |
quinoxyfen (ISO); 5,7-dichloro-4-(4-fluorophenoxy)quinoline |
124495-18-7 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 613-139-00-2 |
metsulfuron-methyl (ISO); 2-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl) benzoic acid |
74223-64-6 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1000: |
|
CLP00/ATP01 |
| 613-140-00-8 |
cycloheximide (ISO); 4-{}{(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl}}piperidine-2,6-dione |
66-81-9 |
Muta. 2, Repr. 1B, Acute Tox. 2 *, Aquatic Chronic 2 |
H341, H360D ***, H300, H411 |
|
|
CLP00/ |
| 613-141-00-3 |
1,4-diamino-2-(2-butyltetrazol-5-yl)-3-cyanoanthraquinone |
93686-63-6 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 613-142-00-9 |
trans-N-methyl-2-styryl-[4'-aminomethine-(1-acetyl-1-(2-methoxyphenyl)acetamido)]pyridinium acetate |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 613-143-00-4 |
1-(3-phenylpropyl)-2-methylpyridinium bromide |
10551-42-5 |
Acute Tox. 4 *, Eye Irrit. 2, Aquatic Chronic 3 |
H302, H319, H412 |
|
|
CLP00/ |
| 613-144-00-X |
Reaction products of: poly(vinyl acetate), partially hydrolyzed, with (E)-2-(4-formylstyryl)-3,4-dimethylthiazoliummethyl sulfate |
125139-08-4 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 613-145-00-5 |
(S)-3-benzyloxycarbonyl-1,2,3,4-tetrahydro-isoquinolinium 4-methylbenzenesulfonate |
77497-97-3 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 613-146-00-0 |
N-ethyl-N-methylpiperidinium iodide |
4186-71-4 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 613-147-00-6 |
4-[2-(1-methyl-2-(4-morpholinyl)ethoxy)ethyl]morpholine |
111681-72-2 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 613-148-00-1 |
tetrasodium 1,2-bis(4-fluoro-6-[5-(1-amino-2-sulfonatoanthrachinon-4-ylamino)-2,4,6-trimethyl-3-sulfonatophenylamino]-1,3,5-triazin-2-ylamino)ethane |
143683-23-2 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 613-149-00-7 |
pyridaben (ISO); 2-tert-butyl-5-(4-tert-butylbenzylthio)-4-chloropyridazin-3(2H)-one |
96489-71-3 |
Acute Tox. 3, Acute Tox. 3, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H301, H400, H410 |
M=1000 , M=1000 |
|
CLP00/ATP07 |
| 613-150-00-2 |
2,2'-[3,3'-(piperazine-1,4-diyl)dipropyl]bis(1H-benzimidazo[2,1-b]benzo[l,m,n][3,8]phenanthroline-1,3,6-trione |
- |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 613-151-00-8 |
1-(3-mesyloxy-5-trityloxymethyl-2-D-threofuryl)thymine |
104218-44-2 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 613-152-00-3 |
phenyl N-(4,6-dimethoxypyrimidin-2-yl)carbamate |
89392-03-0 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 613-153-00-9 |
2,3,5-trichloropyridine |
16063-70-0 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 613-154-00-4 |
2-amino-4-chloro-6-methoxypyrimidine |
5734-64-5 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 613-155-00-X |
5-chloro-2,3-difluoropyridine |
89402-43-7 |
Flam. Liq. 3, Acute Tox. 4 *, Aquatic Chronic 3 |
H226, H302, H412 |
|
|
CLP00/ |
| 613-156-00-5 |
2-butyl-4-chloro-5-formylimidazole |
83857-96-9 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 613-157-00-0 |
2,4-diamino-5-methoxymethylpyrimidine |
54236-98-5 |
Acute Tox. 4 *, STOT RE 2 *, Eye Irrit. 2 |
H302, H373 **, H319 |
|
|
CLP00/ |
| 613-158-00-6 |
2,3-dichloro-5-trifluoromethyl-pyridine |
69045-84-7 |
Acute Tox. 4 *, Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H332, H302, H318, H317, H411 |
|
|
CLP00/ |
| 613-159-00-1 |
fenazaquin (ISO); 4-[2-[4-(1,1-dimethylethyl)phenyl]-ethoxy]quinazoline |
120928-09-8 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H332, H400, H410 |
|
|
CLP00/ |
| 613-160-00-7 |
(1S)-2-methyl-2,5-diazobicyclo[2.2.1]heptane dihydrobromide |
125224-62-6 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 613-161-00-2 |
2,4-diamino-6-hydroxymethylpteridinehydrobromide |
76145-91-0 |
STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 3 |
H373**, H317, H412 |
|
|
ATP01/ |
| 613-162-00-8 |
(6R-trans)-1-((7-ammonio-2-carboxylato-8-oxo-5-thia-1-azabicyclo-[4.2.0]oct-2-en-3-yl)methyl)pyridinium iodide |
100988-63-4 |
Muta. 2, Skin Sens. 1, Aquatic Chronic 2 |
H341, H317, H411 |
|
|
ATP01/ |
| 613-163-00-3 |
azimsulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-[1-methyl-4-(2-methyl-2H-tetrazol-5-yl)pyrazol-5-ylsulfonyl]urea |
120162-55-2 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1000: |
|
CLP00/ATP01 |
| 613-164-00-9 |
flufenacet (ISO); N-(4-fluorophenyl)-N-isopropyl-2-(5-trifluoromethyl-[1,3,4]thiadiazol-2-yloxy)acetamide |
142459-58-3 |
Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373**, H317, H400, H410 |
M=100: |
|
CLP00/ATP01 |
| 613-165-00-4 |
flupyrsulfuron-methyl-sodium (ISO); methyl 2-[[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-6-trifluoromethyl]nicotinate, monosodium salt |
144740-54-5 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=100: |
|
CLP00/ATP01 |
| 613-166-00-X |
flumioxazin (ISO);
N-(7-fluoro-3,4-dihydro- 3-oxo-4-prop- 2-ynyl-2H-1,4-benzoxazin- 6-yl)cyclohex- 1-ene-1,2-dicarboximide |
103361-09-7 |
Repr. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H361d,
H400,
H410 |
M=1000, M=1000 |
|
CLP00/ATP09/ATP17 |
| 613-167-00-5 |
reaction mass of 5-chloro-2-methyl-2H-isothiazol-3-one and 2-methyl-2H-isothiazol-3-one (3:1) |
55965-84-9 |
Acute Tox. 2, Acute Tox. 2, Acute Tox. 3, Skin Corr. 1C, Eye Dam. 1, Skin Sens. 1A, Aquatic Acute 1, Aquatic Chronic 1 |
H330, , H301, H314, H318, H317, H400, H410 |
Skin Corr. 1C; C ≥ 0,6 %, Skin Irrit. 2; H315: 0,06 % ;le; C < 0,6 %, Eye Dam. 1; C ≥ 0,6 %, Eye Irrit. 2; H319: 0,06 % ≤ C < 0,6 %, Skin Sens. 1A; C ≥ 0,0015 %, M=100, M=100 |
B |
CLP00/ATP13 |
| 613-168-00-0 |
1-vinyl-2-pyrrolidone |
88-12-0 |
Carc. 2, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, STOT SE 3, Eye Dam. 1 |
H351, H332, H312, H302, H373 **, H335, H318 |
|
D |
CLP00/ |
| 613-169-00-6 |
9-vinylcarbazole |
1484-13-5 |
Muta. 2, Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H341, H312, H302, H315, H317, H400, H410 |
M=100: |
|
CLP00/ATP01 |
| 613-170-00-1 |
2,2-ethylmethylthiazolidine |
694-64-4 |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H302, H318, H317, H411 |
|
|
CLP00/ |
| 613-171-00-7 |
hexaconazole (ISO); (RS)-2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol |
79983-71-4 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H302, H317, H411 |
|
|
CLP00/ |
| 613-172-00-2 |
5-chloro-1,3-dihydro-2H-indol-2-one |
17630-75-0 |
Repr. 2, Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 3 |
H361f ***, H302, H317, H412 |
|
|
CLP00/ |
| 613-173-00-8 |
fluquinconazole (ISO); 3-(2,4-dichlorophenyl)-6-fluoro-2-(1H-1,2,4-triazol-1-yl)quinazolin-4-(3H)-one |
136426-54-5 |
Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1, Acute Tox. 4 *, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H301, H372 **, H312, H315, H400, H410 |
|
|
CLP00/ |
| 613-174-00-3 |
tetraconazole (ISO); (±) 2-(2,4-dichlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propyl-1,1,2,2-tetrafluoroethylether |
112281-77-3 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 2 |
H332, H302, H411 |
|
|
CLP00/ATP01 |
| 613-175-00-9 |
epoxiconazole (ISO); (2RS,3SR)-3-(2-chlorophenyl)-2-(4-fluorophenyl)-[(1H-1,2,4-triazol-1-yl)methyl]oxirane |
133855-98-8 |
Carc. 2, Repr. 1B, Aquatic Chronic 2 |
H351, H360Df, H411 |
|
|
CLP00/ATP05 |
| 613-176-00-4 |
2-methyl-2-azabicyclo[2.2.1]heptane |
4524-95-2 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1B |
H226, H312, H302, H373 **, H314 |
|
|
CLP00/ |
| 613-177-00-X |
8-amino-7-methylquinoline |
5470-82-6 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H312, H302, H317, H411 |
|
|
CLP00/ |
| 613-178-00-5 |
4-ethyl-2-methyl-2-isopentyl-1,3-oxazolidine |
137796-06-6 |
Skin Corr. 1B, Skin Sens. 1 |
H314, H317 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 613-179-00-0 |
lithium 3-oxo-1,2(2H)-benzisothiazol-2-ide |
111337-53-2 |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 2 |
H302, H314, H317, H411 |
|
|
CLP00/ |
| 613-180-00-6 |
N-(1,1-dimethylethyl)bis(2-benzothiazolesulfen)amide |
3741-80-8 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 613-181-00-1 |
5,5-dimethyl-perhydro-pyrimidin-2-one α-(4-trifluoromethylstyryl)-α-(4-trifluoromethyl)cinnamylidenehydrazone |
67485-29-4 |
STOT RE 1, Acute Tox. 4 *, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H372 **, H302, H319, H400, H410 |
|
|
CLP00/ |
| 613-182-00-7 |
1-(1-naphthylmethyl)quinolinium chloride |
65322-65-8 |
Carc. 2, Muta. 2, Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 3 |
H351, H341, H302, H315, H318, H412 |
|
|
CLP00/ |
| 613-183-00-2 |
reaction mass of: 5-(N-methylperfluorooctylsulfonamido)methyl-3-octadecyl-1,3-oxazolidin-2-one; 5-(N-methylperfluoroheptylsulfonamido)methyl-3-octadecyl-1,3-oxazolidin-2-one |
- |
STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H373 **, H400, H410 |
|
|
CLP00/ |
| 613-184-00-8 |
nitrilotriethyleneammoniopropane-2-ol 2-ethylhexanoate |
- |
Eye Irrit. 2, Skin Sens. 1 |
H319, H317 |
|
|
CLP00/ |
| 613-185-00-3 |
2,3,5,6-tetrahydro-2-methyl-2H-cyclopenta[d]-1,2-thiazol-3-one |
82633-79-2 |
Acute Tox. 3 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H318, H317, H400, H410 |
|
|
CLP00/ |
| 613-186-00-9 |
(2R,3R)-3-((R)-1-(tert-butyldimethylsiloxy)ethyl)-4-oxoazetidin-2-yl acetate |
76855-69-1 |
Eye Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H319, H317, H411 |
|
|
CLP00/ |
| 613-187-00-4 |
5-(2-amino-5-cyano-6-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridin-3-ylazo)-3-methyl-2,4-dicarbonitrilethiophene |
- |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 613-188-00-X |
1-(3-(4-fluorophenoxy)propyl)-3-methoxy-4-piperidinone |
116256-11-2 |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H302, H318, H317, H411 |
|
|
CLP00/ |
| 613-189-00-5 |
1,4,7,10-tetrakis(p-toluensulfonyl)-1,4,7,10-tetraazacyclododecane |
52667-88-6 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 613-190-00-0 |
disodium 1-amino-4-(2-(5-chloro-6-fluoro-pyrimidin-4-ylamino-methyl)-4-methyl-6-sulfo-phenylamino)-9,10-dioxo-9,10-dihydro-anthracene-2-sulfonate |
149530-93-8 |
Acute Tox. 4 *, Skin Sens. 1 |
H302, H317 |
|
|
CLP00/ |
| 613-191-00-6 |
3-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine |
143860-04-2 |
Repr. 1B, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H360F ***, H314, H400, H410 |
|
|
CLP00/ |
| 613-192-00-1 |
3-benzyl-exo-6-nitro-2,4-dioxo-3-aza-cis-bicyclo[3.1.0]hexane |
151860-15-0 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
ATP01/ |
| 613-193-00-7 |
pentakis[3-(dimethylammonio)propylsulfamoyl]-[(6-hydroxy-4,4,8,8-tetramethyl-4,8-diazoniaundecane-1,11-diyldisulfamoyl)di[phthalocyaninecopper(II)]] heptalactate |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 613-194-00-2 |
6,13-dichloro-3,10-bis{}{2-[4-fluoro-6-(2-sulfophenylamino)-1,3,5-triazin-2-ylamino]propylamino}}benzo[5,6][1,4]oxazino[2,3-.b.]phenoxazine-4,11-disulphonic acid, lithium-, sodium salt |
163062-28-0 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 613-195-00-8 |
2,2-(1,4-phenylene)bis((4H-3,1-benzoxazine-4-one) |
18600-59-4 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 613-196-00-3 |
5-[[4-chloro-6-[[2-[[4-fluoro-6-[[5-hydroxy-6-[(4-methoxy-2-sulfophenyl)azo]-7-sulfo-2-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]-1-methylethyl]amino]-1,3,5-triazin-2-yl]amino]-3-[[4-(ethenylsulfonyl)phenyl]azo]-4-hydroxy-naphtalene-2,7-disulfonic acid, sodium salt |
168113-78-8 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 613-197-00-9 |
reaction mass of: 2,4,6-tri(butylcarbamoyl)-1,3,5-triazine; 2,4,6-tri(methylcarbamoyl)-1,3,5-triazine; [(2-butyl-4,6-dimethyl)tricarbamoyl]-1,3,5-triazine; [(2,4-dibutyl-6-methyl)tricarbamoyl]-1,3,5-triazine |
187547-46-2 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 613-198-00-4 |
2-amino-4-dimethylamino-6-trifluoroethoxy-1,3,5-triazine |
145963-84-4 |
Acute Tox. 4 *, STOT RE 2 *, Aquatic Chronic 3 |
H302, H373**, H412 |
|
|
ATP01/ |
| 613-199-00-X |
reaction mass of: 1,3,5-tris(3-aminomethylphenyl)-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione; reaction mass of oligomers of 3,5-bis(3-aminomethylphenyl)-1-poly[3,5-bis(3-aminomethylphenyl)-2,4,6-trioxo-1,3,5-(1H,3H,5H)-triazin-1-yl]-1,3,5-(1H,3H,5H)-triazine |
- |
Carc. 1B, Repr. 1B, Skin Sens. 1, Aquatic Chronic 3 |
H350, H360D ***, H317, H412 |
|
|
CLP00/ |
| 613-200-00-3 |
Reaction product of: copper, (29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32)-, chlorosulfuric acid and 3-(2-sulfooxyethylsulfonyl)aniline, sodium salts |
- |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 613-201-00-9 |
(R)-5-bromo-3-(1-methyl-2-pyrrolidinyl methyl)-1H-indole |
143322-57-0 |
Repr. 2, STOT RE 1, Acute Tox. 4 *, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361f ***, H372 **, H332, H302, H317, H400, H410 |
|
|
CLP00/ |
| 613-202-00-4 |
pymetrozine (ISO); (E)-4,5-dihydro-6-methyl-4-(3-pyridylmethyleneamino)-1,2,4-triazin-3(2H)-one |
123312-89-0 |
Carc. 2, Repr. 2, Aquatic Chronic 1 |
H351, H361fd, H410 |
M=1 |
|
CLP00/ATP15 |
| 613-203-00-X |
pyraflufen-ethyl (ISO); 2-chloro-5-(4-chloro-5-difluoromethoxy-1-methylpyrazol-3-yl)-4-fluorophenoxyacetic acid ethyl ester; [1] pyraflufen (ISO); 2-chloro-5-(4-chloro-5-difluoromethoxy-1-methylpyrazol-3-yl)-4-fluorophenoxyacetic acid [2] |
129630-19-9 [1], 129630-17-7 [2] |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1000: |
|
CLP00/ATP01 |
| 613-204-00-5 |
oxadiargyl (ISO); 3-[2,4-dichloro-5-(2-propynyloxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one; 5-tert-butyl-3-[2,4-dichloro-5-(prop-2-ynyloxy)phenyl]-1,3,4-oxadiazol-2(3H)-one |
39807-15-3 |
Repr. 1A, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H360Fd, H373**, H400, H410 |
M=1000: |
|
CLP00/ATP01 |
| 613-205-00-0 |
propiconazole (ISO); (2RS,4RS;2RS,4SR)-1-{[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl}-1H-1,2,4-triazole |
60207-90-1 |
Repr. 1B, Acute Tox. 4, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360D, H302, H317, H400, H410 |
M=1, M=1 |
|
CLP00/ATP13 |
| 613-206-00-6 |
fenamidone (ISO); (S)-5-methyl-2-methylthio-5-phenyl-3-phenylamino-3,5-dihydroimidazol-4-one |
161326-34-7 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 613-208-00-7 |
imazamox (ISO); (RS)-2-(4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)-5-methoxymethylnicotinic acid |
114311-32-9 |
Repr. 2,
Aquatic Acute 1,
Aquatic Chronic 1 |
H361d,
H400,
H410 |
M=10,
M=10 |
|
CLP00/ATP17 |
| 613-209-00-2 |
cis-1-(3-chloropropyl)-2,6-dimethyl-piperidin hydrochloride |
63645-17-0 |
Acute Tox. 3 *, STOT RE 2 *, Skin Sens. 1, Aquatic Chronic 2 |
H301, H373 **, H317, H411 |
|
|
CLP00/ |
| 613-210-00-8 |
2-(3-chloropropyl)-2,5,5-trimethyl-1,3-dioxane |
88128-57-8 |
STOT RE 2 *, Aquatic Chronic 3 |
H373 **, H412 |
|
|
CLP00/ |
| 613-211-00-3 |
N-methyl-4-(p-formylstyryl)pyridinium methylsulfate |
74401-04-0 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 613-212-00-9 |
4-[4-(2-ethylhexyloxy)phenyl](1,4-thiazinane-1,1-dioxide) |
133467-41-1 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 613-213-00-4 |
cis-1-benzoyl-4-[(4-methylsulfonyl)oxy]-L-proline |
120807-02-5 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 613-214-00-X |
N,N-di-n-butyl-2-(1,2-dihydro-3-hydroxy-6-isopropyl-2-quinolylidene)-1,3-dioxoindan-5-carboxamide |
147613-95-4 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 613-215-00-5 |
2-chloromethyl-3,4-dimethoxypyridinium chloride |
72830-09-2 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H312, H302, H373 **, H315, H318, H317, H411 |
|
|
CLP00/ |
| 613-216-00-0 |
6-tert-butyl-7-(6-diethylamino-2-methyl-3-pyridylimino)-3-(3-methylphenyl)pyrazolo[3,2-c][1,2,4]triazole |
162208-01-7 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 613-217-00-6 |
4-[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionyloxy]-1-[2-[3-(3,5-di-tert-butyl-4-hydrophenyl)propionyloxy]ethyl]-2,2,6,6-tetramethylpiperidine |
73754-27-5 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 613-218-00-1 |
6-hydroxyindole |
2380-86-1 |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H302, H318, H317, H411 |
|
|
CLP00/ |
| 613-219-00-7 |
7a-ethyl-3,5-bis(1-methylethyl)-2,3,4,5-tetrahydrooxazolo[3,4-c]-2,3,4,5-tetrahydrooxazole |
79185-77-6 |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ |
| 613-220-00-2 |
trans-(4S,6S)-5,6-dihydro-6-methyl-4H-thieno[2,3-b]thiopyran-4-ol, 7,7-dioxide |
147086-81-5 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 613-221-00-8 |
2-chloro-5-methyl-pyridine |
18368-64-4 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Aquatic Chronic 3 |
H312, H302, H315, H412 |
|
|
CLP00/ |
| 613-222-00-3 |
4-(1-oxo-2-propenyl)-morpholine |
5117-12-4 |
Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1 |
H302, H373 **, H318, H317 |
|
|
CLP00/ |
| 613-223-00-9 |
N-isopropyl-3-(4-fluorophenyl)-1H-indole |
93957-49-4 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 613-224-00-4 |
2,5-dimercaptomethyl-1,4-dithiane |
136122-15-1 |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H314, H317, H400, H410 |
|
|
CLP00/ |
| 613-225-00-X |
reaction mass of:[2-(anthraquinon-1-ylamino)-6-[(5-benzoylamino)-anthraquinone-1-ylamino]-4-phenyl]-1,3,5-triazine; 2,6-bis-[(5-benzoylamino)-anthraquinon-1-ylamino]-4-phenyl-1,3,5-triazine. |
- |
STOT RE 2 *, Aquatic Chronic 4 |
H373 **, H413 |
|
|
CLP00/ |
| 613-226-00-5 |
1-(2-(ethyl(4-(4-(4-(4-(ethyl(2-pyridinoethyl)amino)-2-methylphenylazo)benzoylamino)-phenylazo)-3-methylphenyl)amino)ethyl)-pyridinium dichloride |
163831-67-2 |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
CLP00/ |
| 613-227-00-0 |
(±)-[(R*,R*) and (R*,S*)]-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran |
99199-90-3 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 613-228-00-6 |
(±)-(R*,S*)-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran |
793669-26-8 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 613-229-00-1 |
1-acetyl-4-(3-dodecyl-2,5-dioxo-1-pyrrolidinyl)-2,2,6,6-tetramethylpiperidine |
106917-31-1 |
Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H317, H400, H410 |
|
|
ATP01/ |
| 613-230-00-7 |
florasulam (ISO); 2',6',8-trifluoro-5-methoxy-5-triazolo[1,5-c]; pyrimidine-2-sulfonanilide |
145701-23-1 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 613-231-00-2 |
2,6-diamino-3-((pyridine-3-yl)azo)pyridine |
28365-08-4 |
Acute Tox. 4 *, STOT RE 2 *, Aquatic Chronic 2 |
H302, H373**, H411 |
|
|
ATP01/ |
| 613-232-00-8 |
3-(benzo[b]thien-2-yl)-5,6-dihydro-1,4,2-oxathiazine-4-oxide |
163269-30-5 |
Acute Tox. 3 *, STOT RE 2 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H373**, H318, H400, H410 |
|
|
ATP01/ |
| 613-233-00-3 |
4,4'-(oxy-(bismethylene))-bis-1,3-dioxolane |
56552-15-9 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 613-234-00-9 |
imidazo[1,2-b]pyridazin hydrochloride |
18087-70-2 |
Acute Tox. 4 *, Eye Irrit. 2 |
H302, H319 |
|
|
ATP01/ |
| 613-235-00-4 |
2,3-dihydro-2,2-dimethyl-1H-perimidine |
6364-17-6 |
Acute Tox. 4*, STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373**, H317, H400, H410 |
|
|
ATP01/ |
| 613-236-00-X |
2-chloro-3-trifluoromethylpyridine |
65753-47-1 |
Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 1, Skin Corr. 1B, Aquatic Chronic 3 |
H311, H301, H372**, H314, H412 |
|
|
ATP01/ |
| 613-237-00-5 |
6-tert-butyl-3-(3-dodecylsulfonyl)propyl-7H-1,2,4-triazolo[3.4b][1,3,4]thiadiazine |
133949-92-5 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 613-238-00-0 |
sodium 2-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]sulfonyl]ethyl sulfate |
81992-66-7 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
ATP01/ |
| 613-239-00-6 |
2-[3-(methylamino)propyl]-1H-benzimidazole |
64137-52-6 |
Eye Dam. 1, Aquatic Chronic 3 |
H318, H412 |
|
|
ATP01/ |
| 613-241-00-7 |
3-(2H-tetrazol-5-yl)pyridine |
3250-74-6 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 613-242-00-2 |
reaction products of 3,10-bis((2-aminopropyl)amino)-6,13-dichloro-4,11-triphenodioxazinedisulfonic acid with 2-amino-1,4-benzenedisulfonic acid, 2-((4-aminophenyl)sulfonyl)ethyl hydrogen sulfate and 2,4,6-trifluoro-1,3,5-triazine, sodium salts |
191877-09-5 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 613-243-00-8 |
4,4'-(1,6-hexamethylenebis(formylimino))bis(2,2,6,6-tetramethyl-1-oxylpiperidine) |
182235-14-9 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 613-244-00-3 |
5,7-dichloro-4-hydroxyquinoline |
21873-52-9 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 613-245-00-9 |
2-fluoro-6-trifluoromethylpyridine |
94239-04-0 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 3 |
H226, H332, H302, H412 |
|
|
ATP01/ |
| 613-246-00-4 |
2-hydroxymethyl-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine |
103577-66-8 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 613-247-00-X |
3-(2-methoxy-4-methoxycarboxybenzyl)-5-nitroindole |
107786-36-7 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 613-248-00-5 |
3,4-dimethyl-1H-pyrazole |
2820-37-3 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 3 |
H302, H318, H412 |
|
|
ATP01/ |
| 613-249-00-0 |
1-(2-hydroxyethyl)-1H-pyrazol-4,5-diyldiammoniumsulfate |
155601-30-2 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H318, H317, H411 |
|
|
ATP01/ |
| 613-250-00-6 |
reaction mass of: carbonato-bis-N-ethyl-2-isopropyl-1,3-oxazolidine; methyl carbonato-N-ethyl-2-isopropyl-1,3-oxazolidine; 2-isopropyl-N-hydroxyethyl 1,3-oxazolidine |
- |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H318, H317, H412 |
|
|
ATP01/ |
| 613-251-00-1 |
(R)-3-[(1-methylpyrrolidin-2-yl)methyl]-5-[2-(phenylsulfonyl)ethenyl]-1H-indole |
180637-89-2 |
Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1 |
H302, H373**, H318, H317 |
|
|
ATP01/ |
| 613-253-00-2 |
2,2-dialkyl-4-hydroxymethyl-1,3-dioxolane; reaction products with ethylene oxide (alkyl is C1-12 and the sum to C13, average degree of ethoxylation is 3.5) |
- |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
ATP01/ |
| 613-254-00-8 |
forchlorfenuron (ISO); 1-(2-chloro-4-pyridyl)-3-phenylurea |
68157-60-8 |
Carc. 2, Aquatic Chronic 2 |
H351, H411 |
|
|
ATP01/ |
| 613-255-00-3 |
reaction mass of isomers of: sodium [(2-hydroxyethylsulfamoyl){[2-(2-piperazin-1-ylethylamino)ethylsulfamoyl][2-(4-aminoethylpiperazine-1-yl)ethylsulfamoyl](sulfamoyl)}(sulfonatophthalocyaninato)]copper(II) |
- |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 613-256-00-9 |
3'5'-anhydro thymidine |
38313-48-3 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 613-257-00-4 |
2-phthalimidoethyl N-[4-(2-cyano-4-nitrophenylazo)phenyl]-N-methyl-β-alaninate |
170222-39-6 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 613-258-00-X |
reaction mass of: 4-chloro-7-methylbenzotriazole sodium salt; 4-chloro-5-methylbenzotriazole sodium salt; 5-chloro-4-methylbenzotriazole sodium salt |
202420-04-0 |
Skin Corr. 1B, Aquatic Chronic 3 |
H314, H412 |
|
|
ATP01/ |
| 613-259-00-5 |
imiprothrin (ISO); reaction mass of: [2,4-dioxo-(2-propyn-1-yl)imidazolidin-3-yl]methyl(1R)-cis-chrysanthemate; [2,4-dioxo-(2-propyn-1-yl)imidazolidin-3-yl]methyl(1R)-trans-chrysanthemate |
72963-72-5 |
Carc. 2, Acute Tox. 4, Acute Tox. 4, STOT SE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H332, H302, H371 (nervous system; oral, inhalation), H400 |
Inhalation: ATE = 1.4 mg/L (dusts/mists), Oral: ATE = 550 mg/kg, M=10, M=10 |
|
ATP01/ATP15 |
| 613-260-00-0 |
(±)-4-(3-chlorophenyl)-6-[(4-chlorophenyl)hydroxy(1-methyl-1H-imidazol-5-yl)methyl]-1-methyl-2(1H)-quinolin |
- |
Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H400, H410 |
|
|
ATP01/ |
| 613-261-00-6 |
pyrazole-1-carboxamidine monohydrochloride |
4023-02-3 |
Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H302, H373**, H318, H317, H412 |
|
|
ATP01/ |
| 613-262-00-1 |
disodium (E)-1,2-bis-(4-(4-methylamino-6-(4-methylcarbamoylphenylamino)-1,3,5-triazin-2-ylamino)phenyl-2-sulfonato)ethene |
180850-95-7 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 613-263-00-7 |
monosodium 3-cyano-5-fluoro-6-hydroxypyridine-2-olate |
- |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 613-266-00-3 |
2-chloro-5-chloromethylthiazole |
105827-91-6 |
Acute Tox. 3 *, Skin Corr. 1B, Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H311, H314, H302, H317, H411 |
|
|
ATP01/ |
| 613-267-00-9 |
thiamethoxam (ISO);
3-(2-chloro-thiazol-5-ylmethyl)-5-methyl[1,3,5]oxadiazinan-4-ylidene-N-nitroamine |
153719-23-4 |
Repr. 2,
Acute Tox. 4,
Aquatic Acute 1,
Aquatic Chronic 1 |
H361fd,
H302,
H400,
H410 |
Oral: ATE = 780 mg/kg bw,
M=10,
M=10 |
|
ATP01/ATP17 |
| 613-268-00-4 |
(4aS-cis-)-6-benzyl-octahydropyrrolo[3.4-b]pyridine |
151213-39-7 |
Skin Corr. 1B, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Aquatic Chronic 2 |
H314, H332, H302, H373**, H411 |
|
|
ATP01/ |
| 613-269-00-X |
2-thiazolidinylidenecyanamide |
26364-65-8 |
Acute Tox. 4*, STOT RE 2 *, Aquatic Chronic 3 |
H302, H373**, H412 |
|
|
ATP01/ |
| 613-270-00-5 |
5-amino-N-(2,6-dichloro-3-methylphenyl)-1H-1,2,4-triazole-3-sulfonamide |
113171-13-4 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 613-271-00-0 |
tritosulfuron (ISO) (containing ≤ 0,02% AMTT); 1-[4-methoxy-6-(trifluoromethyl)-1,3,5-triazin-2-yl]-3-[2-(trifluoromethyl)benzenesulfonyl]urea (containing ≤ 0,02% AMTT) |
142469-14-5 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
M=10: |
|
ATP01/ |
| 613-272-00-6 |
pyraclostrobin (ISO); methyl N-{2-[1-(4-chlorophenyl)-1H-pyrazol-3-yloxymethyl]phenyl}(N-methoxy)carbamate |
- |
Acute Tox. 3 *, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H315, H400, H410 |
M=100: |
|
ATP01/ |
| 613-273-00-1 |
tetrahydro-3-methyl-5-((2-phenylthio)thiazol-5-ylmethyl)-[4H]-1,3,5-oxadiazinan-4-ylidene-N-nitroamine |
192439-46-6 |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 613-274-00-7 |
2,6-dichloro-1-fluoropyridiniumtetrafluoroborate |
140623-89-8 |
Skin Corr. 1B, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H314, H302, H317, H400, H410 |
|
|
ATP01/ |
| 613-275-00-2 |
3-(2-chloroethyl)-6,7,8,9-tetra-hydro-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one monohydrochloride |
93076-03-0 |
Acute Tox. 3 *, STOT SE 2, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H301, H371**, H373**, H318, H317, H411 |
|
|
ATP01/ |
| 613-276-00-8 |
1-(2-chlorophenyl)-1,2-dihydro-5H-tetrazol-5-one |
98377-35-6 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
ATP01/ |
| 613-277-00-3 |
(4-(6-diethylamino-2-methylpyridin-3-yl)imino-4,5-dihydro-3-methyl-1-(4-methylphenyl)-1H-pyrazol-5-one |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 613-278-00-9 |
(3-aminophenyl)pyridin-3-ylmethanone |
79568-06-2 |
STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H373**, H400, H410 |
|
|
ATP01/ |
| 613-279-00-4 |
2-ethyl-2,3-dihydro-2-methyl-1H-perimidine |
43057-68-7 |
Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373**, H400, H410 |
|
|
ATP01/ |
| 613-280-00-X |
tetrahydro-1,3-dimethyl-1H-pyrimidin-2-one; dimethyl propyleneurea |
7226-23-5 |
Repr. 2, Acute Tox. 4 *, Eye Dam. 1 |
H361f***, H302, H318 |
|
|
ATP01/ |
| 613-281-00-5 |
quinoline |
91-22-5 |
Carc. 1B, Muta. 2, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Chronic 2 |
H350, H341, H312, H302, H319, H315, H411 |
|
|
ATP01/ |
| 613-282-00-0 |
triticonazole (ISO);
(RS)-(E)-5-(4-chlorobenzylidene)-2,2-dimethyl-1-(1H-1,2,4-triazol-1-methyl)cyclopentanol |
138182-18-0 |
Repr. 2,
STOT RE 2,
Aquatic Acute 1,
Aquatic Chronic 1 |
H361f,
H373,
H400,
H410 |
M=1,
M=1 |
|
ATP01/ATP17 |
| 613-283-00-6 |
ketoconazole; 1-[4-[4-[[(2SR,4RS)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone |
65277-42-1 |
Repr. 1B, Acute Tox. 3 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H360F***, H301, H373**, H400, H410 |
|
|
ATP01/ |
| 613-284-00-1 |
metconazole (ISO); (1RS,5RS;1RS,5SR)-5-(4-chlorobenzyl)-2,2-dimethyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol |
125116-23-6 |
Repr. 2, Acute Tox. 4 *, Aquatic Chronic 2 |
H361d***, H302, H411 |
|
|
ATP01/ |
| 613-285-00-7 |
1-hydroxybenzotriazole, anhydrous; [1] 1-hydroxybenzotriazole, monohydrated [2] |
2592-95-2 [1], 123333-53-9 [2] |
Expl. 1.3 |
H203 |
|
|
ATP01/ |
| 613-286-00-2 |
potassium 1-methyl-3-morpholinocarbonyl-4-[3-(1-methyl-3-morpholinocarbonyl-5-oxo-2-pyrazolin-4-ylidene)-1-propenyl]pyrazole-5-olate; [containing < 0.5 % N,N-dimethylformamide (EC no 200-679-5)] |
183196-57-8 |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 613-286-01-X |
potassium 1-methyl-3-morpholinocarbonyl-4-[3-(1-methyl-3-morpholinocarbonyl-5-oxo-2-pyrazolin-4-ylidene)-1-propenyl]pyrazole-5-olate; [containing ≥ 0.5 % N,N-dimethylformamide (EC No 200-679-5)] |
183196-57-8 |
Repr. 1B, Skin Sens. 1 |
H360D***, H317 |
|
|
ATP01/ |
| 613-287-00-8 |
1-(3-iodo-4-aminobenzyl)-1H-1,2,4-triazole |
160194-26-3 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H302, H317, H411 |
|
|
ATP01/ |
| 613-288-00-3 |
1,3-bis(dimethylcarbamoyl)-imidazolium chloride |
135756-61-5 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 3 |
H302, H318, H412 |
|
|
ATP01/ |
| 613-289-00-9 |
3-(4-chloro-2-fluoro-5-methylphenyl)-1-methyl-5-(trifluoromethyl)-1H-pyrazole |
142623-48-1 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 613-290-00-4 |
4-hydroxy-7-(2-aminoethyl)-1,3-benzothiazol-2(3H)-one hydrochloride |
189012-93-9 |
Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H317, H400, H410 |
|
|
ATP01/ |
| 613-291-00-X |
2,4-dihydro-4-(4-(4-(4-hydroxyphenyl)-1-piperazinyl)phenyl)-2-(1-methylpropyl)-3H-1,2,4-triazol-3-one |
106461-41-0 |
STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H373**, H400, H410 |
|
|
ATP01/ |
| 613-292-00-5 |
N,N',N''-tris(2-methyl-2,3-epoxypropyl)-perhydro-2,4,6-oxo-1,3,5-triazine |
26157-73-3 |
Muta. 2, Aquatic Chronic 3 |
H341, H412 |
|
|
ATP01/ |
| 613-293-00-0 |
2-(4-tert-butylphenyl)-6-cyano-5-[bis(ethoxycarbonylmethyl)carbamoyloxy]-1H-pyrrolo[1,2-b][1,2,4] triazole-7-carboxylic acid 2,6-di-tert-butyl-4-methylcyclohexylester |
444065-11-6 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 613-294-00-6 |
2-hexyldecanoic acid [4-(6-tert-butyl-7-chloro-1H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)phenylcarbamoyl]methylester |
379268-96-9 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 613-295-00-1 |
11-amino-3-chloro-6,11-dihydro-5,5-dioxo-6-methyl-dibenzo[c,f][1,2]thiazepine hydrochloride |
363138-44-7 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 3 |
H302, H318, H412 |
|
|
ATP01/ |
| 613-296-00-7 |
pentapotassium 2-(4-(5-[1-(2,5-disulfonatophenyl)-4,5-dihydro-3-methylcarbamoyl-5-oxopyrazol-4-ylidene]-3-methyl-1,3-pentadienyl)-3-methylcarbamoyl-5-oxidopyrazol-1-yl)benzene-1,4-disulfonate |
- |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
ATP01/ |
| 613-297-00-2 |
5-(2-bromophenyl)-2-tert-butyl-2H-tetrazole |
- |
Flam. Liq. 3, Acute Tox. 4 *, Aquatic Chronic 2 |
H226, H302, H411 |
|
|
ATP01/ |
| 613-298-00-8 |
bis-(6-hydroxy-4-methyl-5-(3-methylimidazolium-1-yl)-3-(4-phenylazo)-1H-pyridin-2-one)ethylene dilactate |
- |
STOT RE 2 *, Eye Dam. 1, Aquatic Chronic 2 |
H373**, H318, H411 |
|
|
ATP01/ |
| 613-299-00-3 |
main component 1 (isomer 1): 2-{6-fluoro-4-[3-(2,5-disulfo-phenylazo)-4-hydroxy-2-sulfonapht-7-ylamino]-1,3,5-triazin-2-ylamino}-3-{6-fluoro-4-[3-(1,5-disulfonaphth-2-ylazo)-4-hydroxy-2-sulfonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}-propane sodium salt; |
- |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 613-300-00-7 |
1-imidazol-1-yl-octadecan-2-ol |
- |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 613-301-00-2 |
dimethyl-1-{[2-methoxy-5-(2-methyl-butoxycarbonyl)phenylcarbamoyl]-[2-octadecyl-1,1-dioxo-1,2,4-benzothiadiazin-3-yl]methyl} imidazole-4,5-dicarboxylate |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 613-302-00-8 |
disodium 2-(5-carbamoyl-1-ethyl-2-hydroxy-4-methyl-6-oxo-1,6-dihydro-pyridine-3-ylazo)-4-(4-fluoro-6-(4-(2-sulfonyloxy-ethylsulfonyl)-phenylamino)-1,3,5-triazine-2-ylamino)benzene sulfonate |
243858-60-8 |
Eye Dam. 1 |
H318 |
|
|
ATP01/ |
| 613-303-00-3 |
2-(1-methyl-2-(4-phenoxyphenoxy)ethoxy)pyridine |
95737-68-1 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 613-304-00-9 |
5,6-dihydroxy-2,3-dihydro-1H-indolium bromide |
138937-28-7 |
Acute Tox. 4 *, Eye Dam. 1 |
H302, H318 |
|
|
ATP01/ |
| 613-305-00-4 |
2-(2-hydroxy-4-octyloxyphenyl)-2H-benzotriazole |
3147-77-1 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 613-306-00-X |
(2,5-dioxopyrrolidin-1-yl)-9H-fluoren-9-ylmethyl carbonate |
82911-69-1 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Chronic 2 |
H302, H317, H411 |
|
|
ATP01/ |
| 613-307-00-5 |
clothianidin (ISO); 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-1-nitroguanidine |
210880-92-5 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
M=10: |
|
ATP01/ |
| 613-308-00-0 |
2-amino-5-methylthiazole |
7305-71-7 |
Acute Tox. 4 *, STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373**, H400, H410 |
|
|
ATP01/ |
| 613-309-00-6 |
1-methyl-3-phenyl-1-piperazine |
5271-27-2 |
Acute Tox. 4 *, Acute Tox. 4 *, Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 3 |
H312, H302, H315, H318, H412 |
|
|
ATP01/ |
| 613-310-00-1 |
(-)(3S,4R)-4-(4-fluorophenyl)-3-(3,4-methylenedioxy-phenoxymethyl)-N-benzylpiperidine hydrochloride |
105813-13-6 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
ATP01/ |
| 613-311-00-7 |
methyl-5-nitrophenyl-guanidine |
152460-07-6 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Chronic 3 |
H302, H319, H317, H412 |
|
|
ATP01/ |
| 613-312-00-2 |
2-(4-methyl-2-phenyl-1-piperazinyl)benzenemethanol monohydrochloride |
- |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H302, H318, H317, H412 |
|
|
ATP01/ |
| 613-313-00-8 |
2-(4-(4-(3-pyridinyl)-1H-imidazol-1-yl)butyl)-1H-isoindole-1,3(2H)-dione |
173838-67-0 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 613-314-00-3 |
4-decyloxazolidin-2-one; 4-decyl-1,3-oxazolidin-2-one |
7693-82-5 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 613-315-00-9 |
tetrapotassium 4-[5-[3-carboxylato-4,5-dihydro-5-oxo-1-(4-sulfonatophenyl)pyrazol-4-ylidene]-3-(piperidinocarbonyl)penta-1,3-dienylidene]-5-hydroxy-1-(4-sulfonatophenyl)pyrazole-3-carboxylate |
- |
Acute Tox. 4 *, Aquatic Chronic 3 |
H332, H412 |
|
|
ATP01/ |
| 613-316-00-4 |
trimethylopropane tri(3-aziridinylpropanoate); (TAZ) |
52234-82-9 |
Muta. 2, Eye Dam. 1, Skin Sens. 1 |
H341, H318, H317 |
|
|
CLP00/ATP02 |
| 613-317-00-X |
penconazole (ISO); 1-[2-(2,4-dichlorophenyl)pentyl]-1H-1,2,4- triazole |
66246-88-6 |
Repr. 2, Acute Tox. 4, Aquatic Acute 1, Aquatic Chronic 1 |
H361d, H302, H400, H410 |
M=1, M=1 |
|
ATP06 |
| 613-318-00-5 |
fenpyrazamine (ISO); S-allyl 5-amino-2,3-dihydro-2-isopropyl-3-oxo-4-(o-tolyl)pyrazole-1-carbothioate; S-allyl 5-amino-2-isopropyl-4-(2-methylphenyl)-3-oxo-2,3-dihydropyrazole-1-carbothioate |
473798-59-3 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=10, M=1 |
|
ATP06/ATP10 |
| 613-319-00-0 |
imidazole |
288-32-4 |
Repr. 1B, Acute Tox. 4, Skin Corr. 1C |
H360D, H302, H314 |
|
|
ATP07 |
| 613-320-00-6 |
lenacil (ISO); 3-cyclohexyl-6,7-dihydro-1H-cyclopenta[d]pyrimidine-2,4(3H,5H)-dione |
2164-08-1 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H400, H410 |
M=10, M=10 |
|
ATP07 |
| 613-321-00-1 |
(RS)-4-[1-(2,3-dimethylphenyl)ethyl]-1H-imidazole; medetomidine |
86347-14-0 |
Acute Tox. 2, Acute Tox. 2, STOT SE 3, STOT SE 1, STOT RE 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H300, H336, H370 (eye), H372, H400, H410 |
M=1, M=100 |
|
ATP10 |
| 613-322-00-7 |
triadimenol (ISO); (1RS,2RS;1RS,2SR)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol; α-tert-butyl-β-(4-chlorophenoxy)-1H-1,2,4-triazole-1-ethanol |
55219-65-3 |
Repr. 1B, Lact. Acute Tox. 4, Aquatic Chronic 2 |
H360, H362, H302, H411 |
|
|
ATP10 |
| 613-323-00-2 |
terbuthylazine (ISO); N-tert-butyl-6-chloro-N′-ethyl-1,3,5-triazine-2,4-diamine |
5915-41-3 |
Acute Tox. 4, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373, H400, H410 |
M=10, M=10 |
|
ATP10 |
| 613-324-00-8 |
quinolin-8-ol; 8-hydroxyquinoline |
148-24-3 |
Repr. 1B, Acute Tox. 3, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360D, H301, H318, H317, H400, H410 |
M=1, M=1 |
|
ATP10 |
| 613-325-00-3 |
thiacloprid (ISO); (Z)-3-(6-chloro-3-pyridylmethyl)-1,3-thiazolidin-2-ylidenecyanamide; {(2Z)-3-[(6-chloropyridin-3-yl)methyl]-1,3-thiazolidin-2-ylidene}cyanamide |
111988-49-9 |
Carc. 2, Repr. 1B, Acute Tox. 3, Acute Tox. 4, STOT SE 3, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H360FD, H301, H332, H336, H400, H410 |
M=100, M=100 |
|
ATP10 |
| 613-326-00-9 |
2-methylisothiazol-3(2H)-one |
2682-20-4 |
Acute Tox. 2, Acute Tox. 3, Acute Tox. 3, Skin Corr. 1B, Eye Dam. 1, Skin Sens. 1A, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H311, H301, H314, H318, H317, H400, H410 |
Skin Sens. 1A; H317: C ≥ 0,0015 %, M=10, M=1, |
|
ATP13 |
| 613-327-00-4 |
pyroxsulam (ISO); N-(5,7-dimethoxy[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2-methoxy-4-(trifluoromethyl) pyridine-3-sulfonamide |
422556-08-9 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410, |
M=100, M=100 |
|
ATP13 |
| 613-328-00-X |
1-vinylimidazole |
1072-63-5 |
Repr. 1B |
H360D |
Repr. 1B; H360D: C ≥ 0,03 % |
|
ATP13 |
| 613-329-00-5 |
halosulfuron-methyl (ISO); methyl 3-chloro-5-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-1-methyl-1H-pyrazole-4-carboxylate |
100784-20-1 |
Repr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H360D, H400, H410 |
M=1000, M=1000
|
|
ATP14 |
| 613-330-00-0 |
2-methylimidazole |
693-98-1 |
Repr. 1B |
H360Df |
|
|
ATP14 |
| 613-331-00-6 |
(2RS)-2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1-(1H- 1,2,4-triazol-1-yl)propan-2-ol; mefentrifluconazole |
1417782-03-6 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
M=1, M=1 |
|
ATP15 |
| 613-332-00-1 |
oxathiapiprolin (ISO); 1-(4-{4-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3- yl]-1,3-thiazol-2-yl}piperidin-1-yl)-2-[5- methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]ethanone |
1003318-67-9 |
Aquatic Chronic 1 |
H410 |
M=1 |
|
ATP15 |
| 613-333-00-7 |
pyrithione zinc; (T-4)- bis[1-(hydroxy-.kappa.O)pyridine-2(1H)- thionato-.kappa.S]zinc |
13463-41-7 |
Repr. 1B, Acute Tox. 2, Acute Tox. 3, STOT RE 1, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360D, H330, H301, H372, H318, H400, H410 |
Inhalation: ATE = 0.14 mg/L (dusts/mists), Oral: ATE = 221 mg/kg, M=1000, M=10 |
|
ATP15 |
| 613-334-00-2 |
