|
|
|
|
|
|
|
Hinweis: Verwenden Sie die Schlüsselwörter 'nicht leer' und 'leer' (ohne Anführungszeichen) in Freitextfeldern, um nach Ergebnissen mit bzw. ohne Einträge zu suchen. |
001-001-00-9 |
hydrogen |
1333-74-0 |
F+; R12 |
|
|
|
001-002-00-4 |
aluminium lithium hydride |
16853-85-3 |
F; R15, C; R35 |
|
|
|
001-003-00-X |
sodium hydride |
7646-69-7 |
F; R15 |
|
|
|
001-004-00-5 |
calcium hydride |
7789-78-8 |
F; R15 |
|
|
|
003-001-00-4 |
lithium |
7439-93-2 |
F; R15, R14, C; R34 |
|
|
|
003-002-00-X |
n-hexyllithium |
21369-64-2 |
F; R15-17, R14, C; R35 |
|
|
|
003-003-00-5 |
(2-methylpropyl)lithium; isobutyllithium |
920-36-5 |
F; R15-17, R14, C; R35, R67, N; R50-53 |
|
|
|
004-001-00-7 |
beryllium |
7440-41-7 |
Carc. Cat. 2; R49, T+; R26, T; R25-48/23, Xi; R36/37/38, R43 |
|
E |
|
004-002-00-2 |
beryllium compounds with the exception of aluminium beryllium silicates, and with those specified elsewhere in this Annex |
- |
Carc. Cat. 2; R49, T+; R26, T; R25-48/23, Xi; R36/37/38, R43, N; R51-53 |
|
A E |
|
004-003-00-8 |
beryllium oxide |
1304-56-9 |
Carc. Cat. 2; R49, T+; R26, T; R25-48/23, Xi; R36/37/38, R43 |
|
E |
|
005-001-00-X |
boron trifluoride |
7637-07-2 |
R14, T+; R26, C; R35 |
|
|
|
005-002-00-5 |
boron trichloride |
10294-34-5 |
R14, T+; R26/28, C; R34 |
|
|
|
005-003-00-0 |
boron tribromide |
10294-33-4 |
R14, T+; R26/28, C; R35 |
|
|
|
005-004-00-6 |
trialkylboranes |
- |
F; R17, C; R34 |
|
A |
|
005-004-01-3 |
trialkylboranes, liquid |
- |
|
|
|
|
005-005-00-1 |
trimethyl borate |
121-43-7 |
R10, Xn; R21 |
|
|
|
005-006-00-7 |
dibutyltin hydrogen borate |
75113-37-0 |
Muta. Cat. 3; R68, Repr. Cat. 2; R60-61, T; R48/25, Xn; R21/22, Xi; R41, R43, N; R50-53 |
|
E |
|
005-007-00-2 |
boric acid; [1] boric acid, crude natural, containing not more than 85 per cent of H3BO3 calculated on the dry weight [2] |
10043-35-3 [1], 11113-50-1 [2] |
Repr. Cat. 2; R60-61 |
C ≥ 5,5 %: Repr. Cat. 2; R60-61 |
|
|
005-008-00-8 |
diboron trioxide; boric oxide |
1303-86-2 |
Repr. Cat. 2; R60-61 |
C ≥ 3,1 %: Repr. Cat. 2; R60-61 |
|
|
005-009-00-3 |
tetrabutylammonium butyltriphenylborate |
120307-06-4 |
R43, N; R50-53 |
|
|
|
005-010-00-9 |
N,N-dimethylanilinium tetrakis(pentafluorophenyl)borate |
118612-00-3 |
Carc. Cat. 3; R40, Xn; R22, Xi; R38-41 |
|
|
|
005-011-00-4 |
disodium tetraborate, anhydrous; boric acid, disodium salt; [1] tetraboron disodium heptaoxide, hydrate; [2] orthoboric acid, sodium salt [3] |
1330-43-4 [1], 12267-73-1 [2], 13840-56-7 [3] |
Repr. Cat. 2; R60-61 |
C ≥ 4,5 %: Repr. Cat. 2; R60-61 |
|
|
005-011-01-1 |
disodium tetraborate decahydrate; borax decahydrate |
1303-96-4 |
Repr. Cat. 2; R60-61 |
C ≥ 8,5 %: Repr. Cat. 2; R60-61 |
|
|
005-011-02-9 |
disodium tetraborate pentahydrate; borax pentahydrate |
12179-04-3 |
Repr. Cat. 2; R60-61 |
C ≥ 6,5 %: Repr. Cat. 2; R60-61 |
|
|
005-012-00-X |
diethyl{}{4-[1,5,5-tris(4-diethylaminophenyl)penta-2,4-dienylidene]cyclohexa-2,5-dienylidene}}ammonium butyltriphenylborate |
141714-54-7 |
R43, N; R50-53 |
|
|
|
005-013-00-5 |
diethylmethoxyborane |
7397-46-8 |
F; R17, Xn; R20/21/22-48/22, C; R34, R43, R53 |
|
|
|
005-014-00-0 |
4-formylphenylboronic acid |
87199-17-5 |
R43 |
|
|
|
005-015-00-6 |
1-chloromethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane bis(tetrafluoroborate) |
140681-55-6 |
Xn; R22, Xi; R41, R43, R52-53 |
|
|
|
005-016-00-1 |
tetrabutylammonium butyl tris-(4-tert-butylphenyl)borate |
- |
R53 |
|
|
|
005-017-00-7 |
sodium perborate; [1] perboric acid, sodium salt; perboric acid, sodium salt, monohydrate; sodium peroxometaborate; perboric acid (HBO(O2)), sodium salt, monohydrate; sodium peroxoborate; [containing < 0.1 % (w/w) of particles with an aerodynamic diamet |
15120-21-5 [1], 7632-04-4 [2], -, -, -, - |
O; R8, Repr. Cat. 2; R61, Repr. Cat. 3; R62, Xn; R22, Xi; R37-41 |
C ≥ 6,5 %: Repr. Cat. 2; R61, C ≥ 9 %: Repr. Cat. 3; R62, C ≥ 22%: Xi; R41, 14 % ≤ C < 22 %: Xi; R36 |
E |
|
005-017-01-4 |
sodium perborate; [1] perboric acid, sodium salt; perboric acid, sodium salt, monohydrate; sodium peroxometaborate; perboric acid (HBO(O2)), sodium salt, monohydrate; sodium peroxoborate; [containing ≥ 0.1 % (w/w) of particles with an aerodynamic diamet |
15120-21-5 [1], 7632-04-4 [2], -, -, -, - |
O; R8, Repr. Cat. 2; R61, Repr. Cat. 3; R62, T; R23, Xn; R22, Xi; R37-41 |
C ≥ 6,5 %: Repr. Cat. 2; R61, C ≥ 9 %: Repr. Cat. 3; R62, C ≥ 22%: Xi; R41, 14 % ≤ C < 22 %: Xi; R36 |
E |
|
005-018-00-2 |
perboric acid (H3BO2(O2)), monosodium salt trihydrate; [1] perboric acid, sodium salt, tetrahydrate; [2] perboric acid (HBO(O2)), sodium salt, tetrahydrate; sodium peroxoborate hexahydrate; [containing < 0.1 % (w/w) of particles with an aerodynamic dia |
13517-20-9 [1], 37244-98-7 [2], 10486-00-7 [3], - |
Repr. Cat. 2; R61, Repr. Cat. 3; R62, Xi; R37-41 |
C ≥ 10 %: Repr. Cat. 2; R61, C ≥ 14 %: Repr. Cat. 3; R62, C ≥ 36%: Xi; R41, 22 % ≤ C < 36 %: Xi; R36 |
|
|
005-018-01-X |
perboric acid (H3BO2(O2)), monosodium salt, trihydrate; [1] perboric acid, sodium salt, tetrahydrate; [2] perboric acid (HBO(O2)), sodium salt, tetrahydrate; sodium peroxoborate hexahydrate; [containing ≥ 0.1 % (w/w) of particles with an aerodynamic di |
13517-20-9 [1], 37244-98-7 [2], 10486-00-7 [3], - |
Repr. Cat. 2; R61, Repr. Cat. 3; R62, Xn; R20, Xi; R37-41 |
C ≥ 10 %: Repr. Cat. 2; R61, C ≥ 14 %: Repr. Cat. 3; R62, C ≥ 36%: Xi; R41, 22 % ≤ C < 36 %: Xi; R36 |
E |
|
005-019-00-8 |
perboric acid, sodium salt; [1] perboric acid, sodium salt, monohydrate; [2] perboric acid (HBO(O2)), sodium salt, monohydrate; sodium peroxoborate; [containing < 0.1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
11138-47-9 [1], 12040-72-1 [2], 10332-33-9 [3], - |
|
|
|
|
005-019-01-5 |
perboric acid, sodium salt; [1] perboric acid, sodium salt, monohydrate; [2] perboric acid (HBO(O2)), sodium salt, monohydrate; sodium peroxoborate; [containing ≥ 0.1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
11138-47-9 [1], 12040-72-1 [2], 10332-33-9 [3], - |
|
|
|
|
006-001-00-2 |
carbon monoxide |
630-08-0 |
F+; R12, Repr. Cat. 1; R61, T; R23-48/23 |
|
E |
|
006-002-00-8 |
phosgene; carbonyl chloride |
75-44-5 |
T+; R26, C; R34 |
|
|
|
006-003-00-3 |
carbon disulphide |
75-15-0 |
F; R11, Repr. Cat. 3; R62-63, T; R48/23, Xi; R36/38 |
C ≥ 1 %: Repr. Cat. 3; R62-63, C ≥ 1 %: T; R48/23, 0,2 % ≤ C < 1 %: Xn; R48/20 |
|
|
006-004-00-9 |
calcium carbide |
75-20-7 |
F; R15 |
|
|
|
006-005-00-4 |
thiram (ISO); tetramethylthiuram disulphide |
137-26-8 |
Xn; R20/22-48/22, Xi; R36/38, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
006-006-00-X |
hydrogen cyanide; hydrocyanic acid |
74-90-8 |
F+; R12, T+; R26, N; R50-53 |
|
|
|
006-006-01-7 |
hydrogen cyanide ...%; hydrocyanic acid ...% |
74-90-8 |
T+; R26/27/28, N; R50-53 |
|
B |
|
006-007-00-5 |
salts of hydrogen cyanide with the exception of complex cyanides such as ferrocyanides, ferricyanides and mercuric oxycyanide and those specified elsewhere in this Annex |
- |
T+; R26/27/28, R32, N; R50-53 |
|
A |
|
006-008-00-0 |
antu (ISO); 1-(1-naphthyl)-2-thiourea |
86-88-4 |
T+; R28, Carc. Cat. 3; R40 |
|
|
|
006-009-00-6 |
1-isopropyl-3-methylpyrazol-5-yl dimethylcarbamate; Isolan |
119-38-0 |
T+; R27/28 |
|
|
|
006-010-00-1 |
5,5-dimethyl-3-oxocyclohex-1-enyl dimethylcarbamate; 5,5-dimethyldihydroresorcinol dimethylcarbamate; Dimetan |
122-15-6 |
T; R25 |
|
|
|
006-011-00-7 |
carbaryl (ISO); 1-naphthyl methylcarbamate |
63-25-2 |
Carc. Cat. 3; R40, Xn; R20/22, N; R50 |
C ≥ 0,25 %: N; R50 |
|
|
006-012-00-2 |
ziram (ISO); zinc bis dimethyldithiocarbamate |
137-30-4 |
T+; R26, Xn; R22-48/22, Xi; R37-41, R43, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
006-013-00-8 |
metam-sodium (ISO); sodium methyldithiocarbamate |
137-42-8 |
Xn; R22, R31, C; R34, R43, N; R50-53 |
|
|
|
006-014-00-3 |
nabam (ISO); disodium ethylenebis(N,N'-dithiocarbamate) |
142-59-6 |
Xn; R22, Xi; R37, R43, N; R50-53 |
|
|
|
006-015-00-9 |
diuron (ISO); 3-(3,4-dichlorophenyl)-1,1-dimethylurea |
330-54-1 |
Carc. Cat. 3; R40, Xn; R22-48/22, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: N; R52-53 |
|
|
006-016-00-4 |
propoxur (ISO); 2-isopropyloxyphenyl N-methylcarbamate; 2-isopropoxyphenyl methylcarbamate |
114-26-1 |
T; R25, N; R50-53 |
|
|
|
006-017-00-X |
aldicarb (ISO); 2-methyl-2-(methylthio)propanal-O-(N-methylcarbamoyl)oxime |
116-06-3 |
T+; R26/28, T; R24, N; R50-53 |
|
|
|
006-018-00-5 |
aminocarb (ISO); 4-dimethylamino-3-tolyl methylcarbamate |
2032-59-9 |
T; R24/25, N; R50-53 |
|
|
|
006-019-00-0 |
di-allate (ISO); S-(2,3-dichloroallyl)-N,N-diisopropylthiocarbamate |
2303-16-4 |
Carc. Cat. 3; R40, Xn; R22, N; R50-53 |
|
|
|
006-020-00-6 |
barban (ISO); 4-chlorbut-2-ynyl N-(3-chlorophenyl)carbamate |
101-27-9 |
Xn; R22, R43, N; R50-53 |
|
|
|
006-021-00-1 |
linuron (ISO); 3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea |
330-55-2 |
Repr. Cat. 2; R61, Repr. Cat. 3; R62, Carc. Cat. 3; R40, Xn; R22-48/22, N; R50-53 |
|
E |
|
006-022-00-7 |
decarbofuran (ISO); 2,3-dihydro-2-methylbenzofuran-7-yl methylcarbamate |
1563-67-3 |
T; R23/24/25 |
|
|
|
006-023-00-2 |
mercaptodimethur (ISO); methiocarb (ISO); 3,5-dimethyl-4-methylthiophenyl N-methylcarbamate |
2032-65-7 |
T; R25, N; R50-53 |
|
|
|
006-024-00-8 |
proxan-sodium (ISO); sodium O-isopropyldithiocarbonate |
140-93-2 |
Xn; R22, Xi; R38, N; R51-53 |
|
|
|
006-025-00-3 |
allethrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; bioallethrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarb |
584-79-2 [1], 28434-00-6 [2], 84030-86-4 [3] |
Xn; R20/22, N; R50-53 |
|
C |
|
006-026-00-9 |
carbofuran (ISO); 2,3-dihydro-2,2-dimethylbenzofuran-7-yl N-methylcarbamate |
1563-66-2 |
T+; R26/28, N; R50-53 |
|
|
|
006-028-00-X |
dinobuton (ISO); 2-(1-methylpropyl)-4,6-dinitrophenyl isopropyl carbonate |
973-21-7 |
T; R25, N; R50-53 |
|
|
|
006-029-00-5 |
dioxacarb (ISO); 2-(1,3-dioxolan-2-yl)phenyl N-methylcarbamate |
6988-21-2 |
T; R25, N; R51-53 |
|
|
|
006-030-00-0 |
EPTC (ISO); S-ethyl dipropylthiocarbamate |
759-94-4 |
Xn; R22 |
|
|
|
006-031-00-6 |
formetanate (ISO); 3-[(EZ)-dimethylaminomethyleneamino]phenyl methylcarbamate |
22259-30-9 |
T+; R26/28, R43, N; R50-53 |
|
|
|
006-032-00-1 |
monolinuron (ISO); 3-(4-chlorophenyl)-1-methoxy-1-methylurea |
1746-81-2 |
Xn; R22-48/22, N; R50-53 |
|
|
|
006-033-00-7 |
metoxuron (ISO); 3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea |
19937-59-8 |
N; R50-53 |
|
|
|
006-034-00-2 |
pebulate (ISO); N-butyl-N-ethyl-S-propylthiocarbamate |
1114-71-2 |
Xn; R22, N; R51-53 |
|
|
|
006-035-00-8 |
pirimicarb (ISO); 5,6-dimethyl-2-dimethylamino-pyrimidin-4-yl N,N-dimethylcarbamate |
23103-98-2 |
T; R25, N; R50-53 |
|
|
|
006-036-00-3 |
benzthiazuron (ISO); 1-benzothiazol-2-yl-3-methylurea |
1929-88-0 |
Xn; R22 |
|
|
|
006-037-00-9 |
promecarb (ISO); 3-isopropyl-5-methylphenyl N-methylcarbamate |
2631-37-0 |
T; R25, N; R50-53 |
|
|
|
006-038-00-4 |
sulfallate (ISO); 2-chloroallyl N,N-dimethyldithiocarbamate |
95-06-7 |
Carc. Cat. 2; R45, Xn; R22, N; R50-53 |
|
E |
|
006-039-00-X |
tri-allate (ISO); S-2,3,3-trichloroallyl diisopropylthiocarbamate |
2303-17-5 |
Xn; R22-48/22, R43, N; R50-53 |
|
|
|
006-040-00-5 |
3-methylpyrazol-5-yl-dimethylcarbamate; monometilan |
2532-43-6 |
T; R23/24/25 |
|
|
|
006-041-00-0 |
dimethylcarbamoyl chloride |
79-44-7 |
Carc. Cat. 2; R45, T; R23, Xn; R22, Xi; R36/37/38 |
C ≥ 0,001 %: Carc. Cat. 2; R45 |
E |
|
006-042-00-6 |
monuron (ISO); 3-(4-chlorophenyl)-1,1-dimethylurea |
150-68-5 |
Carc. Cat. 3; R40, Xn; R22, N; R50-53 |
|
|
|
006-043-00-1 |
3-(4-chlorophenyl)-1,1-dimethyluronium trichloroacetate; monuron-TCA |
140-41-0 |
Xi; R36/38, Carc. Cat. 3; R40, N; R50-53 |
|
|
|
006-044-00-7 |
isoproturon (ISO); 3-(4-isopropylphenyl)-1,1-dimethylurea |
34123-59-6 |
Carc. Cat. 3; R40, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
006-045-00-2 |
methomyl (ISO); 1-(methylthio)ethylideneamino N-methylcarbamate |
16752-77-5 |
T+; R28, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
006-046-00-8 |
bendiocarb (ISO); 2,2-dimethyl-1,3-benzodioxol-4-yl N-methylcarbamate |
22781-23-3 |
T; R23/25, Xn; R21, N; R50-53 |
|
|
|
006-047-00-3 |
bufencarb (ISO); reaction mass of 3-(1-methylbutyl)phenyl N-methylcarbamate and 3-(1-ethylpropyl)phenyl N-methylcarbamate |
8065-36-9 |
T; R24/25, N; R50-53 |
|
|
|
006-048-00-9 |
ethiofencarb (ISO); 2-(ethylthiomethyl)phenyl N-methylcarbamate |
29973-13-5 |
Xn; R22, N; R50-53 |
|
|
|
006-049-00-4 |
dixanthogen; O,O-diethyl dithiobis(thioformate) |
502-55-6 |
Xn; R22 |
|
|
|
006-050-00-X |
1,1-dimethyl-3-phenyluronium trichloroacetate; fenuron-TCA |
4482-55-7 |
Xi; R38, N; R50-53 |
|
|
|
006-051-00-5 |
ferbam (ISO); iron tris(dimethyldithiocarbamate) |
14484-64-1 |
Xi; R36/37/38, N; R50-53 |
|
|
|
006-052-00-0 |
formetanate hydrochloride; 3-(N,N-dimethylaminomethyleneamino)phenyl N-methylcarbamate |
23422-53-9 |
T+; R26/28, R43, N; R50-53 |
|
|
|
006-053-00-6 |
isoprocarb (ISO); 2-isopropylphenyl N-methylcarbamate |
2631-40-5 |
Xn; R22, N; R50-53 |
|
|
|
006-054-00-1 |
mexacarbate (ISO); 3,5-dimethyl-4-dimethylaminophenyl N-methylcarbamate |
315-18-4 |
T+; R28, Xn; R21, N; R50-53 |
|
|
|
006-055-00-7 |
xylylcarb (ISO); 3,4-dimethylphenyl N-methylcarbamate; 3,4-xylyl methylcarbamate; MPMC |
2425-10-7 |
Xn; R22, N; R50-53 |
|
|
|
006-056-00-2 |
metolcarb (ISO); m-tolyl methylcarbamate; MTMC |
1129-41-5 |
Xn; R22, N; R51-53 |
|
|
|
006-057-00-8 |
nitrapyrin (ISO); 2-chloro-6-trichloromethylpyridine |
1929-82-4 |
Xn; R22, N; R51-53 |
|
|
|
006-058-00-3 |
noruron (ISO); 1,1-dimethyl-3-(perhydro-4,7-methanoinden-5-yl)urea |
2163-79-3 |
Xn; R22 |
|
|
|
006-059-00-9 |
oxamyl (ISO); N',N'-dimethylcarbamoyl(methylthio)methylenamine N-methylcarbamate |
23135-22-0 |
T+; R26/28, Xn; R21, N; R51-53 |
|
|
|
006-060-00-4 |
oxycarboxin (ISO); 2,3-dihydro-6-methyl-5-(N-phenylcarbamoyl)-1,4-oxothiine 4,4-dioxide |
5259-88-1 |
Xn; R22, R52-53 |
|
|
|
006-061-00-X |
S-ethyl N-(dimethylaminopropyl)thiocarbamatehydrochloride; prothiocarb hydrochloride |
19622-19-6 |
Xn; R22, N; R51-53 |
|
|
|
006-062-00-5 |
methyl 3,4-dichlorophenylcarbanilate; SWEP. |
1918-18-9 |
Xn; R22 |
|
|
|
006-063-00-0 |
thiobencarb (ISO); S-4-chlorobenzyl diethylthiocarbamate |
28249-77-6 |
Xn; R22, N; R50-53 |
|
|
|
006-064-00-6 |
thiofanox (ISO); 3,3-dimethyl-1-(methylthio)butanone-O-(N-methylcarbamoyl)oxime |
39196-18-4 |
T+; R27/28, N; R50-53 |
|
|
|
006-065-00-1 |
3-chloro-6-cyano-bicyclo(2,2,1)heptan-2-one-O-(N-methylcarbamoyl)oxime; triamid |
15271-41-7 |
T+; R28, T; R24, N; R51-53 |
|
|
|
006-066-00-7 |
vernolate (ISO); S-propyl dipropylthiocarbamate |
1929-77-7 |
Xn; R22, N; R51-53 |
|
|
|
006-067-00-2 |
XMC; 3,5-xylyl methylcarbamate |
2655-14-3 |
Xn; R22 |
|
|
|
006-068-00-8 |
diazomethane |
334-88-3 |
Carc. Cat. 2; R45 |
|
|
|
006-069-00-3 |
thiophanate-methyl (ISO); 1,2-di-(3-methoxycarbonyl-2-thioureido)benzene |
23564-05-8 |
Muta. Cat. 3; R68, Xn; R20, R43, N; R50-53 |
|
|
|
006-070-00-9 |
furmecyclox (ISO); N-cyclohexyl-N-methoxy-2,5-dimethyl-3-furamide |
60568-05-0 |
Carc. Cat. 3; R40, N; R50-53 |
|
|
|
006-071-00-4 |
cyclooct-4-en-1-yl methyl carbonate |
87731-18-8 |
R43 |
|
|
|
006-072-00-X |
prosulfocarb(ISO); S-benzyl N,N-dipropylthiocarbamate |
52888-80-9 |
Xn; R22, R43, N; R51-53 |
|
|
|
006-073-00-5 |
3-(dimethylamino)propylurea |
31506-43-1 |
Xi; R41 |
|
|
|
006-074-00-0 |
2-(3-(prop-1-en-2-yl)phenyl)prop-2-yl isocyanate |
2094-99-7 |
T+; R26, C; R34, Xn; R48/20, R42/43, N; R50-53 |
|
|
|
006-076-00-1 |
mancozeb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) complex with zinc salt |
8018-01-7 |
Repr. Cat. 3; R63, R43, N; R50 |
C ≥ 2,5 %: N; R50 |
|
|
006-077-00-7 |
maneb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) |
12427-38-2 |
Repr. Cat. 3; R63, Xn; R20, Xi; R36, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51/53, 0,025 % ≤ C < 0,25 %: R52/53 |
|
|
006-078-00-2 |
zineb (ISO); zinc ethylenebis(dithiocarbamate) (polymeric) |
12122-67-7 |
Xi; R37, R43 |
|
|
|
006-079-00-8 |
disulfiram; tetraethylthiuramdisulfide |
97-77-8 |
Xn; R22-48/22, R43, N; R50-53 |
|
|
|
006-080-00-3 |
tetramethylthiuram monosulphide |
97-74-5 |
Xn; R22, R43, N; R51-53 |
|
|
|
006-081-00-9 |
zinc bis(dibutyldithiocarbamate) |
136-23-2 |
Xi; R36/37/38, R43, N; R50-53 |
|
|
|
006-082-00-4 |
zinc bis(diethyldithiocarbamate) |
14324-55-1 |
Xn; R22, Xi; R36/37/38, R43, N; R50-53 |
|
|
|
006-083-00-X |
butocarboxim (ISO); 3-(methylthio)-2-butanone O-[(methylamino)carbonyl]oxime |
34681-10-2 |
R10, T; R23/24/25, Xi; R36, N; R50-53 |
|
|
|
006-084-00-5 |
carbosulfan (ISO); 2,3-dihydro-2,2-dimethyl-7-benzofuryl [(dibutylamino)thio]methylcarbamate |
55285-14-8 |
T+; R26, T; R25, R43, N; R50-53 |
|
|
|
006-085-00-0 |
fenobucarb (ISO); 2-butylphenyl methylcarbamate |
3766-81-2 |
Xn; R22, N; R50-53 |
|
|
|
006-086-00-6 |
ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate; fenoxycarb |
72490-01-8 |
N; R50-53 |
|
|
|
006-087-00-1 |
furathiocarb (ISO); 2,3-dihydro-2,2-dimethyl-7-benzofuryl 2,4-dimethyl-6-oxa-5-oxo-3-thia-2,4-diazadecanoate |
65907-30-4 |
T+; R26, T; R25, Xn; R48/22, Xi; R36/38, R43, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
006-088-00-7 |
benfuracarb (ISO); ethyl N-[2,3-dihydro-2,2-dimethylbenzofuran-7-yloxycarbonyl(methyl)aminothio]-N-isopropyl- β-alaninate |
82560-54-1 |
Repr. Cat. 3; R62, T; R23, Xn; R22, N; R50-53 |
|
|
|
006-090-00-8 |
2-(3-iodoprop-2-yn-1-yloxy)ethyl phenylcarbamate |
88558-41-2 |
Xn; R20, Xi; R41, R52-53 |
|
|
|
006-091-00-3 |
propineb (ISO); polymeric zinc propylenebis(dithiocarbamate) |
9016-72-2 |
Xn; R20-48/20/22, R43, N; R50 |
|
|
|
006-092-00-9 |
tert-butyl (1S)-N-[1-((2S)-2-oxiranyl)-2-phenylethyl]carbamate |
98737-29-2 |
N; R50-53 |
|
|
|
006-093-00-4 |
2,2'-dithio di(ethylammonium)-bis(dibenzyldithiocarbamate) |
- |
Xn; R22, R43, N; R50-53 |
|
|
|
006-094-00-X |
O-isobutyl-N-ethoxy carbonylthiocarbamate |
103122-66-3 |
R10, Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R22-48/22, R43, N; R51-53 |
|
E |
|
006-095-00-5 |
fosetyl-aluminium (ISO); aluminium triethyl triphosphonate |
39148-24-8 |
Xi; R41 |
|
|
|
006-096-00-0 |
chlorpropham (ISO); isopropyl 3-chlorocarbanilate |
101-21-3 |
Carc. Cat. 3; R40, Xn; R48/22, N; R51-53 |
|
|
|
006-097-00-6 |
1-phenyl-3-(p-toluenesulfonyl)urea |
13909-63-2 |
Xn; R22-48/22, R52-53 |
|
|
|
006-098-00-1 |
tert-butyl (1R,5S)-3-azabicyclo[3.1.0]hex-6-ylcarbamate |
134575-17-0 |
Xn; R22-48/22, Xi; R41, R43 |
|
|
|
006-099-00-7 |
N-(p-toluenesulfonyl)-N'-(3-(p-toluenesulfonyloxy)phenyl)urea; 3-({[(4-methylphenyl)sulfonyl]carbamoyl}amino)phenyl 4-methylbenzenesulfonate |
232938-43-1 |
N; R51-53 |
|
|
|
006-101-00-6 |
reaction mass of: N,N''-(methylenedi-4,1-phenylene)bis[N'-phenylurea]; N-(4-[[4-[[(phenylamino)carbonyl]amino]phenylmethyl]phenyl]-N'-cyclohexylurea; N,N''-(methylenedi-4,1-phenylene)bis[N'-cyclohexylurea] |
- |
R53 |
|
|
|
006-102-00-1 |
O-hexyl-N-ethoxycarbonylthiocarbamate |
- |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R22-48/22, R43, N; R51-53 |
|
E |
|
006-103-00-7 |
N,N''-(methylenedi-4,1-phenylene)bis[N'-octyl]urea |
- |
Xi; R41, R42, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
007-001-00-5 |
ammonia, anhydrous |
7664-41-7 |
R10 .tp., T; R23, C; R34, N; R50 |
|
|
|
007-001-01-2 |
ammonia ....% |
1336-21-6 |
C; R34, N; R50 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
B |
|
007-002-00-0 |
nitrogen dioxide; [1] dinitrogen tetraoxide [2] |
10102-44-0 [1], 10544-72-6 [2] |
O; R8, T+; R26, C; R34 |
C ≥ 10 %: T+; R26, 1 % ≤ C < 10 %: T; R23, 0,1 % ≤ C < 1 %: Xn; R20 |
5 |
|
007-003-00-6 |
chlormequat chloride (ISO); 2-chloroethyltrimethylammonium chloride |
999-81-5 |
Xn; R21/22 |
|
|
|
007-004-00-1 |
nitric acid ...% [C > 70 %] |
7697-37-2 |
Ox. Liq. 2, Acute Tox. 1, Skin Corr. 1A |
Ox. Liq. 2, H272: C ≥ 99 %, Ox. Liq. 3, H272: 70 % ≤ C < 99 % |
B |
CLP00/ATP15 |
007-006-00-2 |
ethyl nitrite |
109-95-5 |
E; R2, Xn; R20/21/22 |
|
|
|
007-007-00-8 |
ethyl nitrate |
625-58-1 |
E; R3 |
|
|
|
007-008-00-3 |
hydrazine |
302-01-2 |
R10, Carc. Cat. 2; R45, T; R23/24/25, C; R34, R43, N; R50-53 |
C ≥ 10 %: C; R34, 3 % ≤ C < 10 %: Xi; R36/38 |
E |
|
007-009-00-9 |
dicyclohexylammonium nitrite |
3129-91-7 |
Xn; R20/22 |
C ≥ 10 %: Xn; R20/22 |
|
|
007-010-00-4 |
sodium nitrite |
7632-00-0 |
O; R8, T; R25, N; R50 |
C ≥ 5 %: T; R25, 1 % ≤ C < 5 %: Xn; R22 |
|
|
007-011-00-X |
potassium nitrite |
7758-09-0 |
O; R8, T; R25, N; R50 |
C ≥ 5 %: T; R25, 1 % ≤ C < 5 %: Xn; R22 |
|
|
007-012-00-5 |
N,N-dimethylhydrazine |
57-14-7 |
F; R11, Carc. Cat. 2; R45, T; R23/25, C; R34, N; R51-53 |
|
E |
|
007-013-00-0 |
1,2-dimethylhydrazine |
540-73-8 |
Carc. Cat. 2; R45, T; R23/24/25, N; R51-53 |
C ≥ 0,01 %: Carc. Cat. 2; R45 |
E |
|
007-014-00-6 |
salts of hydrazine |
- |
Carc. Cat. 2; R45, T; R23/24/25, R43, N; R50-53 |
|
A E |
|
007-015-00-1 |
O-ethylhydroxylamine |
624-86-2 |
F; R11, T; R23/24/25-48/23, Xi; R36, R43, N; R50 |
|
|
|
007-016-00-7 |
butyl nitrite |
544-16-1 |
F; R11, T; R23/25 |
|
|
|
007-017-00-2 |
isobutyl nitrite |
542-56-3 |
F; R11, Carc. Cat. 2; R45, Muta. Cat. 3; R68, Xn; R20/22 |
|
E |
|
007-018-00-8 |
sec-butyl nitrite |
924-43-6 |
F; R11, Xn; R20/22 |
|
|
|
007-019-00-3 |
tert-butyl nitrite |
540-80-7 |
F; R11, Xn; R20/22 |
|
|
|
007-020-00-9 |
pentyl nitrite; [1] ‘amyl nitrite’, mixed isomers [2] |
463-04-7 [1], 110-46-3 [2] |
F; R11, Xn; R20/22 |
|
|
|
007-021-00-4 |
hydrazobenzene; 1,2-diphenylhydrazine |
122-66-7 |
Carc. Cat. 2; R45, Xn; R22, N; R50-53 |
|
E |
|
007-022-00-X |
hydrazine bis(3-carboxy-4-hydroxybenzensulfonate) |
- |
Carc. Cat. 2; R45, Xn; R22, C; R34, R43, R52-53 |
|
E |
|
007-023-00-5 |
sodium 3,5-bis(3-(2,4-di-tert-pentylphenoxy)propylcarbamoyl)benzenesulfonate |
- |
Xi; R38, R43 |
|
|
|
007-024-00-0 |
2-(decylthio)ethylammonium chloride |
36362-09-1 |
Xn; R48/22, Xi; R38-41, N; R50-53 |
|
|
|
007-025-00-6 |
(4-hydrazinophenyl)-N-methylmethanesulfonamide hydrochloride |
81880-96-8 |
Muta. Cat. 3; R68, T; R25-48/25, R43, N; R50-53 |
|
|
|
007-026-00-1 |
oxo-((2,2,6,6-tetramethylpiperidin-4-yl)amino)carbonylacetohydrazide |
122035-71-6 |
Xi; R41, R43 |
|
|
|
007-027-00-7 |
1,6-bis(3,3-bis((1-methylpentylidenimino)propyl)ureido)hexane |
771478-66-1 |
C; R34, Xn; R21/22-48/21, R43, N; R50-53 |
|
|
|
007-028-00-2 |
hydroxylammonium nitrate |
13465-08-2 |
E; R2, Carc. Cat. 3; R40, T; R24, Xn; R22-48/22, Xi; R36/38, R43, N; R50 |
|
|
|
007-029-00-8 |
diethyldimethylammonium hydroxide |
95500-19-9 |
Xn; R21/22, C; R35 |
|
|
|
008-001-00-8 |
oxygen |
7782-44-7 |
O; R8 |
|
|
|
008-003-00-9 |
hydrogen peroxide solution ... % |
7722-84-1 |
R5, O; R8, C; R35, Xn; R20/22 |
C ≥ 50 %: Xn; R20, C ≥ 8 %: Xn; R22, C ≥ 70 %: C; R35, 50 % ≤ C < 70 %: C; R34, 35 % ≤ C < 50 %: Xi; R37/38, 8 % ≤ C < 50 %: Xi; R41, 5 % ≤ C < 8 %: Xi; R36, C ≥ 50%: Footnote O; R8, C ≥ 70 %: R5 |
B |
|
009-001-00-0 |
fluorine |
7782-41-4 |
O; R8, T+; R26, C; R35 |
|
|
|
009-002-00-6 |
hydrogen fluoride |
7664-39-3 |
T+; R26/27/28, C; R35 |
|
|
|
009-003-00-1 |
hydrofluoric acid ... % |
7664-39-3 |
T+; R26/27/28, C; R35 |
C ≥ 7 %: C; R35, 1 % ≤ C < 7 %: C; R34, 0,1 % ≤ C < 1 %: Xi; R36 |
B |
|
009-004-00-7 |
sodium fluoride |
7681-49-4 |
T; R25, Xi; R36/38, R32 |
|
|
|
009-005-00-2 |
potassium fluoride |
7789-23-3 |
T; R23/24/25 |
|
|
|
009-006-00-8 |
ammonium fluoride |
12125-01-8 |
T; R23/24/25 |
|
|
|
009-007-00-3 |
sodium bifluoride; sodium hydrogen difluoride |
1333-83-1 |
T; R25, C; R34 |
C ≥ 10 %: T; R25, 1 % ≤ C < 10 %: Xn; R22, C ≥ 1 %: C; R34, 0,1 % ≤ C < 1 %: Xi; R36/38 |
|
|
009-008-00-9 |
potassium bifluoride; potassium hydrogen difluoride |
7789-29-9 |
T; R25, C; R34 |
C ≥ 10 %: T; R25, 1 % ≤ C < 10 %: Xn; R22, C ≥ 1 %: C; R34, 0,1 % ≤ C < 1 %: Xi; R36/38 |
|
|
009-009-00-4 |
ammonium bifluoride; ammonium hydrogen difluoride |
1341-49-7 |
T; R25, C; R34 |
C ≥ 10 %: T; R25, 1 % ≤ C < 10 %: Xn; R22, C ≥ 1 %: C; R34, 0,1 % ≤ C < 1 %: Xi; R36/38 |
|
|
009-010-00-X |
fluoroboric acid ... % |
16872-11-0 |
C; R34 |
C ≥ 25 %: C; R34, 10 % ≤ C < 25 %: Xi; R36/38 |
B |
|
009-011-00-5 |
fluorosilicic acid ... % |
16961-83-4 |
C; R34 |
|
B |
|
009-012-00-0 |
alkali fluorosilicates(Na); [1] alkali fluorosilicates(K); [2] alkali fluorosilicates(NH4) [3] |
16893-85-9 [1], 16871-90-2 [2], 16919-19-0 [3] |
T; R23/24/25 |
C ≥ 10 %: T; R23/24/25, 1 % ≤ C < 10 %: Xn; R20/21/22 |
A |
|
009-013-00-6 |
fluorosilicates, with the exception of those specified elsewhere in this annex |
- |
Xn; R22 |
C ≥ 10 %: Xn; R22 |
A |
|
009-014-00-1 |
lead hexafluorosilicate |
25808-74-6 |
Repr. Cat. 1; R61, Repr. Cat. 3; R62, Xn; R20/22, R33, N; R50-53 |
|
E1 |
|
009-015-00-7 |
sulphuryl difluoride |
2699-79-8 |
T; R23, Xn; R48/20, N; R50 |
|
|
|
009-016-00-2 |
trisodium hexafluoroaluminate; cryolite |
13775-53-6, 15096-52-3 |
T; R48/23/25, Xn; R20/22, N; R51-53 |
|
C |
|
009-017-00-8 |
potassium mu-fluoro-bis(triethylaluminium) |
12091-08-6 |
F; R11-14/15, C; R35, Xn; R20 |
|
|
|
009-018-00-3 |
magnesium hexafluorosilicate |
16949-65-8 |
T; R25 |
C ≥ 10 %: T; R25, 1 % ≤ C < 10 %: Xn; R22 |
|
|
011-001-00-0 |
sodium |
7440-23-5 |
F; 15, R14, C; R34 |
|
|
|
011-002-00-6 |
sodium hydroxide; caustic soda |
1310-73-2 |
C; R35 |
C ≥ 5 %: C; R35, 2 % ≤ C < 5 %: C; R34, 0,5 % ≤ C < 2 %: Xi; R36/38 |
|
|
011-003-00-1 |
sodium peroxide |
1313-60-6 |
O; R8, C; R35 |
|
|
|
011-004-00-7 |
sodium azide |
26628-22-8 |
T+; R28, R32, N; R50-53 |
|
|
|
011-005-00-2 |
sodium carbonate |
497-19-8 |
Xi; R36 |
|
|
|
011-006-00-8 |
sodium cyanate |
917-61-3 |
Xn; R22, R52-53 |
|
|
|
011-007-00-3 |
propoxycarbazone-sodium |
181274-15-7 |
N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
012-001-00-3 |
magnesium powder (pyrophoric) |
7439-95-4 |
F; R15-17 |
|
|
|
012-002-00-9 |
magnesium, powder or turnings |
- |
F; R11-15 |
|
|
|
012-003-00-4 |
magnesium alkyls |
- |
R14, F; R17, C; R34 |
|
A |
|
012-004-00-X |
aluminium-magnesium-carbonate-hydroxide-perchlorate-hydrate |
- |
N; R50-53 |
|
|
|
013-001-00-6 |
aluminium powder (pyrophoric) |
7429-90-5 |
F; R15-17 |
|
|
|
013-002-00-1 |
aluminium powder (stabilised) |
7429-90-5 |
F; R11-15 |
|
T |
|
013-003-00-7 |
aluminium chloride, anhydrous |
7446-70-0 |
C; R34 |
|
|
|
013-004-00-2 |
aluminium alkyls |
- |
R14, F; R17, C; R34 |
|
A |
|
013-005-00-8 |
diethyl(ethyldimethylsilanolato)aluminium |
55426-95-4 |
F; R 15-17, R14, C; R35 |
|
|
|
013-006-00-3 |
(ethyl-3-oxobutanoato-O'1,O'3)(2-dimethylaminoethanolato)(1-methoxypropan-2-olato)aluminium(III), dimerised |
- |
R10, Xi; R41 |
|
|
|
013-007-00-9 |
poly(oxo(2-butoxyethyl-3-oxobutanoato-O'1,O'3)aluminium) |
- |
Xi; R41 |
|
|
|
013-008-00-4 |
di-n-octylaluminium iodide |
7585-14-0 |
R14, F; R17, C; R34, N; R50-53 |
|
|
|
013-009-00-X |
sodium((n-butyl)x(ethyl)y-1,5-dihydro)aluminate) x = 0,5, y = 1,5 |
- |
F; R11-15-17, R14, Xn; R20, C; R35 |
|
|
|
013-010-00-5 |
hydroxy aluminium bis(2,4,8,10-tetra-tert-butyl-6-hydroxy-12H-dibenzo[d,g][1.3.2]dioxaphosphocin-6-oxide) |
151841-65-5 |
N; R51-53 |
|
|
|
014-001-00-9 |
trichlorosilane |
10025-78-2 |
F+; R12, R14, F; R17, Xn; R20/22, R29, C; R35 |
C ≥ 10 %: Xn; R20/22, C ≥ 10 %: C; R35, 5 % ≤ C < 10 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/37/38 |
|
|
014-002-00-4 |
silicon tetrachloride |
10026-04-7 |
R14, Xi; R36/37/38 |
|
|
|
014-003-00-X |
dimethyldichlorosilane |
75-78-5 |
F; R11, Xi; R36/37/38 |
|
|
|
014-004-00-5 |
trichloro(methyl)silane; methyltrichlorosilane |
75-79-6 |
R14, F; R11, Xi; R36/37/38 |
C ≥ 1 %: Xi; R36/37/38 |
|
|
014-005-00-0 |
tetraethyl silicate; ethyl silicate |
78-10-4 |
R10, Xn; R20, Xi; R36/37 |
|
|
|
014-006-00-6 |
bis(4-fluorophenyl)-methyl-(1,2,4-triazol-4-ylmethyl)silane hydrochloride |
- |
Xi; R36, N; R51-53 |
|
|
|
014-007-00-1 |
triethoxyisobutylsilane |
17980-47-1 |
Xi; R38 |
|
|
|
014-008-00-7 |
(chloromethyl)bis(4-fluorophenyl)methylsilane |
85491-26-5 |
N; R51-53 |
|
|
|
014-009-00-2 |
isobutylisopropyldimethoxysilane |
111439-76-0 |
R10, Xn; R20, Xi; R38 |
|
|
|
014-010-00-8 |
disodium metasilicate |
6834-92-0 |
C; R34, Xi; R37 |
|
|
|
014-011-00-3 |
cyclohexyldimethoxymethylsilane |
17865-32-6 |
Xi; R38, N; R51-53 |
|
|
|
014-012-00-9 |
bis(3-(trimethoxysilyl)propyl)amine |
- |
Xi; R41, N; R51-53 |
|
|
|
014-013-00-4 |
α-hydroxypoly(methyl-(3-(2,2,6,6-tetramethylpiperidin-4-yloxy)propyl)siloxane) |
- |
Xn; R21/22, C; R34, N; R51-53 |
|
|
|
014-014-00-X |
etacelasil (ISO); 6-(2-chloroethyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane |
37894-46-5 |
Repr. Cat. 2; R61, Xn; R22-48/22 |
|
E |
|
014-015-00-5 |
α-trimethylsilanyl-ω-trimethylsiloxypoly[oxy(methyl-3-(2-(2-methoxypropoxy)propoxy)propylsilanediyl]-co-oxy(dimethylsilane)) |
69430-40-6 |
R53 |
|
|
|
014-016-00-0 |
reaction mass of: 1,3-dihex-5-en-1-yl-1,1,3,3-tetramethyldisiloxane; 1,3-dihex-n-en-1-yl-1,1,3,3-tetramethyldisiloxane |
- |
N; R51-53 |
|
|
|
014-017-00-6 |
flusilazole (ISO); bis(4-fluorophenyl)(methyl)(1H-1,2,4-triazol-1-ylmethyl)silane |
85509-19-9 |
Carc. Cat. 3; R40, Repr. Cat. 2; R61, Xn; R22, N; R51-53 |
|
E |
|
014-018-00-1 |
octamethylcyclotetrasiloxane |
556-67-2 |
Repr. Cat. 3; R62, R53 |
|
|
|
014-019-00-7 |
reaction mass of: 4-[[bis-(4-fluorophenyl)methylsilyl]methyl]-4H-1,2,4-triazole; 1-[[bis-(4-fluorophenyl)methylsilyl]methyl]-1H-1,2,4-triazole |
- |
Carc. Cat. 3; R40, Repr. Cat. 2; R61, Xn; R22, N; R51-53 |
|
E |
|
014-020-00-2 |
bis(1,1-dimethyl-2-propynyloxy)dimethylsilane |
53863-99-3 |
Xn; R20 |
|
|
|
014-021-00-8 |
tris(isopropenyloxy)phenyl silane |
52301-18-5 |
N; R50-53 |
|
|
|
014-022-00-3 |
reaction product of: (2-hydroxy-4-(3-propenoxy)benzophenone and triethoxysilane) with (hydrolysis product of silica and methyltrimethoxysilane) |
- |
F; R11, T; R39/23/24/25, Xn; R20/21/22 |
|
|
|
014-023-00-9 |
α, ω-dihydroxypoly(hex-5-en-1-ylmethylsiloxane)hoxysilane with (hydrolysis product of silica and methyltrimethoxysilane)iazole |
125613-45-8 |
N; R51-53 |
|
|
|
014-024-00-4 |
1-((3-(3-chloro-4-fluorophenyl)propyl)dimethylsilanyl)-4-ethoxybenzene |
121626-74-2 |
N; R51-53 |
|
|
|
014-025-00-X |
4-[3-(diethoxymethylsilylpropoxy)-2,2,6,6-tetramethyl]piperidine |
102089-33-8 |
Xn; R22-48/21, Xi; R38-41, R52-53 |
|
|
|
014-026-00-5 |
dichloro-(3-(3-chloro-4-fluorophenyl)propyl)methylsilane |
770722-36-6 |
C; R35 |
|
|
|
014-027-00-0 |
chloro(3-(3-chloro-4-fluorophenyl)propyl)dimethylsilane |
770722-46-8 |
C; R35 |
|
|
|
014-028-00-6 |
α-[3-(1-oxoprop-2-eny)l-1-oxypropyl]dimethoxysilyloxy-ω-[3(1-oxoprop-2-enyl)-1-oxypropyl]dimethoxysilyl poly(dimethylsiloxane) |
193159-06-7 |
R43 |
|
|
|
014-029-00-1 |
O,O'-(ethenylmethylsilylene)di[(4-methylpentan-2-one)oxime] |
156145-66-3 |
Repr. Cat. 3; R62, Xn; R22-48/22 |
|
|
|
014-030-00-7 |
[(dimethylsilylene)bis((1,2,3,3a,7a-η)-1H-inden-1-ylidene)dimethyl]hafnium |
137390-08-0 |
T+; R28 |
|
|
|
014-031-00-2 |
bis(1-methylethyl)-dimethoxysilane |
18230-61-0 |
R10, Xi; R38, R43, R52-53 |
|
|
|
014-032-00-8 |
dicyclopentyldimethoxysilane |
126990-35-0 |
Xi; R38-41, N; R50-53 |
|
|
|
014-033-00-3 |
2-methyl-3-(trimethoxysilyl)propyl-2-propenoate hydrolysis product with silica |
125804-20-8 |
F; R11, Xi; R36, R67 |
|
|
|
014-034-00-9 |
3-hexylheptamethyltrisiloxane |
1873-90-1 |
Xn; R20, R53 |
|
|
|
014-035-00-4 |
2-(3,4-epoxycyclohexyl)ethyltriethoxy silane |
10217-34-2 |
R43, R52-53 |
|
|
|
014-036-00-X |
(4-ethoxyphenyl)(3-(4-fluoro-3-phenoxyphenyl)propyl)dimethylsilane |
105024-66-6 |
Repr.Cat.2; R60, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
014-037-00-5 |
2-butanone-O,O',O''-(phenylsilylidyne)trioxime |
34036-80-1 |
Xn; R48/22, R43, R52-53 |
|
|
|
014-038-00-0 |
S-(3-(triethoxysilyl)propyl)octanethioate |
220727-26-4 |
R43 |
|
|
|
014-039-00-6 |
(2,3-dimethylbut-2-yl)-trimethoxysilane |
142877-45-0 |
Xi; R38-41, R52-53 |
|
|
|
014-041-00-7 |
N,N-bis(trimethylsilyl)aminopropylmethyldiethoxysilane |
201290-01-9 |
Xn; R22, R43 |
|
|
|
014-042-00-2 |
reaction mass of: O,O',O'',O'''-silanetetrayl tetrakis(4-methyl-2-pentanone oxime) (3 stereoisomers) |
- |
Xi; R41 |
|
|
|
014-043-00-8 |
reaction product of amorphous silica (50-85%), butyl (1-methylpropyl) magnesium (3-15%), tetraethyl orthosilicate (5-15%) and titanium tetrachloride (5-20%) |
- |
F; R11, Xi; R37/38-41, R52-53 |
|
|
|
014-044-00-3 |
3-[(4'-acetoxy-3'-methoxyphenyl) propyl]trimethoxysilane |
- |
N; R51-53 |
|
|
|
014-045-00-9 |
magnesium sodium fluoride silicate |
- |
Xn; R48/20 |
|
|
|
015-001-00-1 |
white phosphorus |
12185-10-3 |
F; R17, T+; R26/28, C; R35, N; R50 |
|
|
|
015-002-00-7 |
red phosphorus |
7723-14-0 |
F; R11, R16, R52-53 |
|
|
|
015-003-00-2 |
calcium phosphide; tricalcium diphosphide |
1305-99-3 |
F; R15/29, T+; R26/28, Xn; R21, R32, Xi; R38-41, N; R50 |
N; R50: C >= 0,25 % |
|
|
015-004-00-8 |
aluminium phosphide |
20859-73-8 |
F; R15/29, T+; R28, R32, N; R50 |
C ≥ 0,25 %: N; R50 |
|
|
015-005-00-3 |
magnesium phosphide; trimagnesium diphosphide |
12057-74-8 |
F; R15/29, T+; R28, N; R50 |
C ≥ 0,25 %: N; R50 |
|
|
015-006-00-9 |
trizinc diphosphide; zinc phosphide |
1314-84-7 |
F; R15/29, T+; R28, R32, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
T |
|
015-007-00-4 |
phosphorus trichloride |
7719-12-2 |
R14, T+; R26/28, Xn; R48/20, C; R35, R29 |
|
|
|
015-008-00-X |
phosphorus pentachloride |
10026-13-8 |
R14, T+; R26, Xn; R22-48/20, C; R34, R29 |
|
|
|
015-009-00-5 |
phosphoryl trichloride |
10025-87-3 |
R14, T+; R26, T; R48/23, Xn; R22, C; R35, R29 |
|
|
|
015-010-00-0 |
phosphorus pentoxide |
1314-56-3 |
C; R35 |
|
|
|
015-011-00-6 |
phosphoric acid ... %, orthophosphoric acid ... % |
7664-38-2 |
C; R34 |
C ≥ 25 %: C; R34, 10 % ≤ C < 25 %: Xi; R36/38 |
B |
|
015-012-00-1 |
tetraphosphorus trisulphide; phosphorus sesquisulphid |
1314-85-8 |
F; R11, Xn; R22, N; R50 |
|
|
|
015-013-00-7 |
triethyl phosphate |
78-40-0 |
Xn; R22 |
|
|
|
015-014-00-2 |
tributyl phosphate |
126-73-8 |
Carc. Cat. 3; R40, Xn; R22, Xi; R38 |
|
|
|
015-015-00-8 |
tricresyl phosphate (o-o-o-, o-o-m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-); tritolyl phosphate (o-o-o-, o-o-m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-) |
78-30-8 |
T; R39/23/24/25, N; R51-53 |
C ≥ 1 %: T; R39/23/24/25, 0,2 % ≤ C < 1 %: Xn; R68/20/21/22 |
C |
|
015-016-00-3 |
tricresyl phosphate (m-m-m-, m-m-p-, m-p-p-, p-p-p-); tritolyl phosphate (m-m-m-, m-m-p-, m-p-p-, p-p-p-) |
78-32-0 |
Xn; R21/22, N; R51-53 |
C ≥ 5 %: Xn; R21/22 |
C |
|
015-019-00-X |
dichlorvos (ISO); 2,2-dichlorovinyl dimethyl phosphate |
62-73-7 |
T+; R26, T; R24/25, R43, N; R50 |
C ≥ 0,025 %: N; R50 |
|
|
015-020-00-5 |
mevinphos (ISO); 2-methoxycarbonyl-1-methylvinyl dimethyl phosphate |
7786-34-7 |
T+; R27/28, N; R50-53 |
C ≥ 0,0025 %: N; R50-53, 0,00025 % ≤ C < 0,0025 %: N; R51-53, 0,000025 % ≤ C < 0,00025 %: R52-53 |
|
|
015-021-00-0 |
trichlorfon (ISO); dimethyl 2,2,2-trichloro-1-hydroxyethylphosphonate |
52-68-6 |
Xn; R22, R43, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-022-00-6 |
phosphamidon (ISO); 2-chloro-2-diethylcarbamoyl-1-methylvinyl dimethyl phosphate |
13171-21-6 |
T+; R28, T; R24, Muta. Cat. 3; R68, N; R50-53 |
|
|
|
015-023-00-1 |
pyrazoxon; diethyl 3-methylpyrazol-5-yl phosphate |
108-34-9 |
T+; R26/27/28 |
|
|
|
015-024-00-7 |
triamiphos (ISO); 5-amino-3-phenyl-1,2,4-triazol-1-yl-N,N,N',N'-tetramethylphosphonic diamide |
1031-47-6 |
T+; R27/28 |
|
|
|
015-025-00-2 |
TEPP (ISO); tetraethyl pyrophosphate |
107-49-3 |
T+; R27/28, N; R50 |
|
|
|
015-026-00-8 |
schradan (ISO); octamethylpyrophosphoramide |
152-16-9 |
T+; R27/28 |
|
|
|
015-027-00-3 |
sulfotep (ISO); O,O,O,O-tetraethyl dithiopyrophosphate |
3689-24-5 |
T+; R27/28, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-028-00-9 |
demeton-O (ISO); O,O-diethyl-O-2-ethylthioethyl phosphorothioate |
298-03-3 |
T+; R27/28, N; R50 |
|
|
|
015-029-00-4 |
demeton-S (ISO); diethyl-S-2-ethylthioethyl phosphorothioate |
126-75-0 |
T+; R27/28 |
|
|
|
015-030-00-X |
demeton-O-methyl (ISO); O-2-ethylthioethyl O,O-dimethyl phosphorothioate |
867-27-6 |
T; R25 |
|
|
|
015-031-00-5 |
demeton-S-methyl (ISO); S-2-ethylthioethyl dimethyl phosphorothioate |
919-86-8 |
T; R24/25, N; R51-53 |
|
|
|
015-032-00-0 |
prothoate (ISO); O,O-diethyl isopropylcarbamoylmethyl phosphorodithioate |
2275-18-5 |
T+; R27/28, R52-53 |
|
|
|
015-033-00-6 |
phorate (ISO); O,O-diethyl ethylthiomethyl phosphorodithioate |
298-02-2 |
T+; R27/28, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-034-00-1 |
parathion (ISO); O,O-diethyl O-4-nitrophenyl phosphorothioate |
56-38-2 |
T+; R26/28, T; R24-48/25, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-035-00-7 |
parathion - methyl (ISO); O,O-dimethyl O-4-nitrophenyl phosphorothioate |
298-00-0 |
R5, R10, T+; R26/28, T; R24, Xn; R48/22, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-036-00-2 |
O-ethyl O-4-nitrophenyl phenylphosphonothioate; EPN |
2104-64-5 |
T+; R27/28, N; R50-53 |
|
|
|
015-037-00-8 |
phenkapton (ISO); S-(2,5-dichlorophenylthiomethyl) O,O-diethyl phosphorodithioate |
2275-14-1 |
T; R23/24/25, N; R50-53 |
|
|
|
015-038-00-3 |
coumaphos (ISO); O-3-chloro-4-methylcoumarin-7-yl O,O-diethyl phosphorothioate |
56-72-4 |
T+; R28, Xn; R21, N; R50-53 |
|
|
|
015-039-00-9 |
azinphos-methyl (ISO); O,O-dimethyl-4-oxobenzotriazin-3-ylmethyl phosphorodithioate |
86-50-0 |
T+; R26/28, T; R24, R43, N; R50-53 |
|
|
|
015-040-00-4 |
diazinon (ISO); O,O-diethyl O-2-isopropyl-6-methylpyrimidin-4-yl phosphorothioate |
333-41-5 |
Xn; R22, N; R50-53 |
|
|
|
015-041-00-X |
malathion (ISO); 1,2-bis(ethoxycarbonyl)ethyl O,O-dimethyl phosphorodithioate; [containing ≤ 0.03 % isomalathion] |
121-75-5 |
Xn; R22, R43, N; R50-53 |
C ≥ 0,025 %: N; R50, 0,0025 % ≤ C < 0,025 %: N; R51/53, 0,00025 % ≤ C < 0,0025 %: R52/53 |
|
|
015-042-00-5 |
chlorthion; O-(3-chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate |
500-28-7 |
Xn; R20/21/22, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-043-00-0 |
phosnichlor (ISO); O-4-chloro-3-nitrophenyl O,O-dimethyl phosphorothioate |
5826-76-6 |
Xn; R20/21/22 |
|
|
|
015-044-00-6 |
carbophenothion (ISO); 4-chlorophenylthiomethyl O,O-diethyl phosphorodithioate |
786-19-6 |
T; R24/25, N; R50-53 |
|
|
|
015-045-00-1 |
mecarbam (ISO); N-ethoxycarbonyl-N-methylcarbamoylmethyl O,O-diethyl phosphorodithioate |
2595-54-2 |
T; R24/25, N; R50-53 |
|
|
|
015-046-00-7 |
oxydemeton-methyl; S-2-(ethylsulphinyl)ethyl O,O-dimethyl phosphorothioate |
301-12-2 |
T; R24/25, N; R50 |
|
|
|
015-047-00-2 |
ethion (ISO); O,O,O',O'-tetraethyl S,S'-methylenedi (phosphorodithioate); diethion |
563-12-2 |
T; R25, Xn; R21, N; R50-53 |
C ≥ 0,0025 %: N; R50-53, 0,00025 % ≤ C < 0,0025 %: N; R51-53, 0,000025 % ≤ C < 0,00025 %: R52-53 |
|
|
015-048-00-8 |
fenthion (ISO); O,O-dimethyl-O-(4-methylthion-m-tolyl) phosphorothioate |
55-38-9 |
Muta. Cat. 3; R68, T; R23-48/25, Xn; R21/22, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-049-00-3 |
endothion (ISO); S-5-methoxy-4-oxopyran-2-ylmethyl dimethyl phosphorothioate |
2778-04-3 |
T; R24/25 |
|
|
|
015-050-00-9 |
thiometon (ISO); S-2-ethylthioethyl O,O-dimethyl phosphorodithioate |
640-15-3 |
T; R25, Xn; R21 |
|
|
|
015-051-00-4 |
dimethoate (ISO); O,O-dimethyl methylcarbamoylmethyl phosphorodithioate |
60-51-5 |
Xn; R21/22 |
|
|
|
015-052-00-X |
fenchlorphos (ISO); O,O-dimethyl O-2,4,5-trichlorophenyl phosphorothioate |
299-84-3 |
Xn; R21/22, N; R50-53 |
|
|
|
015-053-00-5 |
menazon (ISO); S-[(4,6-diamino-1,3,5-triazin-2-yl)methyl] O,O-dimethyl phosphorodithioate |
78-57-9 |
Xn; R22, R52-53 |
|
|
|
015-054-00-0 |
fenitrothion (ISO); O,O-dimethyl O-4-nitro-m-tolyl phosphorothioate |
122-14-5 |
Xn; R22, N; R50-53 |
|
|
|
015-055-00-6 |
naled (ISO); 1,2-dibromo-2,2-dichloroethyl dimethyl phosphate |
300-76-5 |
Xn; R21/22, Xi; R36/38, N; R50 |
C ≥ 0,025 %: N; R50 |
|
|
015-056-00-1 |
azinphos-ethyl (ISO); O,O-diethyl 4-oxobenzotriazin-3-ylmethyl phosphorodithioate |
2642-71-9 |
T+; R28, T; R24, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-057-00-7 |
formothion (ISO); N-formyl-N-methylcarbamoylmethyl O,O-dimethyl phosphorodithioate |
2540-82-1 |
Xn; R21/22 |
|
|
|
015-058-00-2 |
morphothion (ISO); O,O-dimethyl-S-(morpholinocarbonylmethyl) phosphorodithioate |
144-41-2 |
T; R23/24/25, N; R50-53 |
|
|
|
015-059-00-8 |
vamidothion (ISO); O,O-dimethyl S-2-(1-methylcarbamoylethylthio) ethyl phosphorothioate |
2275-23-2 |
T; R25, Xn; R21, N; R50 |
|
|
|
015-060-00-3 |
disulfoton (ISO); O,O-diethyl 2-ethylthioethyl phosphorodithioate |
298-04-4 |
T+; R27/28, N; R50-53 |
|
|
|
015-061-00-9 |
dimefox (ISO); tetramethylphosphorodiamidic fluoride |
115-26-4 |
T+; R27/28 |
|
|
|
015-062-00-4 |
mipafox (ISO); N,N'- di-isopropylphosphorodiamidic fluoride |
371-86-8 |
T+; R39/26/27/28 |
|
|
|
015-063-00-X |
dioxathion (ISO); 1,4-dioxan-2,3-diyl-O,O,O',O'-tetraethyl di(phosphorodithioate) |
78-34-2 |
T+; R26/28, T; R24, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-064-00-5 |
bromophos-ethyl (ISO); O-4-bromo-2,5-dichlorophenyl O,O-diethyl phosphorothioate |
4824-78-6 |
T; R25, Xn; R21, N; R50-53 |
|
|
|
015-065-00-0 |
S-[2-(ethylsulphinyl)ethyl] O,O-dimethyl phosphorodithioate |
2703-37-9 |
T+; R26/27/28, N; R51-53 |
|
|
|
015-066-00-6 |
omethoate (ISO); O,O-dimethyl S-methylcarbamoylmethyl phosphorothioate |
1113-02-6 |
T; R25, Xn; R21, N; R50 |
|
|
|
015-067-00-1 |
phosalone (ISO); S-(6-chloro-2-oxobenzoxazolin-3-ylmethyl) O,O-diethyl phosphorodithioate |
2310-17-0 |
T; R25, Xn; R20/21, R43, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-068-00-7 |
dichlofenthion (ISO); O-,4-dichlorophenyl O,O-diethyl phosphorothioate |
97-17-6 |
Xn; R22, N; R50-53 |
|
|
|
015-069-00-2 |
methidathion (ISO); 2,3-dihydro-5-methoxy-2-oxo-1,3,4-thiadiazol-3-ylmethyl-O,O-dimethylphosphorodithioate |
950-37-8 |
T+; R28, Xn; R21, N; R50-53 |
|
|
|
015-070-00-8 |
cyanthoate (ISO); S-(N-(1-cyano-1-methylethyl)carbamoylmethyl) O,O-diethyl phosphorothioate |
3734-95-0 |
T+; R28, T; R24 |
|
|
|
015-071-00-3 |
chlorfenvinphos (ISO); 2-chloro-1-(2,4 dichlorophenyl) vinyl diethyl phosphate |
470-90-6 |
T+; R28, T; R24, N; R50-53 |
|
|
|
015-072-00-9 |
monocrotophos (ISO); dimethyl-1-methyl-2-(methylcarbamoyl)vinyl phosphate |
6923-22-4 |
Muta. Cat. 3; R68, T+; R26/28, T; R24, N; R50-53 |
|
|
|
015-073-00-4 |
dicrotophos (ISO); (Z)-2-dimethylcarbamoyl-1-methylvinyl dimethyl phosphate |
141-66-2 |
T+; R28, T; R24, N; R50-53 |
|
|
|
015-074-00-X |
crufomate (ISO); 4-tert-butyl-2-chlorophenyl methyl methylphosphoramidate |
299-86-5 |
Xn; R21/22, N; R50-53 |
|
|
|
015-075-00-5 |
S-[2-(isopropylsulphinyl)ethyl] O,O-dimethyl phosphorothioate |
2635-50-9 |
T; R23/24/25 |
|
|
|
015-076-00-0 |
potasan; O,O-diethyl O-(4-methylcoumarin-7-yl) phosphorothioate |
299-45-6 |
T+; R26/27/28, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-077-00-6 |
2,2-dichlorovinyl 2-ethylsulphinylethyl methyl phosphate |
7076-53-1 |
T; R23/24/25 |
|
|
|
015-078-00-1 |
demeton-S-methylsulphon (ISO); S-2-ethylsulphonylethyl dimethyl phosphorothioate |
17040-19-6 |
T; R25, Xn; R21, N; R51-53 |
|
|
|
015-079-00-7 |
acephate (ISO); O,S-dimethyl acetylphosphoramidothioate |
30560-19-1 |
Xn; R22 |
|
|
|
015-080-00-2 |
amidithion (ISO); 2-methoxyethylcarbamoylmethyl O,O-dimethyl phosphorodithioate |
919-76-6 |
Xn; R22 |
|
|
|
015-081-00-8 |
O,O,O',O'-tetrapropyl dithiopyrophosphate |
3244-90-4 |
Xn; R21/22, N; R50-53 |
|
|
|
015-082-00-3 |
azothoate (ISO); O-4-(4-chlorophenylazo)phenyl O,O-dimethyl phosphorothioate |
5834-96-8 |
Xn; R20/22 |
|
|
|
015-083-00-9 |
bensulide (ISO); O,O-diisopropyl 2-phenylsulphonylaminoethyl phosphorodithioate |
741-58-2 |
Xn; R22, N; R50-53 |
|
|
|
015-084-00-4 |
chlorpyrifos (ISO); O,O-diethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate |
2921-88-2 |
T; R25, N; R50-53 |
C ≥ 0,0025 %: N; R50-53, 0,00025 % ≤ C < 0,0025 %: N; R51-53, 0,000025 % ≤ C < 0,00025 %: R52-53 |
|
|
015-085-00-X |
chlorphonium chloride (ISO); tributyl (2,4-dichlorobenzyl) phosphonium chloride |
115-78-6 |
T; R25, Xn; R21, Xi; R36/38 |
|
|
|
015-086-00-5 |
coumithoate (ISO); O,O-diethyl O-,8,9,10-tetrahydro-6-oxo-benzo(c)chromen-3-yl phosphorothioate |
572-48-5 |
T; R25 |
|
|
|
015-087-00-0 |
cyanophos (ISO); O-4-cyanophenyl O,O-dimethyl phosphorothioate |
2636-26-2 |
Xn; R21/22, N; R50-53 |
|
|
|
015-088-00-6 |
dialifos (ISO); 2-chloro-1-phthalimidoethyl O,O-diethyl phosphorodithioate |
10311-84-9 |
T+; R28, T; R24, N; R50-53 |
|
|
|
015-089-00-1 |
ethoate-methyl (ISO); ethylcarbamoylmethyl O,O-dimethyl phosphorodithioate |
116-01-8 |
Xn; R21/22 |
|
|
|
015-090-00-7 |
fensulfothion (ISO); O,O-diethyl O-4-methylsulfinylphenyl phosphorothioate |
115-90-2 |
T+; R27/28, N; R50-53 |
|
|
|
015-091-00-2 |
fonofos (ISO); O-ethyl phenyl ethylphosphonodithioate |
944-22-9 |
T+; R27/28, N; R50-53 |
|
|
|
015-092-00-8 |
phosacetim (ISO); O,O-bis(4-chlorophenyl) N-acetimidoylphosphoramidothioate |
4104-14-7 |
T+; R27/28, N; R50-53 |
|
|
|
015-093-00-3 |
leptophos (ISO); O-4-bromo-2,5-dichlorophenyl O-methyl phenylphosphorothioate |
21609-90-5 |
T; R25-39/25, Xn; R21, N; R50-53 |
|
|
|
015-094-00-9 |
mephosfolan (ISO); diethyl 4-methyl-1,3-dithiolan-2-ylidenephosphoramidate |
950-10-7 |
T+; R27/28, N; R51-53 |
|
|
|
015-095-00-4 |
methamidophos (ISO); O,S-dimethyl phosphoramidothioate |
10265-92-6 |
T+; R26/28, T; R24, N; R50 |
|
|
|
015-096-00-X |
oxydisulfoton (ISO); O, O-diethyl S-2-ethylsulphinylethyl phosphorodithioate |
2497-07-6 |
T+; R28, T; R24, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
015-097-00-5 |
phenthoate (ISO); ethyl 2-(dimethoxyphosphinothioylthio)-2-phenylacetate |
2597-03-7 |
Xn; R21/22, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-098-00-0 |
trichloronate (ISO); O-ethyl O-2,4,5-trichlorophenyl ethylphosphonothioate |
327-98-0 |
T+; R28, T; R24, N; R50-53 |
|
|
|
015-099-00-6 |
pirimiphos-ethyl (ISO); O,O-diethyl O-2-diethylamino-6-methylpyrimidin-4-yl phosphorothioate |
23505-41-1 |
T; R25, Xn; R21, N; R50-53 |
|
|
|
015-100-00-X |
phoxim (ISO); α-(diethoxyphosphinothioylimino) phenylacetonitrile |
14816-18-3 |
Repr. Cat. 3; R62, Xn; R22, R43, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-101-00-5 |
phosmet (ISO); O,O-dimethyl phthalimidomethyl S-phosphorodithioate |
732-11-6 |
Xn; R21/22, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-102-00-0 |
tris(2-chloroethyl)phosphate |
115-96-8 |
Carc. Cat. 3; R40, Repr. Cat. 2; R60, Xn; R22, N; R51-53 |
|
E |
|
015-103-00-6 |
phosphorus tribromide |
7789-60-8 |
R14, C; R34, Xi; R37 |
|
|
|
015-104-00-1 |
diphosphorus pentasulphide; phosphorus pentasulphide |
1314-80-3 |
F; R11, R29, Xn; R20/22, N; R50 |
|
|
|
015-105-00-7 |
triphenyl phosphite |
101-02-0 |
Xi; R36/38, N; R50-53 |
C ≥ 5 %: Xi; R36/38 |
|
|
015-106-00-2 |
hexamethylphosphoric triamide; hexamethylphosphoramide |
680-31-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
C ≥ 0,01 %: Carc. Cat. 2; R45 |
|
|
015-107-00-8 |
ethoprophos (ISO); ethyl-S,S-dipropyl phosphorodithioate |
13194-48-4 |
T+; R26/27, T; R25, R43, N; R50-53 |
|
|
|
015-108-00-3 |
bromophos (ISO); O-4-bromo-2,5-dichlorophenyl O,O-dimethyl phosphorothioate |
2104-96-3 |
Xn; R22, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-109-00-9 |
crotoxyphos (ISO); 1-phenylethyl 3-(dimethoxyphosphinyloxy) isocrotonate |
7700-17-6 |
T; R24/25, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
015-110-00-4 |
cyanofenphos (ISO); O-4-cyanophenyl O-ethyl phenylphosphonothioate |
13067-93-1 |
T; R25-39/25, Xn; R21, Xi; R36, N; R51-53 |
|
|
|
015-111-00-X |
phosfolan (ISO); diethyl 1,3-dithiolan-2-ylidenephosphoramidate |
947-02-4 |
T+; R27/28 |
|
|
|
015-112-00-5 |
thionazin (ISO); O,O-diethyl O-pyrazin-2-yl phosphorothioate |
297-97-2 |
T+; R27/28 |
|
|
|
015-113-00-0 |
tolclofos-methyl (ISO); O-(2,6-dichloro-p-tolyl)-O,O-dimethyl thiophosphate |
57018-04-9 |
R43, N; R50-53 |
|
|
|
015-114-00-6 |
chlormephos (ISO); S-chloromethyl O,O-diethyl phosphorodithioate |
24934-91-6 |
T+; R27/28, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
015-115-00-1 |
chlorthiophos (ISO); [isomeric reaction mass in which O-2,5-dichlorophenyl-4-methylthiophenyl O,O-diethyl phosphorothioate predominates] |
21923-23-9 |
T+; R28, T; R24, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-116-00-7 |
demephion-O (ISO); O,O-dimethyl O-2-methylthioethyl phosphorothioate |
682-80-4 |
T+; R28, T; R24 |
|
|
|
015-117-00-2 |
demephion-S (ISO); O,O-dimethyl S-2-methylthioethyl phosphorothioate |
2587-90-8 |
T+; R28, T; R24 |
|
|
|
015-118-00-8 |
demeton |
8065-48-3 |
T+; R27/28, N; R50 |
|
|
|
015-119-00-3 |
dimethyl 4-(methylthio)phenyl phosphate |
3254-63-5 |
T+; R27/28 |
|
|
|
015-120-00-9 |
ditalimfos (ISO); O,O-diethyl phthalimidophosphonothioate |
5131-24-8 |
Xi; R38, R43 |
|
|
|
015-121-00-4 |
edifenphos (ISO); O-ethyl S,S-diphenyl phosphorodithioate |
17109-49-8 |
T; R23/25, Xn; R21, R43, N; R50-53 |
|
|
|
015-122-00-X |
etrimfos (ISO); O-6-ethoxy-2-ethylpyrimidin-4-yl O,O-dimethylphosphorothioate |
38260-54-7 |
Xn; R22, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
015-123-00-5 |
fenamiphos (ISO); ethyl-4-methylthio-m-tolyl isopropyl phosphoramidate |
22224-92-6 |
T+; R28, T; R24, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-124-00-0 |
fosthietan (ISO); diethyl 1,3-dithietan-2-ylidenephosphoramidate |
21548-32-3 |
T+; R27/28 |
|
|
|
015-125-00-6 |
glyphosine (ISO); N,N-bis(phosphonomethyl)glycine |
2439-99-8 |
Xi; R41 |
|
|
|
015-126-00-1 |
heptenophos (ISO); 7-chlorobicyclo(3.2.0)hepta-2,6-dien-6-yl dimethyl phosphate |
23560-59-0 |
T; R25, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-127-00-7 |
iprobenfos (ISO); S-benzyl diisopropyl phosphorothioate |
26087-47-8 |
Xn; R22, N; R51-53 |
|
|
|
015-128-00-2 |
IPSP; S-ethylsulphinylmethyl O,O-diisopropylphosphorodithioate |
5827-05-4 |
T+; R27, T; R25, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-129-00-8 |
isofenphos (ISO); O-ethyl O-2-isopropoxycarbonylphenyl-isopropylphosphoramidothioate |
25311-71-1 |
T; R24/25, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-130-00-3 |
isothioate (ISO); S-2-isopropylthioethyl O,O-dimethyl phosphorodithioate |
36614-38-7 |
T; R24/25 |
|
|
|
015-131-00-9 |
isoxathion (ISO); O,O-diethyl O-5-phenylisoxazol-3-ylphosphorothioate |
18854-01-8 |
T; R24/25, N; R50-53 |
|
|
|
015-132-00-4 |
S-(chlorophenylthiomethyl) O,O-dimethylphosphorodithioate; methylcarbophenothione |
953-17-3 |
T; R24/25, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-133-00-X |
piperophos (ISO); S-2-methylpiperidinocarbonylmethyl-O,O-dipropyl phosphorodithioate |
24151-93-7 |
Xn; R22, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
015-134-00-5 |
pirimiphos-methyl (ISO); O-(2-diethylamino-6-methylpyrimidin-4-yl) O,O-dimethyl phosphorothioate |
29232-93-7 |
Xn; R22, N; R50-53 |
|
|
|
015-135-00-0 |
profenofos (ISO); O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate |
41198-08-7 |
Xn; R20/21/22, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-136-00-6 |
trans-isopropyl-3-[[(ethylamino)methoxyfosfinothioyl]oxy]crotonate; isopropyl 3-[[(ethylamino)methoxyphosphinothioyl]oxy]isocrotonate; propetamphos (ISO) |
31218-83-4 |
T; R25, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-137-00-1 |
pyrazophos (ISO); O,O-diethyl O-(6-ethoxycarbonyl-5-methylpyrazolo[2,3-a]pyrimidin-2-yl) phosphorothioate |
13457-18-6 |
Xn; R20/22, N; R50-53 |
|
|
|
015-138-00-7 |
quinalphos (ISO); O,O-diethyl-O-quinoxalin-2-yl phosphorothioate |
13593-03-8 |
T; R25, Xn; R21, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-139-00-2 |
terbufos (ISO); S-tert-butylthiomethyl O,O-diethylphosphorodithioate |
13071-79-9 |
T+; R27/28, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-140-00-8 |
triazophos (ISO); O,O-diethyl-O-1-phenyl-1H-1,2,4-triazol-3-yl phosphorothioate |
24017-47-8 |
T; R23/25, Xn; R21, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-141-00-3 |
ethylenediammonium O,O-bis(octyl) phosphorodithioate, mixed isomers |
- |
C; R34, Xn; R22, N; R50-53 |
|
|
|
015-142-00-9 |
butyl (dialkyloxy(dibutoxyphosphoryloxy))titanium (trialkyloxy)titanium phosphate |
- |
F; R11, Xi; R36, N; R51-53 |
|
|
|
015-143-00-4 |
reaction mass of 2-chloroethyl chloropropyl 2-chloroethylphosphonate, mixture reaction mass of isomers and 2-chloroethyl chloropropyl 2-chloropropylphosphonate, reaction mass of isomers |
- |
Xn; R22 |
|
|
|
015-144-00-X |
reaction mass of pentyl methylphosphinate and 2-methylbutyl methylphosphinate |
87025-52-3 |
C; R34 |
|
|
|
015-145-00-5 |
reaction mass of copper(I) O,O-diisopropyl phosphorodithioate and copper(I) O-isopropyl O-(4-methylpent-2-yl) phosphorodithioate and copper(I) O,O-bis(4-methylpent-2-yl) phosphorodithioate |
- |
N; R50-53 |
|
|
|
015-146-00-0 |
S-(tricyclo(5.2.1.02,6)deca-3-en-8(or 9)-yl O-(isopropyl or isobutyl or 2-ethylhexyl) O-(isopropyl or isobutyl or 2-ethylhexyl) phosphorodithioate |
- |
N; R50-53 |
|
|
|
015-147-00-6 |
reaction mass of C12-14-tert-alkylammonium diphenyl phosphorothioate and dinonyl sulphide (or disulphide) |
- |
Xi; R38-41, N; R51-53, R43 |
|
|
|
015-148-00-1 |
2-(diphosphonomethyl)succinic acid |
51395-42-7 |
C; R34, R43 |
|
|
|
015-149-00-7 |
reaction mass of: hexyldioctylphosphineoxide; dihexyloctylphosphineoxide; trioctylphosphineoxide |
- |
C; R34, N; R50-53 |
|
|
|
015-150-00-2 |
(2-(1,3-dioxolan-2-yl)ethyl)triphenylphosphonium bromide |
86608-70-0 |
Xn; R22, Xi; R41, R33, R52-53 |
|
|
|
015-151-00-8 |
tris(isopropyl/tert-butylphenyl) phosphate |
- |
N; R51-53 |
|
|
|
015-152-00-3 |
dioxabenzofos (ISO); 2-methoxy-4H-1,3,2-benzodioxaphosphorin 2-sulphide |
3811-49-2 |
T; R24/25-39/25, N; R51-53 |
|
|
|
015-153-00-9 |
isazofos (ISO); O-(5-chloro-1-isopropyl-1,2,4-triazol-3-yl) O,O-diethyl phosphorothioate |
42509-80-8 |
T+; R26, T; R24/25, Xn; R48/20, R43, N; R50-53 |
|
|
|
015-154-00-4 |
2-chloroethylphosphonic acid; ethephon |
16672-87-0 |
Xn; R20/21, C; R34, R52-53 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
015-155-00-X |
glufosinate ammonium (ISO); ammonium 2-amino-4-(hydroxymethylphosphinyl)butyrate |
77182-82-2 |
Repr. Cat. 2; R60, Repr. Cat. 3; R63, Xn; R20/21/22-48/20/22 |
|
E |
|
015-156-00-5 |
methyl 3-[(dimethoxyphosphinothioyl)oxy]methacrylate; [1] methacrifos (ISO); methyl (E)-3-[(dimethoxyphosphinothioyl)oxy]methacrylate [2] |
30864-28-9 [1], 62610-77-9 [2] |
Xn; R22, R43, N; R50-53 |
|
|
|
015-157-00-0 |
phosphonic acid; [1] phosphorous acid [2] |
13598-36-2 [1], 10294-56-1 [2] |
Xn; R22, C; R35 |
|
|
|
015-158-00-6 |
(η-cyclopentadienyl)(η-cumenyl)iron(1+)hexafluorophosphate(1-) |
32760-80-8 |
R52-53 |
|
|
|
015-159-00-1 |
hydroxyphosphonoacetic acid |
23783-26-8 |
Xn; R22-48/22, C; R34, R43 |
|
|
|
015-160-00-7 |
vanadyl pyrophosphate |
58834-75-6 |
Xi; R36, R43, R52-53 |
|
|
|
015-161-00-2 |
divanadyl pyrophosphate |
65232-89-5 |
Xn; R22, Xi; R41, R43, N; R51-53 |
|
|
|
015-162-00-8 |
vanadium(IV) oxide hydrogen phosphate hemihydrate, lithium, zinc, molybdenum, iron and chlorine-doped |
- |
Xn; R20-48/22, Xi; R41, N; R51-53 |
|
|
|
015-163-00-3 |