flurochloridone (ISO); 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
61213-25-0 |
Repr. 1B, Acute Tox. 4, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H360FD, H302, H317, H400, H410 |
Oral: ATE = 500 mg/kg, M=100, M=100 |
|
ATP15 |
| 613-335-00-8 |
4,5-dichloro-2-octyl- 2H-isothiazol-3-one; [DCOIT] |
64359-81-5 |
Acute Tox. 2, Acute Tox. 4, Skin Corr. 1, Eye Dam. 1, Skin Sens. 1A, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H302, H314, H318, H317, H400, H410 |
Inhalation: ATE = 0.16 mg/L (dusts/mists), Oral: ATE = 567 mg/kg, Skin Irrit. 2, H315: 0,025 % ≤ C < 5 %, Eye Irrit. 2, H319: 0,025 % ≤ C < 3 %, Skin Sens. 1A, H317: C ≥ 0,0015 %, M=100, M=100 |
|
ATP15 |
| 613-336-00-3 |
2-methyl-1,2-benzothiazol-3(2H)-one; [MBIT] |
2527-66-4 |
Acute Tox. 3, Acute Tox. 4, Skin Corr. 1C, Eye Dam. 1, Skin Sens. 1A, Aquatic Acute 1, Aquatic Chronic 2 |
H301, H312, H314, H318, H317, H400, H411 |
Oral: ATE = 175 mg/kg, Dermal: ATE = 1100 mg/kg, Skin Sens. 1A, H317: C ≥ 0,0015 %, M=1 |
|
ATP15 |
| 613-337-00-9 |
prothioconazole (ISO);
2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione |
178928-70-6 |
Aquatic Acute 1,
Aquatic Chronic 1 |
H400,
H410 |
M=10,
M=1 |
|
ATP17 |
| 613-338-00-4 |
azamethiphos (ISO); S-[(6-chloro-2-oxooxazolo[4,5-b]pyridin-3(2H)-yl)methyl] O,O-dimethyl thiophosphate |
35575-96-3 |
Carc. 2,
Acute Tox. 3,
Acute Tox. 4,
STOT SE 1,
Skin Sens. 1,
Aquatic Acute 1,
Aquatic Chronic 1 |
H351,
H331,
H302,
H370 (nervous system),
H317,
H400,
H410 |
Inhalation: ATE = 0.5 mg/L (dusts/mists),
Oral: ATE = 500 mg/kg bw,
M=1000,
M=1000 |
|
ATP17 |
| 613-339-00-X |
3-methylpyrazole |
1453-58-3 |
Repr. 1B,
Acute Tox. 4,
STOT RE 2,
Skin Corr. 1,
Eye Dam. 1 |
H360D,
H302,
H373 (lung),
H314,
H318 |
Oral: ATE = 500 mg/kg bw |
|
ATP17 |
| 613-340-00-5 |
clomazone (ISO); 2-(2-chlorobenzyl)-4,4-dimethyl-1,2-oxazolidin-3-one |
81777-89-1 |
Acute Tox. 4,
Acute Tox. 4,
Aquatic Acute 1,
Aquatic Chronic 1 |
H332,
H302,
H400,
H410 |
Inhalation: ATE = 4.85 mg/L (dusts/mists),
Oral: ATE = 768 mg/kg bw,
M=1,
M=1 |
|
ATP17 |
| 613-341-00-0 |
clofentezine (ISO); 3,6-bis(o-chlorophenyl)-1,2,4,5-tetrazine |
74115-24-5 |
Aquatic Chronic 1 |
H410 |
M=1 |
|
ATP18 |
| 613-342-00-6 |
theophylline; 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione |
58-55-9 |
Repr. 1B |
H360D |
|
|
ATP18 |
| 613-343-00-1 |
pyridalyl (ISO); 2,6-dichloro-4-(3,3-dichloroallyloxy)phenyl 3-[5-(trifluoromethyl)-2-pyridyloxy]propyl ether |
179101-81-6 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
M=1000, M=100 |
|
ATP18 |
| 613-344-00-7 |
Pyridine-2-thiol 1-oxide, sodium salt; pyrithione sodium; sodium pyrithione |
3811-73-2; 15922-78-8 |
Acute Tox. 3, Acute Tox. 3, Acute Tox. 4, STOT RE 1, Skin Irrit. 2, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 2 |
H331, H311, H302, H372 (nervous system), H315, H319, H317, H400, H411 |
inhalation: ATE = 0,5mg/L (dusts or mists); dermal: ATE = 790 mg/kg bw; oral: ATE = 500 mg/kg bw; M=100 |
|
ATP18 |
| 613-345-00-2 |
1,3,5-triazine-2,4,6-triamine; melamine |
108-78-1 |
Carc. 2, STOT RE 2 |
H351, H373 (urinary tract) |
|
|
ATP18 |
| 614-001-00-4 |
nicotine (ISO); 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
54-11-5 |
Acute Tox. 2, Acute Tox. 2, Acute Tox. 2, Aquatic Chronic 2 |
H330, H310, H300, H411 |
Inhalation: ATE = 0.19 mg/L (dusts/mists), Dermal: ATE = 70 mg/kg, Oral: ATE = 5 mg/kg |
|
CLP00/ATP10 |
| 614-002-00-X |
salts of nicotine |
- |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 *, Aquatic Chronic 2 |
H330, H310, H300, H411 |
|
A |
CLP00/ |
| 614-003-00-5 |
strychnine |
57-24-9 |
Acute Tox. 1, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H310, H300, H400, H410 |
|
|
CLP00/ |
| 614-004-00-0 |
salts of strychnine |
- |
Acute Tox. 2 *, Acute Tox. 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H300, H400, H410 |
|
A |
CLP00/ |
| 614-005-00-6 |
colchicine |
64-86-8 |
Muta. 1B, Acute Tox. 2 * |
H340, H300 |
|
|
CLP00/ATP01 |
| 614-006-00-1 |
brucine; 2,3-dimethoxystrychnine |
357-57-3 |
Acute Tox. 2 *, Acute Tox. 2 *, Aquatic Chronic 3 |
H330, H300, H412 |
|
|
CLP00/ |
| 614-007-00-7 |
brucine sulphate; [1] brucine nitrate; [2] Strychnidin-10-one, 2,3-dimethoxy-, mono[(R)-1-methylheptyl 1,2-benzenedicarboxylate]; [3] Strychnidin-10-one, 2,3-dimethoxy-, compd. with (S)mono(1-methylheptyl)-1,2-benzenedicarboxylate (1:1) [4] |
4845-99-2 [1], 5786-97-0 [2], 68239-26-9 [3], 68310-42-9 [4] |
Acute Tox. 2 *, Acute Tox. 2 *, Aquatic Chronic 3 |
H330, H300, H412 |
|
A |
CLP00/ |
| 614-008-00-2 |
aconitine |
302-27-2 |
Acute Tox. 2 *, Acute Tox. 2 * |
H330, H300 |
|
|
CLP00/ |
| 614-009-00-8 |
salts of aconitine |
- |
Acute Tox. 2 *, Acute Tox. 2 * |
H330, H300 |
|
A |
CLP00/ |
| 614-010-00-3 |
atropine |
51-55-8 |
Acute Tox. 2 *, Acute Tox. 2 * |
H330, H300 |
|
|
CLP00/ |
| 614-011-00-9 |
salts of atropine |
- |
Acute Tox. 2 *, Acute Tox. 2 * |
H330, H300 |
|
A |
CLP00/ |
| 614-012-00-4 |
hyoscyamine |
101-31-5 |
Acute Tox. 2 *, Acute Tox. 2 * |
H330, H300 |
|
|
CLP00/ |
| 614-013-00-X |
salts of hyoscyamine |
- |
Acute Tox. 2 *, Acute Tox. 2 * |
H330, H300 |
|
A |
CLP00/ |
| 614-014-00-5 |
hyoscine |
51-34-3 |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 * |
H330, H310, H300 |
|
|
CLP00/ |
| 614-015-00-0 |
salts of hyoscine |
- |
Acute Tox. 2 *, Acute Tox. 1, Acute Tox. 2 * |
H330, H310, H300 |
|
A |
CLP00/ |
| 614-016-00-6 |
pilocarpine |
92-13-7 |
Acute Tox. 2 *, Acute Tox. 2 * |
H330, H300 |
|
|
CLP00/ |
| 614-017-00-1 |
salts of pilocarpine |
- |
Acute Tox. 2 *, Acute Tox. 2 * |
H330, H300 |
|
A |
CLP00/ |
| 614-018-00-7 |
papaverine |
58-74-2 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 614-019-00-2 |
salts of papaverine |
- |
Acute Tox. 4 * |
H302 |
|
A |
CLP00/ |
| 614-020-00-8 |
physostigmine |
57-47-6 |
Acute Tox. 2 *, Acute Tox. 2 * |
H330, H300 |
|
|
CLP00/ |
| 614-021-00-3 |
salts of physostigmine |
- |
Acute Tox. 2 *, Acute Tox. 2 * |
H330, H300 |
|
A |
CLP00/ |
| 614-022-00-9 |
digitoxin |
71-63-6 |
Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 * |
H331, H301, H373 ** |
|
|
CLP00/ |
| 614-023-00-4 |
ephedrine |
299-42-3 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 614-024-00-X |
salts of ephedrine |
- |
Acute Tox. 4 * |
H302 |
|
A |
CLP00/ |
| 614-025-00-5 |
ouabain |
630-60-4 |
Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 * |
H331, H301, H373 ** |
|
|
CLP00/ |
| 614-026-00-0 |
strophantin-K |
11005-63-3 |
Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 * |
H331, H301, H373 ** |
|
|
CLP00/ |
| 614-027-00-6 |
bufa-4,20,22-trienolide, 6-(acetyloxy)-3-(β-D-glucopyranosyloxy)-8,14-dihydroxy-, (3β, 6β)-; red squill; scilliroside |
507-60-8 |
Acute Tox. 2 * |
H300 |
|
|
CLP00/ |
| 614-028-00-1 |
reaction mass of: 2-ethylhexyl mono-D-glucopyranoside; 2-ethylhexyl di-D-glucopyranoside |
- |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 614-029-00-7 |
constitutional isomers of penta-O-allyl-β-D-fructofuranosyl-α-D-glucopyranoside; constitutional isomers of hexa-O-allyl-β-D-fructofuranosyl-α-D-glucopyranoside; constitutional isomers of hepta-O-allyl-β-D-fructofuransoyl-α-D-glucopyranoside |
68784-14-5 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 614-030-00-2 |
emamectin benzoate (ISO); (4"R)-4"-deoxy-4"-(methylamino) avermectin B1 benzoate |
155569-91-8 |
Acute Tox. 3, Acute Tox. 3, Acute Tox. 3, STOT SE 1, STOT RE 1, Eye Dam. 1, Aquatic Acute 1 |
H331, H311, H301, H370 (nervous system), H372 (nervous system), H318, H400 |
Inhalation: ATE = 0.663 mg/L (dusts/mists), Dermal: ATE = 300 mg/kg bw, Oral: ATE = 60 mg/kg bw, STOT RE 1; H372: C ≥ 5 %, STOT RE 2; H373: 0,5 % ≤ C < 5 %, M=10000, M=10000 |
|
ATP17 |
| 615-001-00-7 |
methyl isocyanate |
624-83-9 |
Flam. Liq. 2, Repr. 2, Acute Tox. 2 *, Acute Tox. 3 *, Acute Tox. 3 *, Resp. Sens. 1, Skin Sens. 1, STOT SE 3, Skin Irrit. 2, Eye Dam. 1 |
H225, H361d***, H330, H311, H301, H334, H317, H335, H315, H318 |
|
|
CLP00/ATP01 |
| 615-002-00-2 |
methyl isothiocyanate |
556-61-6 |
Acute Tox. 3 *, Acute Tox. 3 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H301, H314, H317, H400, H410 |
|
|
CLP00/ |
| 615-003-00-8 |
thiocyanic acid |
463-56-9 |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 3 |
H332, H312, H302, H412 |
|
|
CLP00/ |
| 615-004-00-3 |
salts of thiocyanic acid, with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 3 |
H332, H312, H302, H412 |
|
A |
CLP00/ATP01 |
| 615-005-00-9 |
4,4'-methylenediphenyl diisocyanate; diphenylmethane-4,4'-diisocyanate; [1] 2,2'-methylenediphenyl diisocyanate; diphenylmethane-2,2'-diisocyanate; [2] o-(p-isocyanatobenzyl)phenyl isocyanate; diphenylmethane-2,4'-diisocyanate; [3] methylenediphenyl |
101-68-8 [1], 2536-05-2 [2], 5873-54-1 [3], 26447-40-5 [4] |
Carc. 2, Acute Tox. 4 *, STOT RE 2 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1, Skin Sens. 1 |
H351, H332, H373**, H319, H335, H315, H334, H317 |
Eye Irrit. 2; H319: C ≥ 5 %, Skin Irrit. 2; H315: C ≥ 5 %, Resp. Sens. 1; H334: C ≥ 0,1 %, STOT SE 3; H335: C ≥ 5 % |
C 2 |
CLP00/ATP01 |
| 615-006-00-4 |
2-methyl-m-phenylene diisocyanate; toluene-2,4-di-isocyanate; [1] 4-methyl-m-phenylene diisocyanate; toluene-2,6-di-isocyanate; [2] m-tolylidene diisocyanate; toluene-diisocyanate [3] |
91-08-7 [1], 584-84-9 [2], 26471-62-5 [3] |
Carc. 2, Acute Tox. 2 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1, Skin Sens. 1, Aquatic Chronic 3 |
H351, H330, H319, H335, H315, H334, H317, H412 |
Resp. Sens. 1; H334: C ≥ 0,1 % |
C |
CLP00/ |
| 615-008-00-5 |
3-isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate; isophorone di-isocyanate |
4098-71-9 |
Acute Tox. 3 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1, Skin Sens. 1, Aquatic Chronic 2 |
H331, H319, H335, H315, H334, H317, H411 |
*, Resp. Sens. 1; H334: C ≥ 0,5 %, Skin Sens.1; H317: C ≥ 0,5 % |
2 |
CLP00/ |
| 615-009-00-0 |
4,4'-methylenedi(cyclohexyl isocyanate); dicyclohexylmethane-4,4'-di-isocyanate |
5124-30-1 |
Acute Tox. 3 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1, Skin Sens. 1 |
H331, H319, H335, H315, H334, H317 |
*, Resp. Sens. 1; H334: C ≥ 0,5 %, Skin Sens. 1; H317: C ≥ 0,5 % |
2 |
CLP00/ |
| 615-010-00-6 |
2,2,4-trimethylhexamethylene-1,6-di-isocyanate; [1] 2,4,4-trimethylhexamethylene-1,6-di-isocyanate [2] |
16938-22-0 [1], 15646-96-5 [2] |
Acute Tox. 3 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1 |
H331, H319, H335, H315, H334 |
*, Resp. Sens. 1; H334: C ≥ 0,5 %, Skin Sens. 1; H317: C ≥ 0,5 % |
C 2 |
CLP00/ |
| 615-011-00-1 |
hexamethylene-di-isocyanate |
822-06-0 |
Acute Tox. 3 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1, Skin Sens. 1 |
H331, H319, H335, H315, H334, H317 |
*, Resp. Sens. 1; H334: C ≥ 0,5 %, Skin Sens. 1; H317: C ≥ 0,5 % |
2 |
CLP00/ |
| 615-012-00-7 |
4-isocyanatosulphonyltoluene; tosyl isocyanate |
4083-64-1 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1 |
H319, H335, H315, H334 |
Eye Irrit.; H319: C ≥ 5 %, STOT SE 3; H335: C ≥ 5 %, Skin Irrit. 2; H315: C ≥ 5 % |
|
CLP00/ |
| 615-013-00-2 |
cyanamide; carbamonitril |
420-04-2 |
Carc. 2, Repr. 2, Acute Tox. 3, Acute Tox. 3, STOT RE 2, Skin Corr. 1, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H351, H361fd, H311, H301, H373 (thyroid), H314, H318, H317, H412 |
|
|
CLP00/ATP10 |
| 615-014-00-8 |
tris(1-dodecyl-3-methyl-2-phenylbenzimidazolium)hexacyanoferrate |
7276-58-6 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 615-015-00-3 |
1,7,7-trimethylbicyclo(2,2,1)hept-2-yl thiocyanatoacetate; isobornyl thiocyanoacetate |
115-31-1 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 615-016-00-9 |
potassium cyanate |
590-28-3 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 615-017-00-4 |
calcium cyanamide |
156-62-7 |
Acute Tox. 4 *, STOT SE 3, Eye Dam. 1 |
H302, H335, H318 |
|
|
CLP00/ |
| 615-018-00-X |
2-(2-butoxyethoxy)ethyl thiocyanate |
112-56-1 |
Flam. Liq. 3, Acute Tox. 3 *, Acute Tox. 3 * |
H226, H311, H301 |
|
|
CLP00/ |
| 615-019-00-5 |
dicyclohexylcarbodiimide |
538-75-0 |
Acute Tox. 3 *, Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1 |
H311, H302, H318, H317 |
|
|
CLP00/ |
| 615-020-00-0 |
methylene dithiocyanate |
6317-18-6 |
Acute Tox. 2 *, Acute Tox. 3 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1 |
H330, H301, H314, H317, H400 |
|
|
CLP00/ |
| 615-021-00-6 |
1,3,5-tris(oxiranylmethyl)-1,3,5-triazine-2,4,6(1H,3H,5H)-trione; TGIC |
2451-62-9 |
Muta. 1B, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H340, H331, H301, H373 **, H318, H317, H412 |
|
|
CLP00/ |
| 615-022-00-1 |
methyl 3-isocyanatosulfonyl-2-thiophene-carboxylate |
79277-18-2 |
STOT RE 2 *, Resp. Sens. 1, Skin Sens. 1 |
H373**, H334, H317 |
|
|
CLP00/ATP01 |
| 615-023-00-7 |
2-(isocyanatosulfonylmethyl)benzoic acid methyl ester; (alt.):methyl 2-(isocyanatosulfonylmethyl)benzoate |
83056-32-0 |
Flam. Liq. 3, Muta. 2, Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Resp. Sens. 1 |
H226, H341, H332, H373 **, H318, H334 |
|
|
CLP00/ |
| 615-024-00-2 |
2-phenylethylisocyanate |
1943-82-4 |
Acute Tox. 3 *, Acute Tox. 4 *, Skin Corr. 1A, Resp. Sens. 1, Skin Sens. 1, Aquatic Chronic 2 |
H331, H302, H314, H334, H317, H411 |
|
|
CLP00/ |
| 615-025-00-8 |
4,4'-ethylidenediphenyl dicyanate |
47073-92-7 |
Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H302, H373 **, H318, H400, H410 |
|
|
CLP00/ |
| 615-026-00-3 |
4,4'-methylenebis(2,6-dimethylphenyl cyanate) |
101657-77-6 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 615-028-00-4 |
ethyl 2-(isocyanatosulfonyl)benzoate |
77375-79-2 |
Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Resp. Sens. 1, Skin Sens. 1 |
H302, H373**, H318, H334, H317 |
|
|
CLP00/ATP01 |
| 615-029-00-X |
2,5-bis-isocyanatomethyl-bicyclo[2.2.1]heptane |
- |
Acute Tox. 2 *, Acute Tox. 4 *, Skin Corr. 1B, Resp. Sens. 1, Skin Sens. 1, Aquatic Chronic 3 |
H330, H302, H314, H334, H317, H412 |
|
|
CLP00/ |
| 615-030-00-5 |
alkali salts and alkali earth salts of thiocyanic acid, with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Chronic 3 |
H332, H312, H302, H412 |
|
A |
CLP00/ATP01 |
| 615-031-00-0 |
thallium thiocyanate |
3535-84-0 |
Acute Tox. 2 *, Acute Tox. 2 *, Acute Tox. 4 *, STOT RE 2, Aquatic Chronic 2 |
H330, H300, H312, H373**, H411 |
|
|
CLP00/ATP01 |
| 615-032-00-6 |
metal salts of thiocyanic acid, with the exception of those specified elsewhere in this Annex |
- |
Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H332, H312, H302, H400, H410 |
|
A |
CLP00/ATP01 |
| 615-033-00-1 |
reaction product of diphenylmethanediisocyanate, octylamine, oleylamine and cyclohexylamine (1:1.58:0.32:0.097) |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 615-034-00-7 |
reaction product of diphenylmethanediisocyanate, octylamine, 4-ethoxyaniline and ethylenediamine (1:0,37:1,53:0,05) |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 615-035-00-2 |
reaction product of diphenylmethanediisocyanate, octylamine and oleylamine (molar ratio 1:1.86:0.14) |
122886-55-9 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 615-036-00-8 |
reaction product of diphenylmethanediisocyanate, toluenediisocyanate ( reaction mass of isomers: 65 % 2,4- and 35 % 2,6-diisocyanate), octylamine, oleylamine and 4-ethoxyaniline (molar ratio 4:1:7:1:2) |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 615-037-00-3 |
reaction product of diphenylmethanediisocyanate, toluenediisocyanate ( reaction mass of isomers: 65 % 2,4- and 35 % 2,6-diisocyanate), octylamine and oleylamine (molar ratio 4:1:9:1) |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 615-038-00-9 |
reaction product of toluenediisocyanate ( reaction mass of isomers: 65 % 2,4- and 35 % 2,6-diisocyanate) and aniline (molarratio 1:2) |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 615-039-00-4 |
reaction product of diphenylmethanediisocyanate, toluenediisocyanate ( reaction mass of isomers: 65 % 2,4- and 35 % 2,6-diisocyanate), octylamine, oleylamine and 4-ethoxyaniline (molar ratio 3.88:1:6.38:0.47:2.91) |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 615-044-00-1 |
4-chlorophenylisocyanate |
104-12-1 |
Acute Tox. 2 *, Acute Tox. 4 *, STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Resp. Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H330, H302, H335, H315, H318, H334, H400, H410 |
|
|
ATP01/ |
| 615-045-00-7 |
4,4'-methylene bis(3-chloro-2,6-di-ethylphenylisocyanate) |
- |
Resp. Sens. 1, Skin Sens. 1, Aquatic Chronic 4 |
H334, H317, H413 |
|
|
ATP01/ |
| 615-046-00-2 |
1,3-bis(1-isocyanato-1-methylethyl)benzene; [m-TMXDI] |
2778-42-9 |
Resp. Sens. 1, Skin Sens. 1A |
H334, H317 |
|
|
ATP18 |
| 615-047-00-8 |
Bis(isocyanatomethyl)benzene; [m-XDI] |
3634-83-1 |
Resp. Sens. 1, Skin Sens. 1A |
H334, H317 |
Skin Sens. 1A; H317: C >= 0,001 % |
|
ATP18 |
| 615-048-00-3 |
2,4,6-triisopropyl-m-phenylene diisocyanate |
2162-73-4 |
Resp. Sens. 1, Skin Sens. 1 |
H334, H317 |
|
|
ATP18 |
| 615-049-00-9 |
1,5-naphthylene diisocyanate [containing < 0.1 % (w/w) of particles with an aerodynamic diameter of below 50 µm] |
3173-72-6 |
STOT SE 3, Skin Irrit. 2, Eye Irrit. 2, Resp. Sens. 1, Skin Sens. 1A, Aquatic Chronic 3 |
H335, H315, H319, H334, H317, H412 |
|
|
ATP18 |
| 615-050-00-4 |
1,5-naphthylene diisocyanate [containing %u2265 0.1 % (w/w) of particles with an aerodynamic diameter of below 50 µm] |
3173-72-6 |
Acute Tox. 2, STOT SE 3, Skin Irrit. 2, Eye Irrit. 2, Resp. Sens. 1, Skin Sens. 1A, Aquatic Chronic 3 |
H330, H335, H315, H319, H334, H317, H412 |
inhalation: ATE = 0,27 mg/L (dusts or mists) |
|
ATP18 |
| 616-001-00-X |
N,N-dimethylformamide; dimethyl formamide |
68-12-2 |
Repr. 1B, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2 |
H360D ***, H332, H312, H319 |
|
|
CLP00/ |
| 616-002-00-5 |
2-fluoroacetamide |
640-19-7 |
Acute Tox. 2 *, Acute Tox. 3 * |
H300, H311 |
|
|
CLP00/ |
| 616-003-00-0 |
acrylamide; prop-2-enamide |
79-06-1 |
Carc. 1B, Muta. 1B, Repr. 2, Acute Tox. 3 *, STOT RE 1, Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1 |
H350, H340, H361f ***, H301, H372 **, H332, H312, H319, H315, H317 |
|
D |
CLP00/ |
| 616-004-00-6 |
allidochlor (ISO); N,N-diallylchloroacetamide |
93-71-0 |
Acute Tox. 4 *, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Chronic 2 |
H312, H302, H319, H315, H411 |
|
|
CLP00/ |
| 616-005-00-1 |
chlorthiamid (ISO); 2,6-dichloro (thiobenzamide) |
1918-13-4 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 616-006-00-7 |
dichlofluanid (ISO); N-[(dichlorofluoromethyl)thio]-N′,N′-dimethyl-N-phenylsulfamide |
1085-98-9 |
Acute Tox. 4, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1 |
H332, H319, H317, H400 |
M=10 |
|
CLP00/ATP10 |
| 616-007-00-2 |
diphenamid (ISO); N,N-dimethyl-2,2-diphenylacetamide |
957-51-7 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 616-008-00-8 |
propachlor (ISO); 2-chloro-N-isopropylacetanilide; α-chloro-N-isopropylacetanilide |
1918-16-7 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H319, H317, H400, H410 |
|
|
CLP00/ |
| 616-009-00-3 |
propanil (ISO); 3',4'-dichloropropionanilide |
709-98-8 |
Acute Tox. 4 *, Aquatic Acute 1 |
H302, H400 |
M=10: |
|
CLP00/ATP01 |
| 616-010-00-9 |
tosylchloramide sodium |
127-65-1 |
Acute Tox. 4 *, Skin Corr. 1B, Resp. Sens. 1 |
H302, H314, H334 |
|
|
CLP00/ |
| 616-011-00-4 |
N,N-dimethylacetamide |
127-19-5 |
Repr. 1B, Acute Tox. 4 *, Acute Tox. 4 * |
H360D ***, H332, H312 |
|
|
CLP00/ATP09 |
| 616-012-00-X |
N-(dichlorofluoromethylthio)phthalimide; N-(fluorodichloromethylthio)phthalimide |
719-96-0 |
Skin Irrit. 2 |
H315 |
|
|
CLP00/ |
| 616-013-00-5 |
butyraldehyde oxime |
110-69-0 |
Acute Tox. 3 *, Acute Tox. 4 *, Eye Irrit. 2 |
H311, H302, H319 |
|
|
CLP00/ |
| 616-014-00-0 |
butanone oxime; ethyl methyl ketoxime; ethyl methyl ketone oxime |
96-29-7 |
Carc. 1B, Acute Tox. 3, Acute Tox. 4, STOT SE 3, STOT SE 1, STOT RE 2, Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1 |
H350, H301, H312, H336, H370 (upper respiratory tract), H373 (blood system), H315, H318, H317 |
Oral: ATE = 100 mg/kg, Dermal: ATE = 1100 mg/kg |
|
CLP00/ATP15 |
| 616-015-00-6 |
alachlor (ISO); 2-chloro-2',6'-diethyl-N-(methoxymethyl)acetanilide |
15972-60-8 |
Carc. 2, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H302, H317, H400, H410 |
M=10: |
|
CLP00/ |
| 616-016-00-1 |
1-(3,4-dichlorophenylimino) thiosemicarbazide |
5836-73-7 |
Acute Tox. 2 * |
H300 |
|
|
CLP00/ |
| 616-017-00-7 |
cartap hydrochloride |
15263-52-2 |
Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H312, H302, H400, H410 |
|
|
CLP00/ |
| 616-018-00-2 |
diethyltoluamide (ISO): N,N-diethyl-m-toluamide; [deet] |
134-62-3 |
Acute Tox. 4, Skin Irrit. 2, Eye Irrit. 2 |
H302, H315, H319 |
Oral: ATE = 1892 mg/kg
|
|
CLP00/ATP14 |
| 616-019-00-8 |
perfluidone (ISO); 1,1,1-trifluoro-N-(4-phenylsulphonyl-o-tolyl)methanesulphonamide |
37924-13-3 |
Acute Tox. 4 *, Eye Irrit. 2 |
H302, H319 |
|
|
CLP00/ |
| 616-020-00-3 |
tebuthiuron (ISO); 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea |
34014-18-1 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 616-021-00-9 |
thiazafluron (ISO); 1,3-dimethyl-1-(5-trifluoromethyl-1,3,4-thiadiazol-2-yl)urea |
25366-23-8 |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 616-022-00-4 |
acetamide |
60-35-5 |
Carc. 2 |
H351 |
|
|
CLP00/ |
| 616-023-00-X |
N-hexadecyl(or octadecyl)-N-hexadecyl(or octadecyl)benzamide |
- |
Skin Irrit. 2, Skin Sens. 1 |
H315, H317 |
|
|
CLP00/ |
| 616-024-00-5 |
2-(4,4-dimethyl-2,5-dioxooxazolidin-1-yl)-2-chloro-5-(2-(2,4-di-tert-pentylphenoxy)butyramido)-4,4-dimethyl-3-oxovaleranilide |
54942-74-4 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-025-00-0 |
valinamide |
20108-78-5 |
Repr. 2, Eye Irrit. 2, Skin Sens. 1 |
H361f ***, H319, H317 |
|
|
CLP00/ |
| 616-026-00-6 |
thioacetamide |
62-55-5 |
Carc. 1B, Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Aquatic Chronic 3 |
H350, H302, H319, H315, H412 |
|
|
CLP00/ |
| 616-027-00-1 |
tris(2-(2-hydroxyethoxy)ethyl)ammonium 3-acetoacetamido-4-methoxybenzenesulfonate |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 616-028-00-7 |
N-(4-(3-(4-cyanophenyl)ureido)-3-hydroxyphenyl)-2-(2,4-di-tert-pentylphenoxy)octanamide |
108673-51-4 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 616-029-00-2 |
N,N'-ethylenebis(vinylsulfonylacetamide) |
66710-66-5 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
CLP00/ |
| 616-030-00-8 |
ethidimuron (ISO); 1-(5-ethylsulphonyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea |
30043-49-3 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 616-031-00-3 |
dimethachlor (ISO); 2-chloro-N-(2,6-dimethylphenyl)-N-(2-methoxyethyl)acetamide |
50563-36-5 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
CLP00/ |
| 616-032-00-9 |
diflufenican (ISO);
N-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]-3-pyridinecarboxamide;
2",4"-difluoro-2-(%u03B1,%u03B1,%u03B1- trifluoro-m-tolyloxy) nicotinanilide; N-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]-3-pyridinecarboxamide |
83164-33-4 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=10000, M=1000 |
|
CLP00/ATP17 |
| 616-033-00-4 |
cyprofuram (ISO); N-(3-chlorophenyl)-N-(tetrahydro-2-oxo-3-furyl)cyclopropanecarboxamide |
69581-33-5 |
Acute Tox. 3 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H312, H400, H410 |
|
|
CLP00/ |
| 616-034-00-X |
pyracarbolid (ISO); 3,4-dihydro-6-methyl-2H-pyran-5-carboxanilide |
24691-76-7 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 616-035-00-5 |
cymoxanil (ISO); 2-cyano-N-[(ethylamino)carbonyl]-2-(methoxyimino)acetamide |
57966-95-7 |
Repr. 2, Acute Tox. 4, STOT RE 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361fd, H302, H373 (Blut, Thymusdrüse), H317, H400, H410 |
M=1, M=1" |
|
CLP00/ATP06 |
| 616-036-00-0 |
2-chloracetamide |
79-07-2 |
Repr. 2, Acute Tox. 3 *, Skin Sens. 1 |
H361f ***, H301, H317 |
Skin Sens. 1; H317: C ≥ 0,1 % |
|
CLP00/ |
| 616-037-00-6 |
acetochlor (ISO); 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide |
34256-82-1 |
Carc. 2, Repr. 2, Acute Tox. 4, STOT SE 3, STOT RE 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H361f, H332, H335, H373 (kidneys), H315, H317, H400, H410 |
M=1000, M=100 |
|
CLP00/ATP09 |
| 616-038-00-1 |
(4-aminophenyl)-N-methylmethylensulfonamide hydrochloride |
88918-84-7 |
Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H318, H317, H411 |
|
|
CLP00/ |
| 616-039-00-7 |
3',5'-dichloro-4'-ethyl-2'-hydroxypalmitanilide |
117827-06-2 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 616-040-00-2 |
potassium N-(4-toluenesulfonyl)-4-toluenesulfonamide |
97888-41-0 |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 616-041-00-8 |
3',5'-dichloro-2-(2,4-di-tert-pentylphenoxy)-4'-ethyl-2'-hydroxyhexananilide |
101664-25-9 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-042-00-3 |
N-(2-(6-ethyl-7-(4-methylphenoxy)-1H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propyl)-2-octadecyloxybenzamide |
142859-67-4 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 616-043-00-9 |
isoxaben (ISO); N-[3-(1-ethyl-1-methylpropyl)-1,2-oxazol-5-yl]-2,6-dimethoxybenzamide |
82558-50-7 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-044-00-4 |
N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)-2-(3-pentadecylphenoxy)-butanamide |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 616-045-00-X |
2'-(4-chloro-3-cyano-5-formyl-2-thienylazo)-5'-diethylamino-2-methoxyacetanilide |
122371-93-1 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 616-046-00-5 |
N-(2-(6-chloro-7-methylpyrazolo(1,5-b)-1,2,4-triazol-4-yl)propyl)-2-(2,4-di-tert-pentylphenoxy)octanamide |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 616-047-00-0 |
reaction mass of: 2,2',2'',2'''-(ethylenedinitrilotetrakis-N,N-di(C16)alkylacetamide; 2,2',2'',2'''-(ethylenedinitrilotetrakis-N,N-di(C18)alkylacetamide |
- |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 616-048-00-6 |
3'-trifluoromethylisobutyranilide |
1939-27-1 |
STOT RE 2 *, Aquatic Chronic 2 |
H373 **, H411 |
|
|
CLP00/ |
| 616-049-00-1 |
2-(2,4-bis(1,1-dimethylethyl)phenoxy)-N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)-hexanamide |
99141-89-6 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-050-00-7 |
lufenuron (ISO); N-[2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)-phenyl-aminocarbonyl]-2,6-difluorobenzamide |
103055-07-8 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 616-051-00-2 |
reaction mass of: 2,4 -bis(N'-(4-methylphenyl)-ureido)-toluene; 2,6 -bis(N'-(4-methylphenyl)-ureido)-toluene |
- |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-052-00-8 |
formamide |
75-12-7 |
Repr. 1B |
H360D *** |
|
|
CLP00/ |
| 616-053-00-3 |
N-methylacetamide |
79-16-3 |
Repr. 1B |
H360D *** |
|
|
CLP00/ |
| 616-054-00-9 |
iprodione (ISO); 3-(3,5-dichlorophenyl)-2,4-dioxo-N-isopropylimidazolidine-1-carboxamide |
36734-19-7 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H400, H410 |
|
|
CLP00/ |
| 616-055-00-4 |
propyzamide (ISO); 3,5-dichloro-N-(1,1-dimethylprop-2-ynyl)benzamide |
23950-58-5 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H400, H410 |
|
|
CLP00/ |
| 616-056-00-X |
N-methylformamide |
123-39-7 |
Repr. 1B, Acute Tox. 4 * |
H360D ***, H312 |
|
|
CLP00/ |
| 616-057-00-5 |
reaction mass of: N-[3-hydroxy-2-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide; N-[2,3-bis-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide; methacrylamide; 2-methyl-N-(2-methylacryloylaminomethoxymethyl)-acrylamide; N |
- |
Carc. 1B, Muta. 2, STOT RE 2 * |
H350, H341, H373 ** |
|
|
CLP00/ |
| 616-058-00-0 |
1,3-bis(3-methyl-2,5-dioxo-1H-pyrrolinylmethyl)benzene |
119462-56-5 |
STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H373 **, H318, H317, H400, H410 |
|
|
CLP00/ |
| 616-059-00-6 |
4-((4-(diethylamino)-2-ethoxyphenyl)imino)-1,4-dihydro-1-oxo-N-propyl-2-naphthalenecarboxamide |
121487-83-0 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-060-00-1 |
Condensation product of: 3-(7-carboxyhept-1-yl)-6-hexyl-4-cyclohexene-1,2-dicarboxylic acid with polyamines (primarily amino-ethyl-piperazine and triethylenetetramine) |
- |
Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H314, H317, H400, H410 |
|
|
CLP00/ |
| 616-061-00-7 |
N,N'-1,6-hexanediylbis(N-(2,2,6,6-tetramethyl-piperidin-4-yl)-formamide |
124172-53-8 |
Eye Irrit. 2, Aquatic Chronic 3 |
H319, H412 |
|
|
CLP00/ |
| 616-062-00-2 |
N-[3-[(2-acetyloxy)ethyl](phenyl-methyl)amino]-4-methoxyphenylacetamide |
70693-57-1 |
Skin Corr. 1B, Aquatic Chronic 3 |
H314, H412 |
|
|
CLP00/ |
| 616-063-00-8 |
3-dodecyl-(1-(1,2,2,6,6-pentamethyl-4-piperidin)-yl)-2,5-pyrrolidindione |
106917-30-0 |
Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1A, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H302, H373 **, H314, H400, H410 |
|
|
CLP00/ |
| 616-064-00-3 |
N-tert-butyl-3-methylpicolinamide |
32998-95-1 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 616-065-00-9 |
3'-(3-acetyl-4-hydroxyphenyl)-1,1-diethylurea |
79881-89-3 |
Acute Tox. 4 *, STOT RE 2 * |
H302, H373 ** |
|
|
CLP00/ |
| 616-066-00-4 |
5,6,12,13-tetrachloroanthra(2,1,9-def:6,5,10-d'e'f')diisoquinoline-1,3,8,10(2H,9H)-tetrone |
115662-06-1 |
Repr. 2 |
H361f *** |
|
|
CLP00/ |
| 616-067-00-X |
dodecyl 3-(2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-4,4-dimethyl-3-oxovaleramido)-4-chlorobenzoate |
92683-20-0 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-068-00-5 |
potassium 4-(11-methacrylamidoundecanamido)benzenesulfonate |
174393-75-0 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 616-069-00-0 |
1-hydroxy-5-(2-methylpropyloxycarbonylamino)-N-(3-dodecyloxypropyl)-2-naphthoamide |
110560-22-0 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-070-00-6 |
reaction mass of: 3,3'-dicyclohexyl-1,1'-methylenebis(4,1-phenylene)diurea; 3-cyclohexyl-1-(4-(4-(3-octadecylureido)benzyl)phenyl)urea; 3,3'-dioctadecyl-1,1'-methylenebis(4,1-phenylene)diurea |
- |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-071-00-1 |
reaction mass of: bis(N-cyclohexyl-N'-phenyleneureido)methylene; bis(N-octadecyl-N'-phenyleneureido)methylene; bis(N-dicyclohexyl-N'-phenyleneureido)methylene (1:2:1) |
- |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 616-072-00-7 |
1-(2-deoxy-5-O-trityl-β-D-threopentofuranosyl)thymine |
55612-11-8 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-073-00-2 |
4'-ethoxy-2-benzimidazoleanilide |
120187-29-3 |
Muta. 2, Aquatic Chronic 4 |
H341, H413 |
|
|
CLP00/ |
| 616-074-00-8 |
N-butyl-2-(4-morpholinylcarbonyl)benzamide |
104958-67-0 |
Eye Irrit. 2, Skin Sens. 1, Aquatic Chronic 3 |
H319, H317, H412 |
|
|
CLP00/ |
| 616-075-00-3 |
D,L-(N,N-diethyl-2-hydroxy-2-phenylacetamide) |
65197-96-8 |
Acute Tox. 4 *, Eye Dam. 1 |
H302, H318 |
|
|
CLP00/ |
| 616-076-00-9 |
tebufenozide (ISO); N-tert-butyl-N'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazide |
112410-23-8 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 616-077-00-4 |
reaction mass of: 2-(9-methyl-1,3,8,10-tetraoxo-2,3,9,10-tetrahydro-(1H,8H)-anthra[2,1,9-def: 6,5,10-d'e'f']diisoquinolin-2-ylethansulfonic acid; potassium 2-(9-methyl-1,3,8,10-tetraoxo-2,3,9,10-tetrahydro-(1H,8H)-anthra[2,1,9-def: 6,5,10-d'e'f']diisoqui |
- |
Eye Dam. 1 |
H318 |
|
|
CLP00/ |
| 616-078-00-X |
2-[2,4-bis(1,1-dimethyl-ethyl)phenoxy]-N-(2-hydroxy-5-methyl-phenyl)hexanamide |
104541-33-5 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-079-00-5 |
1,6-hexanediyl-bis(2-(2-(1-ethylpentyl)-3-oxazolidinyl)ethyl)carbamate |
140921-24-0 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 616-080-00-0 |
4-(2-((3-ethyl-4-methyl-2-oxo-pyrrolin-1-yl)carboxamido)ethyl)benzenesulfonamide) |
119018-29-0 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 616-081-00-6 |
5-bromo-8-naphtholactam |
24856-00-6 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
|
|
CLP00/ |
| 616-082-00-1 |
N-(5-chloro-3-((4-(diethylamino)-2-methylphenyl)imino-4-methyl-6-oxo-1,4-cyclohexadien-1-yl)benzamide |
129604-78-0 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 616-083-00-7 |
[2-[(4-nitrophenyl)amino]ethyl]urea |
27080-42-8 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 616-084-00-2 |
2,4-bis[N'-(4-methylphenyl)ureido]toluene |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 616-085-00-8 |
3-(2,4-dichlorophenyl)-6-fluoro-quinazoline-2,4(1H,3H)-dione |
168900-02-5 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 616-086-00-3 |
2-acetylamino-6-chloro-4-[(4-diethylamino)2-methylphenyl-imino]-5-methyl-1-oxo-2,5-cyclohexadiene |
102387-48-4 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-087-00-9 |
reaction mass of: 7,9,9-trimethyl-3,14-dioxa-4,13-dioxo-5,12-diazahexadecane-1,16-diyl-prop-2-enoate; 7,7,9-trimethyl-3,14-dioxa-4,13-dioxo-5,12-diazahexadecan-1,16-diyl-prop-2-enoate |
52658-19-2 |
Eye Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H319, H317, H411 |
|
|
CLP00/ |
| 616-088-00-4 |
2-aminosulfonyl-N,N-dimethylnicotinamide |
112006-75-4 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
CLP00/ |
| 616-089-00-X |
5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidine)-3-fluoro-2-hydroxymethyltetrahydrofuran |
41107-56-6 |
Muta. 2 |
H341 |
|
|
CLP00/ |
| 616-090-00-5 |
1-(1,4-benzodioxan-2-ylcarbonyl)piperazine hydrochloride |
70918-74-0 |
Acute Tox. 3 *, Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Aquatic Chronic 2 |
H331, H311, H301, H373 **, H411 |
|
|
CLP00/ |
| 616-091-00-0 |
1,3,5-tris-[(2S and 2R)-2,3-epoxypropyl]-1,3,5-triazine-2,4,6-(1H,3H,5H)-trione |
59653-74-6 |
Muta. 1B, Acute Tox. 3 *, Acute Tox. 4 *, STOT RE 2 *, Eye Dam. 1, Skin Sens. 1 |
H340, H331, H302, H373 **, H318, H317 |
|
|
CLP00/ |
| 616-092-00-6 |
Polymeric reaction product of bicyclo[2.2.1]hepta-2,5-diene, ethene, 1,4-hexadiene, 1-propene with N,N-di-2-propenylformamide |
- |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
CLP00/ |
| 616-093-00-1 |
Reaction products of: aniline-terephthalaldehyde-o-toluidine condensate with maleic anhydride |
129217-90-9 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 616-094-00-7 |
3,3'-dicyclohexyl-1,1'-methylenebis(4,1-phenylene)diurea |
58890-25-8 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ATP10 |
| 616-095-00-2 |
3,3'-dioctadecyl-1,1'-methylenebis(4,1-phenylene)diurea |
43136-14-7 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-096-00-8 |
N-(3-hexadecyloxy-2-hydroxyprop-1-yl)-N-(2-hydroxyethyl)palmitamide |
110483-07-3 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-097-00-3 |
N,N'-1,4-phenylenebis(2-((2-methoxy-4-nitrophenyl)azo)-3-oxobutanamide |
83372-55-8 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-098-00-9 |
1-[4-chloro-3-((2,2,3,3,3-pentafluoropropoxy)methyl)phenyl]-5-phenyl-1H-1,2,4-triazole-3-carboxamide |
119126-15-7 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 616-099-00-4 |
2-[4-[(4-hydroxyphenyl)sulfonyl]phenoxy]-4,4-dimethyl-N-[5-[(methylsulfonyl)amino]-2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]phenyl]-3-oxopentanamide |
135937-20-1 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-100-00-8 |
1,3-dimethyl-1,3-bis(trimethylsilyl)urea |
10218-17-4 |
Acute Tox. 4 *, Skin Irrit. 2 |
H302, H315 |
|
|
CLP00/ |
| 616-101-00-3 |
(S)-N-tert-butyl-1,2,3,4-tetrahydro-3-isoquinolinecarboxamide |
149182-72-9 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 616-102-00-9 |
reaction mass of: α-[3-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyl]-ω-[3-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyloxy]-poly-(oxyethylene-co-oxypropylene); 1,2-(or 1,3-)bis[α-(3-mercaptopropanoxycarbonylamino)methylphenyl |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 616-103-00-4 |
(S,S)-trans-4-(acetylamino)-5,6-dihydro-6-methyl-7,7-dioxo-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
120298-38-6 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
|
|
CLP00/ |
| 616-104-00-X |
benalaxyl (ISO); methyl N-(2,6-dimethylphenyl)-N-(phenylacetyl)-DL-alaninate |
71626-11-4 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 616-105-00-5 |
chlorotoluron (ISO); 3-(3-chloro-p-tolyl)-1,1-dimethylurea |
15545-48-9 |
Carc. 2, Repr. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H361d ***, H400, H410 |
|
|
CLP00/ |
| 616-106-00-0 |
phenmedipham (ISO);
methyl 3-(3-methylcarbaniloyloxy)carbanilate |
13684-63-4 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=10,
M=10 |
|
CLP00/ATP17 |
| 616-107-00-6 |
cinidon ethyl (ISO); ethyl (Z)-2-chloro-3-[2-chloro-5-(cyclohex-1-ene-1,2-dicarboximido)phenyl]acrylate |
142891-20-1 |
Carc. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H317, H400, H410 |
|
|
ATP01/ |
| 616-108-00-1 |
iodosulfuron-methyl-sodium; sodium ({}{[5-iodo-2-(methoxycarbonyl)phenyl]sulfonyl}}carbamoyl)(4-methoxy-6-methyl-1,3,5-triazin-2-yl)azanide |
144550-36-7 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 616-109-00-7 |
sulfosulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea |
141776-32-1 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 616-110-00-2 |
cyclanilide (ISO); 1-(2,4-dichloroanilinocarbonyl)cyclopropanecarboxylic acid |
113136-77-9 |
Acute Tox. 4 *, Aquatic Chronic 2 |
H302, H411 |
|
|
CLP00/ |
| 616-111-00-8 |
fenhexamid (ISO); N-(2,3-dichlor-4-hydroxyphenyl)-1-methylcyclohexancarboxamid |
126833-17-8 |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 616-112-00-3 |
oxasulfuron (ISO); oxetan-3-yl 2-[(4,6-dimethylpyrimidin-2-yl)-carbamoylsulfamoyl]benzoate |
144651-06-9 |
STOT RE 2 *, Aquatic Acute 1, Aquatic Chronic 1 |
H373 **, H400, H410 |
|
|
CLP00/ |
| 616-113-00-9 |
desmedipham (ISO);
ethyl 3-phenylcarbamoyloxyphenylcarbamate |
13684-56-5 |
Repr. 2,
Aquatic Acute 1,
Aquatic Chronic 1 |
H361d,
H400,
H410 |
M=10,
M=10 |
|
CLP00/ATP17 |
| 616-114-00-4 |
dodecanamide, N,N'-(9,9',10,10'-tetrahydro-9,9',10,10'-tetraoxo(1,1'-bianthracene)-4,4'-diyl)bis- |
136897-58-0 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-115-00-X |
N-(3-acetyl-2-hydroxyphenyl)-4-(4-phenylbutoxy)benzamide |
136450-06-1 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-116-00-5 |
N-(4-dimethylaminopyridinium)-3-methoxy-4-(1-methyl-5-nitroindol-3-ylmethyl)-N-(o-tolylsulfonyl)benzamidate |
143052-96-4 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-117-00-0 |
N-[2-(3-acetyl-5-nitrothiophen-2-ylazo)-5-diethylaminophenyl]acetamide |
777891-21-1 |
Repr. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H361f ***, H317, H400, H410 |
|
|
CLP00/ |
| 616-118-00-6 |
N-(2',6'-dimethylphenyl)-2-piperidinecarboxamide hydrochloride |