bis(2,6-dimethoxybenzoyl)-2,4,4-trimethylpentylphosphinoxide |
145052-34-2 |
R43, N; R50-53 |
|
|
|
015-164-00-9 |
calcium P,P'-(1-hydroxyethylene)bis(hydrogen phosphonate)dihydrate |
36669-85-9 |
R52-53 |
|
|
|
015-165-00-4 |
reaction mass of: thiobis(4,1-phenylene)-S,S,S',S'-tetraphenyldisulfonium bishexafluorophosphate; diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate |
- |
Xi; R41, N; R50-53 |
|
|
|
015-166-00-X |
3,9-bis(2,6-di-tert-butyl-4-methylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
80693-00-1 |
R53 |
|
|
|
015-167-00-5 |
3-(hydroxyphenylphosphinyl)propanoic acid |
14657-64-8 |
Xi; R41 |
|
|
|
015-168-00-0 |
fosthiazate (ISO); (RS)-S-sec-butyl-O-ethyl-2-oxo-1,3-thiazolidin-3-ylphosphonothioate |
98886-44-3 |
T; R23/25-39, Xn; R21, Xi; R41, R43, N; R50-53 |
|
|
|
015-169-00-6 |
tributyltetradecylphosphonium tetrafluoroborate |
- |
Xn; R22-48/22, C; R34, R43, N; R50-53 |
|
|
|
015-170-00-1 |
reaction mass of: di-(1-octane-N,N,N-trimethylammonium) octylphosphate; 1-octane-N,N,N-trimethylammonium di-octylphosphate; 1-octane-N,N,N-trimethylammonium octylphosphate |
- |
Xn; R21/22, C; R34 |
|
|
|
015-171-00-7 |
O,O,O-tris(2(or 4)-C9-10-isoalkylphenyl) phosphorothioate |
- |
N; R51-53 |
|
|
|
015-172-00-2 |
reaction mass of: bis(isotridecylammonium)mono(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate; isotridecylammonium bis(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate |
- |
R10, C; R34, N; R51-53 |
|
|
|
015-173-00-8 |
methyl [2-(1,1-dimethylethyl)-6-methoxypyrimidin-4-yl]ethylphosphonothioate |
117291-73-3 |
Xn; R22, N; R50-53 |
|
|
|
015-174-00-3 |
1-chloro-N,N-diethyl-1,1-diphenyl-1-(phenylmethyl)phosphoramine |
82857-68-9 |
T; R25, Xi; R41, N; R51-53 |
|
|
|
015-175-00-9 |
tert-butyl (triphenylphosphoranylidene) acetate |
35000-38-5 |
T; R25, Xn; R48/22, Xi; R36, R43, N; R51-53 |
|
|
|
015-176-00-4 |
P,P,P',P'-tetrakis-(o-methoxyphenyl)propane-1,3-diphosphine |
116163-96-3 |
N; R50-53 |
|
|
|
015-177-00-X |
((4-phenylbutyl)hydroxyphosphoryl)acetic acid |
83623-61-4 |
Xn; R48/22, Xi; R41, R43 |
|
|
|
015-178-00-5 |
(R)-α-phenylethylammonium (-)-(1R, 2S)-(1,2-epoxypropyl)phosphonate monohydrate |
25383-07-7 |
Repr. Cat. 3; R62, N; R51-53 |
|
|
|
015-179-00-0 |
UVCB condensation product of: tetrakis-hydroxymethylphosphonium chloride, urea and distilled hydrogenated C16-18 tallow alkylamine |
166242-53-1 |
Carc. Cat. 3; R40, Xn; R22-48/22, C; R34, R43, N; R50-53 |
|
|
|
015-180-00-6 |
[R-(R*,S*)]-[[2-methyl-1-(1-oxopropoxy)propoxy]-(4-phenylbutyl)phosphinyl] acetic acid, (-)-cinchonidine (1:1) salt |
137590-32-0 |
Xi; R41, R43, R52-53 |
|
|
|
015-181-00-1 |
phosphine |
7803-51-2 |
F+; R12, R17, T+; R26, C; R34, N; R50 |
|
|
|
015-182-00-7 |
tetraisopropyldichloromethylenebisphosphonate |
10596-22-2 |
Xn; R22, Xi; R36, R43 |
|
|
|
015-183-00-2 |
(1-hydroxydodecylidene)diphosphonic acid |
16610-63-2 |
C; R34, N; R50-53 |
|
|
|
015-184-00-8 |
Salts of glyphosate, with the exception of those specified elsewhere in this Annex |
- |
N; R51-53 |
|
A |
|
015-186-00-9 |
chlorpyrifos-methyl (ISO),; O, O-dimethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate |
5598-13-0 |
R43, N; R50-53 |
C ≥ 0,0025 %: N; R50-53, 0,00025 % ≤ C < 0,0025 %: N; R51-53, 0,000025 % ≤ C < 0,00025 %: R52-53 |
|
|
015-187-00-4 |
reaction mass of: tetrasodium(((2-hydroxyethyl)imino)bis(methylene))bisphosphonate, N-oxide; trisodium ((tetrahydro-2-hydroxy-4H-1,4,2-oxazaphosphorin-4-yl)-methyl)phosphonate, N-oxide, P-oxide |
- |
Xi; R41, N; R51-53 |
|
|
|
015-188-00-X |
(1-methylethylidene)di-4,1-phenylenetetraphenyl diphosphate |
5945-33-5 |
R53 |
|
|
|
015-189-00-5 |
phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide |
162881-26-7 |
R43, R53 |
|
|
|
015-190-00-0 |
bis(2,4-dicumylphenyl) neopentyl diphosphite; 3,9-bis[2,4-bis(1-methyl-1-phenylethyl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
154862-43-8 |
R53 |
|
|
|
015-191-00-6 |
dodecyldiphenyl phosphate |
27460-02-2 |
Xi; R38, R52-53 |
|
|
|
015-192-00-1 |
tetrakis(2,6-dimethylphenyl)-m-phenylene biphosphate |
139189-30-3 |
R43, R53 |
|
|
|
015-193-00-7 |
triphenyl(phenylmethyl)phosphonium 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-1-butanesulfonamide (1:1) |
332350-93-3 |
T; R25, Xi; R41, N; R50-53 |
|
|
|
015-194-00-2 |
tetrabutyl-phosphonium nonafluoro-butane-1-sulfonate |
220689-12-3 |
Xn; R22, R52-53 |
|
|
|
015-195-00-8 |
reaction mass of: potassium o-toluenephosphonate; potassium m-toluenephosphonate; potassium p-toluenephosphonate |
- |
Xi; R36, R43, R52-53 |
|
|
|
015-196-00-3 |
reaction mass of: dimethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate; diethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate; methyl ethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate |
- |
Carc.Cat.2; R45, Muta.Cat.2; R46, R43 |
|
|
|
015-197-00-9 |
bis(2,4,4-trimethylpentyl)dithiophosphonic acid |
107667-02-7 |
R10, T; R23, Xn; R22, C; R34, N; R51-53 |
|
|
|
015-198-00-4 |
(4-phenylbutyl)phosphinic acid |
86552-32-1 |
Carc.Cat.3; R40, Xi; R41 |
|
|
|
016-001-00-4 |
hydrogen sulphide |
7783-06-4 |
F+; R12, T+; R26, N; R50 |
|
|
|
016-002-00-X |
barium sulphide |
21109-95-5 |
R31, Xn; R20/22, N; R50 |
|
|
|
016-003-00-5 |
barium polysulphides |
50864-67-0 |
R31, Xi; R36/37/38, N; R50 |
|
|
|
016-004-00-0 |
calcium sulphide |
20548-54-3 |
R31, Xi; R36/37/38, N; R50 |
|
|
|
016-005-00-6 |
calcium polysulphides |
1344-81-6 |
R31, Xi; R36/37/38, N; R50 |
|
|
|
016-006-00-1 |
dipotassium sulphide; potassium sulphide |
1312-73-8 |
R31, C; R34, N; R50 |
|
|
|
016-007-00-7 |
potassium polysulphides |
37199-66-9 |
R31, C; R34, N; R50 |
|
|
|
016-008-00-2 |
ammonium polysulphides |
9080-17-5 |
R31, C; R34, N; R50 |
C ≥ 5 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/38, C ≥ 1 %: R31 |
|
|
016-009-00-8 |
disodium sulfide; sodium sulfide |
1313-82-2 |
T; R24, Xn; R22, C; R34, R31, N; R50 |
|
|
|
016-010-00-3 |
sodium polysulphides |
1344-08-7 |
T; R25, R31, C; R34, N; R50 |
|
|
|
016-011-00-9 |
sulphur dioxide |
7446-09-5 |
T; R23, C; R34 |
C ≥ 20 %: T; R23, 5 % ≤ C < 20 %: Xn; R20 |
5 |
|
016-012-00-4 |
disulphur dichloride; sulfur monochloride |
10025-67-9 |
R14, T; R25, Xn; R20, R29, C; R35, N; R50 |
C ≥ 10 %: C; R35, 5 % ≤ C < 10 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/37/38 |
|
|
016-013-00-X |
sulphur dichloride |
10545-99-0 |
R14, C; R34, Xi; R37, N; R50 |
|
|
|
016-014-00-5 |
sulphur tetrachloride |
13451-08-6 |
R14, C; R34, N; R50 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
016-015-00-0 |
thionyl dichloride; thionyl chloride |
7719-09-7 |
R14, Xn; R20/22, R29, C; R35 |
C ≥ 10 %: C; R35, 5 % ≤ C < 10 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/37/38 |
|
|
016-016-00-6 |
sulphuryl chloride |
7791-25-5 |
R14, C; R34, Xi; R37 |
|
|
|
016-017-00-1 |
chlorosulphonic acid |
7790-94-5 |
R14, C; R35, Xi; R37 |
|
|
|
016-018-00-7 |
fluorosulphonic acid |
7789-21-1 |
Xn; R20, C; R35 |
|
|
|
016-019-00-2 |
oleum ... % SO3 |
- |
R14, C; R35, Xi; R37 |
|
B |
|
016-020-00-8 |
sulphuric acid ... % |
7664-93-9 |
C; R35 |
C ≥ 15 %: C; R35, 5 % ≤ C < 15 %: Xi; R36/38 |
B |
|
016-021-00-3 |
methanethiol; methyl mercaptan |
74-93-1 |
F+; R12, T; R23, N; R50-53 |
|
|
|
016-022-00-9 |
ethanethiol; ethyl mercaptan |
75-08-1 |
F; R11, Xn; R20, N; R50-53 |
|
|
|
016-023-00-4 |
dimethyl sulphate |
77-78-1 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, T+; R26, T; R25, C; R34, R43 |
C ≥ 0,01 %: Car. Cat. 2; R45, C ≥ 0,01 %: Muta. Cat. 3, R68, C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
E |
|
016-024-00-X |
dimexano (ISO); bis(methoxythiocarbonyl) disulphide |
1468-37-7 |
Xn; R22, N; R50-53 |
|
|
|
016-025-00-5 |
disul (ISO); 2-(2,4-dichlorophenoxy)ethyl hydrogensulphate; 2,4-DES |
149-26-8 |
Xn; R22, Xi; R38-41 |
|
|
|
016-026-00-0 |
sulphamidic acid; sulphamic acid; sulfamic acid |
5329-14-6 |
Xi; R36/38, R52-53 |
|
|
|
016-027-00-6 |
diethyl sulphate |
64-67-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R20/21/22, C; R34 |
|
E |
|
016-028-00-1 |
sodium dithionite; sodium hydrosulphite |
7775-14-6 |
R7, R31, Xn; R22 |
|
|
|
016-029-00-7 |
p-toluenesulphonic acid, containing more than 5 % H2SO4 |
- |
C; R34 |
C ≥ 25 %: C; R34, 10 % ≤ C < 25 %: Xi; R36/38 |
|
|
016-030-00-2 |
p-toluenesulphonic acid (containing a maximum of 5 % H2SO4) |
104-15-4 |
Xi; R36/37/38 |
|
|
|
016-031-00-8 |
tetrahydrothiophene-1,1-dioxide; sulpholane |
126-33-0 |
Xn; R22 |
|
|
|
016-032-00-3 |
1,3-propanesultone; 1,2-oxathiolane 2,2-dioxide |
1120-71-4 |
Carc. Cat. 2; R45, Xn; R21/22 |
C ≥ 0,01 %: Carc. Cat. 2; R45 |
E |
|
016-033-00-9 |
dimethylsulfamoylchloride |
13360-57-1 |
Carc. Cat. 2; R45, T+; R26, Xn; R21/22, C; R34 |
|
E |
|
016-034-00-4 |
tetrasodium 3,3'-(piperazine-1,4-diylbis((6-chloro-1,3,5-triazine-2,4-diyl)imino(2-acetamido)-4,1-phenyleneazo))bis(naphthalene-1,5-disulphonate) |
81898-60-4 |
R43 |
|
|
|
016-035-00-X |
pentasodium 5-anilino-3-(4-(4-(6-chloro-4-(3-sulphonatoanilino)-1,3,5-triazin-2-ylamino)-2,5-dimethylphenylazo)-2,5-disulphonatophenylazo)-4-hydroxynaphthalene-2,7-disulphonate |
- |
Xi; R36 |
|
|
|
016-036-00-5 |
tetrasodium 5-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-4-hydroxy-2,3-azodinaphthalene-1,2,5,7-disulphonate |
- |
R42, N; R51-53 |
|
|
|
016-037-00-0 |
disodium 1-amino-4-(4-benzenesulphonamido-3-sulphonatoanilino)anthraquinone-2-sulphonate |
85153-93-1 |
Xi; R41, R52-53 |
|
|
|
016-038-00-6 |
disodium 6-((4-chloro-6-(N-methyl)-2-toluidino)-1,3,5-triazin-2-ylamino)-1-hydroxy-2-(4-methoxy-2-sulphonatophenylazo)naphthalene-3-sulphonate |
86393-35-3 |
R43 |
|
|
|
016-039-00-1 |
tetrasodium 2-(6-chloro-4-(4-(2,5-dimethyl-4-(2,5-disulphonatophenylazo)phenylazo)-3-ureidoanilino)-1,3,5-triazin-2-ylamino)benzene-1,4-disulphonate |
- |
R43 |
|
|
|
016-040-00-7 |
reaction mass of disodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(2,4-dihydroxyphenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and disodium 6-(2,4-diaminophenylazo)-3-(4-(4-(2,4-diaminophenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and trisodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(7-(2,4-dihydroxyphenylazo)-1-hydroxy-3-sulphonato-2-naphthylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate |
- |
Xi; R36 |
|
|
|
016-041-00-2 |
calcium 2,5-dichloro-4-(4-((5-chloro-4-methyl-2-sulphonatophenyl)azo)-5-hydroxy-3-methylpyrazol-1-yl)benzenesulphonate |
- |
Xn; R20 |
|
|
|
016-042-00-8 |
tetrasodium 5-benzamido-3-(5-(4-fluoro-6-(1-sulphonato-2-naphthylamino)-1,3,5-triazin-2-ylamino)-2-sulphonatophenylazo)-4-hydroxynaphthalene-2,7- disulphonate |
85665-97-0 |
Xi; R36/38, R43 |
|
|
|
016-043-00-3 |
dilithium 6-acetamido-4-hydroxy-3-(4-((2-sulphonatooxy)ethylsulphonyl)phenylazo)naphthalene-2-sulphonate |
- |
R43 |
|
|
|
016-044-00-9 |
disodium S,S-hexane-1,6-diyldi(thiosulphate) dihydrate |
- |
R43, R52-53 |
|
|
|
016-045-00-4 |
lithium sodium hydrogen 4-amino-6-(5-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-2-sulphonatophenylazo)-5-hydroxy-3-(4-(2-(sulphonatooxy)ethylsulphonyl)phenylazo)naphthalene-2,7-disulphonate |
108624-00-6 |
R43 |
|
|
|
016-046-00-X |
sodium hydrogensulphate |
7681-38-1 |
Xi; R41 |
|
|
|
016-047-00-5 |
hexasodium 7-(4-(4-(4-(2,5-disulphonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)-2-methylphenylazo)-7-sulphonatonaphthylazo)naphthalene-1,3,5- trisulphonate |
85665-96-9 |
R43 |
|
|
|
016-048-00-0 |
sodium 3,5-dichloro-2-(5-cyano-2,6-bis(3-hydroxypropylamino)-4-methylpyridin-3-ylazo)benzenesulphonate |
- |
Xi; R41, R52-53 |
|
|
|
016-049-00-6 |
calcium octadecylxylenesulphonate |
- |
C; R34, N; R51-53 |
|
|
|
016-050-00-1 |
potassium sodium 5-(4-chloro-6-(N-(4-(4-chloro-6-(5-hydroxy-2,7-disulphonato-6-(2-sulphonatophenylazo)-4-naphthylamino)-1,3,5-triazin-2-ylamino) phenyl-N-methyl)amino)-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(2-sulphonatophenylazo)naphthalene-2,7-disulphonat |
- |
Xi; R36, R43 |
|
|
|
016-051-00-7 |
trisodium 7-(4-(6-fluoro-4-(2-(2-vinylsulphonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6- trisulphonate |
106359-91-5 |
R43 |
|
|
|
016-052-00-2 |
benzyltributylammonium 4-hydroxynaphthalene-1-sulphonate |
102561-46-6 |
Xn; R20, N; R51-53 |
|
|
|
016-053-00-8 |
(C16 or C18-n-alkyl)(C16 or C18-n-alkyl)ammonium 2-((C16 or C18-n-alkyl)(C16 or C18-n-alkyl)carbamoyl)benzenesulphonate |
- |
Xi; R38, R43, R53 |
|
|
|
016-054-00-3 |
sodium 4-(2,4,4-trimethylpentylcarbonyloxy)benzenesulfonate |
- |
T; R23-48/23, Xn; R22, Xi; R36/37, R43 |
|
|
|
016-055-00-9 |
tetrasodium 4-amino-3,6-bis(5-(6-chloro-4-(2-hydroxyethylamino)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxynaphthalene-2,7-sulfonate (containing > 35 % sodium chloride and sodium acetate) |
- |
Xi; R41, R43 |
|
|
|
016-056-00-4 |
potassium hydrogensulphate |
7646-93-7 |
C; R34, Xi; R37 |
|
|
|
016-057-00-X |
styrene-4-sulfonyl chloride |
2633-67-2 |
Xi; R38-41, R43 |
|
|
|
016-058-00-5 |
thionyl chloride, reaction products with 1,3,4-thiadiazol-2,5-dithiol, tert-nonanethiol and C12-14-tert-alkylamine |
- |
Xi; R38, R43, R52-53 |
|
|
|
016-059-00-0 |
N,N,N',N'-tetramethyldithiobis(ethylene)diamine dihydrochloride |
17339-60-5 |
Xn; R22, Xi; R36, R43, N; R50-53 |
|
|
|
016-060-00-6 |
diammonium peroxodisulphate; ammonium persulphate |
7727-54-0 |
O; R8, Xn; R22, Xi; R36/37/38, R42/43 |
|
|
|
016-061-00-1 |
dipotassium peroxodisulphate; potassium persulphate |
7727-21-1 |
O; R8, Xn; R22, Xi; R36/37/38, R42/43 |
|
|
|
016-062-00-7 |
bensultap (ISO); 1,3-bis(phenylsulfonylthio)-2-(N,N-dimethylamino)propane |
17606-31-4 |
Xn; R22, N; R50-53 |
|
|
|
016-063-00-2 |
sodium metabisulphite |
7681-57-4 |
Xn; R22, Xi; R41, R31 |
|
|
|
016-064-00-8 |
sodium hydrogensulphite … %; sodium bisulphite … % |
7631-90-5 |
Xn; R22, R31 |
|
B |
|
016-065-00-3 |
sodium 1-amino-4-[2-methyl-5-(4-methylphenylsulfonylamino)phenylamino]anthraquinone-2-sulfonate |
84057-97-6 |
N; R51-53 |
|
|
|
016-066-00-9 |
tetrasodium [5-((4-amino-6-chloro-1,3,5-triazin-2-yl)amino)-2-((2-hydroxy-3,5-disulfonatophenylazo)-2- sulfonatobenzylidenehydrazino)benzoate]copper(II) |
116912-62-0 |
R52-53 |
|
|
|
016-067-00-4 |
(4-methylphenyl)mesitylene sulfonate |
67811-06-7 |
R53 |
|
|
|
016-068-00-X |
sodium 3,5-bis(tetradecyloxycarbonyl)benzenesulfinate |
155160-86-4 |
R43, N; R51-53 |
|
|
|
016-069-00-5 |
3,5-bis-(tetradecyloxycarbonyl)benzenesulfinic acid |
141915-64-2 |
R43, N; R51-53 |
|
|
|
016-070-00-0 |
4-benzyloxy-4'-(2,3-epoxy-2-methylprop-1-yloxy)diphenylsulfone |
- |
R53 |
|
|
|
016-071-00-6 |
trisodium 3-amino-6,13-dichloro-10-((3-((4-chloro-6-(2-sulfophenylamino)-1,3,5-triazin-2-yl)amino)propyl) amino)-4,11-triphenoxydioxazinedisulfonate |
136248-03-8 |
R43 |
|
|
|
016-072-00-1 |
3-amino-4-hydroxy-N-(2-methoxyethyl)-benzenesulfonamide |
112195-27-4 |
Xi; R41, R43, N; R51-53 |
|
|
|
016-073-00-7 |
tetrakis(phenylmethyl)thioperoxydi(carbothioamide) |
10591-85-2 |
R53 |
|
|
|
016-074-00-2 |
6-fluoro-2-methyl-3-(4-methylthiobenzyl)indene |
- |
Xi; R38-41, R43, N; R51-53 |
|
|
|
016-075-00-8 |
2,2'-diallyl-4,4'-sulfonyldiphenol |
41481-66-7 |
R43, N; R51-53 |
|
|
|
016-076-00-3 |
2,3-bis((2-mercaptoethyl)thio)-1-propanethiol |
131538-00-6 |
Xn; R22-48/22, N; R50-53 |
|
|
|
016-077-00-9 |
2-chloro-p-toluenesulfochloride |
42413-03-6 |
C; R34, R43, R52-53 |
|
|
|
016-078-00-4 |
4-methyl-N,N-bis(2-(((4-methylphenyl)sulfonyl)amino)ethyl)benzenesulfonamide |
56187-04-3 |
R53 |
|
|
|
016-079-00-X |
N,N-bis(2-(p-toluenesulfonyloxy)ethyl)-p-toluenesulfonamide |
16695-22-0 |
R43, R53 |
|
|
|
016-080-00-5 |
sodium 2-anilino-5-(2-nitro-4-(N-phenylsulfamoyl))anilinobenzenesulfonate |
31361-99-6 |
Xi; R41, R52-53 |
|
|
|
016-081-00-0 |
hexahydrocyclopenta[c]pyrrole-1-(1H)-ammonium N-ethoxycarbonyl-N-(p-tolylsulfonyl)azanide |
- |
Muta. Cat. 3; R68, Xn; R22, Xi; R36, R43, N; R51-53 |
|
|
|
016-082-00-6 |
ethoxysulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethoxyphenoxysulfonyl)urea |
126801-58-9 |
N; R50-53 |
|
|
|
016-083-00-1 |
acibenzolar-S-methyl; benzo[1,2,3]thiadiazole-7-carbothioic acid S-methyl ester |
135158-54-2 |
Xi; R36/37/38, R43, N; R50-53 |
|
|
|
016-084-00-7 |
prosulfuron (ISO); 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(3,3,3-trifluoropropyl)phenylsulfonyl]urea |
94125-34-5 |
Xn; R22, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
016-085-00-2 |
flazasulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-(3-trifluoromethyl-2-pyridylsulfonyl)urea |
104040-78-0 |
N; R50-53 |
|
|
|
016-086-00-8 |
tetrasodium 10-amino-6,13-dichloro-3-(3-(4-(2,5-disulfonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacene-4,11-disulfonate |
109125-56-6 |
Xi; R41 |
|
|
|
016-087-00-3 |
reaction mass of: thiobis(4,1-phenylene)-S,S,S',S'-tetraphenyldisulfonium bishexafluorophosphate; diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate; propylene carbonate |
104558-95-4 |
Xi; R36, R43, N; R50-53 |
|
|
|
016-088-00-9 |
4-(bis(4-(diethylamino)phenyl)methyl)benzene-1,2-dimethanesulfonic acid |
71297-11-5 |
R52-53 |
|
|
|
016-089-00-4 |
reaction mass of esters of 5,5',6,6',7,7'-hexahydroxy-3,3,3',3'-tetramethyl-1,1'-spirobiindan and 2-diazo-1,2-dihydro-1-oxo-5-sulfonaphthalene |
- |
E; R2, F; R11, R53 |
|
|
|
016-090-00-X |
4-methyl-N-(methylsulfonyl)benzenesulfonamide |
14653-91-9 |
Xn; R22, Xi; R37-41 |
|
|
|
016-091-00-5 |
C12-14-tert-alkyl ammonium 1-amino-9,10-dihydro-9,10-dioxo-4-(2,4,6-trimethylanilino)-anthracen-2-sulfonate |
- |
Xi; R41, N; R50-53 |
|
|
|
016-092-00-0 |
reaction mass of: 4,7-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol; 4,8-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol; 5,7-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol |
- |
Repr. Cat. 3; R62, Xi; R38, R43, N; R50-53 |
|
|
|
016-093-00-6 |
reaction mass of: 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinol-4-yl-tris(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate); 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinolbis(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate) (2:1) |
140698-96-0 |
F; R11, Carc. Cat. 3; R40 |
|
|
|
016-094-00-1 |
sulfur |
7704-34-9 |
Xi; R38 |
|
|
|
016-095-00-7 |
reaction mass of: reaction product of 4,4'-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:2); Reaction product of 4,4'-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydr |
- |
F; R11, Carc. Cat. 3; R40 |
|
|
|
016-096-00-2 |
thifensulfuron-methyl (ISO); methyl 3-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl)thiophene-2-carboxylate |
79277-27-3 |
N; R50-53 |
|
|
|
016-097-00-8 |
1-amino-2-methyl-2-propanethiol hydrochloride |
32047-53-3 |
Xn; R22, C; R34, R43, R52-53 |
|
|
|
017-001-00-7 |
chlorine |
7782-50-5 |
T; R23, Xi; R36/37/38, N; R50 |
C ≥ 0,25 %: N; R50 |
|
|
017-002-00-2 |
hydrogen chloride |
7647-01-0 |
T; R23, C; R35 |
|
5 |
|
017-002-01-X |
hydrochloric acid ... % |
- |
C; R34, Xi; R37 |
C ≥ 25 %: C; R34-37, 10 % ≤ C < 25 %: Xi; R36/37/38 |
B |
|
017-003-00-8 |
barium chlorate |
13477-00-4 |
O; R9, Xn; R20/22, N; R51-53 |
|
|
|
017-004-00-3 |
potassium chlorate |
3811-04-9 |
O; R9, Xn; R20/22, N; R51-53 |
|
|
|
017-005-00-9 |
sodium chlorate |
7775-09-9 |
O; R9, Xn; R22, N; R51-53 |
|
|
|
017-006-00-4 |
perchloric acid ... % |
7601-90-3 |
R5, O; R8, C; R35 |
C ≥ 50 %: C; R35, 10 % ≤ C < 50 %: C; R34, 1 % ≤ C < 10 %: Xi; R36/38, C > 50%: Footnote O; R5-8 |
B |
|
017-007-00-X |
barium perchlorate |
13465-95-7 |
O; R9, Xn; R20/22 |
|
|
|
017-008-00-5 |
potassium perchlorate |
7778-74-7 |
O; R9, Xn; R22 |
|
|
|
017-009-00-0 |
ammonium perchlorate; [containing ≥ 80 % of 0-30 µm particles] |
7790-98-9 |
E; R3, O; R9 |
|
T |
|
017-009-01-8 |
ammonium perchlorate; [containing < 80 % of 0-30 µm particles] |
- |
E; R2, O; R9 |
|
T |
|
017-010-00-6 |
sodium perchlorate |
7601-89-0 |
O; R9, Xn; R22 |
|
|
|
017-011-00-1 |
sodium hypochlorite, solution ... % Cl active |
7681-52-9 |
C; R34, R31, N; R50 |
C ≥ 5 %: R31 |
B |
|
017-012-00-7 |
calcium hypochlorite |
7778-54-3 |
O; R8 .tp., C; R34, Xn; R22, R31, N; R50 |
C ≥ 10 %: C; R34, 3 % ≤ C < 10 %: Xi; R37/38-41, 0,5 % ≤ C < 3 %: Xi; R36, C ≥ 2,5 %: N; R50 |
|
|
017-013-00-2 |
calcium chloride |
10043-52-4 |
Xi; R36 |
|
|
|
017-014-00-8 |
ammonium chloride |
12125-02-9 |
Xn; R22, Xi; R36 |
|
|
|
017-015-00-3 |
(2-(aminomethyl)phenyl)acetylchloride hydrochloride |
61807-67-8 |
Xn; R22, C; R35, R43 |
|
|
|
017-016-00-9 |
methyltriphenylphosphonium chloride |
1031-15-8 |
Xn; R21/22, Xi; R38-41, N; R51-53 |
|
|
|
017-017-00-4 |
(Z)-13-docosenyl-N,N-bis(2-hydroxyethyl)-N-methyl-ammonium-chloride |
120086-58-0 |
C; R34, N; R50-53 |
|
|
|
017-018-00-X |
N,N,N-trimethyl-2,3-bis(stearoyloxy)propylammonium chloride |
- |
N; R51-53 |
|
|
|
017-019-00-5 |
(R)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-veratrylisoquinoline hydrochloride |
54417-53-7 |
Xn; R22, R52-53 |
|
|
|
017-020-00-0 |
ethyl propoxy aluminium chloride |
13014-29-4 |
F; R15, R 14, C; R35 |
|
|
|
017-021-00-6 |
behenamidopropyl-dimethyl-(dihydroxypropyl) ammonium chloride |
136920-10-0 |
Xi; R41, R43, N; R50-53 |
|
|
|
017-023-00-7 |
[phosphinyldynetris(oxy)] tris[3-aminopropyl-2-hydroxy-N,N-dimethyl-N-(C6-18)-alkyl] trichlorides |
197179-61-6 |
Xi; R41, N; R50-53 |
|
|
|
017-026-00-3 |
chlorine dioxide |
10049-04-4 |
O; R8, R6, T+; R26, C; R34, N; R50 |
C ≥ 2,5 %: N; R50 |
5 |
|
017-026-01-0 |
chlorine dioxide ... % |
10049-04-4 |
T; R25, C; R34, N; R50 |
C ≥ 10 %: C; R34, 3 % ≤ C < 10 %: Xi; R37/38, 0,3 % ≤ C < 10 %: Xi; R36, C ≥ 2,5 %: N; R50 |
B |
|
019-001-00-2 |
potassium |
7440-09-7 |
F; R15, R14, C; R34 |
|
|
|
019-002-00-8 |
potassium hydroxide; caustic potash |
1310-58-3 |
Xn; R22, C; R35 |
C ≥ 5 %: C; R35, 2 % ≤ C < 5 %: C; R34, 0.5 % ≤ C < 2 %: Xi; R36/38 |
|
|
019-003-00-3 |
potassium (E,E)-hexa-2,4-dienoate |
24634-61-5 |
Xi; R36 |
|
|
ATP07 |
020-001-00-X |
calcium |
7440-70-2 |
F; R15 |
|
|
|
020-002-00-5 |
calcium cyanide |
592-01-8 |
T+; R28, R32, N; R50-53 |
|
|
|
020-003-00-0 |
reaction mass of: dicalcium (bis(2-hydroxy-5-tetra-propenylphenylmethyl)methylamine)dihydroxide; tri-calcium (tris(2-hydroxy-5-tetra-propenylphenylmethyl)methylamine)tri-hydroxide; poly[calcium ((2-hydroxy-5-tetra-propenyl-phenylmethyl)methylamine)hydro |
- |
Xi; R36/38, R43 |
|
|
|
022-001-00-5 |
titanium tetrachloride |
7550-45-0 |
R14, C; R34 |
|
|
|
022-002-00-0 |
titanium(4+) oxalate |
- |
Xi; R41 |
|
|
|
022-003-00-6 |
bis(η5-cyclopentadienyl)-bis(2,6-difluoro-3-[pyrrol-1-yl]-phenyl)titanium |
125051-32-3 |
F; R11, Repr. Cat. 3; R62, Xn; R48/22, N; R51-53 |
|
|
|
022-004-00-1 |
potassium titanium oxide (K2Ti6O13) |
12056-51-8 |
Carc.Cat.3; R40 |
|
|
|
022-005-00-7 |
[N-(1,1-dimethylethyl)-1,1-dimethyl-1-[(1,2,3,4,5-η)-2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl]silanaminato(2-)-κN][(1,2,3,4-η)-1,3-pentadiene]-titanium |
169104-71-6 |
F; R11, C; R34, R43, R53 |
|
|
|
023-001-00-8 |
divanadium pentaoxide; vanadium pentoxide |
1314-62-1 |
Muta. Cat. 3; R68, Repr. Cat. 3; R63, T; R48/23, Xn; R20/22, Xi; R37, N; R51-53 |
|
|
|
024-001-00-0 |
chromium (VI) trioxide |
1333-82-0 |
O; R9, Carc. Cat. 1; R45, Muta. Cat. 2; R46, Repr. Cat. 3; R62, T+; R26, T; R24/25-48/23, C; R35, R42/43, N; R50-53 |
C ≥ 10%: C; R35, 5 % ≤ C < 10 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/37/38 |
E |
|
024-002-00-6 |
potassium dichromate |
7778-50-9 |
O; R8, Carc. Cat. 2; R45, Muta. Cat. 2; R46, Repr. Cat. 2; R60-61, T+; R26, T; R25-48/23, Xn; R21, C; R34, R42/43, N; R50-53 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
E3 |
|
024-003-00-1 |
ammonium dichromate |
7789-09-5 |
E; R2, O; R8, Carc. Cat. 2; R45, Muta. Cat. 2; R46, Repr. Cat. 2; R60-61, T+; R26, T; R25-48/23, Xn; R21, C; R34, R42/43, N; R50-53 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38, C ≥ 0,2 %: R42/43 |
E3 |
|
024-004-00-7 |
sodium dichromate |
10588-01-9 |
O; R8, Carc. Cat. 2; R45, Muta. Cat. 2; R46, Repr. Cat. 2; R60-61, T+; R26, T; R25-48/23, Xn; R21, C; R34, R42/43, N; R50-53 |
C ≥ 25 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38, C ≥ 0,2 %: R42/43 |
E |
|
024-005-00-2 |
chromyl dichloride; chromic oxychloride |
14977-61-8 |
O; R8, Carc. Cat. 2; R49, Muta. Cat. 2; R46, C; R35, R43, N; R50-53 |
C ≥ 10 %: C; R35, 5 % ≤ C < 10 %: C; R34, 0,5 % ≤ C < 5 %: Xi; R36/37/38, C ≥ 0,5 %: R43 |
3 |
|
024-006-00-8 |
potassium chromate |
7789-00-6 |
Carc. Cat. 2; R49, Muta. Cat. 2; R46, Xi; R36/37/38, R43, N; R50-53 |
C ≥ 0,5 %: R43 |
3 |
|
024-007-00-3 |
zinc chromates including zinc potassium chromate |
- |
Carc. Cat. 1; R45, Xn; R22, R43, N; R50-53 |
|
A E |
|
024-008-00-9 |
calcium chromate |
13765-19-0 |
Carc. Cat. 2; R45, Xn; R22, N; R50-53 |
|
E |
|
024-009-00-4 |
strontium chromate |
7789-06-2 |
Carc. Cat. 2; R45, Xn; R22, N; R50-53 |
|
E |
|
024-010-00-X |
dichromium tris(chromate); chromium III chromate; chromic chromate |
24613-89-6 |
O; R8, Carc. Cat. 2; R45, C; R35, R43, N; R50-53 |
|
|
|
024-011-00-5 |
ammonium bis(1-(3,5-dinitro-2-oxidophenylazo)-3-(N-phenylcarbamoyl)-2-naphtholato)chromate(1-) |
109125-51-1 |
F; R11, N; R50-53 |
|
|
|
024-012-00-0 |
trisodium bis(7-acetamido-2-(4-nitro-2-oxidophenylazo)-3-sulphonato-1-naphtholato)chromate(1-) |
- |
Muta. Cat. 3; R68 |
|
|
|
024-013-00-6 |
trisodium (6-anilino-2-(5-nitro-2-oxidophenylazo)-3-sulphonato-1-naphtholato)(4-sulphonato-1,1'-azodi-2,2'naphtholato)chromate(1-) |
- |
Xi; R41, N; R51-53 |
|
|
|
024-014-00-1 |
trisodium bis(2-(5-chloro-4-nitro-2-oxidophenylazo)-5-sulphonato-1-naphtholato)chromate(1-) |
93952-24-0 |
Xi; R41, R52-53 |
|
|
|
024-015-00-7 |
disodium (3-methyl-4-(5-nitro-2-oxidophenylazo)-1-phenylpyrazololato)(1-(3-nitro-2-oxido-5-sulfonatophenylazo)-2-naphtholato)chromate(1-) |
- |
Xn; R20, Xi; R41, N; R51-53 |
|
|
|
024-016-00-2 |
tetradecylammonium bis(1-(5-chloro-2-oxidophenylazo)-2-naphtholato)chromate(1-) |
88377-66-6 |
Xn; R48/22, R53 |
|
|
|
024-017-00-8 |
Chromium (VI) compounds, with the exception of barium chromate and of compounds specified elsewhere in this Annex |
- |
Carc. Cat. 2; R49, R43, N; R50-53 |
|
A |
|
024-018-00-3 |
sodium chromate |
7775-11-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Repr. Cat. 2; R60-61, T+; R26, T; R25-48/23, Xn; R21, C; R34, R42/43, N; R50-53 |
C ≥ 0,2 %: R42/43 |
E3 |
|
024-019-00-9 |
Main component: acetoacetic acid anilide/3-amino-1-hydroxybenzene (ATAN-MAP): trisodium {}{6-[(2 or 3 or 4)-amino-(4 or 5 or 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato}}-{}{6''-[1-(phenylcarbamoyl)ethylazo]- |
- |
R43, R52-53 |
|
|
|
024-020-00-4 |
trisodium bis[(3'-nitro-5'-sulfonato(6-amino-2-[4-(2-hydroxy-1-naphtylazo)phenylsulfonylamino]pyrimidin-5-azo)benzene-2',4-diolato)]chromate (III) |
- |
R43, R52-53 |
|
|
|
024-021-00-X |
potassium tetrasodium bis[(N,N'-n)-1'-(phenylcarbamoyl)-3,5-disulfonatobenzeneazo-1'-prop-1'-ene-2,2'-diolato]chromate(III) |
- |
Xi; R41 |
|
|
|
025-001-00-3 |
manganese dioxide |
1313-13-9 |
Xn; R20/22 |
|
|
|
025-002-00-9 |
potassium permanganate |
7722-64-7 |
O; R8, Xn; R22, N; R50-53 |
|
|
|
025-003-00-4 |
manganese sulphate |
7785-87-7 |
Xn; R48/20/22, N; R51-53 |
|
|
|
025-004-00-X |
bis(N,N',N''-trimethyl-1,4,7-triazacyclononane)-trioxo-dimanganese (IV) di(hexafluorophosphate) monohydrate |
116633-53-5 |
N; R51-53 |
|
|
|
025-005-00-5 |
reaction mass of: tri-sodium [29H, 31H-phthalocyanine-C,C,C-trisulfonato (6-)-N29,N30,N31,N32] manganate (3-); tetrasodium [29H,31H-phthalocyanine-C,C,C,C-tetrasulfonato (6-)-N29,N30,N31,N32], manganate (3-); pentasodium [29H,31H-phthalocyanine-C,C,C,C, |
- |
N; R50-53 |
|
|
|
026-001-00-6 |
(η-cumene)-(η-cyclopentadienyl)iron(II) hexafluoroantimonate |
100011-37-8 |
Xn; R22, Xi; R41, R52-53 |
|
|
|
026-002-00-1 |
(η-cumene)-(η-cyclopentadienyl)iron(II) trifluoromethane-sulfonate |
117549-13-0 |
Xn; R22, R52-53 |
|
|
|
026-003-00-7 |
iron (II) sulfate |
7720-78-7 |
Xn; R22, Xi; R36/38 |
|
|
|
026-003-01-4 |
iron (II) sulfate (1:1) heptahydrate; sulfuric acid, iron(II) salt (1:1), heptahydrate; ferrous sulfate heptahydrate |
7782-63-0 |
Xn; R22, Xi; R36/38 |
C ≥ 25 %: Xi; R38 |
|
|
026-004-00-2 |
potassium ferrite |
12160-44-0 |
C; R34, R43 |
|
|
|
027-001-00-9 |
cobalt |
7440-48-4 |
R42/43, R53 |
|
|
|
027-002-00-4 |
cobalt oxide |
1307-96-6 |
Xn; R22, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
027-003-00-X |
cobalt sulfide |
1317-42-6 |
R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
027-004-00-5 |
cobalt dichloride |
7646-79-9 |
Carc. Cat. 2; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R60, Xn; R22, R42/43, N; R50-53 |
C ≥ 0,01 %: Carc. Cat. 2; R49, C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
E1 |
|
027-005-00-0 |
cobalt sulfate |
10124-43-3 |
Carc. Cat. 2; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R60, Xn; R22, R42/43, N; R50-53 |
C ≥ 0,01 %: Carc. Cat. 2; R49, C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
E1 |
|
027-006-00-6 |
cobalt acetate |
71-48-7 |
Carc. Cat. 2; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R60, R42/43, N; R50-53 |
C ≥ 0,01 %: Carc. Cat. 2; R49, C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
1 |
|
027-007-00-1 |
zinc hexacyanocobaltate(III), tertiary butyl alcohol/polypropylene glycol complex |
- |
Xi; R41, N; R51-53 |
|
|
|
027-008-00-7 |
complex of cobalt(III)-bis(N-phenyl-4-(5-ethylsulfonyl-2-hydroxyphenylazo)-3-hydroxynaphthylamide), hydrated (n H2O, 2<n<3) |
- |
R43 |
|
|
|
027-009-00-2 |
cobalt nitrate |
10141-05-6 |
Carc. Cat. 2; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R60, R42/43, N; R50-53 |
C ≥ 0,01 %: Carc. Cat. 2; R49, C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
1 |
|
027-010-00-8 |
cobalt carbonate |
513-79-1 |
Carc. Cat. 2; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R60, R42/43, N; R50-53 |
C ≥ 0,01 %: Carc. Cat. 2; R49, C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
1 |
|
028-001-00-1 |
tetracarbonylnickel; nickel tetracarbonyl |
13463-39-3 |
F; R11, Carc. Cat. 3; R40, Repr. Cat. 2; R61, T+; R26, N; R50-53 |
|
E |
|
028-002-00-7 |
nickel |
7440-02-0 |
Carc. Cat. 3; R40, T; R48/23, R43 |
|
S7 |
|
028-002-01-4 |
nickel powder; [particle diameter < 1 mm] |
7440-02-0 |
Carc. Cat. 3; R40, T; R48/23, R43, R52-53 |
|
|
|
028-003-00-2 |
nickel monoxide; [1] nickel oxide; [2] bunsenite [3] |
1313-99-1 [1], 11099-02-8 [2], 34492-97-2 [3] |
Carc. Cat. 1; R49, T; R48/23, R43, R53 |
|
E |
|
028-004-00-8 |
nickel dioxide |
12035-36-8 |
Carc. Cat. 1; R49, T; R48/23, R43, R53 |
|
E |
|
028-005-00-3 |
dinickel trioxide |
1314-06-3 |
Carc. Cat. 1; R49, T; R48/23, R43, R53 |
|
E |
|
028-006-00-9 |
nickel (II) sulfide; [1] nickel sulfide; [2] millerite [3] |
16812-54-7 [1], 11113-75-0 [2], 1314-04-1 [3], - |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, T; R48/23, R43, N; R50-53 |
|
E |
|
028-007-00-4 |
trinickel disulfide; nickel subsulfide; [1] heazlewoodite [2] |
12035-72-2 [1], 12035-71-1 [2] |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, T; R48/23, R43, N; R50-53 |
|
E |
|
028-008-00-X |
nickel dihydroxide; [1] nickel hydroxide [2] |
12054-48-7 [1], 11113-74-9 [2] |
Carc. Cat. 1; R49, Repr. Cat. 2; R61, Muta. Cat. 3; R68, T; R48/23, Xn; R20/22, Xi; R38, R42/43, N; R50-53 |
|
E |
|
028-009-00-5 |
nickel sulfate |
7786-81-4 |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, Xn; R20/22, Xi; R38, R42/43, N; R50-53 |
C ≥ 1 %: T; R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 20 %: Xi; R38, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
|
028-010-00-0 |
nickel carbonate; basic nickel carbonate; carbonic acid, nickel (2+) salt; [1] carbonic acid, nickel salt; [2] [µ-[carbonato(2-)-O:O’]] dihydroxy trinickel; [3] [carbonato(2-)] tetrahydroxytrinickel [4] |
3333-67-3 [1], 16337-84-1 [2], 65405-96-1 [3], 12607-70-4 [4] |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, Xn; R20/22, Xi; R38, R42/43, N; R50-53 |
|
E |
|
028-011-00-6 |
nickel dichloride |
7718-54-9 |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R23/25-48/23, Xi; R38, R42/43, N; R50-53 |
C ≥ 1 %: T; R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 20 %: Xi; R38, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
|
028-012-00-1 |
nickel dinitrate; [1] nitric acid, nickel salt [2] |
13138-45-9 [1], 14216-75-2 [2] |
O; R8, Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, Xn; R20/22, Xi; R38-41, R42/43, N; R50-53 |
C ≥ 1 %: T; R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 20 %: Xi; R38, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
|
028-013-00-7 |
nickel matte |
69012-50-6 |
Carc. Cat. 1; R49, T; R48/23, R43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-014-00-2 |
slimes and sludges, copper electrolytic refining, decopperised, nickel sulfate |
92129-57-2 |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, Xn; R20/22, Xi; R38, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
|
028-015-00-8 |
slimes and sludges, copper electrolyte refining, decopperised |
94551-87-8 |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 1; R61, Repr. Cat. 3; R62, T; R48/23, R42/43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-016-00-3 |
nickel diperchlorate; perchloric acid, nickel(II) salt |
13637-71-3 |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, C; R34, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 5 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/38, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
CLP00/ATP02 |
028-017-00-9 |
nickel dipotassium bis(sulfate); [1] diammonium nickel bis(sulfate) [2] |
13842-46-1 [1], 15699-18-0 [2] |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, Xn; R20/22, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
CLP00/ATP02 |
028-018-00-4 |
nickel bis(sulfamidate); nickel sulfamate |
13770-89-3 |
Carc. 1A, Muta. 2, Repr. 1B, Acute Tox. 4, STOT RE 1, Resp. Sens. 1, Skin Sens. 1, Aquatic Acute 1, Aquatic Chronic 1 |
Oral: ATE = 853 mg/kg bw (anhydrate), Oral: ATE = 1098 mg/kg bw (tetrahydrate), STOT RE 1; H372: C ≥ 1 %
STOT RE 2; H373: ,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ ,01 %, M=1
|
|
ATP01/ATP14 |
028-019-00-X |
nickel bis(tetrafluoroborate) |
14708-14-6 |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
CLP00/ATP02 |
028-021-00-0 |
nickel diformate; [1] formic acid, nickel salt; [2] formic acid, copper nickel salt [3] |
3349-06-2 [1], 15843-02-4 [2], 68134-59-8 [3] |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
CLP00/ATP02 |
028-022-00-6 |
nickel di(acetate); [1] nickel acetate [2] |
373-02-4 [1], 14998-37-9 [2] |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, Xn; R20/22, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
CLP00/ATP02 |
028-024-00-7 |
nickel dibenzoate |
553-71-9 |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
CLP00/ATP02 |
028-025-00-2 |
nickel bis(4-cyclohexylbutyrate) |
3906-55-6 |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
|
|
028-026-00-8 |
nickel(II) stearate; nickel(II) octadecanoate |
2223-95-2 |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E U |
|
028-027-00-3 |
nickel dilactate |
16039-61-5 |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
CLP00/ATP02 |
028-028-00-9 |
nickel(II) octanoate |
4995-91-9 |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat 2; R61, T; R48/23, C; R35, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
CLP00/ATP02 |
028-029-00-4 |
nickel difluoride; [1] nickel dibromide; [2] nickel diiodide; [3] nickel potassium fluoride [4] |
10028-18-9 [1], 13462-88-9 [2], 13462-90-3 [3], 11132-10-8 [4] |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
CLP00/ATP02 |
028-030-00-X |
nickel hexafluorosilicate |
26043-11-8 |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
CLP00/ATP02 |
028-031-00-5 |
nickel selenate |
15060-62-5 |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
CLP00/ATP02 |
028-032-00-0 |
nickel hydrogen phosphate; [1] nickel bis(dihydrogen phosphate); [2] trinickel bis(orthophosphate); [3] dinickel diphosphate; [4] nickel bis(phosphinate); [5] nickel phosphinate; [6] phosphoric acid, calcium nickel salt; [7] diphosphoric acid, nick |
14332-34-4 [1], 18718-11-1 [2], 10381-36-9 [3], 14448-18-1 [4], 14507-36-9 [5], 36026-88-7 [6], 17169-61-8 [7], 19372-20-4 [8] |
Carc. Cat. 1; R49, T; R48/23, R42/43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-033-00-6 |
diammonium nickel hexacyanoferrate |
74195-78-1 |
Carc. Cat. 1; R49, T; R48/23, R42/43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-034-00-1 |
nickel dicyanide |
557-19-7 |
Carc. Cat. 1; R49, T; R48/23, R42/43, R32, N; R50-53 |
|
E |
CLP00/ATP02 |
028-035-00-7 |
nickel chromate |
14721-18-7 |
Carc. Cat. 1; R49, T; R48/23, R42/43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-036-00-2 |
nickel(II) silicate; [1] dinickel orthosilicate; [2] nickel silicate (3:4); [3] silicic acid, nickel salt; [4] trihydrogen hydroxybis[orthosilicato(4-)]trinickelate(3-) [5] |
21784-78-1 [1], 13775-54-7 [2], 31748-25-1 [3], 37321-15-6 [4], 12519-85-6 [5] |
Carc. Cat. 1; R49, T; R48/23, R43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-037-00-8 |
dinickel hexacyanoferrate |
14874-78-3 |
Carc. Cat. 1; R49, T; R48/23, R43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-038-00-3 |
trinickel bis(arsenate); nickel(II) arsenate |
13477-70-8 |
Carc. Cat. 1; R45, T; R48/23, R43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-039-00-9 |
nickel oxalate; [1] oxalic acid, nickel salt [2] |
547-67-1 [1], 20543-06-0 [2] |
Carc. Cat. 1; R49, T; R48/23, R43, N: R50-53 |
|
E |
CLP00/ATP02 |
028-040-00-4 |
nickel telluride |
12142-88-0 |
Carc. Cat. 1; R49, T; R48/23, R43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-041-00-X |
trinickel tetrasulfide |
12137-12-1 |
Carc. Cat. 1; R49, T; R48/23, R43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-042-00-5 |
trinickel bis(arsenite) |
74646-29-0 |
Carc. Cat. 1; R49, T; R48/23, R43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-043-00-0 |
cobalt nickel gray periclase; C.I. Pigment Black 25; C.I. 77332; [1] cobalt nickel dioxide; [2] cobalt nickel oxide [3] |
68186-89-0 [1], 58591-45-0 [2], 12737-30-3 [3] |
Carc. Cat. 1; R49, T; R48/23, R43 |
|
E |
CLP00/ATP02 |
028-044-00-6 |
nickel tin trioxide; nickel stannate |
12035-38-0 |
Carc. Cat. 1; R49, T; R48/23, R43 |
|
E |
CLP00/ATP02 |
028-045-00-1 |
nickel triuranium decaoxide |
15780-33-3 |
Carc. Cat. 1; R49, T; R48/23, R43 |
|
E |
CLP00/ATP02 |
028-046-00-7 |
nickel dithiocyanate |
13689-92-4 |
Carc. Cat. 1; R49, Muta. Cat. 3;R68, Repr. Cat. 2; R61, T; R48/23, R42/43, R32, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
CLP00/ATP02 |
028-047-00-2 |
nickel dichromate |
15586-38-6 |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
CLP00/ATP02 |
028-048-00-8 |
nickel(II) selenite |
10101-96-9 |
Carc. Cat. 1; R49, T; R48/23, R42/43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-049-00-3 |
nickel selenide |
1314-05-2 |
Carc. Cat. 1; R49, T; R48/23, R43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-050-00-9 |
silicic acid, lead nickel salt |
68130-19-8 |
Carc. Cat. 1: R49, Repr. Cat. 1: R61, Repr. Cat. 3; R62, T; R48/23, R43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-051-00-4 |
nickel diarsenide; [1] nickel arsenide [2] |
12068-61-0 [1], 27016-75-7 [2] |
Carc. Cat. 1; R49, T; R48/23, R43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-052-00-X |
nickel barium titanium primrose priderite; C.I. Pigment Yellow 157; C.I. 77900 |
68610-24-2 |
Carc. Cat. 1: R49, T; R48/23, R43 |
|
E |
CLP00/ATP02 |
028-053-00-5 |
nickel dichlorate; [1] nickel dibromate; [2] ethyl hydrogen sulfate, nickel(II) salt [3] |
67952-43-6 [1], 14550-87-9 [2], 71720-48-4 [3] |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
CLP00/ATP02 |
028-054-00-0 |
nickel(II) trifluoroacetate; [1] nickel(II) propionate; [2] nickel bis(benzenesulfonate); [3] nickel(II) hydrogen citrate; [4] citric acid, ammonium nickel salt; [5] citric acid, nickel salt; [6] nickel bis(2-ethylhexanoate); [7] 2-ethylhexanoic ac |
16083-14-0 [1], 3349-08-4 [2], 39819-65-3 [3], 18721-51-2 [4], 18283-82-4 [5], 22605-92-1 [6], 4454-16-4 [7], 7580-31-6 [8], 93983-68-7 [9], 29317-63-3 [10], 27637-46-3 [11], 84852-37-9 [12], 93920-10-6 [13], 85508-43-6 [14], 85508-44-7 [15], 51818-56-5 [ |
Carc. Cat. 1; R49, Muta. Cat. 3; R68, Repr. Cat. 2; R61, T; R48/23, R42/43, N; R50-53 |
C ≥ 1 %: T R48/23, 0,1 % ≤ C < 1 %: Xn; R48/20, C ≥ 0,01 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
E |
CLP00/ATP02 |
028-055-00-6 |
nickel(II) sulfite; [1] nickel tellurium trioxide; [2] nickel tellurium tetraoxide; [3] molybdenum nickel hydroxide oxide phosphate [4] |
7757-95-1 [1], 15851-52-2 [2], 15852-21-8 [3], 68130-36-9 [4] |
Carc. Cat. 1; R49, T; R48/23, R42/43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-056-00-1 |
nickel boride (NiB); [1] dinickel boride; [2] trinickel boride; [3] nickel boride; [4] dinickel silicide; [5] nickel disilicide; [6] dinickel phosphide; [7] nickel boron phosphide [8] |
12007-00-0 [1], 12007-01-1 [2], 12007-02-2 [3], 12619-90-8 [4], 12059-14-2 [5], 12201-89-7 [6], 12035-64-2 [7], 65229-23-4 [8] |
Carc. Cat. 1; R49, T; R48/23, R43, N; R50-53 |
|
E |
CLP00/ATP02 |
028-057-00-7 |
dialuminium nickel tetraoxide; [1] nickel titanium trioxide; [2] nickel titanium oxide; [3] nickel divanadium hexaoxide; [4] cobalt dimolybdenum nickel octaoxide; [5] nickel zirkonium trioxide; [6] molybdenum nickel tetraoxide; [7] nickel tungsten |
12004-35-2 [1], 12035-39-1 [2], 12653-76-8 [3], 52502-12-2 [4], 68016-03-5 [5], 70692-93-2 [6], 14177-55-0 [7], 14177-51-6 [8], 68515-84-4 [9], 12031-65-1 [10], 12673-58-4 [11] |
Carc. Cat. 1; R49, T; R48/23, R43 |
|
E |
CLP00/ATP02 |
028-058-00-2 |
cobalt lithium nickel oxide |
- |
Carc. Cat. 1; R49, T+; R26, T; R48/23, R43, N; R50-53 |
|
E |
|
029-001-00-4 |
copper chloride; copper (I) chloride; cuprous chloride |
7758-89-6 |
Xn; R22, N; R50-53 |
|
|
|
029-002-00-X |
dicopper oxide; copper (I) oxide |
1317-39-1 |
Xn; R22, N; R50-53 |
|
|
|
029-003-00-5 |
Naphthenic acids, copper salts; copper naphthenate |
1338-02-9 |
R10, Xn; R22, N; R50-53 |
|
|
|
029-004-00-0 |
copper sulphate |
7758-98-7 |
Xn; R22, Xi; R36/38, N; R50-53 |
|
|
|
029-005-00-6 |
(tris(chloromethyl)phthalocyaninato)copper(II), reaction products with N-methylpiperazine and methoxyacetic acid |
- |
Xi; R36 |
|
|
|
029-006-00-1 |
tris(octadec-9-enylammonium) (trisulfonatophthalocyaninato)copper(II) |
- |
Xi; R41, N; R51-53 |
|
|
|
029-007-00-7 |
(trisodium (2-((3-(6-(2-chloro-5-sulfonato)anilino)-4-(3-carboxypyridinio)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)phenylmethylazo)-4-sulfonatobenzoato)copper(3-)) hydroxide |
89797-01-3 |
E; R2, R43 |
|
|
|
029-008-00-2 |
copper(II) methanesulfonate |
54253-62-2 |
Xn; R22, Xi; R41, N; R50-53 |
|
|
|
029-009-00-8 |
phthalocyanine-N-[3-(diethylamino)propyl]sulfonamide copper complex |
93971-95-0 |
R52-53 |
|
|
|
029-010-00-3 |
reaction mass of compounds from (dodecakis(p-tolylthio)phthalocyaninato)copper(II) to (hexadecakis(p-tolylthio)phthalocyaninato)copper(II) |
101408-30-4 |
R43 |
|
|
|
029-011-00-9 |
sodium [29H,31H-phthalocyaninato-(2-)-N29,N30,N31,N32]-((3-(N-methyl-N-(2-hydroxyethyl)amino)propyl)amino)sulfonyl-sulfonato, copper complex |
150522-10-4 |
C; R34 |
|
|
|
029-012-00-4 |
sodium ((N-(3-trimethylammoniopropyl)sulfamoyl)methylsulfonatophthalocyaninato)copper(II) |
124719-24-0 |
Xi; R41 |
|
|
|
029-013-00-X |
trisodium(2-(α-(3-(4-chloro-6-(2-(2-(vinylsulfonyl)ethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)benzylidenehydrazino)-4-sulfonatobenzoato)copper(II) |
130201-51-3 |
Xi; R41 |
|
|
|
029-014-00-5 |
reaction mass of: 2,2'-[[cis-1,2-cyclohexanediylbis(nitrilomethylidene)]bis[phenolate]](2-)N,N',O,O'-copper complex; 2,2'-[[trans-1,2-cyclohexanediylbis(nitrilomethylidyne)]bis[phenolate]](2-)N,N',O,O'-copper complex |
171866-24-3 |
Xn; R48/22, N; R51-53 |
|
|
|
030-001-00-1 |
zinc powder - zinc dust (pyrophoric) |
7440-66-6 |
F; R15-17, N; R50-53 |
|
|
|
030-001-01-9 |
zinc powder - zinc dust (stabilised) |
7440-66-6 |
N; R50-53 |
|
|
|
030-003-00-2 |
zinc chloride |
7646-85-7 |
C; R34, Xn; R22, N; R50-53 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
030-004-00-8 |
dimethylzinc; [1] diethylzinc [2] |
544-97-8 [1], 557-20-0 [2] |
F; R17, R14, C; R34, N; R50-53 |
|
|
|
030-005-00-3 |
diamminediisocyanatozinc |
- |
Xn; R22, Xi; R41, R42/43, N; R50 |
|
|
|
030-006-00-9 |
zinc sulphate (hydrous) (mono-, hexa- and hepta hydrate); [1] zinc sulphate (anhydrous) [2] |
7446-19-7 [1], 7733-02-0 [2] |
Xn; R22, Xi; R41, N; R50-53 |
|
|
|
030-007-00-4 |
bis(3,5-di-tert-butylsalicylato-O1,O2)zinc |
42405-40-3 |
F; R11, Xn; R22, N; R50-53 |
|
|
|
030-008-00-X |
hydroxo(2-(benzenesulfonamido)benzoato)zinc(II) |
113036-91-2 |
Xn; R20, N; R51-53 |
|
|
|
030-009-00-5 |
zinc-bis(4-(n-octyloxycarbonylamino)salicylate) dihydrate |
- |
Xi; R41, N; R51-53 |
|
|
|
030-010-00-0 |
2-dodec-1-enylbutanedioic acid, 4-methyl ester zinc salt |
- |
N; R51-53 |
|
|
|
030-011-00-6 |
trizinc bis(orthophosphate) |
7779-90-0 |
N; R50-53 |
|
|
|
030-012-00-1 |
aluminium-magnesium-zinc-carbonate-hydroxide |
169314-88-9 |
R52-53 |
|
|
|
030-013-00-7 |
zinc oxide |
1314-13-2 |
N; R50-53 |
|
|
|
030-015-00-8 |
tetrazinc(2+)bis(hexacyanocobalt(3+))diacetate |
- |
N; R51-53 |
|
|
|
031-001-00-4 |
gallium arsenide |
1303-00-0 |
Repr. Cat. 2; R60, Carc. Cat. 2; R45, T; R48/23 |
|
E |
ATP07 |
033-001-00-X |
arsenic |
7440-38-2 |
T; R23/25, N; R50-53 |
|
|
|
033-002-00-5 |
arsenic compounds, with the exception of those specified elsewhere in this Annex |
- |
T; R23/25, N; R50-53 |
C ≥ 0,2 %: T; R23/25, 0,1 % ≤ C < 0,2 %: Xn; R20/22 |
A1 |
|
033-003-00-0 |
diarsenic trioxide; arsenic trioxide |
1327-53-3 |
Carc. Cat. 1; R45, T+; R28, C; R34, N; R50-53 |
|
E |
|
033-004-00-6 |
diarsenic pentaoxide; arsenic pentoxide; arsenic oxide |
1303-28-2 |
Carc. Cat. 1; R45, T; R23/25, N; R50-53 |
|
E |
|
033-005-00-1 |
arsenic acid and its salts with the exception of those specified elsewhere in this Annex |
- |
Carc. Cat. 1; R45, T; R23/25, N; R50-53 |
|
A E |
|
033-006-00-7 |
arsine |
7784-42-1 |
F+; R12, T+; R26, Xn; R48/20, N; R50-53 |
|
|
|
033-007-00-2 |
tert-butylarsine |
4262-43-5 |
F; R17, T+; R26 |
|
|
|
034-001-00-2 |
selenium |
7782-49-2 |
T; R23/25, R33, R53 |
|
|
|
034-002-00-8 |
selenium compounds with the exception of cadmium sulphoselenide and those specified elsewhere in this Annex |
- |
T; R23/25, R33, N; R50-53 |
|
A |
|
034-003-00-3 |
sodium selenite |
10102-18-8 |
T+; R28, T; R23, R31, R43, N; R51-53 |
|
|
|
035-001-00-5 |
bromine |
7726-95-6 |
T+; R26, C; R35, N; R50 |
|
|
|
035-002-00-0 |
hydrogen bromide |
10035-10-6 |
C; R35, Xi; R37 |
|
|
|
035-002-01-8 |
hydrobromic acid ... % |
- |
C; R34, Xi; R37 |
C ≥ 40 %: C; R34, 10 % ≤ C < 40 %: Xi; R36/38, C ≥ 10 %: Xi; R37 |
B |
|
035-003-00-6 |
potassium bromate |
7758-01-2 |
O; R9, Carc. Cat. 2; R45, T; R25 |
|
E |
|
035-004-00-1 |
2-hydroxyethylammonium perbromide |
- |
O; R8, Xn; R22, C; R35, R43, N; R50 |
|
|
|
040-001-00-3 |
zirconium powder (pyrophoric) |
7440-67-7 |
F; R15-17 |
|
|
|
040-002-00-9 |
zirconium powder (non pyrophoric) |
- |
F; R15 |
|
|
|
040-003-00-4 |
reaction product of 3,5-di-tert-butylsalicylic acid and zirconium oxychloride, dehydrated, basic Zr : DTBS = 1.0 : 1.0 to 1.0 : 1.5 |
226996-19-6 |
N; R50-53 |
|
|
|
042-001-00-9 |
molybdenum trioxide |
1313-27-5 |
Carc. Cat. 3; R40, Xi; R36/37 |
|
|
|
042-002-00-4 |
tetrakis(dimethylditetradecylammonium) hexa-μ-oxotetra-μ3-oxodi-μ5-oxotetradecaoxooctamolybdate(4-) |
117342-25-3 |
T; R23, Xi; R41 |
|
|
|
042-003-00-X |
tetrakis(trimethylhexadecylammonium) hexa-mu-oxotetra-mu3-oxodi-mu5-oxotetradecaoxooctamolybdate(4-) |
116810-46-9 |
F; R11, Xi; R41, N; R50-53 |
|
|
|
042-004-00-5 |
Reaction product of ammonium molybdate and C12-C24-diethoxylated alkylamine (1:5-1:3) |
- |
Xi; R38, R43, N; R51-53 |
|
|
|
042-005-00-0 |
reaction mass of: mono- and di-glycerols of canola oil; canola oil acid amide of branched 1,3-propanediamine,N-[3-(tridecyloxy)-propyl]; N,N-diorgano dithiocarbamate molybdenum complex |
- |
R43, N; R51-53 |
|
|
|
046-001-00-X |
tetraammine palladium (II) hydrogen carbonate |
134620-00-1 |
Xn; R22-48/22, Xi; R41, R43, N; R50-53 |
|
|
|
047-001-00-2 |
silver nitrate |
7761-88-8 |
O; R8, C; R34, N; R50-53 |
|
|
|
047-002-00-8 |
polyphosphoric acid, copper, sodium, magnesium, calcium, silver and zinc salt |
- |
N; R50-53 |
|
|
|
048-001-00-5 |
cadmium compounds, with the exception of cadmium sulphoselenide (xCdS.yCdSe), reaction mass of cadmium sulphide with zinc sulphide (xCdS.yZnS), reaction mass of cadmium sulphide with mercury sulphide (xCdS.yHgS), and those specified elsewhere in this Annex |
- |
Xn; R20/21/22, N; R50-53 |
C ≥ 0,1 %: Xn; R20/21/22 |
A1 |
|
048-002-00-0 |
cadmium (non-pyrophoric); [1] cadmium oxide (non-pyrophoric) [2] |
7440-43-9 [1], 1306-19-0 [2] |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Repr. Cat. 3; R62-63, T+; R26, T; R48/23/25, N; R50-53 |
|
E |
|
048-003-00-6 |
cadmium diformate; cadmiumformate |
4464-23-7 |
T; R23/25, R33, Xn; R68, N; R50-53 |
C ≥ 10 %: T; R23/25, 0,25 % ≤ C < 10 %: Xn; R20/22, C ≥ 0,25 %: R33 |
|
|
048-004-00-1 |
cadmium cyanide |
542-83-6 |
T+; R26/27/28, R32, R33, Xn; R68, N; R50-53 |
C ≥ 1 %: R32, C ≥ 0,1 %: R33 |
|
|
048-005-00-7 |
cadmiumhexafluorosilicate(2-); cadmium fluorosilica |
17010-21-8 |
T; R23/25, R33, Xn; R68, N; R50-53 |
C ≥ 10 %: T; R23/25, 0,1 % ≤ C < 10 %: Xn; R20/22, C ≥ 0,1 %: R33 |
|
|
048-006-00-2 |
cadmium fluoride |
7790-79-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Repr. Cat. 2; R60-61, T+; R26, T; R25-48/23/25, N; R50-53 |
C ≥ 0,01 %: Carc. Cat. 2; R45, C ≥ 10 %: T; R25, 0,1 % ≤ C < 10 %: Xn; R22, C ≥ 7 %: T; R48/23/25, 0,1 % ≤ C < 7 %: Xn; R48/20/22 |
E |
|
048-007-00-8 |
cadmium iodide |
7790-80-9 |
T; R23/25, R33, Xn; R68, N; R50-53 |
C ≥ 10 %: T; R23/25, 0,1 % ≤ C < 10 %: Xn; R20/22, C ≥ 0,1 %: R33 |
|
|
048-008-00-3 |
cadmium chloride |
10108-64-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Repr. Cat. 2; R60-61, T+; R26, T; R25-48/23/25, N; R50-53 |
C ≥ 0,01 %: Carc. Cat. 2; R45, C ≥ 10 %: T; R25, 0,1 % ≤ C < 10 %: Xn; R22, C ≥ 7 %: T; R48/23/25, 0,1 % ≤ C < 7 %: Xn; R48/20/22 |
E |
|
048-009-00-9 |
cadmium sulphate |
10124-36-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Repr. Cat. 2; R60-61, T+; R26, T; R25-48/23/25, N; R50-53 |
C ≥ 0,01 %: Carc. Cat. 2; R45, C ≥ 10 %: T; R25, 0,1 % ≤ C < 10 %: Xn; R22, C ≥ 7 %: T; R48/23/25, 0,1 % ≤ C < 7 %: Xn; R48/20/22 |
E |
|
048-010-00-4 |
cadmium sulphide |
1306-23-6 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Repr. Cat. 3; R62-63, T; R48/23/25, Xn; R22, R53 |
C ≥ 10 %: Xn; R22, C ≥ 10 %: T; R48/23/25, 0,1 % ≤ C < 10 %: Xn; R48/20/22 |
E1 |
|
048-011-00-X |
cadmium (pyrophoric) |
7440-43-9 |
F; R17, Carc. Cat. 2; R45, Muta. Cat. 3; R68, Repr. Cat. 3; R62-63, T+; R26, T; R48/23/25, N; R50-53 |
|
E |
|
050-001-00-5 |
tin tetrachloride; stannic chloride |
7646-78-8 |
C; R34, R52-53 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
050-002-00-0 |
cyhexatin (ISO); hydroxytricyclohexylstannane; tri(cyclohexyl)tin hydroxide |
13121-70-5 |
Xn; R20/21/22, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
050-003-00-6 |
fentin acetate (ISO); triphenyltin acetate |
900-95-8 |
Carc. Cat. 3; R40, Repr. Cat. 3; R63, T+; R26, T; R24/25-48/23, Xi; R37/38-41, N; R50-53 |
C ≥ 20 %: Xi; R37, C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
050-004-00-1 |
fentin hydroxide (ISO); triphenyltin hydroxide |
76-87-9 |
Carc. Cat. 3; R40, Repr. Cat. 3; R63, T+; R26, T; R24/25-48/23, Xi; R37/38-41, N; R50-53 |
C ≥ 20 %: Xi; R37, C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
050-005-00-7 |
trimethyltin compounds, with the exception of those specified elsewhere in this Annex |
- |
T+; R26/27/28, N; R50-53 |
C ≥ 0,5 %: T+; R26/27/28, 0,1 % ≤ C < 0,5 %: T; R23/24/25, 0,05 % ≤ C < 0,1 %: Xn; R20/21/22 |
A1 |
|
050-006-00-2 |
triethyltin compounds, with the exception of those specified elsewhere in this Annex |
- |
T+; R26/27/28, N; R50-53 |
C ≥ 0,5 %: T+; R26/27/28, 0,1 % ≤ C < 0,5 %: T; R23/24/25, 0,05 % ≤ C < 0,1 %: Xn; R20/21/22 |
A1 |
|
050-007-00-8 |
tripropyltin compounds, with the exception of those specified elsewhere in this Annex |
- |
T; R23/24/25, N; R50-53 |
C ≥ 0,5 %: T; R23/24/25, 0,1 % ≤ C < 0,5 %: Xn; R20/21/22 |
A1 |
|
050-008-00-3 |
tributyltin compounds, with the exception of those specified elsewhere in this Annex |
- |
Repr. Cat. 2; R60-61, T; R25-48/23/25, Xn; R21, Xi; R36/38, N; R50-53 |
T; R25: C >= 2,5 %, Xn; R22: 0,25 % <= C < 2,5 %, Xn: R21: C >= 1 %, T; R48/23/25: C >= 1 %, Xn; R48/20/22: 0,25 % <= C < 1 %, Xi; R36/38: C >= 1 %, N; R50-53: C >= 2,5 %, N; R51-53: 0,25 % <= C < 2,5 %, R52-53: 0,025 % <= C < 0,25 % |
A1 |
|
050-009-00-9 |
fluorotripentylstannane; [1] hexapentyldistannoxane [2] |
20153-49-5 [1], 25637-27-8 [2] |
Xn; R20/21/22, N; R50-53 |
C ≥ 1 %: Xn; R20/21/22 |
1 |
|
050-010-00-4 |
fluorotrihexylstannane |
20153-50-8 |
Xn; R20/21/22, N; R50-53 |
C ≥ 1 %: Xn; R20/21/22 |
1 |
|
050-011-00-X |
triphenyltin compounds, with the exception of those specified elsewhere in this Annex |
- |
T; R23/24/25, N; R50-53 |
C ≥ 1 %: T; R23/24/25, 0,25 % ≤ C < 1 %: Xn; R20/21/22, C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
A1 |
|
050-012-00-5 |
tetracyclohexylstannane; [1] chlorotricyclohexylstannane; [2] butyltricyclohexylstannane [3] |
1449-55-4 [1], 3091-32-5 [2], 7067-44-9 [3] |
Xn; R20/21/22, N; R50-53 |
C ≥ 1 %: Xn; R20/21/22 |
A1 |
|
050-013-00-0 |
trioctyltin compounds, with the exception of those specified elsewhere in this Annex |
- |
Xi; R36/37/38, R53 |
C ≥ 1 %: Xi; R36/37/38 |
A1 |
|
050-017-00-2 |
fenbutatin oxide (ISO); bis(tris(2-methyl-2-phenylpropyl)tin)oxide |
13356-08-6 |
T+; R26, Xi; R36/38, N; R50-53 |
|
|
|
050-018-00-8 |
tin(II) methanesulphonate |
53408-94-9 |
C; R34, Xn; R22, R43, N; R51-53 |
|
|
|
050-019-00-3 |
azocyclotin (ISO); 1-(tricyclohexylstannyl)-1H-1,2,4-triazole |
41083-11-8 |
T+; R26, T; R25, Xi; R37/38-41, N; R50-53 |
|
|
|
050-020-00-9 |
trioctylstannane |
869-59-0 |
T; R48/25, Xi; R38, R53 |
|
|
|
050-021-00-4 |
dichlorodioctyl stannane |
3542-36-7 |
T; R23-48/25, R53 |
|
|
|
050-022-00-X |
dibutyltin dichloride; (DBTC) |
683-18-1 |
Mut. Cat. 3; R68, Repr. Cat. 2; R60-61, T+; R26, T; R25-48/25, C; R34, Xn; R21, N; R50-53 |
C ≥ 10 %: C; R34, 0,01 % ≤ C < 10 %: Xi; R36/38, C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
E |
|
050-023-00-5 |
reaction mass of: bis[(2-ethyl-1-oxohexyl)oxy]dioctyl stannane; bis[((2-ethyl-1-oxohexyl)oxy)dioctylstannyl]oxide; bis(1-phenyl-1,3-decanedionyl)dioctyl stannane; ((2-ethyl-1-oxohexyl)oxy)-(1-phenyl-1,3-decanedionyl)dioctyl stannane |
- |
Xn; R48/22, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
050-024-00-0 |
reaction mass of: tri-p-tolyltin hydroxide; hexa-p-tolyl-distannoxane |
- |
T; R48/25, Xn; R22, Xi; R38-41, R43, N; R50-53 |
|
|
|
051-001-00-8 |
antimony trichloride |
10025-91-9 |
C; R34, N; R51-53 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
051-002-00-3 |
antimony pentachloride |
7647-18-9 |
C; R34, N; R51-53 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
051-003-00-9 |
antimony compounds, with the exception of the tetroxide (Sb2O4), pentoxide (Sb2O5), trisulphide (Sb2S3), pentasulphide (Sb2S5) and those specified elsewhere in this Annex |
- |
Xn; R20/22, N; R51-53 |
C ≥ 0,25 %: Xn; R20/22 |
A1 |
|
051-004-00-4 |
antimony trifluoride |
7783-56-4 |
T; R23/24/25, N; R51-53 |
|
|
|
051-005-00-X |
antimony trioxide |
1309-64-4 |
Carc. Cat. 3; R40 |
|
|
|
051-006-00-5 |
diphenyl(4-phenylthiophenyl)sulfonium hexafluoroantimonate |
- |
R43, N; R50-53 |
|
|
|
051-007-00-0 |
bis(4-dodecylphenyl)iodonium hexafluoroantimonate |
71786-70-4 |
R43, R52-53 |
|
|
|
053-001-00-3 |
iodine |
7553-56-2 |
Xn; R20/21, N; R50 |
|
|
|
053-002-00-9 |
hydrogen iodide |
10034-85-2 |
C; R35 |
C ≥ 10 %: C; R35, 0,2 % ≤ C < 10 %: C; R34, 0,02 % ≤ C < 0,2 %: Xi; R36/37/38 |
5 |
|
053-002-01-6 |
hydriodic acid ... % |
- |
C; R34 |
C ≥ 25 %: C; R34, 10 % ≤ C < 25 %: Xi; R36/38 |
B |
|
053-003-00-4 |
iodoxybenzene |
696-33-3 |
E; R2 |
|
|
|
053-004-00-X |
calcium iodoxybenzoate |
- |
E; R2 |
|
C |
|
053-005-00-5 |
(4-(1-methylethyl)phenyl)-(4-methylphenyl)iodonium tetrakis(pentafluorophenyl)borate (1-) |
178233-72-2 |
Xn; R21/22-48/22, N; R50-53 |
|
|
|
056-001-00-1 |
barium peroxide |
1304-29-6 |
O; R8, Xn; R20/22 |
|
|
|
056-002-00-7 |
barium salts, with the exception of barium sulphate, salts of 1-azo-2-hydroxynaphthalenyl aryl sulphonic acid, and of salts specified elsewhere in this Annex |
- |
Xn; R20/22 |
C ≥ 1 %: Xn; R20/22 |
A1 |
|
056-003-00-2 |
barium carbonate |
513-77-9 |
Xn; R22 |
|
|
|
056-004-00-8 |
barium chloride |
10361-37-2 |
T; R25, Xn; R20 |
|
|
|
064-001-00-8 |
gadolinium(III)sulfite trihydrate |
51285-81-5 |
N; R51-53 |
|
|
|
072-001-00-4 |
hafnium tetra-n-butoxide |
22411-22-9 |
Xi; R41, R43 |
|
|
|
074-001-00-X |
hexasodium tungstate hydrate |
12141-67-2 |
Xn; R22, Xi; R41, R52-53 |
|
|
|
074-002-00-5 |
Reaction products of tungsten hexachloride with 2-methylpropan-2-ol, nonylphenol and pentane-2,4-dione |
- |
F; R11, Xn; R20, C; R34, R43, N; R50-53 |
|
|
|
076-001-00-5 |
osmium tetraoxide; osmic acid |
20816-12-0 |
T+; R26/27/28, C; R34 |
|
|
|
078-001-00-0 |
tetrachloroplatinates with the exception of those specified elsewhere in this Annex |
- |
T; R25, Xi; R41, R42/43 |
|
A |
|
078-002-00-6 |
diammonium tetrachloroplatinate |
13820-41-2 |
T; R25, Xi; R38-41, R42/43 |
|
|
|
078-003-00-1 |
disodium tetrachloroplatinate |
10026-00-3 |
T; R25, Xi; R38-41, R42/43 |
|
|
|
078-004-00-7 |
dipotassium tetrachloroplatinate |
10025-99-7 |
T; R25, Xi; R38-41, R42/43 |
|
|
|
078-005-00-2 |
hexachloroplatinates with the exception of those specified elsewhere in this Annex |
- |
T; R25, Xi; R41, R42/43 |
|
A |
|
078-006-00-8 |
disodium hexachloroplatinate |
16923-58-3 |
T; R25, Xi; R41, R42/43 |
|
|
|
078-007-00-3 |
dipotassium hexachloroplatinate |
16921-30-5 |
T; R25, Xi; R41, R42/43 |
|
|
|
078-008-00-9 |
diammonium hexachloroplatinate |
16919-58-7 |
T; R25, Xi; R41, R42/43 |
|
|
|
078-009-00-4 |
hexachloroplatinic acid |
16941-12-1 |
T; R25, C; R34, R42/43 |
|
|
|
078-010-00-X |
tetraammine platinum (II) hydrogen carbonate |
123439-82-7 |
Xn; R22, Xi; R41, R52-53 |
|
|
|
078-011-00-5 |
hydroxydisulfito platinum(II) acid |
61420-92-6 |
Xn; R22-48/20/21/22, C; R35, R42/43, R52-53 |
|
|
|
078-012-00-0 |
platinum(IV) nitrate/nitric acid solution |
- |
C; R35, N; R50-53 |
|
|
|
080-001-00-0 |
mercury |
7439-97-6 |
Repr. Cat. 2; R61, T+; R26, T; R48/23, N; R50-53 |
|
E |
|
080-002-00-6 |
inorganic compounds of mercury with the exception of mercuric sulphide and those specified elsewhere in this Annex |
- |
T+; R26/27/28, R33, N; R50-53 |
C ≥ 2 %: T+; R26/27/28, 0,5 % ≤ C < 2 %: T; R23/24/25, 0,1 % ≤ C < 0,5 %: Xn; R20/21/22, C ≥ 0,1 %: R33 |
A1 |
|
080-003-00-1 |
dimercury dichloride; mercurous chloride; calomel |
10112-91-1 |
Xn; R22, Xi; R36/37/38, N; R50-53 |
|
|
|
080-004-00-7 |
organic compounds of mercury with the exception of those specified elsewhere in this Annex |
- |
T+; R26/27/28, R33, N; R50-53 |
C ≥ 2 %: T+; R26/27/28, 0,5 % ≤ C < 2 %: T; R23/24/25, 0,05 % ≤ C < 0,5 %: Xn; R20/21/22, C ≥ 0,05 %: R33 |
A1 |
|
080-005-00-2 |
mercury difulminate; mercuric fulminate; fulminate of mercury |
628-86-4 |
E; R3, T; R23/24/25, R33, N; R50-53 |
|
|
|
080-005-01-X |
mercury difulminate; mercuric fulminate; fulminate of mercury [≥ 20 % phlegmatiser] |
628-86-4 |
|
|
|
|
080-006-00-8 |
dimercury dicyanide oxide; mercuric oxycyanide |
1335-31-5 |
E; R2, T; R23/24/25, R33, N; R50-53 |
|
|
|
080-007-00-3 |
dimethylmercury; [1] diethylmercury [2] |
593-74-8 [1], 627-44-1 [2] |
T+; R26/27/28, R33, N; R50-53 |
C ≥ 0,5 %: T+; R26/27/28, 0,1 % ≤ C < 0,5 %: T; R23/24/25, 0,05 % ≤ C < 0,1 %: Xn; R20/21/22, C ≥ 0,05 %: R33 |
1 |
|
080-008-00-9 |
phenylmercury nitrate; [1] phenylmercury hydroxide; [2] basic phenylmercury nitrate [3] |
55-68-5 [1], 100-57-2 [2], 8003-05-2 [3] |
T; R25-48/24/25, C; R34, N; R50-53 |
|
|
|
080-009-00-4 |
2-methoxyethylmercury chloride |
123-88-6 |
T; R25-48/25, C; R34, N; R50-53 |
|
|
|
080-010-00-X |
mercury dichloride; mercuric chloride |
7487-94-7 |
Muta. Cat. 3; R68, Repr. Cat. 3; R62, T+; R28, T; R48/24/25, C; R34, N; R50-53 |
|
|
|
080-011-00-5 |
phenylmercury acetate |
62-38-4 |
T; R25-48/24/25, C; R34, N; R50-53 |
|
|
|
081-001-00-3 |
thallium |
7440-28-0 |
T+; R26/28, R33, R53 |
|
|
|
081-002-00-9 |
thallium compounds, with the exception of those specified elsewhere in this Annex |
- |
T+; R26/28, R33, N; R51-53 |
|
A |
|
081-003-00-4 |
dithallium sulphate; thallic sulphate |
7446-18-6 |
T+; R28, T; R48/25, Xi; R38, N; R51-53 |
|
|
|
082-001-00-6 |
lead compounds with the exception of those specified elsewhere in this Annex |
- |
Repr. Cat. 1; R61, Repr. Cat. 3; R62, Xn; R20/22, R33, N; R50-53 |
C ≥ 2,5 %: Repr. Cat. 3; R62, C ≥ 1 %: Xn; R20/22, C ≥ 0,5 %: R33 |
A E1 |
|
082-002-00-1 |
lead alkyls |
- |
Repr. Cat. 1; R61, Repr. Cat. 3; R62, T+; R26/27/28, R33, N; R50-53 |
C ≥ 0,1 %: Repr. Cat. 1; R61, C ≥ 0,25 %: T+; R26/27/28, 0,1 % ≤ C < 0,25 %: T; R23/24/25, 0,05 % ≤ C < 0,1 %: Xn; R20/21/22, C ≥ 0,05 %: R33 |
A E1 |
|
082-003-00-7 |
lead diazide; lead azide |
13424-46-9 |
E; R3, Repr. Cat. 1; R61, Repr. Cat. 3; R62, Xn; R20/22, R33, N; R50-53 |
|
E1 |
|
082-003-01-4 |
lead diazide; lead azide [≥ 20 % phlegmatiser] |
13424-46-9 |
|
|
|
|
082-004-00-2 |
lead chromate |
7758-97-6 |
Carc. Cat. 2; R45, Repr. Cat. 1; R61, Repr. Cat. 3; R62, R33, N; R50-53 |
|
1 |
|
082-005-00-8 |
lead di(acetate) |
301-04-2 |
Repr. Cat. 1; R61, Repr. Cat. 3; R62, Xn; R48/22, R33, N; R50-53 |
|
E1 |
|
082-006-00-3 |
trilead bis(orthophosphate) |
7446-27-7 |
Repr. Cat. 1; R61, Repr. Cat. 3; R62, Xn; R48/22, R33, N; R50-53 |
|
E1 |
|
082-007-00-9 |
lead acetate, basic |
1335-32-6 |
Carc. Cat. 3; R40, Repr. Cat. 1; R61, Repr. Cat. 3; R62, Xn; R48/22, R33, N; R50-53 |
|
E1 |
|
082-008-00-4 |
lead(II) methanesulphonate |
17570-76-2 |
Repr. Cat. 1; R61, Repr. Cat. 3; R62, Xn; R20/22-48/20/22, Xi; R38-41, N; R58, R33 |
|
E1 |
|
082-009-00-X |
lead sulfochromate yellow; C.I. Pigment Yellow 34; [This substance is identified in the Colour Index by Colour Index Constitution Number, C.I. 77603.] |
1344-37-2 |
Carc. Cat. 2; R45, Repr. Cat. 1; R61, Repr. Cat. 3; R62, R33, N; R50-53 |
|
1 |
|
082-010-00-5 |
lead chromate molybdate sulfate red; C.I. Pigment Red 104; [This substance is identified in the Colour Index by Colour Index Constitution Number, C.I. 77605.] |
12656-85-8 |
Carc. Cat. 2; R45, Repr. Cat. 1; R61, Repr. Cat. 3; R62, R33, N; R50-53 |
|
1 |
|
082-011-00-0 |
lead hydrogen arsenate |
7784-40-9 |
Carc. Cat. 1; R45, Repr. Cat. 1; R61, Repr. Cat. 3; R62, T; R23/25, R33, N; R50-53 |
|
E1 |
|
082-012-00-6 |
barium calcium cesium lead samarium strontium bromide chloride fluoride iodide europium doped |
199876-46-5 |
Xn; R22-48/22, N; R51-53 |
|
|
|
092-001-00-8 |
uranium |
7440-61-1 |
T+; R26/28, R33, R53 |
|
|
|
092-002-00-3 |
uranium compounds with the exception of those specified elsewhere in this Annex |
- |
T+; R26/28, R33, N; R51-53 |
|
A |
|
601-001-00-4 |
methane |
74-82-8 |
F+; R12 |
|
|
|
601-002-00-X |
ethane |
74-84-0 |
F+; R12 |
|
|
|
601-003-00-5 |
propane |
74-98-6 |
F+; R12 |
|
|
|
601-004-00-0 |
butane; [1] and isobutane [2] |
106-97-8 [1], 75-28-5 [2] |
F+; R12 |
|
C |
|
601-004-01-8 |
butane (containing ≥ 0,1 % butadiene (203-450-8)); [1] isobutane (containing ≥ 0,1 % butadiene (203-450-8)) [2] |
106-97-8 [1], 75-28-5 [2] |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
C S |
|
601-005-00-6 |
2,2-dimethylpropane; neopentane |
463-82-1 |
F+; R12, N; R51-53 |
|
|
|
601-006-00-1 |
pentane; isopentane; 2-methylbutane |
109-66-0, - |
F+; R12, Xn; R65, R66, R67, N; R51-53 |
|
C |
|
601-007-00-7 |
hexane (containing < 5 % n-hexane (203-777-6)); 2-methylpentane; [1] 3-methylpentane; [2] 2,2-dimethylbutane; [3] 2,3-dimethylbutane [4] |
107-83-5 [1], 96-14-0 [2], 75-83-2 [3], 79-29-8 [4] |
F; R11, Xn; R65, Xi; R38, R67, N; R51-53 |
|
C |
|
601-008-00-2 |
heptane; n-heptane; [1] 2,4-dimethylpentane; [2] 2,2,3-trimethylbutane; [3] 3,3-dimethylpentane; [4] 2,3-dimethylpentane; [5] 3-methylhexane; [6] 2,2-dimethylpentane; [7] 2-methylhexane; [8] 3-ethylpentane; [9] isoheptane; [10] |
142-82-5 [1], 108-08-7 [2], 464-06-2 [3], 562-49-2 [4], 565-59-3 [5], 589-34-4 [6], 590-35-2 [7], 591-76-4 [8], 617-78-7 [9], 31394-54-4 [10] |
F; R11, Xn; R65, Xi; R38, R67, N; R50-53 |
|
C |
|
601-009-00-8 |
octane; n-octane; [1] 2,2,4-trimethylpentane; [2] 2,3,3-trimethylpentane; [3] 3,3-dimethylhexane; [4] 2,2,3-trimethylpentane; [5] 2,3,4-trimethylpentane; [6] 3,4-dimethylhexane; [7] 2,3-dimethylhexane; [8] 2,4-dimethylhexane; [9] 4-methylheptane |
111-65-9 [1], 540-84-1 [2], 560-21-4 [3], 563-16-6 [4], 564-02-3 [5], 565-75-3 [6], 583-48-2 [7], 584-94-1 [8], 589-43-5 [9], 589-53-7 [10], 589-81-1 [11], 590-73-8 [12], 592-13-2 [13], 592-27-8 [14], 594-82-1 [15], 609-26-7 [16], 619-99-8 [17], 1067-08-9 |
F; R11, Xn; R65, Xi; R38, R67, N; R50-53 |
|
C |
|
601-010-00-3 |
ethylene |
74-85-1 |
F+; R12, R67 |
|
|
|
601-011-00-9 |
propene; propylene |
115-07-1 |
F+; R12 |
|
|
|
601-012-00-4 |
but-1-ene; [1] butene, mixed-1-and-2-isomers; [2] 2-methylpropene; [3] (Z)-but-2-ene; [4] (E)-but-2-ene [5] |
106-98-9 [1], 107-01-7 [2], 115-11-7 [3], 590-18-1 [4], 624-64-6 [5] |
F+; R12 |
|
C |
|
601-013-00-X |
1,3-butadiene; buta-1,3-diene |
106-99-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
D |
|
601-014-00-5 |
isoprene (stabilised); 2-methyl-1,3-butadiene |
78-79-5 |
F+; R12, Carc. Cat. 2; R45, Muta. Cat. 3; R68, R52-53 |
|
D |
|
601-015-00-0 |
acetylene; ethyne |
74-86-2 |
R5, R6, F+; R12 |
|
|
|
601-016-00-6 |
cyclopropane |
75-19-4 |
F+; R12 |
|
|
|
601-017-00-1 |
cyclohexane |
110-82-7 |
F; R11, Xn; R65, Xi; R38, R67, N; R50-53 |
|
|
|
601-018-00-7 |
methylcyclohexane |
108-87-2 |
F; R11, Xn; R65, Xi; R38, R67, N; R51-53 |
|
|
|
601-019-00-2 |
1,4-dimethylcyclohexane |
589-90-2 |
F; R11, Xn; R65, Xi; R38, R67, N; R51-53 |
|
|
|
601-020-00-8 |
benzene |
71-43-2 |
F; R11, Carc. Cat. 1; R45, Muta. Cat. 2; R46, T; R48/23/24/25, Xn; R65, Xi; R36/38 |
|
E |
|
601-021-00-3 |
toluene |
108-88-3 |
F; R11, Repr. Cat. 3; R63, Xn; R48/20-65, Xi; R38, R67 |
|
|
|
601-022-00-9 |
o-xylene; [1] p-xylene; [2] m-xylene; [3] xylene [4] |
95-47-6 [1], 106-42-3 [2], 108-38-3 [3], 1330-20-7 [4] |
R10, Xn; R20/21, Xi; R38 |
C ≥ 12,5 %: Xn; R20/21 |
C |
|
601-023-00-4 |
ethylbenzene |
100-41-4 |
F; R11, Xn; R20 |
|
|
|
601-024-00-X |
cumene; [1] propylbenzene [2] |
98-82-8 [1], 103-65-1 [2] |
R10, Xn; R65, Xi; R37, N; R51-53 |
|
C |
|
601-025-00-5 |
mesitylene; 1,3,5-trimethylbenzene |
108-67-8 |
R10, Xi; R37, N; R51-53 |
C ≥ 25 %: Xi; R37 |
|
|
601-026-00-0 |
styrene |
100-42-5 |
R10, Xn; R20, Xi; R36/38 |
C ≥ 12,5 %: Xn; R20, C ≥ 12,5 %: Xi; R36/38 |
D |
|
601-027-00-6 |
2-phenylpropene; α-methylstyrene |
98-83-9 |
R10, Xi; R36/37, N; R51-53 |
C ≥ 25 %: Xi; R36/37 |
|
|
601-028-00-1 |
2-methylstyrene; 2-vinyltoluene |
611-15-4 |
Xn; R20, N; R51-53 |
|
|
|
601-029-00-7 |
dipentene; limonene; [1] (R)-p-mentha-1,8-diene; d-limonene; [2] (S)-p-mentha-1,8-diene; l-limonene; [3] trans-1-methyl-4-(1-methylvinyl)cyclohexene; [4] (±)-1-methyl-4-(1-methylvinyl)cyclohexene [5] |
138-86-3 [1], 5989-27-5 [2], 5989-54-8 [3], 6876-12-6 [4], 7705-14-8 [5] |
R10, Xi; R38, R43, N; R50-53 |
|
C |
|
601-030-00-2 |
cyclopentane |
287-92-3 |
F; R11, R52-53 |
|
|
|
601-031-00-8 |
2,4,4-trimethylpent-1-ene |
107-39-1 |
F; R11, N; R51-53 |
|
|
|
601-032-00-3 |
benzo[a]pyrene; benzo[def]chrysene |
50-32-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Repr. Cat. 2; R60-61, R43, N; R50-53 |
C ≥ 0,01 %: Carc. Cat. 2; R45 |
|
|
601-033-00-9 |
benz[a]anthracene |
56-55-3 |
Carc. Cat. 2; R45, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
601-034-00-4 |
benz[e]acephenanthrylene |
205-99-2 |
Carc. Cat. 2; R45, N; R50-53 |
|
|
|
601-035-00-X |
benzo[j]fluoranthene |
205-82-3 |
Carc. Cat. 2; R45, N; R50-53 |
|
|
|
601-036-00-5 |
benzo[k]fluoranthene |
207-08-9 |
Carc. Cat. 2; R45, N; R50-53 |
|
|
|
601-037-00-0 |
n-hexane |
110-54-3 |
F; R11, Repr. Cat. 3; R62, Xn; R65-48/20, Xi; R38, R67, N; R51-53 |
C ≥ 5 %: Xn; R48/20 |
|
|
601-041-00-2 |
dibenz[a,h]anthracene |
53-70-3 |
Carc. Cat. 2; R45, N; R50-53 |
C ≥ 0,01 %: Carc. Cat. 2; R45, C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
601-042-00-8 |
biphenyl; diphenyl |
92-52-4 |
Xi; R36/37/38, N; R50-53 |
|
|
|
601-043-00-3 |
1,2,4-trimethylbenzene |
95-63-6 |
R10, Xn; R20, Xi; R36/37/38, N; R51-53 |
|
|
|
601-044-00-9 |
3a,4,7,7a-tetrahydro-4,7-methanoindene |
77-73-6 |
F; R11, Xn; R20/22, Xi; R36/37/38, N; R51-53 |
|
|
|
601-045-00-4 |
1,2,3,4-tetrahydronaphthalene |
119-64-2 |
R19, Xi; R36/38, N; R51-53 |
|
|
|
601-046-00-X |
7-methylocta-1,6-diene |
42152-47-6 |
R10, N; R50-53 |
|
|
|
601-047-00-5 |
m-mentha-1,3(8)-diene |
17092-80-7 |
Xi; R38, N; R51-53 |
|
|
|
601-048-00-0 |
chrysene |
218-01-9 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, N; R50-53 |
|
|
|
601-049-00-6 |
benzo[e]pyrene |
192-97-2 |
Carc. Cat. 2; R45, N; R50-53 |
|
|
|
601-051-00-7 |
4-phenylbut-1-ene |
768-56-9 |
Xi; R38, N; R51-53 |
|
|
|
601-052-00-2 |
naphthalene |
91-20-3 |
Carc. Cat. 3; R40, Xn; R22, N; R50-53 |
|
|
|
601-053-00-8 |
nonylphenol; [1] 4-nonylphenol, branched [2] |
25154-52-3 [1], 84852-15-3 [2] |
Repr. Cat. 3; R62-63, Xn; R22, C; R34, N; R50-53 |
|
|
|
601-054-00-3 |
reaction mass of isomers of: dibenzylbenzene; dibenzyl(methyl)benzene; dibenzyl(dimethyl)benzene; dibenzyl(trimethyl)benzene |
- |
N; R50-53 |
|
|
|
601-055-00-9 |
reaction mass of isomers of: mono-(2-tetradecyl)naphthalenes; di-(2-tetradecyl)naphthalenes; tri-(2-tetradecyl)naphthalenes |
132983-41-6 |
Xi; R36, R53 |
|
|
|
601-056-00-4 |
reaction mass of isomers of: methyldiphenylmethane; dimethyldiphenylmethane |
73807-39-3 |
Xi; R38, N; R50-53 |
|
|
|
601-057-00-X |
N-dodecyl-[3-(4-(dimethylamino)benzamido)-propyl]dimethylammonium tosylate |
156679-41-3 |
Xi; R41, R43, N; R50-53 |
|
|
|
601-058-00-5 |
di-L-para-menthene |
83648-84-4 |
Xi; R38, R43, N; R50-53 |
|
|
|
601-059-00-0 |
methyl 2-benzylidene-3-oxobutyrate |
15768-07-7 |
Xi; R36/38, N; R51-53 |
|
|
|
601-060-00-6 |
1,2-bis[4-fluoro-6-{}{4-sulfo-5-(2-(4-sulfonaphtalene-3-ylazo)-1-hydroxy-3,6-disulfo-8-aminonaphthalene-7-ylazo)phenylamino}}-1,3,5-triazin-2ylamino]ethane; x-sodium, y-potassium salts x = 7,755 y = 0,245 |
155522-09-1 |
R43 |
|
|
|
601-061-00-1 |
(ethyl-1,2-ethanediyl)[-2-[[[(2-hydroxyethyl)methylamino]acetyl]-propyl]ω-(nonylphenoxy)poly]oxy-(methyl-1,2-ethanediyl) |
- |
C; R34, R43, N; R51-53 |
|
|
|
601-062-00-7 |
reaction mass of: branched triacontane; branched dotriacontane; branched tetratriacontane; branched hexatriacontane |
151006-59-6 |
R53 |
|
|
|
601-063-00-2 |
reaction mass of isomers of branched tetracosane |
151006-61-0 |
Xn; R20, R53 |
|
|
|
601-065-00-3 |
reaction mass of: (1'α,3'α,6'α)-2,2,3',7',7'-pentamethylspiro(1,3-dioxane-5,2'-norcarane); (1'α,3'β,6'α)-2,2,3',7',7'-pentamethylspiro(1,3-dioxane-5,2'-norcarane) |
- |
Xi; R38, N; R51-53 |
|
|
|
601-066-00-9 |
1-(4-(trans-4-heptylcyclohexyl)phenyl)ethanone |
78531-60-9 |
R43, R53 |
|
|
|
601-067-00-4 |
triethyl arsenate |
15606-95-8 |
Carc. Cat. 1; R45, T; R23/25, N; R50-53 |
|
E |
|
601-068-00-X |
1,2-diacetoxybut-3-ene |
18085-02-4 |
Xn; R22 |
|
|
|
601-069-00-5 |
2-ethyl-1-(2-(1,3-dioxanyl)ethyl)-pyridinium bromide |
287933-44-2 |
R52-53 |
|
|
|
601-070-00-0 |
reaction mass of: branched icosane; branched docosane; branched tetracosane |
151006-58-5 |
Xn; R20, R53 |
|
|
|
601-071-00-6 |
1-dimethoxymethyl-2-nitro-benzene |
20627-73-0 |
R43, N; R51-53 |
|
|
|
601-072-00-1 |
reaction mass of: 1-(4-isopropylphenyl)-1-phenylethane; 1-(3-isopropylphenyl)-1-phenylethane; 1-(2-isopropylphenyl)-1-phenylethane |
52783-21-8 |
Xi; R38, N; R50-53 |
|
|
|
601-073-00-7 |
1-bromo-3,5-difluorobenzene |
461-96-1 |
R10, Xn; R22-48/22, Xi; R38, R43, N; R50-53 |
|
|
|
601-074-00-2 |
reaction mass of: 4-(2,2,3-trimethylcyclopent-3-en-1-yl)-1-methyl-2-oxabicyclo[2.2.2]octane; 1-(2,2,3-trimethylcyclopent-3-en-1-yl)-5-methyl-6-oxabicyclo[3.2.1]octane; spiro[cyclohex-3-en-1-yl-[(4,5,6,6a-tetrahydro-3,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2 |
- |
Xi; R36/38, N; R51-53 |
|
|
|
601-075-00-8 |
4,4'-bis(N-carbamoyl-4-methylbenzenesulfonamide)diphenylmethane |
151882-81-4 |
Carc. Cat. 3; R40 |
|
|
|
601-076-00-3 |
ethynyl cyclopropane |
6746-94-7 |
F; R11, R4, Xi; R38-41, R52-53 |
|
|
|
601-077-00-9 |
reaction mass of: 1-heptyl-4-ethyl-2,6,7-trioxabicyclo[2.2.2]octane; 1-nonyl-4-ethyl-2,6,7-trioxabicyclo[2.2.2]octane |
196965-91-0 |
N; R50-53 |
|
|
|
601-078-00-4 |
reaction mass of: 1,7-dimethyl-2-[(3-methylbicyclo[2.2.1]hept-2-yl)methyl]bicyclo[2.2.1]heptane; 2,3-dimethyl-2-[(3-methylbicyclo[2.2.1]hept-2-yl)methyl]bicyclo[2.2.1]heptane |
- |
C; R34, N; R50-53 |
|
|
|
601-079-00-X |
reaction mass of: trans-trans-cyclohexadeca-1,9-diene; cis-trans-cyclohexadeca-1,9-diene |
- |
Xi; R38, R43, R53 |
|
|
|
601-080-00-5 |
reaction mass of: sec-butylphenyl(phenyl)methane, mixed isomers; 1-(sec-butylphenyl(phenyl)-2-phenylethane, mixed isomers; 1-(sec-butylphenyl-1-phenylethane, mixed isomers |
- |
N; R50-53 |
|
|
|
601-081-00-0 |
cyclohexadeca-1,9-diene |
4277-06-9 |
Xi; R38, R43, R53 |
|
|
|
601-082-00-6 |
reaction mass of: endo-2-methyl-exo-3-methyl-exo-2-[(exo-3-methylbicyclo[2.2.1]hept-exo-2-yl)methyl]bicyclo[2.2.1]heptane; exo-2-methyl-exo-3-methyl-endo-2-[(endo-3-methylbicyclo[2.2.1]hept-exo-2-yl)methyl]bicyclo[2.2.1]heptane |
- |
Xi; R38-41, N; R50-53 |
|
|
|
601-083-00-1 |
5-endo-hexyl-bicyclo[2.2.1]hept-2-ene |
22094-83-3 |
Xn; R65, Xi; R38, R53 |
|
|
|
601-084-00-7 |
reaction mass of: 5-endo-butyl-bicyclo[2.2.1]hept-2-ene; 5-exo-butyl-bicyclo[2.2.1]hept-2-ene (80:20) |
- |
Xn; R65, Xi; R38, N; R50-53 |
|
|
|
601-085-00-2 |
isopentane; 2-methylbutane |
78-78-4 |
|
|
|
|
602-001-00-7 |
chloromethane; methyl chloride |
74-87-3 |
F+; R12, Carc. Cat. 3; R40, Xn; R48/20 |
|
|
|
602-002-00-2 |
bromomethane; methylbromide |
74-83-9 |
Muta. Cat. 3; R68, T; R23/25, Xn; R48/20, Xi; R36/37/38, N; R50, N; R59 |
|
|
|
602-003-00-8 |
dibromomethane |
74-95-3 |
Xn; R20, R52-53 |
C ≥ 12,5 %: Xn; R20 |
|
|
602-004-00-3 |
dichloromethane; methylene chloride |
75-09-2 |
Carc. Cat. 3; R40 |
|
|
|
602-005-00-9 |
methyl iodide; iodomethane |
74-88-4 |
Carc. Cat. 3; R40, Xn; R21, T; R23/25, Xi; R37/38 |
|
|
|
602-006-00-4 |
trichloromethane; chloroform |
67-66-3 |
Xn; R22-48/20/22, Xi; R38, Carc. Cat. 3; R40 |
C ≥ 5 %: Xn; R22, C ≥ 5 %: Xn; R48/20/22 |
|
|
602-007-00-X |
bromoform; tribromomethane |
75-25-2 |
T; R23, Xn; R22, Xi; R36/38, N; R51-53 |
|
|
|
602-008-00-5 |
carbon tetrachloride; tetrachloromethane |
56-23-5 |
Carc. Cat. 3; R40, T; R23/24/25-48/23, N; R59, R52-53 |
C ≥ 1 %: T; R23/24/25, 0,2 % ≤ C < 1 %: Xn; R20/21/22, C ≥ 1 %: T; R48/23, 0,2 % ≤ C < 1 %: Xn; R48/20 |
|
|
602-009-00-0 |
chloroethane |
75-00-3 |
F+; R12, Carc. Cat. 3; R40, R52-53 |
|
|
|
602-010-00-6 |
1,2-dibromoethane |
106-93-4 |
Carc. Cat. 2; R45, T; R23/24/25, Xi; R36/37/38, N; R51-53 |
C ≥ 1 %: T; R23/24/25, 0,1 % ≤ C < 1 %: Xn; R20/21/22 |
E |
|
602-011-00-1 |
1,1-dichloroethane |
75-34-3 |
F; R11, Xn; R22, Xi; R36/37, R52-53 |
C ≥ 12,5 %: Xn; R22 |
|
|
602-012-00-7 |
1,2-dichloroethane; ethylene dichloride |
107-06-2 |
F; R11, Carc. Cat. 2; R45, Xn; R22, Xi; R36/37/38 |
|
E |
|
602-013-00-2 |
1,1,1-trichloroethane; methyl chloroform |
71-55-6 |
Xn; R20, N; R59 |
|
F |
|
602-014-00-8 |
1,1,2-trichloroethane |
79-00-5 |
Carc. Cat. 3; R40, Xn; R20/21/22, R66 |
C ≥ 5 %: Xn; R20/21/22 |
|
|
602-015-00-3 |
1,1,2,2-tetrachloroethane |
79-34-5 |
T+; R26/27, N; R51-53 |
|
|
|
602-016-00-9 |
1,1,2,2-tetrabromoethane |
79-27-6 |
T+; R26, Xi; R36, R52-53 |
|
|
|
602-017-00-4 |
pentachloroethane |
76-01-7 |
Carc. Cat. 3; R40, T; R48/23, N; R51-53 |
C ≥ 1 %: T; R48/23, 0,2 % ≤ C < 1 %: Xn; R48/20 |
|
|
602-018-00-X |
1-chloropropane; [1] 2-chloropropane [2] |
540-54-5 [1], 75-29-6 [2] |
F; R11, Xn; R20/21/22 |
|
C |
|
602-019-00-5 |
1-bromopropane; n-propyl bromide |
106-94-5 |
F; R11, Repr. Cat. 2; R60, Repr. Cat. 3; R63, Xn; R48/20, Xi; R36/37/38, R67 |
|
E |
|
602-020-00-0 |
1,2-dichloropropane; propylene dichloride |
78-87-5 |
F; R11, Xn; R20/22 |
|
|
|
602-021-00-6 |
1,2-dibromo-3-chloropropane |
96-12-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Repr. Cat. 1; R60, T; R25, Xn; R48/20/22, R52-53 |
|
E |
|
602-022-00-1 |
1-chloropentane; [1] 2-chloropentane; [2] 3-chloropentane [3] |
543-59-9 [1], 625-29-6 [2], 616-20-6 [3] |
F; R11, Xn; R20/21/22 |
|
C |
|
602-023-00-7 |
vinyl chloride; chloroethylene |
75-01-4 |
F+; R12, Carc. Cat. 1; R45 |
|
D |
|
602-024-00-2 |
bromoethylene |
593-60-2 |
F+; R12, Carc. Cat. 2; R45 |
|
|
|
602-025-00-8 |
1,1-dichloroethylene; vinylidene chloride |
75-35-4 |
F+; R12, Carc. Cat. 3; R40, Xn; R20 |
C ≥ 12,5 %: Xn; R20 |
D |
|
602-026-00-3 |
1,2-dichloroethylene; [1] cis-dichloroethylene; [2] trans-dichloroethylene [3] |
540-59-0 [1], 156-59-2 [2], 156-60-5 [3] |
F; R11, Xn; R20, R52-53 |
C ≥ 12,5 %: Xn; R20 |
C |
|
602-027-00-9 |
trichloroethylene; trichloroethene |
79-01-6 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, R67, Xi; R36/38, R52-53 |
|
|
|
602-028-00-4 |
tetrachloroethylene |
127-18-4 |
Carc. Cat. 3; R40, N; R51-53 |
|
|
|
602-029-00-X |
3-chloropropene; allyl chloride |
107-05-1 |
F; R11, Carc. Cat. 3; R40, Muta. Cat. 3; R68, Xn; R20/21/22-48/20, Xi; R36/37/38, N; R50 |
|
D |
|
602-030-00-5 |
1,3-dichloropropene; [1] (Z)-1,3-dichloropropene [2] |
542-75-6 [1], 10061-01-5 [2] |
R10, T; R24/25, Xn; R20-65, Xi; R36/37/38, R43, N; R50-53 |
|
C D |
|
602-031-00-0 |
1,1-dichloropropene |
563-58-6 |
F; R11, T; R25, R52-53 |
|
|
|
602-032-00-6 |
3-chloro-2-methylpropene |
563-47-3 |
F; R11, Xn; R20/22, C; R34, R43, N; R51-53 |
|
|
|
602-033-00-1 |
chlorobenzene |
108-90-7 |
R10, Xn; R20, N; R51-53 |
C ≥ 5 %: Xn; R20 |
|
|
602-034-00-7 |
1,2-dichlorobenzene; o-dichlorobenzene |
95-50-1 |
Xn; R22, Xi; R36/37/38, N; R50-53 |
C ≥ 5 %: Xn; R22 |
|
|
602-035-00-2 |
1,4-dichlorobenzene; p-dichlorobenzene |
106-46-7 |
Carc. Cat. 3; R40, Xi; R36, N; R50-53 |
|
|
|
602-036-00-8 |
chloroprene (stabilised); 2-chlorobuta-1,3-diene (stabilised) |
126-99-8 |
F; R11, Carc. Cat. 2; R45, Xn; R20/22-48/20, Xi; R36/37/38 |
|
D E |
|
602-037-00-3 |
α-chlorotoluene; benzyl chloride |
100-44-7 |
Carc. Cat. 2; R45, T; R23, Xn; R22-48/22, Xi; R37/38-41 |
|
E |
|
602-038-00-9 |
α,α,α-trichlorotoluene; benzotrichloride |
98-07-7 |
Carc. Cat. 2; R45, T; R23, Xn; R22, Xi; R37/38-41 |
|
E |
|
602-039-00-4 |
polychlorobiphenyls; PCB |
1336-36-3 |
R33, N; R50-53 |
C ≥ 0,005 %: R33 |
C |
|
602-040-00-X |
2-chlorotoluene; [1] 3-chlorotoluene; [2] 4-chlorotoluene; [3] chlorotoluene [4] |
95-49-8 [1], 108-41-8 [2], 106-43-4 [3], 25168-05-2 [4] |
Xn; R20, N; R51-53 |
|
C |
|
602-041-00-5 |
penthachloronaphthalene |
1321-64-8 |
Xn; R21/22, Xi; R36/38, N; R50-53 |
|
C |
|
602-042-00-0 |
1,2,3,4,5,6-hexachlorcyclohexanes with the exception of those specified elsewhere in this Annex |
- |
Carc. Cat. 3; R40, T; R25, Xn; R21, N; R50-53 |
|
A C |
|
602-043-00-6 |
lindane (ISO); γ-HCH or γ-BHC; γ-1,2,3,4,5,6-hexachlorocyclohexane |
58-89-9 |
T; R25, Xn; R20/21-48/22, R64, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
602-044-00-1 |
camphechlor (ISO); toxaphene |
8001-35-2 |
Carc. Cat. 3; R40, T; R25, Xn; R21, Xi; R37/38, N; R50-53 |
|
|
|
602-045-00-7 |
DDT (ISO); clofenotane (INN); dicophane; 1,1,1-trichloro-2,2-bis(4-chlorophenyl)ethane; dichlorodiphenyltrichloroethane |
50-29-3 |
T; R25-48/25, Carc. Cat. 3; R40, N; R50-53 |
|
|
|
602-046-00-2 |
heptachlor (ISO); 1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-4,7-methanoindene |
76-44-8 |
T; R24/25, Carc. Cat. 3; R40, R33, N; R50-53 |
|
|
|
602-047-00-8 |
chlordane (ISO); 1,2,4,5,6,7,8,8-octachloro-3a,4,7,7a-tetrahydro-4,7-methanoindan |
57-74-9 |
Carc. Cat. 3; R40, Xn; R21/22, N; R50-53 |
|
|
|
602-048-00-3 |
aldrin (ISO) |
309-00-2 |
T; R24/25-48/24/25, Carc. Cat. 3; R40, N; R50-53 |
|
|
|
602-049-00-9 |
dieldrin (ISO) |
60-57-1 |
T+; R27, T; R25-48/25, Carc. Cat. 3; R40, N; R50-53 |
|
|
|
602-050-00-4 |
isodrin; (1α,4α,4aβ,5β,8β,8aβ)-1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-1,4:5,8-dimethanonaphthalene |
465-73-6 |
T+; R26/27/28, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
602-051-00-X |
endrin (ISO); 1,2,3,4,10,10-hexachloro-6,7-epoxy-1,4,4a,5,6,7,8,8a-octahydro-1,4:5,8-dimethanonaphthalene |
72-20-8 |
T+; R28, T; R24, N; R50-53 |
|
|
|
602-052-00-5 |
endosulfan (ISO); 1,2,3,4,7,7-hexachloro-8,9,10-trinorborn-2-en-5,6-ylenedimethylene sulfite; 1,4,5,6,7,7-hexachloro-8,9,10-trinorborn-5-en-2,3-ylenedimethylene sulfite |
115-29-7 |
T+; R26/28, Xn; R21, N; R50-53 |
|
|
|
602-053-00-0 |
isobenzan (ISO); 1,3,4,5,6,7,8,8-octachloro-1,3,3a,4,7,7a-hexahydro-4,7-methanoisobenzofuran |
297-78-9 |
T+; R27/28, N; R50 |
|
|
|
602-054-00-6 |
3-iodpropene; allyl iodide |
556-56-9 |
F; R11, C; R34 |
|
|
|
602-055-00-1 |
bromoethane; ethyl bromide |
74-96-4 |
F; R11, Carc. Cat. 3; R40, Xn; R20/22 |
|
|
|
602-056-00-7 |
α,α,α-trifluorotoluene; benzotrifluoride |
98-08-8 |
F; R11, N; R51-53 |
|
|
|
602-057-00-2 |
α-bromotoluene; benzyl bromide |
100-39-0 |
Xi; R36/37/38 |
|
|
|
602-058-00-8 |
α,α-dichlorotoluene; benzylidene chloride; benzal chloride |
98-87-3 |
Carc. Cat. 3; R40, T; R23, Xn; R22, Xi; R37/38-41 |
|
|
|
602-059-00-3 |
1-chlorobutane; butyl chloride |
109-69-3 |
F; R11 |
|
|
|
602-060-00-9 |
bromobenzene |
108-86-1 |
R10, Xi; R38, N; R51-53 |
|
|
|
602-061-00-4 |
hexafluoropropene; hexafluoropropylene |
116-15-4 |
Xn; R20, Xi; R37 |
|
|
|
602-062-00-X |
1,2,3-trichloropropane |
96-18-4 |
Carc. Cat. 2; R45, Repr. Cat. 2; R60, Xn; R20/21/22 |
|
E D |
|
602-063-00-5 |
heptachlor epoxide; 2,3-epoxy-1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-4,7-methanoindane |
1024-57-3 |
T; R25, Carc. Cat. 3; R40, R33, N; R50-53 |
|
|
|
602-064-00-0 |
1,3-dichloro-2-propanol |
96-23-1 |
Carc. Cat. 2; R45, T; R25, Xn; R21 |
|
E |
|
602-065-00-6 |
hexachlorobenzene |
118-74-1 |
Carc. Cat. 2; R45, T; R48/25, N; R50-53 |
|
E |
|
602-066-00-1 |
tetrachloro-p-benzoquinone |
118-75-2 |
Xi; R36/38, N; R50-53 |
|
|
|
602-067-00-7 |
1,3-dichlorbenzene |
541-73-1 |
Xn; R22, N; R51-53 |
|
|
|
602-068-00-2 |
ethylene bis(trichloroacetate) |
2514-53-6 |
Xi; R38 |
|
|
|
602-069-00-8 |
dichloroacetylene |
7572-29-4 |
E; R2, Carc. Cat. 3; R40, Xn; R48/20 |
|
|
|
602-070-00-3 |
3-chloro-4,5,α, α,α-pentafluorotoluene |
77227-99-7 |
R10, Xn; R20/22, N; R50-58 |
|
|
|
602-071-00-9 |
bromobenzylbromotoluene, reaction mass of isomers |
99688-47-8 |
Xn; R48/22, R43, N; R50-53 |
|
|
|
602-072-00-4 |
dichloro [(dichlorophenyl)methyl]methylbenzene, reaction mass of isomers; (dichlorophenyl)(dichlorotolyl)methane, reaction mass of isomers (IUPAC) |
76253-60-6 |
N; R50-53 |
|
|
|
602-073-00-X |
1,4-dichlorobut-2-ene |
764-41-0 |
Carc. Cat. 2; R45, T+; R26, T; R24/25, C; R34, N; R50-53 |
C ≥ 0,01 %: Carc. Cat. 2; R45, C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
E |
|
602-074-00-5 |
pentachlorobenzene |
608-93-5 |
F; R11, Xn; R22, N; R50-53 |
|
|
|
602-075-00-0 |
4,4,5,5-tetrachloro-1,3-dioxolan-2-one |
22432-68-4 |
T+; R26, Xn; R22, C; R34 |
|
|
|
602-076-00-6 |
2,3,4-trichlorobut-1-ene |
2431-50-7 |
Carc. Cat. 3; R40, T; R23, Xn; R22, Xi; R36/37/38, N; R50-53 |
C ≥ 0,1 %: Carc. Cat. 3; R40 |
|
|
602-077-00-1 |
dodecachloropentacyclo[5.2.1.02,6.03,9.05,8]decane; mirex |
2385-85-5 |
Carc. Cat. 3; R40, Repr. Cat. 3; R62-63, R64, Xn; R21/22, N; R50/53 |
|
|
|
602-078-00-7 |
hexachlorocyclopentadiene |
77-47-4 |
T+; R26, T; R24, Xn; R22, C; R34, N; R50-53 |
|
|
|
602-079-00-2 |
2,3-dichloropropene; 2,3-dichloropropylene |
78-88-6 |
F; R11, Muta. Cat. 3; R68, Xn; R20/21/22, Xi; R37/38-41, R52-53 |
|
|
|
602-080-00-8 |
alkanes, C10-13, chloro; chlorinated paraffins, C10-13 |
85535-84-8 |
Carc. Cat. 3; R40, R66, N; R50-53 |
|
|
|
602-081-00-3 |
2-chloro-4,5-difluorobenzoic acid |
- |
Xn; R21/22, Xi; R41, R43 |
|
|
|
602-082-00-9 |
2,2,6,6-tetrakis(bromomethyl)-4-oxaheptane-1,7-diol |
109678-33-3 |
R43, N; R51-53 |
|
|
|
602-083-00-4 |
diphenyl ether, pentabromo derivative pentabromodiphenyl ether |
32534-81-9 |
Xn; R48/21/22, R64, N; R50-53 |
|
|
|
602-084-00-X |
1,1-dichloro-1-fluoroethane |
1717-00-6 |
R52-53, N; R59 |
|
|
|
602-085-00-5 |
2-bromopropane |
75-26-3 |
F; R11, Repr. Cat. 1; R60, Xn; R48/20, R66 |
|
E |
|
602-086-00-0 |
trifluoroiodomethane; trifluoromethyl iodide |
2314-97-8 |
Muta. Cat. 3; R68 |
|
|
|
602-087-00-6 |
1,2,4-trichlorobenzene |
120-82-1 |
Xn; R22, Xi; R38, N; R50-53 |
|
|
|
602-088-00-1 |
2,3-dibromopropan-1-ol; 2,3-dibromo-1-propanol |
96-13-9 |
Carc. Cat. 2; R45, Repr. Cat. 3; R62, T; R24, Xn; R20/22, R52-53 |
|
E |
|
602-089-00-7 |
4-bromo-2-chlorofluorobenzene |
60811-21-4 |
Xn; R22, Xi; R38, N; R50-53 |
|
|
|
602-090-00-2 |
1-allyl-3-chloro-4-fluorobenzene |
121626-73-1 |
Xi; R38, N; R51-53 |
|
|
|
602-091-00-8 |
1,3-dichloro-4-fluorobenzene |
1435-48-9 |
Xn; R22-48/20/22, Xi; R38, N; R51-53 |
|
|
|
602-092-00-3 |
1-bromo-3,4,5-trifluorobenzene |
138526-69-9 |
R10, Carc. Cat. 3; R40, Xi; R38-41, N; R51-53 |
|
|
|
602-093-00-9 |
α, α,α,4-tetrachlorotoluene; p-chlorobenzotrichloride |
5216-25-1 |
Carc. Cat. 2; R45, Repr. Cat. 3; R62, T; R48/23, Xn; R21/22, Xi; R37/38 |
|
E |
|
602-094-00-4 |
diphenylether; octabromo derivate |
32536-52-0 |
Repr. Cat. 2; R61, Repr. Cat. 3; R62 |
|
|
|
602-095-00-X |
alkanes, C14-17, chloro; chlorinated paraffins, C14-17 |
85535-85-9 |
R64, R66, N; R50-53 |
|
|
|
602-096-00-5 |
malachite green hydrochloride; [1] malachite green oxalate [2] |
569-64-2 [1], 2437-29-8 [2] |
Repr. Cat. 3; R63, Xn; R22, Xi; R41, N; R50-53 |
|
|
|
602-097-00-0 |
1-bromo-9-(4,4,5,5,5-pentafluoropentylthio)nonane |
148757-89-5 |
R43, N; R50-53 |
|
|
|
602-098-00-6 |
2-(3-bromophenoxy)tetrahydro-2H-pyran |
57999-49-2 |
R43, N; R51-53 |
|
|
|
602-099-00-1 |
3-(4-fluorophenyl)-2-methylpropionylchloride |
- |
R14, R29, C; R35, Xn; R22, R52-53 |
|
|
|
602-100-00-5 |
reaction mass of: (R,R)-1,1,1,2,2,3,4,5,5,5-decafluoropentane; (S,S)-1,1,1,2,2,3,4,5,5,5-decafluoropentane |
- |
R52-53 |
|
|
|
602-101-00-0 |
2-chloro-4-fluoro-5-nitrophenyl (isobutyl)carbonate |
141772-37-4 |
Xn; R48/22, R43, N; R50-53 |
|
|
|
602-102-00-6 |
1,1,1,3,3-pentafluorobutane |
406-58-6 |
F; R11 |
|
|
|
602-103-00-1 |
1-(chlorophenylmethyl)-2-methylbenzene |
41870-52-4 |
Xi; R38, N; R50-53 |
|
|
|
602-104-00-7 |
1,1,2,2,3,3,4-heptafluorocyclopentane |
15290-77-4 |
R52-53 |
|
|
|
602-105-00-2 |
sodium 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfinate |
102061-82-5 |
Xi; R41, R43 |
|
|
|
602-106-00-8 |
2-bromo-4,6-difluoroaniline |
444-14-4 |
Xn; R22, N; R51-53 |
|
|
|
602-107-00-3 |
3,3,4,4-tetrafluoro-4-iodo-1-butene |
33831-83-3 |
Xn; R22, Xi; R38, N; R51-53 |
|
|
|
602-108-00-9 |
(2,3,5,6-tetrafluorophenyl)methanol |
4084-38-2 |
Xn; R22, Xi; R36, R43 |
|
|
|
603-001-00-X |
methanol |
67-56-1 |
F; R11, T; R23/24/25-39/23/24/25 |
C ≥ 20 %: T; R23/24/25, 3 % ≤ C < 20 %: Xn; R20/21/22, C ≥ 10 %: T; R39/23/24/25, 3 % ≤ C < 10 %: Xn; R68/20/21/22 |
|
|
603-002-00-5 |
ethanol; ethyl alcohol |
64-17-5 |
F; R11 |
|
|
|
603-003-00-0 |
propan-1-ol; n-propanol |
71-23-8 |
F; R11, Xi; R41, R67 |
|
|
|
603-004-00-6 |
butan-1-ol; n-butanol |
71-36-3 |
R10, Xn; R22, Xi; R37/38-41, R67 |
|
|
|
603-005-00-1 |
2-methylpropan-2-ol; tert-butyl alcohol |
75-65-0 |
F; R11, Xn; R20, Xi; R36/37 |
|
|
|
603-006-00-7 |
pentanol isomers, with the exception fo those specified elsewhere in this Annex |
- |
R10, Xn; R20, Xi; R37, R66 |
|
C |
|
603-007-00-2 |
2-methylbutan-2-ol; tert-pentanol |
75-85-4 |
F; R11, Xn; R20, Xi; R37/38 |
|
|
|
603-008-00-8 |
4-methylpentan-2-ol; methyl isobutyl carbinol |
108-11-2 |
R10, Xi; R37 |
C ≥ 25 %: Xi; R37 |
|
|
603-009-00-3 |
cyclohexanol |
108-93-0 |
Xn; R20/22, Xi; R37/38 |
|
|
|
603-010-00-9 |
2-methylcyclohexanol, mixed isomers; [1] cis-2-methylcyclohexanol; [2] trans-2-methylcyclohexanol [3] |
583-59-5 [1], 7443-70-1 [2], 7443-52-9 [3] |
Xn; R20 |
|
C |
|
603-011-00-4 |
2-methoxyethanol; ethylene glycol monomethyl ether |
109-86-4 |
R10, Repr. Cat. 2; R60-61, Xn; R20/21/22 |
|
E |
|
603-012-00-X |
2-ethoxyethanol; ethylene glycol monoethyl ether |
110-80-5 |
R10, Repr. Cat. 2; R60-61, Xn; R20/21/22 |
|
E |
|
603-013-00-5 |
2-isopropoxyethanol; ethylene glycol monoisopropyl ether |
109-59-1 |
Xn; R20/21, Xi; R36 |
|
|
|
603-014-00-0 |
2-butoxyethanol; ethylene glycol monobutyl ether; butyl cellosolve |
111-76-2 |
Xn; R20/21/22, Xi; R36/38 |
|
|
|
603-015-00-6 |
allyl alcohol |
107-18-6 |
R10, T; R23/24/25, Xi; R36/37/38, N; R50 |
|
|
|
603-016-00-1 |
4-hydroxy-4-methylpentan-2-one; diacetone alcohol |
123-42-2 |
Xi; R36 |
C ≥ 10 %: Xi; R36 |
|
|
603-018-00-2 |
furfuryl alcohol |
98-00-0 |
Carc. Cat. 3; R40, T; R23, Xn; R21/22-48/20, Xi; R36/37 |
|
|
|
603-019-00-8 |
dimethyl ether |
115-10-6 |
F+; R12 |
|
|
|
603-020-00-3 |
ethyl methyl ether |
540-67-0 |
F+; R12 |
|
|
|
603-021-00-9 |
methyl vinyl ether |
107-25-5 |
F+; R12 |
|
D |
|
603-022-00-4 |
diethyl ether; ether |
60-29-7 |
F+; R12, R19, Xn; R22, R66, R67 |
|
|
|
603-023-00-X |
ethylene oxide; oxirane |
75-21-8 |
F+; R12, R6, Carc. Cat. 2; R45, Muta. Cat. 2; R46, T; R23, Xi; R36/37/38 |
|
E |
|
603-024-00-5 |
1,4-dioxane |
123-91-1 |
F; R11-19, Carc. Cat. 3; R40, Xi; R36/37, R66 |
|
D |
|
603-025-00-0 |
tetrahydrofuran |
109-99-9 |
F; R11-19, Xi; R36/37 |
C ≥ 25 %: Xi; R36/37 |
|
|
603-026-00-6 |
1-chloro-2,3-epoxypropane; epichlorhydrin |
106-89-8 |
R10, Carc. Cat. 2; R45, T; R23/24/25, C; R34, R43 |
C ≥ 1 %: T; R23/24/25, 0,1 % ≤ C < 1 %: Xn; R20/21/22 |
E |
|
603-027-00-1 |
ethanediol; ethylene glycol |
107-21-1 |
Xn; R22 |
|
|
|
603-028-00-7 |
2-chloroethanol; ethylene chlorohydrin |
107-07-3 |
T+; R26/27/28 |
|
|
|
603-029-00-2 |
bis(2-chloroethyl) ether |
111-44-4 |
Carc. Cat. 3; R40, T+; R26/27/28 |
|
|
|
603-030-00-8 |
2-aminoethanol; ethanolamine |
141-43-5 |
Xn; R20/21/22, C; R34 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
603-031-00-3 |
1,2-dimethoxyethane; ethylene glycol dimethyl ether; EGDME |
110-71-4 |
F; R11, R19, Repr. Cat. 2; R60, Repr. Cat. 2; R61, Xn; R20 |
|
E |
|
603-032-00-9 |
ethylene dinitrate; ethylene glycol dinitrate |
628-96-6 |
E; R3, T+; R26/27/28, R33 |
|
|
|
603-033-00-4 |
oxydiethylene dinitrate; diethylene glycol dinitrate; digol dinitrate |
693-21-0 |
E; R3, T+; R26/27/28, R33, R52-53 |
|
|
|
603-033-01-1 |
oxydiethylene dinitrate; diethylene glycol dinitrate; digol dinitrate; [>25 % phlegmatiser] |
693-21-0 |
|
|
|
|
603-034-00-X |
glycerol trinitrate; nitroglycerine |
55-63-0 |
E; R3, T+; R26/27/28, R33, N; R51-53 |
|
|
|
603-034-01-7 |
glycerol trinitrate; nitroglycerine; [>40 % phlegmatiser] |
55-63-0 |
|
|
|
|
603-035-00-5 |
pentaerythritol tetranitrate; P.E.T.N. |
78-11-5 |
E; R3 |
|
|
|
603-035-01-2 |
pentaerythritol tetranitrate; pentaerythrite tetranitrate; P.E.T.N.; [>20 % phlegmatiser] |
78-11-5 |
|
|
|
|
603-036-00-0 |
mannitol hexanitrate; nitromannite |
15825-70-4 |
E; R3 |
|
|
|
603-036-01-8 |
mannitol hexanitrate; nitromannite; [>40 % phlegmatiser] |
15825-70-4 |
|
|
|
|
603-037-00-6 |
cellulose nitrate; nitrocellulose |
- |
E; R3 |
|
T |
|
603-038-00-1 |
allyl glycidyl ether; allyl 2,3-epoxypropyl ether; prop-2-en-1-yl 2,3-epoxypropyl ether |
106-92-3 |
R10, Carc. Cat. 3; R40, Muta. Cat. 3; R68, Repr. Cat. 3; R62, Xn; R20/22, Xi; R37/38-41, R43, R52-53 |
|
|
|
603-039-00-7 |
butyl glycidyl ether; butyl 2,3-epoxypropyl ether |
2426-08-6 |
R10, Carc. Cat. 3; R40, Muta. Cat. 3; R68, Xn; R20/22, Xi; R37, R43, R52-53 |
|
|
|
603-040-00-2 |
sodium methanolate; sodium methoxide; [1] potassium methanolate; potassium methoxide; [2] lithium methanolate; lithium methoxide [3] |
124-41-4 [1], 865-33-8 [2], 865-34-9 [3] |
F; R11, C; R34, R14 |
|
|
|
603-041-00-8 |
potassium ethanolate; potassium ethoxide; [1] sodium ethanolate; sodium ethoxide [2] |
917-58-8 [1], 141-52-6 [2] |
F; R11, C; R34, R14 |
|
|
|
603-042-00-3 |
aluminium-tri-isopropoxide |
555-31-7 |
F; R11 |
|
|
|
603-043-00-9 |
triarimol (ISO); 2,4-dichloro-α-(pyrimidin-5-yl) benzhydryl alcohol |
26766-27-8 |
Xn; R22 |
|
|
|
603-044-00-4 |
dicofol (ISO); 2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethanol |
115-32-2 |
Xn; R21/22, Xi; R38, R43, N; R50-53 |
|
|
|
603-045-00-X |
diisopropyl ether; [1] dipropyl ether [2] |
108-20-3 [1], 111-43-3 [2] |
F; R11, R19, R66, R67 |
|
C |
|
603-046-00-5 |
bis(chloromethyl) ether; oxybis(chloromethane) |
542-88-1 |
F; R11, Carc. Cat. 1; R45, T+; R26, T; R24, Xn; R22 |
C ≥ 0,001 %: Carc. Cat. 1; R45 |
E |
|
603-047-00-0 |
2-dimethylaminoethanol; N,N-dimethylethanolamine |
108-01-0 |
R10, Xn; R20/21/22, C; R34 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
603-048-00-6 |
2-diethylaminoethanol; N,N-diethylethanolamine |
100-37-8 |
R10, Xn; R20/21/22, C; R34 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
603-049-00-1 |
chlorfenethol (ISO); 1,1-bis (4-chlorophenyl) ethanol |
80-06-8 |
Xn; R22, N; R51-53 |
|
|
|
603-050-00-7 |
1-(2-Butoxypropoxy)propan-2-ol |
24083-03-2 |
Xn; R21/22 |
|
|
|
603-051-00-2 |
2-ethylbutan-1-ol |
97-95-0 |
Xn; R21/22 |
|
|
|
603-052-00-8 |
3-butoxypropan-2-ol; propylene glycol monobutyl ether |
5131-66-8 |
Xi; R36/38 |
|
|
|
603-053-00-3 |
2-methylpentane-2,4-diol |
107-41-5 |
Xi; R36/38 |
C ≥ 10 %: Xi; R36/38 |
|
|
603-054-00-9 |
di-n-butyl ether; dibutyl ether |
142-96-1 |
R10, Xi; R36/37/38, R52-53 |
C ≥ 10 %: Xi; R36/37/38 |
|
|
603-055-00-4 |
propylene oxide; 1,2-epoxypropane; methyloxirane |
75-56-9 |
F+; R12, Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R20/21/22, Xi; R36/37/38 |
|
E |
|
603-056-00-X |
[(p-tolyloxy)methyl]oxirane; [1] [(m-tolyloxy)methyl]oxirane; [2] 2,3-epoxypropyl o-tolyl ether; [3] [(tolyloxy)methyl]oxirane; cresyl glycidyl ether [4] |
2186-24-5 [1], 2186-25-6 [2], 2210-79-9 [3], 26447-14-3 [4] |
Muta. Cat. 3; R68, Xi; R38, R43, N; R51-53 |
|
C |
|
603-057-00-5 |
benzyl alcohol |
100-51-6 |
Xn; R20/22 |
|
|
|
603-058-00-0 |
1,3-propylene oxide |
503-30-0 |
F; R11, Xn; R20/21/22 |
|
|
|
603-059-00-6 |
hexan-1-ol |
111-27-3 |
Xn; R22 |
|
|
|
603-060-00-1 |
2,2'-bioxirane; 1,2:3,4-diepoxybutane |
1464-53-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, T+; R26, T; R24/25, C; R34 |
|
E |
|
603-061-00-7 |
tetrahydro-2-furylmethanol; tetrahydrofurfuryl alcohol |
97-99-4 |
Xi; R36 |
C ≥ 10 %: Xi; R36 |
|
|
603-062-00-2 |
tetrahydrofuran-2,5-diyldimethanol |
104-80-3 |
Xi; R36/37/38 |
C ≥ 10 %: Xi; R36/37/38 |
|
|
603-063-00-8 |
2,3-epoxypropan-1-ol; glycidol; oxiranemethanol |
556-52-5 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Repr. Cat. 2; R60, T; R23, Xn; R21/22, Xi; R36/37/38 |
|
E |
|
603-064-00-3 |
1-methoxy-2-propanol; monopropylene glycol methyl ether |
107-98-2 |
R10, R67 |
|
|
|
603-065-00-9 |
resorcinol diglycidyl ether; 1,3-bis(2,3-epoxypropoxy)benzene |
101-90-6 |
Carc. Cat. 3; R40, Muta. Cat. 3; R68, Xn; R21/22, Xi; R36/38, R43, R52-53 |
|
|
|
603-066-00-4 |
1,2-epoxy-4-epoxyethylcyclohexane; 4-vinylcyclohexene diepoxide |
106-87-6 |
Carc. Cat. 3; R40, T; R23/24/25 |
C ≥ 1 %: T; R23/24/25, 0,1 % ≤ C < 1 %: Xn; R20/21/22 |
|
|
603-067-00-X |
phenyl glycidyl ether; 2,3-epoxypropyl phenyl ether; 1,2-epoxy-3-phenoxypropane |
122-60-1 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Xn; R20, Xi; R37/38, R43, R52-53 |
|
E |
|
603-068-00-5 |
2,3-epoxypropyl-2-ethylcyclohexyl ether; ethylcyclohexylglycidyl ether |
130014-35-6 |
Xi; R36/38, R43 |
|
|
|
603-069-00-0 |
2,4,6-tris(dimethylaminomethyl)phenol |
90-72-2 |
Xn; R22, Xi; R36/38 |
|
|
|
603-070-00-6 |
2-amino-2-methylpropanol |
124-68-5 |
Xi; R36/38, R52-53 |
C ≥ 10 %: Xi; R36/38 |
|
|
603-071-00-1 |
2,2'-iminodiethanol; diethanolamine |
111-42-2 |
Xn; R22-48/22, Xi; R38-41 |
|
|
|
603-072-00-7 |
1,4-bis(2,3 epoxypropoxy)butane; butanedioldiglycidyl ether |
2425-79-8 |
Xn; R20/21, Xi; R36/38, R43 |
|
|
|
603-073-00-2 |
bis-[4-(2,3-epoxipropoxi)phenyl]propane |
1675-54-3 |
Xi; R36/38, R43 |
C ≥ 5 %: Xi; R36/38 |
|
|
603-074-00-8 |
reaction product: bisphenol-A-(epichlorhydrin); epoxy resin (number average molecular weight ≤ 700) |
25068-38-6 |
Xi; R36/38, R43, N; R51-53 |
C ≥ 5 %: Xi; R36/38 |
|
|
603-075-00-3 |
chlormethyl methyl ether; chlorodimethyl ether |
107-30-2 |
F; R11, Carc. Cat. 1; R45, Xn; R20/21/22 |
|
E |
|
603-076-00-9 |
but-2-yne-1,4-diol; 2-butyne-1,4-diol |
110-65-6 |
C; R34, T; R23/25, Xn; R21-48/22, R43 |
C ≥ 50 %: C; R34, 25 % ≤ C < 50 %: Xi; R36/38 |
D |
|
603-077-00-4 |
1-dimethylaminopropan-2-ol; dimepranol (INN) |
108-16-7 |
R10, Xn; R22, C; R34 |
|
|
|
603-078-00-X |
prop-2-yn-1-ol; propargyl alcohol |
107-19-7 |
R10, T; R23/24/25, C; R34, N; R51-53 |
|
|
|
603-079-00-5 |
2,2'-(methylimino)diethanol; N-methyldiethanolamine |
105-59-9 |
Xi; R36 |
|
|
|
603-080-00-0 |
2-methylaminoethanol; N-methylethanolamine; N-methyl-2-ethanolamine; N-methyl-2-amino ethanol; 2-(methylamino)ethanol |
109-83-1 |
Xn; R21/22, C; R34 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
603-081-00-6 |
2,2'-thiodiethanol; thiodiglycol |
111-48-8 |
Xi; R36 |
|
|
|
603-082-00-1 |
1-aminopropan-2-ol; isopropanolamine |
78-96-6 |
C; R34 |
|
|
|
603-083-00-7 |
1,1'-iminodipropan-2-ol; di-isopropanolamine |
110-97-4 |
Xi; R36 |
|
|
|
603-084-00-2 |
styrene oxide; (epoxyethyl)benzene; phenyloxirane |
96-09-3 |
Carc. Cat. 2; R45, Xn; R21, Xi; R36 |
|
E |
|
603-085-00-8 |
bronopol (INN); 2-bromo-2-nitropropane-1,3-diol |
52-51-7 |
Xn; R21/22, Xi; R37/38-41, N; R50 |
C ≥ 2,5 %: N; R50 |
|
|
603-086-00-3 |
ethirimol (ISO); 5-butyl-2-ethylamino-6-methylpyrimidin-4-ol |
23947-60-6 |
Xn; R21 |
|
|
|
603-087-00-9 |
2-ethylhexane-1,3-diol; octylene glycol; ethoexadiol |
94-96-2 |
Xi; R41 |
|
|
|
603-088-00-4 |
2-(octylthio)ethanol; 2-hydroxyethyl octyl sulphide |
3547-33-9 |
Xi; R41 |
|
|
|
603-089-00-X |
7,7-dimethyl-3-oxa-6-azaoctan-1-ol |
- |
C; R35, Xn; R22 |
|
|
|
603-090-00-5 |
2-(2-bromoethoxy)anisole |
4463-59-6 |
Xn; R22, R52-53 |
|
|
|
603-091-00-0 |
exo-1-methyl-4-(1-methylethyl)-7-oxabicyclo[2.2.1]heptan-2-ol |
87172-89-2 |
Xn; R22, Xi; R41 |
|
|
|
603-092-00-6 |
2-methyl-4-phenylpentanol |
92585-24-5 |
R43, N; R51-53 |
|
|
|
603-093-00-1 |
cinmethylin (ISO); exo-(±)-1-methyl-2-(2-methylbenzyloxy)-4-isopropyl-7-oxabicyclo(2.2.1)heptane |
87818-31-3 |
Xn; R20, N; R51-53 |
|
|
|
603-094-00-7 |
1,3-bis(2,3-epoxypropoxy)-2,2-dimethylpropane |
17557-23-2 |
Xi; R38, R43 |
|
|
|
603-095-00-2 |
2-(propyloxy)ethanol; EGPE |
2807-30-9 |
Xn; R21, Xi; R36 |
|
|
|
603-096-00-8 |
2-(2-butoxyethoxy)ethanol; diethylene glycol monobutyl ether |
112-34-5 |
Xi; R36 |
|
|
|
603-097-00-3 |
1,1',1''-nitrilotripropan-2-ol; triisopropanolamine |
122-20-3 |
Xi; R36, R52-53 |
|
|
|
603-098-00-9 |
2-phenoxyethanol |
122-99-6 |
Xn; R22, Xi; R36 |
|
|
|
603-099-00-4 |
3-(N-methyl-N-(4-methylamino-3-nitrophenyl)amino)propane-1,2-diol hydrochloride |
93633-79-5 |
Xn; R22, R52-53 |
|
|
|
603-100-00-8 |
1,2-dimethoxypropane |
7778-85-0 |
F; R11-19 |
|
|
|
603-101-00-3 |
tetrahydro-2-isobutyl-4-methylpyran-4-ol, mixed isomers (cis and trans) |
- |
Xi; R36 |
|
|
|
603-102-00-9 |
1,2-epoxybutane |
106-88-7 |
F; R11, Carc. Cat. 3; R40, Xn; R20/21/22, Xi; R36/37/38 |
|
|
ATP07 |
603-103-00-4 |
oxirane, mono[(C12-14-alkyloxy)methyl] derivs. |
68609-97-2 |
Xi; R38, R43 |
|
|
|
603-104-00-X |
fenarimol (ISO); 2,4'-dichloro-α-(pyrimidin-5-yl)benzhydryl alcohol |
60168-88-9 |
Repr. Cat. 3; R62-63, R64, N; R51-53 |
|
|
|
603-105-00-5 |
furan |
110-00-9 |
F+; R12, R19, Carc. Cat. 2; R45, Muta. Cat. 3; R68, Xn; R20/22-48/22, Xi; R38, R52-53 |
|
E |
|
603-106-00-0 |
2-methoxypropanol |
1589-47-5 |
R10, Repr. Cat. 2; R61, Xi; R37/38-41 |
|
|
|
603-107-00-6 |
2-(2-methoxyethoxy)ethanol; diethylene glycol monomethyl ether |
111-77-3 |
Repr. Cat. 3; R63 |
|
|
|
603-108-00-1 |
2-methylpropan-1-ol; iso-butanol |
78-83-1 |
R10, Xi; R37/38-41, R67 |
|
|
|
603-109-00-7 |
reaction mass of: 1-ethoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane; 1-ethoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane |
- |
R53 |
|
|
|
603-110-00-2 |
reaction mass of: cis-2-isobutyl-5-methyl 1,3-dioxane; trans-2-isobutyl-5-methyl 1,3-dioxane |
166301-21-9 |
Xi; R38, R52-53 |
|
|
|
603-111-00-8 |
reaction mass of: 1-(1,1-dimethylpropyl)-4-ethoxy-cis-cyclohexane; 1-(1,1-dimethylpropyl)-4-ethoxy-trans-cyclohexane |
- |
Xi; R38, N; R50-53 |
|
|
|
603-112-00-3 |
cyclopentyl 2-phenylethyl ether |
- |
Xi; R38, N; R50-53 |
|
|
|
603-113-00-9 |
6-glycidyloxynapht-1-yl oxymethyloxirane |
27610-48-6 |
Muta. Cat. 3; R68, Xn; R21, Xi; R38, R43, R52-53 |
|
|
|
603-114-00-4 |
9-(2-propenyloxy)tricyclo[5.2.1.0(2,6)]dec-3(or-4-)-ene |
26912-64-1 |
Xi; R38, N; R51-53 |
|
|
|
603-115-00-X |
reaction mass of: O,O',O''-(methylsilanetriyl)tris(4-methyl-2-pentanone oxime) (3 stereoisomers) |
- |
Xn; R48/22, R53 |
|
|
|
603-116-00-5 |
(Z)-(2,4-difluorophenyl)piperidin-4-ylmethanone oxime monohydrochloride |
138271-16-6 |
Xn; R22, Xi; R41, R52-53 |
|
|
|
603-117-00-0 |
propan-2-ol; isopropyl alcohol; isopropanol |
67-63-0 |
F; R11, Xi; R36, R67 |
|
|
|
603-118-00-6 |
6-dimethylaminohexan-1-ol |
1862-07-3 |
Xn; R22, C; R34, R52-53 |
|
|
|
603-119-00-1 |
1,1'-(1,3-phenylenedioxy)bis(3-(2-(prop-2-enyl)phenoxy)propan-2-ol) |
- |
R43, N; R50-53 |
|
|
|
603-120-00-7 |
2-methyl-5-phenylpentanol |
25634-93-9 |
Xi; R36/38 |
|
|
|
603-121-00-2 |
4-[4-(1,3-dihydroxyprop-2-yl)phenylamino]-1,8-dihydroxy-5-nitroanthraquinone |
114565-66-1 |
Carc. Cat. 3; R40, R43, R53 |
|
|
|
603-122-00-8 |
sodium 2-ethylhexanolate |
38411-13-1 |
F; R11, C; R34, R52-53 |
|
|
|
603-123-00-3 |
4-methyl-8-methylenetricyclo[3.3.1.13,7]decan-2-ol |
122760-84-3 |
Xi; R38, R43, N; R51-53 |
|
|
|
603-124-00-9 |
1,4-bis[2-(vinyloxy)ethoxy]benzene |
84563-49-5 |
N; R50-53 |
|
|
|
603-125-00-4 |
2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)pent-4-en-2-ol |
89544-40-1 |
Xn; R22, Xi; R41, N; R51-53 |
|
|
|
603-126-00-X |
2-((4-methyl-2-nitrophenyl)amino)ethanol |
100418-33-5 |
Xn; R22, R43, R52-53 |
|
|
|
603-127-00-5 |
butan-2-ol; [1] (S)-butan-2-ol; [2] (R)-butan-2-ol; [3] (±)-butan-2-ol [4] |
78-92-2 [1], 4221-99-2 [2], 14898-79-4 [3], 15892-23-6 [4] |
R10, Xi; R36/37, R67 |
|
C |
|
603-128-00-0 |
2-(phenylmethoxy)naphthalene |
613-62-7 |
R53 |
|
|
|
603-129-00-6 |
1-tert-butoxypropan-2-ol |
57018-52-7 |
R10, Xi; R41 |
|
|
|
603-130-00-1 |
reaction mass of isomers of: α-((dimethyl)biphenyl)-ω-hydroxypoly(oxyethylene) |
- |
Xn; R22, R52-53 |
|
|
|
603-131-00-7 |
reaction mass of: 1-deoxy-1-[methyl-(1-oxododecyl)amino]-D-glucitol; 1-deoxy-1-[methyl-(1-oxotetradecyl)amino]-D-glucitol (3:1) |
- |
Xi; R41 |
|
|
|
603-132-00-2 |
2-hydroxymethyl-9-methyl-6-(1-methylethyl)-1,4-dioxaspiro[4.5]decane |
63187-91-7 |
Xi; R38-41, R52-53 |
|
|
|
603-133-00-8 |
reaction mass of: 3-[(4-amino-2-chloro-5-nitrophenyl)amino]-propane-1,2-diol; 3,3'-(2-chloro-5-nitro-1,4-phenylenediimino)bis(propan-1,2-diol) |
- |
Xn; R22, R52-53 |
|
|
|
603-134-00-3 |
reaction mass of substituted dodecyl and/or tetradecyl, diphenyl ethers. The substance is produced by the Friedel Crafts reaction. The catalyst is removed from the reaction product. Diphenyl ether is substituted by C1-C10 alkyl groups. The alkyl groups are bonded randomly between C1 and C6. Linear C12 and C14, 50/50 used. |
- |
R53 |
|
|
|
603-135-00-9 |
bis[[2,2',2''-nitrilotris-[ethanolato]]-1-N,O]-bis[2-(2-methoxyethoxy)ethoxy]-titanium |
- |
Xi; R41, N; R51-53 |
|
|
|
603-136-00-4 |
3-((4-(bis(2-hydroxyethyl)amino)-2-nitrophenyl)amino)-1-propanol |
104226-19-9 |
R43, R52-53 |
|
|
|
603-137-00-X |
reaction mass of: 1-deoxy-1-[methyl-(1-oxohexadecyl)amino]-D-glucitol; 1-deoxy-1-[methyl-(1-oxooctadecyl)amino]-D-glucitol |
- |
Xi; R41 |
|
|
|
603-138-00-5 |
3-(2,2-dimethyl-3-hydroxypropyl)toluene; (alt.): 2,2-dimethyl-3-(3-methylphenyl)propanol |
103694-68-4 |
R52-53 |
|
|
|
603-139-00-0 |
bis(2-methoxyethyl) ether |
111-96-6 |
R10, R19, Repr. Cat. 2; R60-61 |
|
|
|
603-140-00-6 |
2,2' -oxybisethanol; diethylene glycol |
111-46-6 |
Xn; R22 |
|
|
|
603-141-00-1 |
reaction mass of: dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethylethanoxy)]pentadecane; dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethylethanoxy)]heptadecane |
- |
R52-53 |
|
|
|
603-142-00-7 |
2-(2-(2-hydroxyethoxy)ethyl)-2-aza-bicyclo[2.2.1]heptane |
116230-20-7 |
Xn; R21/22-48/20, Xi; R38-41 |
|
|
|
603-143-00-2 |
R-2,3-epoxy-1-propanol |
57044-25-4 |
E; R2, Carc. Cat. 2; R45, Muta. Cat. 3; R68, Repr. Cat. 2; R60, T; R23, Xn; R21/22, C; R34 |
|
E |
|
603-144-00-8 |
reaction mass of: 2,6,9-trimethyl-2,5,9-cyclododecatrien-1-ol; 6,9-dimethyl-2-methylen-5,9-cyclododecadien-1-ol |
111850-00-1 |
N; R51-53 |
|
|
|
603-145-00-3 |
2-isopropyl-2-(1-methylbutyl)-1,3-dimethoxypropane |
129228-11-1 |
Xi; R38, N; R51-53 |
|
|
|
603-146-00-9 |
2-[(2-[2-(dimethylamino)ethoxy]ethyl)methylamino]ethanol |
83016-70-0 |
Xn; R22, C; R34, R52-53 |
|
|
|
603-147-00-4 |
(-)-trans-4-(4'-fluorophenyl)-3-hydroxymethyl-N-methylpiperidine |
105812-81-5 |
Xn; R22, Xi; R41, N; R51-53 |
|
|
|
603-148-00-X |
1,4-bis[(vinyloxy)methyl]cyclohexane |
17351-75-6 |
R43, N; R51-53 |
|
|
|
603-149-00-5 |
reaction mass of diastereoisomers of 1-(1-hydroxyethyl)-4-(1-methylethyl)cyclohexane |
63767-86-2 |
Xi; R36/38, N; R51-53 |
|
|
|
603-150-00-0 |
(±) trans-3,3-dimethyl-5-(2,2,3-trimethyl-cyclopent-3-en-1-yl)-pent-4-en-2-ol |
107898-54-4 |
Xi; R38, N; R50-53 |
|
|
|
603-151-00-6 |
(±)-2-(2,4-dichlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propan-1-ol |
- |
R52-53 |
|
|
|
603-152-00-1 |
2-(4-tert-butylphenyl)ethanol |
5406-86-0 |
Repr. Cat. 3; R62, Xn; R48/22, Xi; R41, N; R51-53 |
|
|
|
603-153-00-7 |
3-((2-nitro-4-(trifluoromethyl)phenyl)amino)propane-1,2-diol |
104333-00-8 |
Xn; R22, R52-53 |
|
|
|
603-154-00-2 |
1-[(2-tert-butyl)cyclohexyloxy]-2-butanol |
139504-68-0 |
N; R51-53 |
|
|
|
603-156-00-3 |
2-(2,4-dichlorophenyl)-2-(2-propenyl)oxirane |
89544-48-9 |
Xi; R38, R43, N; R50-53 |
|
|
|
603-157-00-9 |
6,9-bis(hexadecyloxymethyl)-4,7-dioxanonane-1,2,9-triol |
143747-72-2 |
R53 |
|
|
|
603-158-00-4 |
reaction mass of 4 diastereoisomers of 2,7-dimethyl-10-(1-methylethyl)-1-oxaspiro[4.5]deca-3,6-diene |
- |
Xi; R38, N; R51-53 |
|
|
|
603-159-00-X |
2-cyclododecylpropan-1-ol |
118562-73-5 |
N; R50-53 |
|
|
|
603-160-00-5 |
1,2-diethoxypropane |
10221-57-5 |
F; R11, R19 |
|
|
|
603-161-00-0 |
1,3-diethoxypropane |
3459-83-4 |
R10 |
|
|
|
603-162-00-6 |
α[2-[[[(2-hydroxyethyl)methylamino]acetyl]amino]propyl]-ω-(nonylphenoxy)poly[oxo(methyl-1,2-ethanediyl)] |
144736-29-8 |
C; R34, R43, N; R51-53 |
|
|
|
603-163-00-1 |
2-phenyl-1,3-propanediol |
1570-95-2 |
Xi; R41 |
|
|
|
603-164-00-7 |
2-butyl-4-chloro-4,5-dihydro-5-hydroxymethyl-1-[2'-(2-triphenylmethyl-1,2,3,4-2H-tetrazol-5-yl)-1,1'-biphenyl-4-methyl]-1H-imidazole |
133909-99-6 |
R53 |
|
|
|
603-165-00-2 |
reaction mass of: 4-allyl-2,6-bis(2,3-epoxypropyl)phenol; 4-allyl-6-[3-[6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3 |
- |
Muta. Cat. 3; R68, R43 |
|
|
|
603-166-00-8 |
R-1-chloro-2,3-epoxypropane |
51594-55-9 |
R10, Carc. Cat. 2; R45, T; R23/24/25, C; R34, R43 |
|
E |
|
603-167-00-3 |
3,3',5,5'-tetra-tert-butylbiphenyl-2,2'-diol |
6390-69-8 |
R53 |
|
|
|
603-168-00-9 |
3-(2-ethylhexyloxy)propane-1,2-diol |
70445-33-9 |
Xi; R41, R52-53 |
|
|
|
603-169-00-4 |
(±)-trans-4-(4-fluorophenyl)-3-hydroxymethyl-N-methylpiperidine |
109887-53-8 |
Xn; R22, Xi; R41, N; R51-53 |
|
|
|
603-170-00-X |
reaction mass of: 2-methyl-1-(6-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol; 2-methyl-1-(1-methylbicyclo[2.2.1]hept-5-en-2-yl)-pent-1-en-3-ol; 2-methyl-1-(5-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol |
67739-11-1 |
Xi; R36, N; R51-53 |
|
|
|
603-171-00-5 |
5-thiazolylmethanol |
38585-74-9 |
Xi; R41, R52-53 |
|
|
|
603-172-00-0 |
mono-2-[2-(4-dibenzo[b,f][1,4]thiazepin-11-yl)piperazinium-1-yl]ethoxy)ethanol trans-butenedioate |
773058-82-5 |
Xn; R22, Xi; R41, N; R51-53 |
|
|
|
603-173-00-6 |
4,4-dimethyl-3,5,8-trioxabicyclo[5.1.0]octane |
57280-22-5 |
Xi; R36, R43 |
|
|
|
603-174-00-1 |
4-cyclohexyl-2-methyl-2-butanol |
83926-73-2 |
Xi; R41, N; R51-53 |
|
|
|
603-175-00-7 |
2-(2-hexyloxyethoxy)ethanol; DEGHE; diethylene glycol monohexyl ether; 3,6-dioxa-1-dodecanol; hexyl carbitol; 3,6-dioxadodecan-1-ol |
112-59-4 |
Xn; R21, Xi; R41 |
|
|
|
603-176-00-2 |
1,2-bis(2-methoxyethoxy)ethane; TEGDME; triethylene glycol dimethyl ether; triglyme |
112-49-2 |
R19, Repr. Cat. 2; R61, Repr. Cat. 3; R62 |
|
|
|
603-177-00-8 |
1-ethoxypropan-2-ol; 2PG1EE; 1-ethoxy-2-propanol; propylene glycol monoethyl ether; [1] 2-ethoxy-1-methylethyl acetate; 2PG1EEA [2] |
1569-02-4 [1], 54839-24-6 [2] |
R10, R67 |
|
|
|
603-178-00-3 |
2-hexyloxyethanol; ethylene glycol monohexyl ether; n-hexylglycol |
112-25-4 |
Xn; R21/22, C; R34 |
|
|
|
603-179-00-9 |
ergocalciferol (ISO); Vitamin D2 |
50-14-6 |
T+; R26, T; R24/25-48/25 |
|
|
|
603-180-00-4 |
colecalciferol; Vitamin D3 |
67-97-0 |
T+; R26, T; R24/25-48/25 |
|
|
|
603-181-00-X |
tert-butyl methyl ether; MTBE; 2-methoxy-2-methylpropane |
1634-04-4 |
F; R11, Xi; R38 |
|
|
|
603-182-00-5 |
reaction product of: saturated, monounsaturated and multiple unsaturated long-chained partly estrified alcohols of vegetable origin (Brassica napus L., Brassica rapa L., Helianthus annuus L., Glycine hispida, Gossypium hirsutum L., Cocos nucifera L., Elaeis guineensis) with O,O-diisobutyldithiophosphate and 2-ethylhexylamine and hydrogen peroxide |
- |
R43 |
|
|
|
603-183-00-0 |
2-[2-(2-butoxyethoxy)ethoxy]ethanol; TEGBE; triethylene glycol monobutyl ether; butoxytriethylene glycol |
143-22-6 |
Xi; R41 |
C ≥ 30 %: Xi; R41, 20 % ≤ C < 30 %: Xi; R36 |
|
|
603-184-00-6 |
2-(hydroxymethyl)-2-[[2-hydroxy-3-(isooctadecyloxy)propoxy]methyl]-1,3-propanediol |