65797-42-4 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 616-119-00-1 |
2-(1-butyl-3,5-dioxo-2-phenyl-(1,2,4)-triazolidin-4-yl)-4,4-dimethyl-3-oxo-N-(2-methoxy-5-(2-(dodecyl-1-sulfonyl))propionylamino)-phenyl)-pentanamide |
118020-93-2 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-120-00-7 |
reaction mass of: N-(3-dimethylamino-4-methyl-phenyl)-benzamide; N-(3-dimethylamino-2-methyl-phenyl)-benzamide; N-(3-dimethylamino-3-methyl-phenyl)-benzamide |
- |
STOT RE 2 *, Aquatic Chronic 2 |
H373 **, H411 |
|
|
CLP00/ |
| 616-121-00-2 |
2,4-dihydroxy-N-(2-methoxyphenyl)benzamide |
129205-19-2 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 616-122-00-8 |
methyl neodecanamide |
105726-67-8 |
Acute Tox. 4 * |
H302 |
|
|
ATP01/ |
| 616-123-00-3 |
N-[3-[[4-(diethylamino)-2-methylphenyl]imino]-6-oxo-1,4-cyclohexadienyl]acetamide |
96141-86-5 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 616-124-00-9 |
lithium bis(trifluoromethylsulfonyl)imide |
90076-65-6 |
Acute Tox. 3 *, Acute Tox. 3 *, STOT RE 2 *, Skin Corr. 1B, Aquatic Chronic 3 |
H311, H301, H373**, H314, H412 |
|
|
CLP00/ATP01 |
| 616-125-00-4 |
3-cyano-N-(1,1-dimethylethyl)androsta-3,5-diene-17-β-carboxamide |
151338-11-3 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 616-126-00-X |
1-methyl-4-nitro-3-propyl-1H-pyrazole-5-carboxamide |
139756-01-7 |
Acute Tox. 4 *, STOT RE 2 *, Aquatic Chronic 3 |
H302, H373**, H412 |
|
|
ATP01/ |
| 616-127-00-5 |
reaction mass of: N,N'-Ethane-1,2-diylbis(decanamide); 12-Hydroxy-N-[2-[1-oxydecyl)amino]ethyl]octadecanamide; N,N'-Ethane-1,2-diylbis(12-hydroxyoctadecanamide) |
- |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
CLP00/ |
| 616-128-00-0 |
N-(2-(1-allyl-4,5-dicyanoimidazol-2-ylazo)-5-(dipropylamino)phenyl)-acetamide |
123590-00-1 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-129-00-6 |
N,N'-bis(2,2,6,6-tetramethyl-4-piperidyl)isophthalamide |
42774-15-2 |
Acute Tox. 4 *, Eye Irrit. 2 |
H302, H319 |
|
|
CLP00/ |
| 616-130-00-1 |
N-(3-(2-(4,4-dimethyl-2,5-dioxo-imidazolin-1-yl)-4,4-dimethyl-3-oxo-pentanoylamino)-4-methoxy-phenyl)-octadecanamide |
150919-56-5 |
Aquatic Chronic 4 |
H413 |
|
|
CLP00/ |
| 616-131-00-7 |
1-aminocyclopentanecarboxamide |
17193-28-1 |
STOT RE 1, Acute Tox. 4 *, Eye Dam. 1 |
H372**, H302, H318 |
|
|
ATP01/ |
| 616-132-00-2 |
N-[4-(4-cyano-2-furfurylidene-2,5-dihydro-5-oxo-3-furyl)phenyl]butane-1-sulfonamide |
130016-98-7 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 616-133-00-8 |
N-cyclohexyl-S,S-dioxobenzo[b]tiophene-2-carboxamide |
149118-66-1 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H318, H400, H410 |
|
|
CLP00/ |
| 616-134-00-3 |
3,3'-bis(dioctyloxyphosphinothioylthio)-N,N'-oxybis(methylene)dipropionamide |
793710-14-2 |
Aquatic Chronic 3 |
H412 |
|
|
CLP00/ |
| 616-135-00-9 |
(3S,4aS,8aS)-2-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-tert-butyldecahydroisoquinoline-3-carboxamide |
136522-17-3 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
CLP00/ |
| 616-136-00-4 |
reaction product of cocoalkyldiethanolamides and cocoalkylmonoglycerides and molybdenumtrioxide (1.75-2.2: 0.75-1.0:0.1-1.1) |
- |
Aquatic Chronic 2 |
H411 |
|
|
ATP01/ |
| 616-137-00-X |
4-dichloroacetyl-1-oxa-4-azaspiro[4.5]decane |
71526-07-3 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 616-138-00-5 |
benzoic acid, N-tert-butyl-N'-(4-chlorobenzoyl)hydrazide |
112226-61-6 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 616-139-00-0 |
(3S,4aS,8aS)-N-tert-butyldecahydro-3-isoquinolinecarboxamide |
136465-81-1 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Chronic 3 |
H302, H318, H412 |
|
|
ATP01/ |
| 616-140-00-6 |
N,N''-(methylenedi-4,1-phenylene)bis[N'-(4-methylphenyl)urea] |
133336-92-2 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 616-141-00-1 |
zoxamide (ISO); (RS)-3,5-dichloro-N-(3-chloro-1-ethyl-1-methyl-2-oxopropyl)-p-toluamide |
156052-68-5 |
Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H400, H410 |
M=10: |
|
ATP01/ |
| 616-142-00-7 |
1,3-Bis(vinylsulfonylacetamido)propane |
93629-90-4 |
Muta. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H341, H318, H317, H412 |
|
|
CLP00/ |
| 616-143-00-2 |
N,N'-dihexadecyl-N,N'-bis(2-hydroxyethyl)propanediamide |
149591-38-8 |
Repr. 2, Eye Irrit. 2, Aquatic Chronic 4 |
H361f ***, H319, H413 |
|
|
CLP00/ |
| 616-144-00-8 |
3,4-dichloro-N-[5-chloro-4-[2-[4-dodecyloxyphenylsulfonyl]butyramido]-2-hydroxyphenyl]benzamide |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-145-00-3 |
pethoxamide (ISO); 2-chloro-N-(2-ethoxyethyl)-N-(2-methyl-1-phenylprop-1-enyl)acetamide |
106700-29-2 |
Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
M=100: |
|
ATP01/ |
| 616-146-00-9 |
N-(2-methoxy-5-octadecanoylaminophenyl)-2-(3-benzyl-2,5-dioxoimidazolidin-1-yl)-4,4-dimethyl-3-oxopentanoic acidamide |
142776-95-2 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-147-00-4 |
1-methyl-4-(2-methyl-2H-tetrazol-5-yl)-1H-pyrazole-5-sulfonamide |
139481-22-4 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
ATP01/ |
| 616-148-00-X |
N-[6,9-dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6-oxo-1H-purin-2-yl]acetamide |
84245-12-5 |
Carc. 1B, Muta. 1B, Repr. 1B |
H350, H340, H360FD |
|
|
ATP01/ |
| 616-150-00-0 |
(2R,3S)-N-(3-amino-2-hydroxy-4-phenylbutyl)-N-isobutyl-4-nitrobenzenesulfonamide hydrochloride |
- |
STOT RE 2 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H373**, H318, H317, H411 |
|
|
ATP01/ |
| 616-151-00-6 |
N-(2-amino-4,6-dichloropyrimidin-5-yl)formamide |
171887-03-9 |
Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 3 |
H302, H318, H317, H412 |
|
|
ATP01/ |
| 616-152-00-1 |
4-(4-fluorophenyl)-2-(2-methyl-1-oxopropyl)-4-oxo-3,N-diphenylbutanamide |
125971-96-2 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-153-00-7 |
4-methyl-3-oxo-N-phenyl-2-(phenylmethylene)pentanamide |
125971-57-5 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 616-154-00-2 |
3,4-dichloro-N-[5-chloro-4-[2-[4-(hexadecyloxy)phenylsulfonyl]butyramido]-2-hydroxyphenyl]benzamide |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-155-00-8 |
N,N,N',N'-tetracyclohexyl-1,3-benzenedicarboxamide |
104560-40-9 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 616-156-00-3 |
6-(2-chloro-6-cyano-4-nitrophenylazo)-4-methoxy-3-[N-(methoxycarbonylmethyl)-N-(1-methoxycarbonylethyl)amino]acetanilide |
204277-61-2 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-157-00-9 |
3-amino-4-hydroxy-N-(3-isopropoxypropyl)benzenesulfonamide hydrochloride |
114565-70-7 |
Acute Tox. 4 *, Eye Dam. 1, Aquatic Acute 1, Aquatic Chronic |
H302, H318, H400, H410 |
|
|
ATP01/ |
| 616-158-00-4 |
N-[4-cyano-3-trifluoromethylphenyl]methacrylamide |
90357-53-2 |
STOT RE 2 *, Aquatic Chronic 2 |
H373**, H411 |
|
|
ATP01/ |
| 616-160-00-5 |
2,2'-azobis[N-(2-hydroxyethyl)-2-methylpropionamide] |
61551-69-7 |
Skin Sens. 1, Aquatic Chronic 3 |
H317, H412 |
|
|
ATP01/ |
| 616-161-00-0 |
2,4-dichloro-5-hydroxyacetanilide |
67669-19-6 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 616-162-00-6 |
isostearic acid monoisopropanolamide |
- |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
ATP01/ |
| 616-163-00-1 |
4,4'-methylenebis[N-(4-chlorophenyl)-3-hydroxynaphthalene-2-carboxamide] |
192463-88-0 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-164-00-7 |
dimoxystrobin (ISO); (2E)-2-{2-[(2,5-dimethylphenoxy)methyl]phenyl}-2-(methoxyimino)-N-methylacetamide; (E)-2-(methoxyimino)-N-methyl-2-[%u03B1-(2,5-xylyloxy)-o-tolyl]acetamide |
149961-52-4 |
Carc. 2, Repr. 2, Acute Tox. 4, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H361d, H332, H400, H410 |
inhalation: ATE = 1,3 mg/L (dusts or mists); M = 100, M = 100 |
|
ATP01/ATP18 |
| 616-165-00-2 |
beflubutamid (ISO); (RS)-N-benzyl-2-(α,α,α,4-tetrafluoro-m-tolyoxy)butyramide |
113614-08-7 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=100: |
|
ATP01/ |
| 616-166-00-8 |
cyazofamid (ISO); 4-chloro-2-cyano-N,N-dimethyl-5-p-tolylimidazole-1-sulfonamide |
120116-88-3 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=10: |
|
ATP01/ |
| 616-167-00-3 |
N,N-dibutyl-(2,5-dihydro-5-thioxo-1H-tetrazol-1-yl)acetamide |
168612-06-4 |
Eye Irrit. 2, Skin Sens. 1 |
H319, H317 |
|
|
ATP01/ |
| 616-168-00-9 |
1-dimethylcarbamoyl-4-(2-sulfonatoethyl)pyridinium |
136997-71-2 |
Skin Sens. 1 |
H317 |
|
|
ATP01/ |
| 616-169-00-4 |
4-[4-(2,2-dimethyl-propanamido)]phenylazo-3-(2-chloro-5-(2-(3-pentadecylphenoxy)butylamido)anilino)-1-(2,4,6-trichlorophenyl)-2-pyrazoline-5-one |
92771-56-7 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 616-170-00-X |
(2R)-2-amino-2-phenylacetamide |
6485-67-2 |
Eye Irrit. 2, Skin Sens. 1 |
H319, H317 |
|
|
ATP01/ |
| 616-171-00-5 |
2-(para-chlorophenyl)glycineamide |
102333-75-5 |
Eye Dam. 1, Skin Sens. 1 |
H318, H317 |
|
|
ATP01/ |
| 616-172-00-0 |
N-(2,2,6,6-tetramethyl-1-oxylpiperidin-4-yl)acetamide; (4-acetamido-2,2,6,6-tetramethyl-1-piperidinyl)oxidanyl |
14691-89-5 |
Acute Tox. 4 * |
H302 |
|
|
ATP01/ |
| 616-174-00-1 |
2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one hydrochloride |
151257-01-1 |
Acute Tox. 4 *, Eye Irrit. 2 |
H302, H319 |
|
|
ATP01/ |
| 616-175-00-7 |
2-(2-hexyldecyloxy)benzamide |
202483-62-3 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-176-00-2 |
3-N,N-bis(methoxyethyl)aminoacetanilide |
24294-01-7 |
Acute Tox. 4 *, Aquatic Chronic 3 |
H302, H412 |
|
|
ATP01/ |
| 616-177-00-8 |
(3-(4-(2-(butyl-(4-methylphenylsulfonyl)amino)phenylthio)-5-oxo-1-(2,4,6-trichlorophenyl)-4,5-dihydro-1H-pyrazole-3-ylamino)-4-chlorophenyl)tetradecanamide; N-[3-({4-[(2-{butyl[(4-methylphenyl)sulfonyl]amino}phenyl)thio]-5-oxo-1-(2,4,6-trichlorophenyl)-4 |
217324-98-6 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-178-00-3 |
N-(5-(bis(2-methoxyethyl)amino)-2-((2-cyano-4,6-dinitrophenyl)-azo)phenyl)acetamide |
52583-35-4 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-179-00-9 |
2-chloro-N-(4-methylphenyl)acetamide |
16634-82-5 |
Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H318, H317, H400, H410 |
|
|
ATP01/ |
| 616-180-00-4 |
N,N-(dimethylamino)thioacetamide hydrochloride |
27366-72-9 |
Repr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H360D***, H400, H410 |
|
|
ATP01/ |
| 616-181-00-X |
4'-methyldodecane-1-sulfonanilide |
17417-32-2 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 616-182-00-5 |
N'-(1,3-dimethylbutylidene)-3-hydroxy-2-naphthohydrazide |
214417-91-1 |
Skin Sens. 1, Aquatic Chronic 2 |
H317, H411 |
|
|
ATP01/ |
| 616-183-00-0 |
N-dodecyl-4-methoxybenzamide |
1854-15-5 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-184-00-6 |
3-methyl-N-(5,8,13,14-tetrahydro-5,8,14-trioxonaphth[2,3-c]acridin-6-yl)benzamide |
105043-55-8 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-186-00-7 |
N,N'-(2-chloro-1,4-phenylene)bis(3-oxobutaneamide) |
53641-10-4 |
Aquatic Chronic 3 |
H412 |
|
|
ATP01/ |
| 616-188-00-8 |
2-(5,5-dimethyl-2,4-dioxooxazolidin-3-yl)-4,4-dimethyl-3-oxo-N-(2-methoxy-5-octadecanoylaminophenyl)pentanoic acid amide |
221215-20-9 |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 616-189-00-3 |
N-[5-(bis-(2-methoxy-ethyl)-amino]-2-(6-bromo-2-methyl-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)-phenyl]acetamide |
452962-97-9 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-190-00-9 |
N-decyl-4-nitrobenzamide |
64026-19-3 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-191-00-4 |
2-ethyl-N-methyl-N-(3-methylphenyl)butanamide |
406488-30-0 |
Acute Tox. 4 *, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H302, H319, H315, H317, H411 |
|
|
ATP01/ |
| 616-192-00-X |
2-[2-(3-butoxypropyl)-1,1-dioxo-1,2,4-benzothiadiazin-3-yl]-5'-tert-butyl-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2'-[(2-ethylhexyl)thio]acetanilide |
727678-39-9 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-193-00-5 |
N-[2-(2-butyl-4,6-dicyano-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)-5-diethylamino-phenyl]acetamide |
368450-39-9 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-194-00-0 |
2,2-diethoxy-N,N-dimethylacetamide |
34640-92-1 |
Eye Irrit. 2 |
H319 |
|
|
ATP01/ |
| 616-196-00-1 |
disodium salt of 1-hydroxy-4-(β-(4-(1-hydroxy-3,6-disulfo-8-acetylamino-2-naphthylazo)phenoxy)ethoxy)-N-dodecyl-2-naphthamide |
- |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
ATP01/ |
| 616-197-00-7 |
reaction mass of: potassium N-[3-(dimethyloxidoamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane sulfonamidate; N-[3-(dimethyloxidoamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane sulfonamide |
- |
STOT RE 2 * |
H373** |
|
|
ATP01/ |
| 616-198-00-2 |
1,3-bis[12-hydroxy-octadecamide-N-methylene]-benzene |
- |
Skin Sens. 1, Aquatic Chronic 4 |
H317, H413 |
|
|
ATP01/ |
| 616-200-00-1 |
reaction mass of N,N’-ethane-1,2-diylbis(hexanamide) and 12-hydroxy-N-[2- [(1-oxyhexyl)amino]ethyl]octadecanamide and N,N’-ethane-1,2-diylbis(12- hydroxyoctadecan amide) |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ATP05 |
| 616-201-00-7 |
12-hydroxyoctadecanoic acid, reaction products with 1,3-benzenedimethanamine and hexamethylenediamine |
220926-97-6 |
Acute Tox. 4 *, Aquatic Chronic 4 |
H332, H413 |
|
|
ATP01/ |
| 616-202-00-2 |
reaction mass of: 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[N-(2,4-dimethylphenyl)]-3-oxo-butanamide; 2-[[3,3'-dichloro-4'-[[1[[(2,4-dimethylphenyl)amino]carbonyl]-2-oxopropyl]azo][1,1'-biphenyl]-4-yl]azo]-N-(2-methylphenyl)-3-oxo-butana |
- |
Carc. 2, Skin Sens. 1, Aquatic Chronic 4 |
H351, H317, H413 |
|
|
ATP01/ |
| 616-203-00-8 |
reaction mass of: N-[5-[bis-(2-methoxyethyl)amino]-2-(2-butyl-4,6-dicyano-1,3-dioxo-2,3-dihydro-1H-isoindol-5-yl-azo)phenyl]acetamide; N-[2-(2-butyl-4,6-dicyano-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)5-diethylaminophenyl]acetamide |
- |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-204-00-3 |
N,N''-(methylenedi-4,1-phenylene)bis[N'-octylurea] |
122886-55-9 |
Aquatic Chronic 4 |
H413 |
|
|
ATP01/ |
| 616-205-00-9 |
Metazachlor (ISO); 2-chloro-N-(2,6-dimethylphenyl)- N-(1H-pyrazol-1- ylmethyl)acetamide |
67129-08-2 |
Skin Sens. 1B, Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H317, H351, H400, H410 |
M=100, M=100“ |
|
ATP03 |
| 616-206-00-4 |
flufenoxuron (ISO); 1-(4-(2-cloro-α,α,α-p-trifluorotolyloxy)-2-fluorophenyl)-3-(2,6-difluorobenzolyl) urea |
101463-69-8 |
Lact., Aquatic Acute 1, Aquatic Chronic 1 |
H362, H400, H410 |
M= 10000, M=10000 |
|
ATP05 |
| 616-207-00-X |
polyhexamethylene biguanide hydrochloride |
27083-27-8 or 32289-58-0 |
Carc. 2,Acute Tox. 2, Acute Tox. 4, STOT RE 1, Eye Dam. 1, Skin Sens. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H330, H302, H372 (respiratory tract) (inhalation), H318, H317, H400, H410 |
M=10, M=10 |
|
ATP09 |
| 616-208-00-5 |
N-ethyl-2-pyrrolidone; 1-ethylpyrrolidin-2-one |
2687-91-4 |
Repr. 1B |
H360D |
|
|
ATP05 |
| 616-209-00-0 |
amidosulfuron (ISO); 3-(4,6-dimethoxypyrimidin-2-yl)- 1-((N-methyl-N-methylsulfonylamino)sulfonyl)urea |
120923-37-7 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=100, M=100 |
|
ATP05 |
| 616-210-00-6 |
tebufenpyrad (ISO); N-(4-tertbutylbenzyl)-4-chloro-3-ethyl-1-methyl-1Hpyrazole-5- carboxamide |
119168-77-3 |
Acute Tox. 3, Acute Tox. 4, STOT RE 2, Skin Sens. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H332, H373 (gastro-intestinaltract) (Oral), H317, H400, H410 |
M=10, M=10 |
|
ATP05 |
| 616-211-00-1 |
proquinazid (ISO); 6-iodo-2-propoxy-3-propylquinazolin-4(3H)-one |
189278-12-4 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H400, H410 |
M=1, M=10 |
|
ATP05 |
| 616-212-00-7 |
3-iodo-2-propynyl butylcarbamate; 3-iodoprop-2-yn-1-yl butylcarbamate |
55406-53-6 |
Acute Tox. 3, Acute Tox. 4, STOT RE 1, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H302, H372 (Kehlkopf), H318, H317, H400, H410 |
M=10, M = 1“ |
|
ATP06 |
| 616-213-00-2 |
mandipropamid (ISO); 2-(4-chlorophenyl)-N-{2-[3-methoxy-4-(prop-2-yn-1-yloxy)phenyl]ethyl}-2-(prop-2-yn-1-yloxy)acetamide |
374726-62-2 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1, M=1 |
|
ATP07 |
| 616-214-00-8 |
metosulam (ISO); N-(2,6-dichloro-3-methylphenyl)-5,7-dimethoxy[1,2,4]triazolo[1,5-a] pyrimidine-2-sulfonamide |
139528-85-1 |
Carc. 2, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H373, (eyes, kidneys), H400, H410 |
M=1000, M=100 |
|
ATP07 |
| 616-215-00-3 |
dimethenamid-P (ISO); 2-chloro-N-(2,4-dimethyl-3-thienyl)-N-[(2S)-1-methoxypropan-2-yl]acetamide |
163515-14-8 |
Acute Tox. 4, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H317, H400, H410 |
M=10, M=10 |
|
ATP07 |
| 616-216-00-9 |
flonicamid (ISO); N-(cyanomethyl)-4-(trifluoromethyl)pyridine-3-carboxamide |
158062-67-0 |
Acute Tox. 4 |
H302 |
|
|
ATP07 |
| 616-217-00-4 |
sulfoxaflor (ISO); [methyl(oxo){1-[6-(trifluoromethyl)-3-pyridyl]ethyl}-λ6-sulfanylidene]cyanamide |
946578-00-3 |
Acute Tox. 4, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
M=1, M=1 |
|
ATP07 |
| 616-218-00-X |
benzovindiflupyr (ISO); N-[9-(dichloromethylene)-1,2,3,4-tetrahydro-1,4-methanonaphthalen-5-yl]-3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxamide |
1072957-71-1 |
Acute Tox. 3, Acute Tox. 3, Aquatic Acute 1, Aquatic Chronic 1 |
H331, H301, H400, H410 |
M=100,
M=100 |
|
ATP09 |
| 616-219-00-5 |
fluopyram (ISO); N-{2-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]ethyl}-2-(trifluoromethyl)benzamide |
658066-35-4 |
Aquatic Chronic 2 |
H411 |
|
|
ATP09 |
| 616-220-00-0 |
pencycuron (ISO); 1-[(4-chlorophenyl)methyl]-1-cyclopentyl-3-phenylurea |
66063-05-6 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1,
M=1 |
|
ATP09 |
| 616-221-00-6 |
hexaflumuron (ISO); 1-(3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl)-3-(2,6-difluorobenzoyl)urea |
86479-06-3 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1000, M=10000 |
|
ATP10 |
| 616-222-00-1 |
penthiopyrad (ISO); (RS)-N-[2-(1,3-dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
183675-82-3 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1, M=1 |
|
ATP10 |
| 616-223-00-7 |
carbetamide (ISO); (R)-1-(ethylcarbamoyl)ethyl carbanilate; (2R)-1-(ethylamino)-1-oxopropan-2-yl phenylcarbamate |
16118-49-3 |
Carc. 2, Repr. 1B, Acute Tox. 4, Aquatic Chronic 2 |
H351, H360D, H302, H411 |
|
|
ATP10 |
| 616-224-00-2 |
amisulbrom (ISO); 3-(3-bromo-6-fluoro-2-methylindol-1-ylsulfonyl)-N,N-dimethyl-1H-1,2,4-triazole-1-sulfonamide |
348635-87-0 |
Carc. 2, Eye Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H319, H400, H410 |
M=10, M=10 |
|
ATP13 |
| 616-225-00-8 |
(RS)-2-methoxy-N-methyl-2-[α-(2,5-xylyloxy)-o-tolyl]acetamide; mandestrobin |
173662-97-0 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
M=1, M=10
|
|
ATP14 |
| 616-226-00-3 |
carboxin (ISO); 2-methyl-N-phenyl-5,6-dihydro-1,4-oxathiine-3-carboxamide; 5,6-dihydro-2-methyl-1,4-oxathiine-3-carboxanilide |
5234-68-4 |
STOT RE 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H373 (Kidneys), H317, H400, H410 |
M=1, M=1
|
|
ATP14 |
| 616-227-00-9 |
metaflumizone (ISO); (EZ)-2'-[2-(4-cyanophenyl)-1-(α,α,α -trifluoro-m-tolyl)ethylidene]-[4-(trifluoromethoxy)phenyl]carbanilohydrazide [E-isomer > 90%, Z-isomer <10% relative content] [1] (E)-2'-[2-(4-cyanophenyl)-1-(α,α,α -trifluoro-m-tolyl)ethylidene]-[ |
139968-49-3 [1]
852403-68-0 [2]
|
Repr. 2, Lact., STOT RE 2 |
H361fd, H362, H373 |
|
|
ATP14 |
| 616-228-00-4 |
3-(difluoromethyl)-1-methyl-N-(3',4',5'-trifluorobiphenyl-2-yl) pyrazole-4-carboxamide; fluxapyroxad |
907204-31-3 |
Lact., Aquatic Acute 1, Aquatic Chronic 1 |
H362, H400, H410 |
M=1, M=1 |
|
ATP15 |
| 616-230-00-5 |
N-(hydroxymethyl)acrylamide; methylolacrylamide; [NMA] |
924-42-5 |
Carc. 1B, Muta. 1B, STOT RE 1 |
H350, H340, H372 (peripheral nervous system) |
|
|
ATP15 |
| 616-231-00-0 |
5-fluoro-1,3-dimethyl-N-[2-(4-methylpentan-2-yl) phenyl]-1H-pyrazole-4-carboxamide; 2'-[(RS)-1,3-dimethylbutyl]-5-fluoro-1,3-dimethylpyrazole-4-carboxanilide; penflufen |
494793-67-8 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H400, H410 |
M=1, M=1 |
|
ATP15 |
| 616-232-00-6 |
iprovalicarb (ISO); isopropyl [(2S)-3-methyl-1-{[1-(4- methylphenyl)ethyl]amino}-1-oxobutan-2-yl]carbamate |
140923-17-7 |
Carc. 2 |
H351 |
|
|
ATP15 |
| 616-233-00-1 |
silthiofam (ISO); N-allyl-4,5-dimethyl- 2-(trimethylsilyl)thiophene-3-carboxamide |
175217-20-6 |
STOT RE 2, Aquatic Chronic 2 |
H373, H411 |
|
|
ATP15 |
| 616-234-00-7 |
N-methoxy-N-[1-methyl-2-(2,4,6-trichlorophenyl)-ethyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide; pydiflumetofen |
1228284-64-7 |
Carc. 2,
Repr. 2,
Aquatic Acute 1,
Aquatic Chronic 1 |
H351,
H361f,
H400,
H410 |
M=1,
M=1 |
|
ATP17 |
| 616-235-00-2 |
N-{2-[[1,1’-bi(cyclopropyl)]-2-yl]phenyl}-3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxamide; sedaxane |
874967-67-6 |
Carc. 2, Aquatic Acute 1, Aquatic Chronic 2, |
H351, H400, H411 |
M=1 |
|
ATP17 |
| 616-237-00-3 |
fluopicolide (ISO); 2,6-dichloro-N-[3-chloro-5-(trifluoromethyl)-2-pyridylmethyl]benzamide |
239110-15-7 |
Repr. 2 |
H361d |
|
|
ATP18 |
| 616-238-00-9 |
N-(2-nitrophenyl)phosphoric triamide |
874819-71-3 |
Repr. 1B, STOT RE 2 |
H360Fd, H373 (kidney) |
|
|
ATP18 |
| 616-239-00-4 |
N-(5-chloro-2-isopropylbenzyl)-N-cyclopropyl-3-(difluoromethyl)-5-fluoro-1-methyl-1H-pyrazole-4-carboxamide; isoflucypram |
1255734-28-1 |
Repr. 2, Acute Tox. 4, Skin Sens. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H361f, H332, H317, H400, H410 |
inhalation: ATE = 2,2 mg/L (dusts or mists); M=10, M=1 |
|
ATP18 |
| 616-240-00-X |
Reaction mass of 3-(difluoromethyl)-1-methyl-N-[(1RS,4SR,9RS)-1,2,3,4-tetrahydro-9-isopropyl-1,4-methanonaphthalen-5-yl]pyrazole-4-carboxamide and 3-(difluoromethyl)-1-methyl-N-[(1RS,4SR,9SR)-1,2,3,4-tetrahydro-9-isopropyl-1,4-methanonaphthalen-5-yl]pyrazole-4-carboxamide [%u2265 78% syn isomers %u226415% anti isomers relative content]; isopyrazam |
881685-58-1 |
Carc. 2, Repr. 1B, Skin Sens. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H360D, H317, H400, H410 |
Repr. 1B; H360D: C >= 3%; M = 10, M = 10 |
|
ATP18 |
| 617-001-00-2 |
di-tert-butyl peroxide |
110-05-4 |
Org. Perox. E, Flam. Liq. 2, Muta. 2 |
H242, H225, H341 |
|
|
CLP00/ATP03 |
| 617-002-00-8 |
α,α-dimethylbenzyl hydroperoxide; cumene hydroperoxide |
80-15-9 |
Org. Perox. E, Acute Tox. 3 *, Acute Tox. 4 *, Acute Tox. 4 *, STOT RE 2 *, Skin Corr. 1B, Aquatic Chronic 2 |
H242, H331, H312, H302, H373 **, H314, H411 |
Skin Corr. 1B; H314: C ≥ 10 %, Skin Irrit. 2; H315: 3 % ≤ C < 10 %, Eye Dam. 1; H318: 3 % ≤ C < 10 %, Eye Irrit. 2; H319: 1 % ≤ C < 3 %, STOT SE 3; H335: C < 10 % |
|
CLP00/ |
| 617-003-00-3 |
dilauroyl peroxide |
105-74-8 |
Org. Perox. D |
H242 |
|
|
CLP00/ |
| 617-004-00-9 |
1,2,3,4-tetrahydro-1-naphthyl hydroperoxide |
771-29-9 |
Org. Perox. D, Acute Tox. 4 *, Skin Corr. 1B, Aquatic Acute 1, Aquatic Chronic 1 |
H242, H302, H314, H400, H410 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 617-006-00-X |
bis(α,α-dimethylbenzyl) peroxide |
80-43-3 |
Org. Perox. F, Repr. 1B, Skin Irrit. 2, Eye Irrit. 2, Aquatic Chronic 2 |
H242, H360D, H315, H319, H411 |
|
|
CLP00/ATP15 |
| 617-007-00-5 |
tert-butyl α,α-dimethylbenzyl peroxide |
3457-61-2 |
Org. Perox. E Skin Irrit. 2, Aquatic Chronic 2, |
H242, H315, H411 |
|
|
CLP00/ |
| 617-008-00-0 |
dibenzoyl peroxide; benzoyl peroxide |
94-36-0 |
Org. Perox. B, Eye Irrit. 2, Skin Sens. 1 |
H241, H319, H317 |
|
|
CLP00/ATP01 |
| 617-010-00-1 |
1-hydroperoxycyclohexyl 1-hydroxycyclohexyl peroxide; [1] 1,1'-dioxybiscyclohexan-1-ol; [2] cyclohexylidene hydroperoxide; [3] cyclohexanone, peroxide [4] |
78-18-2 [1], 2407-94-5 [2], 2699-11-8 [3], 12262-58-7 [4] |
Org. Perox. A, Skin Corr. 1B, Acute Tox. 4 * |
H242, H314, H302 |
STOT SE 3; H335: C ≥ 5 % |
C |
CLP00/ATP01 |
| 617-010-01-9 |
1-hydroperoxycyclohexyl 1-hydroxycyclohexyl peroxide; [1] 1,1'-dioxybiscyclohexan-1-ol; [2] cyclohexylidene hydroperoxide; [3] cyclohexanone, peroxide; [4] [≤ 91 % solution] |
78-18-2 [1], 2407-94-5 [2], 2699-11-8 [3], 12262-58-7 [4], - |
Org. Perox. C, Acute Tox. 4 *, Skin Corr. 1B |
H242, H302, H314 |
STOT SE 3; H335: C ≥ 5 % |
C T |
CLP00/ |
| 617-012-00-2 |
8-p-menthyl hydroperoxide; p-menthane hydroperoxide |
80-47-7 |
Org. Perox. D, Skin Corr. 1B, Acute Tox. 4 * |
H242, H314, H332 |
STOT SE 3; H335: C ≥ 5 % |
|
CLP00/ |
| 617-013-00-8 |
O,O-tert-butyl O-docosyl monoperoxyoxalate |
116753-76-5 |
Org. Perox. C ****, Aquatic Acute 1, Aquatic Chronic 1 |
H242, H400, H410 |
|
|
CLP00/ |
| 617-014-00-3 |
6-(nonylamino)-6-oxo-peroxyhexanoic acid |
104788-63-8 |
Org. Perox. C ****, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1 |
H242, H318, H317, H400 |
|
|
CLP00/ |
| 617-015-00-9 |
bis(4-methylbenzoyl)peroxide |
895-85-2 |
Org. Perox. B ****, Aquatic Acute 1, Aquatic Chronic 1 |
H241, H400, H410 |
|
|
CLP00/ |
| 617-016-00-4 |
3-hydroxy-1,1-dimethylbutyl 2-ethyl-2-methylheptaneperoxoate |
- |
Org. Perox. C ****, Flam. Liq. 3, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H242, H226, H315, H400, H410 |
|
|
CLP00/ |
| 617-017-00-X |
reaction mass of: 2,2'-bis(tert-pentylperoxy)-p-diisopropylbenzene; 2,2'-bis(tert-pentylperoxy)-m-diisopropylbenzene |
32144-25-5 |
Org. Perox. D, Aquatic Chronic 4 |
H242, H413 |
|
T |
CLP00/ATP01 |
| 617-018-00-5 |
reaction mass of: 1-methyl-1-(3-(1-methylethyl)phenyl)ethyl-1-methyl-1-phenylethylperoxide, 63 % by weight; 1-methyl-1-(4-(1-methylethyl)phenyl)ethyl-1-methyl-1-phenylethylperoxide, 31 % by weight |
71566-50-2 |
Org. Perox. C ****, Aquatic Chronic 2 |
H242, H411 |
|
T |
CLP00/ |
| 617-019-00-0 |
6-(phthalimido)peroxyhexanoic acid |
128275-31-0 |
Org. Perox. D, Eye Dam. 1, Aquatic Acute 1 |
H242, H318, H400 |
|
T |
CLP00/ |
| 617-020-00-6 |
1,3-di(prop-2,2-diyl)benzene bis(neodecanoylperoxide) |
117663-11-3 |
Flam. Liq. 3, Org. Perox. D ****, Aquatic Chronic 2 |
H226, H242, H411 |
|
|
CLP00/ |
| 617-021-00-1 |
methylethylketone peroxide trimer |
- |
Org. Perox. B****, Asp. Tox. 1, Skin Irrit. 2, Skin Sens. 1 |
H241, H304, H315, H317 |
|
|
ATP01/ |
| 617-022-00-7 |
reaction mass of: 1,2-dimethylpropylidene dihydroperoxide; dimethyl 1,2-benzenedicarboxylate |
- |
Org. Perox. C, Acute Tox. 4 *, Skin Corr. 1B, Skin Sens. 1, Aquatic Chronic 2 |
H242, H302, H314, H317, H411 |
|
|
ATP01/ |
| 617-023-00-2 |
tert-butyl hydroperoxide |
75-91-2 |
Muta. 2 |
H341 |
|
|
ATP09 |
| 647-001-00-8 |
glucosidase, β- |
9001-22-3 |
Resp. Sens. 1 |
H334 |
|
|
CLP00/ |
| 647-002-00-3 |
cellulase |
9012-54-8 |
Resp. Sens. 1 |
H334 |
|
|
CLP00/ |
| 647-003-00-9 |
cellobiohydrolase, exo- |
37329-65-0 |
Resp. Sens. 1 |
H334 |
|
|
CLP00/ |
| 647-004-00-4 |
cellulases with the exception of those specified elsewhere in this Annex |
- |
Resp. Sens. 1 |
H334 |
|
A |
CLP00/ |
| 647-005-00-X |
bromelain, juice |
9001-00-7 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1 |
H319, H335, H315, H334 |
|
|
CLP00/ |
| 647-006-00-5 |
ficin |
9001-33-6 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1 |
H319, H335, H315, H334 |
|
|
CLP00/ |
| 647-007-00-0 |
papain |
9001-73-4 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1 |
H319, H335, H315, H334 |
|
|
CLP00/ |
| 647-008-00-6 |
pepsin A |
9001-75-6 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1 |
H319, H335, H315, H334 |
|
|
CLP00/ |
| 647-009-00-1 |
rennin |
9001-98-3 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1 |
H319, H335, H315, H334 |
|
|
CLP00/ |
| 647-010-00-7 |
trypsin |
9002-07-7 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1 |
H319, H335, H315, H334 |
|
|
CLP00/ |
| 647-011-00-2 |
chymotrypsin |
9004-07-3 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1 |
H319, H335, H315, H334 |
|
|
CLP00/ |
| 647-012-00-8 |
subtilisin |
9014-01-1 |
STOT SE 3, Skin Irrit. 2, Eye Dam. 1, Resp. Sens. 1 |
H335, H315, H318, H334 |
|
|
CLP00/ |
| 647-013-00-3 |
proteinase, microbial neutral |
9068-59-1 |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1 |
H319, H335, H315, H334 |
|
|
CLP00/ |
| 647-014-00-9 |
proteases with the exception of those specified elsewhere in this Annex |
- |
Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Resp. Sens. 1 |
H319, H335, H315, H334 |
|
|
CLP00/ |
| 647-015-00-4 |
amylase, α- |
9000-90-2 |
Resp. Sens. 1 |
H334 |
|
|
CLP00/ |
| 647-016-00-X |
amylases with the exception of those specified elsewhere in this Annex |
- |
Resp. Sens. 1 |
H334 |
|
|
CLP00/ |
| 647-017-00-5 |
laccase |
80498-15-3 |
Resp. Sens. 1 |
H334 |
|
|
ATP01/ |
| 648-001-00-0 |
Distillates (coal tar), benzole fraction; Light Oil; [A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists of hydrocarbons having carbon numbers primarily in the range of C4 to C10 and distilling in the approximate |
84650-02-2 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 648-002-00-6 |
Tar oils, brown-coal; Light Oil; [The distillate from lignite tar boiling in the range of approximately 80°C to 250°C (176°F to 482°F). Composed primarily of aliphatic and aromatic hydrocarbons and monobasic phenols.] |
94114-40-6 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-003-00-1 |
Benzol forerunnings (coal); Light Oil Redistillate, low boiling; [The distillate from coke oven light oil having an approximate distillation range below 100°C (212°F). Composed primarily of C4 to C6 aliphatic hydrocarbons.] |
65996-88-5 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-004-00-7 |
Distillates (coal tar), benzole fraction, BTX-rich; Light Oil Redistillate, low boiling; [A residue from the distillation of crude benzole to remove benzole fronts. Composed primarily of benzene, toluene and xylenes boiling in the range of approximatel |
101896-26-8 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-005-00-2 |
Aromatic hydrocarbons, C6-10, C8-rich; Light Oil Redistillate, low boiling |
90989-41-6 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-006-00-8 |
Solvent naphtha (coal), light; Light Oil Redistillate, low boiling |
85536-17-0 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-007-00-3 |
Solvent naphtha (coal), xylene-styrene cut; Light Oil Redistillate, intermediate boiling |
85536-20-5 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-008-00-9 |
Solvent naphtha (coal), coumarone-styrene contg.; Light Oil Redistillate, intermediate boiling |
85536-19-2 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-009-00-4 |
Naphtha (coal), distn. residues; Light Oil Redistillate, high boiling; [The residue remaining from the distillation of recovered naphtha. Composed primarily of naphthalene and condensation products of indene and styrene.] |
90641-12-6 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-010-00-X |
Aromatic hydrocarbons, C8; Light Oil Redistillate, high boiling |
90989-38-1 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-012-00-0 |
Aromatic hydrocarbons, C8-9, hydrocarbon resin polymn. by-product; Light Oil Redistillate, high boiling; [A complex combination of hydrocarbons obtained from the evaporation of solvent under vacuum from polymerized hydrocarbon resin. It consists predom |
91995-20-9 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-013-00-6 |
Aromatic hydrocarbons, C9-12, benzene distn.; Light Oil Redistillate, high boiling |
92062-36-7 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-014-00-1 |
Extract residues (coal), benzole fraction alk., acid ext.; Light Oil Extract Residues, low boiling; [The redistillate from the distillate, freed of tar acids and tar bases, from bituminous coal high temperature tar boiling in the approximate range of 90 |
91995-61-8 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-015-00-7 |
Extract residues (coal tar), benzole fraction alk., acid ext.; Light Oil Extract Residues, low boiling; [A complex combination of hydrocarbons obtained by the redistillation of the distillate of high temperature coal tar (tar acid and tar base free). I |
101316-63-6 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-016-00-2 |
Extract residues (coal), benzole fraction acid; Light Oil Extract Residues, low boiling; [An acid sludge by-product of the sulfuric acid refining of crude high temperature coal. Composed primarily of sulfuric acid and organic compounds.] |
93821-38-6 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-017-00-8 |
Extract residues (coal), light oil alk., distn. overheads; Light Oil Extract Residues, low boiling; [The first fraction from the distillation of aromatic hydrocarbons, coumarone, naphthalene and indene rich prefractionator bottoms or washed carbolic oil |
90641-02-4 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-018-00-3 |
Extract residues (coal), light oil alk., acid ext., indene fraction; Light Oil Extract Residues, intermediate boiling |
101316-62-5 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-019-00-9 |
Extract residues (coal), light oil alk., indene naphtha fraction; Light Oil Extract Residues, high boiling; [The distillate from aromatic hydrocarbons, coumarone, naphthalene and indene rich prefractionator bottoms or washed carbolic oils, having an app |
90641-03-5 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-020-00-4 |
Solvent naphtha (coal); Light Oil Extract Residues, high boiling; [The distillate from either high temperature coal tar, coke oven light oil, or coal tar oil alkaline extract residue having an approximate distillation range of 130°C to 210°C (266°F to 4 |
65996-79-4 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-021-00-X |
Distillates (coal tar), light oils, neutral fraction; Light Oil Extract Residues, high boiling; [A distillate from the fractional distillation of high temperature coal tar. Composed primarily of alkyl-substituted one ring aromatic hydrocarbons boiling in |
101794-90-5 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-022-00-5 |
Distillates (coal tar), light oils, acid exts.; Light Oil Extract Residues, high boiling; [This oil is a complex reaction mass of aromatic hydrocarbons, primarily indene, naphthalene, coumarone, phenol, and o-, m- and p-cresol and boiling in the range of |
90640-87-2 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-023-00-0 |
Distillates (coal tar), light oils; Carbolic Oil; [A complex combination of hydrocarbons obtained by distillation of coal tar. It consists of aromatic and other hydrocarbons, phenolic compounds and aromatic nitrogen compounds and distills at the approxim |
84650-03-3 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-024-00-6 |
Tar oils, coal; Carbolic Oil; [The distillate from high temperature coal tar having an approximate distillation range of 130°C to 250°C (266°F to 410°F). Composed primarily of naphthalene, alkylnaphthalenes, phenolic compounds, and aromatic nitrogen bas |
65996-82-9 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-026-00-7 |
Extract residues (coal), light oil alk., acid ext.; Carbolic Oil Extract Residue; [The oil resulting from the acid washing of alkali-washed carbolic oil to remove the minor amounts of basic compounds (tar bases). Composed primarily of indene, indan and |
90641-01-3 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-027-00-2 |
Extract residues (coal), tar oil alk.; Carbolic Oil Extract Residue; [The residue obtained from coal tar oil by an alkaline wash such as aqueous sodium hydroxide after the removal of crude coal tar acids. Composed primarily of naphthalenes and aromatic |
65996-87-4 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-028-00-8 |
Extract oils (coal), light oil; Acid Extract; [The aqueous extract produced by an acidic wash of alkali-washed carbolic oil. Composed primarily of acid salts of various aromatic nitrogen bases including pyridine, quinoline and their alkyl derivatives.] |
90640-99-6 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-029-00-3 |
Pyridine, alkyl derivs.; Crude Tar Bases; [The complex combination of polyalkylated pyridines derived from coal tar distillation or as high-boiling distillates approximately above 150°C (302°F) from the reaction of ammonia with acetaldehyde, formaldehyd |
68391-11-7 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-030-00-9 |
Tar bases, coal, picoline fraction; Distillate Bases; [Pyridine bases boiling in the range of approximately 125°C to 160°C (257°F 320°F) obtained by distillation of neutralized acid extract of the base-containing tar fraction obtained by the distillatio |
92062-33-4 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-031-00-4 |
Tar bases, coal, lutidine fraction; Distillate Bases |
91082-52-9 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-032-00-X |
Extract oils (coal), tar base, collidine fraction; Distillate Bases; [The extract produced by the acidic extraction of bases from crude coal tar aromatic oils, neutralization, and distillation of the bases. Composed primarily of collidines, aniline, tol |
68937-63-3 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-033-00-5 |
Tar bases, coal, collidine fraction; Distillate Bases; [The distillation fraction boiling in the range of approximately 181 °C to 186 °C (356 °F to 367 °F) from the crude bases obtained from the neutralized, acid-extracted base-containing tar fractions |
92062-28-7 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-034-00-0 |
Tar bases, coal, aniline fraction; Distillate Bases; [The distillation fraction boiling in the range of approximately 180 °C to 200 °C (356 °F to 392 °F) from the crude bases obtained by dephenolating and debasing the carbolated oil from the distillatio |
92062-27-6 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-035-00-6 |
Tar bases, coal, toluidine fraction; Distillate Bases |
91082-53-0 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-036-00-1 |
Distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, mixed with high-temp. coal tar, indene fraction; Redistillates; [A complex combination of hydrocarbons obtained as a redistillate from the fractional distillation of bituminous coal high tempe |
91995-31-2 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-037-00-7 |
Distillates (coal), coal tar-residual pyrolysis oils, naphthalene oils; Redistillates; [The redistillate obtained from the fractional distillation of bituminous coal high temperature tar and pyrolysis residual oils and boiling in the range of approximat |
91995-35-6 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-038-00-2 |
Extract oils (coal), coal tar-residual pyrolysis oils, naphthalene oil, redistillate; Redistillates; [The redistillate from the fractional distillation of dephenolated and debased methylnaphthalene oil obtained from bituminous coal high temperature tar |