146925-83-9 |
N; R50-53 |
|
|
|
603-185-00-1 |
2,4-dichloro-3-ethyl-6-nitrophenol |
99817-36-4 |
T; R25, Xi; R41, R43, N; R50-53 |
|
|
|
603-186-00-7 |
trans-(5RS,6SR)-6-amino-2,2-dimethyl-1,3-dioxepan-5-ol |
79944-37-9 |
R43 |
|
|
|
603-187-00-2 |
2-((4,6-bis(4-(2-(1-methylpyridinium-4-yl)vinyl)phenylamino)-1,3,5-triazin-2-yl)(2-hydroxyethyl)amino)ethanol dichloride |
163661-77-6 |
N; R50-53 |
|
|
|
603-188-00-8 |
reaction mass of: 6,7-epoxy-1,2,3,4,5,6,7,8-octahydro-1,1,2,4,4,7-hexamethylnaphthalene; 7,8-epoxy-1,2,3,4,6,7,8,8a-octahydro-1,1,2,4,4,7-hexamethylnaphthalene |
- |
N; R50-53 |
|
|
|
603-189-00-3 |
reaction mass of complexes of: titanium, 2,2'-oxydiethanol, ammonium lactate, nitrilotris(2-propanol) and ethylene glycol |
- |
N; R51-53 |
|
|
|
603-190-00-9 |
8,8-dimethyl-7-isopropyl-6,10-dioxaspiro[4.5]decane |
62406-73-9 |
Xi; R38, R52-53 |
|
|
|
603-191-00-4 |
2-(4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)-5-(3-((2-ethylhexyl)oxy)-2-hydroxypropoxy)phenol |
137658-79-8 |
R53 |
|
|
|
603-192-00-X |
(E,E)-3,7,11-trimethyldodeca-1,4,6,10-tetraen-3-ol |
125474-34-2 |
Xi; R38-41, R43, N; R50-53 |
|
|
|
603-193-00-5 |
disodium 9,10-anthracenedioxide |
46492-07-3 |
C; R35 |
|
|
|
603-194-00-0 |
2-(2-aminoethylamino)ethanol; (AEEA) |
111-41-1 |
Repr. Cat. 2; R61, Repr. Cat. 3; R62, C; R34, R43 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
603-195-00-6 |
2-[4-(4-methoxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]-phenol |
154825-62-4 |
R52-53 |
|
|
|
603-196-00-1 |
2-(7-ethyl-1H-indol-3-yl)ethanol |
41340-36-7 |
Xn; 22-48/22, N; R51-53 |
|
|
|
603-197-00-7 |
tebuconazole (ISO); 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol |
107534-96-3 |
Repr. Cat. 3; R63, Xn; R22, N; R50-53 |
N; R50-53: C >= 25 %, N; R51-53: 2,5 % <= C <25 %, R52-53: 0,25 % <= C < 2,5 % |
|
ATP07 |
603-199-00-8 |
etoxazol (ISO); (RS)-5-tert-butyl-2-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenetole |
153233-91-1 |
N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
603-200-00-1 |
1-pentanol; [1] 3-pentanol [2] |
71-41-0 [1], 584-02-1 [2] |
R10, Xn; R20, Xi; R37/38 |
|
|
|
603-201-00-7 |
(E)-(7R,11R)-3,7,11,15-tetramethylhexadec-2-ene-1-ol |
- |
Xi; R38, R53 |
|
|
|
603-202-00-2 |
4,4,5,5,5-pentafluoropentan-1-ol |
148043-73-6 |
Xn; R22, R52-53 |
|
|
|
603-203-00-8 |
(1R,3S,7R,8R,10R,13R)-5,5,7,9,9,13-hexamethyl-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane |
- |
Xi; R38 |
|
|
|
603-204-00-3 |
reaction mass of: 2,2'-(heptane-1,7-diyl)bis-1,3-dioxolane; 2,2'-(heptane-1,6-diyl)bis-1,3-dioxolane |
- |
R52-53 |
|
|
|
603-205-00-9 |
(1S-cis)-4-(2-amino-6-chloro-9H-purin-9-yl)-2-cyclopentene-1-methanol hydrochloride |
172015-79-1 |
T; R48/25, Xn; R22, Xi; R41, R43, R52-53 |
|
|
|
603-206-00-4 |
2,2-dichloro-1,3-benzodioxol |
2032-75-9 |
R10, R14, C; R35, Xn; R22, R43 |
|
|
|
603-207-00-X |
2-isobutyl-2-isopropyl-1,3-dimethoxypropane |
129228-21-3 |
Xi; R38, N; R51-53 |
|
|
|
603-208-00-5 |
1,2-diethoxyethane |
629-14-1 |
F; R11, R19, Repr. Cat. 2; R61, Repr. Cat. 3; R62, Xi; R36 |
|
|
|
603-209-00-0 |
spinosad (ISO) (reaction mass of spinosyn A and spinosyn D in ratios between 95:5 to 50:50); reaction mass of 50-95% of (2R,3aS,5aR,5bS,9S,13S,14R,16aS,16bR)-2-(6-deoxy-2,3,4-tri-O-methyl-α-l-mannopyranosyloxy)-13-(4-dimethylamino-2,3,4,6-tetradeoxy-β-d- |
- [1], 131929-60-7 [2], 131929-63-0 [3], - |
N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
603-210-00-6 |
2,4-diethyl-1,5-pentanediol |
57987-55-0 |
Xi; R41 |
|
|
|
603-211-00-1 |
2,3-epoxypropyltrimethylammonium chloride ...%; glycidyl trimethylammonium chloride ...% |
3033-77-0 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Repr. Cat. 3; R62, Xn; R21/22-48/22, Xi; R41, R43, R52-53 |
|
B E |
|
603-212-00-7 |
1,3,4,6,7,8-hexahydro-4,6,6,7,8,8-hexamethylindeno[5,6-c]pyran; galaxolide; (HHCB) |
1222-05-5 |
N; R50-53 |
|
|
|
603-213-00-2 |
2-methoxy-2-methylbutane; tert-amyl methyl ether |
994-05-8 |
F; R11, Xn; R22, R67 |
|
|
|
603-214-00-8 |
1,1-diisopropoxycyclohexane |
1132-95-2 |
C; R34 |
|
|
|
603-215-00-3 |
1-hydroxy-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane bis(tetrafluoroborate) |
162241-33-0 |
E; R2, Xn; R22-48/22, Xi; R41, R43, N; R50-53 |
|
|
|
603-216-00-9 |
cis-1-amino-2,3-dihydro-1H-inden-2-ol |
7480-35-5 |
Xi; R41, R43, R52-53 |
|
|
|
603-217-00-4 |
2,4,6-tri-tert-butylphenyl 2-butyl-2-ethyl-1,3-propanediolphosphite |
161717-32-4 |
R43, R53 |
|
|
|
603-220-00-0 |
1-{benzyl[2-(2-methoxyphenoxy)ethyl]amino}-3-(9H-carbazol-4-yloxy)propan-2-ol |
72955-94-3 |
R53 |
|
|
|
603-221-00-6 |
1-(2-amino-5-chlorophenyl)-2,2,2-trifluoro-1,1-ethanediol, hydrochloride; [containing < 0.1 % 4-chloroaniline (EC No 203-401-0)] |
214353-17-0 |
Xn; R22, C; R34, N; R51-53 |
|
|
|
603-221-01-3 |
1-(2-amino-5-chlorophenyl)-2,2,2-trifluoro-1,1-ethanediol, hydrochloride; [containing ≥ 0.1 % 4-chloroaniline (EC No 203-401-0)] |
214353-17-0 |
Carc. Cat. 2; R45, Xn; R22, C; R34, N; R51-53 |
|
E |
|
603-222-00-1 |
(2R,3S,4R,5R,7R,9R,10R,11S,12S,13R)-10-[(4-dimethylamino-3-hydroxy-6-methyltetrahydropyran-2-yl)oxy]-2-ethyl-3,4,12-trihydroxy-9-methoxy-3,5,7,9,11,13-hexamethyl-6,14-dioxo-1-oxacyclotetradecane |
118058-74-5 |
Xi; R36 |
|
|
|
603-223-00-7 |
2-cyclopentylidene cyclopentanol; 1,1'-bi(cyclopentyliden)-2-ol |
6261-30-9 |
Xi; R38-41, R52-53 |
|
|
|
603-224-00-2 |
3-ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)-hexane |
297730-93-9 |
R53 |
|
|
|
603-225-00-8 |
erythromycin A9-oxime (E); (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-4-((2,6-didesoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopiranosyl)oxy)-14-ethyl-7,12,13-trihydroxy-3,5,7,9,11,13-hexamethyl-6-((3,4,6-tridesoxy-3-dimethylamino-β-d-xylohexapiranosyl)oxy)oxacyclot |
13127-18-9 |
N; R51-53 |
|
|
|
603-226-00-3 |
4,4'(4-(4-methoxyphenyl)-1,3,5-triazin-2,4-diyl)bisbenzene-1,3-diol |
1440-00-2 |
R52-53 |
|
|
|
603-227-00-9 |
α-hydro-ω-[[[(1,1-dimethylethyl)dioxy]carbonyl]oxy]-poly[oxy(methyl-1,2-ethanediyl)] ether with 2,2-bis(hydroxymethyl)-1,3-propanediol (4:1); reaction product of: α-hydro-ω-((chlorocarbonyl)oxy)-poly(oxy(methyl-1,2-ethanediyl)) ether with 2,2-bis(hydroxy |
203574-04-3 |
O; R7, N; R50-53 |
|
|
|
603-228-00-4 |
(+/-)-(R*,R*)-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran; 6-fluoro-2-(2-oxiranyl)chromane |
- |
R43, N; R51-53 |
|
|
|
603-229-00-X |
sodium (Z)-3-chloro-3-(4-chlorophenyl)-1-hydroxy-2-propene-1-sulfonate |
- |
Xi; R38-41, R43, N; R50-53 |
|
|
|
603-230-00-5 |
2,6,6,7,8,8-hexamethyldecahydro-2H-indeno[4,5-b]furan |
- |
Xi; R38-41, R53 |
|
|
|
603-231-00-0 |
(S)-1,1-diphenyl-1,2-propanediol |
- |
R52-53 |
|
|
|
603-232-00-6 |
3,3,8,8,10,10-hexamethyl-9-[1-(4-oxiranylmethoxy-phenyl)-ethoxy]-1,5-dioxa-9-aza-spiro[5.5]undecane |
- |
R53 |
|
|
|
603-233-00-1 |
reaction mass of: 4-(1,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-ylidene)-3-methylbutan-2-ol; 4-(3,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-ylidene)-3-methylbutan-2-ol; 1-(1,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-ylidene)pentan-3-ol; 1-(3,3a,4,6,7,7a- |
- |
N; R51-53 |
|
|
|
603-234-00-7 |
(1R,4R)-4-methoxy-2,2,7,7-tetramethyltricyclo(6.2.1.0(1,6))undec-5-ene |
- |
Xi; R38, N; R51-53 |
|
|
|
604-001-00-2 |
phenol; carbolic acid; monohydroxybenzene; phenylalcohol |
108-95-2 |
Muta. Cat. 3; R68, T; R23/24/25, Xn; R48/20/21/22, C; R34 |
C ≥ 10 %: T; R23/24/25, 3 % ≤ C < 10 %: Xn; R20/21/22, C ≥ 3 %: C; R34, 1 % ≤ C < 3 %: Xi; R36/38 |
|
|
604-002-00-8 |
pentachlorophenol |
87-86-5 |
Carc. Cat. 3; R40, T+; R26, T; R24/25, Xi; R36/37/38, N; R50-53 |
|
|
|
604-003-00-3 |
sodium pentachlorophenolate; [1] potassium pentachlorophenolate [2] |
131-52-2 [1], 7778-73-6 [2] |
Carc. Cat. 3; R40, T+; R26, T; R24/25, Xi; R36/37/38, N; R50-53 |
|
|
|
604-004-00-9 |
m-cresol; [1] o-cresol; [2] p-cresol; [3] mix-cresol [4] |
108-39-4 [1], 95-48-7 [2], 106-44-5 [3], 1319-77-3 [4] |
T; R24/25, C; R34 |
C ≥ 5 %: T; R24/25, 1 % ≤ C < 5 %: Xn; R21/22, C ≥ 5 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/38 |
C |
|
604-005-00-4 |
1,4-dihydroxybenzene; hydroquinone; quinol |
123-31-9 |
Carc. Cat. 3; R40, Muta. Cat. 3; R68, Xn; R22, Xi; R41, R43, N; R50 |
C ≥ 2,5 %: N; R50 |
|
|
604-006-00-X |
3,4-xylenol; [1] 2,5-xylenol; [2] 2,4-xylenol; [3] 2,3-xylenol; [4] 2,6-xylenol; [5] xylenol; [6] 2,4(or 2,5)-xylenol [7] |
95-65-8 [1], 95-87-4 [2], 105-67-9 [3], 526-75-0 [4], 576-26-1 [5], 1300-71-6 [6], 71975-58-1 [7] |
T; R24/25, C; R34, N; R51-53 |
|
C |
|
604-007-00-5 |
2-naphthol |
135-19-3 |
Xn; R20/22, N; R50 |
|
|
|
604-008-00-0 |
2-chlorophenol; [1] 4-chlorophenol; [2] 3-chlorophenol; [3] chlorophenol [4] |
95-57-8 [1], 106-48-9 [2], 108-43-0 [3], 25167-80-0 [4] |
Xn; R20/21/22, N; R51-53 |
|
C |
|
604-009-00-6 |
pyrogallol; 1,2,3-trihydroxybenzene |
87-66-1 |
Muta. Cat. 3; R68, Xn; R20/21/22, R52-53 |
C ≥ 10 %: Xn; R20/21/22 |
|
|
604-010-00-1 |
resorcinol; 1,3-benzenediol |
108-46-3 |
Xn; R22, Xi; R36/38, N; R50 |
C ≥ 10 %: Xn; R22 |
|
|
604-011-00-7 |
2,4-dichlorophenol |
120-83-2 |
T; R24, Xn; R22, C; R34, N; R51-53 |
|
|
|
604-012-00-2 |
4-chloro-o-cresol; 4-chloro-2-methyl phenol |
1570-64-5 |
T; R23, C; R35, N; R50 |
C ≥ 10 %: C; R35, 5 % ≤ C < 10 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/37/38 |
|
|
604-013-00-8 |
2,3,4,6-tetrachlorophenol |
58-90-2 |
T; R25, Xi; R36/38, N; R50-53 |
C ≥ 5 %: T; R25, 0,5 % ≤ C < 5 %: Xn; R22, C ≥ 5 %: Xi; R36/38 |
|
|
604-014-00-3 |
chlorocresol; 4-chloro-m-cresol; 4-chloro-3-methylphenol |
59-50-7 |
Xn; R21/22, Xi; R41, R43, N; R50 |
C ≥ 10 %: Xn; R21/22 |
|
|
604-015-00-9 |
2,2'-methylenebis-(3,4,6-trichlorophenol); hexachlorophene |
70-30-4 |
T; R24/25, N; R50-53 |
C ≥ 2 %: T; R24/25, 0,2 % ≤ C < 2 %: Xn; R21/22 |
|
|
604-016-00-4 |
1,2-dihydroxybenzene; pyrocatechol |
120-80-9 |
Xn; R21/22, Xi; R36/38 |
|
|
|
604-017-00-X |
2,4,5-trichlorophenol |
95-95-4 |
Xn; R22, Xi; R36/38, N; R50-53 |
C ≥ 20 %: Xn; R22, C ≥ 5 %: Xi; R36/38 |
|
|
604-018-00-5 |
2,4,6-trichlorophenol |
88-06-2 |
Carc. Cat. 3; R40, Xn; R22, Xi; R36/38, N; R50-53 |
|
|
|
604-019-00-0 |
dichlorophen (ISO) |
97-23-4 |
Xn; R22, Xi; R36, N; R50-53 |
|
|
|
604-020-00-6 |
2-phenylphenol (ISO); biphenyl-2-ol; 2-hydroxybiphenyl |
90-43-7 |
Xi; R36/37/38, N; R50 |
|
|
|
604-021-00-1 |
sodium 2-biphenylate; 2-phenylphenol, sodium salt |
132-27-4 |
Xn; R22, Xi; R37/38-41, N; R50 |
|
|
|
604-022-00-7 |
2,2-dimethyl-1,3-benzodioxol-4-ol |
22961-82-6 |
Xi; R41 |
|
|
|
604-023-00-2 |
2,4-dichloro-3-ethylphenol |
- |
C; R34, N; R50-53 |
|
|
|
604-024-00-8 |
4,4-isobutylethylidenediphenol |
6807-17-6 |
Repr. Cat. 2; R60, Xi; R36, N; R50-53 |
|
|
|
604-025-00-3 |
2,5-bis(1,1-dimethylbutyl)hydroquinone |
- |
N; R51-53 |
|
|
|
604-026-00-9 |
2,2-spirobi(6-hydroxy-4,4,7-trimethylchromane) |
- |
N; R51-53 |
|
|
|
604-027-00-4 |
2-methyl-5-(1,1,3,3-tetramethylbutyl)hydroquinone |
- |
Xi; R41, R43, N; R51-53 |
|
|
|
604-028-00-X |
4-amino-3-fluorophenol |
399-95-1 |
Carc. Cat. 2; R45, Xn; R22, R43, N; R51-53 |
|
E |
|
604-029-00-5 |
1-naphtol |
90-15-3 |
Xn; R21/22, Xi; R37/38-41 |
|
|
|
604-030-00-0 |
bisphenol A; 4,4'-isopropylidenediphenol |
80-05-7 |
Repr. Cat. 3; R62, Xi; R37-41, R43, R52 |
|
|
|
604-031-00-6 |
guaiacol |
90-05-1 |
Xn; R22, Xi; R36/38 |
|
|
|
604-032-00-1 |
thymol |
89-83-8 |
Xn; R22, C; R34, N; R51-53 |
|
|
|
604-033-00-7 |
isobutyl but-3-enoate |
24342-03-8 |
R10 |
|
|
|
604-034-00-2 |
4,4'-thiodi-o-cresol |
24197-34-0 |
Xi; R41, N; R50-53 |
|
|
|
604-035-00-8 |
4-nonylphenol, reaction products with formaldehyde and dodecane-1-thiol |
- |
R43, R53 |
|
|
|
604-036-00-3 |
4,4'-oxybis(ethylenethio)diphenol |
90884-29-0 |
R43, N; R51-53 |
|
|
|
604-037-00-9 |
3,5-xylenol; 3,5-dimethylphenol |
108-68-9 |
T; R24/25, C; R34 |
|
|
|
604-038-00-4 |
4-chloro-3,5-dimethylphenol; [1] chloroxylenol [2] |
88-04-0 [1], 1321-23-9 [2] |
Xn; R22, Xi; R36/38, R43 |
|
|
|
604-039-00-X |
ethyl 2-[4-[(6-chlorobenzoxazol-2-yl)oxy]phenoxy]propionate; fenoxaprop-ethyl |
66441-23-4 |
R43, N; R50-53 |
|
|
|
604-040-00-5 |
fomesafen (ISO); 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulphonyl)-2-nitrobenzamide |
72178-02-0 |
Xn; R22 |
|
|
|
604-041-00-0 |
acifluorfen (ISO); 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid; [1] sodium 5-[2-chloro-4-(trifluoromethyl) phenoxy]-2-nitrobenzoate; acifluorfen-sodium [2] |
50594-66-6 [1], 62476-59-9 [2] |
Xn; R22, Xi; R38-41, N; R50-53 |
|
|
|
604-042-00-6 |
4-nitrosophenol |
104-91-6 |
Muta. Cat. 3; R68, Xn; R22, Xi; R41, N; R51-53 |
|
|
|
604-043-00-1 |
monobenzone; 4-hydroxyphenyl benzyl ether; hydroquinone monobenzyl ether |
103-16-2 |
Xi; R36, R43 |
|
|
|
604-044-00-7 |
mequinol; 4-methoxyphenol; hydroquinone monomethyl ether |
150-76-5 |
Xn; R22, Xi; R36, R43 |
|
|
|
604-045-00-2 |
2,3,5-trimethylhydroquinone |
700-13-0 |
Xn; R20, Xi; R37/38-41, R43, N; R50-53 |
|
|
|
604-046-00-8 |
4-(4-isopropoxyphenylsulfonyl)phenol |
95235-30-6 |
N; R51-53 |
|
|
|
604-047-00-3 |
4-(4-tolyloxy)biphenyl |
51601-57-1 |
Xn; R48/22, R53 |
|
|
|
604-048-00-9 |
4,4',4''-(ethan-1,1,1-triyl)triphenol |
27955-94-8 |
N; R51-53 |
|
|
|
604-049-00-4 |
4-4'-methylenebis(oxyethylenethio)diphenol |
93589-69-6 |
N; R51-53 |
|
|
|
604-051-00-5 |
3,5-bis((3,5-di-tert-butyl-4-hydroxy)benzyl)-2,4,6-trimethylphenol |
87113-78-8 |
R52-53 |
|
|
|
604-052-00-0 |
2,2'-methylenebis(6-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol) |
103597-45-1 |
R53 |
|
|
|
604-053-00-6 |
2-methyl-4-(1,1-dimethylethyl)-6-(1-methyl-pentadecyl)-phenol |
157661-93-3 |
Xi; R38, R43, N; R50-53 |
|
|
|
604-054-00-1 |
reaction mass of: 2-methoxy-4-(tetrahydro-4-methylene-2H-pyran-2-yl)-phenol; 4-(3,6-dihydro-4-methyl-2H-pyran-2-yl)-2-methoxyphenol |
- |
R43, R52-53 |
|
|
|
604-055-00-7 |
2,2'-((3,3',5,5'-tetramethyl-(1,1'-biphenyl)-4,4'-diyl)-bis(oxymethylene))-bis-oxirane |
85954-11-6 |
Carc. Cat. 3; R40, R43 |
|
|
|
604-056-00-2 |
2-(2-hydroxy-3,5-dinitroanilino)ethanol |
99610-72-7 |
F; R11, Repr. Cat. 3; R62, Xn; R22 |
|
|
|
604-057-00-8 |
reaction mass of: isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-(n)-dodecylphenol; isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-(n)-tetracosylphenol; isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-5,6-didodecyl-phenol. n = 5 or 6 |
- |
N; R51-53 |
|
|
|
604-058-00-3 |
1,2-bis(3-methylphenoxy)ethane |
54914-85-1 |
N; R50-53 |
|
|
|
604-059-00-9 |
2-n-hexadecylhydroquinone |
- |
Xn; R48/22, Xi; R38, R43, R53 |
|
|
|
604-060-00-4 |
9,9-bis(4-hydroxyphenyl)fluorene |
3236-71-3 |
Xi; R36-38, N; R50-53 |
|
|
|
604-061-00-X |
reaction mass of: 2-chloro-5-sec-tetradecylhydroquinones where sec-tetradecyl = 1-methyltridecyl; 1-ethyldodecyl; 1-propylundecyl; 1-butyldecyl; 1-pentylnonyl; 1-hexyloctyl |
- |
Xi; R38, R43, R52-53 |
|
|
|
604-062-00-5 |
2,4-dimethyl-6-(1-methyl-pentadecyl)phenol |
- |
Xi; R38, R43, N; R50-53 |
|
|
|
604-063-00-0 |
5,6-dihydroxyindole |
3131-52-0 |
Xn; R22, Xi; R41, N; R51-53 |
|
|
|
604-064-00-6 |
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-((hexyl)oxy)-phenol |
147315-50-2 |
R53 |
|
|
|
604-065-00-1 |
4,4',4''-(1-methylpropan-1-yl-3-ylidene)tris(2-cyclohexyl-5-methylphenol) |
111850-25-0 |
N; R51-53 |
|
|
|
604-066-00-7 |
reaction mass of: phenol, 6-(1,1-dimethylethyl)-4-tetrapropyl-2-[(2-hydroxy-5-tetra-propylphenyl)methyl (C41-compound) and methane, 2,2'-bis[6-(1,1-dimethyl-ethyl)-1-hydroxy-4-tetrapropyl-phenyl)]- (C45-compound); 2,6-bis(1,1-dimethylethyl)-4-tetra-propy |
- |
N; R50-53 |
|
|
|
604-067-00-2 |
reaction mass of: 2,2'-[[(2-hydroxyethyl)imino]bis(methylene)bis[4-dodecylphenol]; formaldehyde, oligomer with 4-dodecyl phenol and 2-aminoethanol(n = 2); formaldehyde, oligomer with 4-dodecyl phenol and 2-aminoethanol(n = 3, 4 and higher) |
- |
Xi; R38-41, N; R50-53 |
|
|
|
604-068-00-8 |
(±)-4-[2-[[3-(4-hydroxyphenyl)-1-methylpropyl]amino]-1-hydroxyethyl]phenol hydrochloride |
90274-24-1 |
Xn; R20/22, R43 |
|
|
|
604-069-00-3 |
2-(1-methylpropyl)-4-tert-butylphenol |
51390-14-8 |
C; R34, N; R51-53 |
|
|
|
604-070-00-9 |
triclosan; 2,4,4'-trichloro-2'-hydroxy-diphenyl-ether; 5-chloro-2-(2,4-dichlorophenoxy)phenol |
3380-34-5 |
Xi; R36/38, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
604-071-00-4 |
4,4'-(1-{4-[1-(4-hydroxyphenyl)-1-methylethyl]phenyl}ethylidene)diphenol |
110726-28-8 |
R53 |
|
|
|
604-072-00-X |
1,2-bis(phenoxymethyl)benzene |
10403-74-4 |
N; R50-53 |
|
|
|
604-073-00-5 |
(E)-3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
82413-20-5 |
Carc. Cat. 3; R40, Repr. Cat. 2; R60, R43, N; R50-53 |
|
|
|
604-074-00-0 |
tetrabromobisphenol-A; 2,2',6,6'-tetrabromo-4,4'-isopropylidenediphenol |
79-94-7 |
N; R50-53 |
|
|
|
604-075-00-6 |
4-(1,1,3,3-tetramethylbutyl)phenol; 4-tert-octylphenol |
140-66-9 |
Xi; R38-41, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
604-076-00-1 |
phenolphthalein |
77-09-8 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Repr. Cat. 3; R62 |
C ≥ 1%: Carc. Cat. 2; R45 |
|
|
604-077-00-7 |
2-benzotriazol-2-yl-4-methyl-6-(2-methylallyl)phenol |
98809-58-6 |
R53 |
|
|
|
604-079-00-8 |
4,4'-(1,3-phenylene-bis(1-methylethylidene))bis-phenol |
13595-25-0 |
Repr.Cat.3; R62, R43, N; R51-53 |
|
|
|
604-080-00-3 |
4-fluoro-3-trifluoromethylphenol |
61721-07-1 |
Xn; R20, C; R35, R43, N; R51-53 |
|
|
|
604-081-00-9 |
1,1-bis(4-hydroxyphenyl)-1-phenylethane |
1571-75-1 |
N; R50-53 |
|
|
|
604-082-00-4 |
2-chloro-6-fluoro-phenol |
2040-90-6 |
Muta.Cat.2; R46, Repr.Cat.3; R62, Xn; R22, C; R34, R43, N; R51-53 |
|
E |
|
604-083-00-X |
4,4'-sulfonylbisphenol, polymer with ammonium chloride(NH4Cl), pentachlorophosphorane and phenol |
260408-02-4 |
R53 |
|
|
|
604-084-00-5 |
1-ethoxy-2,3-difluorobenzene |
121219-07-6 |
Xn; R22, R52-53 |
|
|
|
604-087-00-1 |
reaction mass of: 1,2-naphthoquinonediazide-5-sulfonylchloride (or sulfonic acid)monoester with 4,4'-(1-(4-(1-(4-hydroxyphenyl)-1-methylethyl)phenyl)ethylidene)bisphenol; 1,2-naphthoquinonediazide-5-sulfonylchloride (or sulfonic acid)diester with 4,4'-(1 |
- |
F; R17, R44, R53 |
|
|
|
604-089-00-2 |
2-methyl-5-tert-butylthiophenol |
- |
R10, Repr.Cat.3; R63, Xn; R48/20/22-65, Xi; R36/38, R43, R67, N; R50-53 |
|
|
|
604-092-00-9 |
phenol, dodecyl-, branched [1]; phenol, 2-dodecyl-, branched; phenol, 3-dodecyl-, branched; phenol, 4-dodecyl-, branched; phenol, (tetrapropenyl) derivatives [2] |
121158-58-5 [1], 74499-35-7 [2] |
C; R34, N; R50-53 |
N; R50-53: C >= 2,5 %, N; R51-53: 0,25 % <= C < 2,5 %, R52-53: 0,025% <= C < 0,25 % |
|
ATP07 |
605-001-00-5 |
formaldehyde … % |
50-00-0 |
Carc. Cat. 3; R40, T; R23/24/25, C; R34, R43 |
C ≥25 %: T; R23/24/25, 5 % ≤ C < 25 %: Xn; R20/21/22, C ≥25 %: C; R34, 5 % ≤ C < 25 %: Xi; R36/37/38, C ≥ 0,2 %: R43 |
B D |
|
605-002-00-0 |
1,3,5-trioxan; trioxymethylene |
110-88-3 |
F; R11, Repr. Cat. 3; R63, Xi; R37 |
|
|
|
605-003-00-6 |
acetaldehyde; ethanal |
75-07-0 |
F+; R12, Carc. Cat. 3; R40, Xi; R36/37 |
|
|
|
605-004-00-1 |
2,4,6-trimethyl-1,3,5-trioxane; paraldehyde |
123-63-7 |
R10 |
|
|
|
605-005-00-7 |
2,4,6,8-tetramethyl-1,3,5,7-tetraoxacyclooctane; metaldehyde |
108-62-3 |
F; R11, Xn; R22 |
|
|
|
605-006-00-2 |
butyraldehyde |
123-72-8 |
F; R11 |
|
|
|
605-007-00-8 |
1,1-dimethoxyethane; dimethyl acetal |
534-15-6 |
F; R11 |
|
|
|
605-008-00-3 |
acrylaldehyde; acrolein; prop-2-enal |
107-02-8 |
F; R11, T+; R26, T; R24/25, C; R34, N; R50 |
|
D |
|
605-009-00-9 |
crotonaldehyde; 2-butenal; [1] (E)-2-butenal; (E)-crotonaldehyde [2] |
4170-30-3 [1], 123-73-9 [2] |
F; R11, Muta. Cat. 3; R68, T+; R26, T; R24/25, Xn; R48/22, Xi; R37/38-41, N; R50 |
|
|
|
605-010-00-4 |
2-furaldehyde |
98-01-1 |
Carc. Cat. 3; R40, T; R23/25, Xn; R21, Xi; R36/37/38 |
|
|
|
605-011-00-X |
2-chlorobenzaldehyde; o-chlorobenzaldehyde |
89-98-5 |
C; R34 |
|
|
|
605-012-00-5 |
benzaldehyde |
100-52-7 |
Xn; R22 |
|
|
|
605-013-00-0 |
chloralose (INN); (R)-1,2-O-(2,2,2-trichloroethylidene)-α-D-glucofuranose; glucochloralose; anhydroglucochloral |
15879-93-3 |
Xn; R20/22 |
|
|
|
605-014-00-6 |
chloral hydrate; 2,2,2-trichloroethane-1,1-diol |
302-17-0 |
T; R25, Xi; R36/38 |
|
|
|
605-015-00-1 |
1,1-diethoxyethane; acetal |
105-57-7 |
F; R11, Xi; R36/38 |
C ≥ 10 %: Xi; R36/38 |
|
|
605-016-00-7 |
glyoxal … %; ethandial … % |
107-22-2 |
Muta. Cat. 3; R68, Xn; R20, Xi; R36/38, R43 |
C ≥ 10 %: Xn; R20, C ≥ 10 %: Xi; R36/38 |
B |
|
605-017-00-2 |
1,3-dioxolane |
646-06-0 |
F; R11 |
|
|
|
605-018-00-8 |
propanal; propionaldehyde |
123-38-6 |
F; R11, Xi; R36/37/38 |
|
|
|
605-019-00-3 |
citral |
5392-40-5 |
Xi; R38, R43 |
|
|
|
605-020-00-9 |
safrole; 5-allyl-1,3-benzodioxole |
94-59-7 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Xn; R22 |
|
E |
|
605-021-00-4 |
formaldehyde, reaction products with butylphenol |
91673-30-2 |
R43 |
|
|
|
605-022-00-X |
glutaral; glutaraldehyde; 1,5-pentanedial |
111-30-8 |
T; R23/25, C; R34, R42/43, N; R50 |
C ≥ 50 %: T; R25, 2 % ≤ C < 50 %: Xn; R22, C ≥ 25 %: T; R23, 2 % ≤ C < 25 %: Xn; R20, C ≥ 10 %: C; R34, 2 % ≤ C < 10 %: Xi; R37/38-41, 0,5 % ≤ C < 2 %: Xi; R36/37/38, C ≥ 0,5 %: R43 |
|
|
605-023-00-5 |
5-chloro-2-(4-chlorophenoxy)phenol |
3380-30-1 |
Xi; R41, N; R50-53 |
|
|
|
605-024-00-0 |
2-bromo-5-hydroxy-4-methoxybenzaldehyde |
2973-59-3 |
R43, N; R51-53 |
|
|
|
605-025-00-6 |
chloroacetaldehyde |
107-20-0 |
Carc. Cat. 3; R40, T+; R26, T; R24/25, C; R34, N; R50 |
|
|
|
605-026-00-1 |
2,5,7,7-tetramethyloctanal |
114119-97-0 |
Xi; R38, R43, N; R51-53 |
|
|
|
605-027-00-7 |
reaction mass of: 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indene-6-carboxaldehyde; 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indene-5-carboxaldehyde |
- |
R43, N; R51-53 |
|
|
|
605-028-00-2 |
β-methyl-3-(1-methylethyl)-benzenepropanal |
125109-85-5 |
N; R51-53 |
|
|
|
605-029-00-8 |
2-cyclohexylpropanal |
2109-22-0 |
R43, N; R51-53 |
|
|
|
605-030-00-3 |
1-(p-methoxyphenyl)acetaldehyde oxime |
3353-51-3 |
R43 |
|
|
|
605-031-00-9 |
reaction mass of: 2,2-dimethoxyethanal [(this component is considered to be anhydrous in terms of identity, structure and composition. However, 2,2-dimethoxyethanal will exist in a hydrated form. 60 % anhydrous is equivalent to 70.4 % hydrate; water(Incl |
- |
R43 |
|
|
|
605-032-00-4 |
3-[3-(4-fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl]-(E)-2-propenal |
93957-50-7 |
R43, N; R50-53 |
|
|
|
605-033-00-X |
reaction mass of: 3,7,11-trimethyl-cis-6,10-dodecadienal; 3,7,11-trimethyl-trans-6,10-dodecadienal |
32480-08-3 |
Xi; R38, N; R50-53 |
|
|
|
605-034-00-5 |
reaction mass of: (1RS,2RS,3SR,6RS,9SR)-9-methoxytricyclo[5.2.1.0(2,6)]decane-3-carbaldehyde; (1RS,2RS,3RS,6RS,8SR)-8-methoxytricyclo[5.2.1.0(2,6)]decane-3-carbaldehyde; (1RS,2RS,4SR,6RS,8SR)-8-methoxytricyclo[5.2.1.0(2,6)]decane-4-carbaldehyde |
- |
R43, N; R51-53 |
|
|
|
605-035-00-0 |
(E)-3-(4-(4-fluorophenyl)-5-methoxymethyl-2,6-bis(1-methoxymethyl)pyridin-3-yl)prop-2-enal |
177964-68-0 |
Xi; R36, R43, R53 |
|
|
|
605-036-00-6 |
2-bromomalonaldehyde |
2065-75-0 |
Xn; R22, Xi; R41 |
|
|
|
605-037-00-1 |
trans-3-[2-(7-chloro-2-quinolinyl)vinyl]benzaldehyde; 3-[(E)-2-(7-chloro-2-quinolinyl)vinyl]benzaldehyde |
120578-03-2 |
R53 |
|
|
|
605-038-00-7 |
3-methyl-5-phenylpentan-1-al |
55066-49-4 |
Xn; R22, Xi; R38, R43, N; R51-53 |
|
|
|
605-039-00-2 |
3,4-dihydroxy-5-nitrobenzaldehyde |
116313-85-0 |
Xn; R22, Xi; R41, R43 |
|
|
|
606-001-00-8 |
acetone; propan-2-one; propanone |
67-64-1 |
F; R11, Xi; R36, R66, R67 |
|
|
|
606-002-00-3 |
butanone; ethyl methyl ketone |
78-93-3 |
F; R11, Xi; R36, R66, R67 |
|
|
|
606-003-00-9 |
heptan-3-one; butyl ethyl ketone |
106-35-4 |
R10, Xn; R20, Xi; R36 |
|
|
|
606-004-00-4 |
4-methylpentan-2-one; isobutyl methyl ketone |
108-10-1 |
F; R11, Xn; R20, Xi; R36/37, R66 |
|
|
|
606-005-00-X |
2,6-dimethylheptan-4-one; di-isobutyl ketone |
108-83-8 |
R10, Xi; R37 |
C ≥ 10 %: Xi; R37 |
|
|
606-006-00-5 |
pentan-3-one; diethyl ketone |
96-22-0 |
F; R11, Xi; R37, R66, R67 |
|
|
|
606-007-00-0 |
3-methylbutan-2-one; methyl isopropyl ketone |
563-80-4 |
F; R11 |
|
|
|
606-009-00-1 |
4-methylpent-3-en-2-one; mesityl oxide |
141-79-7 |
R10, Xn; R20/21/22 |
C ≥ 5 %: Xn; R20/21/22 |
|
|
606-010-00-7 |
cyclohexanone |
108-94-1 |
R10, Xn; R20 |
|
|
|
606-011-00-2 |
2-methylcyclohexanone |
583-60-8 |
R10, Xn; R20 |
|
|
|
606-012-00-8 |
3,5,5-trimethylcyclohex-2-enone; isophorone |
78-59-1 |
Carc. Cat. 3; R40, Xn; R21/22, Xi; R36/37 |
C ≥ 10 %: Xi; R36/37 |
|
|
606-013-00-3 |
p-benzoquinone; quinone |
106-51-4 |
T; R23/25, Xi; R36/37/38, N; R50 |
C ≥ 2,5 %: N; R50 |
|
|
606-014-00-9 |
chlorophacinone (ISO); 2-(2-(4-chlorophenyl)phenylacetyl)indan-1,3-dione |
3691-35-8 |
T+; R27/28, T; R23-48/24/25, N; R50-53 |
|
|
|
606-016-00-X |
pindone (ISO); 2-pivaloylindan-1,3-dione |
83-26-1 |
T; R25-48/25, N; R50-53 |
|
|
|
606-017-00-5 |
diketene; diketen |
674-82-8 |
R10, Xn; R20 |
|
D |
|
606-018-00-0 |
dichlone (ISO); 2,3-dichloro-1,4-naphthoquinone |
117-80-6 |
Xn; R22, Xi; R36/38, N; R50-53 |
|
|
|
606-019-00-6 |
chlordecone (ISO); perchloropentacyclo[5,3,0,02,6,03,9,04,8]decan-5-one; decachloropentacyclo[5,2,1,02,6,03,9,05,8]decan-4-one |
143-50-0 |
Carc. Cat. 3; R40, T; R24/25, N; R50-53 |
|
|
|
606-020-00-1 |
5-methylheptan-3-one |
541-85-5 |
R10, Xi; R36/37 |
C ≥ 10 %: Xi; R36/37 |
|
|
606-021-00-7 |
N-methyl-2-pyrrolidone; 1-methyl-2-pyrrolidone |
872-50-4 |
Repr. Cat. 2; R61, Xi; R36/37/38 |
C ≥ 5 %: Repr. Cat. 2; R61, C ≥ 10 %: Xi; R36/37/38 |
|
|
606-022-00-2 |
1-phenyl-3-pyrazolidone |
92-43-3 |
Xn; R22, N; R51-53 |
|
|
|
606-023-00-8 |
4-methoxy-4-methylpentan-2-one |
107-70-0 |
R10, Xn; R20 |
|
|
|
606-024-00-3 |
heptan-2-one; methyl amyl ketone |
110-43-0 |
R10, Xn; R20/22 |
|
|
|
606-025-00-9 |
cyclopentanone |
120-92-3 |
R10, Xi; R36/38 |
|
|
|
606-026-00-4 |
5-methylhexan-2-one; isoamyl methyl ketone |
110-12-3 |
R10, Xn; R20 |
|
|
|
606-027-00-X |
heptan-4-one; di-n-propyl ketone |
123-19-3 |
R10, Xn; R20 |
|
|
|
606-028-00-5 |
2,4-dimethylpentan-3-one; di-isopropyl ketone |
565-80-0 |
F; R11, Xn; R20 |
|
|
|
606-029-00-0 |
pentane-2,4-dione; acetylacetone |
123-54-6 |
R10, Xn; R22 |
|
|
|
606-030-00-6 |
hexan-2-one; methyl butyl ketone; butyl methyl ketone; methyl-n-butyl ketone |
591-78-6 |
R10, Repr. Cat. 3; R62, T; R48/23, R67 |
|
|
|
606-031-00-1 |
3-propanolide; 1,3-propiolactone |
57-57-8 |
Carc. Cat. 2; R45, T+; R26, Xi; R36/38 |
|
E |
|
606-032-00-7 |
hexachloroacetone |
116-16-5 |
Xn; R22, N; R51-53 |
|
|
|
606-033-00-2 |
2-(3,4-dichlorophenyl)-4-methyl-1,2,4-oxadiazolidinedione; methazole |
20354-26-1 |
Xn; R21/22, Xi; R36/38, N; R51-53 |
|
|
|
606-034-00-8 |
metribuzin (ISO); 4-amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5(4H)-one; 4-amino-4,5-dihydro-6-(1,1-dimethylethyl)-3-methylthio-1,2,4-triazin-5-one |
21087-64-9 |
Xn; R22, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
606-035-00-3 |
chloridazon (ISO); 5-amino-4-chloro-2-phenylpyridazine-3-(2H)-one; pyrazon |
1698-60-8 |
R43, N; R50-53 |
|
|
|
606-036-00-9 |
quinomethionate; chinomethionat (ISO); 6-methyl-1,3-dithiolo(4,5-b)quinoxalin-2-one |
2439-01-2 |
Repr. Cat. 3; R62, Xn; R20/21/22-48/22, Xi; R36, R43, N; R50-53 |
|
|
|
606-037-00-4 |
triadimefon (ISO); 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butanone |
43121-43-3 |
Xn; R22, R43, N; R51-53 |
|
|
|
606-038-00-X |
diphacinone (ISO); 2-diphenylacetylindan-1,3-dione |
82-66-6 |
T+; R28, T; R48/23/24/25 |
|
|
|
606-039-00-5 |
5(or 6)-tert-butyl-2'-chloro-6'-ethylamino-3',7'-dimethylspiro(isobenzofuran-1(1H),9'-xanthene)-3-one |
- |
Xn; R20, N; R50-53 |
|
|
|
606-040-00-0 |
(N-benzyl-N-ethyl)amino-3-hydroxyacetophenone hydrochloride |
55845-90-4 |
Xi; R41, N; R51-53 |
|
|
|
606-041-00-6 |
2-methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-one |
71868-10-5 |
Xn; R22, N; R51-53 |
|
|
|
606-042-00-1 |
acetophenone |
98-86-2 |
Xn; R22, Xi; R36 |
|
|
|
606-043-00-7 |
2,4-di-tert-butylcyclohexanone |
13019-04-0 |
Xi; R38, N; R51-53 |
|
|
|
606-044-00-2 |
2,4,6-trimethylbenzophenone |
954-16-5 |
Xn; R22, Xi; R36, N; R50-53 |
|
|
|
606-045-00-8 |
oxadiazon (ISO); 3-[2,4-dichloro-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one |
19666-30-9 |
N; R50-53 |
|
|
|
606-046-00-3 |
reaction mass of cis- and trans-cyclohexadec-8-en-1-one |
3100-36-5 |
N; R50-53 |
|
|
|
606-047-00-9 |
2-benzyl-2-dimethylamino-4-morpholinobutyrophenone |
119313-12-1 |
N; R50-53 |
|
|
|
606-048-00-4 |
2'-anilino-3'-methyl-6'-dipentylaminospiro(isobenzofuran-1(1H),9'-xanthen)-3-one |
- |
R53 |
|
|
|
606-049-00-X |
4-(trans-4-propylcyclohexyl)acetophenone |
78531-61-0 |
R43, R53 |
|
|
|
606-050-00-5 |
6-anilino-1-benzoyl-4-(4-tert-pentylphenoxy)naphto[1,2,3-de]quinoline-2,7-(3H)-dione |
72453-58-8 |
N; R51-53 |
|
|
|
606-051-00-0 |
4-pentylcyclohexanone |
61203-83-6 |
N; R51-53 |
|
|
|
606-052-00-6 |
4-(N,N-dibutylamino)-2-hydroxy-2'-carboxybenzophenone |
54574-82-2 |
R52-53 |
|
|
|
606-053-00-1 |
flurtamone (ISO); (RS)-5-methylamino-2-phenyl-4-(α, α,α-trifluoro-m-tolyl)furan-3(2H)-one |
96525-23-4 |
N; R50-53 |
|
|
|
606-054-00-7 |
isoxaflutole (ISO); 5-cyclopropyl-1,2-oxazol-4-yl α, α,α-trifluoro-2-mesyl-p-tolyl ketone |
141112-29-0 |
Repr. Cat. 3; R63, N; R50-53 |
N; R50-53: C >= 2,5 %, N; R51-53: 0,25 % <= C < 2,5 %, R52-53: 0,025 % <= C < 0,25 % |
|
ATP07 |
606-055-00-2 |
1-(2,3-dihydro-1,3,3,6-tetramethyl-1-(1-methylethyl)-1H-inden-5-yl)ethanone |
92836-10-7 |
Xn; R22-48/22, N; R51-53 |
|
|
|
606-056-00-8 |
4-chloro-3',4'-dimethoxybenzophenone |
116412-83-0 |
N; R50-53 |
|
|
|
606-057-00-3 |
4-propylcyclohexanone |
40649-36-3 |
Xi; R38, R52-53 |
|
|
|
606-058-00-9 |
4'-fluoro-2,2-dimethoxyacetophenone |
21983-80-2 |
R43, R52-53 |
|
|
|
606-059-00-4 |
2,4-difluoro-α-(1H-1,2,4-triazol-1-yl)acetophenone hydrochloride |
86386-75-6 |
Xn; R22, Xi; R41, R43 |
|
|
|
606-060-00-X |
reaction mass of: trans-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-naphthalene-2-yl)-1,3-dioxolane; cis-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-naphthalene-2-yl)-1,3-dioxolane |
- |
N; R50-53 |
|
|
|
606-061-00-5 |
(3-chlorophenyl)-(4-methoxy-3-nitrophenyl)methanone |
66938-41-8 |
Muta. Cat. 3; R68, N; R50-53 |
|
|
|
606-062-00-0 |
tetrahydrothiopyran-3-carboxaldehyde |
61571-06-0 |
Repr. Cat. 2; R61, Xi; R41, R52-53 |
|
|
|
606-063-00-6 |
(E)-3-(2-chlorophenyl)-2-(4-fluorophenyl)propenal |
112704-51-5 |
Xi; R36, R43 |
|
|
|
606-064-00-1 |
pregn-5-ene-3,20-dione bis(ethylene ketal) |
7093-55-2 |
R53 |
|
|
|
606-065-00-7 |
1-(4-morpholinophenyl)butan-1-one |
- |
N; R51-53 |
|
|
|
606-066-00-2 |
(E)-5[(4-chlorophenyl)methylene]-2,2-dimethylcyclopentanone |
164058-20-2 |
N; R51-53 |
|
|
|
606-067-00-8 |
reaction mass of: 1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-4-yl)ethanone; 1-(2,3,5,6,7,8-hexahydro-1,1-dimethyl-1H-benz(f)inden-4-yl)ethanone; 1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-5-yl)ethanone; 1-(2,3,6,7,8,9-hexahydro-3, |
96792-67-5 |
N; R50-53 |
|
|
|
606-068-00-3 |
2,7,11-trimethyl-13-(2,6,6-trimethylcyclohex-1-en-1-yl)tridecahexaen-2,4,6,8,10,12-al |
1638-05-7 |
Xn; R48/22, R43, R52-53 |
|
|
|
606-069-00-9 |
spiro[1,3-dioxolane-2,5'-(4',4',8',8'-tetramethyl-hexahydro-3',9'-methanonaphthalene)] |
154171-76-3 |
N; R51-53 |
|
|
|
606-070-00-4 |
butroxydim (ISO); 5-(3-butyryl-2,4,6-trimethylphenyl)-2-[1-(ethoxyimino)propyl]-3-hydroxycyclohex-2-en-1-one |
138164-12-2 |
Repr. Cat. 3; R62-63, Xn; R22, Xi; R38, N; R50-53 |
|
|
|
606-071-00-X |
17-spiro(5,5-dimethyl-1,3-dioxan-2-yl)androsta-1,4-diene-3-one |
13258-43-0 |
N; R50-53 |
|
|
|
606-072-00-5 |
3-acetyl-1-phenyl-pyrrolidine-2,4-dione |
719-86-8 |
Xn; R48/22, N; R51-53 |
|
|
|
606-073-00-0 |
4,4'-bis(dimethylamino)benzophenone; Michler's ketone |
90-94-8 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Xi; R41 |
|
|
|
606-074-00-6 |
reaction mass of: (1R*,2S*)-2-acetyl-1,2,3,4,5,6,7,8-octahydro-1,2,8,8-tetramethylnaphthalene; (2R*,3S*)-2-acetyl-1,2,3,4,5,6,7,8-octahydro-2,3,8,8-tetramethylnaphthalene |
- |
N; R50-53 |
|
|
|
606-075-00-1 |
1-benzyl-5-ethoxyimidazolidine-2,4-dione |
65855-02-9 |
Xn; R22 |
|
|
|
606-076-00-7 |
1-((2-quinolinyl-carbonyl)oxy)-2,5-pyrrolidinedione |
136465-99-1 |
Xi; R41, R43 |
|
|
|
606-077-00-2 |
(3S,4S)-3-hexyl-4-[(R)-2-hydroxytridecyl]-2-oxetanone |
104872-06-2 |
N; R50-53 |
|
|
|
606-078-00-8 |
1-octylazepin-2-one |
59227-88-2 |
C; R34, R43, N; R51-53 |
|
|
|
606-079-00-3 |
2-n-butyl-benzo[d]isothiazol-3-one |
4299-07-4 |
C; R34, R43, N; R50-53 |
|
|
|
606-081-00-4 |
(3β, 5α, 6β)-3-(acetyloxy)-5-bromo-6-hydroxy-androstan-17-one |
4229-69-0 |
R43, R52-53 |
|
|
|
606-082-00-X |
reaction mass of: butan-2-one oxime; syn-O,O'-di(butan-2-one oxime)diethoxysilane |
- |
T; R48/25, R43, R52-53 |
|
|
|
606-083-00-5 |
2-chloro-5-sec-hexadecylhydroquinone |
137193-60-3 |
Xi; R36/38, R43, R52-53 |
|
|
|
606-084-00-0 |
1-(4-methoxy-5-benzofuranyl)-3-phenyl-1,3-propanedione |
484-33-3 |
N; R50-53 |
|
|
|
606-085-00-6 |
(1R,4S)-2-azabicyclo[2.2.1]hept-5-en-3-one |
79200-56-9 |
Xn; R22, Xi; R41, R43 |
|
|
|
606-086-00-1 |
1-(3,3-dimethylcyclohexyl)pent-4-en-1-one |
56973-87-6 |
N; R51-53 |
|
|
|
606-087-00-7 |
6-ethyl-5-fluoro-4(3H)-pyrimidone |
137234-87-8 |
Xn; R22, N; R50-53 |
|
|
|
606-088-00-2 |
2,4,4,7-tetramethyl-6-octen-3-one |
74338-72-0 |
Xi; R38, N; R51-53 |
|
|
|
606-089-00-8 |
reaction mass of: 1,4-diamino-2-chloro-3-phenoxyanthraquinone; 1,4-diamino-2,3-bis-phenoxyanthraquinone |
12223-77-7 |
R53 |
|
|
|
606-090-00-3 |
1-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]ethanone |
73096-98-7 |
Xn; R22, Xi; R41, R52-53 |
|
|
|
606-091-00-9 |
6-chloro-5-(2-chloroethyl)-1,3-dihydroindol-2-one |
118289-55-7 |
N; R50-53 |
|
|
|
606-092-00-4 |
reaction mass of: (E)-oxacyclohexadec-12-en-2-one; (E)-oxacyclohexadec-13-en-2-one; a) (Z)-oxacyclohexadec-(12)-en-2-one and b) (Z)-oxacyclohexadec-(13)-en-2-one |
- |
N; R50-53 |
|
|
|
606-093-00-X |
5-ethyl-2,4-dihydro-4-(2-phenoxyethyl)-3H-1,2,4-triazol-3-one |
95885-13-5 |
Xn; R22, R52-53 |
|
|
|
606-094-00-5 |
N-[ethyl(3-methylbutyl)amino]-3-methyl-1-phenyl-spiro[[1]benzo-pyrano[2,3-c]pyrazole-4(1H),1'(3'H)-isobenzofuran]-3'-one |
- |
R53 |
|
|
|
606-095-00-0 |
(R,S)-2-azabicyclo[2.2.1]hept-5-en-3-one |
49805-30-3 |
Xn; R22, R43 |
|
|
|
606-096-00-6 |
3-(6-O-(6-desoxy-α-l-mannopyranosyl-O-(α-d-glucopyranosyl)-(β-d-glucopyranosyl)oxy)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one |
130603-71-3 |
R43, N; R51-53 |
|
|
|
606-097-00-1 |
2,2''-dihydroxy-4,4''-(2-hydroxy-propane-1,3-diyldioxy)dibenzophenone |
23911-85-5 |
R53 |
|
|
|
606-098-00-7 |
1-benzyl-5-(hexadecyloxy)-2,4-imidazolidinedione |
158574-65-3 |
R53 |
|
|
|
606-099-00-2 |
5-methoxy-4'-(trifluoromethyl)valerophenone |
61718-80-7 |
N; R51-53 |
|
|
|
606-100-00-6 |
2-butyryl-3-hydroxy-5-thiocyclohexan-3-yl-cyclohex-2-en-1-one |
94723-86-1 |
Repr.Cat.2; R60, Xn; R22, R43, R52-53 |
|
E |
|
606-101-00-1 |
reaction mass of: 1,5-bis[(2-ethylhexyl)amino]-9,10-anthracenedione; 1-[(2-ethylhexyl)amino]-5-[3-[(2-ethylhexyl)oxy]propyl]amino-9,10-anthracenedione; 1,5-bis[3-[(2-ethylhexyl)oxy]propyl]amino-9,10-anthracenedione; 1-[(2-ethylhexyl)amino]-5-[(3-methox |
165038-51-7 |
N; R50-53 |
|
|
|
606-102-00-7 |
4-(3-triethoxysilylpropoxy)-2-hydroxybenzophenone |
79876-59-8 |
N; R51-53 |
|
|
|
606-103-00-2 |
1-(4-(trans-4-ethylcyclohexyl)phenyl)ethanone |
- |
R43 |
|
|
|
606-104-00-8 |
1-(4-(trans-4-pentylcyclohexyl)phenyl)ethanone |
78531-59-6 |
R43, R53 |
|
|
|
606-105-00-3 |
3,4,3',4'-tetraphenyl-1,1'-ethandiylbispyrol-2,5-dione |
226065-73-2 |
R43, R53 |
|
|
|
606-106-00-9 |
1-(4-(trans-4-butylcyclohexyl)phenyl)ethanone |
83626-30-6 |
R43, R53 |
|
|
|
606-107-00-4 |
8-azaspiro[4.5]decane-7,9-dione |
1075-89-4 |
T; R25, N; R51-53 |
|
|
|
606-108-00-X |
1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl )-3-pentanone |
756-13-8 |
R52-53 |
|
|
|
606-109-00-5 |
2-(4-methyl-3-pentenyl)anthraquinone |
71308-16-2 |
Xn; R22, R43, R53 |
|
|
|
606-110-00-0 |
5-ethoxy-5H-furan-2-one |
2833-30-9 |
C; R34, Xn; R21/22-48/22, R43 |
|
|
|
606-111-00-6 |
5-amino-6-methyl-1,3-dihydrobenzoimidazol-2-one |
67014-36-2 |
Xn; R22, R43, N; R51-53 |
|
|
|
606-112-00-1 |
(4aR*,8aR*)-4a,5,9,10,11,12-hexahydro-3-methoxy-11-methyl-6H-benzofuro[3a,3,2-ef][2]benzazepin-6-one |
1668-86-6 |
Xn; R22, Xi; R36, R52-53 |
|
|
|
606-113-00-7 |
1-[4-(4-benzoylphenylsulfanyl)phenyl]-2-methyl-2-(4-methylphenylsulfonyl)propan-1-one |
272460-97-6 |
Xi; R41, R53 |
|
|
|
606-114-00-2 |
4,4',5,5',6,6',7,7'-octachloro-(2,2')biisoindolyl-1,1',3,3'-tetraone |
67887-47-2 |
R53 |
|
|
|
606-115-00-8 |
profoxydim (ISO); 2-{(EZ)-1-[(2RS)-2-(4-chlorophenoxy)propoxyimino]butyl}-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one |
139001-49-3 |
Carc. Cat. 3; R40, Repr. Cat. 3; R63, R43 |
|
|
|
606-116-00-3 |
tepraloxydim (ISO); (RS)-(EZ)-2-{1-[(2E)-3-chloroallyloxyimino]propyl}-3-hydroxy-5-perhydropyran-4-ylcyclohex-2-en-1-one |
149979-41-9 |
Carc. Cat. 3; R40, Repr. Cat. 3; R62-63 |
|
|
|
606-117-00-9 |
2,6-bis(1,1-dimethylethyl)-4-(phenylenemethylene)cyclohexa-2,5-dien-1-one |
7078-98-0 |
R43, R53 |
|
|
|
606-118-00-4 |
N-(1,3-dimethylbutyl)-N'-(phenyl)-1,4-benzoquinonediimine |
52870-46-9 |
Xi; R36, N; R50-53 |
|
|
|
606-119-00-X |
(E)-3-methyl-5-cyclopentadecen-1-one |
- |
R43, N; R50-53 |
|
|
|
606-120-00-5 |
2,5-dihydroxy-5-methyl-3-(morpholin-4-yl)-2-cyclopenten-1-one |
114625-74-0 |
Xn; R22, R52-53 |
|
|
|
606-121-00-0 |
(+)-(1S,2S,3S,5R)-2,6,6-trimethylbicyclo[3.1.1]heptane-3-spiro-1'-(cyclohex-2'-en-4'-one) |
133636-82-5 |
C; R34, R43, N; R50-53 |
|
|
|
606-122-00-6 |
3-(2-bromopropionoyl)-4,4-dimethyl-1,3-oxazolan-2-one |
114341-88-7 |
Xn; R22-48/22, Xi; R38-41, R43, N; R50-53 |
|
|
|
606-123-00-1 |
4-hexadecyl-1-phenylpyrazolidin-3-one |
- |
R43, R53 |
|
|
|
606-124-00-7 |
1-cyclopropyl-3-(2-methylthio-4-trifluoromethylphenyl)-1,3-propanedione |
161462-35-7 |
Xn; R48/22, N; R50-53 |
|
|
|
606-125-00-2 |
1-benzylimidazolidine-2,4-dione |
6777-05-5 |
Xn; R22 |
|
|
|
606-126-00-8 |
1,4-bis(2,3-dihydroxypropylamino)anthraquinone |
99788-75-7 |
N; R51-53 |
|
|
|
606-128-00-9 |
2,2'-(1,3-phenylene)bis[5-chloro-1H-isoindole]-1,3(2H)-dione |
148935-94-8 |
R53 |
|
|
|
606-129-00-4 |
5-amino-[2S-di(methylphenyl)amino]-1,6-diphenyl-4Z-hexen-3-one; (2S,4Z)-5-amino-2-(dibenzylamino)-1,6-diphenylhex-4-en-3-one |
156732-13-7 |
R53 |
|
|
|
606-130-00-X |
4-(1,4-dioxa-spiro[4.5]dec-8-yl)-cyclohexanone |
56309-94-5 |
R43, R52-53 |
|
|
|
606-131-00-5 |
cyclic 3-(1,2-ethanediylacetale)-estra-5(10),9(11)-diene-3,17-dione |
5571-36-8 |
Repr. Cat. 2; R60, Xn; R48/22, N; R51-53 |
|
E |
|
606-132-00-0 |
(6β)-6,19-epoxyandrost-4-ene-3,17-dione |
6563-83-3 |
R43, R52-53 |
|
|
|
606-134-00-1 |
androsta-1,4,9(11)-triene-3,17-dione |
15375-21-0 |
Repr. Cat.3; R62 |
|
|
|
606-135-00-7 |
cyclohexadecanone |
2550-52-9 |
R53 |
|
|
|
606-136-00-2 |
(3S,6R,9S,12R,15S,18R,21S,24R)-6,18-dibenzyl-3,9,15,21-tetraisobutyl-4,10,12,16,22,24-hexamethyl-1,7,13,19-tetraoxa-4,10,16,22-tetraazacyclo-tetracosane-2,5,8,11,14,17,20,23-octaone |
133413-70-4 |
Xi; R36, R53 |
|
|
|
606-137-00-8 |
trans-7,7'-dimethyl-(4H,4H')-(2,2')bi[benzo[1,4]thiazinylidene]-3,3'-dione |
211387-26-7 |
R53 |
|
|
|
606-138-00-3 |
(2-butyl-5-nitrobenzofuran-3-yl)[4-(3-dibutylaminopropoxy)phenyl]methanone |
141645-23-0 |
R10, Xn; R22-48/22, Xi; R38-41, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %3: R52-53 |
|
|
606-139-00-9 |
(S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one |
124379-29-9 |
R53 |
|
|
|
606-140-00-4 |
2-hydroxy-1-(4-(4-(2-hydroxy-2-methylpropionyl)benzyl)phenyl)-2-methylpropan-1-one |
474510-57-1 |
Xn; R48/22, N; R50-53 |
|
|
|
606-141-00-X |
sodium 3-(methoxycarbonyl)-4-oxo-3,4,5,6-tetrahydro-2-pyridinolate |
- |
Xi; R36 |
|
|
|
606-142-00-5 |
reaction mass of: (1RS,2SR,7SR,8SR,E) 9 and 10-ethylidene-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-one; (1RS,2SR,7SR,8SR,Z)-10-ethylidene-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-one; (1RS,2SR,7SR,8SR,Z)-9-ethylidene-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-one |
- |
Xn; R22, N; R51-53 |
|
|
|
606-148-00-8 |
carvone (ISO); 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one; [1], d-carvone; (5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one; [2] l-carvone;(5R)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one [3] |
99-49-0 [1], 2244-16-8 [2], 6485-40-1 [3] |
R43 |
|
|
ATP07 |
606-149-00-3 |
tembotrione (ISO); 2-{2-chloro-4-(methylsulfonyl)-3-[(2,2,2-trifluoroethoxy)methyl]benzoyl} cyclohexane-1,3-dione |
335104-84-2 |
Repr. Cat. 3; R63, Xn; R48/22, R43, N; R50-53 |
N; R50-53: C >= 0,25 %, N; R51-53: 0,025 % <= C < 0,25 %, R52-53: 0,0025 % <= C < 0,025 % |
|
ATP07 |
607-001-00-0 |
formic acid … % |
64-18-6 |
C; R35 |
C ≥ 90 %: C; R35, 10 % ≤ C < 90 %: C; R34, 2 % ≤ C < 10 %: Xi; R36/38 |
B |
|
607-002-00-6 |
acetic acid … % |
64-19-7 |
R10, C; R35 |
C ≥ 90 %: C; R35, 25 % ≤ C < 90 %: C; R34, 10 % ≤ C < 25 %: Xi; R36/38 |
B |
|
607-003-00-1 |
chloroacetic acid |
79-11-8 |
T; R23/24/25, C; R34, N; R50 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xn; 36/37/38 |
|
|
607-004-00-7 |
TCA (ISO); trichloroacetic acid |
76-03-9 |
C; R35, N; R50-53 |
C ≥ 10 %: C; R35, 5 % ≤ C < 10 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/37/38 |
|
|
607-005-00-2 |
TCA-sodium (ISO); sodium trichloroacetate |
650-51-1 |
Xi; R37, N; R50-53 |
|
|
|
607-006-00-8 |
oxalic acid |
144-62-7 |
Xn; R21/22 |
C ≥ 5 %: Xn; R21/22 |
|
|
607-007-00-3 |
salts of oxalic acid with the exception of those specified elsewhere in this Annex |
- |
Xn; R21/22 |
C ≥ 5 %: Xn; R21/22 |
A |
|
607-008-00-9 |
acetic anhydride |
108-24-7 |
R10, Xn; R20/22, C; R34 |
C ≥ 25 %: C; R34, 5 % ≤ C < 25 %: Xi; R37/38-41, 1 % ≤ C < 5 %: Xi; R36 |
|
|
607-009-00-4 |
phthalic anhydride |
85-44-9 |
Xn; R22, Xi; R37/38-41, R42/43 |
|
|
|
607-010-00-X |
propionic anhydride |
123-62-6 |
C; R34 |
C ≥ 25 %: C; R34, 10 % ≤ C < 25 %: Xi; R36/38 |
|
|
607-011-00-5 |
acetyl chloride |
75-36-5 |
F; R11, R14, C; R34 |
|
|
|
607-012-00-0 |
benzoyl chloride |
98-88-4 |
Xn; R20/21/22, C; R34, R43 |
|
|
|
607-013-00-6 |
dimethyl carbonate |
616-38-6 |
F; R11 |
|
|
|
607-014-00-1 |
methyl formate |
107-31-3 |
F+; R12, Xn; R20/22, Xi; R36/37 |
|
|
|
607-015-00-7 |
ethyl formate |
109-94-4 |
F; R11, Xn; R20/22, Xi; R36/37 |
|
|
|
607-016-00-2 |
propyl formate; [1] isopropyl formate [2] |
110-74-7 [1], 625-55-8 [2] |
F; R11, Xi; R36/37, R67 |
|
C |
|
607-017-00-8 |
butyl formate; [1] tert-butyl formate; [2] isobutyl formate [3] |
592-84-7 [1], 762-75-4 [2], 542-55-2 [3] |
F; R11, Xi; R36/37 |
|
C |
|
607-018-00-3 |
isopentyl formate; [1] pentyl formate; 2-methylbutyl formate |
110-45-2 [1], 35073-27-9 [2], - |
R10, Xi; R36/37 |
|
C |
|
607-019-00-9 |
methyl chloroformate |
79-22-1 |
F; R11, T+; R26, Xn; R21/22, C; R34 |
|
|
|
607-020-00-4 |
ethyl chloroformate |
541-41-3 |
F; R11, T+; R26, Xn; R22, C; R34 |
|
|
|
607-021-00-X |
methyl acetate |
79-20-9 |
F; R11, Xi; R36, R66, R67 |
|
|
|
607-022-00-5 |
ethyl acetate |
141-78-6 |
F; R11, Xi; R36, R66, R67 |
|
|
|
607-023-00-0 |
vinyl acetate |
108-05-4 |
F; R11 |
|
D |
|
607-024-00-6 |
propyl acetate; [1] isopropyl acetate [2] |
109-60-4 [1], 108-21-4 [2] |
F; R11, Xi; R36, R66, R67 |
|
C |
|
607-025-00-1 |
n-butyl acetate |
123-86-4 |
R10, R66, R67 |
|
|
|
607-026-00-7 |
sec-butyl acetate; [1] isobutyl acetate; [2] tert-butyl acetate [3] |
105-46-4 [1], 110-19-0 [2], 540-88-5 [3] |
F; R11, R66 |
|
C |
|
607-027-00-2 |
methyl propionate |
554-12-1 |
F; R11, Xn; R20 |
|
|
|
607-028-00-8 |
ethyl propionate |
105-37-3 |
F; R11 |
|
|
|
607-029-00-3 |
n-butyl propionate; [1] sec-butyl propionate; [2] tert-butyl propionate; iso-butyl propionate |
590-01-2 [1], 591-34-4 [2], 540-42-1 [3], - |
R10 |
|
C |
|
607-030-00-9 |
propyl propionate |
106-36-5 |
R10, Xn; R20 |
|
|
|
607-031-00-4 |
butyl butyrate |
109-21-7 |
R10 |
|
C |
|
607-032-00-X |
ethyl acrylate |
140-88-5 |
F; R11, Xn; R20/21/22, Xi; R36/37/38, R43 |
C ≥ 5 %: Xi; 36/37/38 |
D |
|
607-033-00-5 |
n-butyl methacrylate |
97-88-1 |
R10, Xi; R36/37/38, R43 |
|
D |
|
607-034-00-0 |
methyl acrylate; methyl propenoate |
96-33-3 |
F; R11, Xn; R20/21/22, Xi; R36/37/38, R43 |
|
D |
|
607-035-00-6 |
methyl methacrylate; methyl 2-methylprop-2-enoate; methyl 2-methylpropenoate |
80-62-6 |
F; R11, Xi; R37/38, R43 |
|
D |
|
607-036-00-1 |
2-methoxyethyl acetate; methylglycol acetate |
110-49-6 |
Repr. Cat. 2; R60-61, Xn; R20/21/22 |
|
E |
|
607-037-00-7 |
2-ethoxyethyl acetate; ethylglycol acetate |
111-15-9 |
R10, Repr. Cat. 2; R60-61, Xn; R20/21/22 |
|
E |
|
607-038-00-2 |
2-butoxyethyl acetate; butylglycol acetate |
112-07-2 |
Xn; R20/21 |
|
|
|
607-039-00-8 |
2,4-D (ISO); 2,4-dichlorophenoxyacetic acid |
94-75-7 |
Xn; R22, Xi; R37-41, R43, R52-53 |
|
|
|
607-040-00-3 |
salts of 2,4-D |
- |
Xn; R22, Xi; R41, R43, N; R51-53 |
|
A |
|
607-041-00-9 |
2,4,5-T (ISO); 2,4,5-trichlorophenoxy acetic acid |
93-76-5 |
Xn; R22, Xi; R36/37/38, N; R50-53 |
|
|
|
607-042-00-4 |
salts and esters of 2,4,5-T; salts and esters of 2,4,5-trichlorophenoxy acetic acid |
- |
Xn; R22, Xi; R36/37/38, N; R50-53 |
|
A |
|
607-043-00-X |
dicamba (ISO); 2,5-dichloro-6-methoxybenzoic acid; 3,6-dichloro-2-methoxybenzoic acid |
1918-00-9 |
Xn; R22, Xi; R41, R52-53 |
|
|
|
607-044-00-5 |
3,6-dichloro-o-anisic acid, compound with dimethylamine (1:1); [1] potassium 3,6-dichloro-o-anisate [2] |
2300-66-5 [1], 10007-85-9 [2] |
Xi; R36, R52-53 |
|
|
|
607-045-00-0 |
dichlorprop (ISO); 2-(2,4-dichlorophenoxy) propionic acid |
120-36-5 |
Xn; R21/22, Xi; R38-41 |
|
|
|
607-046-00-6 |
salts of dichlorprop |
- |
Xn; R20/21/22 |
|
A |
|
607-047-00-1 |
fenoprop (ISO); 2-(2,4,5-trichlorophenoxy)propionic acid |
93-72-1 |
Xn; R22, Xi; R38, N; R50-53 |
|
|
|
607-048-00-7 |
salts of fenoprop; salts of 2-(2,4,5-trichlorophenoxy)propionic acid |
- |
Xn; R20/21/22, N; R50-53 |
|
A |
|
607-049-00-2 |
mecoprop (ISO); 2-(4-chloro-o-tolyloxy) propionic acid; (RS)-2-(4-chloro-o-tolyloxy)propionic acid; [1] 2-(4-chloro-2-methylphenoxy)propionic acid [2] |
7085-19-0 [1], - [2] |
Xn; R22, Xi; R38-41, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
607-050-00-8 |
salts of mecoprop |
- |
Xn; R22, Xi; R38-41, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
A |
|
607-051-00-3 |
MCPA (ISO); 4-chloro-o-tolyloxyacetic acid |
94-74-6 |
Xn; R22, Xi; R38-41, N; R50-53 |
|
|
|
607-052-00-9 |
salts and esters of MCPA |
- |
Xn; R20/21/22, N; R50-53 |
|
A |
|
607-053-00-4 |
MCPB (ISO); 4-(4-chloro-o-tolyloxy) butyric acid |
94-81-5 |
N; R50-53 |
|
|
|
607-054-00-X |
salts and esters of MCPB |
- |
Xn; R22 |
|
A |
|
607-055-00-5 |
endothal-sodium (ISO); disodium 7-oxabicyclo(2,2,1)heptane-2,3-dicarboxylate |
129-67-9 |
T; R25, Xn; R21, Xi; R36/37/38 |
|
|
|
607-056-00-0 |
warfarin (ISO); [1] (S)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone; [2] (R)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone [3] |
81-81-2 [1], 5543-57-7 [2], 5543-58-8 [3] |
Repr. Cat. 1; R61, T; R48/25, R52-53 |
|
E |
|
607-057-00-6 |
coumachlor (ISO); 3-[1-(4-chlorophenyl)-3-oxobutyl]-4-hydroxycoumarin |
81-82-3 |
Xn; R48/22, R52-53 |
|
|
|
607-058-00-1 |
coumafuryl (ISO); fumarin; (RS)-3-(1-(2-furyl)-3-oxobutyl)4-hydroxycoumarin; 4-hydroxy-3-[3-oxo-1-(2-furyl) butyl]coumarin |
117-52-2 |
T; R25-48/25, R52-53 |
|
|
|
607-059-00-7 |
coumatetralyl; 4-hydroxy-3-(1,2,3,4-tetrahydro-1-naphthyl)coumarin |
5836-29-3 |
T+; R27/28, T; R48/24/25, R52-53 |
|
|
|
607-060-00-2 |
dicoumarol; 4,4'-dihydroxy-3,3'-methylenebis(2H-chromen-2-one) |
66-76-2 |
T; R48/25, Xn; R22, N; R51-53 |
|
|
|
607-061-00-8 |
acrylic acid; prop-2-enoic acid |
79-10-7 |
R10, Xn; R20/21/22, C; R35, N; R50 |
C ≥ 10 %: C; R35, 5 % ≤ C < 10 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/37/38 |
D |
|
607-062-00-3 |
n-butyl acrylate |
141-32-2 |
R10, Xi; R36/37/38, R43 |
|
D |
|
607-063-00-9 |
isobutyric acid |
79-31-2 |
Xn; R21/22 |
|
|
|
607-064-00-4 |
benzyl chloroformate |
501-53-1 |
C; R34, N; R50-53 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
607-065-00-X |
bromoacetic acid |
79-08-3 |
T; R23/24/25, C; R35, R43, N; R50 |
|
|
|
607-066-00-5 |
dichloroacetic acid |
79-43-6 |
C; R35, N; R50 |
|
|
|
607-067-00-0 |
dichloroacetyl chloride |
79-36-7 |
C; R35, N; R50 |
|
|
|
607-068-00-6 |
iodoacetic acid |
64-69-7 |
T; R25, C; R35 |
|
|
|
607-069-00-1 |
ethyl bromoacetate |
105-36-2 |
T+; R26/27/28 |
|
|
|
607-070-00-7 |
ethyl chloroacetate |
105-39-5 |
T; R23/24/25, N; R50 |
|
|
|
607-071-00-2 |
ethyl methacrylate |
97-63-2 |
F; R11, Xi; R36/37/38, R43 |
|
D |
|
607-072-00-8 |
2-hydroxyethyl acrylate |
818-61-1 |
T; R24, C; R34, R43, N; R50 |
C ≥ 2 %: T; R24, 0,2 % ≤ C < 2 %: Xn; R21, C ≥ 0,2 %: R43 |
D |
|
607-073-00-3 |
4-CPA (ISO); 4-chlorophenoxyacetic acid |
122-88-3 |
Xn; R22 |
|
|
|
607-074-00-9 |
chlorfenac (ISO); 2,3,6-trichlorophenylacetic acid |
85-34-7 |
Xn; R22, N; R51-53 |
|
|
|
607-075-00-4 |
chlorfenprop-methyl; methyl 2-chloro-3-(4-chlorophenyl)propionate |
14437-17-3 |
Xn; R21/22, N; R50-53 |
|
|
|
607-076-00-X |
dodine (ISO); dodecylguanidinium acetate |
2439-10-3 |
Xn; R22, Xi; R36/38, N; R50-53 |
|
|
|
607-077-00-5 |
erbon (ISO); 2-(2,4,5-trichlorophenoxy)ethyl 2,2-dichloropropionate |
136-25-4 |
Xn; R22, N; R51-53 |
|
|
|
607-078-00-0 |
fluenetil (ISO); 2-fluoroethyl biphenyl-4-ylacetate |
4301-50-2 |
T+; R27/28 |
|
|
|
607-079-00-6 |
kelevan (ISO); ethyl 5-(perchloro-5-hydroxypentacyclo[5,3,0,02,6,03,9,04,8]decan-5-yl)-4-oxopentanoate; ethyl 5-(1,2,3,5,6,7,8,9,10,10-decachloro-4-hydroxypentacyclo(5,2,1,02,6,03,9,05,8)dec-4-yl)-4-oxovalerate |
4234-79-1 |
T; R24, Xn; R22, N; R51-53 |
|
|
|
607-080-00-1 |
chloroacetyl chloride |
79-04-9 |
R14, R29, T; R23/24/25-48/23, C; R35, N; R50 |
|
|
|
607-081-00-7 |
fluoroacetic acid |
144-49-0 |
T+; R28, N; R50 |
|
|
|
607-082-00-2 |
fluoroacetates, soluble |
- |
T+; R28, N; R50 |
|
A |
|
607-083-00-8 |
2,4-DB (ISO); 4-(2,4-dichlorophenoxy)butyric acid |
94-82-6 |
Xn; R22, N; R51-53 |
|
|
|
607-084-00-3 |
salts of 2,4-DB |
- |
Xn; R22, Xi; R41, N; R51-53 |
|
A |
|
607-085-00-9 |
benzyl benzoate |
120-51-4 |
Xn; R22, N; R51-53 |
|
|
|
607-086-00-4 |
diallyl phthalate |
131-17-9 |
Xn; R22, N; R50-53 |
|
|
|
607-088-00-5 |
methacrylic acid; 2-methylpropenoic acid |
79-41-4 |
Xn; R21/22, C; R35 |
C ≥ 10 %: C; R35, 5 % ≤ C < 10 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/37/38 |
D |
|
607-089-00-0 |
propionic acid … % |
79-09-4 |
C; R34 |
C ≥ 25 %: C; R34, 10 % ≤ C < 25 %: Xi; R36/37/38 |
B |
|
607-090-00-6 |
thioglycolic acid |
68-11-1 |
T; R23/24/25, C; R34 |
C ≥ 2 %: T; R23/24/25, 0,2 % ≤ C < 2 %: Xn; R20/21/22 |
|
|
607-091-00-1 |
trifluoroacetic acid . . . % |
76-05-1 |
Xn; R20, C; R35, R52-53 |
C ≥ 10 %: Xn; R20 |
B |
|
607-092-00-7 |
methyl lactate; [1] methyl (±)-lactate; [2] methyl (R)-lactate; [3] methyl (S)-(-)-lactate [4] |
547-64-8 [1], 2155-30-8 [2], 17392-83-5 [3], 27871-49-4 [4] |
R10, Xi; R36/37 |
|
C |
|
607-093-00-2 |
propionyl chloride |
79-03-8 |
F; R11, R14, C; R34 |
|
B D |
|
607-094-00-8 |
peracetic acid . . . % |
79-21-0 |
R10, O; R7, Xn; R20/21/22, C; R35, N; R50 |
C ≥ 10 %: Xn; R20/21/22, C ≥ 10 %: C; R35, 5 % ≤ C < 10 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/37/38 |
B D |
|
607-095-00-3 |
maleic acid |
110-16-7 |
Xn; R22, Xi; R36/37/38, R43 |
C ≥ 0,1 %: R43 |
|
|
607-096-00-9 |
maleic anhydride |
108-31-6 |
Xn; R22, C; R34, R42/43 |
|
|
|
607-097-00-4 |
benzene-1,2,4-tricarboxylic acid 1,2-anhydride; trimellitic anhydride |
552-30-7 |
Xi; R37-41, R42/43 |
|
|
|
607-098-00-X |
benzene-1,2:4,5-tetracarboxylic dianhydride; benzene-1,2:4,5-tetracarboxylic dianhydride; pyromellitic dianhydride |
89-32-7 |
Xi; R41, R42/43 |
|
|
|
607-099-00-5 |
1,2,3,6-tetrahydrophthalic anhydride; [1] cis-1,2,3,6-tetrahydrophthalic anhydride; [2] 3,4,5,6-tetrahydrophthalic anhydride; [3] tetrahydrophthalic anhydride [4] |
85-43-8 [1], 935-79-5 [2], 2426-02-0 [3], 26266-63-7 [4] |
Xi; R41, R42/43, R52-53 |
|
C |
|
607-100-00-9 |
benzophenone-3,3',4,4'-tetracarboxylic dianhydride; 4,4'-carbonyldi(phthalic anhydride) |
2421-28-5 |
Xi; R36/37 |
C ≥ 1 %: Xi; R36/37 |
|
|
607-101-00-4 |
1,4,5,6,7,7-hexachlorobicyclo [2,2,1]hept-5-ene-2,3-dicarboxylic anhydride chlorendic anhydride |
115-27-5 |
Xi; R36/37/38 |
C ≥ 1 %: Xi; R36/37/38 |
|
|
607-102-00-X |
cyclohexane-1,2-dicarboxylic anhydride; [1] cis-cyclohexane-1,2-dicarboxylic anhydride; [2] trans-cyclohexane-1,2-dicarboxylic anhydride [3] |
85-42-7 [1], 13149-00-3 [2], 14166-21-3 [3] |
Xi; R41, R42/43 |
|
C |
|
607-103-00-5 |
succinic anhydride |
108-30-5 |
Xn; R22, Xi; R36/37 |
C ≥ 5 %: Xn; R22, C ≥ 1 %: Xi; R36/37 |
|
|
607-104-00-0 |
cyclopentane-1,2,3,4-tetracarboxylic dianhydride |
6053-68-5 |
Xi; R36/37 |
C ≥ 1 %: Xi; R36/37 |
|
|
607-105-00-6 |
8,9,10-trinorborn-5-ene-2,3-dicarboxylic anhydride; [1] 1,2,3,6-tetrahydro-3,6-methanophthalic anhydride; [2] (1α,2α,3β,6β)-1,2,3,6-tetrahydro-3,6-methanophthalic anhydride [3] |
129-64-6 [1], 826-62-0 [2], 2746-19-2 [3] |
Xi; R41, R42/43 |
|
C |
|
607-106-00-1 |
8,9-dinorborn-5-ene-2,3-dicarboxylic anhydride |
123748-85-6 |
Xn; R22, Xi; R36/37/38, R42 |
C ≥ 10 %: Xi; R36/37/38 |
C |
|
607-107-00-7 |
2-ethylhexyl acrylate |
103-11-7 |
Xi; R37/38, R43 |
|
D |
|
607-108-00-2 |
2-hydroxy-1-methylethylacrylate; [1] 2-hydroxypropylacrylate; [2] acrylic acid, monoester with propane-1,2-diol [3] |
2918-23-2 [1], 999-61-1 [2], 25584-83-2 [3] |
T; R23/24/25, C; R34, R43 |
C ≥ 2 %: T; R23/24/25, 0,2 % ≤ C < 2 %: Xn; R20/21/22, C ≥ 0,2 %: R43 |
C D |
|
607-109-00-8 |
hexamethylene diacrylate; hexane-1,6-diol diacrylate |
13048-33-4 |
Xi; R36/38, R43 |
|
D |
|
607-110-00-3 |
pentaerythritol triacrylate |
3524-68-3 |
Xi; R36/38, R43 |
|
D |
|
607-111-00-9 |
2,2-bis(acryloyloxymethyl)butyl acrylate; trimethylolpropane triacrylate |
15625-89-5 |
Xi; R36/38, R43 |
|
D |
|
607-112-00-4 |
2,2-dimethyltrimethylene diacrylate; neopentyl glycol diacrylate |
2223-82-7 |
T; R24, Xi; R36/38, R43 |
C ≥ 5 %: T; R24, 0,2 % ≤ C < 5 %: Xn; R21 |
D |
|
607-113-00-X |
isobutyl methacrylate |
97-86-9 |
R10, Xi; R36/37/38, R43, N; R50 |
|
D |
|
607-114-00-5 |
ethylene dimethacrylate |
97-90-5 |
Xi; R37, R43 |
C ≥ 10 %: Xi; R37 |
D |
|
607-115-00-0 |
isobutyl acrylate |
106-63-8 |
R10, Xn; R20/21, Xi; R38, R43 |
C ≥ 10 %: Xi; R38 |
D |
|
607-116-00-6 |
cyclohexyl acrylate |
3066-71-5 |
Xi; R37/38, N; R51-53 |
C ≥ 10 %: Xi; R37/38 |
D |
|
607-117-00-1 |
2,3-epoxypropyl acrylate; glycidyl acrylate |
106-90-1 |
T; R23/24/25, C; R34, R43 |
C ≥ 2 %: T; R23/24/25, 0,2 % ≤ C < 2 %: Xn; R20/21/22, C ≥ 0,2 %: R43 |
D |
|
607-118-00-7 |
1-methyltrimethylene diacrylate; 1,3-butylene glycol diacrylate |
19485-03-1 |
Xn; R21, C; R34, R43 |
|
D |
|
607-119-00-2 |
tetramethylene diacrylate; 1,4-butyleneglycol diacrylate |
1070-70-8 |
Xn; R21, C; R34, R43 |
|
D |
|
607-120-00-8 |
2,2'-oxydiethyl diacrylate; diethylene glycol diacrylate |
4074-88-8 |
T; R24, Xi; R36/38, R43 |
C ≥ 2 %: T; R24, 0,2 % ≤ C < 2 %: Xn; R21, C ≥ 0,2 %: R43 |
D |
|
607-121-00-3 |