91995-66-3 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-039-00-8 |
Extract oils (coal), coal tar-residual pyrolysis oils, naphthalene oils; Redistillates; [A neutral oil obtained by debasing and dephenolating the oil obtained from the distillation of high temperature tar and pyrolysis residual oils which has a boiliing |
122070-79-5 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-040-00-3 |
Extract oils (coal), coal tar residual pyrolysis oils, naphthalene oil, distn. residues; Redistillates; [Residue from the distillation of dephenolated and debased methylnaphthalene oil (from bituminous coal tar and pyrolysis residual oils) with a boilin |
122070-80-8 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-041-00-9 |
Absorption oils, bicyclo arom. and heterocyclic hydrocarbon fraction; Wash Oil Redistillate; [A complex combination of hydrocarbons obtained as a redistillate from the distillation of wash oil. It consists predominantly of 2-ringed aromatic and heterocy |
101316-45-4 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-042-00-4 |
Distillates (coal tar), upper, fluorene-rich; Wash Oil Redistillate; [A complex combination of hydrocarbons obtained by the crystallization of tar oil. It consists af aromatic and polycyclic hydrocarbons primarily fluorene and some acenaphthene.] |
84989-11-7 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-043-00-X |
Creosote oil, acenaphthene fraction, acenaphthene-free; Wash Oil Redistillate; [The oil remaining after removal by a crystallization process of acenaphthene from acenaphthene oil from coal tar. Composed primarily of naphthalene and alkylnaphthalenes.] |
90640-85-0 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-044-00-5 |
Distillates (coal tar), heavy oils; Heavy Anthracene Oil; [Distillate from the fractional distillation of coal tar of bituminous coal, with boiling range of 240 °C to 400 °C (464 °F to 752 °F). Composed primarily of tri- and polynuclear hydrocarbons and |
90640-86-1 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 648-045-00-0 |
Distillates (coal tar), upper; Heavy Anthracene Oil; [The distillate from coal tar having an approximate distillation range of 220 °C to 450 °C (428 °F to 842 °F). Composed primarily of three to four membered condensed ring aromatic hydrocarbons and oth |
65996-91-0 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-046-00-6 |
Anthracene oil, acid ext.; Anthracene Oil Extract Residue; [A complex combination of hydrocarbons from the base-freed fraction obtained from the distillation of coal tar and boiling in the range of approximately 325 °C to 365 °C (617 °F to 689 °F). It c |
91995-14-1 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-047-00-1 |
Distillates (coal tar); Heavy Anthracene Oil; [The distillate from coal tar having an approximate distillation range of 100 °C to 450 °C (212 °F to 842 °F). Composed primarily of two to four membered condensed ring aromatic hydrocarbons, phenolic compou |
65996-92-1 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-048-00-7 |
Distillates (coal tar), pitch, heavy oils; Heavy Anthracene Oil; [The distillate from the distillation of the pitch obtained from bituminous high temperature tar. Composed primarily of tri- and polynuclear aromatic hydrocarbons and boiling in the range |
91995-51-6 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-049-00-2 |
Distillates (coal tar), pitch; Heavy Anthracene Oil; [The oil obtained from condensation of the vapors from the heat treatment of pitch. Composed primarily of two- to four-ring aromatic compounds boiling in the range of 200 °C to greater than 400 °C (39 |
101316-49-8 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-050-00-8 |
Distillates (coal tar), heavy oils, pyrene fraction; Heavy Anthracene Oil Redistillate; [The redistillate obtained from the fractional distillation of pitch distillate boiling in the range of approximately 350 °C to 400 °C (662 °F to 752 °F). Consists p |
91995-42-5 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-051-00-3 |
Distillates (coal tar), pitch, pyrene fraction; Heavy Anthracene Oil Redistillate; [The redistillate obtained from the fractional distillation of pitch distillate and boiling in the range of approximately 380 °C to 410 °C (7160 to 770 °F). Composed prim |
91995-52-7 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-052-00-9 |
Paraffin waxes (coal), brown-coal high-temp. tar, carbon-treated; Coal Tar Extract; [A complet combination of hydrocarbons obtained by the treatment of lignite carbonization tar with activated carbon for removal of trace constituents and impurities. It |
97926-76-6 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-053-00-4 |
Paraffin waxes (coal), brown-coal high-temp tar, clay-treated; Coal Tar Extract; [A complex combination of hydrocarbons obtained by the treatment of lignite carbonization tar with bentonite for removal of trace constituents and impurities. It consists p |
97926-77-7 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-054-00-X |
Pitch; Pitch |
61789-60-4 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-055-00-5 |
pitch, coal tar, high-temp.,; [The residue from the distillation of high temperature coal tar. A black solid with an approximate softening point from 30 °C to 180 °C (86 °F to 356 °F). Composed primarily of a complex mixture of three or more membered cond |
65996-93-2 |
Carc. 1A, Muta. 1B, Repr. 1B |
H350, H340, H360FD |
|
|
CLP00/ATP14 |
| 648-056-00-0 |
Pitch, coal tar, high-temp., heat-treated; Pitch; [The heat treated residue from the distillation of high temperature coal tar. A black solid with an approximate softening point from 80 °C to 180 °C (176 °F to 356 °F). Composed primarily of a complex mi |
121575-60-8 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-057-00-6 |
Pitch, coal tar, high-temp., secondary; Pitch Redistillate; [The residue obtained during the distillation of high boiling fractions from bituminous coal high temperature tar and/or pitch coke oil, with a softening point of 140 °C to 170 °C (284 °F to 39 |
94114-13-3 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-058-00-1 |
Residues (coal tar), pitch distn.; Pitch Redistillate; [Residue from the fractional distillation of pitch distillate boiling in the range of approximately 400 °C to 470 °C (752 °F to 846 °F). Composed primarily of polynuclear aromatic hydrocarbons, and |
92061-94-4 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-059-00-7 |
Tar, coal, high-temp., distn. and storage residues; Coal Tar Solids Residue; [Coke- and ash-containing solid residues that separate on distillation and thermal treatment of bituminous coal high temperature tar in distillation installations and storage v |
92062-20-9 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-060-00-2 |
Tar, coal, storage residues; Coal Tar Solids Residue; [The deposit removed from crude coal tar storages. Composed primarily of coal tar and carbonaceous particulate matter.] |
91082-50-7 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-061-00-8 |
Tar, coal, high-temp., residues; Coal Tar Solids Residue; [Solids formed during the coking of bituminous coal to produce crude bituminous coal high temperature tar. Composed primarily of coke and coal particles, highly aromatized compounds and mineral s |
100684-51-3 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-062-00-3 |
Tar, coal, high-temp., high-solids; Coal Tar Solids Residue; [The condensation product obtained by cooling, to approximately ambient temperature, the gas evolved in the high temperature (greater than 700 °C (1292 °F)) destructive distillation of coal. C |
68990-61-4 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-063-00-9 |
Waste solids, coal-tar pitch coking; Coal Tar Solids Residue; [The combination of wastes formed by the coking of bituminous coal tar pitch. It consists predominantly of carbon.] |
92062-34-5 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-064-00-4 |
Extract residues (coal), brown; Coal Tar Extract; [The residue from extraction of dried coal.] |
91697-23-3 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-065-00-X |
Paraffin waxes (coal), brown-coal-high-temp. tar; Coal Tar Extract; [A complex combination of hydrocarbons obtained from lignite carbonization tar by solvent crystallisation (solvent deoiling), by sweating or an adducting process. It consists predominan |
92045-71-1 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-066-00-5 |
Paraffin waxes (coal), brown-coal-high-temp. tar, hydrotreated; Coal Tar Extract; [A complex combination of hydrocarbons obtained from lignite carbonization tar by solvent crystallisation (solvent deoiling), by sweating or an adducting process treated w |
92045-72-2 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-067-00-0 |
Paraffin waxes (coal), brown-coal high-temp tar, silicic acid-treated; Coal Tar Extract; [A complex combination of hydrocarbons obtained by the treatment of lignite carbonization tar with silicic acid for removal of trace constituents and impurities. It |
97926-78-8 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-068-00-6 |
Tar, coal, low-temp., distn. residues; Tar Oil, intermediate boiling; [Residues from fractional distillation of low temperature coal tar to remove oils that boil in a range up to approximately 300 °C (572 °F). Composed primarily of aromatic compounds.] |
101316-85-2 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-069-00-1 |
Pitch, coal tar, low-temp; Pitch Residue; [A complex black solid or semi-solid obtained from the distillation of a low temperature coal tar. It has a softening point within the approximate range of 40 °C to 180 °C (104 °F to 356 °F). Composed primarily |
90669-57-1 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-070-00-7 |
Pitch, coal tar, low-temp., oxidized; Pitch Residue, oxidised; [The product obtained by air-blowing, at elevated temperature, low-temperature coal tar pitch. It has a softening-point within the approximate range of 70 °C to 180 °C (158 °F to 356 °F). Co |
90669-59-3 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-071-00-2 |
Pitch, coal tar, low-temp., heat-treated; Pitch Residue, oxidised; Pitch Residue, heat-treated; [A complex black solid obtained by the heat treatment of low temperature coal tar pitch. It has a softening point within the approximate range of 50 °C to 1 |
90669-58-2 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-072-00-8 |
Distillates (coal-petroleum), condensed-ring arom; Distillates; [The distillate from a mixture of coal and tar and aromatic petroleum streams having an approximate distillation range of 220 °C to 450 °C (428 °F to 842 °F). Composed primarily of 3- to 4- |
68188-48-7 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-073-00-3 |
Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene-polypropylene pyrolysis-derived; Pyrolysis Products; [A complex combination hydrocarbons obtained from mixed coal tar pitch-polyethylene-polypropylene pyrolysis. Composed prima |
101794-74-5 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-074-00-9 |
Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene pyrolysis-derived; Pyrolysis Products; [A complex combination of hydrocarbons obtained from mixed coal tar pitch-polyethylene pyrolysis. Composed primarily of polycyclic aromat |
101794-75-6 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-075-00-4 |
Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polystyrene pyrolysis-derived; Pyrolysis Products; [A complex combination of hydrocarbons obtained from mixed coal tar pitch-polystyrene pyrolysis. Composed primarily of polycyclic aromatic |
101794-76-7 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-076-00-X |
Pitch, coal tar-petroleum; Pitch Residues; [The residue from the distillation of a mixture of coal tar and aromatic petroleum streams. A solid with a softening point from 40 °C to 180 °C (140 °F to 356 °F). Composed primarily of a complex combination of |
68187-57-5 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-077-00-5 |
Phenanthrene, distn. residues; Heavy Anthracene Oil Redistillate; [Residue from the distillation of crude phenanthrene boiling in the approximate range of 340 °C to 420 °C (644 °F to 788 °F). It consists predominantly of phenanthrene, anthracene and car |
122070-78-4 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-078-00-0 |
Distillates (coal tar), upper, fluorene-free; Wash Oil Redistillate; [A complex combination of hydrocarbons obtained by the crystallization of tar oil. It consists of aromatic polycyclic hydrocarbons, primarily diphenyl, dibenzofuran and acenaphthene.] |
84989-10-6 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-079-00-6 |
Anthracene oil; Anthracene oil; [A complex combination of polycyclic aromatic hydrocarbons obtained from coal tar having an approximate distillation range of 300 °C ot 400 °C (572 °F to 752 °F). Composed primarily of phenanthrene, anthracene and carbazo |
90640-80-5 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-080-00-1 |
Residues (coal tar), creosote oil distn.; Wash Oil Redistillate; [The residue from the fractional distillation of wash oil boiling in the approximate range of 270°C to 330°C (518°F to 626°F). It consists predominantly of dinuclear aromatic and heterocyc |
92061-93-3 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-081-00-7 |
Tar, coal; Coal tar; [The by-product from the destructive distillation of coal. Almost black semisolid. A complex combination of aromatic hydro-carbons, phenolic compounds, nitrogen bases and thiophene.] |
8007-45-2 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 648-082-00-2 |
Tar, coal, high-temp.; Coal tar; [The condensation product obtained by cooling, to approximately ambient temperature, the gas evolved in the high temperature (greater than 700 °C (1292 °F)) destructive distillation of coal. A black viscous liquid denser |
65996-89-6 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 648-083-00-8 |
Tar, coal, low-temp.; Coal oil; [The condensation product obtained by cooling, to approximately ambient temperature, the gas evolved in low temperature (less than 700 °C (1292 °F)) destructive distillation of coal. A black viscous liquid denser than wat |
65996-90-9 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 648-084-00-3 |
Distillates (coal), coke-oven light oil, naphthalene cut; Naphthalene Oil; [The complex combination of hydrocarbons obtained from prefractionation (continuous distillation) of coke oven light oil. It consists predominantly of naphthalene, coumarone and |
85029-51-2 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-085-00-9 |
Distillates (coal tar), naphthalene oils; Naphthalene Oil; [A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists primarily of aromatic and other hydrocarbons, phenolic compounds and aromatic nitrogen compounds and |
84650-04-4 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-086-00-4 |
Distillates (coal tar), naphthalene oils, naphthalene-low; Naphthalene Oil Redistillate; [A complex combination of hydrocarbons obtained by crystallization of naphthalene oil. Composed primarily of naphthalene, alkyl naphthalenes and phenolic compounds |
84989-09-3 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-087-00-X |
Distillates (coal tar), naphthalene oil crystn. mother liquor; Naphthalene Oil Redistillate; [A complex combination of organic compounds obtained as a filtrate from the crystallization of the naphthalene fraction from coal tar and boiling in the range o |
91995-49-2 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-088-00-5 |
Extract residues (coal), naphthalene oil, alk.; Naphthalene Oil Extract Residue; [A complex combination of hydrocarbons obtained from the alkali washing of naphthalene oil to remove phenolic compounds (tar acids). It is composed of naphthalene and alky |
121620-47-1 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-089-00-0 |
Extract residues (coal), naphthalene oil, alk., naphthalene-low; Naphthalene Oil Extract Residue; [A complex combination of hydrocarbons remaining after the removal of naphthalene from alkali-washed naphthalene oil by a crystallization process. It is c |
121620-48-2 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-090-00-6 |
Distillates (coal tar), naphthalene oils, naphthalene-free, alk. exts.; Naphthalene Oil Extract Residue; [The oil remaining after the removal of phenolic compounds (tar acids) from drained naphthalene oil by an alkali wash. Composed primarily of naphth |
90640-90-7 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-091-00-1 |
Extract residues (coal), naphthalene oil alk., distn. overheads; Naphthalene Oil Extract Residue; [The distillate from alkali-washed naphthalene oil having an approximate distillation range of 180°C to 220°C (356°F to 428°F). Composed primarily of naph |
90641-04-6 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-092-00-7 |
Distillates (coal tar), naphthalene oils, methylnaphthalene fraction; Methylnaphthalene Oil; [A distillate from the fractional distillation of high temperature coal tar. Composed primarily of substituted two ring aromatic hydrocarbons and aromatic nitr |
101896-27-9 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-093-00-2 |
Distillates (coal tar), naphthalene oils, indole-methylnaphthalene fraction; Methylnaphthalene Oil; [A distillate from the fractional distillation of high temperature coal tar. Composed primarily of indole and methylnaphthalene boiling in the range of |
101794-91-6 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-094-00-8 |
Distillates (coal tar), naphthalene oils, acid exts.; Methylnaphthalene Oil Extract Residue; [A complex combination of hydrocarbons obtained by debasing the methylnaphthalene fraction obtained by the distillation of coal tar and boiling in the range of |
91995-48-1 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-095-00-3 |
Extract residues (coal), naphthalene oil alk., distn. residues; Methylnaphthalene Oil Extract Residue; [The residue from the distillation of alkali-washed naphthalene oil having an approximate distillation range of 220°C to 300°C (428°F to 572°F). Comp |
90641-05-7 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-096-00-9 |
Extract oils (coal), acidic, tar-base free; Methylnaphthalene Oil Extract Residue; [The extract oil boiling in the range of approximately 220°C to 265°C (428°F to 509°F) from coal tar alkaline extract residue produced by an acidic wash such as aqueous s |
84989-12-8 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-097-00-4 |
Distillates (coal tar), benzole fraction, distn. residues; Wash Oil; [A complex combination of hydrocarbons obtained from the distillation of crude benzole (high temperature coal tar). It may be a liquid with the approximate distillation range of 150°C |
121620-46-0 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-098-00-X |
Creosote oil, acenaphthene fraction; Wash Oil; [A complex combination of hydrocarbons produced by the distillation of coal tar and boiling in the range of approximately 240°C to 280°C (464°F to 536°F). Composed primarily of acenaphthene, naphthalene and |
90640-84-9 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-099-00-5 |
Creosote oil; [A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists primarily of aromatic hydrocarbons and may contain appreciable quantities of tar acids and tar bases. It distills at the approximate range of 200°C |
61789-28-4 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-100-00-9 |
Creosote oil, high-boiling distillate; Wash Oil; [The high-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal which is further refined to remove excess crystalline salts. It consists primarily of creosote o |
70321-79-8 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-101-00-4 |
Creosote; [The distillate of coal tar produced by the high temperature carbonization of bituminous coal. It consists primarily of aromatic hydrocarbons, tar acids and tar bases.] |
8001-58-9 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 648-102-00-X |
Extract residues (coal), creosote oil acid; Wash Oil Extract Residue; [A complex combination of hydrocarbons from the base-freed fraction from the distillation of coal tar, boiling in the range of approximately 250°C to 280°C (482°F to 536°F). It consis |
122384-77-4 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-103-00-5 |
Anthracene oil, anthracene paste; Anthracene Oil Fraction; [The anthracene-rich solid obtained by the crystallization and centrifuging of anthracene oil. It is composed primarily of anthracene, carbazole and phenanthrene.] |
90640-81-6 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-104-00-0 |
Anthracene oil, anthracene-low; Anthracene Oil Fraction; [The oil remaining after the removal, by a crystallization process, of an anthracene-rich solid (anthracene paste) from anthracene oil. It is composed primarily of two, three and four membered ar |
90640-82-7 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-105-00-6 |
Residues (coal tar), anthracene oil distn.; Anthracene Oil Fraction; [The residue from the fraction distillation of crude anthracene boiling in the approximate range of 340°C to 400°C (644°F to 752°F). It consists predominantly of tri- and polynuclear |
92061-92-2 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-106-00-1 |
Anthracene oil, anthracene paste, anthracene fraction; Anthracene Oil Fraction; [A complex combination of hydrocarbons from the distillation of anthracene obtained by the crystallization of anthracene oil from bituminous high temperature tar and boiling |
91995-15-2 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-107-00-7 |
Anthracene oil, anthracene paste, carbazole fraction; Anthracene Oil Fraction; [A complex combination of hydrocarbons from the distillation of anthracene obtained by crystallization of anthracene oil from bituminous coal high temperature tar and boiling |
91995-16-3 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-108-00-2 |
Anthracene oil, anthracene paste, distn. lights; Anthracene Oil Fraction; [A complex combination of hydrocarbons from the distillation of anthracene obtained by crystallization of anthracene oil from bituminous high temperature tar and boiling in the ra |
91995-17-4 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-109-00-8 |
Tar oils, coal, low-temp.; Tar Oil, high boiling; [A distillate from low-temperature coal tar. Composed primarily of hydrocarbons, phenolic compounds and aromatic nitrogen bases boiling in the range of approximately 160°C to 340°C (320°F to 644°F).] |
101316-87-4 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-110-00-3 |
Extract residues (coal), low temp. coal atar alk.; [The residue from low temperature coal tar oils after an alkaline wash, such as aqueous sodium hydroxide, to remove crude coal tar acids. Composed primarily of hydrocarbons and aromatic nitrogen bases.] |
122384-78-5 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-111-00-9 |
Phenols, ammonia liquor ext.; Alkaline Extract; [The combination of phenols extracted, using isobutyl acetate, from the ammonia liquor condensed from the gas evolved in low-temperature (less than 700°C (1292°F)) destructive distillation of coal. It con |
84988-93-2 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-112-00-4 |
Distillates (coal tar), light oils, alk. exts.; Alkaline Extract; [The aqueous extract from carbolic oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] |
90640-88-3 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-113-00-X |
Extracts, coal tar oil alk.; Alkaline Extract; [The extract from coal tar oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] |
65996-83-0 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-114-00-5 |
Distillates (coal tar), naphthalene oils, alk. exts.; Alkaline Extract; [The aqueous extract from naphthalene oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] |
90640-89-4 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-115-00-0 |
Extract residues (coal), tar oil alk., carbonated, limed; Crude Phenols; [The product obtained by treatment of coal tar oil alkaline extract with CO2 and CaO. Composed primarily of CaCO3, Ca(OH)2, Na2CO3 and other organic and inorganic impurities.] |
90641-06-8 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-116-00-6 |
Tar acids, coal, crude; Crude Phenols; [The reaction product obtained by neutralizing coal tar oil alkaline extract with an acidic solution, such as aqueous sulfuric acid, or gaseous carbon dioxide, to obtain the free acids. Composed primarily of tar a |
65996-85-2 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-117-00-1 |
Tar acids, brown-coal, crude; Crude Phenols; [An acidified alkaline extract of brown coal tar distillate. Composed primarily of phenol and phenol homologs.] |
101316-86-3 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-118-00-7 |
Tar acids, brown-coal gasification; Crude Phenols; [A complex combination of organic compounds obtained from brown coal gasification. Composed primarily of C6-10 hydroxy aromatic phenols and their homologs.] |
92062-22-1 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-119-00-2 |
Tar acids, distn. residues; Distillate Phenols; [A residue from the distillation of crude phenol from coal. It consists predominantly of phenols having carbon numbers in the range of C8 through C10 with a softening point of 60°C to 80°C (140°F to 176°F |
96690-55-0 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-120-00-8 |
Tar acids, methylphenol fraction; Distillate Phenols; [The fraction of tar acid rich in 3- and 4-methylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] |
84989-04-8 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-121-00-3 |
Tar acids, polyalkylphenol fraction; Distillate Phenols; [The fraction of tar acids, recovered by distillation of low-temperature coal tar crude tar acids, having an approximate boiling range of 225°C to 320°C (437°F to 608°F). Composed primarily of po |
84989-05-9 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-122-00-9 |
Tar acids, xylenol fraction; Distillate Phenols; [The fraction of tar acids, rich in 2,4- and 2,5-dimethylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] |
84989-06-0 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-123-00-4 |
Tar acids, ethylphenol fraction; Distillate Phenols; [The fraction of tar acids, rich in 3- and 4-ethylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] |
84989-03-7 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-124-00-X |
Tar acids, 3,5-xylenol fraction; Distillate Phenols; [The fraction of tar acids, rich in 3,5-dimethylphenol, recovered by distillation of low-temperature coal tar acids.] |
84989-07-1 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-125-00-5 |
Tar acids, residues, distillates, first-cut; Distillate Phenols; [The residue from the distillation in the range of 235°C to 355°C (481°F to 697°F) of light carbolic oil.] |
68477-23-6 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-126-00-0 |
Tar acids, cresylic, residues; Distillate Phenols; [The residue from crude coal tar acids after removal of phenol, cresols, xylenols and any higher boiling phenols. A black solid with a melting point approximately 80°C (176°F). Composed primarily of po |
68555-24-8 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-127-00-6 |
Phenols, C9-11; Distillate Phenols |
91079-47-9 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-128-00-1 |
Tar acids, cresylic; Distillate Phenols; [A complex combination of organic compounds obtained from brown coal and boiling in the range of approximately 200°C to 230°C (392°F to 446°F). It contains chiefly phenols and pyridine bases.] |
92062-26-5 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-129-00-7 |
Tar acids, brown-coal, C2-alkylphenol fraction; Distillate Phenols; [The distillate from the acidification of alkaline washed lignite tar distillate boiling in the range of approximately 200°C to 230°C (392°F to 446°F). Composed primarily of m- and p-e |
94114-29-1 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-130-00-2 |
Extract oils (coal), naphthalene oils; Acid Extract; [The aqueous extract produced by an acidic wash of alkali-washed naphthalene oil. Composed primarily of acid salts of various aromatic nitrogen bases including pyridine, quinoline and their alkyl der |
90641-00-2 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-131-00-8 |
Tar bases, quinoline derivs.; Distillate Bases |
68513-87-1 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-132-00-3 |
Tar bases, coal, quinoline derivs. fraction; Distillate Bases |
70321-67-4 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-133-00-9 |
Tar bases, coal, distn. residues; Distillate Bases; [The distillation residue remaining after the distillation of the neutralized, acid-extracted base-containing tar fractions obtained by the distillation of coal tars. It contains chiefly aniline, coll |
92062-29-8 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-134-00-4 |
Hydrocarbon oils, arom., mixed with polyethylene and polypropylene, pyrolyzed, light oil fraction; Heat Treatment Products; [The oil obtained from the heat treatment of a polyethylene/polypropylene reaction mass with coal tar pitch or aromatic oils. It |
100801-63-6 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-135-00-X |
Hydrocarbon oils, arom., mixed with polyethylene, pyrolyzed, light oil fraction; Heat Treatment Products; [The oil obtained from the heat treatment of polyethylene with coal tar pitch or aromatic oils. It consists predominantly of benzene and its homol |
100801-65-8 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-136-00-5 |
Hydrocarbon oils, arom., mixed with polystyrene, pyrolyzed, light oil fraction; Heat Treatment Products; [The oil obtained from the heat treatment of polystyrene with coal tar pitch or aromatic oils. It consists predominantly of benzene and its homolog |
100801-66-9 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-137-00-0 |
Extract residues (coal), tar oil alk., naphthalene distn. residues; Naphthalene Oil Extract Residue; [The residue obtained from chemical oil extracted after the removal of naphthalene by distillation composed primarily of two to four membered condensed |
73665-18-6 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-138-00-6 |
Creosote oil, low-boiling distillate; Wash Oil; [The low-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal, which is further refined to remove excess crystalline salts. It consists primarily of creosote oi |
70321-80-1 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-139-00-1 |
Tar acids, cresylic, sodium salts, caustic solns.; Alkaline Extract |
68815-21-4 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-140-00-7 |
Extract oils (coal), tar base; Acid Extract; [The extract from coal tar oil alkaline extract residue produced by an acidic wash such as aqueous sulfuric acid after distillation to remove naphthalene. Composed primarily of the acid salts of various arom |
65996-86-3 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-141-00-2 |
Tar bases, coal, crude; Crude Tar Bases; [The reaction product obtained by neutralizing coal tar base extract oil with an alkaline solution, such as aqueous sodium hydroxide, to obtain the free bases. Composed primarily of such organic bases as acridine |
65996-84-1 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J M |
CLP00/ATP02 |
| 648-142-00-8 |
Residues (coal), liq. solvent extn.; [A cohesive powder composed of coal mineral matter and undissolved coal remaining after extraction of coal by a liquid solvent.] |
94114-46-2 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-143-00-3 |
Coal liquids, liq. solvent extn. soln.; [The product obtained by filtration of coal mineral matter and undissolved coal from coal extract solution produced by digesting coal in a liquid solvent. A black, viscous, highly complex liquid combination compose |
94114-47-3 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-144-00-9 |
Coal liquids, liq. solvent extn.; [The substantially solvent-free product obtained by the distillation of the solvent from filtered coal extract solution produced by digesting coal in a liquid solvent. A black semi-solid, composed primarily of a complex |
94114-48-4 |
Carc. 1B |
H350 |
|
M |
CLP00/ATP02 |
| 648-145-00-4 |
Tar brown-coal; [An oil distilled from brown-coal tar. Composed primarily of aliphatic, naphthenic and one- to three-ring aromatic hydrocarbons, their alkyl derivates, heteroaromatics and one- and two-ring phenols boiling in the range of approximately 15 |
101316-83-0 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 648-146-00-X |
Tar, brown-coal, low-temp.; [A tar obtained from low temperature carbonization and low temperature gasification of brown coal. Composed primarily of aliphatic, naphthenic and cyclic aromatic hydrocarbons, heteroaromatic hydrocarbons and cyclic phenols.] |
101316-84-1 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 648-147-00-5 |
Light oil (coal), coke-oven; Crude benzole; [The volatile organic liquid extracted from the gas evolved in the high temperature (greater than 700°C (1292°F)) destructive distillation of coal. Composed primarily of benzene, toluene, and xylenes. May co |
65996-78-3 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-148-00-0 |
Distillates (coal), liq. solvent extn., primary; [The liquid product of condensation of vapors emitted during the digestion of coal in a liquid solvent and boiling in the range of approximately 30°C to 300°C (86°F to 572°F). Composed primarily of partly |
94114-52-0 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-149-00-6 |
Distillates (coal), solvent extn., hydrocracked; [Distillate obtained by hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 30°C to 300°C |
94114-53-1 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-150-00-1 |
Naphtha (coal), solvent extn., hydrocracked; [Fraction of the distillate obtained by hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 3 |
94114-54-2 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-151-00-7 |
Gasoline, coal solvent extn., hydrocracked naphtha; [Motor fuel produced by the reforming of the refined naphtha fraction of the products of hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extracti |
94114-55-3 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 648-152-00-2 |
Distillates (coal), solvent extn., hydrocracked middle; [Distillate obtained from the hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately |
94114-56-4 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-153-00-8 |
Distillates (coal), solvent extn., hydrocracked hydrogenated middle; [Distillate from the hydrogenation of hydrocracked middle distillate from coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes an |
94114-57-5 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 648-154-00-3 |
Fuels, jet aircraft, coal solvent extn., hydrocracked hydrogenated; [Jet engine fuel produced by hydrogenation of the middle distillate fraction of the products of hydrocracking of coal extract or solution produced by the liquid solvent extraction or sup |
94114-58-6 |
Carc. 2 |
H351 |
|
|
CLP00/ATP02 |
| 648-155-00-9 |
Fuels, diesel, coal solvent extn., hydrocracked hydrogenated; [Diesel engine fuel produced by the hydrogenation of the middle distillate fraction of the products of hydrocracking of coal extract or solution produced by the liquid solvent extraction or su |
94114-59-7 |
Carc. 2 |
H351 |
|
|
CLP00/ATP02 |
| 648-156-00-4 |
Light oil (coal), semi-coking process; Fresh oil; [The volatile organic liquid condensed from the gas evolved in the low-temperature (less than 700°C (1292°F)) destructive distillation of coal. Composed primarily of C6-10 hydrocarbons.] |
90641-11-5 |
Carc. 1B, Muta. 1B |
H350, H340 |
|
J |
CLP00/ATP02 |
| 649-001-00-3 |
Extracts (petroleum), light naphthenic distillate solvent |
64742-03-6 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-002-00-9 |
Extracts (petroleum), heavy paraffinic distillate solvent |
64742-04-7 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-003-00-4 |
Extracts (petroleum), light paraffinic distillate solvent |
64742-05-8 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-004-00-X |
Extracts (petroleum), heavy naphthenic distillate solvent |
64742-11-6 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-005-00-5 |
Extracts (petroleum), light vacuum gas oil solvent |
91995-78-7 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-006-00-0 |
hydrocarbons C26-55, arom-rich |
97722-04-8 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-007-00-6 |
fatty acids, tall-oil, reaction products with iminodiethanol and boric acid |
- |
Skin Irrit. 2, Aquatic Chronic 2 |
H315, H411 |
|
|
CLP00/ |
| 649-008-00-1 |
Residues (petroleum), atm. tower; Heavy Fuel oil; [A complex residuum from the atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 °C (662 °F). This |
64741-45-3 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-009-00-7 |
Gas oils (petroleum), heavy vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in |
64741-57-7 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-010-00-2 |
Distillates (petroleum), heavy catalytic cracked; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the r |
64741-61-3 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-011-00-8 |
Clarified oils (petroleum), catalytic cracked; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from distillation of the products from a catalytic cracking process. It consists of hydrocarbons having carbon number |
64741-62-4 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-012-00-3 |
Residues (petroleum), hydrocracked; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from distillation of the products of a hydrocracking process. It consists of hydrocarbons having carbon numbers predominantly gr |
64741-75-9 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-013-00-9 |
Residues (petroleum), thermal cracked; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from distillation of the product from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons havin |