8,9,10-trinorborn-2-yl acrylate |
10027-06-2 |
Xn; R21, Xi; R38, R43 |
C ≥ 10 %: Xi; R38 |
D |
|
607-122-00-9 |
pentaerythritol tetraacrylate |
4986-89-4 |
Xi; R36/38, R43 |
|
D |
|
607-123-00-4 |
2,3-epoxypropyl methacrylate; glycidyl methacrylate |
106-91-2 |
Xn; R20/21/22, Xi; R36/38, R43 |
C ≥ 10 %: Xi; R36/38 |
D |
|
607-124-00-X |
2-hydroxyethyl methacrylate |
868-77-9 |
Xi; R36/38, R43 |
|
D |
|
607-125-00-5 |
2-hydroxypropyl methacrylate; [1] 3-hydroxypropyl methacrylate [2] |
923-26-2 [1], 2761-09-3 [2] |
Xi; R36, R43 |
|
C D |
|
607-126-00-0 |
2,2'-(ethylenedioxy)diethyl diacrylate; triethylene glycol diacrylate |
1680-21-3 |
Xi; R36/38, R43 |
|
D |
|
607-127-00-6 |
2-diethylaminoethyl methacrylate |
105-16-8 |
Xn; R20, Xi; R36/38, R43 |
C ≥ 10 %: Xi; R36/38 |
D |
|
607-128-00-1 |
2-tert-butylaminoethyl methacrylate |
3775-90-4 |
Xi; R36/38, R43 |
|
D |
|
607-129-00-7 |
ethyl lactate; ethyl DL-lactate; [1] ethyl (S)-2-hydroxypropionate; ethyl L-lactate; ethyl-(S)-lactate [2] |
97-64-3 [1], 687-47-8 [2] |
R10, Xi; R37-41 |
|
C |
|
607-130-00-2 |
pentyl acetate; [1] isopentyl acetate; [2] 1-methylbutyl acetate; [3] 2-methylbutyl acetat; [4] 2(or 3)-methylbutyl acetate [5] |
628-63-7 [1], 123-92-2 [2], 626-38-0 [3], 624-41-9 [4], 84145-37-9 [5] |
R10, R66 |
|
C |
|
607-131-00-8 |
isopentyl propionate; [1] pentyl propionate; [2] 2-methylbutyl propionate [3] |
105-68-0 [1], 624-54-4 [2], 2438-20-2 [3] |
R10 |
|
C |
|
607-132-00-3 |
2-dimethylaminoethyl methacrylate |
2867-47-2 |
Xn; R21/22, Xi; R36/38, R43 |
C ≥ 10 %: Xi; R36/38 |
D |
|
607-133-00-9 |
monoalkyl or monoaryl or monoalkylaryl esters of acrylic acid with the exception of those specified elsewhere in this Annex |
- |
Xi; R36/37/38, N; R51-53 |
C ≥ 10 %: Xi; R36/37/38 |
A |
|
607-134-00-4 |
monoalkyl or monoaryl or monoalkyaryl esters of methacrylic acid with the exception of those specified elsewhere in this Annex |
- |
Xi; R36/37/38 |
C ≥ 10 %: Xi; R36/37/38 |
A |
|
607-135-00-X |
butyric acid |
107-92-6 |
C; R34 |
|
|
|
607-136-00-5 |
butyryl chloride |
141-75-3 |
F; R11, C; R34 |
|
|
|
607-137-00-0 |
methyl acetoacetate |
105-45-3 |
Xi; R36 |
|
|
|
607-138-00-6 |
butyl chloroformate; chloroformic acid butyl ester |
592-34-7 |
R10, T; R23, C; R34 |
|
|
|
607-139-00-1 |
2-chloropropionic acid |
598-78-7 |
Xn; R22, C; R35 |
|
|
|
607-140-00-7 |
isobutyryl chloride |
79-30-1 |
F; R11, C; R35 |
|
|
|
607-141-00-2 |
oxydiethylene bis(chloroformate) |
106-75-2 |
Xn; R22, Xi; R38-41, N; R51-53 |
|
|
|
607-142-00-8 |
propyl chloroformate; chloroformic acid propylester; n-propyl chloroformate |
109-61-5 |
F; R11, T; R23, C; R34 |
|
|
|
607-143-00-3 |
valeric acid |
109-52-4 |
C; R34, R52-53 |
|
|
|
607-144-00-9 |
adipic acid |
124-04-9 |
Xi; R36 |
|
|
|
607-145-00-4 |
methanesulphonic acid |
75-75-2 |
C; R34 |
|
|
|
607-146-00-X |
fumaric acid |
110-17-8 |
Xi; R36 |
|
|
|
607-147-00-5 |
oxalic acid diethylester; diethyl oxalate |
95-92-1 |
Xn; R22, Xi; R36 |
|
|
|
607-148-00-0 |
guanidinium chloride; guanadine hydrochloride |
50-01-1 |
Xn; R22, Xi; R36/38 |
|
|
|
607-149-00-6 |
urethane (INN); ethyl carbamate |
51-79-6 |
Carc. Cat. 2; R45 |
|
|
|
607-150-00-1 |
endothal (ISO); 7-oxabicyclo(2,2,1)heptane-2,3-dicarboxylic acid |
145-73-3 |
T; R25, Xn; R21, Xi; R36/37/38 |
|
|
|
607-151-00-7 |
propargite (ISO); 2-(4-tert-butylphenoxy) cyclohexyl prop-2-ynyl sulphite |
2312-35-8 |
Carc. Cat. 3; R40, T; R23, Xi; R38-41, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
607-152-00-2 |
2,3,6-TBA (ISO); 2,3,6-trichlorobenzoic acid |
50-31-7 |
Xn; R22, N; R51-53 |
|
|
|
607-153-00-8 |
benazolin (ISO); 4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetic acid |
3813-05-6 |
Xi; R36/38, R52-53 |
|
|
|
607-154-00-3 |
ethyl N-benzoyl-N-(3,4-dichlorophenyl)-DL-alaninate; benzoylprop-ethyl (ISO) |
22212-55-1 |
Xn; R22, N; R50-53 |
|
|
|
607-155-00-9 |
3-(3-amino-5-(1-methylguanidino)-1-oxopentylamino-6-(4-amino-2-oxo-2,3-dihydro-pyrimidin-1-yl)-2,3-dihydro-(6H)-pyran-2-carboxylic acid; blasticidin-s |
2079-00-7 |
T+; R28 |
|
|
|
607-156-00-4 |
chlorfenson (ISO); 4-chlorophenyl 4-chlorobenzenesulfonate |
80-33-1 |
Xn; R22, Xi; R38, N; R50-53 |
|
|
|
607-157-00-X |
3-(3-biphenyl-4-yl-1,2,3,4-tetrahydro-1-naphthyl)-4-hydroxycoumarin; difenacoum |
56073-07-5 |
T+; R28, T; R48/25, N; R50-53 |
|
|
|
607-158-00-5 |
sodium salt of chloroacetic acid; sodium chloroacetate |
3926-62-3 |
T; R25, Xi; R38, N; R50 |
|
|
|
607-159-00-0 |
chlorobenzilate (ISO); ethyl 2,2-di(4-chlorophenyl)-2-hydroxyacetate; ethyl 4,4'-dichlorobenzilate |
510-15-6 |
Xn; R22, N; R50-53 |
|
|
|
607-160-00-6 |
isobutyl 2-(4-(4-chlorophenoxy)phenoxy)propionate; clofop-isobutyl (ISO) |
51337-71-4 |
Xn; R22 |
|
|
|
607-161-00-1 |
diethanolamine salt of 4-CPA |
- |
Xn; R22 |
|
|
|
607-162-00-7 |
dalapon; 2,2-dichloropropionic acid; [1] dalapon-sodium; sodium 2,2-dichloropropionate [2] |
75-99-0 [1], 127-20-8 [2] |
Xi; R38-41, R52-53 |
|
|
|
607-163-00-2 |
3-acetyl-6-methyl-2H-pyran-2,4(3H)-dione; dehydracetic acid |
520-45-6 |
Xn; R22 |
|
|
|
607-164-00-8 |
sodium 1-(3,4-dihydro-6-methyl-2,4-dioxo-2H-pyran-3-ylidene)ethonolate; sodium dehydracetate |
4418-26-2 |
Xn; R22 |
|
|
|
607-165-00-3 |
diclofop-methyl (ISO); methyl 2-(4-(2,4-dichlorophenoxy)phenoxy)propionate; methyl (RS)-2-[4-(2,4-dichlorophenoxy)phenoxy]propionate |
51338-27-3 |
Xn; R22, R43, N; R50-53 |
|
|
|
607-166-00-9 |
medinoterb acetate (ISO); 6-tert-butyl-3-methyl-2,4-dinitrophenyl acetate |
2487-01-6 |
T; R25, Xn; R21 |
|
|
|
607-167-00-4 |
sodium 3-chloroacrylate |
4312-97-4 |
Xn; R21/22 |
|
|
|
607-168-00-X |
dipropyl 6,7-methylenedioxy-1,2,3,4-tetrahydro-3-methylnaphthalene-1,2-dicarboxylate; propylisome |
83-59-0 |
T; R24, Xn; R22, N; R50-53 |
|
|
|
607-169-00-5 |
sodium fluoroacetate |
62-74-8 |
T+; R26/27/28, N; R50 |
|
|
|
607-170-00-0 |
bis(1,2,3-trithiacyclohexyldimethylammonium) oxalate; thiocyclam-oxalate |
31895-22-4 |
Xn; R21/22, N; R50-53 |
|
|
|
607-172-00-1 |
4-hydroxy-3-(3-(4'-bromo-4-biphenylyl)-1,2,3,4-tetrahydro-1-naphthyl)coumarin; brodifacoum |
56073-10-0 |
T+; R27/28, T; R48/24/25, N; R50-53 |
|
|
|
607-173-00-7 |
dimethyl (3-methyl-4-(5-nitro-3-ethoxycarbonyl-2-thienyl)azo)phenylnitrilodipropionate |
- |
R43, R52-53 |
|
|
|
607-174-00-2 |
reaction mass of dodecyl 3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionate and tetradecyl 3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionate |
- |
Xi; R38, N; R51-53 |
|
|
|
607-175-00-8 |
methyl 2-(2-nitrobenzylidene)acetoacetate |
39562-27-1 |
R43, N; R51-53 |
|
|
|
607-176-00-3 |
reaction mass of α-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-hydroxypoly(oxyethylene) and α-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyloxypoly(oxyethylene) |
- |
R43, N; R51-53 |
|
|
|
607-177-00-9 |
tribenuron methyl (ISO); 2-[4-methoxy-6-methyl-1,3,5-triazin-2-yl(methyl)carbamoylsulfamoyl]benzoic acid methyl ester; methyl 2-(3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-methylureidosulfonyl)benzoate |
101200-48-0 |
R43, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
607-178-00-4 |
methyl α-((4,6-dimethoxypyrimidin-2-yl)ureidosulphonyl)-o-toluate |
83055-99-6 |
R43, N; R51-53 |
|
|
|
607-179-00-X |
(benzothiazol-2-ylthio)succinic acid |
95154-01-1 |
R43 |
|
|
|
607-180-00-5 |
potassium 2-hydroxycarbazole-1-carboxylate |
96566-70-0 |
Xn; R22, Xi; R36/37, R52-53 |
|
|
|
607-181-00-0 |
3,5-dichloro-2,4-difluorobenzoyl fluoride |
101513-70-6 |
T; R23, C; R34, Xn; R22, R29, R43, R52-53 |
|
|
|
607-182-00-6 |
methyl 3-sulphamoyl-2-thenoate |
- |
R43 |
|
|
|
607-183-00-1 |
zinc 2-hydroxy-5-C13-18alkylbenzoate |
- |
Xi; R36/38, N; R51-53 |
|
|
|
607-184-00-7 |
S-(3-trimethoxysilyl)propyl 19-isocyanato-11-(6-isocyanatohexyl)-10,12-dioxo-2,9,11,13-tetraazanonadecanethioate |
85702-90-5 |
R10, R42/43 |
|
|
|
607-185-00-2 |
ethyl trans-3-dimethylaminoacrylate |
1117-37-9 |
R43 |
|
|
|
607-186-00-8 |
quinclorac (ISO); 3,7-dichloroquinoline-8-carboxylic acid |
84087-01-4 |
R43 |
|
|
|
607-187-00-3 |
bis(2,2,6,6-tetramethyl-4-piperidyl) succinate |
62782-03-0 |
Xi; R36, R52-53 |
|
|
|
607-188-00-9 |
hydrogen sodium N-carboxylatoethyl-N-octadec-9-enylmaleamate |
- |
R43, N; R51-53 |
|
|
|
607-189-00-4 |
trimethylenediaminetetraacetic acid |
1939-36-2 |
Xn; R22, Xi; R41 |
|
|
|
607-190-00-X |
methyl acrylamidomethoxyacetate (containing ≥ 0,1 % acrylamid) |
77402-03-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R22, Xi; R36 |
|
E |
|
607-191-00-5 |
isobutyl 3,4-epoxybutyrate |
100181-71-3 |
Xi; R38, R43, N; R50-53 |
|
|
|
607-192-00-0 |
disodium N-carboxymethyl-N-(2-(2-hydroxyethoxy)ethyl)glycinate |
92511-22-3 |
Xi; R41 |
|
|
|
607-194-00-1 |
propylene carbonate |
108-32-7 |
Xi; R36 |
|
|
|
607-195-00-7 |
2-methoxy-1-methylethyl acetate |
108-65-6 |
R10 |
|
|
|
607-196-00-2 |
heptanoic acid |
111-14-8 |
C; R34 |
|
|
|
607-197-00-8 |
nonanoic acid |
112-05-0 |
Xi; R36/38 , N; R51-53 |
|
|
ATP07 |
607-198-00-3 |
propyl 3,4,5-trihydroxybenzoate |
121-79-9 |
Xn; R22, R43 |
|
|
|
607-199-00-9 |
octyl 3,4,5-trihydroxybenzoate |
1034-01-1 |
Xn; R22, R43 |
|
|
|
607-200-00-2 |
dodecyl 3,4,5-trihydroxybenzoate |
1166-52-5 |
R43 |
|
|
|
607-201-00-8 |
thiocarbonyl chloride |
463-71-8 |
T; R23, Xn; R22, Xi; R36/37/38 |
|
|
|
607-203-00-9 |
2-ethylhexyl[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]thio]acetate |
80387-97-9 |
Repr. Cat. 2; R61, R43, R52-53 |
|
|
|
607-204-00-4 |
(chlorophenyl)(chlorotolyl)methane, mixed isomers |
- |
N; R50-53 |
|
|
|
607-205-00-X |
methyl chloroacetate |
96-34-4 |
R10, T; R23/25, Xi; R37/38-41 |
|
|
|
607-206-00-5 |
isopropyl chloroacetate |
105-48-6 |
R10, T; R25, Xi; R36/37/38 |
|
|
|
607-207-00-0 |
haloxyfop-etotyl (ISO); 2-ethoxyethyl 2-(4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy)propionate; haloxyfop-(2-ethoxyethyl) |
87237-48-7 |
Xn; R22, N; R50-53 |
|
|
|
607-208-00-6 |
4,8,12-trimethyltrideca-3,7,11-trienoic acid, mixed isomers |
91853-67-7 |
Xi; R38, N; R50-53 |
|
|
|
607-209-00-1 |
reaction mass of O,O'-diisopropyl (pentathio)dithioformate and O,O'-diisopropyl (trithio)dithioformate and O,O'-diisopropyl (tetrathio)dithioformate |
- |
Xn; R22, R43, N; R50-53 |
|
|
|
607-210-00-7 |
methyl acrylamidoglycolate (containing ≥ 0,1 % acrylamide) |
77402-05-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, C; R34, R43 |
|
|
|
607-211-00-2 |
methyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionate |
6386-39-6 |
Xn; R22, N; R51-53 |
|
|
|
607-212-00-8 |
poly(oxypropylenecarbonyl-co-oxy(ethylethylene)carbonyl), containing 27 % hydroxyvalerate |
- |
R43 |
|
|
|
607-213-00-3 |
ethyl 3,3-bis(tert-pentylperoxy)butyrate |
67567-23-1 |
E; R3, O; R7, R10, N; R51-53 |
|
|
|
607-214-00-9 |
N,N-hydrazinodiacetic acid |
19247-05-3 |
T; R25, Xn; R48/22, R43, R52-53 |
|
|
|
607-215-00-4 |
3-(3-tert-butyl-4-hydroxyphenyl)propionic acid |
107551-67-7 |
Xn; R22, Xi; R36 |
|
|
|
607-216-00-X |
glutamic acid, reaction products with N-(C12-14-alkyl)propylenediamine |
- |
T+; R26, Xn; R22, C; R34, N; R50 |
|
|
|
607-217-00-5 |
2-ethoxyethyl 2-(4-(2,6-dihydro-2,6-dioxo-7-phenyl-1,5-dioxaindacen-3-yl)phenoxy)acetate |
- |
R43, R53 |
|
|
|
607-218-00-0 |
dichlorprop-P (ISO); (+)-R-2-(2,4-dichlorophenoxy)propionic acid |
15165-67-0 |
Xn; R22, Xi; R38-41, R43 |
|
|
|
607-219-00-6 |
bis(2-ethylhexyl) dithiodiacetate |
62268-47-7 |
Xn; R22, R43, N; R51-53 |
|
|
|
607-221-00-7 |
6-docosyloxy-1-hydroxy-4-(1-(4-hydroxy-3-methylphenanthren-1-yl)-3-oxo-2-oxaphenalen-1-yl)naphthalene-2-carboxylic acid |
- |
R43, R53 |
|
|
|
607-222-00-2 |
6-(2,3-dimethylmaleimido)hexyl methacrylate |
63740-41-0 |
R43, N; R51-53 |
|
|
|
607-223-00-8 |
transfluthrin (ISO); 2,3,5,6-tetrafluorobenzyl trans-2-(2,2-dichlorovinyl)-3,3-dimethylcyclopropanecarboxylate |
118712-89-3 |
Xi; R38, N; R50-53 |
|
|
|
607-224-00-3 |
methyl 2-(3-nitrobenzylidene)acetoacetate |
39562-17-9 |
Xi; R43, N; R50-53 |
|
|
|
607-225-00-9 |
3-azidosulfonylbenzoic acid |
15980-11-7 |
E; R2, Xn; R48/22, Xi; R41, R43 |
|
|
|
607-226-00-4 |
reaction mass of 2-acryloyloxyethyl hydrogen cyclohexane-1,2-dicarboxylate and 2-methacryloyloxyethyl hydrogen cyclohexane-1,2-dicarboxylate |
- |
Xi; R38-41, R43, R52-53 |
|
|
|
607-227-00-X |
potassium 2-amino-2-methylpropionate octahydrate |
120447-91-8 |
Xn; R22, C; R35 |
|
|
|
607-228-00-5 |
bis(2-methoxyethyl) phthalate |
117-82-8 |
Repr. Cat. 2; R61, Repr. Cat. 3; R62 |
|
|
|
607-229-00-0 |
diethylcarbamoyl chloride |
88-10-8 |
Carc. Cat. 3; R40, Xn; R20/22, Xi; R36/37/38 |
|
|
|
607-230-00-6 |
2-ethylhexanoic acid |
149-57-5 |
Repr. Cat. 3; R63 |
|
|
|
607-231-00-1 |
clopyralid (ISO); 3,6-dichloropyridine-2-carboxylic acid |
1702-17-6 |
Xi; R41 |
|
|
|
607-232-00-7 |
pyridate (ISO); O-(6-chloro-3-phenylpyridazin-4-yl) S-octyl thiocarbonate |
55512-33-9 |
Xi; R38, R43, N; R50-53 |
|
|
|
607-233-00-2 |
hexyl acrylate |
2499-95-8 |
Xi; R36/37/38, R43, N; R51-53 |
|
|
|
607-234-00-8 |
flurenol (ISO); 9-hydroxy-9H-fluorene-9-carboxylic acid |
467-69-6 |
N; R51-53 |
|
|
|
607-235-00-3 |
mecrilate; methyl 2-cyanoacrylate |
137-05-3 |
Xi; R36/37/38 |
C ≥ 10 %: Xi; R36/37/38 |
|
|
607-236-00-9 |
ethyl 2-cyanoacrylate |
7085-85-0 |
Xi; R36/37/38 |
C ≥ 10 %: Xi; R36/37/38 |
|
|
607-237-00-4 |
benzyl 2-chloro-4-(trifluoromethyl)thiazole-5-carboxylate; flurazole |
72850-64-7 |
N; R51-53 |
|
|
|
607-238-00-X |
tau-fluvalinate (ISO); cyano-(3-phenoxyphenyl)methyl N-[2-chloro-4-(trifluoromethyl)phenyl]-D-valinate |
102851-06-9 |
Xn; R22, Xi; R38, N; R50-53 |
|
|
|
607-239-00-5 |
fenpropathrin (ISO); α-cyano-3-phenoxybenzyl 2,2,3,3-tetramethylcyclopropanecarboxylate |
39515-41-8 |
T+; R26, T; R25, Xn; R21, N; R50-53 |
|
|
|
607-240-00-0 |
cis-1,2,3,6-tetrahydro-4-methylphthalic anhydride; [1] 1,2,3,6-tetrahydro-4-methylphthalic anhydride; [2] 1,2,3,6-tetrahydro-3-methylphthalic anhydride; [3] tetrahydromethylphthalic anhydride; [4] 1,2,3,6-tetrahydromethylphthalic anhydride; [5] tetra |
1694-82-2 [1], 3425-89-6 [2], 5333-84-6 [3], 11070-44-3 [4], 26590-20-5 [5], 34090-76-1 [6], 42498-58-8 [7] |
Xi; R41, R42/43 |
|
|
|
607-241-00-6 |
hexahydro-4-methylphthalic anhydride; [1] hexahydromethylphthalic anhydride; [2] hexahydro-1-methylphthalic anhydride; [3] hexahydro-3-methylphthalic anhydride [4] |
19438-60-9 [1], 25550-51-0 [2], 48122-14-1 [3], 57110-29-9 [4] |
Xi; R41, R42/43 |
|
|
|
607-242-00-1 |
tetrachlorophthalic anhydride |
117-08-8 |
Xi; R41, R42/43, N; R50-53 |
|
|
|
607-243-00-7 |
sodium 3,6-dichloro-o-anisate; [1] 3,6-dichloro-o-anisic acid, compound with 2,2'-iminodiethanol (1:1); [2] 3,6-dichloro-o-anisic acid, compound with 2-aminoethanol (1:1) [3] |
1982-69-0 [1], 25059-78-3 [2], 53404-28-7 [3] |
R52-53 |
|
|
|
607-244-00-2 |
isooctyl acrylate |
29590-42-9 |
Xi; R36/37/38, N; R50-53 |
C ≥ 10 %: Xi; R36/37/38 |
|
|
607-245-00-8 |
tert-butyl acrylate |
1663-39-4 |
F; R11, Xn; R20/21/22, Xi; R37/38, R43, N; R51-53 |
|
|
|
607-246-00-3 |
allyl methacrylate; 2-methyl-2-propenoic acid 2-propenyl ester |
96-05-9 |
R10, T; R23, Xn; R21/22, N; R50 |
|
|
|
607-247-00-9 |
dodecyl methacrylate |
142-90-5 |
Xi; 36/37/38, N; R50-53 |
C ≥ 10 %: Xi; R36/37/38 |
|
|
607-248-00-4 |
naptalam-sodium (ISO); sodium N-naphth-1-ylphthalamate |
132-67-2 |
Xn; R22 |
|
|
|
607-249-00-X |
(1-methyl-1,2-ethanediyl)bis[oxy(methyl-2,1-ethanediyl)] diacrylate |
42978-66-5 |
Xi; R36/37/38, R43, N; R51-53 |
C ≥ 10 %: Xi; R36/37/38 |
|
|
607-250-00-5 |
4H-3,1-benzoxazine-2,4(1H)-dione |
118-48-9 |
Xi; R36, R43 |
|
|
|
607-251-00-0 |
2-methoxypropyl acetate |
70657-70-4 |
R10, Repr. Cat. 2; R61, Xi; R37 |
|
|
|
607-252-00-6 |
lambda-cyhalothrin (ISO); reaction mass of (S)-α-cyano-3-phenoxybenzyl(Z)-(1R)-cis-3-(2-chloro-3,3,3-trifluoropropenyl)-2,2-dimethylcyclopropanecarboxylate and (R)-α-cyano-3-phenoxybenzyl (Z)-(1S)-cis-3-(2-chloro-3,3,3-trifluoropropenyl)-2,2-dimethylcycl |
91465-08-6 |
T+; R26, T; R25, Xn; R21, N; R50-53 |
C ≥ 0,0025 %: N; R50-53, 0,00025 % ≤ C < 0,0025 %: N; R51-53, 0,000025 % ≤ C < 0,00025 %: R52-53 |
|
|
607-253-00-1 |
cyfluthrin (ISO); α-cyano-4-fluoro-3-phenoxybenzyl-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
68359-37-5 |
T+; R28, T; R23, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
607-254-00-7 |
α-cyano-4-fluoro-3-phenoxybenzyl-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate; beta-cyfluthrin |
68359-37-5 |
T+; R26/28, N; R50-53 |
|
|
|
607-255-00-2 |
fluroxypyr (ISO); 4-amino-3,5-dichloro-6-fluoro-2-pyridyloxyacetic acid |
69377-81-7 |
R52-53 |
|
|
|
607-256-00-8 |
azoxystrobin (ISO); methyl (E)-2-{}{2-[6-(2-cyanophenoxy)pyrimidin-4-yloxy]phenyl}}-3-methoxyacrylate |
131860-33-8 |
T; R23, N; 50-53 |
|
|
|
607-257-00-3 |
isopropyl propionate |
637-78-5 |
F; R11 |
|
|
|
607-258-00-9 |
dodecyl 3-(2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-(4-methoxybenzoyl)acetamido)-4-chlorobenzoate |
70950-45-7 |
R53 |
|
|
|
607-259-00-4 |
methyl 2R,3S-(-)-3-(4-methoxyphenyl)oxiranecarboxylate |
105560-93-8 |
Xi; R41, R43, R52-53 |
|
|
|
607-260-00-X |
ethyl 2-(3-nitrobenzylidene)acetoacetate |
39562-16-8 |
Xi; R41, R43, R52-53 |
|
|
|
607-261-00-5 |
iso(C10-C14)alkyl (3,5-di-tert-butyl-4-hydroxyphenyl)methylthioacetate |
118832-72-7 |
N; R50-53 |
|
|
|
607-262-00-0 |
7-chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid |
86393-33-1 |
Xn; R22, R52-53 |
|
|
|
607-263-00-6 |
potassium iron(III) 1,3-propanediamine-N,N,N',N'-tetraacetate hemihydrate |
- |
E; R2, N; R51-53 |
|
|
|
607-264-00-1 |
2-chloro-4-(methylsulfonyl)benzoic acid |
53250-83-2 |
Xi; R41 |
|
|
|
607-265-00-7 |
ethyl-2-chloro-2,2-diphenylacetate |
52460-86-3 |
Xi; R38, R52-53 |
|
|
|
607-266-00-2 |
reaction mass of: hydroxyaluminium bis[2-hydroxy-3,5-di-tert-butylbenzoate]; 3,5-di-tert-butyl-salicylic acid |
130296-87-6 |
Xn; R22, N; R50-53 |
|
|
|
607-267-00-8 |
tert-butyl (5S,6R,7R)-3-bromomethyl-5,8-dioxo-7-(2-(2-phenylacetamido)-5-thia-1-azabicyclo[4.2.0] oct-2-ene-2-carboxylate |
33610-13-8 |
R42/43, R52-53 |
|
|
|
607-268-00-3 |
2-methylpropyl (R)-2-hydroxypropanoate |
61597-96-4 |
Xi; R36 |
|
|
|
607-269-00-9 |
(R)-2-(4-hydroxyphenoxy)propanoic acid |
94050-90-5 |
Xi; R41 |
|
|
|
607-270-00-4 |
3,9-bis(2-(3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionyloxy-1,1-dimethylethyl)-2,4,8,10- tetraoxaspiro[5.5]undecane |
90498-90-1 |
Xn; R21 |
|
|
|
607-271-00-X |
2-isopropyl-5-methylcyclohexyloxycarbonyloxy-2-hydroxypropane |
156324-82-2 |
Xi; R36, N; R51-53 |
|
|
|
607-272-00-5 |
fluroxypyr-meptyl (ISO); methylheptyl, O-(4-amino-3,5-dichloro-6-fluoro-2-pyridyloxy) acetate; [1] fluroxypyr-butometyl (ISO); 2-butoxy-1-methylethyl, O-(4-amino-3,5-dichloro-6-fluoro-2-pyridyloxy) acetate [2] |
81406-37-3 [1], 154486-27-8 [2] |
N; R50-53 |
|
|
|
607-273-00-0 |
ammonium 7-(2,6-dimethyl-8-(2,2-dimethylbutyryloxy)-1,2,6,7,8,8a-hexahydro-1-naphthyl)-3,5-dihydroxyheptanoate |
- |
R52-53 |
|
|
|
607-274-00-6 |
2-(N-benzyl-N-methylamino)ethyl 3-amino-2-butenoate |
54527-73-0 |
R43, N; R51-53 |
|
|
|
607-275-00-1 |
sodium benzoyloxybenzene-4-sulfonate |
66531-87-1 |
R43 |
|
|
|
607-276-00-7 |
bis[(1-methylimidazol)-(2-ethyl-hexanoate)], zinc complex |
- |
Xi; R38-41, N; R50-53 |
|
|
|
607-277-00-2 |
reaction mass of: 2-(hexylthio)ethylamine hydrochloride; sodium propionate |
- |
Xn; R22, Xi; R41, R43, N; R51-53 |
|
|
|
607-278-00-8 |
reaction mass of isomers of: sodium phenethylnaphthalenesulfonate; sodium naphthylethylbenzenesulfonate |
- |
Xi; R41, R43, R52-53 |
|
|
|
607-279-00-3 |
reaction mass of n-octadecylaminodiethyl bis(hydrogen maleate); n-octadecylaminodiethyl hydrogen maleate hydrogenphthalate |
- |
R43, N; R51-53 |
|
|
|
607-280-00-9 |
sodium 4-chloro-1-hydroxybutane-1-sulfonate |
54322-20-2 |
Xn; R22, Xi; R36, R43 |
|
|
|
607-281-00-4 |
reaction mass of branched and linear C7-C9 alkyl 3-[3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxyphenyl]propionates |
127519-17-9 |
N; R51-53 |
|
|
|
607-282-00-X |
2-acetoxymethyl-4-benzyloxybut-1-yl acetate |
131266-10-9 |
R52-53 |
|
|
|
607-283-00-5 |
E-ethyl-4-oxo-4-phenylcrotonate |
15121-89-8 |
Xn; R21/22, Xi; R38-41, R43, N; R50-53 |
|
|
|
607-284-00-0 |
reaction mass of: sodium 3,3'-(1,4-phenylenebis(carbonylimino-3,1-propanediylimino))bis(10-amino-6,13-dichloro-4,11-triphenodioxazinedisulfonate); lithium 3,3'-(1,4-phenylenebis-(carbonylimino-3,1-propanediyl-imino))bis(10-amino-6,13-dichloro)-4,11-triph |
136213-76-8 |
N; R51-53 |
|
|
|
607-285-00-6 |
reaction mass of: 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonic acid; sodium 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonate; potassium 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonate |
- |
R43 |
|
|
|
607-286-00-1 |
reaction mass of: sodium/potassium 7-[[[3-[[4-((2-hydroxy-naphthyl)azo)phenyl]azo]phenyl]sulfonyl]amino]-naphthalene-1,3-disulfonate |
141880-36-6 |
R43, R52-53 |
|
|
|
607-287-00-7 |
O'-methyl O-(1-methyl-2-methacryloyloxy-ethyl)-1,2,3,6-tetrahydrophthalate |
- |
R52-53 |
|
|
|
607-288-00-2 |
Tetrasodium (c-(3-(1-(3-(e-6-dichloro-5-cyanopyrimidin-f-yl(methyl)amino)propyl)-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo)-4-sulfonatophenylsulfamoyl)phthalocyanine-a,b,d-trisulfonato(6-))nickelato II, where a is 1 or 2 or 3 or 4,b is 8 or 9 or 10 or 11,c is 15 or 16 or 17 or 18, d is 22 or 23 or 24 or 25 and where e and f together are 2 and 4 or 4 and 2 respectively |
148732-74-5 |
Xi; R36, R43, R52-53 |
|
|
|
607-289-00-8 |
3-(3-(4-(2,4-bis(1,1-dimethylpropyl)phenoxy)butylaminocarbonyl-4-hydroxy-1-naphthalenyl)thio)propanoic acid |
105488-33-3 |
R53 |
|
|
|
607-290-00-3 |
reaction mass (ratio not known) of: ammonium 1-C14-C18-alkyloxycarbonyl-2-(3-allyloxy-2-hydroxypropoxycarbonyl)ethane-1-sulfonate; ammonium 2-C14-C18-alkyloxycarbonyl-1-(3-allyloxy-2-hydroxypropoxycarbonyl)ethane-1-sulfonate |
- |
Xi; R38, R43, N; R50-53 |
|
|
|
607-291-00-9 |
dodecyl-ω-(C5/C6-cycloalkyl)alkyl carboxylate |
104051-92-5 |
R53 |
|
|
|
607-292-00-4 |
reaction mass of: [1-(methoxymethyl)-2-(C12-alkoxy)-ethoxy]acetic acid; [1-(methoxymethyl)-2-(C14-alkoxy)-ethoxy]acetic acid |
- |
Xi; R38-41, N; R50-53 |
|
|
|
607-293-00-X |
reaction mass of: N-aminoethylpiperazonium mono-2,4,6-trimethylnonyldiphenyl ether di-sulfonate; N-aminoethylpiperazonium di-2,4,6-trimethylnonyldiphenyl ether di-sulfonate |
- |
Xi; R41, R43, N; R51-53 |
|
|
|
607-294-00-5 |
sodium 2-benzoyloxy-1-hydroxyethane-sulfonate |
- |
R43 |
|
|
|
607-295-00-0 |
reaction mass of: tetrasodium phosphonoethane-1,2-dicarboxylate; hexasodium phosphonobutane-1,2,3,4-tetracarboxylate |
- |
R43, N; R51-53 |
|
|
|
607-296-00-6 |
reaction mass of: pentaerythriol tetraesters with heptanoic acid and 2-ethylhexanoic acid |
- |
R53 |
|
|
|
607-297-00-1 |
(E-E)-3,3'-(1,4-phenylenedimethylidene)bis(2-oxobornane-10-sulfonic acid) |
92761-26-7 |
Xi; R41 |
|
|
|
607-298-00-7 |
2-(trimethylammonium)ethoxycarboxybenzene-4-sulfonate |
- |
R43 |
|
|
|
607-299-00-2 |
methyl 3-(acetylthio)-2-methyl-propanoate |
97101-46-7 |
Xn; R22, R43, N; R50-53 |
|
|
|
607-300-00-6 |
trisodium [2-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-5-(b-sulfamoyl-c, d-sulfonatophthalocyanin-a-yl-K4,N29,N30,N31,N32-sulfonylamino)benzoato(5-)]cuprate(II) where a = 1,2,3,4 b = 8,9,10,11 c = 15,16,17,18 d = 22,23,24,25 |
- |
Xi; R41, R43 |
|
|
|
607-301-00-1 |
reaction mass of: dodecanoic acid; poly(1-7)lactate esters of dodecanoic acid |
- |
R43, N; R51-53 |
|
|
|
607-302-00-7 |
reaction mass of: tetradecanoic acid; poly(1-7)lactate esters of tetradecanoic acid |
- |
Xi; R38-41, R43, N; R51-53 |
|
|
|
607-303-00-2 |
1-cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid |
93107-30-3 |
Repr. Cat. 3; R62, R52-53 |
|
|
|
607-304-00-8 |
fluazifop-butyl (ISO); butyl (RS)-2-[4-(5-trifluoromethyl-2-pyridyloxy)phenoxy]propionate |
69806-50-4 |
Repr. Cat. 2; R61, N; R50-53 |
|
|
|
607-305-00-3 |
fluazifop-P-butyl (ISO); butyl (R)-2-[4-(5-trifluoromethyl-2-pyridyloxy)phenoxy]propionate |
79241-46-6 |
Repr. Cat. 3; R63, N; R50-53 |
|
|
|
607-306-00-9 |
chlozolinate (ISO); ethyl (RS)-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxo-oxazolidine-5-carboxylate |
84332-86-5 |
Carc. Cat. 3; R40, N; R51-53 |
|
|
|
607-307-00-4 |
vinclozolin (ISO); N-3,5-dichlorophenyl-5-methyl-5-vinyl-1,3-oxazolidine-2,4-dione |
50471-44-8 |
Carc. Cat. 3; R40, Repr. Cat. 2; R60-61, R43, N; R51-53 |
|
|
|
607-308-00-X |
esters of 2,4-D |
- |
Xn; R22, R43, N; R50-53 |
|
A |
|
607-309-00-5 |
carfentrazone-ethyl (ISO); ethyl (RS)-2-chloro-3-[2-chloro-4-fluoro-5-[4-difluoromethyl-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]propionate |
128639-02-1 |
N; R50-53 |
|
|
|
607-310-00-0 |
kresoxim-methyl (ISO); methyl (E)-2-methoxyimino-[2-(o-tolyloxymethyl)phenyl]acetate |
143390-89-0 |
Carc. Cat. 3; R40, N; R50-53 |
|
|
|
607-311-00-6 |
benazolin-ethyl; ethyl 4-chloro-2-oxo-2H-benzothiazole-3-acetate |
25059-80-7 |
N; R51-53 |
|
|
|
607-312-00-1 |
methoxyacetic acid |
625-45-6 |
Repr. Cat. 2; R60-61, Xn; R22, C; R34 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
E |
|
607-313-00-7 |
neodecanoyl chloride |
40292-82-8 |
T+; R26, Xn; R22, C; R34 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
607-314-00-2 |
ethofumesate (ISO); (±)-2-ethoxy-2,3-dihydro-3,3-dimethylbenzofuran-5-yl methanesulfonate |
26225-79-6 |
N; R51-53 |
|
|
|
607-315-00-8 |
glyphosate (ISO); N-(phosphonomethyl)glycine |
1071-83-6 |
Xi; R41, N; R51-53 |
|
|
|
607-316-00-3 |
glyphosate-trimesium; glyphosate-trimethylsulfonium |
81591-81-3 |
Xn; R22, N; R51-53 |
|
|
|
607-317-00-9 |
bis(2-ethylhexyl) phthalate; di-(2-ethylhexyl) phthalate; DEHP |
117-81-7 |
Repr. Cat. 2; R60-61 |
|
|
|
607-318-00-4 |
dibutyl phthalate; DBP |
84-74-2 |
Repr. Cat. 2; R61, Repr. Cat. 3; R62, N; R50 |
|
|
|
607-319-00-X |
deltamethrin (ISO); (S)-α-cyano-3-phenoxybenzyl (1R, 3R)-3-(2,2-dibromovinyl)-2,2-dimethylcyclopropanecarboxylate |
52918-63-5 |
T; R23/25, N; R50-53 |
C ≥ 0,000025 %: N; R50-53, 0,0000025 % ≤ C < 0,000025 %: N; R51-53, 0,00000025 % ≤ C < 0,0000025 %: R52-53 |
|
|
607-320-00-5 |
bis[4-(ethenyloxy)butyl] 1,3-benzenedicarboxylate |
130066-57-8 |
R43, N; R50-53 |
|
|
|
607-321-00-0 |
(S)-methyl-2-chloropropionate |
73246-45-4 |
R10, Xn; R48/22, Xi; R36 |
|
|
|
607-322-00-6 |
4-(4,4-dimethyl-3-oxo-pyrazolidin-1-yl)-benzoic acid |
107144-30-9 |
Xn; R22, N; R51-53 |
|
|
|
607-323-00-1 |
2-(1-(2-hydroxy-3,5-di-tert-pentyl-phenyl)ethyl)-4,6-di-tert-pentylphenyl acrylate |
123968-25-2 |
R53 |
|
|
|
607-324-00-7 |
reaction mass of: N,N-di(hydrogenated alkyl C14-C18)phtalamic acid; dihydrogenated alkyl (C14-C18)amine |
- |
R53 |
|
|
|
607-325-00-2 |
(S)-2-chloropropionic acid |
29617-66-1 |
Xn; R21/22, C; R35 |
|
|
|
607-326-00-8 |
reaction mass of: isobutyl hydrogen 2-(α-2,4,6-trimethylnon-2-enyl)succinate; isobutyl hydrogen 2-(ß-2,4,6-trimetyhylnon-2-enyl)succinate |
141847-13-4 |
Xi; R41, N; R51-53 |
|
|
|
607-327-00-3 |
2-(2-iodoethyl)-1,3-propanediol diacetate |
127047-77-2 |
Xn; R22, N; R51-53 |
|
|
|
607-328-00-9 |
methyl 4-bromomethyl-3-methoxybenzoate |
70264-94-7 |
Xi; R38-41, R43, N; R50-53 |
|
|
|
607-329-00-4 |
reaction mass of: sodium 2-(C12-18-n-alkyl)amino-1,4-butandioate; sodium 2-octadecenyl-amino-1,4-butandioate |
- |
R43 |
|
|
|
607-330-00-X |
(S)-2,3-dihydro-1H-indole-2-carboxylic acid |
79815-20-6 |
Repr. Cat. 3; R62, Xn; R48/22, R43 |
|
|
|
607-332-00-0 |
cyclopentyl chloroformate |
50715-28-1 |
R10, T; R23, Xn; R22-48/22, Xi; R41, R43 |
|
|
|
607-333-00-6 |
reaction mass of: dodecyl N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninate; tetradecyl N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninate |
- |
Xn; R22-48/22, C; R34, N; R50-53 |
|
|
|
607-334-00-1 |
ethyl 1-ethyl-6,7,8-trifluoro-1,4-dihydro-4-oxoquinoline-3-carboxylate |
100501-62-0 |
R43, R52-53 |
|
|
|
607-335-00-7 |
methyl (R)-2-(4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy)propionate |
72619-32-0 |
Xn; R22, N; R50-53 |
|
|
|
607-336-00-2 |
4-methyl-8-methylenetricyclo[3.3.1.13,7]dec-2-yl acetate |
122760-85-4 |
Xi; R38, R43, N; R51-53 |
|
|
|
607-337-00-8 |
di-tert-(C12-14)-alkylammonium 2-benzothiazolylthiosuccinate |
125078-60-6 |
R10, Xn; R22, Xi; R38-41, N; R51-53 |
|
|
|
607-338-00-3 |
2-methylpropyl 2-hydroxy-2-methylbut-3-enoate |
72531-53-4 |
Xi; R36/38 |
|
|
|
607-339-00-9 |
2,3,4,5-tetrachlorobenzoylchloride |
42221-52-3 |
Xn; R22, C; R34, R43 |
|
|
|
607-340-00-4 |
1,3-bis(4-benzoyl-3-hydroxyphenoxy)prop-2-yl acetate |
- |
N; R51-53 |
|
|
|
607-341-00-X |
(9S)-9-amino-9-deoxyerythromycin |
26116-56-3 |
Xi; R41, N; R50-53 |
|
|
|
607-342-00-5 |
4-chlorobutyl veratrate |
69788-75-6 |
R43, N; R51-53 |
|
|
|
607-343-00-0 |
4,7-methanooctahydro-1H-indene-diyldimethyl bis(2-carboxybenzoate) |
- |
R53 |
|
|
|
607-344-00-6 |
reaction mass of: 3-(N-(3-dimethylaminopropyl)-(C4-8)perfluoroalkylsulfonamido)propionic acid; N-[dimethyl-3-(C4-8-perfluoroalkylsulfonamido)propylammonium propionate; 3-(N-(3-dimethyl-propylammonium)-(C4-8)perfluoroalkylsulfonamido)propionic acid propi |
- |
Xn; R48/22 |
|
|
|
607-345-00-1 |
potassium 2-(2,4-dichlorophenoxy)-(R)-propionate |
113963-87-4 |
Xn; R22, Xi; R38-41, R43 |
|
|
|
607-346-00-7 |
3-icosyl-4-henicosylidene-2-oxetanone |
83708-14-9 |
R53 |
|
|
|
607-347-00-2 |
sodium (R)-2-(2,4-dichlorophenoxy)propionate |
119299-10-4 |
Xn; R22, Xi; R38-41, R43 |
|
|
|
607-348-00-8 |
magnesium bis((R)-2-(2,4-dichlorophenoxy)propionate) |
- |
Xn; R22, Xi; R38-41, R43 |
|
|
|
607-349-00-3 |
mono-(tetrapropylammonium) hydrogen 2,2'-dithiobisbenzoate |
- |
R52-53 |
|
|
|
607-350-00-9 |
bis(4-(1,2-bis(ethoxycarbonyl)ethylamino)-3-methylcyclohexyl)methane |
136210-32-7 |
R43, R52-53 |
|
|
|
607-351-00-4 |
methyl O-(4-amino-3,5-dichloro-6-fluoropyridin-2-yloxy)acetate |
69184-17-4 |
N; R51-53 |
|
|
|
607-352-00-X |
4,4'-oxydiphthalic anhydride |
1823-59-2 |
R52-53 |
|
|
|
607-353-00-5 |
reaction mass of: ethyl exo-tricyclo[5.2.1.02,6]decane-endo-2-carboxylate; ethyl endo-tricyclo[5.2.1.02,6]decane-exo-2-carboxylate |
80657-64-3 |
Xi; R38, N; R51-53 |
|
|
|
607-354-00-0 |
ethyl 2-cyclohexylpropionate |
2511-00-4 |
N; R51-53 |
|
|
|
607-355-00-6 |
p-tolyl 4-chlorobenzoate |
15024-10-9 |
R43, N; R50-53 |
|
|
|
607-356-00-1 |
ethyl trans-2,2,6-trimethylcyclohexanecarboxylate |
- |
Xi; R38, N; R51-53 |
|
|
|
607-357-00-7 |
reaction mass of: trans-4-acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran; cis-4-acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran |
131766-73-9 |
R43 |
|
|
|
607-358-00-2 |
(1S,3S,5R,6R)-(4-nitrophenylmethyl)-1-dioxo-6-phenylacetamido-penam-3-carboxylate |
54275-93-3 |
R42 |
|
|
|
607-359-00-8 |
(1S,4R,6R,7R)-(4-nitrophenylmethyl)3-methylene-1-oxo-7-phenylacetamido-cepham-4-carboxylateido-penam-3-carboxylate |
76109-32-5 |
R42 |
|
|
|
607-360-00-3 |
sodium 3-acetoacetylamino-4-methoxytolyl-6-sulfonate |
133167-77-8 |
R43 |
|
|
|
607-361-00-9 |
methyl (R)-2-(4-hydroxyphenoxy)propionate |
96562-58-2 |
Xi; R41, R52-53 |
|
|
|
607-362-00-4 |
reaction mass of: (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethyl)hexadec-4-enoate; (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethy |
- |
Xi; R38-41, N; R51-53 |
|
|
|
607-363-00-X |
methyl-3-methoxyacrylate |
5788-17-0 |
R43 |
|
|
|
607-364-00-5 |
3-phenyl-7-[4-(tetrahydrofurfuryloxy)phenyl]-1,5-dioxa-s-indacen-2,6-dione |
134724-55-3 |
R53 |
|
|
|
607-365-00-0 |
2-(2-amino-1,3-thiazol-4-yl)-(Z)-2-methoxyiminoacetyl chloride hydrochloride |
119154-86-8 |
Xn; R22, C; R34, R43 |
|
|
|
607-366-00-6 |
3,5-dimethylbenzoyl chloride |
6613-44-1 |
C; R34, R43 |
|
|
|
607-367-00-1 |
potassium bis(N-carboxymethyl)-N-methyl-glycinato-(2-)N,O,O,N)-ferrate-(1-) monohydrate |
153352-59-1 |
Xn; R22 |
|
|
|
607-368-00-7 |
1-(N,N-dimethylcarbamoyl)-3-tert-butyl-5-carbethoxymethylthio-1H-1,2,4-triazole |
110895-43-7 |
T; R23/25, N; R50-53 |
|
|
|
607-369-00-2 |
reaction mass of: trans-(2R)-5-acetoxy-1,3-oxathiolane-2-carboxylic acid; cis-(2R)-5-acetoxy-1,3-oxathiolane-2-carboxylic acid |
147027-04-1 |
Xn; R22, Xi; R38-41, R43 |
|
|
|
607-370-00-8 |
2-[[2-(acetyloxy)-3-(1,1-dimethyl-ethyl)-5-methylphenyl]methyl]-6-(1,1-dimethylethyl)-4-methylphenol |
41620-33-1 |
N; R50-53 |
|
|
|
607-371-00-3 |
3-ethyl 5-methyl 4-(2-chlorophenyl)-1,4-dihydro-2-[2-(1,3-dihydro-1,3-dioxo-(2H)isoindol-2-yl)-ethoxymethyl]-6-methyl-3,5-pyridinedicarboxylate |
88150-62-3 |
R53 |
|
|
|
607-372-00-9 |
ethoxylated bis phenol A di-(norbornene carboxylate) |
- |
R52-53 |
|
|
|
607-373-00-4 |
(±) tetrahydrofurfuryl (R)-2-[4-(6-chloroquinoxalin-2-yloxy)phenyloxy]propionate |
119738-06-6 |
Muta. Cat. 3; R68, Repr. Cat. 2; R61, Repr. Cat. 3; R62, Xn; R22-48/22, N; R50-53 |
|
E |
|
607-374-00-X |
5-amino-2,4,6-triiodo-1,3-benzenedicarbonyldichloride |
37441-29-5 |
R43, N; R51-53 |
|
|
|
607-375-00-5 |
reaction mass of: cis-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin; trans-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin |
90035-08-8 |
T+; R26/27/28, T; R48/23/24/25, N; R50-53 |
|
|
|
607-376-00-0 |
benzyl 2,4-dibromobutanoate |
23085-60-1 |
Repr. Cat. 3; R62, Xi; R38, R43, N; R50-53 |
|
|
|
607-377-00-6 |
trans-4-cyclohexyl-L-proline monohydrochloride |
90657-55-9 |
Repr. Cat. 3; R62, Xn; R22, Xi; R38-41, R43 |
|
|
|
607-378-00-1 |
ammonium (Z)-α-methoxyimino-2-furylacetate |
97148-39-5 |
F; R11 |
|
|
|
607-379-00-7 |
reaction mass of: 2-[N-(2-hydroxyethyl)stearamido]ethyl stearate; sodium [bis[2-(stearoyloxy)ethyl]amino]methylsulfonate; sodium [bis(2-hydroxyethyl)amino]methylsulfonate; N,N-bis(2-hydroxyethyl)stearamide |
- |
R52-53 |
|
|
|
607-380-00-2 |
reaction mass of: ammonium-1,2-bis(hexyloxycarbonyl)ethanesulfonate; ammonium-1-hexyloxycarbonyl-2-octyloxycarbonylethanesulfonate; ammonium-2-hexyloxycarbonyl-1-octyloxycarbonylethanesulfonate |
- |
Xi; R38-41, R52-53 |
|
|
|
607-381-00-8 |
reaction mass of triesters of 2,2-bis(hydroxymethyl)butanol with C7-alkanoic acids and 2-ethylhexanoic acid |
- |
R53 |
|
|
|
607-382-00-3 |
2-((4-amino-2-nitrophenyl)amino)benzoic acid |
117907-43-4 |
Xi; R41, R43, R52-53 |
|
|
|
607-383-00-9 |
reaction mass of: 2,2,6,6-tetramethylpiperidin-4-yl-hexadecanoate; 2,2,6,6-tetramethylpiperidin-4-yl-octadecanoate |
86403-32-9 |
Xi; R41, R43, N; R50-53 |
|
|
|
607-384-00-4 |
reaction mass of: esters of C14-C15 branched alcohols with 3,5-di-t-butyl-4-hydroxyphenyl propionic acid; C15 branched and linear alkyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoate; C13 branched and linear alkyl 3,5-bis(1,1-dimethylethyl)-4-hyd |
171090-93-0 |
R53 |
|
|
|
607-385-00-X |
Copolymer of vinyl-alcohol and vinyl acetate partially acetilized with 4-(2-(4-formylphenyl)ethenyl)-1-methylpyridinium methylsulfate |
125229-74-5 |
N; R51-53 |
|
|
|
607-386-00-5 |
reaction mass of: tetradecanoic acid (42.5-47.5 %); poly(1-7)lactate esters of tetradecanoic acid (52.5-57.5 %) |
174591-51-6 |
Xi; R38-41, R43, N; R50-53 |
|
|
|
607-387-00-0 |
reaction mass of: dodecanoic acid (35-40 %); poly(1-7)lactate esters of dodecanoic acid (60-65 %) |
58856-63-6 |
Xi; R38-41, R43, N; R50-53 |
|
|
|
607-388-00-6 |
4-ethylamino-3-nitrobenzoic acid |
2788-74-1 |
Xn; R22, R43, R52-53 |
|
|
|
607-389-00-1 |
trisodium N,N-bis(carboxymethyl)-3-amino-2-hydroxypropionate |
119710-96-2 |
Xn; R22 |
|
|
|
607-390-00-7 |
1,2,3,4-tetrahydro-6-nitro-quinoxaline |
41959-35-7 |
Xn; R22, N; R51-53 |
|
|
|
607-391-00-2 |
dimethylcyclopropane-1,1-dicarboxylate |
6914-71-2 |
R52-53 |
|
|
|
607-392-00-8 |
2-phenoxyethyl 4-((5-cyano-1,6-dihydro-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)azo)benzoate |
88938-37-8 |
R53 |
|
|
|
607-393-00-3 |
3-(cis-1-propenyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
106447-44-3 |
R43 |
|
|
|
607-394-00-9 |
5-methylpyrazine-2-carboxylic acid |
5521-55-1 |
Xi; R41 |
|
|
|
607-395-00-4 |
reaction mass of: sodium 1-tridecyl-4-allyl-(2 or 3)-sulfobutanedioate; sodium 1-dodecyl-4-allyl-(2 or 3)-sulfobutanedioate |
- |
C; R34, R43, N; R51-53 |
|
|
|
607-396-00-X |
bis(1,2,2,6,6-pentamethyl-4-piperidinyl) 2-(4-methoxybenzylidene)malonate |
147783-69-5 |
N; R50-53 |
|
|
|
607-397-00-5 |
reaction mass of: Ca salicylates (branched C10-14 and C18-30 alkylated); Ca phenates (branched C10-14 and C18-30 alkylated); Ca sulfurised phenates (branched C10-14 and C18-30 alkylated) |
- |
Repr. Cat. 3; R62, R43 |
|
|
|
607-398-00-0 |
ethyl N-(5-chloro-3-(4-(diethylamino)-2-methylphenylimino)-4-methyl-6-oxo-1,4-cyclohexadienyl)carbamate |
125630-94-6 |
N; R50-53 |
|
|
|
607-399-00-6 |
2,2-dimethyl 3-methyl-3-butenyl propanoate |
104468-21-5 |
Xi; R38, R52-53 |
|
|
|
607-400-00-X |
methyl 3-[[(dibutylamino)thioxomethyl]thio]propanoate |
32750-89-3 |
N; R50-53 |
|
|
|
607-401-00-5 |
ethyl 3-hydroxy-5-oxo-3-cyclohexene-1-carboxylate |
88805-65-6 |
Xi; R38-41, R43 |
|
|
|
607-402-00-0 |
methyl N-(phenoxycarbonyl)-L-valinate |
153441-77-1 |
R52-53 |
|
|
|
607-403-00-6 |
reaction mass of: bis(1S,2S,4S)-(1-benzyl-4-tert-butoxycarboxamido-2-hydroxy-5-phenyl)pentylammonium succinate; isopropyl alcohol |
- |
Xn; R48/22, Xi; R41, N; R50-53 |
|
|
|
607-404-00-1 |
reaction mass of: ((Z)-3,7-dimethyl-2,6-octadienyl)oxycarbonylpropanoic acid; di-((E)-3,7-dimethyl-2,6-octadienyl) butandioate; di-((Z)-3,7-dimethyl-2,6-octadienyl) butandioate; (Z)-3,7-dimethyl-2,6-octadienyl butandioate; ((E)-3,7-dimethyl-2,6-octadi |
- |
R43 |
|
|
|
607-405-00-7 |
2-hexyldecyl-p-hydroxybenzoate |
148348-12-3 |
N; R51-53 |
|
|
|
607-406-00-2 |
potassium 2,5-dichlorobenzoate |
184637-62-5 |
Xn; R22, Xi; R41 |
|
|
|
607-407-00-8 |
ethyl 2-carboxy-3-(2-thienyl)propionate |
143468-96-6 |
Xi; R38-41, R43 |
|
|
|
607-408-00-3 |
potassium N-(4-fluorophenyl)glycinate |
184637-63-6 |
Xn; R48/22, Xi; R41, R43, R52-53 |
|
|
|
607-409-00-9 |
reaction mass of: (3R)-[1S-(1α, 2α, 6β-((2S)-2-methyl-1-oxo-butoxy)-8aγ)hexahydro-2,6-dimethyl-1-naphthalene]-3,5-dihydroxyheptanoic acid; inert biomass from Aspergillus terreus |
- |
R43, R52-53 |
|
|
|
607-410-00-4 |
mono[2-(dimethylamino)ethyl]monohydrogen-2-(hexadec-2-enyl)butanedioate and/or mono[2-(dimethylamino)ethyl]monohydrogen-3-(hexadec-2-enyl)butanedioate |
779343-34-9 |
Xi; R38-41, R43, N; R50-53 |
|
|
|
607-411-00-X |
oxiranemethanol, 4-methylbenzene-sulfonate, (S)- |
70987-78-9 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Xi; R41, R43, N; R51-53 |
|
|
|
607-412-00-5 |
ethyl 2-(1-cyanocyclohexyl)acetate |
133481-10-4 |
Xn; R22-48/22, R52-53 |
|
|
|
607-413-00-0 |
trans-4-phenyl-L-proline |
96314-26-0 |
Repr. Cat. 3; R62, R43 |
|
|
|
607-414-00-6 |
tris(2-ethylhexyl)-4,4',4''-(1,3,5-triazine-2,4,6-triyltriimino)tribenzoate |
88122-99-0 |
R53 |
|
|
|
607-415-00-1 |
poly-(methyl methacrylate)-co-(butylmethacrylate)-co-(4-acryloxybutyl-isopropenyl-α, α-dimethylbenzyl carbamate)-co-(maleicanhydride) |
- |
F; R11, R43 |
|
|
|
607-416-00-7 |
4-(2-carboxymethylthio)ethoxy-1-hydroxy-5-isobutyloxycarbonylamino-N-(3-dodecyloxypropyl)-2-naphthamide |
- |
N; R50-53 |
|
|
|
607-417-00-2 |
3-chloropropyl chloroformiate |
628-11-5 |
T; R23, Xn; R22-48/22, Xi; R38-41, R43 |
|
|
|
607-418-00-8 |
2-ethylhexyl 4-aminobenzoate |
26218-04-2 |
N; R50-53 |
|
|
|
607-419-00-3 |
(3'-carboxymethyl-5-(2-(3-ethyl-3H-benzothiazol-2-ylidene)-1-methyl-ethylidene)-4,4'-dioxo-2'-thioxo-(2,5')bithiazolidinyliden-3-yl)-acetic acid |
166596-68-5 |
Xi; R41, R43 |
|
|
|
607-420-00-9 |
2,2-bis(hydroxymethyl)butanoic acid |
10097-02-6 |
Xi; R41, R52-53 |
|
|
|
607-421-00-4 |
cypermethrin cis/trans +/- 40/60; (RS)-α-cyano-3-phenoxybenzyl (1RS,3RS;1RS,3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
52315-07-8 |
Xn; R20/22, Xi; R37, N; R50-53 |
|
|
|
607-422-00-X |
α-cypermethrin (ISO); racemate comprising (R)-α-cyano-3-phenoxybenzyl (1S,3S)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate; (S)-α-cyano-3-phenoxybenzyl (1R,3R)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
67375-30-8 |
T; R25, Xn; R48/22, Xi; R37, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
607-423-00-5 |
esters of mecoprop and of mecoprop-P |
- |
Xn; R22, R43, N; R50-53 |
|
A |
|
607-424-00-0 |
trifloxystrobin (ISO); (E,E)-α-methoxyimino-{}{2-[[[[1-[3-(trifluoromethyl)phenyl]ethylidene]amino]oxy]methyl]benzeneacetic acid methyl ester |
141517-21-7 |
R43, N; R50-53 |
|
|
|
607-425-00-6 |
metalaxyl (ISO); methyl-N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-DL-alaninate |
57837-19-1 |
Xn; R22, R43, R52-53 |
|
|
|
607-426-00-1 |
1,2-benzenedicarboxylic acid, dipentylester, branched and linear; [1] n-pentyl-isopentylphthalate; [2] di-n-pentyl phthalate; [3] diisopentylphthalate [4] |
84777-06-0 [1], - [2], 131-18-0 [3], 605-50-5 [4] |
Repr. Cat. 2; R60-61, N; R50 |
|
|
|
607-427-00-7 |
bromoxynil heptanoate (ISO); 2,6-dibromo-4-cyanophenyl heptanoate |
56634-95-8 |
Repr. Cat. 3; R63, Xn; R20/22, R43, N; R50-53 |
|
|
|
607-428-00-2 |
tetrasodium ethylene diamine tetraacetate |
64-02-8 |
Xn; R22, Xi; R41 |
|
|
|
607-429-00-8 |
edetic acid; (EDTA) |
60-00-4 |
Xi; R36 |
|
|
|
607-430-00-3 |
BBP; benzyl butyl phthalate |
85-68-7 |
Repr. Cat. 2; R61, Repr. Cat. 3; R62, N; R50-53 |
|
|
|
607-431-00-9 |
prallethrin (ISO); ETOC; 2-methyl-4-oxo-3-(prop-2-ynyl)cyclopent-2-en-1-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
23031-36-9 |
T; R23, Xn; R22, N; R50-53 |
|
|
|
607-432-00-4 |
S-metolachlor; reaction mass of (S)-2-chloro-N-(2-ethyl-6-methyl-phenyl)-N-(2-methoxy-1-methyl-ethyl)-acetamide (80-100 %); [1] (R)-2-chloro-N-(2-ethyl-6-methyl-phenyl)-N-(2-methoxy-1-methyl-ethyl)-acetamide (0-20 %) [2] |
87392-12-9 [1], 178961-20-1 [2] |
R43, N; R50-53 |
|
|
|
607-433-00-X |
cypermethrin cis/trans +/- 80/20; (RS)-α-cyano-3-phenoxybenzyl (1RS; 3RS; 1RS, 3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
52315-07-8 |
Xn; R22, Xi; R37/38, R43, N; R50-53 |
|
|
|
607-434-00-5 |
mecoprop-P [1] and its salts; (R)-2-(4-chloro-2-methylphenoxy)propionic acid |
16484-77-8 |
Xn; R22, Xi; R41, N; R51-53 |
|
|
|
607-435-00-0 |
2S-isopropyl-5R-methyl-1R-cyclohexyl 2,2-dihydroxyacetate |
111969-64-3 |
Xn; R48/22, Xi; R41, N; R51-53 |
|
|
|
607-436-00-6 |
2-hydroxy-3-(2-ethyl-4-methylimidazoyl)propyl neodecanoate |
- |
Xi; R38-41, N; R50-53 |
|
|
|
607-437-00-1 |
3-(4-aminophenyl)-2-cyano-2-propenoic acid |
252977-62-1 |
R43 |
|
|
|
607-438-00-7 |
methyl-2-[(aminosulfonyl)methyl]benzoate |
112941-26-1 |
Xn; R22, Xi; R36 |
|
|
|
607-439-00-2 |
methyl tetrahydro-2-furancarboxylate |
37443-42-8 |
Xi; R41 |
|
|
|
607-440-00-8 |
methyl 2-aminosulfonyl-6-(trifluoromethyl)pyridine-3-c arboxylate |
144740-59-0 |
R43, N; R51-53 |
|
|
|
607-441-00-3 |
3-[3-(2-dodecyloxy-5-methylphenylcarbamoyl)-4-hydroxy-1-naphthylthio]propionic acid |
167684-63-1 |
R53 |
|
|
|
607-442-00-9 |
benzyl [hydroxy-(4-phenylbutyl)phosphinyl] acetate |
87460-09-1 |
Xi; R41 |
|
|
|
607-444-00-X |
reaction mass of: cis-1,4-dimethylcyclohexyl dibenzoate; trans-1,4-dimethylcyclohexyl dibenzoate |
35541-81-2 |
R53 |
|
|
|
607-445-00-5 |
Iron (III) tris(4-methylbenzenesulfonate) |
77214-82-5 |
Xi; R41 |
|
|
|
607-446-00-0 |
methyl 2-[4-(2-chloro-4-nitrophenylazo)-3-(1-oxopropyl)amino]phenylaminopropionate |
155522-12-6 |
R43, R53 |
|
|
|
607-447-00-6 |
sodium 4-[4-(4-hydroxyphenylazo)phenylamino]-3-nitrobenzenesulfonate |
156738-27-1 |
R43, R52-53 |
|
|
|
607-448-00-1 |
2,3,5,6-tetrafluorobenzoic acid |
652-18-6 |
Xi; R38-41 |
|
|
|
607-449-00-7 |
reaction mass of: 4,4',4''-[(2,4,6-trioxo-1,3,5(2H,4H,6H)-triazine-1,3,5-triyl)tris[methylene(3,5,5-trimethyl-3,1-cyclohexanediyl)iminocarbonyloxy-2,1-ethanediyl(ethyl)amino]]trisbenzenediazoniumtri[bis(2-methylpropyl)naphthalenesulfonate]; 4,4',4'',4''' |
- |
E; R2, R43, N; R50-53 |
|
|
|
607-450-00-2 |
2-mercaptobenzothiazolyl-(Z)-(2-aminothiazol-4-yl)-2-(tert-butoxycarbonyl) isopropoxyiminoacetate |
89604-92-2 |
R53 |
|
|
|
607-451-00-8 |
4-[4-amino-5-hydroxy-3-(4-(2-sulfoxyethylsulfonyl)phenylazo)-2,7-disulfonapht-6-ylazo]-6-[3-(4-amino-5-hydroxy-3-(4-(2-sulfoxyethylsulfonyl)phenylazo)-2,7-disulfonapht-6-ylazo]phenylcarbonylamino]benzenesulfonic acid, sodium salt |
161935-19-9 |
Xi; R41, R43 |
|
|
|
607-453-00-9 |
4-benzyl-2,6-dihydroxy-4-aza-heptylene bis(2,2-dimethyloctanoate) |
172964-15-7 |
R43, R53 |
|
|
|
607-454-00-4 |
reaction mass of: trans-2-(1-methylethyl)-1,3-dioxane-5-carboxylic acid; cis-2-(1-methylethyl)-1,3-dioxane-5-carboxylic acid |
116193-72-7 |
Xi; R41, R52-53 |
|
|
|
607-455-00-X |
1-amino-4-(3-[4-chloro-6-(2,5-di-sulfophenylamino)-1,3,5-triazin-2-ylamino]-2,2-dimethyl-propylamino)-anthraquinone-2-sulfonic acid, sodium/lithiumsalt |
172890-93-6 |
R43 |
|
|
|
607-456-00-5 |
3-amino-4-chlorobenzoic acid, hexadecyl ester |
143269-74-3 |
N; R51-53 |
|
|
|
607-457-00-0 |
tetrasodium dihydrogen 1,1''-dihydroxy-8,8''-[p-phenylbis(imino-{}{6-[4-(2-aminoethyl)piperazin-1-yl]}}-1,3,5-triazine-4,2-diyl-imino)]bis(2,2'-azonaphthalene-1',3,6-trisulfonate) |
172277-97-3 |
Xi; R41, N; R51-53 |
|
|
|
607-458-00-6 |
reaction mass of: 2-ethyl-[2,6-dibromo-4-[1-[3,5-dibromo-4-(2-hydroxyethoxy)phenyl]-1-methylethyl]phenoxy]propenoate; 2,2'-diethyl-[4,4'-bis(2,6-dibromophenoxy)-1-methylethylidene] dipropenoate; 2,2'-[(1-methylethylidene)bis[[2,6-dibromo-4,1-phenylene)o |
- |
N; R51-53 |
|
|
|
607-459-00-1 |
isopentyl 4-{}{2-[5-cyano-1,2,3,6-tetrahydro-1-(2-isopropoxyethoxy-carbonylmethyl)-4-methyl-2,6-dioxo-3-pyridylidene]hydrazino}}benzoate |
- |
R53 |
|
|
|
607-460-00-7 |
3-tridecyloxy-propyl-ammonium 9-octadecenoate |
778577-53-0 |
Xn; R48/22, Xi; R36/38, N; R50-53 |
|
|
|
607-461-00-2 |
reaction mass of: pentasodium 2-{}{4-{}{3-methyl-4-[6-sulfonato-4-(2-sulfonato-phenylazo)-naphthalen-1-ylazo]-phenylamino}}-6-[3-(2-sulfato-ethanesulfonyl)-phenylamino]-1,3,5-triazin-2-ylamino}}-benzene-1,4-disulfonate; pentasodium 2-{}{4-{}{3-methyl-4-[ |
- |
R52-53 |
|
|
|
607-462-00-8 |
reaction mass of: 1-hexyl acetate; 2-methyl-1-pentyl acetate; 3-methyl-1-pentyl acetate; 4-methyl-1-pentyl acetate; other mixed linear and branched C6-alkyl acetates |
88230-35-7 |
N; R51-53 |
|
|
|
607-463-00-3 |
3-(phenothiazin-10-yl)propionic acid |
362-03-8 |
N; R51-53 |
|
|
|
607-464-00-9 |
reaction mass of: 7-chloro-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid; 5-chloro-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid |
- |
R52-53 |
|
|
|
607-465-00-4 |
tris(2-hydroxyethyl)ammonium 7-{}{4-[4-(2-cyanoamino-4-hydroxy-6-oxidopyrimidin-5-ylazo)benzamido]-2-ethoxy-phenylazo}}naphthalene-1,3-disulfonate |
778583-04-3 |
R52-53 |
|
|
|
607-466-00-X |
reaction mass of: phenyl 1-(1-[2-chloro-5-(hexadecyloxycarbonyl)phenylcarbamoyl]-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazole-5-carboxylate; phenyl 2-(1-(2-chloro-5-(hexadecyloxycarbonyl)phenylcarbamoyl)-3,3-dimethyl-2-oxobutyl)-1H-2,3,3 |
- |
N; R51-53 |
|
|
|
607-467-00-5 |
1,1,3,3-tetrabutyl-1,3-ditinoxydicaprylate |
56533-00-7 |
Xn; R21/22-48/22, C; R34, N; R50-53 |
|
|
|
607-468-00-0 |
reaction mass of: monosodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonate; disodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6- |
- |
R43 |
|
|
|
607-469-00-6 |
disodium 7-((4,6-bis(3-diethylaminopropylamino)-1,3,5-triazine-2-yl)amino)-4-hydroxy-3-(4-(4-sulfonatophenylazo)phenylazo)-2-naphthalene sulfonate |
120029-06-3 |
R52-53 |
|
|
|
607-470-00-1 |
potassium sodium 6,13-dichloro-3,10-bis{}{2-[4-[3-(2-hydroxysulphonyloxyethanesulfonyl)phenylamino]-6-(2,5-disulfonatophenylamino)-1,3,5-triazin-2-ylamino]ethylamino}}benzo[5,6][1,4]oxazino[2,3-b]phenoxazine-4,11-disulfonate |
154336-20-6 |
Xi; R41, R52-53 |
|
|
|
607-471-00-7 |
1,6-bis((dibenzylthiocarbamoyl)disulfanyl)hexane |
151900-44-6 |
R53 |
|
|
|
607-473-00-8 |
pentaerythritol, dipentaerythritol, fatty acids, C6-10, mixed esters with adipic acid, heptanoic acid and isostearic acid |
187412-41-5 |
R43 |
|
|
|
607-474-00-3 |
(4-(4-(4-dimethylaminobenzyliden-1-yl)-3-methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid |
117573-89-4 |
R53 |
|
|
|
607-475-00-9 |
reaction mass of: tetrasodium 7-(4-[4-chloro-6-[methyl-(3-sulfonatophenyl)amino]-1,3,5-triazin-2-ylamino]-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate; tetrasodium 7-(4-[4-chloro-6-[methyl-(4-sulfonatophenyl)amino]-1,3,5-triazin-2-ylamino]-2-ureidoph |
148878-18-6 |
R43 |
|
|
|
607-476-00-4 |
trisodium N,N-bis(carboxymethyl)-β-alanine |
129050-62-0 |
C; R34, R52-53 |
|
|
|
607-477-00-X |
(1α5α6α)-6-nitro-3-benzyl-3-azabicyclo[3.1.0]hexane methanesulfonate salt |
- |
Xn; R22, Xi; R41, N; R51-53 |
|
|
|
607-478-00-5 |
tetramethylammonium hydrogen phthalate |
79723-02-7 |
T; R25, Xn; R48/22, N; R50 |
|
|
|
607-479-00-0 |
hexadecyl 4-chloro-3-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentamido]benzoate |
168689-49-4 |
R53 |
|
|
|
607-480-00-6 |
1,2-benzenedicarboxylic acid; di-C7-11-branched and linear alkylesters |
68515-42-4 |
Repr. Cat. 2; R61, Repr. Cat. 3; R62 |
|
|
|
607-481-00-1 |
reaction mass of: trihexyl citrate; dihexyloctyl citrate; dioctylhexyl citrate; dihexyldecyl citrate |
- |
R53 |
|
|
|
607-482-00-7 |
N-[1-(S)-ethoxycarbonyl-3-phenylpropyl]-l-alanyl-N-carboxyanhydride |
84793-24-8 |
Xi; R41, R43 |
|
|
|
607-483-00-2 |
1,2-benzenedicarboxylic acid; di-C6-8-branched alkylesters, C7-rich |
71888-89-6 |
Repr. Cat. 2; R61 |
|
|
|
607-484-00-8 |
ethyl 2-{[3-acetylamino-4-(6-bromo-2-methyl-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)phenyl]ethylamino}propionate |
221452-67-1 |
R53 |
|
|
|
607-485-00-3 |
(3S-trans)-phenyl-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)-1-piperidinecarboxylate |
- |
R53 |
|
|
|
607-486-00-9 |
potassium sodium 5'-(6-chloro-4-(2-(2-vinylsulfonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-4'-hydroxy-2,3'-azodinaphthalene-1,2',5,7'-disulfonate |
110081-40-8 |
R52-53 |
|
|
|
607-487-00-4 |
reaction mass of: disodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-hydroxy-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate; trisodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-oxido-1-(4-sul |
- |
Repr. Cat. 2; R61, R52-53 |
|
|
|
607-488-00-X |
ethyl (2-acetylamino-5-fluoro-4-isothiocyanatophenoxy)acetate |
147379-38-2 |
N; R50-53 |
|
|
|
607-489-00-5 |
reaction mass of: 2-ethylhexyl linolenate, linoleate and oleate; 2-ethylhexyl epoxyoleate; 2-ethylhexyl diepoxylinoleate; 2-ethylhexyl triepoxylinolenate |
71302-79-9 |
R43 |
|
|
|
607-490-00-0 |
N-[2-hydroxy-3-(C12-16-alkyloxy)propyl]-N-methyl glycinate |
- |
Xi; R41, R43 |
|
|
|
607-491-00-6 |
reaction mass of: diester of 4,4'-methylenebis[2-(2-hydroxy-5-methylbenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxonaphthalene-1-sulfonic acid (1:2); triester of 4,4'-methylenebis[2-(2-hydroxy-5-methylbenzyl)-3,6-dimethylphenol] and 6-diazo-5,6 |
- |
Carc. Cat. 3; R40 |
|
|
|
607-492-00-1 |
2-(1-(3',3'-dimethyl-1'-cyclohexyl)ethoxy)-2-methyl propyl propanoate |
141773-73-1 |
N; R51-53 |
|
|
|
607-493-00-7 |
methyl (3aR,4R,7aR)-2-methyl-4-(1S,2R,3-triacetoxypropyl)-3a,7a-dihydro-4H-pyrano[3,4-d]oxazole-6-carboxylate |
78850-37-0 |
Xi; R41 |
|
|
|
607-494-00-2 |
bis(2-ethylhexyl)octylphosphonate |
52894-02-7 |
N; R50-53 |
|
|
|
607-495-00-8 |
sodium 4-sulfophenyl-6-((1-oxononyl)amino)hexanoate |
168151-92-6 |
R43 |
|
|
|
607-496-00-3 |
2,2'-methylenebis(4,6-di-tert-butyl-phenyl)-2-ethylhexyl phosphite |
126050-54-2 |
R53 |
|
|
|
607-497-00-9 |
cerium oxide isostearate |
- |
R53 |
|
|
|
607-498-00-4 |
(E)-3,7-dimethyl-2,6-octadienylhexadecanoate |
3681-73-0 |
Xi; R38, R53 |
|
|
|
607-499-00-X |
bis(dimethyl-(2-hydroxyethyl)ammonium) 1,2-ethanediyl-bis(2-hexadecenylsuccinate) |
- |
Xi; R41, R43, N; R51-53 |
|
|
|
607-500-00-3 |
calcium 2,2,bis[(5-tetrapropylene-2-hydroxy)phenyl]ethanoate |
- |
Xi; R38, N; R50-53 |
|
|
|
607-501-00-9 |
reaction mass of: triphenylthiophosphate and tertiary butylated phenyl derivatives |
192268-65-8 |
R53 |
|
|
|
607-502-00-4 |
(N-benzyl-N,N,N-tributyl)ammonium 4-dodecylbenzenesulfonate |
178277-55-9 |
C; R34, Xn; R22, N; R51-53 |
|
|
|
607-503-00-X |
2,4,6-tri-n-propyl-2,4,6-trioxo-1,3,5,2,4,6-trioxatriphosphorinane |
68957-94-8 |
C; R34 |
|
|
|
607-504-00-5 |
diammonium 1-hydroxy-2-(4-(4-carboxyphenylazo)-2,5-dimethoxyphenylazo)-7-amino-3-naphthalenesulfonate |
- |
Repr. Cat. 3; R62, T; R25, Xn; R48/22, N; R50-53 |
|
|
|
607-505-00-0 |
pentasodium 7-(4-(4-(5-amino-4-sulfonato-2-(4-((2-(sulfonato-ethoxy)sulfonyl)phenylazo)phenylamino)-6-chloro-1,3,5-triazin-2-yl)amino-2-ureidophenylazo)naphtalene-1,3,6-trisulfonate |
- |
R52-53 |
|
|
|
607-506-00-6 |
reaction mass of: strontium (4-chloro-2-((4,5-dihydro-3-methyl-5-oxo-1-(3-sulfonatophenyl)-1H-pyrazol-4-yl)azo)-5-methyl)benzenesulfonate; disodium (4-chloro-2-((4,5-dihydro-3-methyl-5-oxo-1-(3-sulfonatophenyl)-1H-pyrazol-4-yl)azo)-5-methyl)benzenesulfon |
- |
N; R51-53 |
|
|
|
607-507-00-1 |
potassium,sodium 2,4-diamino-3-[4-(2-sulfonatoethoxysulfonyl)phenylazo]-5-[4-(2-sulfonatoethoxysulfonyl)-2-sulfonatophenylazo]-benzenesulfonate |
187026-95-5 |
Xi; R41 |
|
|
|
607-508-00-7 |
disodium 3,3'-[iminobis[sulfonyl-4,1-phenylene-(5-hydroxy-3-methylpyrazole-1,4-diyl)azo-4,1-phenylenesulfonylimino-(4-amino-6-hydroxypyrimidine-2,5-diyl)azo-4,1-phenylenesulfonylimino(4-amino-6-hydroxypyrimidine-2,5-diyl)azo]bis(benzenesulfonate)] |
- |
Xi; R41 |
|
|
|
607-509-00-2 |
2-phenoxyethyl 4-aminobenzoate |
88938-23-2 |
N; R51-53 |
|
|
|
607-510-00-8 |
(2S,5R)-6,6-dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide |
76646-91-8 |
Xn; R22, Xi; R38-41, R43 |
|
|
|
607-511-00-3 |
reaction mass of: 4-[(3-decyloxypropyl)(3-isobutoxy-1-isobutoxycarbonyl-3-oxopropyl)amino]-4-oxobutyric acid; 4-[(3-isobutoxy-1-isobutoxycarbonyl-3-oxopropyl)(3-octyloxypropyl)amino]-4-oxobutyric acid |
- |
Xi; R36, N; R51-53 |
|
|
|
607-512-00-9 |
trisodium 2,4-diamino-3,5-bis-[4-(2-sulfonatoethoxy)sulfonyl)phenylazo]benzenesulfonate |
182926-43-8 |
R52-53 |
|
|
|
607-513-00-4 |
reaction mass of: Trisodium 4-benzoylamino-6-(6-ethenesulfonyl-1-sulfato-naphthalen-2-ylazo)-5-hydroxynaphthalene-2,7-disulfonate; 5-(benzoylamino)-4-hydroxy-3-((1-sulfo-6-((2-(sulfooxy)ethyl)sulfonyl)-2-naphthyl)azo)naphthalene-2,7-disulfonic acid sodiu |
- |
Xi; R41, R43, R52-53 |
|
|
|
607-514-00-X |
potassium N-(1-methoxy-1-oxobut-2-en-3-yl)valinate |
134841-35-3 |
R43 |
|
|
|
607-515-00-5 |
reaction mass of: disodium hexyldiphenyl ether disulphonate; disodium dihexyldiphenyl ether disulphonate |
147732-60-3 |
Xi; R36, N; R51-53 |
|
|
|
607-516-00-0 |
N,N'-bis(trifluoroacetyl)-S,S'-bis L-homocysteine |
105996-54-1 |
Xi; R41, R43 |
|
|
|
607-517-00-6 |
(S)-α-(acetylthio)benzenepropanoic acid |
76932-17-7 |
Xn; R22, Xi; R41, R43 |
|
|
|
607-518-00-1 |
3-oxoandrost-4-ene-17-β-carboxylic acid |
302-97-6 |
Repr. Cat. 3; R62, R53 |
|
|
|
607-519-00-7 |
poly-[((4-((4-ethyl-ethylene)amino)phenyl)-((4-(ethyl-(2-oxyethylene)amino)phenyl)methinyl)cyclohexa-2,5-dienylidene)-N-ethyl-N-(2-hydroxyethyl)ammonium acetate] |
176429-27-9 |
Xi; R37/38-41, N; R50-53 |
|
|
|
607-520-00-2 |
reaction mass of: sodium 4,5-dihydro-2-[(propionato)(C6-18)alkyl]-3H-imidazolium-N-ethylphosphate; disodium 4,5-dihydro-2-[(dipropionato)(C6-18)alkyl]-3H-imidazolium-N-ethylphosphate |
- |
Xi; R41, R43 |
|
|
|
607-521-00-8 |
tetraethyl N,N'-(methylenedicyclohexane-4,1-diyl)bis-dl-aspartate |
136210-30-5 |
R43, R52-53 |
|
|
|
607-522-00-3 |
sodium salt of the polymer of: sodium 2-methyl-buta-1,3-diene-1-sulfonate with acrylic acid and 2-hydroxyethyl-2-methylacrylate |
184246-86-4 |
R52-53 |
|
|
|
607-523-00-9 |
reaction mass of mono to tetra(lithium and/or sodium)3-amino-10-[4-(4-amino-3-sulfonatoanilino)-6-[methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2-ylamino]-6-13-dichlorobenzo[1,2-B:4,5-B']di[1,4]benzoxazine-4,11-disulfonate; mono to tetra(lithium and/or sodium)3-amino-10-[4,6-bis(4-amino-3-sulfonatoanilino)-1,3,5-triazin-2-ylamino]-6-13-dichlorobenzo[1,2-B:4,5-B']di[1,4]benzoxazine-4,11-disulfonate; mono to penta(lithium and/or sodium)10,10´-diamino-6,6',13,13´-tetrachloro-3,3'-[6-[methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2,4-diyldiimino]bis[benzo[1,2-B:4,5-B']di[1,4]benzoxazine-4,11-disulfonate; mono to hepta(lithium and/or sodium)10-amino-6,6',13,13'-tetrachloro-10´[4-(4-amino-3-sulfonatoanilino)-[6-methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2,4-diimino]bis[benzo[1,2-B:4,5-B']di[1,4]benzoxazine-4,11-disulfonate; mono to hepta(lithium and/or sodium)10,10'-diamino-6,6',3,3'[(2-sulfonato)-1,4-phenylenediiminobis[6-methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2,4-diyldiimino]bis[benzo[1,2-B:4,5-B']di[1,4]benzoxazine-4,11-disulfonate |
- |
Xi; R41, R52-53 |
|
|
|
607-524-00-4 |
tall oil 2-[(tetrahydro-2H-pyran-2-yl) thio]ethyl esters |
- |
R53 |
|
|
|
607-525-00-X |
(Z)-2-methoxymino-2-[2-(tritylamino)thiazol-4-yl]acetic acid |
64485-90-1 |
E; R2, Carc. Cat. 3; R40, R52-53 |
|
|
|
607-526-00-5 |
cartap (ISO); 1,3-bis(carbamoylthio)-2-(dimethylamino)propane |
15263-53-3 |
N; R50-53 |
|
|
|
607-527-00-0 |
reaction mass of: 1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-tridecafluorooctyl)dodecanedioate; 1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-heptdecafluorodecyl)dodecanedioate; 1-(1'H,1'H,2'H,2'H-tridecafluorooctyl) |
- |
Xn; R48/22 |
|
|
|
607-528-00-6 |
(S)-3-methyl-2-(2-oxotetrahydropyrimidine-1-yl)butyric acid |
192725-50-1 |
Xi; R41 |
|
|
|
607-529-00-1 |
benzyl cis-4-ammonium-4'-toluenesulfonato-1-cyclohexanecarboxylate |
67299-45-0 |
R52-53 |
|
|
|
607-530-00-7 |
reaction mass of isomers of: C7-9-alkyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate |
125643-61-0 |
R53 |
|
|
|
607-531-00-2 |
methyl 3-amino-4,6-dibromo-2-methyl-benzoate |
119916-05-1 |
Xn; R48/22, N; R51-53 |
|
|
|
607-532-00-8 |
(S)-1-[2-tert-butoxycarbonyl-3-(2-methoxyethoxy)propyl]-1-cyclopentanecarboxylic acid, cyclohexylamine salt |
167944-94-7 |
R52-53 |
|
|
|
607-533-00-3 |
pentasodium monohydrogen 6-chloro-3,10-bis[2-[4-chloro-6-(2,4-disulfophenylamino)-1,3,5-triazin-2-yl-amino]ethylamino]-13-ethylbenzo[5.6][1.4]oxazino[2,3-b]phenoxazine-4,11-disulfonate |
- |
Xi; R41, R43 |
|
|
|
607-534-00-9 |
ethyl 2-(3-benzoylphenyl)propanoate |
60658-04-0 |
T; R25-48/25, R43, N; R51-53 |
|
|
|
607-535-00-4 |
potassium 4-iodo-2-sulfonato-benzoic acid |
- |
Xi; R41, R52-53 |
|
|
|
607-536-00-X |
(2,6-xylyloxy) acetic acid |
13335-71-2 |
Xn; R22, Xi; R41, R52-53 |
|
|
|
607-537-00-5 |
isopropylammonium 2-(3-benzoylphenyl)propionate |
- |
T; R25-48/25, Xn; R21, Xi; R41, N; R50-53 |
|
|
|
607-539-00-6 |
propyl((4-(5-oxo-3-propylisoxazolidin-4-ylidenmethin)phenyl)propoxycarbonylmethyleneamino)acetate |
198705-81-6 |
R53 |
|
|
|
607-540-00-1 |
1-(mercaptomethyl)cyclopropylacetic acid |
162515-68-6 |
C; R34, Xn; R21/22, R43, N; R51-53 |
|
|
|
607-541-00-7 |
[(1-methyl-1,2-ethanediyl)bis[nitrilobis(methylene)]]tetrakis(phosphonic acid) |
28698-31-9 |
Xi; R41, N; R50-53 |
|
|
|
607-542-00-2 |
methyl 2-(4-butanesulfonamidophenoxy)tetradecanoate |
- |
N; R50-53 |
|
|
|
607-543-00-8 |
poly-[((4-((4-(ethyl-ethylene)amino)phenyl)-(4-(ethyl-(2-oxyethylene)amino)phenyl)methinyl)-3-methylcyclohexa-2,5-dienylidene)-N-ethyl-N-(2-hydroxyethyl)ammonium acetate] |
176429-22-4 |
Xi; R37/38-41, N; R50-53 |
|
|
|
607-544-00-3 |
ethyl 6,8-difluoro-1-(formylmethylamino)-1,4-dihydro-7-(4-methyl)piperazin-1-yl)-4-oxo-quinoline-3-carboxylate |
158585-86-5 |
R52-53 |
|
|
|
607-545-00-9 |
1,2-dimethyl-3-(1-methylethenyl)cyclopentyl acetate |
94346-09-5 |
Xi; R38, N; R51-53 |
|
|
|
607-546-00-4 |
reaction mass of: methyl {[5-acetylamino-4-(2-chloro-4-nitrophenylazo)phenyl]methoxycarbonylmethylamino}acetate; methyl {[5-acetylamino-4-(2-chloro-4-nitrophenylazo)phenyl]ethoxycarbonylmethylamino}acetate |
188070-47-5 |
R43 |
|
|
|
607-547-00-X |
18-methylnonadecyl 2,2 -dimethylpropanoate |
125496-22-2 |
Xi; R38, R43, R53 |
|
|
|
607-548-00-5 |
1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethanone methanesulfonate |
154486-26-7 |
Xn; R22, Xi; R41, N; R51-53 |
|
|
|
607-549-00-0 |
methyl (E)-2((3-(1,3-benzodioxol-5-yl)-2-methyl-1-propenyl)amino)benzoate |
125778-19-0 |
N; R50-53 |
|
|
|
607-550-00-6 |
2-amino-4-bromo-5-chlorobenzoic acid |
- |
Xi; R41, R52-53 |
|
|
|
607-551-00-1 |
tetrabutylammonium 2-amino-6-iodopurinate |
156126-48-6 |
Xn; R21/22-48/22, Xi; R38-41, R43, N; R51-53 |
|
|
|
607-552-00-7 |
hexadecyl 3-amino-4-isopropoxybenzoate |
- |
R53 |
|
|
|
607-553-00-2 |
7-amino-4-hydroxy-2-naphthalenesulfonic acid, coupled with 5 (or 8) -amino-8 (or 5)-[[4-[[4-[[4-amino-6(or 7)-sulfo-1-naphthyl]azo]phenyl]amino]-3-sulfophenyl]azo]-2-naphthalenesulfonic acid and 4-hydroxy-7-(phenylamino)-2-naphthalenesulfonic acid, sodium salt |
- |
Xi; R41 |
|
|
|
607-554-00-8 |
2,4-diamino-5-[4-[(2-sulfoxyl ethyl)sulfonyl]phenylazo]benzenesulfonic acid |
27624-67-5 |
E; R3, Xi; R41, R52-53 |
|
|
|
607-555-00-3 |
1,1,3,3-tetramethylbutylperoxypivalate |
22288-41-1 |
F; R11, O; R7, Xi; R38, R43, N; R51-53 |
|
|
|
607-556-00-9 |
2-acetoxymethylene-4-acetylphenylacetate |
24085-06-1 |
Xn; R22-48/22, Xi; R41, R43, N; R50-53 |
|
|
|
607-557-00-4 |
salt of: (1S-cis)-1-amino-2,3-dihydro-1H-inden-2-ol and [R-[R*R*]]-2,3-dihydroxybutanedioic acid |
169939-84-8 |
R43 |
|
|
|
607-558-00-X |
2S-isopropyl-5R-methyl-1R-cyclohexyl (2R,5S)-5-(4-amino-2-oxo-2H-pyrimidin-1-yl)-[1.3]-oxathiolane-2-carboxylate |
147027-10-9 |
N; R51-53 |
|
|
|
607-559-00-5 |
coconut oil, reaction products with glycerol esters of 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid |
179986-09-5 |
R53 |
|
|
|
607-560-00-0 |
(R,S)-2-butyloctanedioic acid |
50905-10-7 |
Xi; R41 |
|
|
|
607-561-00-6 |
sodium 4-hydroxy-3-(N'-(2-(2-hydroxyethylenesulfonyl)ethylene)ureido)-5-nitrobenzenesulfonate |
- |
R43, R52-53 |
|
|
|
607-562-00-1 |
reaction mass of: (2R,3R)-3-(2-ethoxyphenoxy)-2-hydroxy-3-phenylpropylammonium methanesulfonate; (2S,3S)-3-(2-ethoxyphenoxy)-2-hydroxy-3-phenylpropylammonium methanesulfonate |
98769-75-6 |
Xn; R22, Xi; R41, N; R51-53 |
|
|
|
607-563-00-7 |
5,7-dichloro-4-hydroxyquinoline-3-carboxylic acid |
171850-30-9 |
N; R51-53 |
|
|
|
607-564-00-2 |
1,6-hexanediammonium, sodium 5-sulfato-1,3-benzenedicarboxylate |
51178-75-7 |
R43 |
|
|
|
607-565-00-8 |
3-ethyl 5-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-3,5-pyridinedicarboxylate |
88150-42-9 |
T; R25, Xn; R48/22, Xi; R41, N; R50-53 |
|
|
|
607-566-00-3 |
reaction mass of: dodecylphenyl dodecylhydroxybenzenecarboxylate; bis(dodecylphenyl)dodecyl hydroxybenzenedicarboxylate |
- |
R53 |
|
|
|
607-567-00-9 |
potassium 3-iodo-6-methylbenzenesulfonate |
- |
Xi; R41 |
|
|
|
607-568-00-4 |
potassium 2-chloro-3-(benzyloxy)propionate |
138666-92-9 |
Xn; R22-48/22, Xi; R41, R43 |
|
|
|
607-569-00-X |
reaction mass of: sodium 2-amino-4-(2,6-difluoropyrimidin-4-ylamino)benzenesulfonate; sodium 2-amino-4-(4,6-difluoropyrimidin-4-ylamino)benzenesulfonate |
- |
R43 |
|
|
|
607-570-00-5 |
sodium (6R-trans)-7-amino-8-oxo-3-[[[1-(sulfomethyl)-1H-tetrazol-5-yl]thio]methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate monohydrate |
71420-85-4 |
R43 |
|
|
|
607-571-00-0 |
2-cyclopentene-1-acetic acid, 3-hydroxy-2-pentyl-, methyl ester acetate |
57374-49-9 |
R43, N; R51-53 |
|
|
|
607-572-00-6 |
diethyl thiophosphoryl (Z)-(2-aminothiazol-4-yl)methoxyimino acetate |
162208-27-7 |
Xn; R21/22-48/22, R43, N; R50-53 |
|
|
|
607-573-00-1 |
reaction mass of: disodium 7-(2,4-difluoropyrimidin-6-ylamino)-4-hydroxy-3-(4-methoxy-2-sulfonatophenylazo)naphthalene-2-sulfonate; disodium 7-(4,6-difluoropyrimidin-2-ylamino)-4-hydroxy-3-(4-methoxy-2-sulfonatophenylazo)naphthalene-2-sulfonate |
- |
Xi; R41 |
|
|
|
607-574-00-7 |
[1R-(1-α,2β,5α)]-mono[5-methyl-2-(1-methylethyl)cyclohexyl]butanedioate |
77341-67-4 |
Xi; R41 |
|
|
|
607-575-00-2 |
4-(5-(5-[1-(4-carboxyphenyl)hexahydro-2,4,6-trioxopyrimidin-5-ylidene]penta-1,3-dienyl)-1,2,3,4-tetrahydro-6-hydroxy-2,4-dioxopyrimidin-1-yl)benzoic acid-triethylamine salt |
- |
Xi; R37, R52-53 |
|
|
|
607-576-00-8 |
branched, octyl 3-[3,5-di(tert-butyl)-4-hydroxyphenyl]propanoate |
- |
N; R50-53 |
|
|
|
607-577-00-3 |
(2R*,3S*)-2-(2,4-difluorophenyl)-3-(5-fluoro-4-pyrimidinyl)-1-(1H-1,2,4-triazol-1-yl)butan-2-ol (1R)-10-camphorsulfonate |
- |
Xn; R22, Xi; R41, R43, R52-53 |
|
|
|
607-578-00-9 |
ethyl 4-((4-diethylamino-2-methylphenyl)imino)-4,5-dihydro-1-isopropyl-5-oxo-1H-pyrazole-3-carboxylate |
- |
Xn; R22-48/22, R53 |
|
|
|
607-579-00-4 |
diethyl[(p-ethoxyanilino)methylene]malonate |
103976-28-9 |
Xn; R22, N; R51-53 |
|
|
|
607-580-00-X |
ethyl 7-chloro-1-(2,4-difluorophenyl)-6-fluoro-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylate |
100491-29-0 |
R43, N; R51-53 |
|
|
|
607-581-00-5 |
ethyl 2-ethoxy-4-carboxymethylbenzoate |
99469-99-5 |
Xi; R41 |
|
|
|
607-582-00-0 |
reaction mass of: tetrasodium 7-(4-(4-fluoro-6-(4-(2-sulfonatoethylsulfonyl)phenylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate; tetrasodium 7-(4-(4-hydroxy-6-(4-(2-sulfonatoethylsulfonyl)phenylamino)-1,3,5-triazin-2-yl |
- |
R52-53 |
|
|
|
607-583-00-6 |
4-amino-3-[[4-[[2-(sulfooxy)ethyl]sulfonyl]phenyl]azo]-1-naphthalene sulfonic acid |
188907-52-0 |
Xi; R41, R43, R52-53 |
|
|
|
607-584-00-1 |
trisodium 3-[2-acetylamino-4-[4-chloro-6-[4-(2-sulfonatoxyethylsulfonyl)phenylamino]-1,3,5-triazine-2-ylamino]phenylazo]naphthalene-1,5-disulfonate |
215612-56-9 |
Xi; R41, R43, R52-53 |
|
|
|
607-585-00-7 |
strontium 2-[(2-hydroxy-6-sulfonato-1-naphthyl)azo]naphthalene-1-sulfonate |
- |
R43 |
|
|
|
607-586-00-2 |
dodecyl 3-amino-4-chlorobenzoate |
6195-20-6 |
R43, R53 |
|
|
|
607-587-00-8 |
ethyl cis-4-[4-[[2-(2,4-dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine-1-carboxylate |
67914-69-6 |
Xn; R22-48/22, N; R50-53 |
|
|
|
607-588-00-3 |
reaction mass of: 2-ethylhexyl 2,3,4,5-tetrabromobenzoate; bis(2-ethylhexyl) 3,4,5,6-tetrabromophthalate |
- |
R43, N; R50-53 |
|
|
|
607-589-00-9 |
tetrakis(1,2,2,6,6-pentamethyl-4-piperidyl)-1,2,3,4-butanetetracarboxylate |
91788-83-9 |
T; R48/25, Xn; R22, N; R50-53 |
|
|
|
607-590-00-4 |
hexadecyl 3-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxovaleramido]-4-isopropoxybenzoate |
210706-50-6 |
R53 |
|
|
|
607-591-00-X |
reaction mass of: trisodium 5-(4-fluoro-6-morpholin-4-yl-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(4-(2-sulfooxyethanesulfonyl)phenylazo)naphthalene-2,7-disulfonate; disodium 3-(4-ethenesulfonylphenylazo)-5-(4-fluoro-6-morpholin-4-yl-1,3,5-triazin-2-ylamino) |
- |
Xi; R41 |
|
|
|
607-592-00-5 |
di(C9-11-alkyl) cyclohexane-1,4-dicarboxylate |
- |
R53 |
|
|
|
607-593-00-0 |
4-(2-methylacryloyloxy)phenyl 4-allyloxybenzoate |
159235-16-2 |
R43, R52-53 |
|
|
|
607-594-00-6 |
ethyl (1S,5R,6S)-5-(1-ethylpropoxy)-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate |
204254-96-6 |
Xn; R48/22, R43 |
|
|
|
607-595-00-1 |
N-amidino-N-methylglycine-2-oxopropionate |
208535-04-0 |
Xi; R41 |
|
|
|
607-596-00-7 |
ethyl 2-(4-phenoxyphenyl)lactate |
132584-17-9 |
R43, N; R50-53 |
|
|
|
607-597-00-2 |
tetrasodium 4,4'-bis{4-[4-(2-hydroxyethylamino)-6-(4-sulfonatoanilino)-1,3,5-triazin-2-ylamino]phenylazo}stilbene-2,2'-disulfonate |
- |
Xi; R41 |
|
|
|
607-598-00-8 |
trisodium 3-amino-4-[4-[4-(2-(2-ethenylsulfonylethoxy)ethylamino)-6-fluoro-1,3,5-triazine-2-ylamino]-2-sulfophenylazo]-5-hydroxynaphthalene-2,7-disulfonate |
212652-59-0 |
Xi; R41 |
|
|
|
607-599-00-3 |
1,1-dimethylpropyl 3,5,5-trimethylperoxyhexanoate |
68860-54-8 |
O; R7, R43, N; R50-53 |
|
|
|
607-600-00-7 |
(1S,1'R)-[1-(3',3'-dimethyl-1'-cyclohexyl)ethoxycarbonyl]methyl propanoate |
- |
N; R51-53 |
|
|
|
607-601-00-2 |
1,4-dihydroxy-2,2,6,6-tetramethyl piperidinium-2-hydroxy-1,2,3-propanetricarboxylate |
220410-74-2 |
Xn; R22 |
|
|
|
607-602-00-8 |
ethyl (3-cyanomethyl-3,4-dihydro-4-oxophthalazin-1-yl)acetate |
122665-86-5 |
R43, R52-53 |
|
|
|
607-603-00-3 |
lithium sodium 4,4',4''-(nitrilotris(ethane-2,1-diylimino(6-chloro-1,3,5-triazine-4,2-diyl)imino))tris(5-hydroxy-6-(1-sulfonaphthalene-2-ylazo)-2,7-naphthalene)disulfonate |
193562-37-7 |
Xi; R41, R43 |
|
|
|
607-604-00-9 |
guanidinium benzoate |
26739-54-8 |
Xn; R22 |
|
|
|
607-605-00-4 |
methyl 4-iodo-2-(3-(4-methoxy-6-methyl-1,3,5-triazine-2-yl)ureidosulfonyl)benzoate |
144550-06-1 |
N; R50-53 |
|
|
|
607-606-00-X |
(Z)-2-(2-t-butoxycarbonylamino-4-thiazolyl)pent-2-enoic acid |
86978-24-7 |
Xn; R22 |
|
|
|
607-607-00-5 |
reaction mass of: calcium bis(C10-14 branched alkyl salicylate); calcium bis(C18-30-alkyl salicylate); calcium C10-14 branched alkylsalicylato-C18-30-alkyl salicylate; calcium bis (C10-14 branched alkyl phenolate); calcium bis (C18-30-alkyl phenolate) |
- |
Xi; R38, N; R51-53 |
|
|
|
607-608-00-0 |
pentapotassium 2-(4-{5-[1-(2,5-disulfophenyl)-4,5-dihydro-3-methylcarbamoyl-5-oxopyrazol-4-ylidene]-3-(2-pyrrolidinone-1-yl)-1,3-pentadienyl}-3-methylcarbamoyl-5-oxopyrazol-1-yl)benzene-1,4-disulfonate |
- |
N; R50-53 |
|
|
|
607-609-00-6 |
ethyl (3R)-4-cyano-3-hydroxybutanoate |
141942-85-0 |
Xi; R36 |
|
|
|
607-610-00-1 |
trisodium 4-hydroxy-6-(sulfonatomethylamino)-5-(2-(2-sulfatoethylsulfonyl)phenylazo)naphthalene-2-sulfonate |
- |
R43 |
|
|
|
607-611-00-7 |
methyl 3-amino-2,2,3-trimethylbutyrate |
90886-53-6 |
C; R34, Xn; R22, R52-53 |
|
|
|
607-612-00-2 |
reaction mass of: 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octanesulfonic acid; ammonium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octanesulfonate |
182176-52-9 |
Xn; R22-48/22, Xi; R41 |
|
|
|
607-613-00-8 |
reaction mass of: succinic acid; monopersuccinic acid; dipersuccinic acid; monomethyl ester of succinic acid; monomethyl ester of persuccinic acid; dimethyl succinate; glutaric acid; monoperglutaric acid; diperglutaric acid; monomethyl ester of g |
- |
Muta. Cat. 3; R68, C; R34, Xn; R20/21/22 |
|
|
|
607-614-00-3 |
2-(10-oxo-10H-9-oxa-10-phosphaphenanthren-10-ylmethyl)succinic acid |
63562-33-4 |
R43, R52-53 |
|
|
|
607-615-00-9 |
reaction product of thioglycerol and mercaptoacetic acid consisting mainly of 3-mercapto-1,2-bismercaptoacetoxypropane and oligomers of this substance |
- |
T; R23, Xn; R22, Xi; R36, R43 |
|
|
|
607-616-00-4 |
2,4-dichloro-5-fluorobenzoylchloride |
86393-34-2 |
Xi; R37/38-41, R43, R52-53 |
|
|
|
607-617-00-X |
bis(2-ethylhexyl)-4,5-epoxycyclohexane-1,2-dicarboxylate |
10138-36-0 |
R43 |
|
|
|
607-618-00-5 |
menadione sodium bisulfite; 2-naphthalenesulfonic acid,1,2,3,4-tetrahydro-2-methyl-1,4-dioxo-, sodium salt |
130-37-0 |
Xi; R36/38, N; R50-53 |
|
|
|
607-619-00-0 |
menadione nicotinamide bisulfite; 1,2,3,4-tetrahydro-2-methyl-1,4-dioxonaphthalene-2-sulfonic acid, compound with nicotin-3-amide (1:1) |
73581-79-0 |
Xi; R36/38, N; R50-53 |
|
|
|
607-620-00-6 |
trisodium nitrilotriacetate |
5064-31-3 |
Carc. Cat. 3; R40, Xn; R22, Xi; R36 |
C ≥ 5 %: Carc. Cat. 3; R40 |
|
|
607-621-00-1 |
milbemectin (ISO); [reaction mass of milbemycin A3 (CAS No 51596-10-2) and milbemycin A4 (CAS No 51596-11-3) (30:70)] |
- |
Xn; R20/22, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
607-622-00-7 |
2-ethylhexyl-2-ethylhexanoate |
7425-14-1 |
Repr. Cat. 3; R63 |
|
|
|
607-623-00-2 |
diisobutyl phthalate |
84-69-5 |
Repr. Cat. 2; R61, Repr. Cat. 3; R62 |
C ≥ 25 %: Repr. Cat. 2; R61, C ≥ 5 %: Repr. Cat. 3; R62 |
|
|
607-624-00-8 |
perfluorooctane sulfonic acid; heptadecafluorooctane-1-sulfonic acid; [1] potassium perfluorooctanesulfonate; potassium heptadecafluorooctane-1-sulfonate; [2] diethanolamine perfluorooctane sulfonate; [3] ammonium perfluorooctane sulfonate; ammonium |
1763-23-1 [1], 2795-39-3 [2], 70225-14-8 [3], 29081-56-9 [4], 29457-72-5 [5] |
Carc. Cat. 3; R40, Repr. Cat. 2; R61, T; R48/25, Xn; R20/22, R64, N; R51-53 |
|
E |
|
607-625-00-3 |
clodinafop-propargyl (ISO) |
105512-06-9 |
Xn; R22-48/22, R43, N; R50-53. |
C ≥ 0,001 %: R43, C ≥ 25 %: N; R50-53, 2,5 % ≤ C < 25 %: N; R51-53, 0,25 % ≤ C < 2,5 %: R52-53 |
|
|
607-626-00-9 |
ethyl 1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1H-1,2,4-triazole-3-carboxylate |
103112-35-2 |
Carc.Cat.2; R45, N; R50-53 |
|
|
|
607-627-00-4 |
[(4S,5S)-4-benzyl-2-oxo-5-oxazolidinyl]methyl 4-nitrobenzenesulfonate |
162221-28-5 |
R43 |
|
|
|
607-628-00-X |
4-oxo-4-(p-tolyl)butyric acid adduct with 4-ethylmorpholine |
171054-89-0 |
Xi; R41 |
|
|
|
607-629-00-5 |
[[2-methyl-1-(1-oxopropoxy)propoxy](4-phenylbutyl)phosphinyl] acetic acid |
123599-82-6 |
Xi; R36 |
|
|
|
607-630-00-0 |
acrylic acid, 3-(trimethoxysilyl)propyl ester |
4369-14-6 |
Xn; R20, C; R34, R43, R52-53 |
|
|
|
607-631-00-6 |
reaction mass of: 2-(2-((oxo(phenyl)acetyl)oxy)ethoxy)ethyl oxo(phenyl)acetate; (2-(2-hydroxyethoxy)ethyl) oxo(phenyl)acetate |
- |
R43 |
|
|
|
607-632-00-1 |
N-[3-(2,4-di-(1,1-dimethyl-propyl)phenoxy)-propyl]-1-hydroxy-5-(2-methylpropyl-oxycarbonylamino)-naphthamide |
111244-14-5 |
R53 |
|
|
|
607-633-00-7 |
trisodium 5-{[4-chloro-6-(1-naphthylamino)-1,3,5-triazin-2-yl]amino}-4-hydroxy-3-[(E)-(4-methoxy-2-sulfonatophenyl)diazenyl]-2,7-naphthalenedisulfonate |
341026-59-3 |
Xi; R41, R43 |
|
|
|
607-634-00-2 |
(S)-(-)-2-acetoxypropionylchloride; (1S)-2-chloro-1-methyl-2-oxoethyl acetate |
36394-75-9 |
Xn; R22, C; R34, R43 |
|
|
|
607-635-00-8 |
trisodium N-(3-propionato)-l-aspartate |
172737-80-3 |
Xi; R41 |
|
|
|
607-636-00-3 |
1-bromo-2-methylpropyl propionate |
158894-67-8 |
R10, Carc.Cat.3; R40, C; R34, R43 |
|
|
|
607-637-00-9 |
disodium 8-amino-5-{4-[2-(sulfonatoethoxy)sulfonyl]phenylazo}naphthalene-2-sulfonate |
250688-43-8 |
Xi; R41 |
|
|
|
607-638-00-4 |
2-hydroxybenzoic acid 2-butyloctyl ester |
190085-41-7 |
R53 |
|
|
|
607-639-00-X |
2-(2-oxo-5-(1,1,3,3-tetramethylbutyl)-2,3-dihydro-1-benzofuran-3-yl)-4-(1,1,3,3-tetramethylbutyl)phenyl acetate |
216698-07-6 |
R53 |
|
|
|
607-641-00-0 |
2-(formylamino)-3-thiophenecarboxylic acid; 2-formamido-3-thiophenecarboxylic acid |
43028-69-9 |
Xn; R22, R43 |
|
|
|
607-642-00-6 |
3,6,9-trithiaundecamethylene-1,11-dimethacrylate |
141631-22-3 |
N; R50-53 |
|
|
|
607-643-00-1 |
dimethyl (2S)-2-hydroxysuccinate |
617-55-0 |
R10, Xi; R41, R43 |
|
|
|
607-644-00-7 |
methyl 2,2-dimethyl-6-methylenecyclohexanecarboxylate |
81752-87-6 |
Xi; R38 |
|
|
|
607-645-00-2 |
tetrasodium 2-(4-fluoro-6-(methyl-(2-(sulfatoethylsulfonyl)ethyl)amino)-1,3,5-triazin-2-ylamino)-5-hydroxy-6-(4-methyl-2-sulfonatophenylazo)naphthalene-1,7-disulfonate |
243858-01-7 |
Xi; R41 |
|
|
|
607-646-00-8 |
d-erythro-hexanoic acid 2,4-dideoxy-3,5-O-(1-methylethylidene)-1,1-dimethylethylester; tert-butyl 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
124655-09-0 |
Xn; R22 |
|
|
|
607-647-00-3 |
5-acetoxy-2-(R,S)butyryloxymethyl-1,3-oxathiolane |
143446-73-5 |
Xn; R22, R43, N; R50 |
|
|
|
607-649-00-4 |
[3-(chlorocarbonyl)-2-methylphenyl]acetate |
167678-46-8 |
C; R35, R43 |
|
|
|
607-650-00-X |
2-methyl-1,5-pentanediamine-1,3-benzenedicarboxylate |
145153-52-2 |
R43 |
|
|
|
607-651-00-5 |
sodium 2-(nonanoyloxy)benzenesulfonate |
91125-43-8 |
Xi; R41, R43 |
|
|
|
607-652-00-0 |
ethyl N2-dodecanoyl-l-argininate hydrochloride |
60372-77-2 |
Xi; R41, N; R50 |
|
|
|
607-653-00-6 |
tetrakis(bis(2-hydroxyethyl)methylammonium) 3-(4-(7-acetylamino-1-hydroxy-3-sulfonatonaphthalen-2-ylazo)-5-methoxy-2-sulfonatophenylazo)-7-(4-amino-3-sulfonatophenylamino)-4-hydroxynaphthalene-2-sulfonate |
225786-91-4 |
N; R51-53 |
|
|
|
607-654-00-1 |
(S)-3-hydroxy-γ-butyrolactone |
7331-52-4 |
R43 |
|
|
|
607-655-00-7 |
ethyl 6,8-dichlorooctanoate |
1070-64-0 |
R43, N; R51-53 |
|
|
|
607-656-00-2 |
sodium salt of 4-amino-3,6-bis[[5-[[4-chloro-6-[(2-methyl-4-sulfophenyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]azo]-5-hydroxy-2,7-naphthalenedisulfonic acid |
141250-43-3 |
Xi; R41, R52-53 |
|
|
|
607-657-00-8 |
pentasodium 7-(4-(4-(3-(2-sulfatoethanesulfonyl)phenylamino)-6-(4-(2-sulfatoethanesulfonyl)phenylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate |
172399-10-9 |
Xi; R41 |
|
|
|
607-658-00-3 |
3,10-diamino-6,13-dichloro-2-((6-(((4-(1,1-dimethylethyl)phenyl)sulfonyl)amino)-2-naphthalenyl)sulfonyl)-4,11-triphenodioxazinedisulfonic acid, lithium potassium sodium salt |
371921-63-0 |
Xi; R41, R52-53 |
|
|
|
607-659-00-9 |
pentasodium N-[5-[[4-[[3-[(aminocarbonyl)amino]-4-[(3,6,8-trisulfonatonaphthalen-2-yl)azo]phenyl]amino]-6-chloro-1,3,5-triazin-2-yl]amino]-2-sulfonato-4-[[4-[[-2-(oxysulfonato)ethyl] sulfonyl]phenyl]azo]phenyl]-3-aminopropanoic acid |
321912-47-4 |
Xi; R41 |
|
|
|
607-660-00-4 |
2-{4-[4-[4-fluoro-6-(2-(2-vinylsulfonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino]phenylazo]phenylazo}naphthalene-4,6,8-trisulfonate, trisodium salt |
321679-52-1 |
Xi; R41 |
|
|
|
607-661-00-X |
1,1-dimethylethyl 4'-(bromomethyl)biphenyl-2-carboxylate |
114772-40-6 |
R43, R53 |
|
|
|
607-662-00-5 |
methyl 2-(acetylamino)-3-chloropropionate |
87333-22-0 |
R43, N; R50-53 |
|
|
|
607-663-00-0 |
bis(2-ethylhexyl) naphthalene-2,6-dicarboxylate |
127474-91-3 |
R53 |
|
|
|
607-664-00-6 |
methyl 2-chlorosulfonyl-4-(methanesulfonylaminomethyl) benzoate |
393509-79-0 |
Xi; R41, N; R51-53 |
|
|
|
607-665-00-1 |
trans-methyl-2-ethyl-but-2-enoate |
101226-85-1 |
R10 |
|
|
|
607-666-00-7 |
(2S)-5-(benzyloxy)-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-5-oxopentanoic acid |
88784-33-2 |
Xi; R36 |
|
|
|
607-667-00-2 |
chloro-1-ethylcyclohexyl carbonate |
99464-83-2 |
Muta.Cat.3; R68, R43 |
|
|
|
607-668-00-8 |
trans-2-isopropyl-5-carboxy-1,3-dioxane |
42031-28-7 |
Xi; R41, R52-53 |
|
|
|
607-669-00-3 |
methyl (9-acetoxy-3,8,10-triethyl-7,8,10-trimethyl-1,5-dioxa-9-aza-spiro[5.5]undec-3-yl)octadecanoate |
376588-17-9 |
R43, R53 |
|
|
|
607-670-00-9 |
dibutyl-3-(4-(5-ammonio-2-butyl)benzofuran-3-yl)carbonyl)phenoxy)propyl ammonium oxalate; (5-amino-2-butylbenzofuran-3-yl) [4-(3-dibutylaminopropoxy)phenyl]methanone, dioxalate |
500791-70-8 |
Xn; R48/22, Xi; R41, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
607-671-00-4 |
diethyl 1,4-cyclohexanedicarboxylate |
72903-27-6 |
N; R51-53 |
|
|
|
607-672-00-X |
reaction mass of: 2-hydroxy-3-(methacryloyloxy)propyl (2-benzoyl)benzoate; 1-hydroxymethyl-2-(methacryloyloxy)ethyl (2-benzoyl)benzoate; x-hydroxy-y-(methacryloyloxy)propyl(or -ethyl) (2-benzoyl)benzoate |
- |
R43, N; R51-53 |
|
|
|
607-673-00-5 |
1-ethyl-5,6,7,8-tetrahydroquinolinium tosylate |
- |
Xn; R22, R52-53 |
|
|
|
607-675-00-6 |
reaction mass of: cis-9-octadecenedioic acid; cis-9-cis-12-octadecadienedioic acid; hexadecanedioic acid; octadecanedioic acid |
- |
Xi; R41, N; R50-53 |
|
|
|
607-676-00-1 |
reaction mass of: 2-methylnonanedioic acid; 2,4-dimethyl-4-methoxycarbonylundecanedioic acid; 2,4,6-trimethyl-4,6-dimethoxycarbonyltridecanedioic acid; 8,9-dimethyl-8,9-dimethoxycarbonylhexadecanedioic acid |
- |
Xi; R41, R43 |
|
|
|
607-677-00-7 |
2,5-dioxopyrrolidin-1-yl N-{[methyl[[2-(1-methylethyl)-4-thiazolyl]methyl]amino]carbonyl}-l-valinate |
- |
Xn; R48/22, Xi; R41, R43 |
|
|
|
607-678-00-2 |
reaction mass of: ethyl (2R,3R)-3-isopropylbicyclo[2.2.1]hept-5-ene-2-carboxylate; ethyl (2S,3S)-3-isopropylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
- |
R43, N; R51-53 |
|
|
|
607-679-00-8 |
reaction mass of: 3-{5-[3-(4-{1,6-dihydro-2-hydroxy-4-methyl-1-[3-(methylammonio)propyl]-6-oxo-3-pyridylazo}benzamido)phenylazo]-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-1-pyridyl}propyl(methyl)ammonium di(acetate); 3-{5-[4-(3-{1,6-dihydro-2-hydroxy-4-methyl |
- |
Xi; R41, N; R51-53 |
|
|
|
607-680-00-3 |
tert-butyl(6-{2-[4-(4-fluorophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]pyrimidin-5-yl]vinyl}(4S,6S)-2,2-dimethyl[1,3]dioxan-4-yl)acetate |
- |
R53 |
|
|
|
607-681-00-9 |
reaction mass of: 9-nonyl-10-octyl-19-carbonyloxyhexadecylnonadecanoic acid; 9-nonyl-10-octyl-19-carbonyloxyoctadecylnonadecanoic acid; dihexadecyl 9-nonyl-10-octylnonadecandioate; 1-octadecyl,19-hexadecyl 9-nonyl-10-octylnonadecandioate; dioctadecyl |
- |
R53 |
|
|
|
607-682-00-4 |
complex reaction mass of Chinese gum rosin post reacted with acrylic acid |
144413-22-9 |
R53 |
|
|
|
607-683-00-X |
reaction mass of: methyl 3-((1E)-2-methylprop-1-enyl)-2,2-dimethylcyclopropanecarboxylate; methyl 3-((1Z)-2-methylprop-1-enyl)-2,2-dimethylcyclopropanecarboxylate (20:80) |
- |
R43, N; R51-53 |
|
|
|
607-684-00-5 |
alkenes, C12-14, hydroformylation products, distn. residues, C-(hydrogen sulfobutanedioates), disodium salts |
243662-67-1 |
Xi; R38, R43 |
|
|
|
607-685-00-0 |
ammonium 2-cocoyloxyethanesulfonate |
- |
Xi; R38-41 |
|
|
|
607-686-00-6 |
6,6'-bis(diazo-5,5',6,6'-tetrahydro-5,5'-dioxo)[methylene-bis(5-(6-diazo-5,6-dihydro-5-oxo-1-naphthylsulphonyloxy)-6-methyl-2-phenylene]di(naphthalene-1-sulfonate) |
- |
E; R2, F; R11, Carc. Cat. 3; R40 |
|
|
|
607-687-00-1 |
reaction mass of: 2-{3,6-bis-[(2-ethylphenyl)-methylamino]-xanthylium-9-yl}-benzenesulfonate (2-10%); 2-{3,6-bis-[(2,3-dimethylphenyl)-methylamino]-xanthylium-9-yl}-benzenesulfonate (2-10%); 2-{3,6-bis-[(2,4-dimethylphenyl)-methylamino]-xanthylium-9-yl} |
- |
Xi; R38, N; R51-53 |
|
|
|
607-688-00-7 |
(R)-1-cyclohexa-1,4-dienyl-1-methoxycarbonyl-methylammoniumchloride |
- |
Xn; R22 |
|
|
|
607-689-00-2 |
reaction mass of: methyl 1,4-dimethylcyclohexanecarboxylate ("para-isomer" including cis- and trans- isomers); methyl 1,3-dimethylcyclohexanecarboxylate ("meta-isomer" including cis- and trans-isomers) |
- |
R52-53 |
|
|
|
607-690-00-8 |
dimethyl[2S,2S']-6,6,6'6'-tetramethoxy-2,2'-[N,N'-bis(trifluoracetyl)-S,S'-bi(L-homocysteinyl) diimino]dihexanoate |
255387-46-3 |
R43 |
|
|
|
607-691-00-3 |
magnesium salts, fatty acids, C16-18 and C18 unsaturated, branched and linear |
- |
R53 |
|
|
|
607-692-00-9 |
zinc salts, fatty acids, C16-18 and C18 unsaturated, branched and linear |
- |
R53 |
|
|
|
607-694-00-X |
ethyl 5,5-diphenyl-2-isoxazoline-3-carboxylate |
163520-33-0 |
Xn; R22, R43, N; R50-53 |
|
|
|
607-696-00-0 |
pentyl formate |
638-49-3 |
|
|
|
|
607-697-00-6 |
tert-butyl propionate |
20487-40-5 |
|
|
|
|
607-707-00-9 |
fenoxaprop-P-ethyl (ISO); ethyl (2R)-2-{4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy}propanoate |
71283-80-2 |
Xn; R48/22, R43, N; R50-53 |
N; R50-53: C >= 25 %, N; R51-53: 2,5 % <= C < 25 %, R52-53: 0,25 % <= C < 2,5 % |
|
ATP07 |
607-708-00-4 |
octanoic acid |
124-07-2 |
C; R34, N; R51-53 |
|
|
ATP07 |
607-709-00-X |
decanoic acid |
334-48-5 |
Xi; R36/38, N; R51-53 |
|
|
ATP07 |
607-710-00-5 |
1,2-Benzenedicarboxylic acid, dihexyl ester, branched and linear |
68515-50-4 |
Repr. Cat. 2; R60-61 |
|
|
ATP07 |
607-711-00-0 |
spirotetramat (ISO); (5s,8s)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4,5]dec-3-en-4-yl ethyl carbonate |
203313-25-1 |
Repr. Cat. 3; R62-63, Xi; R36/37, R43, N; R50-53 |
Xi; R43: C >= 0,1 %, N; R50-53: C >= 25 %, N; R51-53: 2,5 % <= C < 25 %
R52-53: 0,25 % <= C < 2,5 % |
|
ATP07 |
607-712-00-6 |
dodemorph acetate; 4-cyclododecyl-2,6-dimethylmorpholin-4-ium acetate |
31717-87-0 |
Repr. Cat. 3; R63, C; R34, R43, N; R51-53 |
C; R34: C >= 10 %, Xi: R36/37/38: 5 % <= C < 10 % |
|
ATP07 |
607-713-00-1 |
fenpyroximate (ISO); tert-butyl 4-[({(E)-[(1,3-dimethyl-5-phenoxy-1H-pyrazol-4-yl)methylene]amino}oxy)methyl]benzoate |
134098-61-6 |
T+; R26, Xn; R22, R43, N; R50-53 |
N; R50-53: C >= 0,25 %, N; R51-53: 0,025 % <= C < 0,25 %, R52-53: 0,0025 % <= C < 0,025 % |
|
ATP07 |
607-714-00-7 |
triflusulfuron-methyl; methyl 2-({[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]carbamoyl}sulfamoyl)-3-methylbenzoate |
126535-15-7 |
Carc. Cat. 3; R40, N; R50-53 |
N; R50-53: C >= 0,25 %, N; R51-53: 0,025 % <= C < 0,25 %, R52-53: 0,0025 % <= C < 0,025 % |
|
ATP07 |
607-715-00-2 |
bifenazate (ISO); isopropyl 2-(4-methoxybiphenyl-3-yl)hydrazinecarboxylate |
149877-41-8 |
R43, N; R50-53 |
N; R50-53: C >= 25 %, N; R51-53: 2,5 % <= C < 25 %, R52-53: 0,25 % <= C < 2,5 % |
|
ATP07 |
608-001-00-3 |
acetonitrile; cyanomethane |
75-05-8 |
F; R11, Xn; R20/21/22, Xi; R36 |
|
|
|
608-002-00-9 |
trichloroacetonitrile |
545-06-2 |
T; R23/24/25, N; R51-53 |
|
|
|
608-003-00-4 |
acrylonitrile |
107-13-1 |
F; R11, Carc. Cat. 2; R45, T; R23/24/25, Xi; R37/38-41, R43, N; R51-53 |
C ≥ 1 %: T; R23/24/25, 0,2 % ≤ C < 1 %: Xn; R20/21/22 |
D E |
|
608-004-00-X |
2-hydroxy-2-methylpropionitrile; 2-cyanopropan-2-ol; acetone cyanohydrin |
75-86-5 |
T+; R26/27/28, N; R50-53 |
|
|
|
608-005-00-5 |
n-butyronitrile |
109-74-0 |
F; R11, T; R23/24/25 |
|
|
|
608-006-00-0 |
bromoxynil (ISO); 3,5-dibromo-4-hydroxybenzonitrile; bromoxynil phenol |
1689-84-5 |
Repr. Cat. 3; R63, T+; R26, T; R25, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
608-007-00-6 |
ioxynil (ISO); 4-hydroxy-3,5-diiodobenzonitrile |
1689-83-4 |
Repr. Cat. 3; R63, T; R23/25, Xn; R21-48/22, Xi; R36, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
608-008-00-1 |
chloroacetonitrile |
107-14-2 |
T; R23/24/25, N; R51-53 |
|
|
|
608-009-00-7 |
malononitrile |
109-77-3 |
T; R23/24/25, N; R50-53 |
|
|
|
608-010-00-2 |
methacrylonitrile; 2-methyl-2-propene nitrile |
126-98-7 |
F; R11, T; R23/24/25, R43 |
C ≥ 1 %: T; R23/24/25, 0,2 % ≤ C < 1 %: Xn; R20/21/22, C ≥ 0,2 %: R43 |
D |
|
608-011-00-8 |
oxalonitrile; cyanogen |
460-19-5 |
F+; R12, T; R23, N; R50-53 |
|
|
|
608-012-00-3 |
benzonitrile |
100-47-0 |
Xn; R21/22 |
|
|
|
608-013-00-9 |
2-chlorobenzonitrile |
873-32-5 |
Xn; R21/22, Xi; R36 |
|
|
|
608-014-00-4 |
chlorothalonil (ISO); tetrachloroisophthalonitrile |
1897-45-6 |
Carc. Cat. 3; R40, T+; R26, Xi; R37-41, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
608-015-00-X |
dichlobenil (ISO); 2,6-dichlorobenzonitrile |
1194-65-6 |
Xn; R21, N; R51-53 |
|
|
|
608-016-00-5 |
1,4-Dicyano-2,3,5,6-tetra-chloro-benzene |
1897-41-2 |
R43, N; R50-53 |
|
|
|
608-017-00-0 |
bromoxynil octanoate (ISO); 2,6-dibromo-4-cyanophenyl octanoate |
1689-99-2 |
Repr. Cat. 3; R63, T; R23, Xn; R22, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
608-018-00-6 |
ioxynil octanoate (ISO); 4-cyano-2,6-diiodophenyl octanoate |
3861-47-0 |
Repr. Cat. 3; R63, T; R25, Xi; R36, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
608-019-00-1 |
2,2'-dimethyl-2,2'-azodipropiononitrile; ADZN |
78-67-1 |
E; R2, F; R11, Xn; R20/22, R52-53 |
|
|
|
608-020-00-7 |
diphenoxymethylenecyanamide |
79463-77-7 |
Xi; R41, R52-53 |
|
|
|
608-021-00-2 |
3-(2-(diaminomethyleneamino)thiazol-4-ylmethylthio)propionitrile |
76823-93-3 |
Xn; R22, R43 |
|
|
|
608-022-00-8 |
3,7-dimethyloctanenitrile |
40188-41-8 |
Xi; R38, R43, N; R51-53 |
|
|
|
608-023-00-3 |
fenbuconazole (ISO); 4-(4-chlorophenyl)-2-phenyl-2-[(1H-1,2,4-triazol-1-yl)methyl]butanenitrile |
114369-43-6 |
N; R50-53 |
|
|
|
608-024-00-9 |
2-(4-(N-butyl-N-phenethylamino)phenyl)ethylene-1,1,2-tricarbonitrile |
97460-76-9 |
R53 |
|
|
|
608-025-00-4 |
2-nitro-4,5-bis(benzyloxy)phenylacetonitrile |
117568-27-1 |
R53 |
|
|
|
608-026-00-X |
3-cyano-3,5,5-trimethylcyclohexanone |
7027-11-4 |
Xn; R22-48/22, R43, R52-53 |
|
|
|
608-027-00-5 |
reaction mass of: 3-(4-ethylphenyl)-2,2-dimethylpropanenitrile; 3-(2-ethylphenyl)-2,2-dimethylpropanenitrile; 3-(3-ethylphenyl)-2,2-dimethylpropanenitrile |
- |
N; R51-53 |
|
|
|
608-028-00-0 |
4-(2-cyano-3-phenylamino-acryloyloxymethyl)-cyclohexyl-methyl 2-cyano-3-phenylamino)-acrylate |
147374-67-2 |
Xn; R48/20/21, R43, N; R51-53 |
|
|
|
608-029-00-6 |
1,2-dihydro-6-hydroxy-4-methyl-1-[3-(1-methylethoxy)propyl]-2-oxo-3-pyridinecarbonitrile |
68612-94-2 |
R43 |
|
|
|
608-030-00-1 |
N-acetyl-N-[5-cyano-3-(2-dibutylamino-4-phenylthyazol-5-yl-methylene)-4-methyl-2,6-dioxo-1,2,3,6-tetrahydropyridin-1-yl]benzamide |
147741-93-3 |
N; R50-53 |
|
|
|
608-031-00-7 |
2-benzyl-2-methyl-3-butenitrile |
97384-48-0 |
Xn; R22, R52-53 |
|
|
|
608-032-00-2 |
acetamiprid (ISO); (E)-N1-[(6-chloro-3-pyridyl)methyl]-N2-cyano-N1-methylacetamidine |
135410-20-7 |
Xn; R22, R52-53 |
|
|
|
608-033-00-8 |
N-butyl-3-(2-chloro-4-nitrophenylhydrazono)-1-cyano-2-methylprop-1-ene-1,3-dicarboximide |
75511-91-0 |
R43, R52-53 |
|
|
|
608-034-00-3 |
chlorfenapyr (ISO); 4-bromo-2-(4-chlorophenyl)-1-ethoxymethyl-5-trifluoromethylpyrrole-3-carbonitrile |
122453-73-0 |
T; R23, Xn; R22, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
608-035-00-9 |
(±)-α-[(2-acetyl-5-methylphenyl)-amino]-2,6-dichlorobenzene-aceto-nitrile |
- |
R43, R53 |
|
|
|
608-036-00-4 |
3-(2-{}{4-[2-(4-cyanophenyl)vinyl]phenyl}}vinyl)benzonitrile |
79026-02-1 |
R53 |
|
|
|
608-037-00-X |
reaction mass of: (E)-2,12-tridecadiennitrile; (E)-3,12-tridecadiennitrile; (Z)-3,12-tridecadiennitrile |
- |
N; R50-53 |
|
|
|
608-038-00-5 |
2,2,4-trimethyl-4-phenyl-butane-nitrile |
75490-39-0 |
Xn; R22, N; R51-53 |
|
|
|
608-039-00-0 |
2-phenylhexanenitrile |
3508-98-3 |
Xn; R22, N; R50-53 |
|
|
|
608-040-00-6 |
4,4'-dithiobis(5-amino-1-(2,6-dichloro-4-(trifluoromethyl)phenyl)-1H-pyrazole-3-carbonitrile) |
130755-46-3 |
N; R50-53 |
|
|
|
608-041-00-1 |
4'-((2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-ene-3-yl)methyl)(1,1'-biphenyl)-2-carbonitrile |
138401-24-8 |
N; R50-53 |
|
|
|
608-042-00-7 |
(S)-2,2-diphenyl-2-(3-pyrrolidinyl)acetonitrile hydrobromide |
194602-27-2 |
Xn; R22, Xi; R41, R43, N; R51-53 |
|
|
|
608-043-00-2 |
3-(cis-3-hexenyloxy)propanenitril |
142653-61-0 |
T; R23, Xn; R22, N; R50-53 |
|
|
|
608-044-00-8 |
2-cyclohexylidene-2-phenylacetonitrile |
10461-98-0 |
Xn; R22, N; R51-53 |
|
|
|
608-046-00-9 |
5-(4-chloro-2-nitro-phenylazo)-1,2-dihydro-6-hydroxy-1,4-dimethyl-2-oxo-pyridine-3-carbonitrile |
77889-90-8 |
R53 |
|
|
|
608-047-00-4 |
2-piperidin-1-yl-benzonitrile |
72752-52-4 |
N; R51-53 |
|
|
|
608-048-00-X |
1-(3-cyclopentyloxy-4-methoxyphenyl)-4-oxo-cyclohexanecarbonitrile |
152630-47-2 |
Xn; R22-48/22, R43, N; R51-53 |
|
|
|
608-049-00-5 |
2-(4-(4-(butyl-(1-methylhexyl)amino)phenyl)-3-cyano-5-oxo-1,5-dihydropyrrol-2-ylidene)propandinitrile |
157362-53-3 |
R43, N; R50-53 |
|
|
|
608-050-00-0 |
reaction mass of: 5-(2-cyano-4-nitrophenylazo)-2-(2-(2-hydroxyethoxy)ethylamino)-4-methyl-6-phenylaminonicotinonitrile; 5-(2-cyano-4-nitrophenylazo)-6-(2-(2-hydroxyethoxy)ethylamino)-4-methyl-2-phenylaminonicotinonitrile |
- |
R53 |
|
|
|
608-051-00-6 |
(R)-4-(4-dimethylamino-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile |
219861-18-4 |
Xn; R22, R43, N; R51-53 |
|
|
|
608-052-00-1 |
(S)-4-(4-dimethylamino-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile |
128173-52-4 |
Xn; R22, R43, N; R51-53 |
|
|
|
608-053-00-7 |
(R,S)-4-(4-dimethylamino-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile |
103146-25-4 |
Xn; R22, R43, N; R51-53 |
|
|
|
608-054-00-2 |
(R,S)-4-(4-dimethylamino-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile hemisulfate |
- |
Xn; R22, Xi; R41, R43, N; R51-53 |
|
|
|
608-055-00-8 |
fipronil (ISO); 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[(trifluoromethyl)sulfinyl]-1H-pyrazole-3-carbonitrile |
120068-37-3 |
T; R23/24/25-48/25, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
608-056-00-3 |
N-methyl-N-cyanomethylmorpholiniummethylsulfate |
- |
Xn; R22, Xi; R41 |
|
|
|
608-057-00-9 |
4-cyanomethyl-4-methylmorpholin-4-iumhydrogene sulfate |
208538-34-5 |
Xn; R22, Xi; R41, R43 |
|
|
|
608-058-00-4 |
esfenvalerate (ISO); (S)-α-cyano-3-phenoxybenzyl-(S)-2-(4-chlorophenyl)-3-methylbutyrate |
66230-04-4 |
T; R23/25, R43, N; R50-53 |
C ≥ 0,0025 %: N; R50-53, 0,00025 % ≤ C < 0,0025 %: N; R51-53, 0,000025 % ≤ C < 0,00025 %: R52-53 |
|
|
608-059-00-X |
5-amino-1-(2,6-dichloro-4-(trifluoromethyl)phenyl)-1H-pyrazole-3-carbonitrile |
120068-79-3 |
N; R51-53 |
|
|
|
608-060-00-5 |
5-methyl-2-[(2-nitrophenyl)amino]-3-thiophenecarbonitrile |
138564-59-7 |
N; R50-53 |
|
|
|
608-062-00-6 |
2-fluoro-4-hydroxybenzonitrile |
82380-18-5 |
Xn; R22, Xi; R41, N; R51-53 |
|
|
|
608-063-00-1 |
(S)-α-hydroxy-3-phenoxy-benzeneacetonitrile |
61826-76-4 |
T; R25, Xi; R41, R43, N; R50-53 |
|
|
|
608-064-00-7 |
cyanomethyltrimethylammoniummethylsulfate |
- |
R52-53 |
|
|
|
608-065-00-2 |
salts of bromoxynil with the exception of those specified elsewhere in this Annex |
- |
Repr. Cat. 3; R63, T+; R26, T; R25, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
A |
|
608-066-00-8 |
salts of ioxynil with the exception of those specified elsewhere in this Annex |
- |
Repr. Cat. 3; R63, T; R23/25, Xn; R21-48/22, Xi; R36, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
A |
|
609-001-00-6 |
1-nitropropane |
108-03-2 |
R10, Xn; R20/21/22 |
C ≥ 5 %: Xn; R20/21/22 |
|
|
609-002-00-1 |
2-nitropropane |
79-46-9 |
R10, Carc. Cat. 2; R45, Xn; R20/22 |
|
E |
|
609-003-00-7 |
nitrobenzene |
98-95-3 |
Carc. Cat. 3; R40, Repr. Cat. 3; R62, T; R23/24/25-48/23/24, N; R51-53 |
|
|
|
609-004-00-2 |
dinitrobenzene; [1] 1,4-dinitrobenzene; [2] 1,3-dinitrobenzene; [3] 1,2-dinitrobenzene [4] |
25154-54-5 [1], 100-25-4 [2], 99-65-0 [3], 528-29-0 [4] |
T+; R26/27/28, R33, N; R50-53 |
|
|
|
609-005-00-8 |
1,3,5-trinitrobenzene |
99-35-4 |
E; R3, T+; R26/27/28, R33, N; R50-53 |
|
|
|
609-006-00-3 |
4-nitrotoluene |
99-99-0 |
T; R23/24/25, R33, N; R51-53 |
|
|
|
609-007-00-9 |
2,4-dinitrotoluene; [1] dinitrotoluene [2] |
121-14-2 [1], 25321-14-6 [2], - |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Repr. Cat. 3; R62, T; R23/24/25, Xn; R48/22, N; R50-53 |
|
|
|
609-008-00-4 |
2,4,6-trinitrotoluene; TNT |
118-96-7 |
E; R2, T; R23/24/25, R33, N; R51-53 |
|
|
|
609-009-00-X |
2,4,6-trinitrophenol; picric acid |
88-89-1 |
E; R3, R4, T; R23/24/25 |
|
|
|
609-010-00-5 |
salts of picric acid |
- |
E; R3, T; R23/24/25 |
|
|
|
609-011-00-0 |
2,4,6-trinitroanisole |
606-35-9 |
E; R2, Xn; R20/21/22, N; R51-53 |
|
|
|
609-012-00-6 |
2,4,6-trinitro-m-cresol |
602-99-3 |
E; R2, R4, Xn; R20/21/22 |
|
|
|
609-013-00-1 |
2,4,6-trinitro-m-xylene |
632-92-8 |
E; R2, Xn; R20/21/22, R33 |
|
|
|
609-015-00-2 |
4-nitrophenol; p-nitrophenol |
100-02-7 |
Xn; R20/21/22, R33 |
|
|
|
609-016-00-8 |
dinitrophenol (reaction mass of isomers); [1] 2,4(or 2,6)-dinitrophenol [2] |
25550-58-7 [1], 71629-74-8 [2] |
T; R23/24/25, R33, N; R50-53 |
|
|
|
609-018-00-9 |
2,4,6-trinitroresorcinol; styphnic acid |
82-71-3 |
E; R3, R4, Xn; R20/21/22 |
|
|
|
609-019-00-4 |
lead 2,4,6-trinitro-m-phenylene dioxide; lead 2,4,6-trinitroresorcinoxide; lead styphnate |
15245-44-0 |
E; R3, Repr. Cat. 1; R61, Repr. Cat. 3; R62, Xn; R20/22, R33, N; R50-53 |
|
E1 |
|
609-019-01-1 |
lead 2,4,6-trinitro-m-phenylene dioxide; lead 2,4,6-trinitroresorcinoxide; lead styphnate (≥ 20 % phlegmatiser) |
15245-44-0 |
|
|
|
|
609-020-00-X |
DNOC (ISO); 4,6-dinitro-o-cresol |
534-52-1 |
Muta. Cat. 3; R68, T+; R26/27/28, Xi; R38-41, R43, R44, N; R50-53 |
|
|
|
609-021-00-5 |
sodium salt of DNOC; sodium 4,6-dinitro-o-cresolate; [1] potassium salt of DNOC; potassium 4,6-dinitro-o-cresolate [2] |
2312-76-7 [1], 5787-96-2 [2] |
T; R23/24/25, R33, N; R50-53 |
|
|
|
609-022-00-0 |
ammonium salt of DNOC; ammonium 4,6-dinitro-o-tolyl oxide |
2980-64-5 |
T+; R26/27/28, R33, N; R50-53 |
|
|
|
609-023-00-6 |
dinocap (ISO); (RS)-2,6-dinitro-4-octylphenyl crotonates and (RS)-2,4-dinitro-6-octylphenyl crotonates in which “octyl” is a reaction mass of 1-methylheptyl, 1-ethylhexyl and 1-propylpentyl groups |
39300-45-3 |
Repr. Cat. 2; R61, Xn; R20/22-48/22, Xi; R38, R43, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
E |
|
609-024-00-1 |
binapacryl (ISO); 2-sec-butyl-4,6-dinitrophenyl-3-methylcrotonate |
485-31-4 |
Repr. Cat. 2; R61, Xn; R21/22, N; R50-53 |
|
E |
|
609-025-00-7 |
dinoseb (ISO); 6-sec-butyl-2,4-dinitrophenol |
88-85-7 |
R44, T; R24/25, Repr. Cat. 2; R61, Repr. Cat. 3; R62, Xi; R36, N; R50-53 |
|
E |
|
609-026-00-2 |
salts and esters of dinoseb, with the exception of those specified elsewhere in this Annex |
- |
R44, Repr. Cat. 2; R61, Repr. Cat. 3; R62, T; R24/25, Xi; R36, N; R50-53 |
|
A E |
|
609-027-00-8 |
dinocton; reaction mass of isomers: methyl 2-octyl-4,6-dinitrophenyl carbonate, methyl 4-octyl-2,6-dinitrophenyl carbonate |
63919-26-6 |
Xn; R22, N; R50-53 |
|
|
|
609-028-00-3 |
dinex (ISO); 2-cyclohexyl-4,6-dinitrophenol |
131-89-5 |
T; R23/24/25, N; R50-53 |
|
|
|
609-029-00-9 |
salts and esters of dinex |
- |
T; R23/24/25, N; R50-53 |
|
A |
|
609-030-00-4 |
dinoterb (ISO); 2-tert-butyl-4,6-dinitrophenol |
1420-07-1 |
Repr. Cat. 2; R61, T+; R28, T; R24, R44, N; R50-53 |
|
E |
|
609-031-00-X |
salts and esters of dinoterb |
- |
Repr. Cat. 2; R61, T+; R28, T; R24, N; R50-53 |
|
A E |
|
609-032-00-5 |
bromofenoxim (ISO); 3,5-dibromo-4-hydroxybenzaldehyde-O-(2,4-dinitrophenyl)-oxime |
13181-17-4 |
Xn; R22, N; R50-53 |
|
|
|
609-033-00-0 |
dinosam (ISO); 2-(1-methylbutyl)-4,6-dinitrophenol |
4097-36-3 |
T; R23/24/25, N; R50-53 |
|
|
|
609-034-00-6 |
salts and esters of dinosam |
- |
T; R23/24/25, N; R50-53 |
|
A |
|
609-035-00-1 |
nitroethane |
79-24-3 |
R10, Xn; R20/22 |
C ≥ 12,5 %: Xn; R20/22 |
|
|
609-036-00-7 |
nitromethane |
75-52-5 |
R5-10, Xn; R22 |
C ≥ 12,5 %: Xn; R22 |
|
|
609-037-00-2 |
5-nitroacenaphthene |
602-87-9 |
Carc. Cat. 2; R45 |
|
|
|
609-038-00-8 |
2-nitronaphthalene |
581-89-5 |
Carc. Cat. 2; R45, N; R51-53 |
|
|
|
609-039-00-3 |
4-nitrobiphenyl |
92-93-3 |
Carc. Cat. 2; R45, N; R51-53 |
|
|
|
609-040-00-9 |
nitrofen (ISO); 2,4-dichlorophenyl 4-nitrophenyl ether |
1836-75-5 |
Carc. Cat. 2; R45, Repr. Cat. 2; R61, Xn; R22, N; R50-53 |
|
E |
|
609-041-00-4 |
2,4-dinitrophenol |
51-28-5 |
T; R23/24/25, R33, N; R50 |
|
|
|
609-042-00-X |
pendimethalin (ISO); N-(1-ethylpropyl)-2,6-dinitro-3,4-xylidine |
40487-42-1 |
R43, N; R50-53 |
|
|
|
609-043-00-5 |
quintozene (ISO); pentachloronitrobenzene |
82-68-8 |
R43, N; R50-53 |
|
|
|
609-044-00-0 |
tecnazene (ISO); 1,2,4,5-tetrachloro-3-nitrobenzene |
117-18-0 |
Xn; R22, R43, N; R50-53 |
|
|
|
609-045-00-6 |
reaction mass of: 4,6-dinitro-2-(3-octyl)phenyl methyl carbonate and 4,6-dinitro-2-(4-octyl)phenyl methyl carbonate; dinocton-6 |
8069-76-9 |
Xn; R22, N; R50-53 |
|
|
|
609-046-00-1 |
trifluralin (ISO) (containing < 0.5 ppm NPDA); α,α,α-trifluoro-2,6-dinitro-N,N-dipropyl-p-toluidine (containing < 0.5 ppm NPDA); 2,6-dinitro-N,N-dipropyl-4-trifluoromethylaniline (containing < 0.5 ppm NPDA); N,N-dipropyl-2,6-dinitro-4-trifluoromethylan |
1582-09-8 |
Carc. Cat. 3; R40, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
609-047-00-7 |
2-nitroanisole |
91-23-6 |
Carc. Cat. 2; R45, Xn; R22 |
|
E |
|
609-048-00-2 |
sodium 3-nitrobenzenesulphonate |
127-68-4 |
Xi; R36, R43 |
|
|
|
609-049-00-8 |
2,6-dinitrotoluene |
606-20-2 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Repr. Cat. 3; R62, T; R23/24/25, Xn; R48/22, R52-53 |
|
E |
|
609-050-00-3 |
2,3-dinitrotoluene |
602-01-7 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Repr. Cat. 3; R62, T; R23/24/25, Xn; R48/22, N; R50-53 |
|
E |
|
609-051-00-9 |
3,4-dinitrotoluene |
610-39-9 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Repr. Cat. 3; R62, T; R23/24/25, Xn; R48/22, N; R51-53 |
|
E |
|
609-052-00-4 |
3,5-dinitrotoluene |
618-85-9 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Repr. Cat. 3; R62, T; R23/24/25, Xn; R48/22, R52-53 |
|
E |
|
609-053-00-X |
hydrazine-trinitromethane |
- |
E; R3, O; R8, Carc. Cat. 2; R45, T; R23/25, R43 |
|
E |
|
609-054-00-5 |
2,3-dinitrophenol; [1] 2,5-dinitrophenol; [2] 2,6-dinitrophenol; [3] 3,4-dinitrophenol; [4] salts of dinitrophenol [5] |
66-56-8 [1], 329-71-5 [2], 573-56-8 [3], 577-71-9 [4], - [5] |
T; R23/24/25, R33, N; R51-53 |
|
|
|
609-055-00-0 |
2,5-dinitrotoluene |
619-15-8 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Repr. Cat. 3; R62, T; R23/24/25, Xn; R48/22, N; R51-53 |
|
E |
|
609-056-00-6 |
2,2-dibromo-2-nitroethanol |
69094-18-4 |
E; R2, Carc. Cat. 3; R40, Xn; R22-48/22, C; R35, R43, N; R50-53 |
C ≥ 10 %: Xn; R22, C ≥ 10 %: C; R35, 5 % ≤ C < 10 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/37/38 |
|
|
609-057-00-1 |
3-chloro-2,4-difluoronitrobenzene |
3847-58-3 |
Xn; R22, C; R34, R43, N; R50-53 |
|
|
|
609-058-00-7 |
2-nitro-2-phenyl-1,3-propanediol |
5428-02-4 |
T; R39-48/25, Xn; R21/22, Xi; R41, R43, N; R51-53 |
|
|
|
609-059-00-2 |
2-chloro-6-(ethylamino)-4-nitrophenol |
131657-78-8 |
Xn; R22, R43, N; R51-53 |
|
|
|
609-060-00-8 |
4-[(3-hydroxypropyl)amino]-3-nitrophenol |
92952-81-3 |
Xi; R38, N; R51-53 |
|
|
|
609-061-00-3 |
(E,Z)-4-chlorophenyl(cyclopropyl)ketone O-(4-nitrophenylmethyl)oxime |
94097-88-8 |
R43, N; R50-53 |
|
|
|
609-062-00-9 |
2-bromo-2-nitropropanol |
24403-04-1 |
T; R24, Xn; R22-48/22, C; R34, R43, N; R50-53 |
|
|
|
609-063-00-4 |
2-[(4-chloro-2-nitrophenyl)amino]ethanol |
59320-13-7 |
Xn; R22, N; R51-53 |
|
|
|
609-064-00-X |
mesotrione (ISO); 2-[4-(methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione |
104206-82-8 |
N; R50-53 |
|
|
|
609-065-00-5 |
2-nitrotoluene |
88-72-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Repr. Cat. 3; R62, Xn; R22, N; R51-53 |
|
E |
|
609-067-00-6 |
sodium and potassium 4-(3-aminopropylamino)-2,6-bis[3-(4-methoxy-2-sulfophenylazo)-4-hydroxy-2-sulfo-7-naphthylamino]-1,3,5-triazine |
156769-97-0 |
R43 |
|
|
|
609-068-00-1 |
musk xylene; 5-tert-butyl-2,4,6-trinitro-m-xylene |
81-15-2 |
E; R2, Carc. Cat. 3; R40, N; R50-53 |
|
|
|
609-069-00-7 |
musk ketone; 3,5-dinitro-2,6-dimethyl-4-tert-butylacetophenone; 4'-tert-butyl-2',6'-dimethyl-3',5'-dinitroacetophenone |
81-14-1 |
Carc. Cat. 3; R40, N; R50-53 |
|
|
|
609-070-00-2 |
1,4-dichloro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-nitrobenzene |
130841-23-5 |
Xn; R22, R43, N; R50-53 |
|
|
|
609-071-00-8 |
reaction mass of: 2-methylsulfanyl-4,6-bis-(2-hydroxy-4-methoxy-phenyl)-1,3,5-triazine; 2-(4,6-bis-methylsulfanyl-1,3,5-triazin-2-yl)-5-methoxy-phenol |
156137-33-6 |
R43 |
|
|
|
609-072-00-3 |
4-mesyl-2-nitrotoluene |
1671-49-4 |
Repr. Cat. 3; R62, Xn; R22, R43, R52-53 |
|
|
|
609-073-00-9 |
lithium potassium sodium N,N''-bis{6-[7-[4-(4-chloro-1,3,5-triazin-2-yl)amino-4-(2-ureidophenylazo)]naphthalene-1,3,6-trisulfonato]}-N'-(2-aminoethyl)piperazine |
- |
R43 |
|
|
|
610-001-00-3 |
trichloronitromethane; chloropicrin |
76-06-2 |
Xn; R22, T+; R26, Xi; R36/37/38 |
|
|
|
610-002-00-9 |
1,1-dichloro-1-nitroethane |
594-72-9 |
T; R23/24/25 |
|
|
|
610-003-00-4 |
chlorodinitrobenzene |
- |
T; R23/24/25, R33, N; R50-53 |
|
C |
|
610-004-00-X |
2-chloro-1,3,5-trinitrobenzene |
88-88-0 |
E; R2, T+; R26/27/28, N; R50-53 |
|
|
|
610-005-00-5 |
1-chloro-4-nitrobenzene |
100-00-5 |
Carc. Cat. 3; R40, Muta. Cat. 3; R68, T; R23/24/25, Xn; R48/20/21/22, N; R51-53 |
|
|
|
610-006-00-0 |
chloronitroanilines with the exception of those specified elsewhere in this Annex |
- |
T+; R26/27/28, R33, N; R51-53 |
|
A C |
|
610-007-00-6 |
1-chloro-1-nitropropane |
600-25-9 |
Xn; R20/22 |
C ≥ 5 %: Xn; R20/22 |
|
|
610-008-00-1 |
2,6-dichloro-4-nitroanisole |
17742-69-7 |
T; R25, N; R51-53 |
|
|
|
610-009-00-7 |
2-chloro-4-nitroaniline |
121-87-9 |
Xn; R22, N; R51-53 |
|
|
|
610-010-00-2 |
2-bromo-1-(2-furyl)-2-nitroethylene |
35950-52-8 |
Xn; R22-48/22, C; R34, R43, N; R50-53 |
|
|
|
611-001-00-6 |
azobenzene |
103-33-3 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Xn; R20/22-48/22, N; R50-53 |
|
E |
|
611-002-00-1 |
azoxybenzene |
495-48-7 |
Xn; R20/22 |
|
|
|
611-003-00-7 |
fenaminosulf (ISO); sodium 4-dimethylaminobenzenediazosulphonate |
140-56-7 |
T; R25, Xn; R21, R52-53 |
|
|
|
611-004-00-2 |
methyl-ONN-azoxymethyl acetate; methyl azoxy methyl acetate |
592-62-1 |
Carc. Cat. 2; R45, Repr. Cat. 2; R61 |
|
|
|
611-005-00-8 |
disodium {}{5-[(4'-((2,6-hydroxy-3-((2-hydroxy-5-sulphophenyl)azo)phenyl)azo)(1,1'-biphenyl)-4-yl)azo]salicylato(4-)}}cuprate(2-); CI Direct Brown 95 |
16071-86-6 |
Carc. Cat. 2; R45 |
|
|
|
611-006-00-3 |
4-o-tolylazo-o-toluidine; 4-amino-2',3-dimethylazobenzene; fast garnet GBC base; AAT; o-aminoazotoluene |
97-56-3 |
Carc. Cat. 2; R45, R43 |
|
|
|
611-007-00-9 |
tricyclazole (ISO); 5-methyl-1,2,4-triazolo(3,4-b)benzo-1,3-thiazole |
41814-78-2 |
Xn; R22 |
|
|
|
611-008-00-4 |
4-aminoazobenzene; 4-phenylazoaniline |
60-09-3 |
Carc. Cat. 2; R45, N; R50-53 |
|
|
|
611-009-00-X |
sodium (1-(5-(4-(4-anilino-3-sulphophenylazo)-2-methyl-5-methylsulphonamidophenylazo)-4-hydroxy-2-oxido-3-(phenylazo)phenylazo)-5-nitro-4-sulphonato-2-naphtholato)iron(II) |
- |
Xn; R20, R52-53 |
|
|
|
611-010-00-5 |
2'-(2-cyano-4,6-dinitrophenylazo)-5'-(N,N-dipropylamino)propionanilide |
106359-94-8 |
R43, R52-53 |
|
|
|
611-011-00-0 |
N,N,N',N'-tetramethyl-3,3'-(propylenebis(iminocarbonyl-4,1-phenylenazo(1,6-dihydro-2-hydroxy-4-methyl-6-oxopyridine-3,1-diyl)))di(propylammonium) dilactate |
- |
Xi; R41, N; R51-53 |
|
|
|
611-012-00-6 |
reaction mass of 2,2-iminodiethanol 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazole-7-sulfonate and 2-methylaminoethanol 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazole-7-sulfonate and N,N-diethylpropane-1,3-diamine 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazole-7-sulfonate |
114565-65-0 |
R43 |
|
|
|
611-013-00-1 |
trilithium-1-hydroxy-7-(3-sulfonatoanilino)-2-(3-methyl-4-(2-methoxy-4-(3-sulfonatophenylazo)phenylazo)phenylazo)naphthalene-3-sulfonate |
117409-78-6 |
E; R2, N; R51-53 |
|
|
|
611-014-00-7 |
(tetrasodium 1-(4-(3-acetamido-4-(4'-nitro-2,2'-disulfonatostilben-4-ylazo)anilino)-6-(2,5-disulfonatoanilino)-1,3,5-triazin-2-yl)-3-carboxypyridinium) hydroxide |
115099-55-3 |
R43 |
|
|
|
611-015-00-2 |
tetrasodium 4-amino-5-hydroxy-6-(4-(2-(2-(sulfonatooxy)ethylsulfonyl)ethylcarbamoyl)phenylazo)-3-(4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo)naphthalene-2,7-disulfonate |
116889-78-2 |
R43 |
|
|
|
611-016-00-8 |
reaction mass of 1,1'-((dihydroxyphenylene)bis(azo-3,1-phenylenazo(1-(3-dimethylaminopropyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3-diyl)))dipyridinium dichloride dihydrochloride, mixed isomers and 1-(1-(3-dimethylaminopropyl)-5-(3-((4-(1-(3-dimethylaminopropyl)-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-5-pyridinio-3-pyridylazo)phenylazo)-2,4(or2,6 or3,5)-dihydroxyphenylazo)phenylazo)-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-3-pyridyl)pyridinium dichloride |
- |
R43 |
|
|
|
611-017-00-3 |
2-(4-(diethylaminopropylcarbamoyl)phenylazo)-3-oxo-N-(2,3-dihydro-2-oxobenzimidazol-5-yl)butyramide |
- |
R43, N; R51-53 |
|
|
|
611-018-00-9 |
tetraammonium 5-(4-(7-amino-1-hydroxy-3-sulfonato-2-naphthylazo)-6-sulfonato-1-naphthylazo)isophthalate |
- |
R43 |
|
|
|
611-019-00-4 |
tetralithium 6-amino-4-hydroxy-3-(7-sulfonato-4-(4-sulfonatophenylazo)-1-naphthylazo)naphthalene-2,7-disulfonate |
106028-58-4 |
R43 |
|
|
|
611-020-00-X |
tetrakis(tetramethylammonium) 6-amino-4-hydroxy-3-(7-sulfonato-4-(4-sulfonatophenylazo)-1-naphthylazo)naphthalene-2,7-disulfonate |
116340-05-7 |
T; R25, R43, R52-53 |
|
|
|
611-021-00-5 |
2-(4-(4-cyano-3-methylisothiazol-5-ylazo)-N-ethyl-3-methylanilino)ethyl acetate |
- |
Xn; R22-48/22, Xi; R38, R53 |
|
|
|
611-022-00-0 |
4-dimethylaminobenzenediazonium 3-carboxy-4-hydroxybenzenesulfonate |
- |
E; R2, T; R23/25, Xn; R21-48/22, Xi; R41, R43, N; R50/53 |
|
|
|
611-023-00-6 |
disodium 7-(4,6-dichloro-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo) naphthalene-2-sulfonate |
- |
R43 |
|
|
|
611-024-00-1 |
Benzidine based azo dyes; 4,4'-diarylazobiphenyl dyes, with the exception of those specified elsewhere in this Annex |
- |
Carc. Cat. 2; R45 |
|
A |
|
611-025-00-7 |
disodium 4-amino-3-[[4'-[(2,4-diaminophenyl)azo][1,1'-biphenyl]-4-yl]azo]-5-hydroxy-6-(phenylazo)naphtalene-2,7-disulphonate; C.I. Direct Black 38 |
1937-37-7 |
Carc. Cat. 2; R45, Repr. Cat. 3; R63 |
|
|
|
611-026-00-2 |
tetrasodium 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis[5-amino-4-hydroxynaphthalene-2,7-disulphonate]; C.I. Direct Blue 6 |
2602-46-2 |
Carc. Cat. 2; R45, Repr. Cat. 3; R63 |
|
|
|
611-027-00-8 |
disodium 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis(4-aminonaphthalene-1-sulphonate); C.I. Direct Red 28 |
573-58-0 |
Carc. Cat. 2; R45, Repr. Cat. 3; R63 |
|
|
|
611-028-00-3 |
C,C'-azodi(formamide) |
123-77-3 |
E; R2, R42 |
|
|
|
611-029-00-9 |
o-dianisidine based azo dyes; 4,4'-diarylazo-3,3'-dimethoxybiphenyl dyes with the exception of those mentioned elsewhere in this Annex |
- |
Carc. Cat. 2; R45 |
|
A |
CLP00/ATP02 |
611-030-00-4 |
o-tolidine based dyes; 4,4'-diarylazo-3,3'-dimethylbiphenyl dyes, with the exception of those mentioned elsewhere in this Annex |
- |
Carc. Cat. 2; R45 |
|
A |
CLP00/ATP02 |
611-031-00-X |
4,4'-(4-iminocyclohexa-2,5-dienylidenemethylene)dianiline hydrochloride; C.I. Basic Red 9 |
569-61-9 |
Carc. Cat. 2; R45 |
|
|
|
611-032-00-5 |
1,4,5,8-tetraaminoanthraquinone; C.I. Disperse Blue 1 |
2475-45-8 |
Carc. Cat. 2; R45, Xi; R38-41, R43 |
|
|
|
611-033-00-0 |
hexasodium [4,4''-azoxybis(2,2'-disulfonatostilbene-4,4'-diylazo)]-bis[5'-sulfonatobenzene-2,2'- diolato-O(2),O(2),N(1)]-copper(II) |
82027-60-9 |
N; R51-53 |
|
|
|
611-034-00-6 |
N-(5-(bis(2-methoxyethyl)amino)-2-((5-nitro-2,1-benzisothiazol-3-yl)azo)phenylacetamide |
105076-77-5 |
R53 |
|
|
|
611-035-00-1 |
tetralithium 6-amino-4-hydroxy-3-[7-sulfonato-4-(5-sulfonato-2-naphthylazo)-1-naphthylazo]naphthalene-2,7-disulfonate |
107246-80-0 |
N; R51-53 |
|
|
|
611-036-00-7 |
2-(4-(5,6(or 6,7)-dichloro-1,3-benzothiazol-2-ylazo)-N-methyl-m-toluidino)ethyl acetate |
- |
R43 |
|
|
|
611-037-00-2 |
3(or 5)-(4-(N-benzyl-N-ethylamino)-2-methylphenylazo)-1,4-dimethyl-1,2,4-triazolium methylsulphate |
124584-00-5 |
Xn; R22, Xi; R41, R43, N; R51-53 |
|
|
|
611-038-00-8 |
trisodium 1-hydroxynaphthalene-2-azo-4'(5',5''-dimethylbiphenyl)-4''-azo(4''-phenylsulfonyloxybenzene)- 2',2'',4-trisulfonate |
- |
Xi; R36 |
|
|
|
611-039-00-3 |
7-[((4,6-dichloro-1,3,5-triazin-2-yl)amino)-4-hydroxy-3-(4-((2-sulfoxy)ethyl)sulfonyl)phenylazo]naphthalene-2-sulfonic acid |
117715-57-8 |
R43 |
|
|
|
611-040-00-9 |
3-(5-acetylamino-4-(4-[4,6-bis(3-diethylaminopropylamino)-1,3,5-triazin-2-ylamino]phenylazo)-2-(2-methoxyethoxy)phenylazo)-6-amino-4-hydroxy-2-naphthalenesulfonic acid |
115099-58-6 |
N; R50-53 |
|
|
|
611-041-00-4 |
2-[[4[[4,6-bis[[3-(diethylamino)propyl]amino]-1,3,5-triazine-2-yl]amino]phenyl]azo]-N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-oxobutanamide |
98809-11-1 |
Xi; R41, R43, N; R51-53 |
|
|
|
611-042-00-X |
trisodium 5-amino-3-[5-(2-bromoacryloylamino)-2-sulfonatophenylazo]-4-hydroxy-6-(4-vinylsulfonylphenylazo)naphthalene-2,7-disulfonate |
136213-71-3 |
R52-53 |
|
|
|
611-043-00-5 |
reaction mass of: trisodium N(1')-N(2):N(1''')-N(2'')-η-6-[2-amino-4-(or 6)-hydroxy-(or 4-amino-2-hydroxy)phenylazo]-6''-(1-carbaniloyl-2-hydroxyprop-1-enylazo)-5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalene-2,1'-azobenzene-1,2'-diolato-O(1),O(2'))- |