64741-80-6 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-014-00-4 |
Distillates (petroleum), heavy thermal cracked; Heavy Fuel oil; [A complex combination of hydrocarbons from the distillation of the products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers pre |
64741-81-7 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-015-00-X |
Gas oils (petroleum), hydrotreated vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in t |
64742-59-2 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-016-00-5 |
Residues (petroleum), hydrodesulfurized atmospheric tower; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating an atmospheric tower residuum with hydrogen in the presence of a catalyst under conditions primarily to remove organic |
64742-78-5 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-017-00-0 |
Gas oils (petroleum), hydrodesulfurized heavy vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 thro |
64742-86-5 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-018-00-6 |
Residues (petroleum), steam-cracked; Heavy Fuel oil; [A complex combination of hydrocarbons obtained as the residual fraction from the distillation of the products of a steam cracking process (including steam cracking to produce ethylene). It consists p |
64742-90-1 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-019-00-1 |
Residues (petroleum), atmospheric; Heavy Fuel oil; [A complex residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly greater than C11 and boiling above approximately 200 °C (392 °F). This str |
68333-22-2 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-020-00-7 |
Clarified oils (petroleum), hydrodesulfurized catalytic cracked; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating catalytic cracked clarified oil with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It |
68333-26-6 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-021-00-2 |
Distillates (petroleum), hydrodesulfurized intermediate catalytic cracked; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating intermediate catalytic cracked distillates with hydrogen to convert organic sulfur to hydrogen sulfide |
68333-27-7 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-022-00-8 |
Distillates (petroleum), hydrodesulfurized heavy catalytic cracked; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treatment of heavy catalytic cracked distillates with hydrogen to convert organic sulfur to hydrogen sulfide which is |
68333-28-8 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-023-00-3 |
Fuel oil, residues-straight-run gas oils, high-sulfur; Heavy Fuel oil |
68476-32-4 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-024-00-9 |
Fuel oil, residual; Heavy Fuel oil; [The liquid product from various refinery streams, usually residues. The composition is complex and varies with the source of the crude oil.] |
68476-33-5 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-025-00-4 |
Residues (petroleum), catalytic reformer fractionator residue distn.; Heavy Fuel oil; [A complex residuum from the distillation of catalytic reformer fractionator residue. It boils approximately above 399 °C (750 °F).] |
68478-13-7 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-026-00-X |
Residues (petroleum), heavy coker gas oil and vacuum gas oil; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from the distillation of heavy coker gas oil and vacuum gas oil. It predominantly consists of hydrocar |
68478-17-1 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-027-00-5 |
Residues (petroleum), heavy coker and light vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from the distillation of heavy coker gas oil and light vacuum gas oil. It consists predominantly of hydrocarbons |
68512-61-8 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-028-00-0 |
Residues (petroleum), light vacuum; Heavy Fuel oil; [A complex residuum from the vacuum distillation of the residuum from the atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly greater than C13 and boi |
68512-62-9 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-029-00-6 |
Residues (petroleum), steam-cracked light; Heavy Fuel oil; [A complex residuum from the distillation of the products from a steam-cracking process. It consists predominantly of aromatic and unsaturated hydrocarbons having carbon numbers greater than C7 |
68513-69-9 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-030-00-1 |
Fuel oil, No 6; Heavy Fuel oil; [A distillate oil having a minimum viscosity of 900 SUS at 37.7 °C (100 °F) to a maximum of 9000 SUS at 37.7 °C (100 °F).] |
68553-00-4 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-031-00-7 |
Residues (petroleum), topping plant, low-sulfur; Heavy Fuel oil; [A low-sulfur complex combination of hydrocarbons produced as the residual fraction from the topping plant distillation of crude oil. It is the residuum after the straight-run gasoline cut |
68607-30-7 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-032-00-2 |
Gas oils (petroleum), heavy atmospheric; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C7 through C35 and boiling in the |
68783-08-4 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-033-00-8 |
Residues (petroleum), coker scrubber, Condensed-ring-arom.-contg.; Heavy Fuel oil; [A very complex combination of hydrocarbons produced as the residual fraction from the distillation of vaccum residuum and the products from a thermal cracking process. I |
68783-13-1 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-034-00-3 |
Distillates (petroleum), petroleum residues vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from the atmospheric distillation of crude oil.] |
68955-27-1 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-035-00-9 |
Residues (petroleum), steam-cracked, resinous; Heavy Fuel oil; [A complex residuum from the distillation of steam-cracked petroleum residues.] |
68955-36-2 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-036-00-4 |
Distillates (petroleum), intermediate vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the vacuum, distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predo |
70592-76-6 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-037-00-X |
Distillates (petroleum), light vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly |
70592-77-7 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-038-00-5 |
Distillates (petroleum), vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having numbers predominantly in the range |
70592-78-8 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-039-00-0 |
Gas oils (petroleum), hydrodesulfurized coker heavy vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by hydrodesulfurization of heavy coker distillate stocks, It consists predominantly of hydrocarbons having carbon numbers predomi |
85117-03-9 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-040-00-6 |
Residues (petroleum), steam-cracked, distillates; Heavy Fuel oil; [A complex combination of hydrocarbons obtained during the production of refined petroleum tar by the distillation of steam cracked tar. It consists predominantly of aromatic and other hy |
90669-75-3 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-041-00-1 |
Residues (petroleum), vacuum, light; Heavy Fuel oil; [A complex residuum from the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than |
90669-76-4 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-042-00-7 |
Fuel oil, heavy, high-sulfur; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by the distillation of crude petroleum. It consists predominantly of aliphatic, aromatic and cycloaliphatic hydrocarbons having carbon numbers predominantly hi |
92045-14-2 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-043-00-2 |
Residues (petroleum), catalytic cracking; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from the distillation of the products from a catalytic cracking process. It consists predominantly of hydrocarbons having |
92061-97-7 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-044-00-8 |
Distillates (petroleum), intermediate catalytic cracked, thermally degraded; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process which has been used as a heat transfer fluid. |
92201-59-7 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-045-00-3 |
Residual oils (petroleum); Heavy Fuel oil; [A complex combination of hydrocarbons, sulfur compounds and metal-containing organic compounds obtained as the residue from refinery fractionation cracking processes. It produces a finished oil with a viscosit |
93821-66-0 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-046-00-9 |
Residues, steam cracked, thermally treated; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by the treatment and distillation of raw steam-cracked naphtha. It consists predominantly of unsaturated hydrocarbons boiling in the range above |
98219-64-8 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-047-00-4 |
Distillates (petroleum), hydrodesulfurized full-range middle; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating a petroleum stock with hydrogen. It consists predominantly of hydrocarbons having carbon numbers predominantly in t |
101316-57-8 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-048-00-X |
Residues (petroleum), catalytic reformer fractionator; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from distillation of the product from a catalytic reforming process. It consists of predominantly aromatic hy |
64741-67-9 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-049-00-5 |
Petroleum; Crude oil; [A complex combination of hydrocarbons, It consists predominantly of aliphatic, alicyclic and aromatic hydrocarbons. It may also contain small amounts of nitrogen, oxygen and sulfur compounds. This category encompasses light, mediu |
8002-05-9 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-050-00-0 |
Distillates (petroleum), light paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon |
64741-50-0 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 649-051-00-6 |
Distillates (petroleum), heavy paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon |
64741-51-1 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 649-052-00-1 |
Distillates (petroleum), light naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon |
64741-52-2 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 649-053-00-7 |
Distillates (petroleum), heavy naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon |
64741-53-3 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 649-054-00-2 |
Distillates (petroleum), acid-treated heavy naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predomin |
64742-18-3 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 649-055-00-8 |
Distillates (petroleum), acid-treated light naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predomin |
64742-19-4 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 649-056-00-3 |
Distillates (petroleum), acid-treated heavy paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid process. It consists predominantly of saturated hydrocarbons having carbon n |
64742-20-7 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 649-057-00-9 |
Distillates (petroleum), acid-treated light paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists predominantly of saturated hydrocarbons having |
64742-21-8 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 649-058-00-4 |
Distillates (petroleum), chemically neutralized heavy paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons obtained from a treating process to remove acidic materials. It consists predominantly of hydrocarbons having c |
64742-27-4 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 649-059-00-X |
Distillates (petroleum), chemically neutralized light paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers pr |
64742-28-5 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 649-060-00-5 |
Distillates (petroleum), chemically neutralized heavy naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers pr |
64742-34-3 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 649-061-00-0 |
Distillates (petroleum), chemically neutralized light naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers pr |
64742-35-4 |
Carc. 1A |
H350 |
|
|
CLP00/ATP02 |
| 649-062-00-6 |
Gases (petroleum), catalytic cracked naphtha depropanizer overhead, C3-rich acid-free; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked hydrocarbons and treated to remove acidic impurities. It consis |
68477-73-6 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-063-00-1 |
Gases (petroleum), catalytic cracker; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of the products from a catalytic cracking process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predomi |
68477-74-7 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-064-00-7 |
Gases (petroleum), catalytic cracker, C1-5-rich; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of aliphatic hydrocarbons having carbon numbers in the range o |
68477-75-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-065-00-2 |
Gases (petroleum), catalytic polymd. naphtha stabilizer overhead, C2-4-rich; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation stabilization of catalytic polymerized naphtha. It consists of aliphatic hydrocarbons havi |
68477-76-9 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-066-00-8 |
Gases (petroleum), catalytic reformer, C1-4-rich; Petroleum gas; [A complex combination of hydrocarbons produced by distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers in the range of C1 through |
68477-79-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-067-00-3 |
Gases (petroleum), C3-5 olefinic-paraffinic alkylation feed; Petroleum gas; [A complex combination of olefinic and paraffinic hydrocarbons having carbon numbers in the range of C3 through C5 which are used as alkylation feed. Ambient temperatures normal |
68477-83-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-068-00-9 |
Gases (petroleum), C4-rich; Petroleum gas; [A complex combination of hydrocarbons produced by distillation of products from a catalytic fractionation process. It consists of aliphatic hydrocarbons having carbon numbers in the range of C3 through C5, pre |
68477-85-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-069-00-4 |
Gases (petroleum), deethanizer overheads; Petroleum gas; [A complex combination of hydrocarbons produced from distillation of the gas and gasoline fractions from the catalytic cracking process. It contains predominantly ethane and ethylene.] |
68477-86-1 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-070-00-X |
Gases (petroleum), deisobutanizer tower overheads; Petroleum gas; [A complex combination of hydrocarbons produced by the atmospheric distillation of a butane-butylene stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in t |
68477-87-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-071-00-5 |
Gases (petroleum), depropanizer dry, propene-rich; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from the gas and gasoline fractions of a catalytic cracking process. It consists predominantly of propylene |
68477-90-7 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-072-00-0 |
Gases (petroleum), depropanizer overheads; Petroleum gas; [A complex combination of hydrocarbons produced by distillation of products from the gas and gasoline fractions of a catalytic cracking process. It consists of aliphatic hydrocarbons having carbo |
68477-91-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-073-00-6 |
Gases (petroleum), gas recovery plant depropanizer overheads; Petroleum gas; [A complex combination of hydrocarbons obtained by fractionation of miscellaneous hydrocarbon streams. It consists predominantly of hydrocarbons having carbon numbers in the ra |
68477-94-1 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-074-00-1 |
Gases (petroleum), Girbotol unit feed; Petroleum gas; [A complex combination of hydrocarbons that is used as the feed into the Girbatol unit to remove hydrogen sulfide. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the ran |
68477-95-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-075-00-7 |
Gases (petroleum), isomerized naphtha fractionator, C4-rich, hydrogen sulfide-free; Petroleum gas |
68477-99-6 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-076-00-2 |
Tail gas (petroleum), catalytic cracked clarified oil and thermal cracked vacuum residue fractionation reflux drum; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked clarified oil and thermal cracked |
68478-21-7 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-077-00-8 |
Tail gas (petroleum), catalytic cracked naphtha stabilization absorber; Petroleum gas; [A complex combination of hydrocarbons obtained from the stabilization of catalytic cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers p |
68478-22-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-078-00-3 |
Tail gas (petroleum), catalytic cracker, catalytic reformer and hydrodesulfurizer combined fractionater; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation of products from catalytic cracking, catalytic reforming and h |
68478-24-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-079-00-9 |
Tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation stabilization of catalytic reformed naphtha. It consists predominantly of hydrocarbons havin |
68478-26-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-080-00-4 |
Tail gas (petroleum), saturate gas plant mixed stream, C4-rich; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation stabilization of straight-run naphtha, distillation tail gas and catalytic reformed naphtha stabilizer |
68478-32-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-081-00-X |
Tail gas (petroleum), saturate gas recovery plant, C1-2-rich; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of distillate tail gas, straight-run naphtha, catalytic reformed naphtha stabilizer tail gas. It consists pre |
68478-33-1 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-082-00-5 |
Tail gas (petroleum), vacuum residues thermal cracker; Petroleum gas; [A complex combination of hydrocarbons obtained from the thermal cracking of vacuum residues. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 throug |
68478-34-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-083-00-0 |
Hydrocarbons, C3-4-rich, petroleum distillate; Petroleum gas; [A complex combination of hydrocarbons produced by distillation and condensation of crude oil. It consists of hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C |
68512-91-4 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-084-00-6 |
Gases (petroleum), full-range straight-run naphtha dehexanizer off; petroleum gas; [A complex combination of hydrocarbons obtained by the fractionation of the full-range straight-run naphtha. It consists of hydrocarbons having carbon numbers predominant |
68513-15-5 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-085-00-1 |
Gases (petroleum), hydrocracking depropanizer off, hydrocarbon-rich; Petroleum gas; [A complex combination of hydrocarbon produced by the distillation of products from a hydrocracking process. It consists predominantly of hydrocarbons having carbon numb |
68513-16-6 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-086-00-7 |
Gases (petroleum), light straight-run naphtha stabilizer off; Petroleum gas; [A complex combination of hydrocarbons obtained by the stabilization of light straight-run naphtha. It consists of saturated aliphatic hydrocarbons having carbon numbers predom |
68513-17-7 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-087-00-2 |
Residues (petroleum), alkylation splitter, C4-rich; Petroleum gas; [A complex residuum from the distillation of streams various refinery operations. It consists of hydrocarbons having carbon numbers in the range of C4 through C5, predominantly butane an |
68513-66-6 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-088-00-8 |
Hydrocarbons, C1-4; Petroleum gas; [A complex combination of hydrocarbons provided by thermal cracking and absorber operations and by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C |
68514-31-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-089-00-3 |
Hydrocarbons, C1-4, sweetened; Petroleum gas; [A complex combination of hydrocarbons obtained by subjecting hydrocarbon gases to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers |
68514-36-3 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-090-00-9 |
Hydrocarbons, C1-3; Petroleum gas; [A complex combination of hydrocarbons having carbon numbers predominantly in the range of C1 through C3 and boiling in the range of approximately minus 164°C to minus 42°C (-263°F to -44°F).] |
68527-16-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-091-00-4 |
Hydrocarbons, C1-4, debutanizer fraction; Petroleum gas |
68527-19-5 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-092-00-X |
Gases (petroleum), C1-5, wet; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of crude oil and/or the cracking of tower gas oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 throug |
68602-83-5 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-093-00-5 |
Hydrocarbons, C2-4; Petroleum gas |
68606-25-7 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-094-00-0 |
Hydrocarbons, C3; Petroleum gas |
68606-26-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-095-00-6 |
Gases (petroleum), alkylation feed; Petroleum gas; [A complex combination of hydrocarbons produced by the catalytic cracking of gas oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] |
68606-27-9 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-096-00-1 |
Gases (petroleum), depropanizer bottoms fractionation off; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation of depropanizer bottoms. It consists predominantly of butane, isobutane and butadiene.] |
68606-34-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-097-00-7 |
Gases (petroleum), refinery blend; Petroleum gas; [A complex combination obtained from various processes. It consists of hydrogen, hydrogen sulfide and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
68783-07-3 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-098-00-2 |
Gases (petroleum), catalytic cracking; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of the products from a catalytic cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in |
68783-64-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-099-00-8 |
Gases (petroleum), C2-4, sweetened; Petroleum gas; [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of saturated |
68783-65-3 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-100-00-1 |
Gases (petroleum), crude oil fractionation off; Petroleum gas; [A complex combination of hydrocarbons produced by the fractionation of crude oil. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 thro |
68918-99-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-101-00-7 |
Gases (petroleum), dehexanizer off; Petroleum gas; [A complex combination of hydrocarbons obtained by the fractionation of combined naphtha streams. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 t |
68919-00-6 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-102-00-2 |
Gases (petroleum), light straight run gasoline fractionation stabilizer off; Petroleum gas; [A complex combination of hydrocarbons obtained by the fractionation of light straight-run gasoline. It consists of saturated aliphatic hydrocarbons having carbo |
68919-05-1 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-103-00-8 |
Gases (petroleum), naphtha unifiner desulfurization stripper off; Petroleum gas; [A complex combination of hydrocarbons produced by a naphtha unifiner desulfurization process and stripped from the naphtha product. It consists of saturated aliphatic hydr |
68919-06-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-104-00-3 |
Gases (petroleum), straight-run naphtha catalytic reforming off; Petroleum gas; [A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha and fractionation of the total effluent. It consists of methane, ethane, a |
68919-09-5 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-105-00-9 |
Gases (petroleum), fluidized catalytic cracker splitter overheads; Petroleum gas; [A complex combination of hydrocarbons produced by the fractionation of the charge to the C3 -C4 splitter. It consists predominantly of C3 hydrocarbons.] |
68919-20-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-106-00-4 |
Gases (petroleum), straight-run stabilizer off; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation of the liquid from the first tower used in the distillation of crude oil. It consists of saturated aliphatic hydrocarbo |
68919-10-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-107-00-X |
Gases (petroleum), catalytic cracked naphtha debutanizer; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked naphtha. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 |
68952-76-1 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-108-00-5 |
Tail gas (petroleum), catalytic cracked distillate and naphtha stabilizer; Petroleum gas; [A complex combination of hydrocarbons obtained by the fractionation of catalytic cracked naphtha and distillate. It consists predominantly of hydrocarbons having |
68952-77-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-109-00-0 |
Tail gas (petroleum), thermal-cracked distillate, gas oil and naphtha absorber; petroleum gas; [A complex combination of hydrocarbons obtained from the separation of thermal-cracked distillates, naphtha and gas oil. It consists pedrominantly of hydrocar |
68952-81-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-110-00-6 |
Tail gas (petroleum), thermal cracked hydrocarbon fractionation stabilizer, petroleum coking; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation stabilization of thermal cracked hydrocarbons from petroleum coking proce |
68952-82-9 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-111-00-1 |
Gases (petroleum, light steam-cracked, butadiene conc.; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from a thermal cracking process. It consists of hydrocarbons having a carbon number predominantly of C |
68955-28-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-112-00-7 |
Gases (petroleum), straight-run naphtha catalytic reformer stabilizer overhead; Petroleum gas; [A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha and the fractionation of the total effluent. It consists of |
68955-34-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-113-00-2 |
Hydrocarbons, C4; Petroleum gas |
87741-01-3 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-114-00-8 |
Alkanes, C1-4, C3-rich; Petroleum gas |
90622-55-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-115-00-3 |
Gases (petroleum), steam-cracker C3-rich; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from a steam cracking process. It consists predominantly of propylene with some propane and boils in the range of ap |
92045-22-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-116-00-9 |
Hydrocarbons, C4, steam-cracker distillate; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of the products of a steam cracking process. It consists predominantly of hydrocarbons having a carbon number of C4, predomina |
92045-23-3 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-117-00-4 |
Petroleum gases, liquefied, sweetened, C4 fraction; Petroleum gas; [A complex combination of hydrocarbons obtained by subjecting a liquified petroleum gas mix to a sweetening process to oxidize mercaptans or to remove acidic impurities. It consists pred |
92045-80-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K S U |
CLP00/ATP02 |
| 649-118-00-X |
Hydrocarbons, C4, 1,3-butadiene- and isobutene-free; Petroleum gas |
95465-89-7 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-119-00-5 |
Raffinates (petroleum), steam-cracked C4 fraction cuprous ammonium acetate extn., C3-5 and C3-5 unsatd., butadiene-free; Petroleum gas |
97722-19-5 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-120-00-0 |
Gases (petroleum), amine system feed; Refinery gas; [The feed gas to the amine system for removal of hydrogen sulfide. It consists of hydrogen. Carbon monoxide, carbon dioxide, hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominan |
68477-65-6 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-121-00-6 |
Gases (petroleum), benzene unit hydrodesulfurizer off; Refinery gas; [Off gases produced by the benzene unit. It consists primarily of hydrogen. Carbon monoxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6, includin |
68477-66-7 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-122-00-1 |
Gases (petroleum), benzene unit recycle, hydrogen-rich; Refinery gas; [A complex combination of hydrocarbons obtained by recycling the gases of the benzene unit. It consists primarily of hydrogen with various small amounts of carbon monoxide and hydroca |
68477-67-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-123-00-7 |
Gases (petroleum), blend oil, hydrogen-nitrogen-rich; Refinery gas; [A complex combination of hydrocarbons obtained by distillation of a blend oil. It consists primarily of hydrogen and nitrogen with various small amounts of carbon monoxide, carbon diox |
68477-68-9 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-124-00-2 |
Gases (petroleum), catalytic reformed naphtha stripper overheads; Refinery gas; [A complex combination of hydrocarbons obtained from stabilization of catalytic reformed naphtha. Its consists of hydrogen and saturated hydrocarbons having carbon numbers p |
68477-77-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-125-00-8 |
Gases (petroleum), C6-8 catalytic reformer recycle; Refinery gas; [A complex combination of hydrocarbons produced by distillation of products from catalytic reforming of C6-C8 feed and recycled to conserve hydrogen. It consists primarily of hydrogen. It |
68477-80-5 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-126-00-3 |
Gases (petroleum), C6-8 catalytic reformer; Refinery gas; [A complex combination of hydrocarbons produced by distillation of products from catalytic reforming of C6-C8feed. It consists of hydrocarbons having carbon numbers in the range of C1 through C5 |
68477-81-6 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-127-00-9 |
Gases (petroleum), C6-8 catalytic reformer recycle, hydrogen-rich; Refinery gas |
68477-82-7 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-128-00-4 |
Gases (petroleum), C2-return stream; Refinery gas; [A complex combination of hydrocarbons obtained by the extraction of hydrogen from a gas stream which consists primarily of hydrogen with small amounts of nitrogen, carbon monoxide, methane, ethane, and |
68477-84-9 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-129-00-X |
Gases (petroleum), dry sour, gas-concn.-unit-off; Refinery gas; [The complex combination of dry gases from a gas concentration unit. It consists of hydrogen, hydrogen sulfide and hydrocarbons having carbon numbers predominantly in the range of C1 throug |
68477-92-9 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-130-00-5 |
Gases (petroleum), gas concn. reabsorber distn.; Refinery gas; [A complex combination of hydrocarbons produced by distillation of products from combined gas streams in a gas concentration reabsorber. It consists predominantly of hydrogen, carbon monoxid |
68477-93-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-131-00-0 |
Gases (petroleum), hydrogen absorber off; Refinery gas; [A complex combination obtained by absorbing hydrogen from a hydrogen rich stream. It consists of hydrogen, carbon monoxide, nitrogen, and methane with small amounts of C2 hydrocarbons.] |
68477-96-3 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-132-00-6 |
Gases (petroleum), hydrogen-rich; Refinery gas; [A complex combination separated as a gas from hydrocarbon gases by chilling. It consists primarily of hydrogen with various small amounts of carbon monoxide, nitrogen, methane, and C2 hydrocarbons.] |
68477-97-4 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-133-00-1 |
Gases (petroleum), hydrotreater blend oil recycle, hydrogen-nitrogen-rich; Refinery gas; [A complex combination obtained from recycled hydrotreated blend oil. It consists primarily of hydrogen and nitrogen with various small amounts of carbon monoxide, |
68477-98-5 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-134-00-7 |
Gases (petroleum), recycle, hydrogen-rich; Refinery gas; [A complex combination obtained from recycled reactor gases. It consists primarily of hydrogen with various small amounts of carbon monoxide, carbon dioxide, nitrogen, hydrogen sulfide, and satura |
68478-00-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-135-00-2 |
Gases (petroleum), reformer make-up, hydrogen-rich; Refinery gas; [A complex combination obtained from the reformers. It consists primarily of hydrogen with various small amounts of carbon monoxide and aliphatic hydrocarbons having carbon numbers predom |
68478-01-3 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-136-00-8 |
Gases (petroleum), reforming hydrotreater; Refinery gas; [A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen, methane, and ethane with various small amounts of hydrogen sulfide and aliphatic hydroc |
68478-02-4 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-137-00-3 |
Gases (petroleum), reforming hydrotreater, hydrogen-methane-rich; Refinery gas; [A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen and methane with various small amounts of carbon monoxide, carbon |
68478-03-5 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-138-00-9 |
Gases (petroleum), reforming hydrotreater make-up, hydrogen-rich; Refinery gas; [A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen with various small amounts of carbon monoxide and aliphatic hydro |
68478-04-6 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-139-00-4 |
Gases (petroleum), thermal cracking distn.; Refinery gas; [A complex combination produced by distillation of products from a thermal cracking process. It consists of hydrogen, hydrogen sulfide, carbon monoxide, carbon dioxide and hydrocarbons having car |
68478-05-7 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-140-00-X |
Tail gas (petroleum), catalytic cracker refractionation absorber; Refinery gas; [A complex combination of hydrocarbons obtained from refractionation of products from a catalytic cracking process. It consists of hydrogen and hydrocarbons having carbon nu |
68478-25-1 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-141-00-5 |
Tail gas (petroleum), catalytic reformed naphtha separator; Refinery gas; [A complex combination of hydrocarbons obtained from the catalytic reforming of straight run naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly |
68478-27-3 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-142-00-0 |
Tail gas (petroleum), catalytic reformed naphtha stabilizer; Refinery gas; [A complex combination of hydrocarbons obtained from the stabilization of catalytic reformed naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly |
68478-28-4 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-143-00-6 |
Tail gas (petroleum), cracked distillate hydrotreater separator; Refinery gas; [A complex combination of hydrocarbons obtained by treating cracked distillates with hydrogen in the presence of a catalyst. It consists of hydrogen and saturated aliphatic h |
68478-29-5 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-144-00-1 |
Tail gas (petroleum), hydrodesulfurized straight-run naphtha separator; Refinery gas; [A complex combination of hydrocarbons obtained from hydrodesulfurization of straight-run naphtha. It consists of hydrogen and saturated aliphatic hydrocarbons having |
68478-30-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-145-00-7 |
Gases (petroleum), catalytic reformed straight-run naphtha stabilizer overheads; Refinery gas; [A complex combination of hydrocarbons obtained from the catalytic reforming of straight-run naphtha followed by fractionation of the total effluent. It consi |
68513-14-4 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-146-00-2 |
Gases (petroleum), reformer effluent high-pressure flash drum off; Refinery gas; [A complex combination produced by the high-pressure flashing of the effluent from the reforming reactor. It consists primarily of hydrogen with various small amounts of me |
68513-18-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-147-00-8 |
Gases (petroleum), reformer effluent low-pressure flash drum off; Refinery gas; [A complex combination produced by low-pressure flashing of the effluent from the reforming reactor. It consists primarily of hydrogen with various small amounts of methane, |
68513-19-9 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-148-00-3 |
Gases (petroleum), oil refinery gas distn. off; Refinery gas; [A complex combination separated by distillation of a gas stream containing hydrogen, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers in the range of C1 through C6 or o |
68527-15-1 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-149-00-9 |
Gases (petroleum), benzene unit hydrotreater depentanizer overheads; Refinery gas; [A complex combination produced by treating the feed from the benzene unit with hydrogen in the presence of a catalyst followed by depentanizing. It consists primarily of |
68602-82-4 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-150-00-4 |
Gases (petroleum), secondary absorber off, fluidized catalytic cracker overheads fractionator; Refinery gas; [A complex combination produced by the fractionation of the overhead products from the catalytic cracking process in the fluidized catalytic cra |
68602-84-6 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-151-00-X |
Petroleum products, refinery gases; Refinery gas; [A complex combination which consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] |
68607-11-4 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-152-00-5 |
Gases (petroleum), hydrocracking low-pressure separator; Refinery gas; [A complex combination obtained by the liquid-vapor separation of the hydrocracking process reactor effluent. It consists predominantly of hydrogen and saturated hydrocarbons having |
68783-06-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-153-00-0 |
Gases (petroleum), refinery; Refinery gas; [A complex combination obtained from various petroleum refining operations. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] |
68814-67-5 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-154-00-6 |
Gases (petroleum), platformer products separator off; Refinery gas; [A complex combination obtained from the chemical reforming of naphthenes to aromatics. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly |
68814-90-4 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-155-00-1 |
Gases (petroleum), hydrotreated sour kerosine depentanizer stabilizer off; Refinery gas; [The complex combination obtained from the depentanizer stabilization of hydrotreated kerosine. It consists primarily of hydrogen, methane, ethane, and propane with |
68911-58-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-156-00-7 |
Gases (petroleum), hydrotreated sour kerosine flash drum; Refinery gas; [A complex combination obtained from the flash drum of the unit treating sour kerosine with hydrogen in the presence of a catalyst. It consists primarily of hydrogen and methane wit |
68911-59-1 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-157-00-2 |
Gases (petroleum), distillate unifiner desulfurization stripper off; Refinery gas; [A complex combination stripped from the liquid product of the unifiner desulfurization process. It consists of hydrogen sulfide, methane, ethane, and propane.] |
68919-01-7 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-158-00-8 |
Gases (petroleum), fluidized catalytic cracker fractionation off; Refinery gas; [A complex combination produced by the fractionation of the overhead product of the fluidized catalytic cracking process. It consists of hydrogen, hydrogen sulfide, nitrogen |
68919-02-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-159-00-3 |
Gases (petroleum), fluidized catalytic cracker scrubbing secondary absorber off; Refinery gas; [A complex combination produced by scrubbing the overhead gas from the fluidized catalytic cracker. It consists of hydrogen, nitrogen, methane, ethane and pro |
68919-03-9 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-160-00-9 |
Gases (petroleum), heavy distillate hydrotreater desulfurization stripper off; Refinery gas; [A complex combination stripped from the liquid product of the heavy distillate hydrotreater desulfurization process. It consists of hydrogen, hydrogen sulfide, |
68919-04-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-161-00-4 |
Gases (petroleum), platformer stabilizer off, light ends fractionation; Refinery gas; [A complex combination obtained by the fractionation of the light ends of the platinum reactors of the platformer unit. It consists of hydrogen, methane, ethane and pr |
68919-07-3 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-162-00-X |
Gases (petroleum), preflash tower off, crude distn.; Refinery gas; [A complex combination produced from the first tower used in the distillation of crude oil. It consists of nitrogen and saturated aliphatic hydrocarbons having carbon numbers predominant |
68919-08-4 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-163-00-5 |
Gases (petroleum), tar stripper off; Refinery gas; [A complex combination obtained by the fractionation of reduced crude oil. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] |
68919-11-9 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-164-00-0 |
Gases (petroleum), unifiner stripper off; Refinery gas; [A combination of hydrogen and methane obtained by fractionation of the products from the unifiner unit.] |
68919-12-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-165-00-6 |
Tail gas (petroleum), catalytic hydrodesulfurized naphtha separator; Refinery gas; [A complex combination of hydrocarbons obtained from the hydrodesulfurization of naphtha. It consists of hydrogen, methane, ethane, and propane.] |
68952-79-4 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-166-00-1 |
Tail gas (petroleum), straight-run naphtha hydrodesulfurizer; Refinery gas; [A complex combination obtained from the hydrodesulfurization of straight-run naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range |
68952-80-7 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-167-00-7 |
Gases (petroleum), sponge absorber off, fluidized catalytic cracker and gas oil desulfurizer overhead fractionation; Refinery gas; [A complex combination obtained by the fractionation of products from the fluidized catalytic cracker and gas oil desulfur |
68955-33-9 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-168-00-2 |
Gases (petroleum), crude distn. and catalytic cracking; Refinery gas; [A complex combination produced by crude distillation and catalytic cracking processes. It consists of hydrogen, hydrogen sulfide, nitrogen, carbon monoxide and paraffinic and olefini |
68989-88-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-169-00-8 |
Gases (petroleum), gas oil diethanolamine scrubber off; Refinery gas; [A complex combination produced by desulfurization of gas oils with diethanolamine. It consists predominantly of hydrogen sulfide, hydrogen and aliphatic hydrocarbons having carbon nu |
92045-15-3 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-170-00-3 |
Gases (petroleum), gas oil hydrodesulfurization effluent; Refinery gas; [A complex combination obtained by separation of the liquid phase from the effluent from the hydrogenation reaction. It consists predominantly of hydrogen, hydrogen sulfide and alip |
92045-16-4 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-171-00-9 |
Gases (petroleum), gas oil hydrodesulfurization purge; Refinery gas; [A complex combination of gases obtained from the reformer and from the purges from the hydrogenation reactor. It consists predominantly of hydrogen and aliphatic hydrocarbons having c |
92045-17-5 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-172-00-4 |
Gases (petroleum), hydrogenator effluent flash drum off; Refinery gas; [A complex combination of gases obtained from flash of the effluents after the hydrogenation reaction. It consists predominantly of hydrogen and aliphatic hydrocarbons having carbon |
92045-18-6 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-173-00-X |
Gases (petroleum), naphtha steam cracking high-pressure residual; Refinery gas; [A complex combination obtained as a reaction mass of the non-condensable portions from the product of a naphtha steam cracking process as well as residual gases obtained du |
92045-19-7 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-174-00-5 |
Gases (petroleum), residue visbaking off; Refinery gas; [A complex combination obtained from viscosity reduction of residues in a furnace. It consists predominantly of hydrogen sulfide and paraffinic and olefinic hydrocarbons having carbon numbers predo |
92045-20-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-175-00-0 |
Foots oil (petroleum), acid-treated; Foots oil; [A complex combination of hydrocarbons obtained by treatment of Foot's oil with sulfuric acid. It consists predominantly of branched-chain hydrocarbons with carbon numbers predominantly in the range of C20 |
93924-31-3 |
Flam. Gas 1, Press. Gas, Carc. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-176-00-6 |
Foots oil (petroleum), clay-treated; Foots oil; [A complex combination of hydrocarbons obtained by treatment of Foot's oil with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and imp |
93924-32-4 |
Flam. Gas 1, Press. Gas, Carc. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-177-00-1 |
Gases (petroleum), C3-4; Petroleum gas; [A complex combination of hydrocarbons produced by distillation of products from the cracking of crude oil. It consists of hydrocarbons having carbon numbers in the range of C3 through C4, predominantly of propane |
68131-75-9 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-178-00-7 |
Tail gas (petroleum), catalytic cracked distillate and catalytic cracked naphtha fractionation absorber; Petroleum gas; [The complex combination of hydrocarbons from the distillation of the products from catalytic cracked distillates and catalytic crack |
68307-98-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-179-00-2 |
Tail gas (petroleum), catalytic polymn. naphtha fractionation stabilizer; Petroleum gas; [A complex combination of hydrocarbons from the fractionation stabilization products from polymerization of naphtha. It consists predominantly of hydrocarbons havin |
68307-99-3 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-180-00-8 |
Tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer, hydrogen sulfide-free; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation stabilization of catalytic reformed naphtha and from which hydrogen sulfi |
68308-00-9 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-181-00-3 |
Tail gas (petroleum), cracked distillate hydrotreater stripper; Petroleum gas; [A complex combination of hydrocarbons obtained by treating thermal cracked distillates with hydrogen in the presence of a catalyst. It consists predominantly of saturated hy |
68308-01-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-182-00-9 |
Tail gas (petroleum), straight-run distillate hydrodesulfurizer, hydrogen sulfide-free; Petroleum gas; [A complex combination of hydrocarbons obtained from catalytic hydrodesulfurization of straight run distillates and from which hydrogen sulfide has be |
68308-10-1 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-183-00-4 |
Tail gas (petroleum), gas oil catalytic cracking absorber; Petroleum gas; [A complex combination of hydrocarbons obtained from the distillation of products from the catalytic cracking of gas oil. It consists predominantly of hydrocarbons having carbon n |
68308-03-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-184-00-X |
Tail gas (petroleum), gas recovery plant; Petroleum gas; [A complex combination of hydrocarbons from the distillation of products from miscellaneous hydrocarbon streams. It consists predominantly of hydrocarbons having carbon numbers predominantly in th |
68308-04-3 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-185-00-5 |
Tail gas (petroleum), gas recovery plant deethanizer; Petroleum gas; [A complex combination of hydrocarbons from the distillation of products from miscellaneous hydrocarbon streams. It consists of hydrocarbons having carbon numbers predominantly in the |
68308-05-4 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-186-00-0 |
Tail gas (petroleum), hydrodesulfurized distillate and hydrodesulfurized naphtha fractionator, acid-free; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of hydrodesulfurized naphtha and distillate hydrocarbon streams a |
68308-06-5 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-187-00-6 |
Tail gas (petroleum), hydrodesulfurized vacuum gas oil stripper, hydrogen sulfide-free; Petroleum gas; [A complex combination of hydrocarbons obtained from stripping stabilization of catalytic hydrodesulfurized vacuum gas oil and from which hydrogen sul |
68308-07-6 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-188-00-1 |
Tail gas (petroleum), light straight-run naphtha stabilizer, hydrogen sulfide-free; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation stabilization of light straight run naphtha and from which hydrogen sulfide has been re |
68308-09-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-189-00-7 |
Tail gas (petroleum), propane-propylene alkylation feed prep deethanizer; Petroleum gas; [A complex combination of hydrocarbons obtained from the distillation of the reaction products of propane with propylene. It consists of hydrocarbons having carbon |
68308-11-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-190-00-2 |
Tail gas (petroleum), vacuum gas oil hydrodesulfurizer, hydrogen sulfide-free; Petroleum gas; [A complex combination of hydrocarbons obtained from catalytic hydrodesulfurization of vacuum gas oil and from which hydrogen sulfide has been removed by amine |
68308-12-3 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-191-00-8 |
Gases (petroleum), catalytic cracked overheads; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from the catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the ra |
68409-99-4 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-193-00-9 |
Alkanes, C1-2; Petroleum gas |
68475-57-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-194-00-4 |
Alkanes, C2-3; Petroleum gas |
68475-58-1 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-195-00-X |
Alkanes, C3-4; petroleum gas |
68475-59-2 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-196-00-5 |
Alkanes, C4-5; Petroleum gas |
68475-60-5 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-197-00-0 |
Fuel gases; Petroleum gas; [A combination of light gases. It consists predominantly of hydrogen and/or low molecular weight hydrocarbons.] |
68476-26-6 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-198-00-6 |
Fuel gases, crude oil of distillates; Petroleum gas; [A complex combination of light gases produced by distillation of crude oil and by catalytic reforming of naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the r |
68476-29-9 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-199-00-1 |
Hydrocarbons, C3-4; Petroleum gas |
68476-40-4 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-200-00-5 |
Hydrocarbons, C4-5; Petroleum gas |
68476-42-6 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-201-00-0 |
Hydrocarbons, C2-4, C3-rich; Petroleum gas |
68476-49-3 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-202-00-6 |
Petroleum gases, liquefied; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C7 and boiling in the range of approx |
68476-85-7 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K S U |
CLP00/ATP02 |
| 649-203-00-1 |
Petroleum gases, liquefied, sweetened; Petroleum gas; [A complex combination of hydrocarbons obtained by subjecting liquefied petroleum gas mix to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons hav |
68476-86-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K S U |
CLP00/ATP02 |
| 649-204-00-7 |
gases (petroleum), C3-4, isobutane-rich; Petroleum gas; [A complex combination of hydrocarbons from the distillation of saturated and unsaturated hydrocarbons usually ranging in carbon numbers from C3 through C6, predominantly butane and isobutane. It c |
68477-33-8 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-205-00-2 |
Distillates (petroleum), C3-6, piperylene-rich; Petroleum gas; [A complex combination of hydrocarbons from the distillation of saturated and unsaturated aliphatic hydrocarbons usually ranging in the carbon numbers C3 through C6. It consists of saturated |
68477-35-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-206-00-8 |
Gases (petroleum), butane splitter overheads; Petroleum gas; [A complex combination of hydrocarbons obtained from the distillation of the butane stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through |
68477-69-0 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-207-00-3 |
Gases (petroleum), C2-3-; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic fractionation process. It contains predominantly ethane, ethylene, propane, and propylene.] |
68477-70-3 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-208-00-9 |
Gases (petroleum), catalytic-cracked gas oil depropanizer bottoms, C4-rich acid-free; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked gas oil hydrocarbon stream and treated to remove hydrogen sulfid |
68477-71-4 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-209-00-4 |
Gases (petroleum), catalytic-cracked naphtha debutanizer bottoms, C3-5-rich; Petroleum gas; [A complex combination of hydrocarbons obtained from the stabilization of catalytic cracked naphtha. It consists of aliphatic hydrocarbons having carbon numbers |
68477-72-5 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-210-00-X |
Tail gas (petroleum), isomerized naphtha fractionation stabilizer; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation stabilization products from isomerized naphtha. It consists predominantly of hydrocarbons having car |
68308-08-7 |
Press. Gas, Flam. Gas 1, Carc. 1B, Muta. 1B |
H220, H350, H340 |
|
K U |
CLP00/ATP02 |
| 649-211-00-5 |
Foots oil (petroleum), carbon-treated; Foots oil; [A complex combination of hydrocarbons obtained by the treatment of Foots oil with activated carbon for the removal of trace constituents and impurities. It consists predominantly of saturated straight c |
97862-76-5 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-212-00-0 |
Distillates (petroleum), sweetened middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbo |
64741-86-2 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-213-00-6 |
Gas oils (petroleum), solvent-refined; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in t |
64741-90-8 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-214-00-1 |
Distillates (petroleum), solvent-refined middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predomin |
64741-91-9 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-215-00-7 |
Gas oils (petroleum), acid-treated; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C13 through C |
64742-12-7 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-216-00-2 |
Distillates (petroleum), acid-treated middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 |
64742-13-8 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-217-00-8 |
Distillates (petroleum), acid-treated light; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 t |
64742-14-9 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-218-00-3 |
Gas oils (petroleum), chemically neutralized; Gasoil - unspecified; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C13 thr |
64742-29-6 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-219-00-9 |
Distillates (petroleum), chemically neutralized middle; Gasoil - unspecified; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range |
64742-30-9 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-220-00-4 |
Distillates (petroleum), clay-treated middle; Gasoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay, usually in a percolation process to remove the trace amounts of po |
64742-38-7 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-221-00-X |
Distillates (petroleum), hydrotreated middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predomina |
64742-46-7 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-222-00-5 |
Gas oils (petroleum), hydrodesulfurized; Gasoil - unspecified; [A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists predominantly of |
64742-79-6 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-223-00-0 |
Distillates (petroleum), hydrodesulfurized middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydr |
64742-80-9 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-224-00-6 |
Fuels, diesel; Gasoil - unspecified; [A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C20 and boiling in the range of approximate |
68334-30-5 |
Carc. 2 |
H351 |
|
N |
CLP00/ATP02 |
| 649-225-00-1 |
Fuel oil, No 2; Gasoil - unspecified; [A distillate oil having a minimum viscosity of 32,6 SUS at 37,7 °C (100 °F) to a maximum of 37,9 SUS at 37,7 °C (100 °F).] |
68476-30-2 |
Carc. 2 |
H351 |
|
|
CLP00/ATP02 |
| 649-226-00-7 |
Fuel oil, No 4; Gasoil - unspecified; [A distillate oil having a minimum viscosity of 45 SUS at 37,7 °C (100 °F) to a maximum of 125 SUS at 37,7 °C (100 °F).] |
68476-31-3 |
Carc. 2 |
H351 |
|
|
CLP00/ATP02 |
| 649-227-00-2 |
Fuels, diesel, No 2; Gasoil - unspecified; [A distillate oil having a minimum viscosity of 32,6 SUS at 37,7 °C (100 °F).] |
68476-34-6 |
Carc. 2 |
H351 |
|
|
CLP00/ATP02 |
| 649-228-00-8 |
Distillates (petroleum), catalytic reformer fractionator residue, high-boiling; Gasoil - unspecified; [A complex combination of hydrocarbons from the distillation of catalytic reformer fracftionator residue. It boils in the range of approximately 343 °C |
68477-29-2 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-229-00-3 |
Distillates (petroleum), catalytic reformer fractionator residue, intermediate-boiling; Gasoil - unspecified; [A complex combination of hydrocarbons from the distillation of catalytic reformer fractionator residue. It boils in the range of approximately |
68477-30-5 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-230-00-9 |
Distillates (petroleum), catalytic reformer fractionator residue, low-boiling; Gasoil - unspecified; [The complex combination of hydrocarbons from the distillation of catalytic reformer fractionator residue. It boils approximately below 288 °C (550 °F). |
68477-31-6 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-231-00-4 |
Distillates (petroleum), highly refined middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by the subjection of a petroleum fraction to several of the following steps: filtration, centrifugation, atmospheric distillation, vacu |
90640-93-0 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-232-00-X |
Distillates (petroleum) catalytic reformer, heavy arom. conc.; Gasoil - unspecified; [A complex combination of hydrocarbons obtained from the distillation of a catalytically reformed petroleum cut. It consists predominantly of aromatic hydrocarbons havi |
91995-34-5 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-233-00-5 |
Gas oils, paraffinic; Gasoil - unspecified; [A distillate obtained from the redistillation of a complex combination of hydrocarbons obtained by the distillation of the effluents from a severe catalytic hydrotreatment of paraffins. It boils in the range |
93924-33-5 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-234-00-0 |
Naphtha (petroleum), solvent-refined hydrodesulfurized heavy; Gasoil - unspecified |
97488-96-5 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-235-00-6 |
Hydrocarbons, C16-20, hydrotreated middle distillate, distn. lights; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the treatment of a middle distillate with hydroge |
97675-85-9 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-236-00-1 |
Hydrocarbons, C12-20, hydrotreated paraffinic, distn. lights; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the treatment of heavy paraffins with hydrogen in the pr |
97675-86-0 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-237-00-7 |
Hydrocarbons, C11-17, solvent-extd. light naphthenic; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by extraction of the aromatics from a light naphthenic distillate having a visciosity of 2.2 cSt at 40 °C (104 °F). It consists p |
97722-08-2 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-238-00-2 |
Gas oils, hydrotreated; Gasoil - unspecified; [A complex combination of hydrocarbons obtained from the redistillation of the effluents from the treatment of paraffins with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons |
97862-78-7 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-239-00-8 |
Distillates (petroleum), carbon-treated light paraffinic; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by the treatment of a petroleum oil fraction with activated charcoal for the removal of traces of polar constituents and impu |
100683-97-4 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-240-00-3 |
Distillates (petroleum), intermediate paraffinic, carbon-treated; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by the treatment of petroleum with activated charcoal for the removal of trace polar constituents and impurities. It |
100683-98-5 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-241-00-9 |
Distillates (petroleum), intermediate paraffinic, clay-treated; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by the treatment of petroleum with bleaching earth for the removal of trace polar constituents and impurities. It consi |
100683-99-6 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-242-00-4 |
Alkanes, C12-26-branched and linear |
90622-53-0 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-243-00-X |
Lubricating greases; Grease; [A complex combination of hydrocarbons having carbon numbers predominantly in the range of C12 through C50. May contain organic salts of alkali metals, alkaline earth metals, and/or aluminium compounds.] |
74869-21-9 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-244-00-5 |
Slack wax (petroleum); Slack wax; [A complex combination of hydrocarbons obtained from a petroleum fraction by solvent crystallization (solvent dewaxing) or as a distillation fraction from a very waxy crude. It consists predominantly of saturated straig |
64742-61-6 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-245-00-0 |
Slack wax (petroleum), acid-treated; Slack wax; [A complex combination of hydrocarbons obtained as a raffinate by treatment of a petroleum slack wax fraction with sulfuric acid treating process. It consists predominantly of saturated straight and branch |
90669-77-5 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-246-00-6 |
Slack wax (petroleum), clay-treated; Slack wax; [A complex combination of hydrocarbons obtained by treatment of a petroleum slack wax fraction with natural or modified clay in either a contacting or percolation process. It consists predominantly of satu |
90669-78-6 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-247-00-1 |
Slack wax (petroleum), hydrotreated; Slack wax; [A complex combination of hydrocarbons obtained by treating slack wax with hydrogen in the presence of a catalyst. It consists predominantly of saturated straight and branched chain hydrocarbons having car |
92062-09-4 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-248-00-7 |
Slack wax (petroleum), low-melting; Slack wax; [A complex combination of hydrocarbons obtained from a petroleum fraction by solvent deparaffination. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers pr |
92062-10-7 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-249-00-2 |
Slack wax (petroleum), low-melting, hydrotreated; Slack wax; [A complex combination of hydrocarbons obtained by treatment of low-melting petroleum slack wax with hydrogen in the presence of a catalyst. It consists predominantly of saturated straight and |
92062-11-8 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-250-00-8 |
Slack wax (petroleum), low-melting, carbon-treated; Slack wax; [A complex combination of hydrocarbons obtained by the treatment of low-melting slack wax with activated carbon for the removal of trace polar constituents and impurities. It consists predom |
97863-04-2 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-251-00-3 |
Slack wax (petroleum), low-melting, clay-treated; Slack wax; [A complex combination of hydrocarbons obtained by the treatment of low-melting petroleum slack wax with bentonite for removal of trace polar constituents and impurities. It consists predomina |
97863-05-3 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-252-00-9 |
Slack wax (petroleum), low-melting, silicic acid-treated; Slack wax; [A complex combination of hydrocarbons obtained by the treatment of low-melting petroleum slack wax with silicic acid for the removal of trace polar constituents and impurities. It con |
97863-06-4 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-253-00-4 |
Slack wax (petroleum), carbon-treated; Slack wax; [A complex combination of hydrocarbons obtained by treatment of petroleum slack wax with activated charcoal for the removal of trace polar constituents and impurities.] |
100684-49-9 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-254-00-X |
Petrolatum; Petrolatum; [A complex combination of hydrocarbons obtained as a semi-solid from dewaxing paraffinic residual oil. It consists predominantly of saturated crystalline and liquid hydrocarbons having carbon numbers predominantly greater than C2 |
8009-03-8 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-255-00-5 |
Petrolatum (petroleum), oxidized; Petrolatum; [A complex combination of organic compounds, predominantly high molecular weight carboxylic acids, obtained by the air oxidation of petrolatum.] |
64743-01-7 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-256-00-0 |
Petrolatum (petroleum), alumina-treated; Petrolatum; [A complex combination of hydrocarbons obtained when petrolatum is treated with Al2O3 to remove polar components and impurities. It consists predominantly of saturated, crystalline, and liquid hydroca |
85029-74-9 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-257-00-6 |
Petrolatum (petroleum), hydrotreated; Petrolatum; [A complex combination of hydrocarbons obtained as a semi-solid from dewaxed paraffinic residual oil treated with hydrogen in the presence of a catalyst. It consists predominantly of saturated microcryst |
92045-77-7 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-258-00-1 |
Petrolatum (petroleum), carbon-treated; Petrolatum; [A complex combination of hydrocarbons obtained by the treatment of petroleum petrolatum with activated carbon for the removal of trace polar constituents and impurities. It consists predominantly of s |
97862-97-0 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-259-00-7 |
Petrolatum (petroleum), silicic acid-treated; Petrolatum; [A complex combination of hydrocarbons obtained by the treatment of petroleum petrolatum with silicic acid for the removal of trace polar constituents and impurities. It consists predominantly of |
97862-98-1 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-260-00-2 |
Petrolatum (petroleum), clay-treated; Petrolatum; [A complex combination of hydrocarbons obtained by treatment of petrolatum with bleaching earth for the removal of traces of polar constituents and impurities. It consists predominantly of hydrocarbons h |
100684-33-1 |
Carc. 1B |
H350 |
|
N |
CLP00/ATP02 |
| 649-261-00-8 |
Gasoline, natural; Low boiling point naphtha; [A complex combination of hydrocarbons separated from natural gas by processes such as refrigeration or absorption. It consists predominantly of saturated aliphatic hydrocarbons having carbon numbers predom |
8006-61-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-262-00-3 |
Naphtha; Low boiling point naphtha; [Refined, partly refined, or unrefined petroleum products produced by the distillation of natural gas. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C6 and boiling in the |
8030-30-6 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-263-00-9 |
Ligroine; Low boiling point naphtha; [A complex combination of hydrocarbons obtained by the fractional distillation of petroleum. This fraction boils in a range of approximately 20°C to 135°C (58°F to 275°F).] |
8032-32-4 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-264-00-4 |
Naphtha (petroleum), heavy straight-run; Low boiling point naphtha; [A complex combination of hydrocarbons produced by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling |
64741-41-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-265-00-X |
Naphtha (petroleum), full-range straight-run; Low boiling point naphtha; [A complex combination of hydrocarbons produced by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and bo |
64741-42-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-266-00-5 |
Naphtha (petroleum), light straight-run; Low boiling point naphtha; [A complex combination of hydrocarbons produced by distillation of crude oil. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 |
64741-46-4 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-267-00-0 |
Solvent naphtha (petroleum), light aliph.; Low boiling point naphtha; [A complex combination of hydrocarbons obtained from the distillation of crude oil or natural gasoline. It consists predominantly of saturated hydrocarbons having carbon numbers pred |
64742-89-8 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-268-00-6 |
Distillates (petroleum), straight-run light; Low boiling point naphtha; [A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C2 through C7 and |
68410-05-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-269-00-1 |
Gasoline, vapor-recovery; Low boiling point naphtha; [A complex combination of hydrocarbons separated from the gases from vapor recovery systems by cooling. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 |
68514-15-8 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-270-00-7 |
Gasoline, straight-run, topping-plant; Low boiling point naphtha; [A complex combination of hydrocarbons produced from the topping plant by the distillation of crude oil. It boils in the range of approximately 36.1°C to 193.3°C (97°F to 380°F).] |
68606-11-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-271-00-2 |
Naphtha (petroleum), unsweetened; Low boiling point naphtha; [A complex combination of hydrocarbons produced from the distillation of naphtha streams from various refinery processes. It consists of hydrocarbons having carbon numbers predominantly in th |
68783-12-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-272-00-8 |
Distillates (petroleum), light straight-run gasoline fractionation stabilizer overheads; Low boiling point naphtha; [A complex combination of hydrocarbons obtained by the fractionation of light straight-run gasoline. It consists of saturated aliphatic |
68921-08-4 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-273-00-3 |
Naphtha (petroleum), heavy straight run, arom.-contg.; Low boiling point naphtha; [A complex combination of hydrocarbons obtained from a distillation process of crude petroleum. It consists predominantly of hydrocarbons having carbon numbers in the ran |
101631-20-3 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-274-00-9 |
Naphtha (petroleum), full-range alkylate; Low boiling point modified naphtha; [A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 |
64741-64-6 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-275-00-4 |
Naphtha (petroleum), heavy alkylate; Low boiling point modified naphtha; [A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 to C5 |
64741-65-7 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-276-00-X |
Naphtha (petroleum), light alkylate; Low boiling point modified naphtha; [A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 throu |
64741-66-8 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-277-00-5 |
Naphtha (petroleum), isomerization; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained from catalytic isomerization of straight chain paraffinic C4 through C6 hydrocarbons. It consists predominantly of saturated hydroca |
64741-70-4 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-278-00-0 |
Naphtha (petroleum), solvent-refined light; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon number |
64741-84-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-279-00-6 |
Naphtha (petroleum), solvent-refined heavy; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon number |
64741-92-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-280-00-1 |
Raffinates (petroleum), catalytic reformer ethylene glycol-water countercurrent exts.; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained as the raffinate from the UDEX extraction process on the catalytic reformer stream |
68410-71-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-281-00-7 |
Raffinates (petroleum), reformer, Lurgi unit-sepd.; Low boiling point modified naphtha; [The complex combination of hydrocarbons obtained as a raffinate from a Lurgi separation unit. It consists predominantly of non-aromatic hydrocarbons with various s |
68425-35-4 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-282-00-2 |
Naphtha (petroleum), full-range alkylate, butane-contg.; Low boiling point modified naphta; [A complex combination of hydrocarbons produced by the distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbo |
68527-27-5 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-283-00-8 |
Distillates (petroleum), naphtha steam cracking-derived, solvent-refined light hydrotreated; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained as the raffinates from a solvent extraction process of hydrotreated light di |
91995-53-8 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-284-00-3 |
Naphtha (petroleum), C4-12, butane-alkylate, isooctane-rich; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained by alkylation of butanes. It consists predominantly of hydrocarbons having carbon numbers predominantly in |
92045-49-3 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-285-00-9 |
Hydrocarbons, hydrotreated light naphtha distillates, solvent-refined; Low boiling point modified naphtha; [A combination of hydrocarbons obtained from the distillation of hydrotreated naphtha followed by a solvent extraction and distillation process. |
92045-55-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-286-00-4 |
Naphtha (petroleum), isomerization, C6-fraction; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained by distillation of a gasoline which has been catalytically isomerized. It consists predominantly of hexane isomers boil |
92045-58-4 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-287-00-X |
Hydrocarbons, C6-7, naphtha-cracking, solvent-refined; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained by the sorption of benzene from a catalytically fully hydrogenated benzene-rich hydrocarbon cut that was distillat |
92045-64-2 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-288-00-5 |
Hydrocarbons, C6-rich, hydrotreated light naphtha distillates, solvent-refined; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained by distillation of hydrotreated naphtha followed by solvent extraction. It consists pred |
101316-67-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-289-00-0 |
Naphtha (petroleum), heavy catalytic cracked; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons produced by a distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers pred |
64741-54-4 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-290-00-6 |