- |
Xi; R41, R52-53 |
|
|
|
611-044-00-0 |
reaction mass of: tert-alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-); tert-alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-); tert-alkyl(C12-C14)ammonium bis |
117527-94-3 |
N; R51-53 |
|
|
|
611-045-00-6 |
2-[4-[N-(4-acetoxybutyl)-N-ethyl]amino-2-methylphenylazo]-3-acetyl-5-nitrothiophene |
- |
R53 |
|
|
|
611-046-00-1 |
4,4'-diamino-2-methylazobenzene |
43151-99-1 |
T; R25, Xn; R48/22, R43, N; R50-53 |
|
|
|
611-047-00-7 |
reaction mass of: 2-[[4-[N-ethyl-N-(2-acetoxyethyl)amino]phenyl]azo]-5,6-dichlorobenzothiazole; 2-[[4-[N-ethyl-N-(2-acetoxyethyl)amino]phenyl]azo]-6,7-dichlorobenzothiazole (1:1) |
111381-11-4 |
R53 |
|
|
|
611-048-00-2 |
reaction mass of: 2-[[4-[bis(2-acetoxyethyl)amino]phenyl]azo]-5,6-dichlorobenzothiazole; 2-[[4-[bis(2-acetoxyethyl)amino]phenyl]azo]-6,7-dichlorobenzothiazole (1:1) |
111381-12-5 |
R53 |
|
|
|
611-049-00-8 |
reaction mass of 7-[4-(3-diethylaminopropylamino)-6-(3-diethylammoniopropylamino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(4-phenylazophenylazo)-naphthalene-2-sulfonate, acetic acid, lactic acid (2:1:1) |
118658-98-3 |
Xn; R48/22, R43, R52-53 |
|
|
|
611-050-00-3 |
reaction mass of: pentasodium 7-amino-3-[[4-[[4-[[4-[[4-[(6-amino-1-hydroxy-3-sulfonato-2-naphthyl)azo]-7-sulfonato-1-naphthyl]azo]phenyl]amino]-3-sulfonatophenyl]azo]-6-sulfonato-1-naphthyl]azo]-4-hydroxynaphthalen-2-sulfonate; pentasodium 7-amino-8-[4- |
- |
Xi; R41, R52-53 |
|
|
|
611-051-00-9 |
2-(4-(N-ethyl-N-(2-hydroxy)ethyl)amino-2-methylphenyl)azo-6-methoxy-3-methyl-benzothiazolium chloride |
136213-74-6 |
N; R50-53 |
|
|
|
611-052-00-4 |
monosodium aqua-[5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)azo]phenyl]azo]-2-naphthalensulfonate], iron complex |
- |
R52-53 |
|
|
|
611-053-00-X |
2,2'-azobis[2-methylpropionamidine] dihydrochloride |
2997-92-4 |
Xn; R22, R43 |
|
|
|
611-055-00-0 |
C.I. Disperse Yellow 3; N-[4-[(2-hydroxy-5-methylphenyl)azo]phenyl]acetamide |
2832-40-8 |
Carc. Cat. 3; R40, R43 |
|
|
|
611-056-00-6 |
C.I. Solvent Yellow 14; 1-phenylazo-2-naphthol |
842-07-9 |
Carc. Cat. 3; R40, Muta. Cat. 3; R68, R43, R53 |
|
|
|
611-057-00-1 |
6-hydroxy-1-(3-isopropoxypropyl)-4-methyl-2-oxo-5-[4-(phenylazo)phenylazo]-1,2-dihydro-3-pyridinecarbonitrile |
85136-74-9 |
Carc. Cat. 2; R45, R53 |
|
|
|
611-058-00-7 |
(6-(4-hydroxy-3-(2-methoxyphenylazo)-2-sulfonato-7-naphthylamino)-1,3,5-triazin-2,4-diyl)bis[(amino-1-methylethyl)ammonium] formate |
108225-03-2 |
Carc. Cat. 2; R45, Xi; R41, N; R51-53 |
|
|
|
611-059-00-2 |
octasodium 2-(6-(4-chloro-6-(3-(N-methyl-N-(4-chloro-6-(3,5-disulfonato-2-naphthylazo)-1-hydroxy-6-naphthylamino)-1,3,5-triazin-2-yl)aminomethyl)phenylamino)-1,3,5-triazin-2-ylamino)-3,5-disulfonato-1-hydroxy-2-naphthylazo)naphthalene-1,5-disulfonate |
148878-21-1 |
Xi; R41, R43, R52-53 |
|
|
|
611-060-00-8 |
reaction mass of: sodium 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonatonaphthalen-2-ylazo] |
187285-15-0 |
Xi; R41 |
|
|
|
611-061-00-3 |
disodium 5-[5-[4-(5-chloro-2,6-difluoropyrimidin-4-ylamino)benzamido]-2-sulfonatophenylazo]-1-ethyl-6-hydroxy-4-methyl-2-oxo-3-pyridylmethylsulfonate |
- |
Xi; R41, R43 |
|
|
|
611-062-00-9 |
octasodium 2-(8-(4-chloro-6-(3-((4-chloro-6-(3,6-disulfonato-2-(1,5-disulfonatonaphthalen-2-ylazo)-1-hydroxynaphthalen-8-ylamino)-1,3,5-triazin-2-yl)aminomethyl)phenylamino)-1,3,5-triazin-2-ylamino)-3,6-disulfonato-1-hydroxynaphthalen-2-ylazo)naphthalene-1,5-disulfonate |
- |
Xi; R38-41 |
|
|
|
611-063-00-4 |
trisodium [4'-(8-acetylamino-3,6-disulfonato-2-naphthylazo)-4''-(6-benzoylamino-3-sulfonato-2-naphthylazo)-biphenyl-1,3',3'',1'''-tetraolato-O,O',O'',O''']copper(II) |
164058-22-4 |
Carc. Cat. 2; R45 |
|
|
|
611-064-00-X |
4-(3,4-dichlorophenylazo)-2,6-di-sec-butyl-phenol |
124719-26-2 |
Xn; R48/22, Xi; R38, N; R50-53 |
|
|
|
611-065-00-5 |
4-(4-nitrophenylazo)-2,6-di-sec-butyl-phenol |
111850-24-9 |
Xn; R48/22, Xi; R36/38, R43, N; R50-53 |
|
|
|
611-066-00-0 |
tetrasodium 5-[4-chloro-6-(N-ethyl-anilino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(1,5-disulfonatonaphthalen-2-ylazo)-naphthalene-2,7-disulfonate |
130201-57-9 |
Xi; R41, R43, N; R51-53 |
|
|
|
611-067-00-6 |
reaction mass of: bis(tris(2-(2-hydroxy(1-methyl)ethoxy)ethyl)ammonium) 7-anilino-4-hydroxy-3-(2-methoxy-5-methyl-4-(4-sulfonatophenylazo)phenylazo)naphthalene-2-sulfonate; bis(tris(2-(2-hydroxy(2-methyl)ethoxy)ethyl)ammonium) 7-anilino-4-hydroxy-3-(2-me |
- |
Xn; R22, R52-53 |
|
|
|
611-068-00-1 |
tetrasodium 4-amino-3,6-bis(5-[4-chloro-6-(2-hydroxyethylamino)-1,3,5-triazin-2-ylamino]-2-sulfonatophenylazo)-5-hydroxynaphthalene-2,7-disulfonate |
85665-98-1 |
N; R51-53 |
|
|
|
611-069-00-7 |
N,N-di-[poly(oxyethylene)-co-poly(oxypropylene)]-4-[(3,5-dicyano-4-methyl-2-thienyl)azo)]-3-methylaniline |
- |
N; R51-53 |
|
|
|
611-070-00-2 |
reaction mass of: disodium (6-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)(1-(5-chloro-2-oxidophenylazo)-2-naphtholato)chromate(1-); trisodium bis(5-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)chr |
- |
R43, N; R50-53 |
|
|
|
611-071-00-8 |
tris(tetramethylammonium) 5-hydroxy-1-(4-sulphonatophenyl)-4-(4-sulphonatophenylazo)pyrazole-3-carboxylate |
131013-81-5 |
T; R25, R52-53 |
|
|
|
611-072-00-3 |
2,4-bis[2,2'-[2-(N,N-dimethylamino)ethyloxycarbonyl]phenylazo]-1,3-dihydroxybenzene, dihydrochloride |
118208-02-9 |
Xn; R22, Xi; R41, N; R51-53 |
|
|
|
611-073-00-9 |
dimethyl 3,3'-(N-(4-(4-bromo-2,6-dicyanophenylazo)-3-hydroxyphenyl)imino)dipropionate |
122630-55-1 |
R53 |
|
|
|
611-074-00-4 |
reaction mass of: sodium/potassium (3-(4-(5-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-2-methoxy-3-sulfonatophenylazo)-2-oxidophenylazo)-2,5,7-trisulfonato-4-naphtholato)copper(II); sodium/potassium (3-(4-(5-(5-chloro-4,6-difluoropyrimidin-2-ylamino)-2-m |
- |
R43 |
|
|
|
611-075-00-X |
reaction mass of: tris(3,5,5-trimethylhexylammonium) 4-amino-3-(4-(4-(2-amino-4-hydroxyphenylazo)anilino)-3-sulfonatophenylazo)-5,6-dihydro-5-oxo-6-phenylhydrazononaphthalene-2,7-disulfonate; tris(3,5,5-trimethylhexylammonium) 4-amino-3-(4-(4-(4-amino-2- |
- |
Xi; R41, N; R51-53 |
|
|
|
611-076-00-5 |
3-(2,6-dichloro-4-nitrophenylazo)-1-methyl-2-phenylindole |
117584-16-4 |
N; R50-53 |
|
|
|
611-077-00-0 |
dilithium disodium (5,5'-diamino-(μ-4,4'-dihydroxy-1:2-κ-2,O4,O4',-3,3'-[3,3'-dihydroxy-1:2-κ-2-O3,O3'-biphenyl-4,4'-ylenebisazo-1:2-(N3,N4-η:N3',N4'-η)]-dinaphthalene-2,7-disulfonato(8)))dicuprate(2-) |
126637-70-5 |
Xn; R22, R43 |
|
|
|
611-078-00-6 |
(2,2'-(3,3'-dioxidobiphenyl-4,4'-diyldiazo)bis(6-(4-(3-(diethylamino)propylamino)-6-(3-(diethylammonio)propylamino)-1,3,5-triazin-2-ylamino)-3-sulfonato-1-naphtholato))dicopper(II) acetate lactate |
159604-94-1 |
R43, N; R51-53 |
|
|
|
611-079-00-1 |
disodium 7-[4-chloro-6-(N-ethyl-o-toluidino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(4-methoxy-2-sulfonatophenylazo)-2-naphthalenesulfonate |
147703-64-8 |
Xi; R41 |
|
|
|
611-080-00-7 |
sodium 3-(2-acetamido-4-(4-(2-hydroxybutoxy)phenylazo)phenylazo)benzenesulfonate |
147703-65-9 |
R43 |
|
|
|
611-081-00-2 |
tetrasodium [7-(2,5-dihydroxy-KO2-7-sulfonato-6-[4-(2,5,6-trichloro-pyrimidin-4-ylamino)phenylazo]-(N1,N7-N)-1-naphthylazo)-8-hydroxy-KO8-naphthalene-1,3,5-trisulfonato(6-)]cuprate(II) |
141048-13-7 |
R43, R52-53 |
|
|
|
611-082-00-8 |
reaction mass of: pentasodium bis(1-(3(or 5)-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2-naphtholato)ferrate(1-); pentasodium [(1-(3-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2 |
- |
N; R51-53 |
|
|
|
611-083-00-3 |
reaction mass of: 2-[N-ethyl-4-[(5,6-dichlorobenzothiazol-2-yl)azo]-m-toludino]ethyl acetate; 2-[N-ethyl-4-[(6,7-dichlorobenzothiazol-2-yl)azo]-m-toludino]ethyl acetate (1:1) |
- |
T; R48/25, R43, N; R51-53 |
|
|
|
611-085-00-4 |
reaction mass of: 3-cyano-5-(2-cyano-4-nitro-phenylazo)-2-(2-hydroxy-ethylamino)-4-methyl-6-[3-(2-phenoxyethoxy)propylamino]pyridine; 3-cyano-5-(2-cyano-4-nitro-phenylazo)-6-(2-hydroxy-ethylamino)-4-methyl-2-[3-(2-phenoxyethoxy)propylamino]pyridine; 3-c |
- |
R43, N; R51-53 |
|
|
|
611-086-00-X |
monolithium 5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)azo]phenyl]azo]-2-naphthalenesulfonate], iron complex, monohydrate |
- |
R52-53 |
|
|
|
611-087-00-5 |
reaction mass of: 3-((5-cyano-1,6-dihydro-1,4-dimethyl-2-hydroxyl-6-oxo-3-pyridinyl)azo)-benzoyloxy-2-phenoxyethane; 3-((5-cyano-1,6-dihydro-1,4-dimethyl-2-hydroxy-6-oxo-3-pyridinyl)azo)-benzoyloxy-2-ethyloxy-2-(ethylphenol) |
- |
R53 |
|
|
|
611-088-00-0 |
reaction mass of: trilithium 4-amino-3-((4-((4-((2-amino-4-hydroxyphenyl)azo)phenyl)amino)-3-sulfophenyl)azo)-5-hydroxy-6-(phenylazo)naphthalene-2,7-disulfonate; trilithium 4-amino-3-((4-((4-((4-amino-2-hydroxyphenyl)azo)phenyl)amino)-3-sulfophenyl)azo)- |
- |
Xn; R22, Xi; R41, R52-53 |
|
|
|
611-089-00-6 |
2-((4-(ethyl-(2-hydroxyethyl)amino)-2-methylphenyl)azo)-6-methoxy-3-methyl-benzothiazolium methylsulfate |
136213-73-5 |
Xn; R48/22, R43, N; R50-53 |
|
|
|
611-090-00-1 |
2,5-dibutoxy-4-(morpholin-4-yl)benzenediazonium 4-methylbenzenesulfonate |
93672-52-7 |
F; R11, Xn; R22, Xi; R41, R43, R52-53 |
|
|
|
611-091-00-7 |
sodium (1.0-1.95)/lithium (0.05-1) 5-((5-((5-chloro-6-fluoro-pyrimidin-4-yl)amino)-2-sulfonatophenyl)azo)-1,2-dihydro-6-hydroxy-1,4-dimethyl-2-oxo-3-pyridinemethylsulfonate |
134595-59-8 |
R43 |
|
|
|
611-092-00-2 |
tert-(dodecyl/tetradecyl)-ammonium bis(3-(4-((5-(1,1-dimethyl-propyl)-2-hydroxy-3-nitrophenyl)azo)-3-methyl-5-hydroxy-(1H)pyrazol-1-yl)benzenesulfonamidato)chromate |
- |
N; R51-53 |
|
|
|
611-093-00-8 |
sodium 2-(4-(4-fluoro-6-(2-sulfo-ethylamino)-[1,3,5]triazin-2-ylamino)-2-ureido-phenylazo)-5-(4-sulfophenylazo)benzene-1-sulfonate |
146177-84-6 |
R43 |
|
|
|
611-094-00-3 |
reaction mass of: 2-[2-acetylamino-4-[N,N-bis[2-ethoxy-carbonyloxy)ethyl]amino]phenylazo]-5,6-dichloro-1,3-benzothiazole; 2-[2-acetylamino-4-[N,N-bis[2-ethoxy-carbonyloxy)ethyl]amino]phenylazo]-6,7-dichloro-1,3-benzotriazole (1:1) |
143145-93-1 |
R53 |
|
|
|
611-095-00-9 |
hexasodium 1,1'-[(1-amino-8-hydroxy-3,6-disulfonate-2,7-naphthalenediyl)bis(azo(4-sulfonate-1,3-phenyl)imino[6-[(4-chloro-3-sulfonatophenyl)amino]-1,3,5-triazin-2,4-diyl]]]bis[3-carboxypyridinium] dihydroxide |
89797-03-5 |
N; R51-53 |
|
|
|
611-096-00-4 |
methyl N-[3-acetylamino)-4-(2-cyano-4-nitrophenylazo)phenyl]-N-[(1-methoxy)acetyl]glycinate |
149850-30-6 |
R43 |
|
|
|
611-097-00-X |
reaction mass of iron complexes of: 1,3-dihydroxy-4-[(5-phenylaminosulfonyl)-2-hydroxyphenylazo]-n-(5-amino-sulfonyl-2-hydroxyphenylazo)benzene and: 1,3-dihydroxy-4-[(5-phenylaminosulfonyl)-2-hydroxyphenylazo]-n-[4-(4-nitro-2-sulfophenylamino)phenylazo]benzene (n=2,5,6) |
- |
R43, N; R51-53 |
|
|
|
611-098-00-5 |
tetrakis(tetramethylammonium)3,3'-(6-(2-hydroxyethylamino)1,3,5-triazine-2,4-diylbisimino(2-methyl-4,1-phenyleneazo))bisnaphthalene-1,5-disulfonate |
131013-83-7 |
T; R25, R52-53 |
|
|
|
611-099-00-0 |
(methylenebis(4,1-phenylenazo(1-(3-(dimethylamino)propyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3-diyl)))-1,1'-dipyridinium dichloride dihydrochloride |
118658-99-4 |
Carc. Cat. 2; R45, N; R51-53 |
|
|
|
611-100-00-4 |
potassium sodium 3,3'-(3(or4)-methyl-1,2-phenylenebis(imino(6-chloro)-1,3,5-triazine-4,2-diylimino(2-acetamido-5-methoxy)-4,1-phenylenazo)dinaphthalene-1,5-disulfonate |
140876-13-7 |
Xi; R41 |
|
|
|
611-101-00-X |
2'-(4-chloro-3-cyano-5-formyl-2-thienyl)azo-5'-diethylaminoacetanilide |
104366-25-8 |
R43 |
|
|
|
611-102-00-5 |
reaction product of: C.I. Leuco Sulfur Black 1 and reaction mass of: disodium-4-{4-[8-amino-1-hydroxy-7-(4-sulfamoylphenylazo)-3,6-disulfonato-2-naphthylazo]phenylsulfonylamino}benzendiazoniumchlorid; disodium-4-{4-[2,6-dihydroxy-3-(8-hydroxy-3,6-disulfo |
- |
R52-53 |
|
|
|
611-103-00-0 |
trisodium (1-(3-carboxylato-2-oxido-5-sulfonatophenylazo)-5-hydroxy-7-sulfonatonaphthalen-2-amido)nickel(II) |
- |
Xi; R41, R43, N; R51-53 |
|
|
|
611-104-00-6 |
reaction mass of: trisodium (2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(or 4or 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(or 2or 6)-(4-(4-nitro-2-sulfonatoanilino)phenylazo)phenolato)ferrate(1-); trisodium bis(2,4(or 2, |
- |
R43, N; R51-53 |
|
|
|
611-105-00-1 |
sodium 4-(4-chloro-6-(N-ethylanilino)-1,3,5-triazin-2-ylamino)-2-(1-(2-chlorophenyl)-5-hydroxy-3-methyl-1H-pyrazol-4-ylazo)benzenesulfonate |
136213-75-7 |
R43, N; R51-53 |
|
|
|
611-106-00-7 |
hexasodium 4,4'-dihydroxy-3,3'-bis[2-sulfonato-4-(4-sulfonatophenylazo)phenylazo]-7,7'[p-phenylenebis[imino(6-chloro-1,3,5-triazine-4,2-diyl)imino]]dinaphthalene-2-sulfonate |
157627-99-1 |
Xi; R41 |
|
|
|
611-107-00-2 |
potassium sodium 4-(4-chloro-6-(3,6-disulfonato-7-(5,8-disulfonato-naphthalen-2-ylazo)-8-hydroxy-naphthalen-1-ylamino)-1,3,5-triazin-2-ylamino)-5-hydroxy-6-(4-(2-sulfatoethanesulfonyl)-phenylazo)-naphthalene-1,7-disulfonate |
- |
R43 |
|
|
|
611-108-00-8 |
disodium 5-((4-((4-chloro-3-sulfonatophenyl)azo)-1-naphthyl)azo)-8-(phenylamino)-1-naphthalenesulfonate |
6527-62-4 |
R52-53 |
|
|
|
611-109-00-3 |
Reaction products of: copper(II) sulfate and tetrasodium 2,4-bis[6-(2-methoxy-5-sulfonatophenylazo)-5-hydroxy-7-sulfonato-2-naphthylamino]-6-(2-hydroxyethylamino)-1,3,5-triazine (2:1) |
- |
N; R51-53 |
|
|
|
611-110-00-9 |
tetra-sodium/lithium 4,4'-bis-(8-amino-3,6-disulfonato-1-naphthol-2-ylazo)-3-methylazobenzene |
124605-82-9 |
R43, N; R51-53 |
|
|
|
611-111-00-4 |
disodium 2-[[4-(2-chloroethylsulfonyl)phenyl]-[(2-hydroxy-5-sulfo-3-[3-[2-(2-(sulfooxy)ethylsulfonyl)ethylazo]-4-sulfobenzoato(3-)cuprate(1-) |
- |
R43 |
|
|
|
611-112-00-X |
tetrasodium 4-hydroxy-5-[4-[3-(2-sulfatoethanesulfonyl)phenylamino]-6-morpholin-4-yl-1,3,5-triazin-2-ylamino]-3-(1-sulfonatonaphthalen-2-ylazo)naphthalene-2,7-disulfonate |
- |
R43 |
|
|
|
611-113-00-5 |
lithium sodium (2-(((5-((2,5-dichlorophenyl)azo)-2-hydroxyphenyl)methylene)amino)benzoato(2-))(2-((4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo)-5-sulfobenzoato(3-)) chromate(2-) |
149626-00-6 |
N; R51-53 |
|
|
|
611-114-00-0 |
lithium sodium (4-((5-chloro-2-hydroxyphenyl)azo)-2,4-dihydro-5-methyl-3H-pyrazol-3-onato(2-))(3-((4,5-dihydro-3-methyl-1-(4-methylphenyl)-5-oxo-1H-pyrazol-4-yl)azo)-4-hydroxy-5-nitrobenzenesulfonato(3-)) chromate(2-) |
149564-66-9 |
Xn; R22, Xi; R41, R52-53 |
|
|
|
611-115-00-6 |
trilithium bis(4-((4-(diethylamino)-2-hydroxyphenyl)azo)-3-hydroxy-1-naphthalenesulfonato(3-))chromate(3-) |
149564-65-8 |
Xn; R22, R52-53 |
|
|
|
611-116-00-1 |
reaction mass of: trisodium 5-{}{4-chloro-6-[2-(2,6-dichloro-5-cyanopyrimidin-4-ylamino)-propylamino]-1,3,5-triazin-2-ylamino}}-4-hydroxy-3-(1-sulfonatonaphthalene-2-ylazo)-naphthalene-2,7-disulfonate; trisodium 5-{}{4-chloro-6-[2-(2,6-dichloro-5-cyanopy |
- |
Xi; R41, R43 |
|
|
|
611-117-00-7 |
1,3-bis{}{6-fluoro-4-[1,5-disulfo-4-(3-aminocarbonyl-1-ethyl-6-hydroxy-4-methyl-pyrid-2-on-5-ylazo)-phenyl-2-ylamino]-1,3,5-triazin-2-ylamino}}propane lithium-, sodium salt |
149850-29-3 |
R43 |
|
|
|
611-118-00-2 |
sodium 1,2-bis[4-[4-{}{4-(4-sulfophenylazo)-2-sulfophenylazo}}-2-ureido-phenyl-amino]-6-fluoro-1,3,5-triazin-2-ylamino]-propane, sodium salt |
- |
R43 |
|
|
|
611-119-00-8 |
tetrasodium 4-[4-chloro-6-(4-methyl-2-sulfophenylamino)-1,3,5-triazin-2-ylamino]-6-(4,5-dimethyl-2-sulfophenylazo)-5-hydroxynaphthalene-2,7-disulfonate |
148878-22-2 |
Xi; R41, R43 |
|
|
|
611-120-00-3 |
5-{}{4-[5-amino-2-[4-(2-sulfoxyethylsulfonyl)phenylazo]-4-sulfo-phenylamino]-6-chloro-1,3,5-triazin-2-ylamino}}-4-hydroxy-3-(1-sulfo-naphthalen-2-ylazo)-naphthalene-2,7-disulfonicacid sodium salt |
157707-94-3 |
Xi; R41, R52-53 |
|
|
|
611-121-00-9 |
Main component 6 (isomer): asym. 1:2 Cr(III)-complex of: A: 3-hydroxy-4-(2-hydroxy-naphthalene-1-ylazo)naphthalene-1-sulfonic acid, Na-salt and B: 1-[2-hydroxy-5-(4-methoxy-phenylazo)phenylazo]naphthalene-2-ol; Main component 8 (isomer): asym. 1:2 Cr-com |
30785-74-1 |
Xi; R41, N; R50-53 |
|
|
|
611-122-00-4 |
hexasodium (di[N-(3-(4-[5-(5-amino-3-methyl-1-phenylpyrazol-4-yl-azo)-2,4-disulfo-anilino]-6-chloro-1,3,5-triazin-2-ylamino)phenyl)-sulfamoyl](di-sulfo)-phthalocyaninato)nickel |
151436-99-6 |
Xi; R41, R43 |
|
|
|
611-123-00-X |
3-(2,4-bis(4-((5-(4,6-bis(2-aminopropylamino)-1,3,5-triazin-2-ylamino)-4-hydroxy-2,7-disulfonaphthalen-3-yl)azo)phenylamino)-1,3,5-triazin-6-ylamino)propyldiethylammonium lactate |
178452-66-9 |
Xi; R41 |
|
|
|
611-124-00-5 |
reaction mass of: pentasodium 5-amino-3-(5-{}{4-chloro-6-[4-(2-sulfoxyethoxysulfonato)phenylamino]-1,3,5-triazin-2-ylamino}}-2-sulfonatophenylazo)-6-[5-(2,3-dibromopropionylamino)-2-sulfonatophenylazo]-4-hydroxynaphthalene-2,7-disulfonate; pentasodium 5- |
- |
Xi; R41, N; R51-53 |
|
|
|
611-125-00-0 |
reaction mass of: Disodium 6-[3-carboxy-4,5-dihydro-5-oxo-4-sulfonatophenyl)pyrazolin-4-yl-azo]-3-[2-oxido-4-(ethensulfonyl)-5-methoxyphenylazo]-4-oxidonaphthalene-2-sulfonate copper (II) complex; Disodium 6-[3-carboxy-4,5-dihydro-5-oxo-4-sulfonatophenyl |
- |
Xi; R41, N; R51-53 |
|
|
|
611-126-00-6 |
2,6-bis-(2-(4-(4-amino-phenylamino)-phenylazo)-1,3-dimethyl-3H-imidazolium)-4-dimethylamino-1,3,5-triazine, dichloride |
174514-06-8 |
Xi; R41, N; R50-53 |
|
|
|
611-127-00-1 |
pentasodium 4-amino-6-(5-(4-(2-ethyl-phenylamino)-6-(2-sulfatoethanesulfonyl)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxy-3-(4-(2-sulfatoethanesulfonyl)phenylazo)naphthalene-2,7-disulfonate |
- |
R5, Xi; R41, R43, R52-53 |
|
|
|
611-128-00-7 |
N,N'-bis{}{6-chloro-4-[6-(4-vinylsulfonylphenylazo)-2,7-disulfonicacid-5-hydroxynapht-4-ylamino]-1,3,5-triazin-2-yl}}-N-(2-hydroxyethyl)ethane-1,2-diamine, sodium salt |
171599-85-2 |
Xi; R41, R43 |
|
|
|
611-129-00-2 |
reaction mass of: 5-[(4-[(7-amino-1-hydroxy-3-sulfo-2-naphthyl)azo]-2,5-diethoxyphenyl)azo]-2-[(3-phosphonophenyl)azo]benzoic acid; 5-[(4-[(7-amino-1-hydroxy-3-sulfo-2-naphthyl)azo]-2,5-diethoxyphenyl)azo]-3-[(3-phosphonophenyl)azo]benzoic acid |
163879-69-4 |
E; R2, Repr. Cat. 3; R62, Xn; R48/22, R43, N; R51-53 |
|
|
|
611-130-00-8 |
tetra-ammonium 2-[6-[7-(2-carboxylato-phenylazo)-8-hydroxy-3,6-disulfonato-1-naphthylamino]-4-hydroxy-1,3,5-triazin-2-ylamino]benzoate |
183130-96-3 |
Xi; R36, R52-53 |
|
|
|
611-131-00-3 |
2-[2-hydroxy-3-(2-chlorophenyl)carbamoyl-1-naphthylazo]-7-[2-hydroxy-3-(3-methylphenyl)carbamoyl-1-naphthylazo]fluoren-9-one |
151798-26-4 |
Repr. Cat. 2; R61, R53 |
|
|
|
611-132-00-9 |
pentasodium bis{}{7-[4-(1-butyl-5-cyano-1,2-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo)phenylsulfonylamino]-5'-nitro-3,3'-disulfonatonaphthalene-2-azobenzene-1,2'-diolato}} chromate (III) |
178452-71-6 |
Xi; R41, R52-53 |
|
|
|
611-133-00-4 |
Product by process iron complex of azo dyestuffs obtained by coupling a mixture of diazotized 2-amino-1-hydroxybenzene-4-sulfanilide and 2-amino-1-hydroxybenzene-4-sulfonamide with resorcin, the obtained mixture being subsequently submitted to a second coupling reaction with a mixture of diazotized 3-aminobenzene-1-sulfonic acid (metanilic acid) and 4'-amino-4-nitro-1,1'-diphenylamine-2-sulfonic acid and metallization with ferric chloride, sodium salt |
- |
Xi; R41, N; R51-53 |
|
|
|
611-134-00-X |
trisodium 2-{}{α[2-hydroxy-3-[4-chloro-6-[4-(2,3-dibromopropionylamino)-2-sulfonatophenylamino]-1,3,5-triazin-2-ylamino]-5-sulfonatophenylazo]-benzylidenehydrazino}}-4-sulfonatobenzoate, copper complex |
- |
Xi; R41, N; R51-53 |
|
|
|
611-135-00-5 |
Reaction product of: 2-[[4-amino-2-ureidophenylazo]-5-[(2-(sulfooxy)ethyl)sulfonyl]]benzenesulfonic acid with 2,4,6-trifluoropyrimidine and partial hydrolysis to the corresponding vinylsulfonyl derivative,mixed potassium/sodium salt |
- |
Xi; R41, R52-53 |
|
|
|
611-136-00-0 |
2-{}{4-(2-ammoniopropylamino)-6-[4-hydroxy-3-(5-methyl-2-methoxy-4-sulfamoylphenylazo)-2-sulfonatonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}}-2-aminopropyl formate |
- |
Repr. Cat. 3; R62, Xi; R41, N; R51-53 |
|
|
|
611-137-00-6 |
6-tert-butyl-7-chloro-3-tridecyl-7,7a-dihydro-1H-pyrazolo[5,1-c]-1,2,4-triazole |
159038-16-1 |
R53 |
|
|
|
611-138-00-1 |
2-(4-aminophenyl)-6-tert-butyl-1H-pyrazolo[1,5-b][1,2,4]triazole |
152828-25-6 |
R43, N; R51-53 |
|
|
|
611-139-00-7 |
reaction product of: C.I. Leuco Sulfur Black 1 with (3-chloro-2-hydroxypropyl)trimethylammonium chloride |
- |
Xi; R41, N; R51-53 |
|
|
|
611-140-00-2 |
azafenidin (ISO); 2-(2,4-dichloro-5-prop-2-ynyloxyphenyl)-5,6,7,8-tetrahydro-1,2,4-triazolo[4,3-a]pyridin-3(2H)-one |
68049-83-2 |
Repr. Cat. 2; R61, Repr. Cat. 3; R62, Xn; R48/22, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
E |
|
611-141-00-8 |
5-(4-[4-[4-(3,5-dicarboxy-phenyl-azo)phenylamino]-6-morpholin-4-yl-1,3,5-triazin-2-ylamino]phenylazo)isophthalic acid, mixed monosodium and diammonium salt |
- |
Xi; R41, R43 |
|
|
|
611-142-00-3 |
product-by-process definition polyazodyestuff obtained by coupling 4-[4-(1-amino-8-hydroxy-3,6-disulfo-2-naphthylazo)phenylsulfonylamino]benzenediazonium with reaction mass of 4-carboxybenzenediazonium and diphenylamine-3-sulfo-4,4'-bisdiazonium, and furt |
- |
Xi; R41, R52-53 |
|
|
|
611-143-00-9 |
reaction mass of: trisodium 2-(2-[α-(2-carboxylato-κ-O-4-sulfonatophenylazo)benzylidene]hydrazino-κ-N')-6-(2,6-difluoropyrimidin-4-ylamino)-4-sulfonatophenolatocuprate (II); trisodium 2-(2-[α-(2-carboxylato-κ-O-4-sulfonatophenylazo)benzylidene]hydrazino- |
- |
Xi; R41 |
|
|
|
611-144-00-4 |
reaction mass of: 7-amino-3,8-bis-[4-(2-sulfoxyethylsulfonyl)phenylazo]-4-hydroxynaphthalene-2-sulfonic acid, Na/K salt; 7-amino-3-[4-(2-sulfoxyethylsulfonyl)phenylazo]-4-hydroxy-8-[4-(2-sulfoxyethylsulfonyl)-2-sulfophenylazo]naphthalene-2-sulfonic acid, |
214362-06-8 |
Xi; R41 |
|
|
|
611-145-00-X |
reaction mass of: tetrasodium 3-(1,5-disulfonatonaphthalene-2-ylazo)-4-hydroxy-7-{4-chloro-6-[4-(2-sulfoxyethylsulfonyl)phenylamino]-1,3,5-triazine-2-ylamino}naphthalene-2-sulfonate; 3-(2,5-disulfophenylazo)-4-hydroxy-7-{4-chloro-6-[4-(2-sulfoxyethylsulf |
- |
Xi; R41 |
|
|
|
611-146-00-5 |
reaction mass of: pentasodium 3-(4-(4-(7-(2,4-diamino-5-sulfonato-3-(4-sulfonatophenylazo)phenylazo)-1-hydroxy-3-sulfonatonaphthalen-2-ylazo)-2-sulfonatophenylamino)phenylazo)-4-hydroxy-6-(2-oxo-1-phenylcarbamoylpropylazo)naphthalene-2-sulfonate; pentaso |
- |
N; R51-53 |
|
|
|
611-147-00-0 |
sodium, potassium, lithium 5-amino-3,6-bis(5-(4-chloro-6-(methyl-(2-methylaminoacetyl)amino)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-4-hydroxynaphthalene-2,7-disulfonate |
205764-96-1 |
Xi; R41, R43 |
|
|
|
611-148-00-6 |
reaction mass of: 2-(3-(2,6-dichloro-4-nitrophenylazo)carbazol-9-yl)ethanol; 2-(2-(3-(2,6-dichloro-4-nitro-phenylazo)-carbazol-9-yl)-ethoxy)ethanol; 3-(2,6-dichloro-4-nitrophenylazo)carbazol |
- |
R43, N; R50-53 |
|
|
|
611-149-00-1 |
2-(2-chloroacetoxy)ethyl 3-((4-(2,5-dichloro-4-fluorosulfonylphenylazo)-3-methylphenyl)ethylamino)propionate |
193486-83-8 |
N; R51-53 |
|
|
|
611-150-00-7 |
tetralithium 2-[6-[7-[2-(carboxylato)phenylazo]-8-hydroxy-3,6-disulfonato-1-naphthylamino]-4-hydroxy-1,3,5-triazine-2-ylamino]benzoate |
- |
Xi; R36, R52-53 |
|
|
|
611-151-00-2 |
chrysoidine; 4-(phenylazo)benzene-1,3-diamine |
495-54-5 |
Muta. Cat. 3; R68, Xn; R22, Xi; R38, N; R50-53 |
|
|
|
611-152-00-8 |
chrysoidine monohydrochloride; 4-phenylazophenylene-1,3-diamine monohydrochloride; [1] chrysoidine monoacetate; 4-(phenylazo)benzene-1,3-diamine monoacetate; [2] chrysoidine acetate; 4-(phenylazo)benzene-1,3-diamine acetate; [3] chrysoidine-p-dodecy |
532-82-1 [1], 75660-25-2 [2], 79234-33-6 [3], 63681-54-9 [4], 83968-67-6 [5], 84196-22-5 [6] |
Muta. Cat. 3; R68, Xn; R22, Xi; R38-41, N; R50-53 |
|
|
|
611-153-00-3 |
chrysoidine C10-14-alkyl derivatives; benzenesulfonic acid, mono-C10-14-alkyl derivatives, compounds with 4-(phenylazo)-1,3-benzenediamine; [1] chrysoidine compound with dibutylnaphthalene sulfonic acid; dibutylnaphthalenesulfonic acid, compound with 4 |
85407-90-5 [1], 94247-67-3 [2] |
Muta. Cat. 3; R68, Xn; R22, Xi; R38-41 |
|
|
|
611-154-00-9 |
trisodium 5-benzamido-4-hydroxy-3-(4-methyl-2-sulfonatophenylazo)naphthalene-2,7-disulfonate |
92408-46-3 |
R52-53 |
|
|
|
611-155-00-4 |
4,4'-oxybis(benzenesulfonylazide) |
7456-68-0 |
E; R3, F; R11, Xn; R48/22, N; R50-53 |
|
|
|
611-156-00-X |
triammonium 4-[4-[7-(4-carboxylatoanilino)-1-hydroxy-3-sulfonato-2-naphthylazo]-2,5-dimethoxyphenylazo]benzoate |
221354-37-6 |
Repr. Cat. 3; R62, Xn; R48/22, N; R51-53 |
|
|
|
611-157-00-5 |
benzenesulfonic acid, 3,3'-(methylenebis((dihydroxyphenylene)azo))bis-, potassium sodium salt; potassium sodium 3-[(E)-(6-{3,4-dihydroxy-2-[(Z)-(3-sulfonatophenyl)diazenyl]benzyl}-2,3-dihydroxyphenyl)diazenyl]benzenesulfonate |
243869-48-9 |
Xi; R36, R52-53 |
|
|
|
611-158-00-0 |
reaction product of: 2,3,4,2',3',4'-hexahydroxy-5,5'-diacethyl-diphenylmethane and 6-diazo-5,6-dihydro-5-oxo-1-naphthalenesulfonylchloride and 3-diazo-3,4-dihydro-6-methoxy-4-oxo-1-naphthalenesulfonylchloride |
- |
F; R11, R53 |
|
|
|
611-159-00-6 |
disodium 4-amino-6-((4-((4-(2,4-diaminophenyl)azo)phenylsulfamoyl)phenyl)azo)-5-hydroxy-3-((4-nitrophenyl)azo)naphthalene-2,7-disulfonate |
- |
Xi; R41, R52-53 |
|
|
|
611-160-00-1 |
reaction mass of: 1,1,1-tris(phenyl-4'-(3''-diazo-3'',4''-dihydro-4''-oxo-naphthalene-1''-sulfonato)ethane; 1,1,1-tris(phenyl-4'-(6''-diazo-5'',6''-dihydro-5''-oxo-naphthalene-1''-sulfonato)ethane; reaction product of 1,1,1-tris(p-hydroxyphenyl)ethane w |
- |
F; R11, R53 |
|
|
|
611-161-00-7 |
trisodium [1,2'-(2-(8-amino-3,5-disulfonatonaphthalene)azo)-(4'-nitrobenzene)diolato-O,O,N][(Z)-2,2-((phenylcarbamoylprop-1'-enyl)azo)-5-sulfamoylbenzene)diolato-O,O,N]chromate(III) |
- |
Xi; R41 |
|
|
|
611-162-00-2 |
2,4-bis(((2-(dimethylammonio)ethyloxy)carbonyl)phen-2-ylazo)benzene-1,3-diolbis(methanesulfonate) |
- |
Xn; R22, Xi; R41, N; R51-53 |
|
|
|
611-163-00-8 |
2,4-bis(((2-(dimethylammonio)ethyloxy)carbonyl)phen-2-ylazo)benzene-1,3-diol sulfate |
- |
Xn; R22, Xi; R41, N; R51-53 |
|
|
|
611-164-00-3 |
reaction mass of: 2,2'-dimethyl-2,2'-azobutanenitrile; 2-methylpentanenitrile-2-azo-2'-(2'-methylpropanenitrile); 2,2'-dimethyl-2,2'-azoheptanenitrile; 2-methylheptanenitrile-2-azo-2'-(2'-methylpropanenitrile); 2-methylheptanenitrile-2-azo-2'-(2'-meth |
- |
R10, R32, R44, Xn; R22, N; R51-53 |
|
|
|
611-165-00-9 |
reaction mass of: tetrasodium 4-amino-6-(5-(2,6-difluoropyrimidin-4-ylamino)-2-sulfonatophenylazo)-5-hydroxy-3-(4-(sulfatoethylsulfonyl)phenylazo)naphthalene-2,7-disulfonate; tetrasodium 4-amino-6-(5-(4,6-difluoropyrimidin-2-ylamino)-2-sulfonatophenylazo |
- |
R52-53 |
|
|
|
611-166-00-4 |
reaction mass of: pentasodium 4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-6-{(E)-2-sulfonato-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}naphthalene-2,7-disulfonate; tetrasodium 4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsul |
- |
Xi; R41, R52-53 |
|
|
|
611-167-00-X |
sodium bis[tris(2-hydroxyethyl)ammonium][6-anilino-4'-(4,8-disulfonato-2-naphthylazo)-5'-methyl-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato]cuprate(II) |
- |
R52-53 |
|
|
|
611-168-00-5 |
reaction mass of: 3-[[4-chloro-6-[[7-[(1,5-disulfo-2-naphthalenyl)azo]-8-hydroxy-3,6-disulfo-1-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]-5-[[4-chloro-6-[[8-hydroxy-3,6-disulfo-7-[(2-sulfophenyl)azo]-1-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]benzo |
- |
Xi; R41 |
|
|
|
611-169-00-0 |
sodium 5-(2-carboxyphenylazo)-6-hydroxynaphthalene-2-sulfonate |
- |
R52-53 |
|
|
|
611-170-00-6 |
reaction mass of: trisodium 2-((1-(2-hydroxy-κ-O-5-(2-sulfonatoethansulfonyl)phenylazo-κ-N2)-1-phenylmethyl)azo-κ-N1)-4-sulfonatobenzoate(5-)-κ-O)cuprate(II); disodium 2-((1-(5-ethenesulfonyl-2-hydroxy-κ-O-phenylazo-κ-N2)-1-phenylmethyl)azo-κ-N1)-4-sulfo |
- |
R52-53 |
|
|
|
611-171-00-1 |
reaction mass of: trisodium 3-(5-(2,6-difluoropyrimidin-4-ylamino)-2-sulfonatophenylazo)-5-(4-fluoro-6-morpholin-4-yl-1,3,5-triazin-2-ylamino)-4-hydroxy-2,7-naphthalenedisulfonate; trisodium 3-(5-(4,6-difluoropyrimidin-2-ylamino)-2-sulfonatophenylazo)-5- |
- |
Xi; R41, R52-53 |
|
|
|
611-172-00-7 |
reaction mass of: triammonium 6-amino-3-((2,5-diethoxy-4-(3-phosphonophenyl)azo)phenyl)azo-4-hydroxy-2-naphthalenesulfonate; diammonium 3-((4-((7-amino-1-hydroxy-3-sulfo-naphthalen-2-yl)azo)-2,5-diethoxyphenyl)azo)benzoate |
- |
E; R2, Repr. Cat. 3; R62, Xn; R22-48/22, R52-53 |
|
|
|
611-173-00-2 |
reaction mass of: 3-[3-carbamoyl-5-(5-{4-chloro-6-[4-(2-sulfonatooxyethylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-1-pyridyl]propanoic acid, trisodium salt; 3-[3-carbamoyl-5-(5-{4-chloro-6-[4-(v |
- |
Xi; R41, R43 |
|
|
|
611-174-00-8 |
reaction mass of: 3-[5-(4-ethenesulfonylbutyrylamino)-2-sulfophenylazo]-5-{4-chloro-[6-(4-(3-amino-5-hydroxy-2,7-disulfonaphthalene-4-ylazo)-3-sulfophenylamino]-1,3,5-triazin-2-ylamino}-4-hydroxynaphthalene-2,7-disulfonic acid, sodium salt; 3-[5-(4-(2-ch |
457624-86-1 |
Xi; R41 |
|
|
|
611-175-00-3 |
reaction mass of: trisodium 5-{4-chloro-6-[N-ethyl-(3-(2-sulfonatooxy)ethylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-[4-(vinylsulfonyl)phenylazo]naphthalene-2,7-disulfonate; trisodium 5-{4-chloro-6-[N-ethyl-3-(vinylsulfonyl)anilino]-1,3,5-tr |
- |
Xi; R41, R52-53 |
|
|
|
611-176-00-9 |
2,6-bis(2,3,4-trihydroxybenzyl)-p-cresol ester with 6-diazo-5,6-dihydro-5-oxo-1-naphthalenesulfonate |
- |
E; R2, F; R11, N; R51-53 |
|
|
|
611-177-00-4 |
reaction mass of: pentasodium bis[6-anilino-3,5'-disulfonatonaphthalene-2-azobenzene-1,2'-diolato]cobaltate(III); tetrasodium [6-anilino-3,5'-disulfonatonaphthalene-2-azobenzene-1,2'-diolato][6-anilino-5'-sulfamoyl-3-sulfonatonaphthalene-2-azobenzene-1, |
508202-43-5 |
Xi; R41, R43, R52-53 |
|
|
|
611-178-00-X |
reaction mass of: pentasodium 4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-6-{(E)-2-sulfonato-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}naphthalene-2,7-disulfonate; tetrasodium 4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsul |
- |
Xi; R41, R43, R52-53 |
|
|
|
611-179-00-5 |
reaction mass of: pentasodium 2-[[8-[[4-chloro-6-[[4-(2-sulfonato ethylsulfonyl)]phenyl]amino]-1,3,5-triazin-2-yl]amino-1- hydroxy-3,6-disulfonato-2-naphthalenyl]azo]naphthalene-1,5-disulfonate; 2-[[8-[[4-chloro-6-[[4-[[2-ethenyl]sulfonyl]phenyl]amino]-1 |
- |
Xi; R41, R43 |
|
|
|
611-180-00-0 |
iron, complexes with diazotised 4-aminobenzenesulfonamide,diazotised 3-aminobenzenesulfonic acid, diazotised 3-amino-4-hydroxybenzenesulfonamide,diazotised 3-amino-4-hydroxy-N-phenylbenzenesulfonamide, diazotised 5-amino-2-(phenylamino)benzenesulfonic acid and resorcinol, sodium salts |
- |
N; R51-53 |
|
|
|
612-001-00-9 |
mono-methylamine; [1] di-methylamine; [2] tri-methylamine [3] |
74-89-5 [1], 124-40-3 [2], 75-50-3 [3] |
F+; R12, Xn; R20, Xi; R37/38-41 |
C ≥ 5 %: Xn; R20, C ≥ 5 %: Xi; R37/38-41, 0,5 % ≤ C < 5 %: Xi; R36 |
5 |
|
612-001-01-6 |
mono-methylamine ... %; [1] di-methylamine ... %; [2] tri-methylamine ... % [3] |
74-89-5 [1], 124-40-3 [2], 75-50-3 [3] |
F+; R12, Xn; R20/22, C; R34 |
C ≥ 15 %: Xn; R20/22, C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
B |
|
612-002-00-4 |
ethylamine |
75-04-7 |
F+; R12, Xi; R36/37 |
|
|
|
612-003-00-X |
diethylamine |
109-89-7 |
F; R11, Xn; R20/21/22, C; R35 |
C ≥ 10 %: C; R35, 5 % ≤ C < 10 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/37/38 |
|
|
612-004-00-5 |
triethylamine |
121-44-8 |
F; R11, Xn; R20/21/22, C; R35 |
C ≥ 10 %: C; R35, 5 % ≤ C < 10 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/37/38 |
|
|
612-005-00-0 |
butylamine |
109-73-9 |
F; R11, Xn; R20/21/22, C; R35 |
C ≥ 10 %: C; R35, 5 % ≤ C < 10 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/37/38 |
|
|
612-006-00-6 |
ethylenediamine; 1,2-diaminoethane |
107-15-3 |
R10, Xn; R21/22, C; R34, R42/43 |
C ≥ 10 %: C; R34, 2 % ≤ C < 10 %: Xi; R36/38 |
|
|
612-007-00-1 |
2-aminopropane; isopropylamine |
75-31-0 |
F+; R12, Xi; R36/37/38 |
|
|
|
612-008-00-7 |
aniline |
62-53-3 |
Carc. Cat. 3; R40, Muta. Cat. 3; R68, T; R23/24/25-48/23/24/25, Xi; R41, R43, N; R50 |
C ≥ 25 %: T; R23/24/25, 1 % ≤ C < 25 %: Xn; R20/21/22, C ≥ 1 %: T; R48/23/24/25, 0,2 % ≤ C < 1 %: Xn; R48/20/21/22 |
|
|
612-009-00-2 |
salts of aniline |
- |
Carc. Cat. 3; R40, Muta. Cat. 3; R68, T; R23/24/25-48/23/24/25, Xi; R41, R43, N; R50 |
C ≥ 25 %: T; R23/24/25, 1 % ≤ C < 25 %: Xn; R20/21/22, C ≥ 1 %: T; R48/23/24/25, 0,2 % ≤ C < 1 %: Xn; R48/20/21/22 |
A |
|
612-010-00-8 |
chloroanilines, with exception of those specified elsewhere in this Annex |
- |
T; R23/24/25, R33, N; R50-53 |
|
C |
|
612-011-00-3 |
4-nitrosoaniline |
659-49-4 |
Xn; R20/21/22 |
|
|
|
612-012-00-9 |
o-nitroaniline; [1] m-nitroaniline; [2] p-nitroaniline [3] |
88-74-4 [1], 99-09-2 [2], 100-01-6 [3] |
T; R23/24/25, R33, R52-53 |
|
C |
|
612-013-00-4 |
3-aminobenzene sulphonic acid; metanilic acid |
121-47-1 |
Xn; R20/21/22 |
|
|
|
612-014-00-X |
sulphanilic acid; 4-aminobenzenesulphonic acid |
121-57-3 |
Xi; R36/38, R43 |
|
|
|
612-015-00-5 |
N-methylaniline |
100-61-8 |
T; R23/24/25, R33, N; R50-53 |
|
|
|
612-016-00-0 |
N,N-dimethylaniline |
121-69-7 |
Carc. Cat. 3; R40, T; R23/24/25, N; R51-53 |
|
|
|
612-017-00-6 |
N-methyl-N-2,4,6-tetranitroaniline; tetryl |
479-45-8 |
E; R3, T; R23/24/25, R33 |
|
|
|
612-018-00-1 |
bis(2,4,6-trinitrophenyl)amine; hexyl |
131-73-7 |
E; R3, T+; R26/27/28, R33, N; R51-53 |
|
|
|
612-019-00-7 |
dipicrylamine, ammonium salt |
2844-92-0 |
E; R3, T+; R26/27/28, R33, N; R51-53 |
|
|
|
612-020-00-2 |
1-naphthylamine |
134-32-7 |
Xn; R22, N; R51-53 |
|
|
|
612-022-00-3 |
2-naphthylamine |
91-59-8 |
Carc. Cat. 1; R45, Xn; R22, N; R51-53 |
C ≥ 0,01 %: Carc. Cat. 1; R45 |
|
|
612-023-00-9 |
phenylhydrazine; [1] phenylhydrazinium chloride; [2] phenylhydrazine hydrochloride; [3] phenylhydrazinium sulphate (2:1) [4] |
100-63-0 [1], 59-88-1 [2], 27140-08-5 [3], 52033-74-6 [4] |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, T; R23/24/25-48/23/24/25, Xi; R36/38, R43, N; R50 |
|
|
|
612-024-00-4 |
m-toluidine; 3-aminotoluene |
108-44-1 |
T; R23/24/25, R33, N; R50 |
|
|
|
612-025-00-X |
nitrotoluidines, with the exception of those specified elsewhere in this Annex |
- |
T; R23/24/25, R33, N; R51-53 |
|
|
|
612-026-00-5 |
diphenylamine |
122-39-4 |
T; R23/24/25, R33, N; R50-53 |
|
|
|
612-027-00-0 |
xylidines with the exception of those specified elsewhere in this Annex; dimethyl anilines with the exception of those specified elsewhere in this Annex |
- |
T; R23/24/25, R33, N; R51-53 |
|
|
|
612-028-00-6 |
p-phenylenediamine |
106-50-3 |
T; R23/24/25, Xi; R36, R43, N; R50-53 |
|
|
|
612-029-00-1 |
benzene-1,4-diamine dihydrochloride; p-phenylenediamine dihydrochloride |
624-18-0 |
T; R23/24/25, Xi; R36, R43, N; R50-53 |
|
|
|
612-030-00-7 |
2-methyl-p-phenylenediamine sulphate [1] |
615-50-9 [1], 6369-59-1 [2] |
T; R25, Xn; R20/21, R43, N; R51-53 |
|
|
|
612-031-00-2 |
N,N-dimethylbenzene-1,3-diamine; [1] 4-amino-N,N-dimethylaniline; 3-amino-N,N'-dimethylaniline [2] |
2836-04-6 [1], 99-98-9 [2] |
T; R23/24/25 |
|
|
|
612-032-00-8 |
N,N,N',N'-tetramethyl-p-phenylenediamine |
100-22-1 |
Xn; R20/21/22 |
|
|
|
612-033-00-3 |
2-aminophenol |
95-55-6 |
Xn; R20/22, Muta. Cat. 3; R68 |
|
|
|
612-034-00-9 |
2-amino-4,6-dinitrophenol; picramic acid |
96-91-3 |
E; R2, Xn; R20/21/22, R52-53 |
|
|
|
612-034-01-6 |
2-amino-4,6-dinitrophenol; picramic acid; [≥ 20 % water] |
96-91-3 |
|
|
|
|
612-035-00-4 |
2-methoxyaniline; o-anisidine |
90-04-0 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, T; R23/24/25 |
|
|
|
612-036-00-X |
3,3'-dimethoxybenzidine; o-dianisidine |
119-90-4 |
Carc. Cat. 2; R45, Xn; R22 |
|
|
|
612-037-00-5 |
salts of 3,3'-dimethoxybenzidine; salts of o-dianisidine |
- |
Carc. Cat. 2; R45, Xn; R22 |
|
|
|
612-038-00-0 |
2-nitro-p-anisidine; 4-methoxy-2-nitroaniline |
96-96-8 |
T+; R26/27/28, R33, R52-53 |
|
|
|
612-039-00-6 |
2-ethoxyaniline; o-phenetidine |
94-70-2 |
T; R23/24/25, R33 |
|
|
|
612-040-00-1 |
2,4-dinitroaniline |
97-02-9 |
T+; R26/27/28, R33, N; R51-53 |
|
|
|
612-041-00-7 |
4,4'-bi-o-toluidine |
119-93-7 |
Carc. Cat. 2; R45, Xn; R22, N; R51-53 |
|
|
|
612-042-00-2 |
benzidine; 1,1'-biphenyl-4,4'-diamine; 4,4'-diaminobiphenyl; biphenyl-4,4'-ylenediamine |
92-87-5 |
Carc. Cat. 1; R45, Xn; R22, N; R50-53 |
C ≥ 0,01 %: Carc. Cat. 1; R45 |
|
|
612-043-00-8 |
N,N'-dimethylbenzidine |
2810-74-4 |
Xn; R20/21/22 |
|
|
|
612-044-00-3 |
N,N'-diacetylbenzidine |
613-35-4 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Xn; R20/21/22 |
|
|
|
612-046-00-4 |
allylamine |
107-11-9 |
F; R11, T; R23/24/25, N; R51-53 |
|
|
|
612-047-00-X |
benzylamine |
100-46-9 |
Xn; R21/22, C; R34 |
|
|
|
612-048-00-5 |
dipropylamine |
142-84-7 |
F; R11, Xn; R20/21/22, C; R35 |
C ≥ 10 %: C; R35, 5 % ≤ C < 10 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/37/38 |
|
|
612-049-00-0 |
di-n-butylamine; [1] di-sec-butylamine [2] |
111-92-2 [1], 626-23-3 [2] |
R10, Xn; R20/21/22 |
|
|
|
612-050-00-6 |
cyclohexylamine |
108-91-8 |
R10, Repr. Cat. 3; R62, Xn; R21/22, C; R34 |
C ≥ 10 %: C; 34, 2% ≤ C < 10 %: Xi; R36/38 |
|
|
612-051-00-1 |
4,4'-diaminodiphenylmethane; 4,4'-methylenedianiline |
101-77-9 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, T; R39/23/24/25, Xn; R48/20/21/22, R43, N; R51-53 |
|
|
|
612-052-00-7 |
(S)-sec-butylamine; (S)-2-aminobutane; [1] (R)-sec-butylamine; (R)-2-aminobutane; [2] sec-butylamine; 2-aminobutane [3] |
513-49-5 [1], 13250-12-9 [2], 13952-84-6 [3] |
F; R11, Xn; R20/22, C; R35, N; R50 |
|
|
|
612-053-00-2 |
N-ethylaniline |
103-69-5 |
T; R23/24/25, R33 |
|
|
|
612-054-00-8 |
N,N-diethylaniline |
91-66-7 |
T; R23/24/25, R33, N; R51-53 |
C ≥ 5 %: T; R23/24/25, 1 % ≤ C < 5 %: Xn; R20/21/22 |
|
|
612-055-00-3 |
N-methyl-o-toluidine; [1] N-methyl-m-toluidine; [2] N-methyl-p-toluidine [3] |
611-21-2 [1], 696-44-6 [2], 623-08-5 [3] |
T; R23/24/25, R33, R52-53 |
|
C |
|
612-056-00-9 |
N,N-dimethyl-p-toluidine; [1] N,N-dimethyl-m-toluidine; [2] N,N-dimethyl-o-toluidine [3] |
99-97-8 [1], 121-72-2 [2], 609-72-3 [3] |
T; R23/24/25, R33, R52-53 |
C ≥ 5 %: T; R23/24/25, 1 % ≤ C < 5 %: Xn; R20/21/22 |
C |
|
612-057-00-4 |
piperazine; [solid] |
110-85-0 |
Repr. Cat. 3; R62-63, C; R34, R42/43 |
|
|
|
612-057-01-1 |
piperazine; [liquid] |
110-85-0 |
Repr. Cat. 3; R62-63, C; R34, R42/43 |
|
|
|
612-058-00-X |
2,2'-iminodiethylamine; diethylenetriamine |
111-40-0 |
Xn; R21/22, C; R34, R43 |
|
|
|
612-059-00-5 |
3,6-diazaoctanethylenediamin; triethylenetetramine |
112-24-3 |
Xn; R21, C; R34, R43, R52-53 |
|
|
|
612-060-00-0 |
3,6,9-triazaundecamethylenediamine; tetraethylenepentamine |
112-57-2 |
Xn; R21/22, C; R34, R43, N; R51-53 |
|
|
|
612-061-00-6 |
3-aminopropyldimethylamine; N,N-dimethyl-1,3-diaminopropane |
109-55-7 |
R10, Xn; R22, C; R34, R43 |
|
|
|
612-062-00-1 |
3-aminopropyldiethylamine; N,N-diethyl-1,3-diaminopropane |
104-78-9 |
R10, Xn; R21/22, C; R34, R43 |
|
|
|
612-063-00-7 |
3,3'-iminodi(propylamine); dipropylenetriamine |
56-18-8 |
T+; R26, T; R24, Xn; R22, C; R35, R43 |
|
|
|
612-064-00-2 |
3,6,9,12-tetra-azatetradecamethylenediamine; pentacthylenehexamine |
4067-16-7 |
C; R34, R43, N; R50-53 |
|
|
|
612-065-00-8 |
polyethlyenepolyamines with the exception of those specified elsewhere in this Annex |
- |
Xn; R21/22, C; R34, R43, N; R50-53 |
|
|
|
612-066-00-3 |
dicyclohexylamine |
101-83-7 |
Xn; R22, C; R34, N; R50-53 |
C ≥ 10 %: C; R34, 2 % ≤ C < 10 %: Xi; R36/38 |
|
|
612-067-00-9 |
3-aminomethyl-3,5,5-trimethylcyclohexylamine |
2855-13-2 |
Xn; R21/22, C; R34, R43, R52-53 |
|
|
|
612-068-00-4 |
3,3'-dichlorobenzidine; 3,3'-dichlorobiphenyl-4,4'-ylenediamine |
91-94-1 |
Carc. Cat. 2; R45, Xn; R21, R43, N; R50-53 |
|
E |
|
612-069-00-X |
salts of 3,3'-dichlorobenzidine; salts of 3,3'-dichlorobiphenyl-4,4'-ylenediamine |
- |
Carc. Cat. 2; R45, Xn; R21, R43, N; R50-53 |
|
A E |
|
612-070-00-5 |
salts of benzidine |
531-85-1, 531-86-2, 21136-70-9, 36341-27-2 |
Carc. Cat. 1; R45, Xn; R22, N; R50-53 |
|
A E |
|
612-071-00-0 |
salts of 2-naphthylamine |
553-00-4, 612-52-2 |
Carc. Cat. 1; R45, Xn; R22, N; R51-53 |
|
A E |
|
612-072-00-6 |
biphenyl-4-ylamine; xenylamine; 4-aminobiphenyl |
92-67-1 |
Carc. Cat. 1; R45, Xn; R22 |
|
E |
|
612-073-00-1 |
salts of biphenyl-4-ylamine; salts of xenylamine; salts of 4-aminobiphenyl |
- |
Carc. Cat. 1; R45, Xn; R22 |
|
A E |
|
612-074-00-7 |
benzyldimethylamine |
103-83-3 |
R10, Xn; R20/21/22, C; R34, R52-53 |
|
|
|
612-075-00-2 |
2-aminoethyldimethylamine; 2-dimethylaminoethylamine |
108-00-9 |
F; R11, Xn; R21/22, C; R35 |
|
|
|
612-076-00-8 |
ethyldimethylamine |
598-56-1 |
F; R11, Xn; R20/22, C; R34 |
|
|
|
612-077-00-3 |
dimethylnitrosoamine; N-nitrosodimethylamine |
62-75-9 |
Carc. Cat. 2; R45, T+; R26, T; R25-48/25, N; R51-53 |
C ≥ 0,001 %: Carc. Cat. 2; R45 |
E |
|
612-078-00-9 |
2,2'-dichloro-4,4'-methylenedianiline; 4,4'-methylene bis(2-chloroaniline) |
101-14-4 |
Carc. Cat. 2; R45, Xn; R22, N; R50-53 |
|
E |
|
612-079-00-4 |
salts of 2,2'-dichloro-4,4'-methylenedianiline; salts of 4,4'-methylenebis(2-chloroaniline) |
- |
Carc. Cat. 2; R45, Xn; R22, N; R50-53 |
|
A E |
|
612-080-00-X |
4-amino-N,N-diethylaniline; N,N-diethyl-p-phenylendiamine |
93-05-0 |
T; R25, C; R34 |
|
|
|
612-081-00-5 |
salts of 4,4'-bi-o-toluidine; salts of 3,3'-dimethylbenzidine; salts of o-tolidine |
612-82-8, 64969-36-4, 74753-18-7 |
Carc. Cat. 2; R45, Xn; R22, N; R51-53 |
|
A E |
|
612-082-00-0 |
thiourea; thiocarbamide |
62-56-6 |
Carc. Cat. 3; R40, Repr. Cat. 3; R63, Xn; R22, N; R51-53 |
|
|
|
612-083-00-6 |
1-methyl-3-nitro-1-nitrosoguanidine |
70-25-7 |
Carc. Cat. 2; R45, Xn; R20, Xi; R36/38, N; R51-53 |
C ≥ 0,01 %: Carc. Cat. 2; R45 |
E |
|
612-084-00-1 |
dapsone; 4,4'-diamino diphenyl sulfone |
80-08-0 |
Xn; R22 |
|
|
|
612-085-00-7 |
4,4'-methylenedi-o-toluidine |
838-88-0 |
Carc. Cat. 2; R45, Xn; R22, R43, N; R50-53 |
|
E |
|
612-086-00-2 |
amitraz (ISO); N,N-bis(2,4-xylyliminomethyl) methylamine |
33089-61-1 |
Xn; R22-48/22, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
612-087-00-8 |
guazatine (ISO) |
108173-90-6 |
T+; R26, Xn; R21/22, Xi; R37/38-41, N; R50-53 |
|
|
|
612-088-00-3 |
simazine (ISO); 6-chloro-N,N'-diethyl-1,3,5-triazine-2,4-diamine |
122-34-9 |
Carc. Cat. 3; R40, N; R50-53 |
|
|
|
612-089-00-9 |
1,5-naphthylenediamine |
2243-62-1 |
Carc. Cat. 3; R40, N; R50-53 |
|
|
|
612-090-00-4 |
2,2'-(nitrosoimino)bisethanol |
1116-54-7 |
Carc. Cat. 2; R45 |
|
|
|
612-091-00-X |
o-toluidine; 2-aminotoluene |
95-53-4 |
Carc. Cat. 2; R45, T; R23/25, Xi; R36, N; R50 |
|
E |
|
612-092-00-5 |
N,N'-(2,2-dimethylpropylidene)hexamethylenediamine |
1000-78-8 |
Xi; R38, R43 |
|
|
|
612-093-00-0 |
3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline |
104147-32-2 |
Xn; R22, N; R50-53 |
|
|
|
612-094-00-6 |
4-(2-chloro-4-trifluoromethyl)phenoxy-2-fluoroaniline hydrochloride |
113674-95-6 |
T; R48/25, Xn; R22-48/20, Xi; R41, R43, N; R50-53 |
|
|
|
612-095-00-1 |
benzyl-2-hydroxydodecyldimethylammonium benzoate |
113694-52-3 |
C; R34, Xn; R22, N; R50-53 |
|
|
|
612-096-00-7 |
4,4'-carbonimidoylbis[N,N-dimethylaniline] |
492-80-8 |
Carc. Cat. 3; R40, Xn; R22, Xi; R36, N; R51-53 |
|
|
|
612-097-00-2 |
salts of 4,4'-carbonimidoylbis[N,N-dimethylaniline] |
- |
Carc. Cat. 3; R40, Xn; R22, Xi; R36, N; R51-53 |
|
A |
|
612-098-00-8 |
nitrosodipropylamine |
621-64-7 |
Carc. Cat. 2; R45, Xn; R22, N; R51-53 |
C ≥ 0,001 %: Carc. Cat. 2; R45 |
E |
|
612-099-00-3 |
4-methyl-m-phenylenediamine; 2,4-toluenediamine |
95-80-7 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Repr. Cat. 3; R62, T; R25, Xn; R21-48/22, R43, N; R51-53 |
|
E |
|
612-100-00-7 |
propylenediamine |
78-90-0 |
R10, Xn; R21/22, C; R35 |
|
|
|
612-101-00-2 |
methenamine; hexamethylenetetramine |
100-97-0 |
F; R11, R43 |
|
|
|
612-102-00-8 |
N,N-bis(3-aminopropyl)methylamine |
105-83-9 |
T; R23/24, Xn; R22, C; R34 |
|
|
|
612-103-00-3 |
N,N,N',N'-tetramethylethylenediamine |
110-18-9 |
F; R11, Xn; R20/22, C; R34 |
|
|
|
612-104-00-9 |
hexamethylenediamine |
124-09-4 |
Xn; R21/22, Xi; R37, C; R34 |
|
|
|
612-105-00-4 |
2-piperazin-1-ylethylamine |
140-31-8 |
Xn; R21/22, C; R34, R43, R52-53 |
|
|
|
612-106-00-X |
2,6-diethylaniline |
579-66-8 |
Xn; R22 |
|
|
|
612-107-00-5 |
1-phenylethylamine; [1] Dl-α-methylbenzylamine [2] |
98-84-0 [1], 618-36-0 [2] |
Xn; R21/22, C; R34 |
|
|
|
612-108-00-0 |
3-aminopropyltriethoxysilane |
919-30-2 |
Xn; R22, C; R34 |
|
|
|
612-109-00-6 |
bis(2-dimethylaminoethyl)(methyl)amine |
3030-47-5 |
T; R24, Xn; R22, C; R34 |
|
|
|
612-110-00-1 |
2,2'-dimethyl-4,4'-methylenebis(cyclohexylamine) |
6864-37-5 |
T; R23/24, Xn; R22, C; R35, N; R51-53 |
|
|
|
612-111-00-7 |
2-methyl-m-phenylenediamine; 2,6-toluenediamine |
823-40-5 |
Muta. Cat. 3; R68, Xn; R21/22, R43, N; R51-53 |
|
|
|
612-112-00-2 |
p-anisidine; 4-methoxyaniline |
104-94-9 |
T+; R26/27/28, R33, N; R50 |
|
|
|
612-113-00-8 |
6-methyl-2,4-bis(methylthio)phenylene-1,3-diamine |
106264-79-3 |
Xn; R22, R43, N; R50-53 |
|
|
|
612-114-00-3 |
R,R-2-hydroxy-5-(1-hydroxy-2-(4-phenylbut-2-ylamino)ethyl)benzamide hydrogen 2,3-bis(benzoyloxy)succinate |
- |
F; R11, R43, R52-53 |
|
|
|
612-115-00-9 |
dimethyldioctadecylammonium hydrogen sulfate |
123312-54-9 |
Xi; R36, R53 |
|
|
|
612-116-00-4 |
C8-18alkylbis(2-hydroxyethyl)ammonium bis(2-ethylhexyl)phosphate |
68132-19-4 |
T; R23, C; R34, R43, N; R50-53 |
|
|
|
612-117-00-X |
C12-14-tert-alkylamine, methylphosphonic acid salt |
119415-07-5 |
Xn; R22, C; R34, N; R51-53 |
|
|
|
612-118-00-5 |
A reaction mass of: (1,3-dioxo-2H-benz(de)isoquinolin-2-ylpropyl)hexadecyldimethylammonium 4-toluenesulfonate; (1,3-dioxo-2H-benz(de)isoquinolin-2-ylpropyl)hexadecyldimethylammonium bromide |
- |
Xi; R41, N; R50-53 |
|
|
|
612-119-00-0 |
benzyldimethyloctadecylammonium 3-nitrobenzenesulfonate |
- |
Xi; R38-41, N; R50-53 |
|
|
|
612-120-00-6 |
aclonifen (ISO); 2-chloro-6-nitro-3-phenoxyaniline |
74070-46-5 |
N; R50-53 |
|
|
|
612-121-00-1 |
amines, polyethylenepoly-; HEPA |
68131-73-7 |
Xn; R21/22, C; R34, R43, N; R50-53 |
|
|
|
612-122-00-7 |
hydroxylamine ....% [> 55 % in aqueous solution] |
7803-49-8 |
E; R2, Carc. Cat. 3; R40, Xn; R21/22-48/22, Xi; R37/38-41, R43, N; R50 |
|
B |
|
612-122-01-4 |
hydroxylamine ...% [≤ 55% in aqueous solution] |
7803-49-8 |
R5, Carc. Cat. 3; R40, Xn; R21/22-48/22, Xi; R37/38-41, R43, N; R50 |
|
B |
|
612-123-00-2 |
hydroxylammonium chloride; hydroxylamine hydrochloride; [1] bis(hydroxylammonium) sulfate; hydroxylamine sulfate (2:1) [2] |
5470-11-1 [1], 10039-54-0 [2] |
E; R2, Carc. Cat. 3; R40, Xn; R21/22-48/22, Xi; R36/38, R43, N; R50 |
|
|
|
612-124-00-8 |
N,N,N-trimethylanilinium chloride |
138-24-9 |
T; R24/25 |
|
|
|
612-125-00-3 |
2-methyl-p-phenylenediamine; 2,5-toluenediamine |
95-70-5 |
T; R25, Xn; R20/21, R43, N; R51-53 |
|
|
|
612-126-00-9 |
toluene-2,4-diammonium sulphate; 4-methyl-m-phenylenediamine sulfate |
65321-67-7 |
Carc. Cat. 2; R45, T; R25, Xn; R21, Xi; R36, R43, N; R51-53 |
|
E |
|
612-127-00-4 |
3-aminophenol |
591-27-5 |
Xn; R20/22, N; R51-53 |
|
|
|
612-128-00-X |
4-aminophenol |
123-30-8 |
Muta. Cat. 3; R68, Xn; R20/22, N; R50-53 |
|
|
|
612-129-00-5 |
diisopropylamine |
108-18-9 |
F; R11, Xn; R20/22, C; R34 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
612-130-00-0 |
2,6-diamino-3,5-diethyltoluene; 4,6-diethyl-2-methyl-1,3-benzenediamine; [1] 2,4-diamino-3,5-diethyltoluene; 2,4-diethyl-6-methyl-1,3-benzenediamine; [2] diethylmethylbenzenediamine [3] |
2095-01-4 [1], 2095-02-5 [2], 68479-98-1 [3] |
Xn; R21/22-48/22, Xi; R36, N; R50-53 |
|
C |
|
612-131-00-6 |
didecyldimethylammonium chloride |
7173-51-5 |
Xn; R22, C; R34 |
|
|
|
612-132-00-1 |
N,N'-diphenyl-p-phenylenediamine; N,N'-diphenyl-1,4-benzenediamine |
74-31-7 |
R43, R52-53 |
|
|
|
612-133-00-7 |
(4-ammonio-m-tolyl)ethyl(2-hydroxyethyl)ammonium sulphate; 4-(N-ethyl-N-2-hydroxyethyl)-2-methylphenylenediamine sulphate |
25646-77-9 |
T; R25, Xn; R48/22, R43, N; R50-53 |
|
|
|
612-134-00-2 |
N-(2-(4-amino-N-ethyl-m-toluidino)ethyl)methanesulphonamide sesquisulphate; 4-(N-ethyl-N-2-methanesulphonylaminoethyl)-2-methylphenylenediamine sesquisulphate monohydrate |
25646-71-3 |
Xn; R22, R43, N; R50-53 |
|
|
|
612-135-00-8 |
N-2-naphthylaniline; N-phenyl-2-naphthylamine |
135-88-6 |
Carc. Cat. 3; R40, Xi; R36/38, R43, N; R51-53 |
|
|
|
612-136-00-3 |
N-isopropyl-N'-phenyl-p-phenylenediamine |
101-72-4 |
Xn; R22, R43, N; R50-53 |
C ≥ 0,1 %: R43 |
|
|
612-137-00-9 |
4-chloroaniline |
106-47-8 |
Carc. Cat. 2; R45, T; R23/24/25, R43, N; R50-53 |
|
E |
|
612-138-00-4 |
furalaxyl (ISO); methyl N-(2,6-dimethylphenyl)-N-(2-furylcarbonyl)-Dl-alaninate |
57646-30-7 |
Xn; R22, R52-53 |
|
|
|
612-139-00-X |
mefenacet (ISO); 2-(benzothiazol-2-yloxy)-N-methyl-N-phenylacetamide |
73250-68-7 |
N; R51-53 |
|
|
|
612-140-00-5 |
quaternary ammonium compounds, benzyl-C8-18-alkyldimethyl, chlorides |
63449-41-2 |
Xn; R21/22, C; R34, N; R50 |
|
|
|
612-141-00-0 |
4,4'-methylenebis(2-ethylaniline); 4,4'-methylenebis(2-ethylbenzeneamine) |
19900-65-3 |
Carc. Cat. 3; R40, Xn; R22, N; R50-53 |
|
|
|
612-142-00-6 |
biphenyl-2-ylamine |
90-41-5 |
Carc. Cat. 3; R40, Xn; R22, R52-53 |
|
|
|
612-143-00-1 |
N5,N5-diethyltoluene-2,5-diamine monohydrochloride; 4-diethylamino-2-methylaniline monohydrochloride |
2051-79-8 |
T; R25, Xi; R36, R43, N; R50-53 |
|
|
|
612-144-00-7 |
flumetralin (ISO); N-(2-chloro-6-fluorobenzyl)-N-ethyl-α,α,α-trifluoro-2,6-dinitro-p-toluidine |
62924-70-3 |
Xi; R36/38, R43, N; R50-53 |
|
|
|
612-145-00-2 |
o-phenylenediamine |
95-54-5 |
Carc. Cat. 3; R40, Muta. Cat. 3; R68, T; R25, Xn; R20/21, Xi; R36, R43, N; R50-53 |
|
|
|
612-146-00-8 |
o-phenylenediamine dihydrochloride |
615-28-1 |
Carc. Cat. 3; R40, Muta. Cat. 3; R68, T; R25, Xn; R20/21, Xi; R36, R43, N; R50-53 |
|
|
|
612-147-00-3 |
m-phenylenediamine |
108-45-2 |
Muta. Cat. 3; R68, T; R23/24/25, Xi; R36, R43, N; R50-53 |
|
|
|
612-148-00-9 |
m-phenylenediamine dihydrochloride |
541-69-5 |
Muta. Cat. 3; R68, T; R23/24/25, Xi; R36, R43, N; R50-53 |
|
|
|
612-149-00-4 |
1,3-diphenylguanidine |
102-06-7 |
Repr. Cat. 3; R62, Xn; R22, Xi; R36/37/38, N; R51-53 |
|
|
|
612-150-00-X |
spiroxamine (ISO); 8-tert-butyl-1,4-dioxaspiro[4.5]decan-2-ylmethyl(ethyl)(propyl)amine |
118134-30-8 |
Xn; R20/21/22, Xi; R38, R43, N; R50-53 |
|
|
|
612-151-00-5 |
methyl-phenylene diamine; diaminotoluene; [technical product – reaction mass of 4-methyl-m-phenylene diamine (EC No 202-453-1) and 2-methyl-m-phenylene diamine (EC No 212-513-9)] |
- |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Repr. Cat. 3; R62, T; R25, Xn; R21-48/22, Xi; R36, R43, N; R51-53 |
|
E |
|
612-152-00-0 |
N,N-diethyl-N',N'-dimethylpropan-1,3-diyl-diamine |
62478-82-4 |
R10, Xn; R20/22-48/20, C; R35, R52-53 |
|
|
|
612-153-00-6 |
4-[N-ethyl-N-(2-hydroxyethyl)amino]-1-(2-hydroxyethyl)amino-2-nitrobenzene, monohydrochloride |
132885-85-9 |
Xn; R22, R43, R52-53 |
|
|
|
612-154-00-1 |
6'-(isobutylethylamino)-3'-methyl-2'-phenylamino-spiro[isobenzo-2-oxofuran-7,9'-[9H]-xanthene] |
95235-29-3 |
R53 |
|
|
|
612-155-00-7 |
2'-anilino-6'-((3-ethoxypropyl)ethylamino)-3'-methylspiro(isobenzo-3-oxofuran)-1-(1H)-9'-xanthene |
93071-94-4 |
R53 |
|
|
|
612-156-00-2 |
reaction mass of: trihexadecylmethylammonium chloride; dihexadecyldimethylammonium chloride |
- |
Xi; R41, N; R50-53 |
|
|
|
612-157-00-8 |
(Z)-1-benzo[b]thien-2-ylethanone oxime hydrochloride |
- |
Xn; R22-48/22, Xi; R41, R43, N; R51-53 |
|
|
|
612-158-00-3 |
reaction mass of: bis(5-dodecyl-2-hydroxybenzald-oximate) copper (II) C12-alkyl group is branched; 4-dodecylsalicylaldoxime |
- |
R53 |
|
|
|
612-159-00-9 |
Reaction products of: trimethylhexamethylene diamine (a mixture of 2,2,4-trimethyl-1,6-hexanediamine and 2,4,4-trimethyl-1,6-hexanediamine, EINECS listed), Epoxide 8 (mono[(C10-C16-alkyloxy)methyl]oxirane derivatives) and p-toluene-sulfonic acid |
- |
Xn; R22, C; R34, N; R50-53 |
|
|
|
612-160-00-4 |
p-toluidine; 4-aminotoluene; [1] toluidinium chloride; [2] toluidine sulphate (1:1) [3] |
106-49-0 [1], 540-23-8 [2], 540-25-0 [3] |
Carc. Cat. 3; R40, T; R23/24/25, Xi; R36, R43, N; R50 |
|
|
|
612-161-00-X |
2,6-xylidine; 2,6-dimethylaniline |
87-62-7 |
Carc. Cat. 3; R40, Xn; R20/21/22, Xi; R37/38, N; R51-53 |
|
|
|
612-162-00-5 |
dimethyldioctadecylammonium chloride; DODMAC |
107-64-2 |
Xi; R41, N; R50-53 |
|
|
|
612-163-00-0 |
metalaxyl-M (ISO); mefenoxam; (R)-2-[(2,6-dimethylphenyl)-methoxyacetylamino]propionic acid methyl ester |
70630-17-0 |
Xn; R22, Xi; R41 |
|
|
|
612-164-00-6 |
2-butyl-2-ethyl-1,5-diaminopentane |
137605-95-9 |
Xn; R21/22-48/22, C; R34, R43, R52-53 |
|
|
|
612-165-00-1 |
N,N'-diphenyl-N,N'-bis(3-methylphenyl)-(1,1'-diphenyl)-4,4'-diamine |
65181-78-4 |
N; R51-53 |
|
|
|
612-166-00-7 |
reaction mass of: cis-(5-ammonium-1,3,3-trimethyl)-cyclohexanemethylammonium phosphate (1:1); trans-(5-ammonium-1,3,3-trimethyl)-cyclohexanemethylammonium phosphate (1:1) |
114765-88-7 |
Xi; R41, R43, R52-53 |
|
|
|
612-167-00-2 |
5-acetyl-3-amino-10,11-dihydro-5H-dibenz[b,f]azepine-hydrochloride |
- |
Xn; R22-48/22, Xi; R41, R43, N; R51-53 |
|
|
|
612-168-00-8 |
3,5-dichloro-2,6-difluoropyrdine-4-amine |
2840-00-8 |
Xn; R21/22, N; R51-53 |
|
|
|
612-169-00-3 |
bis(N-methyl-N-phenylhydrazine)sulfate |
618-26-8 |
F; R11, T; R48/25, Xn; R22, Xi; R41, R43, N; R50-53 |
|
|
|
612-170-00-9 |
4-chlorophenyl cyclopropyl ketone O-(4-aminobenzyl)oxime |
- |
Xn; R22, R43, N; R50-53 |
|
|
|
612-171-00-4 |
N,N,N',N'-tetraglycidyl-4,4'-diamino-3,3'-diethyldiphenylmethane |
130728-76-6 |
Muta. Cat. 3; R68, R43, N; R51-53 |
|
|
|
612-172-00-X |
4,4'-methylenebis(N,N'-dimethylcyclohexanamine |
13474-64-1 |
Xn; R22-48/22, C; R35, R52-53 |
|
|
|
612-173-00-5 |
lithium 1-amino-4-(4-tert-butylanilino)anthraquinone-2-sulfonate |
125328-86-1 |
Xi; R41, R43, N; R51-53 |
|
|
|
612-174-00-0 |
4,4-dimethoxybutylamine |
19060-15-2 |
Xn; R22, C; R34, R43, R52-53 |
|
|
|
612-175-00-6 |
2-(O-aminooxy)ethylamine dihydrochloride |
37866-45-8 |
R43, R52-53 |
|
|
|
612-176-00-1 |
Polymer of 1,3-dibromopropane and N,N-diethyl-N',N'-dimethyl-1,3-propanediamine |
143747-73-3 |
N; R50-53 |
|
|
|
612-177-00-7 |
2-naphthylamino-6-sulfomethylamide |
104295-55-8 |
Xn; R48/22, R43, N; R51-53 |
|
|
|
612-178-00-2 |
1,4,7,10-tetraazacyclododecane disulfate |
112193-77-8 |
Xn; R22, Xi; R37-41, R52-53 |
|
|
|
612-179-00-8 |
1-(2-propenyl)pyridinium chloride |
25965-81-5 |
Xn; R22, R43 |
|
|
|
612-180-00-3 |
3-aminobenzylamine |
4403-70-7 |
Xn; R22, C; R34, N; R51-53 |
|
|
|
612-181-00-9 |
2-phenylthioaniline |
1134-94-7 |
R43, N; R51-53 |
|
|
|
612-182-00-4 |
1-ethyl-1-methylmorpholinium bromide |
65756-41-4 |
Muta. Cat. 3; R68 |
|
|
|
612-183-00-X |
1-ethyl-1-methylpyrrolidinium bromide |
69227-51-6 |
Muta. Cat. 3; R68 |
|
|
|
612-184-00-5 |
6'-(dibutylamino)-3'-methyl-2'-(phenylamino)spiro[isobenzofuran-1(3H),9-(9H)-xanthen]-3-one |
89331-94-2 |
R52-53 |
|
|
|
612-185-00-0 |
1-[3-[4-((heptadecafluorononyl)oxy)-benzamido]propyl]-N,N,N-trimethylammonium iodide |
59493-72-0 |
Xi; R41, N; R50-53 |