Naphtha (petroleum), light catalytic cracked; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers pr |
64741-55-5 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-291-00-1 |
Hydrocarbons, C3-11, catalytic cracker distillates; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons produced by the distillations of products from a catalytic cracking process. It consists of hydrocarbons having carbon num |
68476-46-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-292-00-7 |
Naphtha (petroleum), catalytic cracked light distd.; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon num |
68783-09-5 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-293-00-2 |
Distillates (petroleum), naphtha steam cracking-derived, hydrotreated light arom.; Low boiling point cat-cracked naphtha.; [A complex combination of hydrocarbons obtained by treating a light distillate from steam-cracked naphtha. It consists predominan |
91995-50-5 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-294-00-8 |
Naphtha (petroleum), heavy catalytic cracked, sweetened; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons obtained by subjecting a catalytic cracked petroleum distillate to a sweetening process to convert mercaptans or to re |
92045-50-6 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-295-00-3 |
Naphtha (petroleum), light catalytic cracked sweetened; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons obtained by subjecting naphtha from a catalytic cracking process to a sweetening process to convert mercaptans or to re |
92045-59-5 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-296-00-9 |
Hydrocarbons, C8-12, catalytic-cracking, chem. neutralized; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons produced by the distillation of a cut from the catalytic cracking process, having undergone an alkaline washing. I |
92128-94-4 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-297-00-4 |
Hydrocarbons, C8-12, catalytic cracker distillates; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons obtained by distillation of products from a catalytic cracking process. It consists predominantly of hydrocarbons having ca |
101794-97-2 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-298-00-X |
Hydrocarbons, C8-12, catalytic cracking, chem. neutralized, sweetened; Low boiling point cat-cracked naphtha |
101896-28-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-299-00-5 |
Naphtha (petroleum), light catalytic reformed; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons produced from the distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbe |
64741-63-5 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-300-00-9 |
Naphtha (petroleum), heavy catalytic reformed; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons produced from the distillation of products from a catalytic reforming process. It consists of predominantly aromatic hydrocarb |
64741-68-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-301-00-4 |
Distillates (petroleum), catalytic reformed depentanizer; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons from the distillation of products from a catalytic reforming process. It consists predominantly of aliphatic hydroc |
68475-79-6 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-302-00-X |
Hydrocarbons, C2-6, C6-8 catalytic reformer; Low boiling point cat-reformed naphtha |
68476-47-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-303-00-5 |
Residues (petroleum), C6-8 catalytic reformer; Low boiling point cat-reformed naphtha; [A complex residuum from the catalytic reforming of C6-8 feed. It consists of hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] |
68478-15-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-304-00-0 |
Naphtha (petroleum), light catalytic reformed, arom.-free; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons obtained from distillation of products from a catalytic reforming process. It consists predominantly of hydrocarbo |
68513-03-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-305-00-6 |
Distillates (petroleum), catalytic reformed straight-run naphtha overheads; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha followed by the fractionation of the t |
68513-63-3 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-306-00-1 |
Petroleum products, hydrofiner-powerformer reformates; Low boiling point cat-reformed naphtha; [The complex combination of hydrocarbons obtained in a hydrofiner-powerformer process and boiling in a range of approximately 27°C to 210°C (80°F to 410°F).] |
68514-79-4 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-307-00-7 |
Naphtha (petroleum), full-range reformed; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons produced by the distillation of the products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers |
68919-37-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-308-00-2 |
Naphtha (petroleum), catalytic reformed; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers predo |
68955-35-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-309-00-8 |
Distillates (petroleum), catalytic reformed hydrotreated light, C8-12 arom. fraction; Low boiling point cat-reformed naphtha; [A complex combination of alkylbenzenes obtained by the catalytic reforming of petroleum naphtha. It consists predominantly of |
85116-58-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-310-00-3 |
Aromatic hydrocarbons, C8, catalytic reforming-derived; Low boiling point cat-reformed naphtha |
91995-18-5 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-311-00-9 |
Aromatic hydrocarbons, C7-12, C8-rich; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons obtained by separation from the platformate-containing fraction. It consists predominantly of aromatic hydrocarbons having carbon numb |
93571-75-6 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-312-00-4 |
Gasoline, C5-11, high-octane stabilised reformed; Low boiling point cat-reformed naphtha; [A complex high octane combination of hydrocarbons obtained by the catalytic dehydrogenation of a predominantly naphthenic naphtha. It consists predominantly of a |
93572-29-3 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-313-00-X |
Hydrocarbons, C7-12, C≥9-arom.-rich, reforming heavy fraction; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons obtained by separation from the platformate-containing fraction. It consists predominantly of nonaromatic hydr |
93572-35-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-314-00-5 |
Hydrocarbons, C5-11, nonaroms.-rich, reforming light fraction; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons obtained by separation from the platformate-containing fraction. It consists predominantly of nonaromatic hydr |
93572-36-2 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-315-00-0 |
Foots oil (petroleum), silicic acid-treated; Foots oil; [A complex combination of hydrocarbons obtained by the treatment of Foots oil with silicic acid for removal of trace constituents and impurities. It consists predominantly of straight chain hydroca |
97862-77-6 |
Carc. 1B, |
H350, H304 |
|
L |
CLP00/ATP02 |
| 649-316-00-6 |
Naphtha (petroleum), light thermal cracked; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons from distillation of products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having |
64741-74-8 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-317-00-1 |
Naphtha (petroleum), heavy thermal cracked; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons from distillation of the products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons hav |
64741-83-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-318-00-7 |
Distillates (petroleum), heavy arom.; Low boiling point thermally cracked naphtha; [The complex combination of hydrocarbons from the distillation of the products from the thermal cracking of ethane and propane. This higher boiling fraction consists pre |
67891-79-6 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-319-00-2 |
Distillates (petroleum), light arom.; Low boiling point thermally cracked naphtha; [The complex combination of hydrocarbons from the distillation of the products from the thermal cracking of ethane and propane. This lower boiling fraction consists pred |
67891-80-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-320-00-8 |
Distillates (petroleum), naphtha-raffinate pyrolyzate-derived, gasoline-blending; Low boiling point thermally cracked naphtha; [The complex combination of hydrocarbons obtained by the pyrolysis fractionation at 816°C (1500°F) of naphtha and raffinate. |
68425-29-6 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-321-00-3 |
Aromatic hydrocarbons, C6-8, naphtha-raffinate pyrolyzate-derived; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons obtained by the fractionation pyrolysis at 816°C (1500°F) of naphtha and raffinate. It consists predo |
68475-70-7 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-322-00-9 |
Distillates (petroleum), thermal cracked naphtha and gas oil; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons produced by distillation of thermally cracked naphtha and/or gas oil. It consists predominantly of olefini |
68603-00-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-323-00-4 |
Distillates (petroleum), thermal cracked naphtha and gas oil, C5-dimer-contg.; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons produced by the extractive distillation of thermal cracked naphtha and/or gas oil. It con |
68603-01-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-324-00-X |
Distillates (petroleum), thermal cracked naphtha and gas oil, extractive; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons produced by the extractive distillation of thermal cracked naphtha and/or gas oil. It consists |
68603-03-2 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-325-00-5 |
Distillates (petroleum), light thermal cracked, debutanized arom.; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons produced by the distillation of products from a thermal cracking process. It consists predominantly o |
68955-29-3 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-326-00-0 |
Naphtha (petroleum), light thermal cracked, sweetened; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate from the high temperature thermal cracking of heavy oil fractions to |
92045-65-3 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-327-00-6 |
Naphtha (petroleum), hydrotreated heavy; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon |
64742-48-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-328-00-1 |
Naphtha (petroleum), hydrotreated light; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon |
64742-49-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-329-00-7 |
Naphtha (petroleum), hydrodesulfurized light; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists of hydrocarbons having carbon numbers predominantly in |
64742-73-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-330-00-2 |
naphtha (petroleum), hydrodesulphurized heavy; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons
obtained from a catalytic hydrodesulfurization process. It consists of hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90 °C to 230 °C (194 °F to 446 °F).] |
64742-82-1 |
Carc. 1B, Muta. 1B, STOT RE 1, Asp. Tox. 1 |
H350, H340, H372 (central nervous system), H304 |
|
P |
CLP00/ATP02/ATP05 |
| 649-331-00-8 |
Distillates (petroleum), hydrotreated middle, intermediate boiling; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by the distillation of products from a middle distillate hydrotreating process. It consists |
68410-96-8 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-332-00-3 |
Distillates (petroleum), light distillate hydrotreating process, low-boiling; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by the distillation of products from the light distillate hydrotreating process. I |
68410-97-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-333-00-9 |
Distillates (petroleum), hydrotreated heavy naphtha, deisohexanizer overheads; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by distillation of the products from a heavy naphtha hydrotreating process. It co |
68410-98-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-334-00-4 |
Solvent naphtha (petroleum), light arom., hydrotreated; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists predominantly |
68512-78-7 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-335-00-X |
Naphtha (petroleum), hydrodesulfurized thermal cracked light; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by fractionation of hydrodesulfurized thermal cracker distillate. It consists predominantly of hyd |
85116-60-5 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-336-00-5 |
Naphtha (petroleum), hydrotreated light, cycloalkane-contg.; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained from the distillation of a petroleum fraction. It consists predominantly of alkanes and cycloalkane |
85116-61-6 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-337-00-0 |
Naphtha (petroleum), heavy steam-cracked, hydrogenated; Low boiling point hydrogen treated naphtha |
92045-51-7 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-338-00-6 |
Naphtha (petroleum), hydrodesulfurized full-range; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists predominantly of hydrocarbons having carbon number |
92045-52-8 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-339-00-1 |
Naphtha (petroleum), hydrotreated light steam-cracked; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by treating a petroleum fraction, derived from a pyrolysis process, with hydrogen in the presence of a cat |
92045-57-3 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-340-00-7 |
Hydrocarbons, C4-12, naphtha-cracking, hydrotreated; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by distillation from the product of a naphtha steam cracking process and subsequent catalytic selective hydr |
92045-61-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-341-00-2 |
Solvent naphtha (petroleum), hydrotreated light naphthenic; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists predominan |
92062-15-2 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-342-00-8 |
Naphtha (petroleum), light steam-cracked, hydrogenated; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons produced from the separation and subsequent hydrogenation of the products of a steam-cracking process to produce e |
93165-55-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-343-00-3 |
Hydrocarbons, C6-11, hydrotreated, dearomatized; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained as solvents which have been subjected to hydrotreatment in order to convert aromatics to naphthenes by catalytic |
93763-33-8 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-344-00-9 |
Hydrocarbons, C9-12, hydrotreated, dearomatized; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained as solvents which have been subjected to hydrotreatment in order to convert aromatics to naphthenes by catalytic |
93763-34-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-345-00-4 |
Stoddard solvent; Low boiling point naphtha - unspecified; [A colorless, refined petroleum distillate that is free from rancid or objectionable odors and that boils in a range of approximately 148.8°C to 204.4°C. (300°F to 400°F).] |
8052-41-3 |
Carc. 1B, Muta. 1B, STOT RE 1, Asp. Tox. 1 |
H350, H340, H372 (central nervous system), H304 |
|
P |
CLP00/ATP02/ATP05 |
| 649-346-00-X |
Natural gas condensates (petroleum); Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons separated as a liquid from natural gas in a surface separator by retrograde condensation. It consists mainly of hydrocarbons having car |
64741-47-5 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-347-00-5 |
Natural gas (petroleum), raw liq. mix; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons separated as a liquid from natural gas in a gas recycling plant by processes such as refrigeration or absorption. It consists mainly |
64741-48-6 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-348-00-0 |
Naphtha (petroleum), light hydrocracked; Low boiling naphtha - unspecified; [A complex combination of hydrocarbons from distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers |
64741-69-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-349-00-6 |
Naphtha (petroleum), heavy hydrocracked; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons from distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon n |
64741-78-2 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-350-00-1 |
Naphtha (petroleum), sweetened; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum naphtha to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydr |
64741-87-3 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-351-00-7 |
Naphtha (petroleum), acid-treated; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the ran |
64742-15-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-352-00-2 |
Naphtha (petroleum), chemically neutralized heavy; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantl |
64742-22-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-353-00-8 |
Naphtha (petroleum), chemically neutralized light; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantl |
64742-23-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-354-00-3 |
Naphtha (petroleum), catalytic dewaxed; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from the catalytic dewaxing of a petroleum fraction. It consists predominantly of hydrocarbons having carbon numbers predom |
64742-66-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-355-00-9 |
Naphtha (petroleum), light steam-cracked; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the distillation of the products from a steam cracking process. It consists predominantly of unsaturated hydrocarbons |
64742-83-2 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-356-00-4 |
Solvent naphtha (petroleum), light arom.; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from distillation of aromatic streams. It consists predominantly of aromatic hydrocarbons having carbon numbers predomina |
64742-95-6 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-357-00-X |
Aromatic hydrocarbons, C6-10, acid-treated, neutralized; Low boiling point naphtha - unspecified |
68131-49-7 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-358-00-5 |
Distillates (petroleum), C3-5, 2-methyl-2-butene-rich; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons from the distillation of hydrocarbons usually ranging in carbon numbers from C3 through C5, predominantly isopentane a |
68477-34-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-359-00-0 |
Distillates (petroleum), polymd. steam-cracked petroleum distillates, C5-12 fraction; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from the distillation of polymerized steam-cracked petroleum distillate. It c |
68477-50-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-360-00-6 |
Distillates (petroleum), steam-cracked, C5-12 fraction; Low boiling point naphtha - unspecified; [A complex combination of organic compounds obtained by the distillation of products from a steam cracking process. It consists of unsaturated hydrocarbons |
68477-53-2 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-361-00-1 |
Distillates (petroleum), steam-cracked, C5-10 fraction, mixed with light steam-cracked petroleum naphtha C5 fraction; Low boiling point naphtha - unspecified |
68477-55-4 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-362-00-7 |
Extracts (petroleum), cold-acid, C4-6; Low boiling point naphtha - unspecified; [A complex combination of organic compounds produced by cold acid unit extraction of saturated and unsaturated aliphatic hydrocarbons usually ranging in carbon numbers from |
68477-61-2 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-363-00-2 |
Distillates (petroleum), depentanizer overheads; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from a catalytic cracked gas stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in |
68477-89-4 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-364-00-8 |
Residues (petroleum), butane splitter bottoms; Low boiling point naphtha - unspecified; [A complex residuum from the distillation of butane stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 through C6. |
68478-12-6 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-365-00-3 |
Residual oils (petroleum), deisobutanizer tower; Low boiling point naphtha - unspecified; [A complex residuum from the atmospheric distillation of the butane-butylene stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in |
68478-16-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-366-00-9 |
Naphtha (petroleum), full-range coker; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by the distillation of products from a fluid coker. It consists predominantly of unsaturated hydrocarbons having carbon numb |
68513-02-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-367-00-4 |
Naphtha (petroleum), steam-cracked middle arom.; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by the distillation of products from a steam-cracking process. It consists predominantly of aromatic hydrocarbons |
68516-20-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-368-00-X |
Naphtha (petroleum), clay-treated full-range straight-run; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons resulting from treatment of full-range straight-run naphtha with natural or modified clay, usually in a percolatio |
68527-21-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-369-00-5 |
Naphtha (petroleum), clay-treated light straight-run; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons resulting from treatment of light straight-run naphtha with a natural or modified clay, usually in a percolation proces |
68527-22-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-370-00-0 |
Naphtha (petroleum), light steam-cracked arom.; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by distillation of products from a steam-cracking process. It consists predominantly of aromatic hydrocarbons havin |
68527-23-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-371-00-6 |
Naphtha (petroleum), light steam-cracked, debenzenized; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by distillation of products from a steam-cracking process. It consists predominantly of hydrocarbons having |
68527-26-4 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-372-00-1 |
Naphtha (petroleum), arom.-contg.; Low boiling point naphtha - unspecified |
68603-08-7 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-373-00-7 |
Gasoline, pyrolysis, debutanizer bottoms; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from the fractionation of depropanizer bottoms. It consists of hydrocarbons having carbon numbers predominantly greater t |
68606-10-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-374-00-2 |
Naphtha (petroleum), light, sweetened; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consis |
68783-66-4 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-375-00-8 |
Natural gas condensates; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons separated and/or condensed from natural gas during transportation and collected at the wellhead and/or from the production, gathering, transmission, |
68919-39-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-376-00-3 |
Distillates (petroleum), naphtha unifiner stripper; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by stripping the products from the naphtha unifiner. It consists of saturated aliphatic hydrocarbons having car |
68921-09-5 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-377-00-9 |
Naphtha (petroleum), catalytic reformed light, arom.-free fraction; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons remaining after removal of aromatic compounds from catalytic reformed light naphtha in a selective absorp |
85116-59-2 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-378-00-4 |
Gasoline; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons consisting primarily of paraffins, cycloparaffins, aromatic and olefinic hydrocarbons having carbon numbers predominantly greater than C3 and boiling in the range |
86290-81-5 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-379-00-X |
Aromatic hydrocarbons, C7-8, dealkylation products, distn. residues; Low boiling point naphtha - unspecified |
90989-42-7 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-380-00-5 |
Hydrocarbons, C4-6, depentanizer lights, arom. hydrotreater; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained as first runnings from the depentanizer column before hydrotreatment of the aromatic charges. It consi |
91995-38-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-381-00-0 |
Distillates (petroleum), heat-soaked steam-cracked naphtha, C5-rich; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation of heat-soaked steam-cracked naphtha. It consists predominantly of hydrocarbon |
91995-41-4 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-382-00-6 |
Extracts (petroleum), catalytic reformed light naphtha solvent; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained as the extract from the solvent extraction of a catalytically reformed petroleum cut. It consists p |
91995-68-5 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-383-00-1 |
Naphtha (petroleum), hydrodesulfurized light, dearomatized; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation of hydrodesulfurized and dearomatized light petroleum fractions. It consists predominan |
92045-53-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-384-00-7 |
Naphtha (petroleum), light, C5-rich, sweetened; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum naphtha to a sweetening process to convert mercaptans or to remove acidic impurities. It |
92045-60-8 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-385-00-2 |
Hydrocarbons, C8-11, naphtha-cracking, toluene cut; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation from prehydrogenated cracked naphtha. It consists predominantly of hydrocarbons having carbon n |
92045-62-0 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-386-00-8 |
Hydrocarbons, C4-11, naphtha-cracking, arom.-free; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from prehydrogenated cracked naphtha after distillative separation of benzene- and toluene-containing hydrocarbon |
92045-63-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-387-00-3 |
Naphtha (petroleum), light heat-soaked, steam-cracked; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the fractionation of steam cracked naphtha after recovery from a heat soaking process. It consists predom |
92201-97-3 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-388-00-9 |
Distillates (petroleum), C6-rich; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from the distillation of a petroleum feedstock. It consists predominantly of hydrocarbons having carbon numbers of C5 through C7, |
93165-19-6 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-389-00-4 |
Gasoline, pyrolysis, hydrogenated; Low boiling point naphtha-unspecified; [A distillation fraction from the hydrogenation of pyrolysis gasoline boiling in the range of approximately 20°C to 200°C (68°F to 392°F).] |
94114-03-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-390-00-X |
Distillates (petroleum), steam-cracked, C8-12 fraction, polymd., distn. lights; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation of the polymerized C8 through C12 fraction from steam-cracked petrol |
95009-23-7 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-391-00-5 |
Extracts (petroleum) heavy naphtha solvent, clay-treated; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the treatment of heavy naphthic solvent petroleum extract with bleaching earth. It consists predominan |
97926-43-7 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-392-00-0 |
Naphtha (petroleum), light steam-cracked, debenzenized, thermally treated; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the treatment and distillation of debenzenized light steam-cracked petroleum naphtha. |
98219-46-6 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-393-00-6 |
Naphtha (petroleum), light steam-cracked, thermally treated; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the treatment and distillation of light steam-cracked petroleum naphtha. It consists predominantly |
98219-47-7 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-394-00-1 |
Distillates (petroleum), C7-9, C8-rich, hydrodesulfurized dearomatized; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the distillation of petroleum light fraction, hydrodesulfurized and dearomatized. It con |
101316-56-7 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-395-00-7 |
Hydrocarbons, C6-8, hydrogenated sorption-dearomatized, toluene raffination; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained during the sorptions of toluene from a hydrocarbon fraction from cracked gasoline treat |
101316-66-9 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-396-00-2 |
Naphtha (petroleum), hydrodesulfurised full-range coker; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurised coker distillate. It consists predominantly of hydrocarbons having |
101316-76-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-397-00-8 |
Naphtha (petroleum), sweetened light; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum naphtha to a sweetening process to convert mercaptans or to remove acidic impurities. It consists p |
101795-01-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-398-00-3 |
Hydrocarbons, C3-6, C5-rich, steam-cracked naphtha; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation of steam-cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers in th |
102110-14-5 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-399-00-9 |
Hydrocarbons, C5-rich, dicyclopentadiene-contg.; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation of the products from a steam-cracking process. It consists predominantly of hydrocarbons having ca |
102110-15-6 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-400-00-2 |
Residues (petroleum), steam-cracked light, arom.; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the distillation of the products of steam cracking or similar processes after taking off the very light product |
102110-55-4 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-401-00-8 |
Hydrocarbons, C≥5, C5-6-rich; Low boiling point naphtha - unspecified |
68476-50-6 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-402-00-3 |
Hydrocarbons, C5-rich; Low boiling point naphtha - unspecified |
68476-55-1 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-403-00-9 |
Aromatic hydrocarbons, C8-10; Low boiling point naphtha - unspecified |
90989-39-2 |
Carc. 1B, Muta. 1B, Asp. Tox. 1 |
H350, H340, H304 |
|
P |
CLP00/ATP02 |
| 649-404-00-4 |
Kerosine (petroleum); Straight run kerosine; [A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of app |
8008-20-6 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-405-00-X |
solvent naphtha (petroleum), medium aliph.; Straight run kerosine; [A complex combination of hydrocarbons obtained from the distillation of crude oil or natural gasoline. It consists predominantly of saturated hydrocarbons having carbon numbers redominantly in the range of C9 through C12 and boiling in the range of approximately 140 °C to 220 °C (284 °F to 428 °F).] |
64742-88-7 |
STOT RE 1, Asp. Tox. 1 |
H372 (central nervous system), H304 |
|
|
CLP00/ATP02/ATP05 |
| 649-406-00-5 |
Solvent naphtha (petroleum) heavy aliph.; Straight run kerosine; [A complex combination of hydrocarbons obtained from the distillation of crude oil or natural gasoline. It consists predominantly of saturated hydrocarbons having carbon numbers predominan |
64742-96-7 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-407-00-0 |
Kerosine (petroleum), straight-run wide-cut; Straight run kerosine; [A complex combination of hydrocarbons obtained as a wide cut hydrocarbon fuel cut from atmospheric distillation and boiling in the range of approximately 70 °C to 220 °C (158 °F to 428 |
92045-37-9 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-408-00-6 |
Distillates (petroleum), steam-cracked; Cracked kerosine; [A complex combination of hydrocarbons obtained by the distillation of the products from a steam cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers pred |
64742-91-2 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-409-00-1 |
Distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C8-10 fraction; Cracked kerosine; [A complex combination of hydrocarbons obtained by distilling cracked stripped steam-cracked distillates. It consists of hydro-carbons havin |
68477-39-4 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-410-00-7 |
Distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C10-12 fraction; Cracked kerosine; [A complex combination of hydrocarbons obtained by distilling cracked stripped steam-cracked distillates. It consists predominantly of arom |
68477-40-7 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-411-00-2 |
Distillates (petroleum), steam-cracked, C8-12 fraction; Cracked kerosine; [A complex combination of organic compounds obtained by the distillation of products from a steam cracking process. It consists predominantly of unsaturated hydrocarbons having ca |
68477-54-3 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-412-00-8 |
Kerosine (petroleum), hydrodesulfurized thermal cracked; Cracked kerosine; [A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized thermal cracker distillate. It consists predominantly of hydrocarbons predominantly in the |
85116-55-8 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-413-00-3 |
Aromtic hydrocarbons, C≥10, steam-cracking, hydrotreated; Cracked kerosine; [A complex combination of hydrocarbons produced by the distillation of the products from a steam cracking process treated with hydrogen in the presence of a catalyst. It consist |
90640-98-5 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-414-00-9 |
Naphtha (petroleum), steam-cracked, hydrotreated, C9-10-arom.-rich; Cracked kerosine; [A complex combination of hydrocarbons produced by the distillation of the products from a steam cracking process thereafter treated with hydrogen in the presence of a |
90641-13-7 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-415-00-4 |
Distillates (petroleum), thermal-cracked, alkylarom. hydrocarbon-rich; Cracked kerosine; [A complex combination of hydrocarbons obtained by distillation of thermal-cracking heavy tars. It consists predominantly of highly alkylated aromatic hydrocarbons |
101316-61-4 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-416-00-X |
Distillates (petroleum), catalytic cracked heavy tar light; Cracked kerosine; [A complex combination of hydrocarbons obtained by distillation of catalytic cracking heavy tars. It consists predominantly of highly alkylated aromatic hydrocarbons boiling i |
101631-13-4 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-417-00-5 |
Solvent naphtha (petroleum), hydrocracked heavy arom.; Cracked kerosine; [A complex combination of hydrocarbons obtained by the distillation of hydrocracked petroleum distillate. It consists predominantly of hydrocarbons having carbon numbers predominan |
101316-80-7 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-418-00-0 |
Distillates (petroleum), steam-cracked heavy tar light; Cracked kerosine; [A complex combination of hydrocarbons obtained by distillation of steam cracking heavy tars. It consists predominantly of highly alkylated aromatic hydrocarbons boiling in the ra |
101631-15-6 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-419-00-6 |
Distillates (petroleum), alkylate; Kerosine - unspecified; [A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 through C5. It cons |
64741-73-7 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-420-00-1 |
Extracts (petroleum), heavy naphtha solvent; Kerosine - unspecified; [A complex combination of hydrocarbons obtained as the extract from a solvent extraction process. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly |
64741-98-6 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-421-00-7 |
Distillates (petroleum), chemically neutralized light; Kerosine - unspecified; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range |
64742-31-0 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-422-00-2 |
Distillates (petroleum), hydrotreated light; Kerosine - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predomin |
64742-47-8 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-423-00-8 |
Kerosine (petroleum), hydrodesulfurized; Kerosine - unspecified; [A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons |
64742-81-0 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-424-00-3 |
Solvent naphtha (petroleum), heavy arom.; Kerosine - unspecified; [A complex combination of hydrocarbons obtained from distillation of aromatic streams. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range o |
64742-94-5 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-425-00-9 |
Naphtha (petroleum), heavy coker; Kerosine - unspecified; [A complex combination of hydrocarbons from the distillation of products from a fluid coker. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range |
68333-23-3 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-426-00-4 |
Naphtha (petroleum), catalytic reformed hydrodesulfurized heavy, arom. fraction; Kerosine - unspecified; [A complex combination of hydrocarbons produced by fractionation from catalytically reformed hydrodesulfurized naphtha. It consists predominantly of |
85116-57-0 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-427-00-X |
Kerosine (petroleum), sweetened; Kerosine - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of hydr |
91770-15-9 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-428-00-5 |
Kerosine (petroleum), solvent-refined sweetened; Kerosine - unspecified; [A complex combination of hydrocarbons obtained from a petroleum stock by solvent refining and sweetening and boiling in the range of approximately 150 °C to 260 °C (302 °F to 500 |
92045-36-8 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-429-00-0 |
Hydrocarbons, C9-16, hydrotreated, dearomatized; Kerosine - unspecified; [A complex combination of hydrocarbons obtained as solvents which have been subjected to hydrotreatment in order to convert aromatics to naphthenes by catalytic hydrogenation.] |
93763-35-0 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-430-00-6 |
Kerosine (petroleum), solvent-refined hydrodesulfurized; Kerosine - unspecified |
97488-94-3 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-431-00-1 |
Distillates (petroleum), hydrodesulfurized full-range middle coker; Kerosine - unspecified; [A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized coker distillate. It consists predominantly of hydrocarbons having carbon |
101316-58-9 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-432-00-7 |
Solvent naphtha (petroleum), hydrodesulfurized heavy arom.; Kerosine - unspecified; [A complex combination of hydrocarbons obtained by the catalytic hydrodesulfurization of a petroleum fraction. It consists predominantly of hydrocarbons having carbon nu |
101316-81-8 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-433-00-2 |
Solvent naphtha (petroleum), hydrodesulfurized medium; Kerosine - unspecified; [A complex combination of hydrocarbons obtained by the catalytic hydrodesulfurization of a petroleum fraction. It consists predominantly of hydrocarbons having carbon numbers |
101316-82-9 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-434-00-8 |
Kerosine (petroleum), hydrotreated; Kerosine - unspecified; [A complex combination of hydrocarbons obtained from the distillation of petroleum and subsequent hydrotreatment. It consists predominantly of alkanes, cycloalkanes and alkylbenzenes having car |
101631-19-0 |
Asp. Tox. 1 |
H304 |
|
|
CLP00/ATP02 |
| 649-435-00-3 |
Distillates (petroleum), light catalytic cracked; Cracked gasoil; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the r |
64741-59-9 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-436-00-9 |
Distillates (petroleum), intermediate catalytic cracked; Cracked gasoil; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly i |
64741-60-2 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-437-00-4 |
Distillates (petroleum), light hydrocracked; Cracked gasoil; [A complex combination of hydrocarbons from distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly i |
64741-77-1 |
Carc. 2 |
H351 |
|
|
CLP00/ATP02 |
| 649-438-00-X |
Distillates (petroleum), light thermal cracked; Cracked gasoil; [A complex combination of hydrocarbons from the distillation of the products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers pre |
64741-82-8 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-439-00-5 |
Distillates (petroleum), hydrodesulfurized light catalytic cracked; Cracked gasoil; [A complex combination of hydrocarbons obtained by treating light catalytic cracked distillates with hydrogen to convert organic sulfur to hydrogen sulfide which is remo |
68333-25-5 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-440-00-0 |
Distillates (petroleum), light steam-cracked naphtha; Cracked gasoil; [A complex combination of hydrocarbons from the multiple distillation of products from a steam cracking process. It consists of hydrocarbons having carbon numbers predominantly in the |
68475-80-9 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-441-00-6 |
Distillates (petroleum), cracked steam-cracked petroleum distillates; Cracked gasoil; [A complex combination of hydrocarbons produced by distilling cracked steam cracked distillate and/or its fractionation products. It consists of hydrocarbons having ca |
68477-38-3 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-442-00-1 |
Gas oils (petroleum), steam-cracked; Cracked gasoil; [A complex combination of hydrocarbons produced by distillation of the products from a steam cracking process. It consists of hydrocarbons having carbon numbers predominantly greater than C9 and boili |
68527-18-4 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-443-00-7 |
Distillates (petroleum), hydrodesulfurized thermal cracked middle; Cracked gasoil; [A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized themal cracker distillate stocks. It consists predominantly of hydrocarbons having |
85116-53-6 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-444-00-2 |
Gas oils (petroleum), thermal-cracked, hydrodesulfurized; Cracked gasoil |
92045-29-9 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-445-00-8 |
Residues (petroleum), hydrogenated steam-cracked naphtha; Cracked gasoil; [A complex combination of hydrocarbons obtained as a residual fraction from the distillation of hydrotreated steam-cracked naphtha. It consists predominantly of hydrocarbons boili |
92062-00-5 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-446-00-3 |
Residues (petroleum), steam-cracked naphtha distn.; Cracked gasoil; [A complex combination of hydrocarbons obtained as a column bottom from the separation of effluents from steam cracking naphtha at a high temperature. It boils in the range of approxima |
92062-04-9 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-447-00-9 |
Distillates (petroleum), light catalytic cracked, thermally degraded; Cracked gasoil; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process which has been used as a heat transfer fluid. It cons |
92201-60-0 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-448-00-4 |
Residues (petroleum), steam-cracked heat-soaked naphtha; Cracked gasoil; [A complex combination of hydrocarbons obtained as residue from the distillation of steam cracked heat soaked naphtha and boiling in the range of approximately 150 °C to 350 °C (30 |
93763-85-0 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-449-00-X |
Hydrocarbons, C16-20, solvent-dewaxed hydrocracked paraffinic distn. residue; Cracked gasoil; [A complex combination of hydrocarbons obtained by solvent dewaxing of a distillation residue from a hydrocracked paraffinic distillate. It consists predominan |
97675-88-2 |
Carc. 2 |
H351 |
|
|
CLP00/ATP02 |
| 649-450-00-5 |
Gas oils (petroleum), light vacuum, thermal-cracked hydrodesulfurized; Cracked gasoil; [A complex combination of hydrocarbons obtained by catalytic dehydrosulfurization of thermal-cracked light vacuum petroleum. It consists predominantly of hydrocarbons |
97926-59-5 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-451-00-0 |
Distillates (petroleum), hydrodesulfurized middle coker; Cracked gasoil; [A complex combination of hydrocarbons by fractionation from hydrodesulfurised coker distillate stocks. Is consists of hydro-carbons having carbon numbers predominantly in the rang |
101316-59-0 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-452-00-6 |
Distillates (petroleum), heavy steam-cracked; Cracked gasoil; [A complex combination of hydrocarbons obtained by distillation of steam cracking heavy residues. It consists predominantly of highly alkylated heavy aromatic hydrocarbons boiling in the rang |
101631-14-5 |
Carc. 1B |
H350 |
|
|
CLP00/ATP02 |
| 649-453-00-1 |
Distillates (petroleum), heavy hydrocracked; Baseoil - unspecified; [A complex combination of hydrocarbons from the distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers in t |
64741-76-0 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-454-00-7 |
Distillates (petroleum), solvent-refined heavy paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of saturated hydrocarbons having carbon numbe |
64741-88-4 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-455-00-2 |
Distillates (petroleum), solvent-refined light paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of saturated hydrocarbons having carbon numbe |
64741-89-5 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-456-00-8 |
Residual oils (petroleum), solvent deasphalted; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as the solvent soluble fraction from C3-C4 solvent deasphalting of a residuum. It consists of hydrocarbons having carbon numbers predo |
64741-95-3 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-457-00-3 |
Distillates (petroleum), solvent-refined heavy naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists of hydrocarbons having carbon numbers predominantly in the |
64741-96-4 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-458-00-9 |
Distillates (petroleum), solvent-refined light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists of hydrocarbons having carbon numbers predominantly in the |
64741-97-5 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-459-00-4 |
Residual oils (petroleum,) solvent-refined; Baseoil - unspecified; [A complex combination by hydrocarbons obtained as the solvent insoluble fraction from solvent refining of a residuum using a polar organic solvent such as phenol or furfural. It consist |
64742-01-4 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-460-00-X |
Distillates (petroleum), clay-treated paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove the tr |
64742-36-5 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-461-00-5 |
Distillates (petroleum), clay-treated light paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove |
64742-37-6 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-462-00-0 |
Residual oils (petroleum), clay-treated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treatment of a residual oil with a natural or modified clay in either a contacting or percolation process to remove the trace amounts of p |
64742-41-2 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-463-00-6 |
Distillates (petroleum), clay-treated heavy naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove |
64742-44-5 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-464-00-1 |
Distillates (petroleum), clay-treated light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove |
64742-45-6 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-465-00-7 |
Distillates (petroleum), hydrotreated heavy naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon number |
64742-52-5 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-466-00-2 |
Distillates (petroleum), hydrotreated light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon number |
64742-53-6 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-467-00-8 |
Distillates (petroleum), hydrotreated heavy paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon number |
64742-54-7 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-468-00-3 |
Distillates (petroleum), hydrotreated light paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon number |
64742-55-8 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-469-00-9 |
Distillates (petroleum), solvent-dewaxed light paraffinic; Baseoil - unspecified; [A complex comination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists predominantly of hydrocarbo |
64742-56-9 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-470-00-4 |
Residual oils (petroleum), hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly |
64742-57-0 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-471-00-X |
Residual oils (petroleum), solvent-dewaxed; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by removal of long, branched chain hydrocarbons from a residual oil by solvent crystallization. It consists of hydrocarbons having carbon |
64742-62-7 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-472-00-5 |
Distillates (petroleum), solvent-dewaxed heavy naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists of hydrocarbons having car |
64742-63-8 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-473-00-0 |
Distillates (petroleum), solvent-dewaxed light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists of hydrocarbons having car |
64742-64-9 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-474-00-6 |
Distillates (petroleum), solvent-dewaxed heavy paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists predominantly of hydrocarb |
64742-65-0 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-475-00-1 |
Naphthenic oils (petroleum), catalytic dewaxed heavy; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of |
64742-68-3 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-476-00-7 |
Naphthenic oils (petroleum), catalytic dewaxed light; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C |
64742-69-4 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-477-00-2 |
Paraffin oils (petroleum), catalytic dewaxed heavy; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C |
64742-70-7 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-478-00-8 |
Paraffin oils (petroleum), catalytic dewaxed light; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from a catalytic dewxing process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 |
64742-71-8 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-479-00-3 |
Naphthenic oils (petroleum), complex dewaxed heavy; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by removing straight chain paraffin hydrocarbons as a solid by treatment with an agent such as urea. It consists of hydrocarbons h |
64742-75-2 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-480-00-9 |
Naphthenic oils (petroleum), complex dewaxed light; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 |
64742-76-3 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-481-00-4 |
Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based, high-viscosity; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating light vacuum gas oil, heavy vacuum gas oil, and solvent deasphalted residual oil wit |
72623-85-9 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-482-00-X |
Lubricating oils (petroleum), C15-30, hydrotreated neutral oil-based; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating light vacuum gas oil and heavy vacuum gas oil with hydrogen in the presence of a catalyst in a two s |
72623-86-0 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-483-00-5 |
Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating light vacuum gas oil, heavy vacuum gas oil and solvent deasphalted residual oil with hydrogen in the |
72623-87-1 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-484-00-0 |
Lubricating oils; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from solvent extraction and dewaxing processes. It consists predominantly of saturated hydrocarbons having carbon numbers in the range C15 through C50.] |
74869-22-0 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-485-00-6 |
Distillates (petroleum), complex dewaxed heavy paraffinci; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by dewaxing heavy paraffinic distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in t |
90640-91-8 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-486-00-1 |
Distillates (petroleum), complex dewaxed light paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by dewaxing light paraffinic distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in t |
90640-92-9 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-487-00-7 |
Distillates (petroleum), solvent dewaxed heavy paraffinic, clay-treated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating dewaxed heavy paraffinic distillate with neutral or modified clay in either a contacting or perco |
90640-94-1 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-488-00-2 |
Hydrocarbons, C20-50, solvent dewaxed heavy paraffinic, hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons produced by treating dewaxed heavy paraffinic distillate with hydrogen in the presence of a catalyst. It consists predomi |
90640-95-2 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-489-00-8 |
Distillates (petroleum), solvent dewaxed light paraffinic, clay-treated; Baseoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of dewaxed light paraffinic distillate with natural or modified clay in either a contacting o |
90640-96-3 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-490-00-3 |
Distillates (petroleum), solvent dewaxed light paraffinic, hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons produced by treating a dewaxed light paraffinic distillate with hydrogen in the presence of a catalyst. It consists pr |
90640-97-4 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-491-00-9 |
Residual oils (petroleum), hydrotreated solvent dewaxed; Baseoil - unspecified |
90669-74-2 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-492-00-4 |
Residual oils (petroleum), catalytic dewaxed; Baseoil - unspecified |
91770-57-9 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-493-00-X |
Distillates (petroleum), dewaxed heavy paraffinic, hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from an intensive treatment of dewaxed distillate by hydrogenation in the presence of a catalyst. It consists predomi |
91995-39-0 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-494-00-5 |
Distillates (petroleum), dewaxed light paraffinic, hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from an intensive treatment of dewaxed distillate by hydrogenation in the presence of a catalyst. It consists predomi |
91995-40-3 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-495-00-0 |
Distillates (petroleum), hydrocracked solvent-refined, dewaxed; Baseoil - unspecified; [A complex combination of liquid hydrocarbons obtained by recrystallization of dewaxed hydrocracked solvent-refined petroleum distillates.] |
91995-45-8 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-496-00-6 |
Distillates (petroleum), solvent-refined light naphthenic, hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst and removing the aromatic hydroc |
91995-54-9 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-497-00-1 |
Lubricating oils (petroleum), C17-35, solvent-extd., dewaxed, hydrotreated; Baseoil - unspecified |
92045-42-6 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-498-00-7 |
Lubricating oils (petroleum), hydrocracked nonarom. solvent-deparaffined; Baseoil - unspecified |
92045-43-7 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-499-00-2 |
Residual oils (petroleum), hydrocracked acid-treated solvent-dewaxed; Baseoil - unspecified; [A complex combination of hydrocarbons produced by solvent removal of paraffins from the residue of the distillation of acid-treated, hydrocracked heavy paraffi |
92061-86-4 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-500-00-6 |
Paraffin oils (petroleum), solvent-refined dewaxed heavy; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from sulfur-containing paraffinic crude oil. It consists predominantly of a solvent refined deparaffinated lubricating oil w |
92129-09-4 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-501-00-1 |
Lubricating oils (petroleum), base oils, paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by refining of crude oil. It consists predominantly of aromatics, naphthenics and paraffinics and produces a finished oil with a |
93572-43-1 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-502-00-7 |
Hydrocarbons, hydrocracked paraffinic distn. residues, solvent-dewaxed; Baseoil - unspecified |
93763-38-3 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-503-00-2 |
Hydrocarbons, C20-50, residual oil hydrogenation vacuum distillate; Baseoil - unspecified |
93924-61-9 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-504-00-8 |
Distillates (petroleum), solvent-refined hydrotreated heavy, hydrogenated; Baseoil - unspecified |
94733-08-1 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-505-00-3 |
Distillates (petroleum), solvent-refined hydrocracked light; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent dearomatization of the residue of hydrocracked petroleum. It consists predominantly of hydrocarbons having car |
94733-09-2 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-506-00-9 |
Lubricating oils (petroleum), C18-40, solvent-dewaxed hydrocracked distillate-based; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent deparaffination of the distillation residue from hydrocracked petroleum. It consists p |
94733-15-0 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-507-00-4 |
Lubricating oils (petroleum), C18-40, solvent-dewaxed hydrogenated raffinate-based; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent deparaffination of the hydrogenated raffinate obtained by solvent extraction of a hydro |
94733-16-1 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-508-00-X |
Hydrocarbons, C13-30, arom.-rich, solvent-extd. naphthenic distillate; Baseoil - unspecified |
95371-04-3 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-509-00-5 |
Hydrocarbons, C16-32, arom. rich, solvent-extd. naphthenic distillate; Baseoil - unspecified |
95371-05-4 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-510-00-0 |
Hydrocarbons, C37-68, dewaxed deasphalted hydrotreated vacuum distn. residues; Baseoil - unspecified |
95371-07-6 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-511-00-6 |
Hydrocarbons, C37-65, hydrotreated deasphalted vacuum distn. residues; Baseoil - unspecified |
95371-08-7 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-512-00-1 |
Distillates (petroleum), hydrocracked solvent-refined light; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by the solvent treatment of a distillate from hydrocracked petroleum distillates. It consists predominantly of hydrocarbo |
97488-73-8 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-513-00-7 |
Distillates (petroleum), solvent-refined hydrogenated heavy; Baseoil - unspecified; [A complex combination of hydrocarbons, obtained by the treatment of a hydrogenated petroleum distillate with a solvent. It consists predominantly of hydrocarbons having |
97488-74-9 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-514-00-2 |
Lubricating oils (petroleum), C18-27, hydrocracked solvent-dewaxed; Baseoil - unspecified |
97488-95-4 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-515-00-8 |
Hydrocarbons, C17-30, hydrotreated solvent-deasphalted atm. distn. residue, distn. lights; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the treatment of a solvent |
97675-87-1 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-516-00-3 |
Hydrocarbons, C17-40, hydrotreated solvent-deasphalted distn. residue, vacuum distn. lights; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the catalytic hydrotreat |
97722-06-0 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-517-00-9 |
Hydrocarbons, C13-27, solvent-extd. light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by extraction of the aromatics from a light naphthenic distillate having a viscosity of 9.5cSt at 40 °C (104 °F). It consists pr |
97722-09-3 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-518-00-4 |
Hydrocarbons, C14-29, solvent-extd. light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by extraction of the aromatics from a light naphthenic distillate having a viscosity of 16cSt at 40 °C (104 °F). It consists pre |
97722-10-6 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-519-00-X |
Hydrocarbons, C27-42, dearomatized; Baseoil - unspecified |
97862-81-2 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-520-00-5 |
Hydrocarbons, C17-30, hydrotreated distillates, distn. lights; Baseoil - unspecified |
97862-82-3 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-521-00-0 |
Hydrocarbons, C27-45, naphthenic vacuum distn.; Baseoil - unspecified |
97862-83-4 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-522-00-6 |
Hydrocarbons, C27-45, dearomatized; Baseoil - unspecified |
97926-68-6 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-523-00-1 |
Hydrocarbons, C20-58, hydrotreated; Baseoil - unspecified |
97926-70-0 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-524-00-7 |
Hydrocarbons, C27-42, naphthenic; Baseoil - unspecified |
97926-71-1 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-525-00-2 |
Residual oils (petroleum), carbon-treated solvent-dewaxed; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by the treatment of solvent-dewaxed petroleum residual oils with activated charcoal for the removal of trace polar constitu |
100684-37-5 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-526-00-8 |
Residual oils (petroleum), clay-treated solvent-dewaxed; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treatment of solvent-dewaxed petroleum residual oils with bleaching earth for the removal of trace polar constituents and |
100684-38-6 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-527-00-3 |
Lubricating oils (petroleum), C >25, solvent-extd., deasphalted, dewaxed, hydrogenated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of vacuum distillation residues. It consists predomina |
101316-69-2 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-528-00-9 |
Lubricating oils (petroleum), C17-32, solvent-extd., dewaxed, hydrogenated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of atmospheric distillation residues. It consists predominantly of |
101316-70-5 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-529-00-4 |
Lubricating oils (petroleum), C20-35, solvent-extd., dewaxed, hydrogenated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of atmospheric distillation residues. It consists predominantly of |
101316-71-6 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-530-00-X |
Lubricating oils (petroleum), C24-50, solvent-extd., dewaxed, hydrogenated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of atmospheric distillation residues. It consists predominantly of |
101316-72-7 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-531-00-5 |
Extracts (petroleum), heavy naphthenic distillate solvent, arom. conc.; Distillate aromatic extract (treated); [An aromatic concentrate produced by adding water to heavy naphthenic distillate solvent extract and extraction solvent.] |
68783-00-6 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-532-00-0 |
Extracts (petroleum), solvent-refined heavy paraffinic distillate solvent; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as the extract from the re-extraction of solvent-refined heavy paraffinic distillate. It co |
68783-04-0 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-533-00-6 |
Extracts (petroleum), heavy paraffinic distillates, solvent-deasphalted; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as the extract from a solvent extraction of heavy paraffinic distillate.] |
68814-89-1 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-534-00-1 |
Extracts (petroleum), heavy naphthenic distillate solvent, hydrotreated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained by treating a heavy naphthenic distillate solvent extract with hydrogen in the presence of a |
90641-07-9 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-535-00-7 |
Extracts (petroleum), heavy paraffinic distillate solvent, hydrotreated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons produced by treating a heavy paraffinic distillate solvent extract with hydrogen in the presence of a |
90641-08-0 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-536-00-2 |
Extracts (petroleum), light paraffinic distillate solvent, hydrotreated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons produced by treating a light paraffinic distillate solvent extract with hydrogen in the presence of a |
90641-09-1 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-537-00-8 |
Extracts (petroleum), hydrotreated light paraffinic distillate solvent; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as the extract from solvent extraction of intermediate paraffinic top solvent distillate that |
91995-73-2 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-538-00-3 |
Extracts (petroleum), light naphthenic distillate solvent, hydrodesulfurized; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained by treating the extract, obtained from a solvent extraction process, with hydrogen in th |
91995-75-4 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-539-00-9 |
Extracts (petroleum), light paraffinic distillate solvent, acid-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as a fraction of the distillation of an extract from the solvent extraction of light paraffin |
91995-76-5 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-540-00-4 |
Extracts (petroleum), light paraffinic distillate solvent, hydrodesulfurized; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained by solvent extraction of a light paraffin distillate and treated with hydrogen to conver |
91995-77-6 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-541-00-X |
Extracts (petroleum), light vacuum gas oil solvent, hydrotreated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons, obtained by solvent extraction from light vacuum petroleum gas oils and treated with hydrogen in the presenc |
91995-79-8 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-542-00-5 |
Extracts (petroleum), heavy paraffinic distillate solvent, clay-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contact or |
92704-08-0 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-543-00-0 |
Extracts (petroleum), heavy naphthenic distillate solvent, hydrodesulfurized; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen s |
93763-10-1 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-544-00-6 |
Extracts (petroleum), solvent-dewaxed heavy paraffinic distillate solvent, hydrodesulfurized; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained from a solvent dewaxed petroleum stock by treating with hydrogen to conv |
93763-11-2 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-545-00-1 |
Extracts (petroleum), light paraffinic distillate solvent, carbon-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as a fraction from distillation of an extract recovered by solvent extraction of light para |
100684-02-4 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-546-00-7 |
Extracts (petroleum), light paraffinic distillate solvent, clay-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as a fraction from distillation of an extract recovered by solvent extraction of light paraff |
100684-03-5 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-547-00-2 |
Extracts (petroleum), light vacuum, gas oil solvent, carbon-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained by solvent extraction of light vacuum petroleum gas oil treated with activated charcoal for the r |
100684-04-6 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-548-00-8 |
Extracts (petroleum), light vacuum gas oil solvent, clay-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained by solvent extraction of light vacuum petroleum gas oils treated with bleaching earth for removal of |
100684-05-7 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-549-00-3 |
Foots oil (petroleum); Foots oil; [A complex combination of hydrocarbons obtained as the oil fraction from a solvent deoiling or a wax sweating process. It consists predominantly of branched chain hydrocarbons having carbon numbers predominantly in the |
64742-67-2 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 649-550-00-9 |
Foots oil (petroleum), hydrotreated; Foots oil |
92045-12-0 |
Carc. 1B |
H350 |
|
L |
CLP00/ATP02 |
| 650-002-00-6 |
turpentine, oil |
8006-64-2 |
Flam. Liq. 3, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Asp. Tox. 1, Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 2 |
H226, H332, H312, H302, H304, H319, H315, H317, H411 |
|
|
CLP00/ |
| 650-003-00-1 |
fenson (ISO); 4-chlorophenyl benzenesulphonate |
80-38-6 |
Acute Tox. 4 *, Eye Irrit. 2, Aquatic Chronic 2 |
H302, H319, H411 |
|
|
CLP00/ |
| 650-004-00-7 |
norbormide (ISO); 5-(α-hydroxy-α-2-pyridylbenzyl)-7-(α-2-pyridylbenzylidene)bicyclo [2.2.1] hept-5-ene-2,3-dicarboximide |
991-42-4 |
Acute Tox. 4 * |
H302 |
|
|
CLP00/ |
| 650-005-00-2 |
(2R,6aS,12aS)-1,2,6,6a,12,12a-hexahydro-2-isopropenyl-8,9-dimethoxychromeno[3,4-b]furo[2,3-h]chromen-6-one; rotenone |
83-79-4 |
Acute Tox. 3 *, Eye Irrit. 2, STOT SE 3, Skin Irrit. 2, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H319, H335, H315, H400, H410 |
|
|
CLP00/ |
| 650-006-00-8 |
benquinox (ISO); p-benzoquinone 1-benzoylhydrazone 4-oxime |
495-73-8 |
Acute Tox. 3 *, Acute Tox. 4 * |
H301, H312 |
|
|
CLP00/ |
| 650-007-00-3 |
chlordimeform (ISO); N2-(4-chloro-o-tolyl)-N1,N1-dimethylformamidine |
6164-98-3 |
Carc. 2, Acute Tox. 4 *, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H312, H302, H400, H410 |
|
|
CLP00/ |
| 650-008-00-9 |
drazoxolon (ISO); 4-(2-chlorophenylhydrazone)-3-methyl-5-isoxazolone |
5707-69-7 |
Acute Tox. 3 *, Aquatic Acute 1, Aquatic Chronic 1 |
H301, H400, H410 |
|
|
CLP00/ |
| 650-009-00-4 |
chlordimeform hydrochloride; N'-(4-chloro-o-tolyl)-N,N-dimethylformamidine monohydrochloride; N2-(4-chloro-o-tolyl)-N1,N1-dimethylformamidine hydorchloride |
19750-95-9 |
Carc. 2, Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H351, H302, H400, H410 |
|
|
CLP00/ |
| 650-010-00-X |
benzyl violet 4B; α-[4-(4-dimethylamino-α-{}{4-[ethyl(3-sodiosulphonatobenzyl)amino] phenyl}}benzylidene)cyclohexa-2,5-dienylidene(ethyl)ammonio]toluene-3-sulphonate |
1694-09-3 |
Carc. 2 |
H351 |
|
|
CLP00/ |
| 650-012-00-0 |
erionite |
12510-42-8 |
Carc. 1A |
H350 |
|
|
CLP00/ |
| 650-013-00-6 |
asbestos |
12001-28-4, 132207-32-0, 12172-73-5, 77536-66-4, 77536-68-6, 77536-67-5, 12001-29-5 |
Carc. 1A, STOT RE 1 |
H350, H372 ** |
|
|
CLP00/ |
| 650-014-00-1 |
diethyl 2,4-dihydroxycyclodisiloxane-2,4-diylbis(trimethylene)diphosphonate, tetrasodium salt, reaction products with disodium metasilicate |
- |
Skin Corr. 1B, Acute Tox. 4 * |
H314, H302 |
|
|
CLP00/ |
| 650-015-00-7 |
rosin; colophony |
8050-09-7, 8052-10-6, 73138-82-6 |
Skin Sens. 1 |
H317 |
|
|
CLP00/ |
| 650-016-00-2 |
Mineral wool, with the exception of those specified elsewhere in this Annex; [Man-made vitreous (silicate) fibres with random orientation with alkaline oxide and alkali earth oxide (Na2O+K2O+CaO+MgO+BaO) content greater than 18 % by weight] |
- |
Carc. 2 |
H351 |
|
A Q R |
CLP00/ATP01 |
| 650-017-00-8 |
Refractory Ceramic Fibres, Special Purpose Fibres, with the exception of those specified elsewhere in this Annex; [Man-made vitreous (silicate) fibres with random orientation with alkaline oxide and alkali earth oxide (Na2O+K2O+CaO+ MgO+BaO) content less |
- |
Carc. 1B |
H350i |
|
A R |
CLP00/ATP01 |
| 650-018-00-3 |
reaction product of: acetophenone, formaldehyde, cyclohexylamine, methanol and acetic acid |
- |
Flam. Liq. 3, Carc. 2, Skin Corr. 1B, Acute Tox. 4 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H226, H351, H314, H332, H317, H400, H410 |
|
|
CLP00/ |
| 650-031-00-4 |
bis(4-hydroxy-N-methylanilinium) sulphate |
55-55-0 |
Acute Tox. 4 *, STOT RE 2 *, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H373 **, H317, H400, H410 |
|
|
CLP00/ |
| 650-032-00-X |
cyproconazole (ISO); (2RS,3RS;2RS,3SR)-2-(4-chlorophenyl)-3-cyclopropyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol |
94361-06-5 |
Repr. 1B, Acute Tox. 3, STOT RE 2, Aquatic Acute 1, Aquatic Chronic 1 |
H360D, H301, H373 (liver), H400, H410 |
M=10, M=1 |
|
CLP00/ATP10 |
| 650-041-00-9 |
triasulfuron (ISO); 1-[2-(2-chloroethoxy)phenylsulfonyl]-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea |
82097-50-5 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 650-042-00-4 |
reaction product of: polyethylene-polyamine-(C16-C18)-alkylamides with monothio-(C2)-alkyl phosphonates |
- |
Eye Irrit. 2, Skin Irrit. 2, Skin Sens. 1, Aquatic Chronic 3 |
H319, H315, H317, H412 |
|
|
CLP00/ |
| 650-043-00-X |
reaction product of: 3,5-bis-tert-butylsalicylic acid and aluminiumsulfate |
- |
Acute Tox. 4 *, Aquatic Acute 1, Aquatic Chronic 1 |
H302, H400, H410 |
|
|
CLP00/ |
| 650-044-00-5 |
mixed linear and branched C14-15 alcohols ethoxylated, reaction product with epichlorohydrin |
158570-99-1 |
Skin Irrit. 2, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H317, H400, H410 |
|
|
CLP00/ |
| 650-045-00-0 |
reaction product of: 1,2,3-propanetricarboxylic acid, 2-hydroxy, diethyl ester, 1-propanol and zirconium tetra-n-propanolate |
- |
Flam. Liq. 2, Skin Irrit. 2, Eye Dam. 1, Aquatic Chronic 2 |
H225, H315, H318, H411 |
|
|
CLP00/ |
| 650-046-00-6 |
di(tetramethylammonium)(29H,31H-phthalocyanin-N29,N30,N31,N32)disulfonamide disulfonate, cuprate(2-)complex, derivates |
12222-04-7 |
Acute Tox. 4 *, STOT RE 2 *, Aquatic Chronic 2 |
H302, H373 **, H411 |
|
|
CLP00/ |
| 650-047-00-1 |
dibenzylphenylsulfonium hexafluoroantimonate |
134164-24-2 |
STOT RE 1, Acute Tox. 4 *, Eye Dam. 1, Skin Sens. 1, Aquatic Chronic 2 |
H372 **, H302, H318, H317, H411 |
|
|
CLP00/ |
| 650-048-00-7 |
reaction product of: borax, hydrogen peroxide, acetic acid anhydride and acetic acid |
- |
Org. Perox. D ****, Acute Tox. 4 *, Acute Tox. 4 *, Acute Tox. 4 *, Skin Corr. 1A, Aquatic Acute 1 |
H242, H332, H312, H302, H314, H400 |
|
|
CLP00/ |
| 650-049-00-2 |
2-alkoyloxyethyl hydrogen maleate, where alkoyl represents (by weight) 70 to 85 % unsaturated octadecoyl, 0.5 to 10 % saturated octadecoyl, and 2 to 18 % saturated hexadecoyl |
- |
Skin Irrit. 2, Eye Dam. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
H315, H318, H317, H400, H410 |
|
|
CLP00/ |
| 650-050-00-8 |
reaction mass of: 1-methyl-3-hydroxypropyl 3,5-[1,1-dimethylethyl]-4-hydroxydihydro-cinnamate and/or 3-hydroxybutyl 3,5-[1,1-dimethylethyl]-4-hydroxydihydrocinnamate; 1,3-butanediol bis[3-(3'-(1,1-dimethylethyl)4'-hydroxy-phenyl)propionate] isomers; 1,3 |
- |
Aquatic Chronic 2 |
H411 |
|
|
CLP00/ |
| 650-055-00-5 |
silver sodium zirconium hydrogenphosphate |
155925-27-2 |
Aquatic Acute 1, Aquatic Chronic 1 |
H400, H410 |
|
|
CLP00/ |
| 650-056-00-0 |
dibutylbis(pentane-2,4-dionato-O,O')tin |
22673-19-4 |
Repr. 1B, STOT RE 1 |
H360FD, H372 (immune system) |
|
|
ATP14 |
| 650-057-00-6 |
Margosa, ext. [cold-pressed oil of Azadirachta indica seeds without shells extracted with super-critical carbon dioxide] |
84696-25-3 |
Aquatic Chronic 3 |
H412 |
|
|
ATP15 |
| 650-058-00-1 |
Margosa, ext. [from the kernels of Azadirachta indica extracted with water and further processed with organic solvents] |
84696-25-3 |
Repr. 2, Skin Sens. 1, Aquatic Chronic 1 |
H361d, H317, H410 |
M = 10 |
|
ATP18 |