|
|
|
612-186-00-6 |
bis(N-(7-hydroxy-8-methyl-5-phenylphenazin-3-ylidene)dimethylammonium) sulfate |
149057-64-7 |
Xn; R48/22, Xi; R41, R43, N; R50-53 |
|
|
|
612-187-00-1 |
2,3,4-trifluoroaniline |
3862-73-5 |
Xn; R21/22-48/22, Xi; R38-41, N; R51-53 |
|
|
|
612-188-00-7 |
4,4'-(9H-fluoren-9-ylidene)bis(2-chloroaniline) |
107934-68-9 |
N; R51-53 |
|
|
|
612-189-00-2 |
4-amino-2-(aminomethyl)phenol dihydrochloride |
135043-64-0 |
Xn; R22, R43, N; R50-53 |
|
|
|
612-190-00-8 |
4,4'-methylenebis(2-isopropyl-6-methylaniline) |
16298-38-7 |
Xn; R48/22, N; R51-53 |
|
|
|
612-191-00-3 |
Polymer of allylamine hydrochloride |
71550-12-4 |
Xn; R22, R43 |
|
|
|
612-192-00-9 |
2-isopropyl-4-(N-methyl)aminomethylthiazole |
154212-60-9 |
Xn; R21/22, Xi; R38-41, N; R51-53 |
|
|
|
612-193-00-4 |
3-methylaminomethylphenylamine |
18759-96-1 |
Xn; R21/22, C; R34, R43, N; R50-53 |
|
|
|
612-194-00-X |
2-hydroxy-3-[(2-hydroxyethyl)-[2-(1-oxotetradecyl)amino]ethyl]amino]-N,N,N-trimethyl-1-propanammonium chloride |
141890-30-4 |
Xn; R22, Xi; R41, N; R50-53 |
|
|
|
612-195-00-5 |
bis[tributyl 4-(methylbenzyl)ammonium] 1,5-naphthalenedisulfonate |
160236-81-7 |
Xn; R20/22, Xi; R41, N; R50-53 |
|
|
|
612-196-00-0 |
4-chloro-o-toluidine; [1] 4-chloro-o-toluidine hydrochloride [2] |
95-69-2 [1], 3165-93-3 [2] |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, T; R23/24/25, N; R50-53 |
|
E |
|
612-197-00-6 |
2,4,5-trimethylaniline; [1] 2,4,5-trimethylaniline hydrochloride [2] |
137-17-7 [1], 21436-97-5 [2] |
Carc. Cat. 2; R45, T; R23/24/25, N; R51-53 |
|
E |
|
612-198-00-1 |
4,4'-thiodianiline and its salts |
139-65-1 |
Carc. Cat. 2; R45, Xn; R22, N; R51-53 |
|
E |
|
612-199-00-7 |
4,4'-oxydianiline and its salts; p-aminophenyl ether |
101-80-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Repr. Cat. 3; R62, T; R23/24/25, N; R51-53 |
|
E |
|
612-200-00-0 |
2,4-diaminoanisole; 4-methoxy-m-phenylenediamine; [1] 2,4-diaminoanisole sulphate [2] |
615-05-4 [1], 39156-41-7 [2] |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Xn; R22, N; R51-53 |
|
E |
|
612-201-00-6 |
N,N,N',N'-tetramethyl-4,4'-methylendianiline |
101-61-1 |
Carc. Cat. 2; R45, N; R50-53 |
|
|
|
612-202-00-1 |
3,4-dichloroaniline |
95-76-1 |
T; R23/24/25, Xi; R41, R43, N; R50-53 |
|
|
|
612-203-00-7 |
C8-10 alkyl dimethyl hydroxyethyl ammoniumchloride (chain < C8: <3%, chain = C8: 15%-70%, chain = C10: 30%-85%, chain > C10: <3%) |
- |
Xn; R21/22, Xi; R38 |
|
|
|
612-204-00-2 |
C.I. Basic Violet 3; 4-[4,4'-bis(dimethylamino) benzhydrylidene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride |
548-62-9 |
Carc. Cat. 3; R40, Xn; R22, Xi; R41, N; R50-53 |
|
|
|
612-205-00-8 |
C.I. Basic Violet 3 with ≥ 0.1 % of Michler's ketone (EC no. 202-027-5) |
548-62-9 |
Carc. Cat. 2; R45, Xn; R22, Xi; R41, N; R50-53 |
|
E |
|
612-206-00-3 |
famoxadone (ISO); 3-anilino-5-methyl-5-(4-phenoxyphenyl)-1,3-oxazolidine-2,4-dione |
131807-57-3 |
Xn; R48/22, N; R50-53 |
|
|
|
612-207-00-9 |
4-ethoxyaniline; p-phenetidine |
156-43-4 |
Muta. Cat. 3; R68, Xn; R20/21/22, Xi; R36, R43 |
|
|
|
612-208-00-4 |
N-methylbenzene-1,2-diammonium hydrogen phosphate |
- |
Xn; R22, R43, N; R51-53 |
|
|
|
612-209-00-X |
6-methoxy-m-toluidine; p-cresidine |
120-71-8 |
Carc. Cat. 2; R45, Xn; R22 |
|
E |
|
612-210-00-5 |
5-nitro-o-toluidine; [1] 5-nitro-o-toluidine hydrochloride [2] |
99-55-8 [1], 51085-52-0 [2] |
Carc. Cat. 3; R40, T; R23/24/25, R52-53 |
|
|
|
612-211-00-0 |
N-[(benzotriazole-1-yl)methyl)]-4-carboxybenzenesulfonamide |
170292-97-4 |
Xi; R36, N; R51-53 |
|
|
|
612-212-00-6 |
2,6-dichloro-4-trifluoromethylaniline |
24279-39-8 |
Xn; R20/22, Xi; R38, R43, N; R50-53 |
|
|
|
612-213-00-1 |
isobutylidene-(2-(2-isopropyl-4,4-dimethyloxazolidine-3-yl)-1,1-dimethylethyl)amine |
148348-13-4 |
C; R34, R52-53 |
|
|
|
612-214-00-7 |
4-(2,2-diphenylethenyl)-N,N-di-phenylbenzenamine |
89114-90-9 |
R53 |
|
|
|
612-215-00-2 |
3-chloro-2-(isopropylthio)aniline |
179104-32-6 |
Xi; R38, N; R51-53 |
|
|
|
612-216-00-8 |
1-amino-1-cyanamino-2,2-dicyanoethylene, sodium salt |
19450-38-5 |
R43, R52-53 |
|
|
|
612-217-00-3 |
1-methoxy-2-propylamine |
37143-54-7 |
F; R11, C; R34, Xn; R22, R52-53 |
|
|
|
612-219-00-4 |
(2-hydroxy-3-(3,4-dimethyl-9-oxo-10-thiaanthracen-2-yloxy)propyl)trimethylammonium chloride |
- |
R52-53 |
|
|
|
612-220-00-X |
N-nitro-N-(3-methyl-3,6-dihydro-2H-1,3,5-oxadiazin-4-yl)amine |
153719-38-1 |
Xn; R22, R43, R52-53 |
|
|
|
612-221-00-5 |
2-amino-4-(trifluoromethyl)benzenethiol hydrochloride |
4274-38-8 |
C; R34, Xn; R20/21/22-48/22, R43, N; R50 |
|
|
|
612-222-00-0 |
cis-1-(3-(4-fluorophenoxy)propyl)-3-methoxy-4-piperidinamine |
104860-26-6 |
Xn; R21/22-48/22, Xi; R41, N; R50-53 |
|
|
|
612-223-00-6 |
N-benzyl-N-ethyl-(4-(5-nitro-benzo[c]isothiazol-3-ylazo)phenyl)amine |
186450-73-7 |
R43, R53 |
|
|
|
612-224-00-1 |
N2,N4,N6-tris{4-[(1,4-dimethylpentyl)amino]phenyl}-1,3,5-triazine-2,4,6-triamine |
121246-28-4 |
R43, N; R50-53 |
|
|
|
612-225-00-7 |
1,4,7,10-tetraazacyclododecane |
294-90-6 |
C; R34, Xn; R21/22, N; R50-53 |
|
|
|
612-226-00-2 |
3-(2'-phenoxyethoxy)propylamine |
6903-18-0 |
Xn; R22, Xi; R38-41, R52-53 |
|
|
|
612-227-00-8 |
benzyl-N-(2-(2-methoxyphenoxy)ethyl)amine hydrochloride |
120606-08-8 |
Xn; R22, Xi; R41, N; R50-53 |
|
|
|
612-228-00-3 |
reaction mass of: N-(3-(trimethoxysilyl)propyl)ethylenediamine; N-benzyl-N-(3-(trimethoxysilyl)propyl)ethylenediamine; N-benzyl-N'-[3-(trimethoxysilyl)propyl]ethylenediamine; N,N'-bis-benzyl-N'-[3-(trimethoxysilyl)propyl]ethylenediamine; N,N,N'-tris-b |
- |
R10, Xn; R20/21/22-68/20/21/22, Xi; R41, R43, R52-53 |
|
|
|
612-229-00-9 |
mepanipyrim; 4-methyl-N-phenyl-6-(1-propynyl)-2-pyrimidinamine |
110235-47-7 |
Carc. Cat. 3; R40, N; R50-53 |
|
|
|
612-230-00-4 |
N,N-bis(cocoyl-2-oxypropyl)-N,N-dibutylammonium bromide |
- |
C; R35, R43, N; R50-53 |
|
|
|
612-231-00-X |
3-((C12-18)-acylamino)-N-(2-((2-hydroxyethyl)amino)-2-oxoethyl)-N,N-dimethyl-1-propanaminium chloride |
164288-56-6 |
Xi; R41, N; R50-53 |
|
|
|
612-232-00-5 |
reaction mass of: triisopropanolamine salt of 1-amino-4-(3-propionamidoanilino)anthraquinone-2-sulfonic acid; triisopropanolamine salt of 1-amino-4-[3,4-dimethyl-5-(2-hydroxyethylaminosulfonyl)anilino]anthraquinone-2-sulfonic acid |
186148-38-9 |
R52-53 |
|
|
|
612-237-00-2 |
hydroxylammonium hydrogensulfate; hydroxylamine sulfate(1:1); [1] hydroxylamine phosphate; [2] hydroxylamine dihydrogenphosphate; [3] hydroxylamine 4-methylbenzenesulfonate [4] |
10046-00-1 [1], 20845-01-6 [2], 19098-16-9 [3], 53933-48-5 [4] |
E; R2, Carc. Cat. 3; R40, Xn; R21/22-48/22, Xi; R36/38, R43, N; R50 |
|
T |
|
612-238-00-8 |
(3-chloro-2-hydroxypropyl) trimethylammonium chloride ...% |
3327-22-8 |
Carc. Cat. 3, R40, R52-53 |
|
B |
|
612-239-00-3 |
biphenyl-3,3',4,4'-tetrayltetraamine; diaminobenzidine |
91-95-2 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68 |
|
|
|
612-240-00-9 |
pyrimethanil (ISO); N-(4,6-dimethylpyrimidin-2-yl)aniline |
53112-28-0 |
N; R51-53 |
|
|
|
612-241-00-4 |
piperazine hydrochloride; [1] piperazine dihydrochloride; [2] piperazine phosphate [3] |
6094-40-2 [1], 142-64-3 [2], 1951-97-9 [3] |
Repr. Cat. 3; R62-63, Xi; R36/38, R42/43, R52-53 |
|
|
|
612-242-00-X |
cyprodinil (ISO); 4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine |
121552-61-2 |
R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
612-243-00-5 |
(1S-cis)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenamine 2-hydroxy-2-phenylacetate |
79617-97-3 |
Xi; R41, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
612-244-00-0 |
3-(piperazin-1-yl)-benzo[d]isothiazole hydrochloride |
87691-88-1 |
Repr. Cat. 3; R62, Xn; R22, Xi; R36, R43, N; R50-53 |
|
|
|
612-245-00-6 |
2-ethylphenylhydrazine hydrochloride |
19398-06-2 |
Carc. Cat. 3; R40, T; R48/25, Xn; R22, Xi; R41, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
612-246-00-1 |
(2-chloroethyl)(3-hydroxypropyl)ammonium chloride |
40722-80-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R48/22, R43, R52-53 |
|
E |
|
612-247-00-7 |
N-[3-(1,1-dimethylethyl)-1H-pyrazol-5-yl]-N'-hydroxy-4-nitrobenzenecarboximidamide |
152828-23-4 |
T; R48/25, Xn; R22, R52-53 |
|
|
|
612-248-00-2 |
reaction product of diphenylamine, phenothiazine, and alkenes, branched (C8-10, C9-rich) |
- |
Xi; R38, R43, R53 |
|
|
|
612-249-00-8 |
4-[(3-chlorophenyl)(1H-imidazol-1-yl)methyl]-1,2-benzenediamine dihydrochloride |
159939-85-2 |
Repr. Cat. 3; R62, Xn; R22, C; R34, R43, N; R51-53 |
|
|
|
612-250-00-3 |
chloro-N,N-dimethylformiminium chloride |
3724-43-4 |
R14, Repr. Cat. 2; R61, Xn; R22, C; R35 |
|
E |
|
612-251-00-9 |
cis-1-(3-chloroallyl)-3,5,7-triaza-1-azoniaadamantane chloride |
51229-78-8 |
F; R11, Repr. Cat. 3; R63, Xn; R22, Xi; R38, R43, N; R51-53 |
|
|
|
612-252-00-4 |
imidacloprid (ISO); 1-(6-chloropyridin-3-ylmethyl)-N-nitroimidazolidin-2-ylidenamine |
138261-41-3 |
Xn; R22, N; R50-53 |
|
|
|
612-253-00-X |
7-methoxy-6-(3-morpholin-4-yl-propoxy)-3H-quinazolin-4-one; [containing < 0.5 % formamide (EC No 200-842-0)] |
199327-61-2 |
R52-53 |
|
|
|
612-253-01-7 |
7-methoxy-6-(3-morpholin-4-yl-propoxy)-3H-quinazolin-4-one; [containing ≥ 0.5 % formamide (EC No 200-842-0) ] |
199327-61-2 |
Repr. Cat. 2; R61, R52-53 |
|
|
|
612-254-00-5 |
reaction products of diisopropanolamine with formaldehyde (1:4) |
220444-73-5 |
Carc. Cat. 3; R40, Xn; R22, C; R34, R43, N; R51-53 |
|
|
|
612-255-00-0 |
1-(3-methoxypropyl)-4-piperidinamine |
179474-79-4 |
Xn; R21/22, C; R34, R52-53 |
|
|
|
612-256-00-6 |
benzyl(S)-2-[(2'-cyanobiphenyl-4-ylmethyl)pentanoylamino]-3-methylbutyrate |
137864-22-3 |
Xn; R22, R43 |
|
|
|
612-257-00-1 |
tripropylammonium dihydrogenphosphate |
35687-90-2 |
Xn; R22 |
|
|
|
612-259-00-2 |
N-ethyl-3-trimethoxysilyl-2-methyl-propanamine |
227085-51-0 |
Xi; R41 |
|
|
|
612-261-00-3 |
3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)aniline |
121451-05-6 |
Xn; R22, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
612-265-00-5 |
bis(2-hydroxyethyl)-(2-hydroxypropyl)ammonium acetate |
191617-13-7 |
R52-53 |
|
|
|
612-266-00-0 |
3-chloro-4-(3-fluorobenzyloxy)aniline |
202197-26-0 |
Muta. Cat. 3; R68, Xn; R22-48/22, N; R50-53 |
|
|
|
612-267-00-6 |
bis(hydrogenated tallow C16-18-alkyl)hydroxylamine |
- |
R43, R53 |
|
|
|
612-269-00-7 |
reaction mass of: 1-[di(4-octylphenyl)aminomethyl]-5-methyl-1H-benzotriazole; 1-[di(4-octylphenyl)aminomethyl]-4-methyl-1H-benzotriazole; reaction mass of: N-[(5-methyl-1H-benzotriazol-1-yl)methyl]-4-octyl-N-(4-octylphenyl)aniline; N-[(4-methyl-1H-benz |
- |
R53 |
|
|
|
612-270-00-2 |
(S)-azetidine-2-carboxylic acid 4-cyanobenzylamide hydrochloride |
- |
Xn; R22, R43, R52-53 |
|
|
|
612-271-00-8 |
reaction mass of: ethyl 2-((4-(5,6-dichlorobenzothiazol-2-ylazo)phenyl)ethylamino)benzoate; ethyl 2-((4-(6,7-dichlorobenzothiazol-2-ylazo)phenyl)ethylamino)benzoate |
160987-57-5 |
R53 |
|
|
|
612-272-00-3 |
ammonium (η-6-2-(2-(1,2-dicarboxylatoethylamino)ethylamino)butane-1,4-dioato(4-))iron(3+) monohydrate |
- |
N; R51-53 |
|
|
|
612-273-00-9 |
alkyl(rapeseed oil), bis(2-hydroxyethyl)ammonium fluoride |
- |
Xn; R22, C; R35, N; R50-53 |
|
|
|
612-274-00-4 |
(R,S)-1-[2-amino-1(4-methoxyphenyl)ethyl]cyclohexanol acetate |
- |
Xn; R22, Xi; R41, R43, R52-53 |
|
|
|
612-275-00-X |
fatty acids, C18-unsatd., dimers, reaction products with 1-piperazineethanamine and tall oil |
206565-89-1 |
Xi; R38-41, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
612-276-00-5 |
1-amino-4-[(4-amino-2-sulfofenyl)amino]-9,10-dihydro-9,10-dioxo-2-anthracenesulfonic acid, disodium salt, reaction products with 2-[[3-[(4,6-dichloro-1,3,5-triazin-2-yl)ethylamino]phenyl]sulfonyl]ethyl hydrogen sulfate, sodium salts |
500717-36-2 |
Xi; R41, R43, R52-53 |
|
|
|
612-277-00-0 |
reaction mass of: 4-amino-3-(4-ethenesulfonyl-2-sulfonatophenylazo)-5-hydroxy-6-(5-{4-chloro-6-[4-(2-sulfonatooxyethanesulfonyl)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)naphthalene-2,7-disulfonate potassium/sodium; 4-amino-5-hydroxy-6-( |
586372-44-3 |
Xi; R41 |
|
|
|
612-278-00-6 |
ethidium bromide; 3,8-diamino-1-ethyl-6-phenylphenantridinium bromide |
1239-45-8 |
Muta. Cat. 3; R68, T+; R26, Xn; R22 |
|
|
|
612-279-00-1 |
(R,S)-2-amino-3,3-dimethylbutane amide |
144177-62-8 |
Repr. Cat. 3; R62, Xn; R48/22, Xi; R36/38, R43 |
|
|
|
612-280-00-7 |
3-amino-9-ethyl carbazole; 9-ethylcarbazol-3-ylamine |
132-32-1 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
613-001-00-1 |
ethyleneimine; aziridine |
151-56-4 |
F; R11, Carc. Cat. 2; R45, Muta. Cat. 2; R46, T+; R26/27/28, C; R34, N; R51-53 |
|
D E |
|
613-002-00-7 |
pyridine |
110-86-1 |
F; R11, Xn; R20/21/22 |
C ≥ 5 %: Xn; R20/21/22 |
|
|
613-003-00-2 |
1,2,3,4-tetranitrocarbazole |
6202-15-9 |
E; R2, Xn; R20/21/22 |
|
|
|
613-004-00-8 |
crimidine (ISO); 2-chloro-6-methylpyrimidin-4-yldimethylamine |
535-89-7 |
T+; R28 |
|
|
|
613-007-00-4 |
desmetryne (ISO); 6-isopropylamino-2-methylamino-4-methylthio-1,3,5-triazine |
1014-69-3 |
Xn; R21/22, N; R50-53 |
|
|
|
613-008-00-X |
dazomet (ISO); tetrahydro-3,5-dimethyl-1,3,5-thiadiazine-2-thione |
533-74-4 |
Xn; R22, Xi; R36, N; R50-53 |
|
|
|
613-009-00-5 |
2,4,6-trichloro-1,3,5-triazine; cyanuric chloride |
108-77-0 |
R14, T+; R26, Xn; R22, C; R34, R43 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
613-010-00-0 |
ametryn (ISO); 2-ethylamino-4-isopropylamino-6-methylthio-1,3,5-triazine |
834-12-8 |
Xn; R22, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
613-011-00-6 |
amitrole (ISO); 1,2,4-triazol-3-ylamine |
61-82-5 |
Repr. Cat. 3; R63, Xn; R48/22, N; R51-53 |
|
|
|
613-012-00-1 |
bentazone (ISO); 3-isopropyl-2,1,3-benzothiadiazine-4-one-2,2-dioxide |
25057-89-0 |
Xn; R22, Xi; R36, R43, R52-53 |
|
|
|
613-013-00-7 |
cyanazine (ISO); 2-(4-chloro-6-ethylamino-1,3,5-triazine-2-ylamino)-2-methylpropionitrile |
21725-46-2 |
Xn; R22, N; R50-53 |
|
|
|
613-014-00-2 |
ethoxyquin (ISO); 6-ethoxy-1,2-dihydro-2,2,4-trimethylquinoline |
91-53-2 |
Xn; R22 |
|
|
|
613-015-00-8 |
fenazaflor (ISO); phenyl 5,6-dichloro-2-trifluoromethylbenzimidazole-1-carboxylate |
14255-88-0 |
Xn; R21/22, N; R50-53 |
|
|
|
613-016-00-3 |
fuberidazole (ISO); 2-(2-furyl)benzimidazole |
3878-19-1 |
Xn; R22, N; R50-53 |
|
|
|
613-017-00-9 |
bis (8-hydroxyquinolinium) sulphate |
134-31-6 |
Xn; R22 |
|
|
|
613-018-00-4 |
morfamquat (ISO); 1,1'-bis(3,5-dimethylmorpholinocarbonylmethyl)-4,4'-bipyridilium ion |
7411-47-4 |
Xn; R22, Xi; R36/37/38, R52-53 |
|
|
|
613-019-00-X |
thioquinox (ISO); 2-thio-1,3-dithiolo(4,5,b)quinoxaline |
93-75-4 |
Xn; R22 |
|
|
|
613-020-00-5 |
tridemorph (ISO); 2,6-dimethyl-4-tridecylmorpholine |
24602-86-6 |
Repr. Cat. 2; R61, Xn; R20/22, Xi; R38, N; R50-53 |
|
E |
|
613-021-00-0 |
dithianon (ISO); 5,10-dihydro-5,10-dioxonaphtho(2,3-b)(1,4)dithiazine-2,3-dicarbonitrile |
3347-22-6 |
Xn; R22, N; R50-53 |
|
|
|
613-022-00-6 |
pyrethrins including cinerins, with the exception of those specified elsewhere in this Annex |
- |
Xn; R20/21/22, N; R50-53 |
|
A |
|
613-023-00-1 |
2-methyl-4-oxo-3-(penta-2,4-dienyl)cyclopent-2-enyl [1R-[1α[S*(Z)],3β]]-chrysanthemate; pyrethrin I |
121-21-1 |
Xn; R20/21/22, N; R50-53 |
|
|
|
613-024-00-7 |
2-methyl-4-oxo-3-(penta-2,4-dienyl)cyclopent-2-enyl[1R-[1α[S*(Z)](3β)]]-3-(3-methoxy-2-methyl-3-oxoprop-1-enyl)-2,2-dimethylcyclopropanecarboxylate; pyrethrin II |
121-29-9 |
Xn; R20/21/22, N; R50-53 |
|
|
|
613-025-00-2 |
cinerin I; 3-(but-2-enyl)-2-methyl-4-oxocyclopent-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
25402-06-6 |
Xn; R22, N; R50-53 |
|
|
|
613-026-00-8 |
cinerin II; 3-(but-2-enyl)-2-methyl-4-oxocyclopent-2-enyl 2,2-dimethyl-3-(3-methoxy-2-methyl-3-oxoprop-1-enyl)cyclopropanecarboxylate |
121-20-0 |
Xn; R22, N; R50-53 |
|
|
|
613-027-00-3 |
piperidine |
110-89-4 |
F; R11, T; R23/24, C; R34 |
C ≥ 5 %: T; R23/24, 1 % ≤ C < 5 %: Xn; R20/21, C ≥ 5 %: C; R34, 1 % ≤ C < 5 %: Xi; R36/38 |
|
|
613-028-00-9 |
morpholine |
110-91-8 |
R10, Xn; R20/21/22, C; R34 |
C ≥ 10 %: C; R34, 1 % ≤ C < 10 %: Xi; R36/38 |
|
|
613-029-00-4 |
dichloro-1,3,5-triazinetrione; dichloroisocyanuric acid |
2782-57-2 |
O; R8, Xn; R22, R31, Xi; R36/37, N; R50-53 |
|
|
|
613-030-00-X |
troclosene potassium; [1] troclosene sodium [2] |
2244-21-5 [1], 2893-78-9 [2] |
E; R2, O; R8, Xn; R22, Xi; R36/37, R31, N; R50-53 |
C ≥ 10 %: Xn; R22, C ≥ 10 %: Xi; R36/37, C ≥ 10 %: R31 |
T |
|
613-030-01-7 |
troclosene sodium, dihydrate |
51580-86-0 |
Xn; R22, R31, Xi; R36/37, N; R50-53 |
|
|
|
613-031-00-5 |
symclosene; trichloroisocyanuric acid; trichloro-1,3,5-triazinetrion |
87-90-1 |
O; R8, Xn; R22, Xi; R36/37, R31, N; R50-53 |
|
|
|
613-032-00-0 |
methyl-2,3,5,6-tetrachloro-4-pyridylsulphone; 2,3,5,6-tetrachloro-4-(methylsulphonyl)pyridine |
13108-52-6 |
Xn; R21/22, Xi; R36, R43 |
|
|
|
613-033-00-6 |
2-methylaziridine; propyleneimine |
75-55-8 |
F; R11, Carc. Cat. 2; R45, T+; R26/27/28, Xi; R41, N; R51-53 |
C ≥ 0,01 %: Carc. Cat. 2; R45 |
E |
|
613-034-00-1 |
1,2-dimethylimidazole |
1739-84-0 |
Xn; R22, Xi; R38-41 |
|
|
|
613-035-00-7 |
1-methylimidazole |
616-47-7 |
Xn; R21/22, C; R34 |
|
|
|
613-036-00-2 |
2-methylpyridine; 2-picoline |
109-06-8 |
R10, Xn; R20/21/22, Xi; R36/37 |
|
|
|
613-037-00-8 |
4-methylpyridine; 4-picoline |
108-89-4 |
R10, T; R24, Xn; R20/22, Xi; R36/37/38 |
|
|
|
613-038-00-3 |
6-phenyl-1,3,5-triazine-2,4-diyldiamine; 6-phenyl-1,3,5-triazine-2,4-diamine; benzoguanamine |
91-76-9 |
Xn; R22, R52-53 |
|
|
|
613-039-00-9 |
ethylene thiourea; imidazolidine-2-thione; 2-imidazoline-2-thiol |
96-45-7 |
Repr. Cat. 2; R61, Xn; R22 |
|
E |
|
613-040-00-4 |
azaconazole (ISO); 1-{}{[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl}}-1H-1,2.4-triazole |
60207-31-0 |
Xn; R22 |
|
|
|
613-041-00-X |
morpholine-4-carbonyl chloride |
15159-40-7 |
R14, Carc. Cat. 3; R40, Xi; R36/38 |
|
|
|
613-042-00-5 |
imazalil (ISO); 1-[2-(allyloxy)-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole |
35554-44-0 |
Carc. Cat. 3; R40, Xn; R20/22, Xi; R41, N; R51-53 |
|
|
ATP07 |
613-043-00-0 |
imazalil sulphate (ISO) powder; 1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate; [1] (±)-1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate [2] |
58594-72-2 [1], 83918-57-4 [2] |
Xn; R22, R43, N; R50-53 |
|
|
|
613-043-01-8 |
imazalil sulphate (ISO), aqueous solution; 1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate; [1] (±)-1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate [2] |
58594-72-2 [1], 83918-57-4 [2] |
Xn; R22, C; R34, R43, N; R50-53 |
C ≥ 50 %: C; R34, 30 % ≤ C < 50 %: Xi; R38, 15 % ≤ C < 50 %: Xi; R41, 5 % ≤ C < 15 %: Xi; R36 |
|
|
613-044-00-6 |
captan (ISO); 1,2,3,6-tetrahydro-N-(trichloromethylthio)phthalimide |
133-06-2 |
Carc. Cat. 3; R40, T; R23, Xi; R41, R43, N; R50 |
C ≥ 2,5 %: N; R50 |
|
|
613-045-00-1 |
folpet (ISO); N-(trichloromethylthio)phthalimide |
133-07-3 |
Carc. Cat. 3; R40, Xn; R20, Xi; R36, R43, N; R50 |
C ≥ 2,5 %: N; R50 |
|
|
613-046-00-7 |
captafol (ISO); 1,2,3,6-tetrahydro-N-(1,1,2,2-tetrachloroethylthio)phthalimide |
2425-06-1 |
Carc. Cat. 2; R45, R43, N; R50-53 |
|
|
|
613-047-00-2 |
1-dimethylcarbamoyl-5-methylpyrazol-3-yl dimethylcarbamate; dimetilan (ISO) |
644-64-4 |
T; R25, Xn; R21, N; R50-53 |
|
|
|
613-048-00-8 |
carbendazim (ISO); methyl benzimidazol-2-ylcarbamate |
10605-21-7 |
Muta. Cat. 2; R46, Repr. Cat. 2; R60-61, N; R50-53 |
|
|
|
613-049-00-3 |
benomyl (ISO); methyl 1-(butylcarbamoyl)benzimidazol-2-ylcarbamate |
17804-35-2 |
Muta. Cat. 2; R46, Repr. Cat. 2; R60-61, Xi; R37/38, R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
613-050-00-9 |
carbadox (INN); methyl 3-(quinoxalin-2-ylmethylene)carbazate 1,4-dioxide; 2-(methoxycarbonylhydrazonomethyl)quinoxaline 1,4-dioxide |
6804-07-5 |
F; R11, Carc. Cat. 2; R45, Xn; R22 |
|
E |
|
613-051-00-4 |
molinate (ISO); S-ethyl 1-perhydroazepinecarbothioate; S-ethyl perhydroazepine-1-carbothioate |
2212-67-1 |
Carc. Cat. 3; R40, Repr. Cat. 3; R62, Xn; R20/2248/22, R43, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
613-052-00-X |
trifenmorph (ISO); 4-tritylmorpholine |
1420-06-0 |
Xn; R22, N; R50-53 |
|
|
|
613-053-00-5 |
anilazine (ISO); 2-chloro-N-(4,6-dichloro-1,3,5-triazin-2-yl)aniline |
101-05-3 |
Xi; R36/38, N; R50-53 |
|
|
|
613-054-00-0 |
thiabendazol (ISO); 2-(thiazole-4-yl)benzimidazole |
148-79-8 |
N; R50-53 |
|
|
|
613-056-00-1 |
1,2-dimethyl-3,5-diphenylpyrazolium methylsulphate; difenzoquat methyl sulfate |
43222-48-6 |
Xn; R22, N; R50-53 |
|
|
|
613-057-00-7 |
dodemorph (ISO); 4-cyclododecyl-2,6-dimethylmorpholine |
1593-77-7 |
Repr. Cat. 3; R63 ,C; R34, R43, N; R50-53 |
C; R34: C >= 10 %, Xi; R36/37/38: 5 % <= C < 10 %, N; R50-53: C ≥ 25 %, N; R51-53: 2,5 % <= C < 25 %, R52-53: 0,25 % <= C < 2,5 % |
|
ATP07 |
613-058-00-2 |
permethrin (ISO); m-phenoxybenzyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
52645-53-1 |
Xn; R20/22, R43, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
613-059-00-8 |
profluralin (ISO); N-(cyclopropylmethyl)-α,α,α-trifluoro-2,6-dinitro-N-propyl-p-toluidine |
26399-36-0 |
Xi; R36, N; R50-53 |
|
|
|
613-060-00-3 |
resmethrin (ISO); 5-benzyl-3-furylmethyl (±)-cis-trans-chrysanthemate |
10453-86-8 |
Xn; R22, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
613-061-00-9 |
6-(1α,5aβ,8aβ,9-pentahydroxy-7β-isopropyl-2β,5β,8β-trimethylperhydro-8bα,9-epoxy-5,8-ethanocyclopenta[1,2-b]indenyl) pyrrole-2-carboxylate; ryania |
15662-33-6 |
Xn; R21/22, N; R50-53 |
|
|
|
613-062-00-4 |
sabadilla (ISO); veratrine |
8051-02-3 |
Xi; R36/37/38 |
|
|
|
613-063-00-X |
secbumeton (ISO); 2-sec-butylamino-4-ethylamino-6-methoxy-1,3,5-triazine |
26259-45-0 |
Xn; R22, Xi; R36, N; R50-53 |
|
|
|
613-064-00-5 |
5-(3,6,9-trioxa-2-undecyloxy)benzo(d)-1,3-dioxolane; sesamex |
51-14-9 |
Xn; R22 |
|
|
|
613-065-00-0 |
simetryn (ISO); 2,4-bis(ethylamino)-6-methylthio-1,3,5-triazine |
1014-70-6 |
Xn; R22, N; R50-53 |
|
|
|
613-066-00-6 |
terbumeton (ISO); 2-tert-butylamino-4-ethylamino-6-methoxy-1,3,5-triazine |
33693-04-8 |
Xn; R22, N; R50-53 |
|
|
|
613-067-00-1 |
propazine (ISO); 2-chloro-4,6-bis(isopropylamino)-1,3,5-triazine |
139-40-2 |
Carc. Cat. 3; R40, N; R50-53 |
|
|
|
613-068-00-7 |
atrazine (ISO); 2-chloro-4-ethylamine-6-isopropylamine-1,3,5-triazine |
1912-24-9 |
Xn; R48/22, R43, N; R50-53 |
|
|
|
613-069-00-2 |
ε-caprolactam |
105-60-2 |
Xn; R20/22, Xi; R36/37/38 |
|
|
|
613-070-00-8 |
propylenethiourea |
2122-19-2 |
Repr. Cat. 3; R63, Xn; R22, R52-53 |
|
|
|
613-071-00-3 |
2-fluoro-5-trifluoromethylpyridine |
69045-82-5 |
R10, R43, R52-53 |
|
|
|
613-072-00-9 |
N,N-bis(2-ethylhexyl)-((1,2,4-triazol-1-yl)methyl)amine |
91273-04-0 |
C; R34, R43, N; R51-53 |
|
|
|
613-073-00-4 |
N,N-dimethyl-2-(3-(4-chlorophenyl)-4,5-dihydropyrazol-1-ylphenylsulphonyl)ethylamine |
10357-99-0 |
Xn; R48/22, R43, N; R51-53 |
|
|
|
613-074-00-X |
3-(3-methylpent-3-yl)isoxazol-5-ylamine |
82560-06-3 |
T; R23/25, Xi; R41, R52-53 |
|
|
|
613-075-00-5 |
1,3-dichloro-5-ethyl-5-methylimidazolidine-2,4-dione |
89415-87-2 |
O; R8, T; R23, C; R34, Xn; R22, R43, N; R50 |
|
|
|
613-076-00-0 |
3-chloro-5-trifluoromethyl-2-pyridylamine |
79456-26-1 |
Xn; R22, R52-53 |
|
|
|
613-077-00-6 |
reaction mass of 5-heptyl-1,2,4-triazol-3-ylamine and 5-nonyl-1,2,4-triazol-3-ylamine |
- |
Xn; R22, Xi; R36, N; R51-53 |
|
|
|
613-078-00-1 |
N,N,N,N-tetrakis(4,6-bis(butyl-(N-methyl-2,2,6,6-tetramethylpiperidin-4-yl)amino)triazin-2-yl)-4,7-diazadecane-1,10-diamine |
106990-43-6 |
R43, N; R51-53 |
|
|
|
613-079-00-7 |
4-(1(or 4 or 5 or 6)-methyl-8,9,10-trinorborn-5-en-2-yl)pyridine, reaction mass of isomers |
- |
Xn; R21/22, Xi; R38, R43, N; R50-53 |
|
|
|
613-080-00-2 |
3-(bis(2-ethylhexyl)aminomethyl)benzothiazole-2(3H)-thione |
105254-85-1 |
C; R34, R43, N; R50-53 |
|
|
|
613-081-00-8 |
1-butyl-2-methylpyridinium bromide |
26576-84-1 |
Xn; R22, R52-53 |
|
|
|
613-082-00-3 |
2-methyl-1-pentylpyridinium bromide |
- |
Xn; R21/22, R52-53 |
|
|
|
613-083-00-9 |
2-(4-(3-(4-chlorophenyl)-2-pyrazolin-1-yl)phenylsulfonyl)ethyldimethylammonium formate |
- |
C; R34, Xn; R48/22, R43, N; R50-53 |
|
|
|
613-084-00-4 |
2-(4-(3-(4-chlorophenyl)-4,5-dihydropyrazolyl)phenylsulphonyl)ethyldimethylammonium hydrogen phosphonate |
106359-93-7 |
Xi; R36, N; R50-53 |
|
|
|
613-085-00-X |
reaction mass of 1,1'-(methylenebis(4,1-phenylene))dipyrrole-2,5-dione and N-(4-(4-(2,5-dioxopyrrol-1-yl)benzyl)phenyl)acetamide and 1-(4-(4-(5-oxo-2H-2-furylidenamino)benzyl)phenyl)pyrrole-2,5-dione |
- |
R43, N; R50-53 |
|
|
|
613-086-00-5 |
caffeine |
58-08-2 |
Xn; R22 |
|
|
|
613-087-00-0 |
tetrahydrothiophene |
110-01-0 |
F; R11, Xn; R20/21/22, Xi; R36/38, R52-53 |
|
|
|
613-088-00-6 |
1,2-benzisothiazol-3(2H)-one; 1,2-benzisothiazolin-3-one |
2634-33-5 |
Xn; R22, Xi; R38-41, R43, N; R50 |
C ≥ 0,05 %: R43 |
|
|
613-089-00-1 |
diquat dibromide; [1] diquat dichloride; [2] 6,7-dihydrodipyrido[1,2-α:2',1'-c]pyrazinediylium dihydroxide [3] |
85-00-7 [1], 4032-26-2 [2], 94021-76-8 [3] |
T+; R26, T; R48/25, Xn; R22, Xi; R36/37/38, R43, N; R50-53 |
|
|
|
613-090-00-7 |
paraquat dichloride; 1,1-dimethyl-4,4'-bipyridinium dichloride; [1] paraquat dimethylsulfate; 1,1-dimethyl-4,4'-bipyridinium dimethyl sulphate [2] |
1910-42-5 [1], 2074-50-2 [2] |
T+; R26, T; R24/25-48/25, Xi; R36/37/38, N; R50-53 |
|
|
|
613-091-00-2 |
morfamquat dichloride; [1] morfamquat sulfate [2] |
4636-83-3 [1], 29873-36-7 [2] |
Xn; R22, Xi; R36/37/38, R52-53 |
|
|
|
613-092-00-8 |
1,10-phenanthroline |
66-71-7 |
T; R25, N; R50-53 |
|
|
|
613-093-00-3 |
hexasodium 6,13-dichloro-3,10-bis((4-(2,5-disulfonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacene-4,11-disulfonate |
85153-92-0 |
R42/43 |
|
|
|
613-094-00-9 |
4-methoxy-N,6-dimethyl-1,3,5-triazin-2-ylamine |
5248-39-5 |
Xn; R22-48/22 |
|
|
|
613-095-00-4 |
sodium 3-(2H-benzotriazol-2-yl)-5-sec-butyl-4-hydroxybenzenesulfonate |
92484-48-5 |
Xi; R41 |
|
|
|
613-096-00-X |
2-amino-6-ethoxy-4-methylamino-1,3,5-triazine |
62096-63-3 |
Xn; R22 |
|
|
|
613-097-00-5 |
7-amino-3-((5-carboxymethyl-4-methyl-1,3-thiazol-2-ylthio)methyl)-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-ene-2-carboxylic acid |
111298-82-9 |
R42/43, R52-53 |
|
|
|
613-098-00-0 |
N-(n-octyl)-2-pyrrolidone |
2687-94-7 |
C; R34, N; R51-53 |
|
|
|
613-099-00-6 |
1-dodecyl-2-pyrrolidone |
2687-96-9 |
C; R34, R43, N; R50-53 |
|
|
|
613-100-00-X |
2,9-bis(3-(diethylamino)propylsulfamoyl)quino(2,3-b)acridine-7,14-dione |
- |
R43, R53 |
|
|
|
613-101-00-5 |
N-tert-pentyl-2-benzothiazolesulfenamide |
110799-28-5 |
R43, R52-53 |
|
|
|
613-102-00-0 |
dimethomorph (ISO); 4-(3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)acryloyl)morpholine |
110488-70-5 |
N; R51-53 |
|
|
|
613-103-00-6 |
sodium 5-n-butylbenzotriazole |
118685-34-0 |
Xn; R22, C; R34, R43, N; R51-53 |
|
|
|
613-104-00-1 |
5-tert-butyl-3-isoxazolylamine hydrochloride |
- |
Xn; R22-48/22, Xi; R41, R52-53 |
|
|
|
613-105-00-7 |
hexakis(tetramethylammonium) 4,4'-vinylenebis((3-sulfonato-4,1-phenylene)imino(6-morpholino-1,3,5-triazine-4,2-diyl)imino)bis(5-hydroxy-6-phenylazonaphthalene-2,7-disulfonate) |
124537-30-0 |
T; R25, R43, R52-53 |
|
|
|
613-106-00-2 |
tetrapotassium 2-(4-(5-(1-(2,5-disulfonatophenyl)-3-ethoxycarbonyl-5-hydroxypyrazol-4-yl)penta-2,4-dienylidene)-3-ethoxycarbonyl-5-oxo-2-pyrazolin-1-yl)benzene-1,4-disulfonate |
- |
R43 |
|
|
|
613-107-00-8 |
hexasodium 2,2'-vinylenebis((3-sulfonato-4,1-phenylene)imino(6-(N-cyanoethyl-N-(2-hydroxypropyl)amino)-1,3,5-triazine-4,2-diyl)imino)dibenzene-1,4-disulfonate |
76508-02-6 |
Xi; R36 |
|
|
|
613-108-00-3 |
benzothiazole-2-thiol |
149-30-4 |
R43, N; R50-53 |
|
|
|
613-109-00-9 |
bis(piperidinothiocarbonyl) disulphide |
94-37-1 |
Xi; R36/37/38, R43 |
|
|
|
613-110-00-4 |
dimepiperate (ISO); S-(1-methyl-1-phenylethyl) piperidine-1-carbothioate |
61432-55-1 |
Xn; R22, N; R51-53 |
|
|
|
613-111-00-X |
1,2,4-triazole |
288-88-0 |
Repr. Cat. 3; R63, Xn; R22, Xi; R36 |
|
|
|
613-112-00-5 |
octhilinone (ISO); 2-octyl-2H-isothiazol-3-one |
26530-20-1 |
T; R23/24, Xn; R22, C; R34, R43, N; R50-53 |
C ≥ 0,05 %: R43 |
|
|
613-113-00-0 |
2-(morpholinothio)benzothiazole |
102-77-2 |
Xi; R36/38, R43, N; R51-53 |
|
|
|
613-114-00-6 |
2,2',2"-(hexahydro-1,3,5-triazine-1,3,5-triyl)triethanol; 1,3,5-tris(2-hydroxyethyl)hexahydro-1,3,5-triazine |
4719-04-4 |
Xn; R22, R43 |
C ≥ 0,1 %: R43 |
|
|
613-115-00-1 |
hymexazol (ISO); 3-hydroxy-5-methylisoxazole |
10004-44-1 |
Xn; R22, Xi; R41, R52-53 |
|
|
|
613-116-00-7 |
tolylfluanid (ISO); dichloro-N-[(dimethylamino)sulphonyl]fluoro-N-(p-tolyl)methanesulphenamide; [containing ≥ 0.1% (w/w) of particles with an aerodynamic diameter of below 50 μm] |
731-27-1 |
T+; R26, T; R48/23, Xi; R36/37/38, R43, N; R50 |
C ≥ 2,5 %: N; R50 |
|
|
613-116-01-4 |
tolylfluanid (ISO); dichloro-N-[(dimethylamino)sulphonyl]fluoro-N-(p-tolyl)methanesulphenamide; [containing < 0.1% (w/w) of particles with an aerodynamic diameter of below 50 μm] |
731-27-1 |
Xi; R36/37/38, R43, N; R50 |
C ≥ 2,5 %: N; R50 |
|
|
613-117-00-2 |
diniconazole (ISO); (E)-β-[(2,4-dichlorophenyl)methylene]-α-(1,1-dimethylethyl)-1H-1,2,4-triazol-1-ethanol; (E)-(RS)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol |
76714-88-0 |
Xn; R22, N; R50-53 |
|
|
|
613-118-00-8 |
flubenzimine (ISO); N-[3-phenyl-4,5-bis[(trifluoromethyl)imino]thiazolidin-2-ylidene]aniline |
37893-02-0 |
Xi; R36, N; R50-53 |
|
|
|
613-119-00-3 |
(benzothiazol-2-ylthio)methyl thiocyanate; TCMTB |
21564-17-0 |
T+; R26, Xn; R22, Xi; R36/38, R43, N; R50-53 |
|
|
|
613-120-00-9 |
bioresmethrin (ISO); (5-benzylfur-3-yl)methyl(1R)-trans-2,2-dimethyl-3-(2-methylpropenyl)cyclopropanecarboxylate |
28434-01-7 |
N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
613-121-00-4 |
chlorsulfuron (ISO); 2-chloro-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]benzenesulphonamide |
64902-72-3 |
N; R50-53 |
|
|
|
613-122-00-X |
diclobutrazole (ISO); (R*, R*)-(±)-β-[(2,4-dichlorophenyl)methyl]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol; (2RS, 3RS)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1yl)pentan-3-ol |
75736-33-3 |
Xi; R36, N; R51-53 |
|
|
|
613-123-00-5 |
5,6-dihydro-3H-imidazo[2,1-c]-1,2,4-dithiazole-3-thione; etem |
33813-20-6 |
Xn; R22, N; R50-53 |
|
|
|
613-124-00-0 |
fenpropimorph (ISO); cis-4-[3-(p-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine |
67564-91-4 |
Repr. Cat. 3; R63, Xn; R22, Xi; R38, N; R51-53 |
|
|
|
613-125-00-6 |
hexythiazox (ISO); trans-5-(4-chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-3-thiazolidine-carboxamide |
78587-05-0 |
N; R50-53 |
|
|
|
613-126-00-1 |
imazapyr (ISO); 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-3-pyridine carboxylate |
81334-34-1 |
Xi; R36, R52-53 |
|
|
|
613-127-00-7 |
1,1-dimethylpiperidinium chloride; mepiquat chloride |
24307-26-4 |
Xn; R22, R52-53 |
|
|
|
613-128-00-2 |
prochloraz (ISO); N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide |
67747-09-5 |
Xn; R22, N; R50-53 |
|
|
|
613-129-00-8 |
metamitron (ISO); 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one |
41394-05-2 |
Xn; R22, N; R50 |
|
|
|
613-131-00-9 |
pyroquilon (ISO); 1,2,5,6-tetrahydropyrrolo[3,2,1-ij]quinolin-4-one |
57369-32-1 |
Xn; R22, R52-53 |
|
|
|
613-132-00-4 |
hexazinone (ISO); 3-cyclohexyl-6-dimethylamino-1-methyl-1,2,3,4-tetrahydro-1,3,5-triazine-2,4-dione |
51235-04-2 |
Xn; R22, Xi; R36, N; R50-53 |
|
|
|
613-133-00-X |
etridiazole (ISO); 5-ethoxy-3-trichloromethyl-1,2,4-thiadiazole |
2593-15-9 |
Carc. Cat. 3: R40, Xn; R22, R43, N; R50-53 |
N; R50-53: C >= 25 %, N; R51-53: 2,5 % <= C < 25 %, R52-53: 0,25 % <= C < 2,5 % |
|
ATP07 |
613-134-00-5 |
myclobutanil (ISO); 2-(4-chlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)hexanenitrile |
88671-89-0 |
Repr. Cat. 3; R63, Xn; R22, Xi; R36, N; R51-53 |
|
|
|
613-135-00-0 |
di(benzothiazol-2-yl) disulphide |
120-78-5 |
R31, R43, N; R50-53 |
|
|
|
613-136-00-6 |
N-cyclohexylbenzothiazole-2-sulphenamide |
95-33-0 |
R43, N; R50-53 |
|
|
|
613-137-00-1 |
methabenzthiazuron (ISO); 1-(1,3-benzothiazol-2-yl)1,3-dimethylurea |
18691-97-9 |
N; R50-53 |
|
|
|
613-138-00-7 |
quinoxyfen (ISO); 5,7-dichloro-4-(4-fluorophenoxy)quinoline |
124495-18-7 |
R43, N; R50-53 |
|
|
|
613-139-00-2 |
metsulfuron-methyl (ISO); 2-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl) benzoic acid |
74223-64-6 |
N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
613-140-00-8 |
cycloheximide (ISO); 4-{}{(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl}}piperidine-2,6-dione |
66-81-9 |
Muta. Cat. 3; R68, Repr. Cat. 2; R61, T+; R28, N; R51-53 |
|
|
|
613-141-00-3 |
1,4-diamino-2-(2-butyltetrazol-5-yl)-3-cyanoanthraquinone |
93686-63-6 |
R53 |
|
|
|
613-142-00-9 |
trans-N-methyl-2-styryl-[4'-aminomethine-(1-acetyl-1-(2-methoxyphenyl)acetamido)]pyridinium acetate |
- |
R43, N; R51-53 |
|
|
|
613-143-00-4 |
1-(3-phenylpropyl)-2-methylpyridinium bromide |
10551-42-5 |
Xn; R22, Xi; R36, R52-53 |
|
|
|
613-144-00-X |
Reaction products of: poly(vinyl acetate), partially hydrolyzed, with (E)-2-(4-formylstyryl)-3,4-dimethylthiazoliummethyl sulfate |
125139-08-4 |
R52-53 |
|
|
|
613-145-00-5 |
(S)-3-benzyloxycarbonyl-1,2,3,4-tetrahydro-isoquinolinium 4-methylbenzenesulfonate |
77497-97-3 |
N; R51-53 |
|
|
|
613-146-00-0 |
N-ethyl-N-methylpiperidinium iodide |
4186-71-4 |
Xn; R22, N; R51-53 |
|
|
|
613-147-00-6 |
4-[2-(1-methyl-2-(4-morpholinyl)ethoxy)ethyl]morpholine |
111681-72-2 |
Xi; R41 |
|
|
|
613-148-00-1 |
tetrasodium 1,2-bis(4-fluoro-6-[5-(1-amino-2-sulfonatoanthrachinon-4-ylamino)-2,4,6-trimethyl-3-sulfonatophenylamino]-1,3,5-triazin-2-ylamino)ethane |
143683-23-2 |
R43, R52-53 |
|
|
|
613-149-00-7 |
pyridaben (ISO); 2-tert-butyl-5-(4-tert-butylbenzylthio)-4-chloropyridazin-3(2H)-one |
96489-71-3 |
T; R23/25, N; R50-53 |
N; R50-53: C >= 0,025 %, N; R51-53: 0,0025 % <= C < 0,025 %, R52-53: 0,00025 % <= C < 0,0025 % |
|
ATP07 |
613-150-00-2 |
2,2'-[3,3'-(piperazine-1,4-diyl)dipropyl]bis(1H-benzimidazo[2,1-b]benzo[l,m,n][3,8]phenanthroline-1,3,6-trione |
- |
R53 |
|
|
|
613-151-00-8 |
1-(3-mesyloxy-5-trityloxymethyl-2-D-threofuryl)thymine |
104218-44-2 |
R53 |
|
|
|
613-152-00-3 |
phenyl N-(4,6-dimethoxypyrimidin-2-yl)carbamate |
89392-03-0 |
R43, N; R51-53 |
|
|
|
613-153-00-9 |
2,3,5-trichloropyridine |
16063-70-0 |
R52-53 |
|
|
|
613-154-00-4 |
2-amino-4-chloro-6-methoxypyrimidine |
5734-64-5 |
Xn; R22 |
|
|
|
613-155-00-X |
5-chloro-2,3-difluoropyridine |
89402-43-7 |
R10, Xn; R22, R52-53 |
|
|
|
613-156-00-5 |
2-butyl-4-chloro-5-formylimidazole |
83857-96-9 |
R43, N; R51-53 |
|
|
|
613-157-00-0 |
2,4-diamino-5-methoxymethylpyrimidine |
54236-98-5 |
Xn; R22-48/22, Xi; R36 |
|
|
|
613-158-00-6 |
2,3-dichloro-5-trifluoromethyl-pyridine |
69045-84-7 |
Xn; R20/22, Xi; R41, R43, N; R51-53 |
|
|
|
613-159-00-1 |
fenazaquin (ISO); 4-[2-[4-(1,1-dimethylethyl)phenyl]-ethoxy]quinazoline |
120928-09-8 |
T; R25, Xn; R20, N; R50-53 |
|
|
|
613-160-00-7 |
(1S)-2-methyl-2,5-diazobicyclo[2.2.1]heptane dihydrobromide |
125224-62-6 |
R43 |
|
|
|
613-161-00-2 |
2,4-diamino-6-hydroxymethylpteridinehydrobromide |
76145-91-0 |
Xn; R48/22, R43, R52-53 |
|
|
|
613-162-00-8 |
(6R-trans)-1-((7-ammonio-2-carboxylato-8-oxo-5-thia-1-azabicyclo-[4.2.0]oct-2-en-3-yl)methyl)pyridinium iodide |
100988-63-4 |
Muta. Cat. 3; R68, R43, N; R51-53 |
|
|
|
613-163-00-3 |
azimsulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-[1-methyl-4-(2-methyl-2H-tetrazol-5-yl)pyrazol-5-ylsulfonyl]urea |
120162-55-2 |
N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
613-164-00-9 |
flufenacet (ISO); N-(4-fluorophenyl)-N-isopropyl-2-(5-trifluoromethyl-[1,3,4]thiadiazol-2-yloxy)acetamide |
142459-58-3 |
Xn; R22-48/22, R43, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
613-165-00-4 |
flupyrsulfuron-methyl-sodium (ISO); methyl 2-[[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-6-trifluoromethyl]nicotinate, monosodium salt |
144740-54-5 |
N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
613-166-00-X |
flumioxazin (ISO); N-(7-fluoro-3,4-dihydro-3-oxo-4-prop-2-ynyl-2H-1,4-benzoxazin-6-yl)cyclohex-1-ene-1,2-dicarboxamide |
103361-09-7 |
Repr. Cat. 2; R61, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
613-167-00-5 |
reaction mass of: 5-chloro-2-methyl-4-isothiazolin-3-one [EC no. 247-500-7]; and 2-methyl-2H -isothiazol-3-one [EC no. 220-239-6] (3:1); reaction mass of: 5-chloro-2-methyl-4-isothiazolin-3-one [EC no. 247-500-7]; and 2-methyl-4-isothiazolin-3-one [EC |
55965-84-9 |
T; R23/24/25, C; R34, R43, N; R50-53 |
C ≥ 0,6 %: C; R34, 0,06 % ≤ C < 0,6 %: Xi; R36/38, C ≥ 0,0015 %: R43 |
|
|
613-168-00-0 |
1-vinyl-2-pyrrolidone |
88-12-0 |
Carc. Cat. 3; R40, Xn; R20/21/22-48/20, Xi; R37-41 |
|
D |
|
613-169-00-6 |
9-vinylcarbazole |
1484-13-5 |
Muta. Cat. 3; R68, Xn; R21/22, Xi; R38, R43, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
613-170-00-1 |
2,2-ethylmethylthiazolidine |
694-64-4 |
Xn; R22, Xi; R41, R43, N; R51-53 |
|
|
|
613-171-00-7 |
hexaconazole (ISO); (RS)-2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol |
79983-71-4 |
Xn; R22, R43, N; R51-53 |
|
|
|
613-172-00-2 |
5-chloro-1,3-dihydro-2H-indol-2-one |
17630-75-0 |
Repr. Cat. 3; R62, Xn; R22, R43, R52-53 |
|
|
|
613-173-00-8 |
fluquinconazole (ISO); 3-(2,4-dichlorophenyl)-6-fluoro-2-(1H-1,2,4-triazol-1-yl)quinazolin-4-(3H)-one |
136426-54-5 |
T; R23/25-48/25, Xn; R21, Xi; R38, N; R50-53 |
|
|
|
613-174-00-3 |
tetraconazole (ISO); (±) 2-(2,4-dichlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propyl-1,1,2,2-tetrafluoroethylether |
112281-77-3 |
Xn; R20/22, N; R51-53 |
|
|
|
613-175-00-9 |
epoxiconazole (ISO); (2RS,3SR)-3-(2-chlorophenyl)-2-(4-fluorophenyl)-[(1H-1,2,4-triazol-1-yl)methyl]oxirane |
133855-98-8 |
Carc. Cat. 3; R40, Repr. Cat. 3; R62, Repr. Cat. 3; R63, N; R51-53 |
|
|
|
613-176-00-4 |
2-methyl-2-azabicyclo[2.2.1]heptane |
4524-95-2 |
R10, Xn; R21/22-48/20, C; R34 |
|
|
|
613-177-00-X |
8-amino-7-methylquinoline |
5470-82-6 |
Xn; R21/22, R43, N; R51-53 |
|
|
|
613-178-00-5 |
4-ethyl-2-methyl-2-isopentyl-1,3-oxazolidine |
137796-06-6 |
C; R34, R43 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
613-179-00-0 |
lithium 3-oxo-1,2(2H)-benzisothiazol-2-ide |
111337-53-2 |
Xn; R22, C; R34, R43, N; R51-53 |
|
|
|
613-180-00-6 |
N-(1,1-dimethylethyl)bis(2-benzothiazolesulfen)amide |
3741-80-8 |
N; R50-53 |
|
|
|
613-181-00-1 |
5,5-dimethyl-perhydro-pyrimidin-2-one α-(4-trifluoromethylstyryl)-α-(4-trifluoromethyl)cinnamylidenehydrazone |
67485-29-4 |
T; R48/25, Xn; R22, Xi; R36, N; R50-53 |
|
|
|
613-182-00-7 |
1-(1-naphthylmethyl)quinolinium chloride |
65322-65-8 |
Carc. Cat. 3; R40, Muta. Cat. 3; R68, Xn; R22, Xi; R38-41, R52-53 |
|
|
|
613-183-00-2 |
reaction mass of: 5-(N-methylperfluorooctylsulfonamido)methyl-3-octadecyl-1,3-oxazolidin-2-one; 5-(N-methylperfluoroheptylsulfonamido)methyl-3-octadecyl-1,3-oxazolidin-2-one |
- |
Xn; R48/22, N; R50-53 |
|
|
|
613-184-00-8 |
nitrilotriethyleneammoniopropane-2-ol 2-ethylhexanoate |
- |
Xi; R36, R43 |
|
|
|
613-185-00-3 |
2,3,5,6-tetrahydro-2-methyl-2H-cyclopenta[d]-1,2-thiazol-3-one |
82633-79-2 |
T; R25, Xi; R41, R43, N; R50-53 |
|
|
|
613-186-00-9 |
(2R,3R)-3-((R)-1-(tert-butyldimethylsiloxy)ethyl)-4-oxoazetidin-2-yl acetate |
76855-69-1 |
Xi; R36, R43, N; R51-53 |
|
|
|
613-187-00-4 |
5-(2-amino-5-cyano-6-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridin-3-ylazo)-3-methyl-2,4-dicarbonitrilethiophene |
- |
R43 |
|
|
|
613-188-00-X |
1-(3-(4-fluorophenoxy)propyl)-3-methoxy-4-piperidinone |
116256-11-2 |
Xn; R22, Xi; R41, R43, N; R51-53 |
|
|
|
613-189-00-5 |
1,4,7,10-tetrakis(p-toluensulfonyl)-1,4,7,10-tetraazacyclododecane |
52667-88-6 |
R43, N; R50-53 |
|
|
|
613-190-00-0 |
disodium 1-amino-4-(2-(5-chloro-6-fluoro-pyrimidin-4-ylamino-methyl)-4-methyl-6-sulfo-phenylamino)-9,10-dioxo-9,10-dihydro-anthracene-2-sulfonate |
149530-93-8 |
Xn; R22, R43 |
|
|
|
613-191-00-6 |
3-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine |
143860-04-2 |
Repr. Cat. 2; R60, C; R34, N; R50-53 |
|
|
|
613-192-00-1 |
3-benzyl-exo-6-nitro-2,4-dioxo-3-aza-cis-bicyclo[3.1.0]hexane |
151860-15-0 |
R43, R52-53 |
|
|
|
613-193-00-7 |
pentakis[3-(dimethylammonio)propylsulfamoyl]-[(6-hydroxy-4,4,8,8-tetramethyl-4,8-diazoniaundecane-1,11-diyldisulfamoyl)di[phthalocyaninecopper(II)]] heptalactate |
- |
N; R51-53 |
|
|
|
613-194-00-2 |
6,13-dichloro-3,10-bis{}{2-[4-fluoro-6-(2-sulfophenylamino)-1,3,5-triazin-2-ylamino]propylamino}}benzo[5,6][1,4]oxazino[2,3-.b.]phenoxazine-4,11-disulphonic acid, lithium-, sodium salt |
163062-28-0 |
Xi; R41 |
|
|
|
613-195-00-8 |
2,2-(1,4-phenylene)bis((4H-3,1-benzoxazine-4-one) |
18600-59-4 |
R43, R53 |
|
|
|
613-196-00-3 |
5-[[4-chloro-6-[[2-[[4-fluoro-6-[[5-hydroxy-6-[(4-methoxy-2-sulfophenyl)azo]-7-sulfo-2-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]-1-methylethyl]amino]-1,3,5-triazin-2-yl]amino]-3-[[4-(ethenylsulfonyl)phenyl]azo]-4-hydroxy-naphtalene-2,7-disulfonic acid, sodium salt |
168113-78-8 |
Xi; R41 |
|
|
|
613-197-00-9 |
reaction mass of: 2,4,6-tri(butylcarbamoyl)-1,3,5-triazine; 2,4,6-tri(methylcarbamoyl)-1,3,5-triazine; [(2-butyl-4,6-dimethyl)tricarbamoyl]-1,3,5-triazine; [(2,4-dibutyl-6-methyl)tricarbamoyl]-1,3,5-triazine |
187547-46-2 |
R43, N; R51-53 |
|
|
|
613-198-00-4 |
2-amino-4-dimethylamino-6-trifluoroethoxy-1,3,5-triazine |
145963-84-4 |
Xn; R22-48/22, R52-53 |
|
|
|
613-199-00-X |
reaction mass of: 1,3,5-tris(3-aminomethylphenyl)-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione; reaction mass of oligomers of 3,5-bis(3-aminomethylphenyl)-1-poly[3,5-bis(3-aminomethylphenyl)-2,4,6-trioxo-1,3,5-(1H,3H,5H)-triazin-1-yl]-1,3,5-(1H,3H,5H)-triazine |
- |
Carc. Cat. 2; R45, Repr. Cat. 2; R61, R43, R52-53 |
|
|
|
613-200-00-3 |
Reaction product of: copper, (29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32)-, chlorosulfuric acid and 3-(2-sulfooxyethylsulfonyl)aniline, sodium salts |
- |
Xi; R41 |
|
|
|
613-201-00-9 |
(R)-5-bromo-3-(1-methyl-2-pyrrolidinyl methyl)-1H-indole |
143322-57-0 |
Repr. Cat. 3; R62, T; R39-48/25, Xn; R20/22, Xi; R41, R43, N; R50-53 |
|
|
|
613-202-00-4 |
pymetrozine (ISO); (E)-4,5-dihydro-6-methyl-4-(3-pyridylmethyleneamino)-1,2,4-triazin-3(2H)-one |
123312-89-0 |
Carc. Cat. 3; R40, R52-53 |
|
|
|
613-203-00-X |
pyraflufen-ethyl (ISO); 2-chloro-5-(4-chloro-5-difluoromethoxy-1-methylpyrazol-3-yl)-4-fluorophenoxyacetic acid ethyl ester; [1] pyraflufen (ISO); 2-chloro-5-(4-chloro-5-difluoromethoxy-1-methylpyrazol-3-yl)-4-fluorophenoxyacetic acid [2] |
129630-19-9 [1], 129630-17-7 [2] |
N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
613-204-00-5 |
oxadiargyl (ISO); 3-[2,4-dichloro-5-(2-propynyloxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one; 5-tert-butyl-3-[2,4-dichloro-5-(prop-2-ynyloxy)phenyl]-1,3,4-oxadiazol-2(3H)-one |
39807-15-3 |
Repr. Cat. 3; R63, Xn; R48/22, N; R50-53 |
C ≥ 0,025 %: N; R50-53, 0,0025 % ≤ C < 0,025 %: N; R51-53, 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
613-205-00-0 |
propiconazole (ISO); (±)-1-[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-ylmethyl]-1H-1,2,4-triazole |
60207-90-1 |
Xn; R22, R43, N; R50-53 |
|
|
|
613-206-00-6 |
fenamidone (ISO); (S)-5-methyl-2-methylthio-5-phenyl-3-phenylamino-3,5-dihydroimidazol-4-one |
161326-34-7 |
N; R50-53 |
|
|
|
613-208-00-7 |
imazamox (ISO); (RS)-2-(4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)-5-methoxymethylnicotinic acid |
114311-32-9 |
N; R50-53 |
|
|
|
613-209-00-2 |
cis-1-(3-chloropropyl)-2,6-dimethyl-piperidin hydrochloride |
63645-17-0 |
T; R25, Xn; R48/22, R43, N; R51-53 |
|
|
|
613-210-00-8 |
2-(3-chloropropyl)-2,5,5-trimethyl-1,3-dioxane |
88128-57-8 |
Xn; R48/22, R52-53 |
|
|
|
613-211-00-3 |
N-methyl-4-(p-formylstyryl)pyridinium methylsulfate |
74401-04-0 |
R43, R52-53 |
|
|
|
613-212-00-9 |
4-[4-(2-ethylhexyloxy)phenyl](1,4-thiazinane-1,1-dioxide) |
133467-41-1 |
Xn; R22, N; R50-53 |
|
|
|
613-213-00-4 |
cis-1-benzoyl-4-[(4-methylsulfonyl)oxy]-L-proline |
120807-02-5 |
R52-53 |
|
|
|
613-214-00-X |
N,N-di-n-butyl-2-(1,2-dihydro-3-hydroxy-6-isopropyl-2-quinolylidene)-1,3-dioxoindan-5-carboxamide |
147613-95-4 |
R53 |
|
|
|
613-215-00-5 |
2-chloromethyl-3,4-dimethoxypyridinium chloride |
72830-09-2 |
Xn; R21/22-48/22, Xi; R38-41, R43, N; R51-53 |
|
|
|
613-216-00-0 |
6-tert-butyl-7-(6-diethylamino-2-methyl-3-pyridylimino)-3-(3-methylphenyl)pyrazolo[3,2-c][1,2,4]triazole |
162208-01-7 |
N; R50-53 |
|
|
|
613-217-00-6 |
4-[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionyloxy]-1-[2-[3-(3,5-di-tert-butyl-4-hydrophenyl)propionyloxy]ethyl]-2,2,6,6-tetramethylpiperidine |
73754-27-5 |
R53 |
|
|
|
613-218-00-1 |
6-hydroxyindole |
2380-86-1 |
Xn; R22, Xi; R41, R43, N; R51-53 |
|
|
|
613-219-00-7 |
7a-ethyl-3,5-bis(1-methylethyl)-2,3,4,5-tetrahydrooxazolo[3,4-c]-2,3,4,5-tetrahydrooxazole |
79185-77-6 |
Xi; R38, N; R51-53 |
|
|
|
613-220-00-2 |
trans-(4S,6S)-5,6-dihydro-6-methyl-4H-thieno[2,3-b]thiopyran-4-ol, 7,7-dioxide |
147086-81-5 |
Xn; R22 |
|
|
|
613-221-00-8 |
2-chloro-5-methyl-pyridine |
18368-64-4 |
Xn; R21/22, Xi; R38, R52-53 |
|
|
|
613-222-00-3 |
4-(1-oxo-2-propenyl)-morpholine |
5117-12-4 |
Xn; R22-48/22, Xi; R41, R43 |
|
|
|
613-223-00-9 |
N-isopropyl-3-(4-fluorophenyl)-1H-indole |
93957-49-4 |
R53 |
|
|
|
613-224-00-4 |
2,5-dimercaptomethyl-1,4-dithiane |
136122-15-1 |
Xn; R22, C; R34, R43, N; R50-53 |
|
|
|
613-225-00-X |
reaction mass of:[2-(anthraquinon-1-ylamino)-6-[(5-benzoylamino)-anthraquinone-1-ylamino]-4-phenyl]-1,3,5-triazine; 2,6-bis-[(5-benzoylamino)-anthraquinon-1-ylamino]-4-phenyl-1,3,5-triazine. |
- |
Xn; R48/22, R53 |
|
|
|
613-226-00-5 |
1-(2-(ethyl(4-(4-(4-(4-(ethyl(2-pyridinoethyl)amino)-2-methylphenylazo)benzoylamino)-phenylazo)-3-methylphenyl)amino)ethyl)-pyridinium dichloride |
163831-67-2 |
Xi; R41, N; R50-53 |
|
|
|
613-227-00-0 |
(±)-[(R*,R*) and (R*,S*)]-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran |
99199-90-3 |
R43, N; R51-53 |
|
|
|
613-228-00-6 |
(±)-(R*,S*)-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran |
793669-26-8 |
N; R51-53 |
|
|
|
613-229-00-1 |
1-acetyl-4-(3-dodecyl-2,5-dioxo-1-pyrrolidinyl)-2,2,6,6-tetramethylpiperidine |
106917-31-1 |
Xi; R38, R43, N; R50-53 |
|
|
|
613-230-00-7 |
florasulam (ISO); 2',6',8-trifluoro-5-methoxy-5-triazolo[1,5-c]; pyrimidine-2-sulfonanilide |
145701-23-1 |
N; R50-53 |
|
|
|
613-231-00-2 |
2,6-diamino-3-((pyridine-3-yl)azo)pyridine |
28365-08-4 |
Xn; R22-48/22, N; R51-53 |
|
|
|
613-232-00-8 |
3-(benzo[b]thien-2-yl)-5,6-dihydro-1,4,2-oxathiazine-4-oxide |
163269-30-5 |
T; R23, Xn; R48/22, Xi; R41, N; R50-53 |
|
|
|
613-233-00-3 |
4,4'-(oxy-(bismethylene))-bis-1,3-dioxolane |
56552-15-9 |
Xi; R41 |
|
|
|
613-234-00-9 |
imidazo[1,2-b]pyridazin hydrochloride |
18087-70-2 |
Xn; R22, Xi; R36 |
|
|
|
613-235-00-4 |
2,3-dihydro-2,2-dimethyl-1H-perimidine |
6364-17-6 |
Xn; R22-48/22, R43, N; R50-53 |
|
|
|
613-236-00-X |
2-chloro-3-trifluoromethylpyridine |
65753-47-1 |
T; R24/25-48/25, C; R34, R52-53 |
|
|
|
613-237-00-5 |
6-tert-butyl-3-(3-dodecylsulfonyl)propyl-7H-1,2,4-triazolo[3.4b][1,3,4]thiadiazine |
133949-92-5 |
R53 |
|
|
|
613-238-00-0 |
sodium 2-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]sulfonyl]ethyl sulfate |
81992-66-7 |
R43, N; R50-53 |
|
|
|
613-239-00-6 |
2-[3-(methylamino)propyl]-1H-benzimidazole |
64137-52-6 |
Xi; R41, R52-53 |
|
|
|
613-241-00-7 |
3-(2H-tetrazol-5-yl)pyridine |
3250-74-6 |
Xi; R41 |
|
|
|
613-242-00-2 |
reaction products of 3,10-bis((2-aminopropyl)amino)-6,13-dichloro-4,11-triphenodioxazinedisulfonic acid with 2-amino-1,4-benzenedisulfonic acid, 2-((4-aminophenyl)sulfonyl)ethyl hydrogen sulfate and 2,4,6-trifluoro-1,3,5-triazine, sodium salts |
191877-09-5 |
Xi; R41 |
|
|
|
613-243-00-8 |
4,4'-(1,6-hexamethylenebis(formylimino))bis(2,2,6,6-tetramethyl-1-oxylpiperidine) |
182235-14-9 |
N; R51-53 |
|
|
|
613-244-00-3 |
5,7-dichloro-4-hydroxyquinoline |
21873-52-9 |
N; R51-53 |
|
|
|
613-245-00-9 |
2-fluoro-6-trifluoromethylpyridine |
94239-04-0 |
R10, Xn; R20/22, R52-53 |
|
|
|
613-246-00-4 |
2-hydroxymethyl-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine |
103577-66-8 |
R52-53 |
|
|
|
613-247-00-X |
3-(2-methoxy-4-methoxycarboxybenzyl)-5-nitroindole |
107786-36-7 |
R53 |
|
|
|
613-248-00-5 |
3,4-dimethyl-1H-pyrazole |
2820-37-3 |
Xn; R22, Xi; R41, R52-53 |
|
|
|
613-249-00-0 |
1-(2-hydroxyethyl)-1H-pyrazol-4,5-diyldiammoniumsulfate |
155601-30-2 |
Xi; R41, R43, N; R51-53 |
|
|
|
613-250-00-6 |
reaction mass of: carbonato-bis-N-ethyl-2-isopropyl-1,3-oxazolidine; methyl carbonato-N-ethyl-2-isopropyl-1,3-oxazolidine; 2-isopropyl-N-hydroxyethyl 1,3-oxazolidine |
- |
Xi; R41, R43, R52-53 |
|
|
|
613-251-00-1 |
(R)-3-[(1-methylpyrrolidin-2-yl)methyl]-5-[2-(phenylsulfonyl)ethenyl]-1H-indole |
180637-89-2 |
Xn; R22-48/22, Xi; R41, R43 |
|
|
|
613-253-00-2 |
2,2-dialkyl-4-hydroxymethyl-1,3-dioxolane; reaction products with ethylene oxide (alkyl is C1-12 and the sum to C13, average degree of ethoxylation is 3.5) |
- |
R19, Xi; R38, N; R51-53 |
|
|
|
613-254-00-8 |
forchlorfenuron (ISO); 1-(2-chloro-4-pyridyl)-3-phenylurea |
68157-60-8 |
Carc. Cat. 3; R40, N; R51-53 |
|
|
|
613-255-00-3 |
reaction mass of isomers of: sodium [(2-hydroxyethylsulfamoyl){[2-(2-piperazin-1-ylethylamino)ethylsulfamoyl][2-(4-aminoethylpiperazine-1-yl)ethylsulfamoyl](sulfamoyl)}(sulfonatophthalocyaninato)]copper(II) |
- |
Xi; R41 |
|
|
|
613-256-00-9 |
3'5'-anhydro thymidine |
38313-48-3 |
R52-53 |
|
|
|
613-257-00-4 |
2-phthalimidoethyl N-[4-(2-cyano-4-nitrophenylazo)phenyl]-N-methyl-β-alaninate |
170222-39-6 |
R43, R53 |
|
|
|
613-258-00-X |
reaction mass of: 4-chloro-7-methylbenzotriazole sodium salt; 4-chloro-5-methylbenzotriazole sodium salt; 5-chloro-4-methylbenzotriazole sodium salt |
202420-04-0 |
C; R34, R52-53 |
|
|
|
613-259-00-5 |
reaction mass of: [2,4-dioxo-(2-propyn-1-yl)imidazolidin-3-yl]methyl(1R)-cis-chrysanthemate; [2,4-dioxo-(2-propyn-1-yl)imidazolidin-3-yl]methyl(1R)-trans-chrysanthemate |
72963-72-5 |
Xn; R22, N; R50-53 |
|
|
|
613-260-00-0 |
(±)-4-(3-chlorophenyl)-6-[(4-chlorophenyl)hydroxy(1-methyl-1H-imidazol-5-yl)methyl]-1-methyl-2(1H)-quinolin |
- |
Xi; R41, N; R50-53 |
|
|
|
613-261-00-6 |
pyrazole-1-carboxamidine monohydrochloride |
4023-02-3 |
Xn; R22-48/22, Xi; R41, R43, R52-53 |
|
|
|
613-262-00-1 |
disodium (E)-1,2-bis-(4-(4-methylamino-6-(4-methylcarbamoylphenylamino)-1,3,5-triazin-2-ylamino)phenyl-2-sulfonato)ethene |
180850-95-7 |
Xi; R41 |
|
|
|
613-263-00-7 |
monosodium 3-cyano-5-fluoro-6-hydroxypyridine-2-olate |
- |
R43 |
|
|
|
613-266-00-3 |
2-chloro-5-chloromethylthiazole |
105827-91-6 |
T; R24, C; R34, Xn; R22, R43, N; R51-53 |
|
|
|
613-267-00-9 |
thiamethoxam (ISO); 3-(2-chloro-thiazol-5-ylmethyl)-5-methyl[1,3,5]oxadiazinan-4-ylidene-N-nitroamine |
153719-23-4 |
Xn; R22, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
613-268-00-4 |
(4aS-cis-)-6-benzyl-octahydropyrrolo[3.4-b]pyridine |
151213-39-7 |
C; R34, Xn; R20/22-48/22, N; R51-53 |
|
|
|
613-269-00-X |
2-thiazolidinylidenecyanamide |
26364-65-8 |
Xn; R22-48/22, R52-53 |
|
|
|
613-270-00-5 |
5-amino-N-(2,6-dichloro-3-methylphenyl)-1H-1,2,4-triazole-3-sulfonamide |
113171-13-4 |
R52-53 |
|
|
|
613-271-00-0 |
tritosulfuron (ISO) (containing ≤ 0,02% AMTT); 1-[4-methoxy-6-(trifluoromethyl)-1,3,5-triazin-2-yl]-3-[2-(trifluoromethyl)benzenesulfonyl]urea (containing ≤ 0,02% AMTT) |
142469-14-5 |
R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
613-272-00-6 |
pyraclostrobin (ISO); methyl N-{2-[1-(4-chlorophenyl)-1H-pyrazol-3-yloxymethyl]phenyl}(N-methoxy)carbamate |
- |
T; R23, Xi; R38, N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
613-273-00-1 |
tetrahydro-3-methyl-5-((2-phenylthio)thiazol-5-ylmethyl)-[4H]-1,3,5-oxadiazinan-4-ylidene-N-nitroamine |
192439-46-6 |
N; R51-53 |
|
|
|
613-274-00-7 |
2,6-dichloro-1-fluoropyridiniumtetrafluoroborate |
140623-89-8 |
C; R34, Xn; R22, R43, N; R50-53 |
|
|
|
613-275-00-2 |
3-(2-chloroethyl)-6,7,8,9-tetra-hydro-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one monohydrochloride |
93076-03-0 |
T; R25, Xn; R68/21-48/22, Xi; R41, R43, N; R51-53 |
|
|
|
613-276-00-8 |
1-(2-chlorophenyl)-1,2-dihydro-5H-tetrazol-5-one |
98377-35-6 |
R43, R52-53 |
|
|
|
613-277-00-3 |
(4-(6-diethylamino-2-methylpyridin-3-yl)imino-4,5-dihydro-3-methyl-1-(4-methylphenyl)-1H-pyrazol-5-one |
- |
R53 |
|
|
|
613-278-00-9 |
(3-aminophenyl)pyridin-3-ylmethanone |
79568-06-2 |
Xn; R48/22, N; R50-53 |
|
|
|
613-279-00-4 |
2-ethyl-2,3-dihydro-2-methyl-1H-perimidine |
43057-68-7 |
Xn; R22-48/22, N; R50-53 |
|
|
|
613-280-00-X |
tetrahydro-1,3-dimethyl-1H-pyrimidin-2-one; dimethyl propyleneurea |
7226-23-5 |
Repr. Cat. 3; R62, Xn; R22, Xi; R41 |
|
|
|
613-281-00-5 |
quinoline |
91-22-5 |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Xn; R21/22, Xi; R36/38, N; R51-53 |
|
E |
|
613-282-00-0 |
triticonazole (ISO); (RS)-(E)-5-(4-chlorobenzylidene)-2,2-dimethyl-1-(1H-1,2,4-triazol-1-methyl)cyclopentanol |
131983-72-7 |
N; R51-53 |
|
|
|
613-283-00-6 |
ketoconazole; 1-[4-[4-[[(2SR,4RS)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone |
65277-42-1 |
Repr. Cat. 2; R60, T; R25, Xn; R48/22, N; R50-53 |
|
E |
|
613-284-00-1 |
metconazole (ISO); (1RS,5RS;1RS,5SR)-5-(4-chlorobenzyl)-2,2-dimethyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol |
125116-23-6 |
Repr. Cat. 3; R63, Xn; R22, N; R51-53 |
|
|
|
613-285-00-7 |
1-hydroxybenzotriazole, anhydrous; [1] 1-hydroxybenzotriazole, monohydrated [2] |
2592-95-2 [1], 123333-53-9 [2] |
E; R2 |
|
|
|
613-286-00-2 |
potassium 1-methyl-3-morpholinocarbonyl-4-[3-(1-methyl-3-morpholinocarbonyl-5-oxo-2-pyrazolin-4-ylidene)-1-propenyl]pyrazole-5-olate; [containing < 0.5 % N,N-dimethylformamide (EC no 200-679-5)] |
183196-57-8 |
R43 |
|
|
|
613-286-01-X |
potassium 1-methyl-3-morpholinocarbonyl-4-[3-(1-methyl-3-morpholinocarbonyl-5-oxo-2-pyrazolin-4-ylidene)-1-propenyl]pyrazole-5-olate; [containing ≥ 0.5 % N,N-dimethylformamide (EC No 200-679-5)] |
183196-57-8 |
Repr. Cat. 2; R61, R43 |
|
|
|
613-287-00-8 |
1-(3-iodo-4-aminobenzyl)-1H-1,2,4-triazole |
160194-26-3 |
Xn; R22, R43, N; R51-53 |
|
|
|
613-288-00-3 |
1,3-bis(dimethylcarbamoyl)-imidazolium chloride |
135756-61-5 |
Xn; R22, Xi; R41, R52-53 |
|
|
|
613-289-00-9 |
3-(4-chloro-2-fluoro-5-methylphenyl)-1-methyl-5-(trifluoromethyl)-1H-pyrazole |
142623-48-1 |
N; R50-53 |
|
|
|
613-290-00-4 |
4-hydroxy-7-(2-aminoethyl)-1,3-benzothiazol-2(3H)-one hydrochloride |
189012-93-9 |
Xi; R41, R43, N; R50-53 |
|
|
|
613-291-00-X |
2,4-dihydro-4-(4-(4-(4-hydroxyphenyl)-1-piperazinyl)phenyl)-2-(1-methylpropyl)-3H-1,2,4-triazol-3-one |
106461-41-0 |
Xn; R48/22, N; R50-53 |
|
|
|
613-292-00-5 |
N,N',N''-tris(2-methyl-2,3-epoxypropyl)-perhydro-2,4,6-oxo-1,3,5-triazine |
26157-73-3 |
Muta. Cat. 3; R68, R52-53 |
|
|
|
613-293-00-0 |
2-(4-tert-butylphenyl)-6-cyano-5-[bis(ethoxycarbonylmethyl)carbamoyloxy]-1H-pyrrolo[1,2-b][1,2,4] triazole-7-carboxylic acid 2,6-di-tert-butyl-4-methylcyclohexylester |
444065-11-6 |
R53 |
|
|
|
613-294-00-6 |
2-hexyldecanoic acid [4-(6-tert-butyl-7-chloro-1H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)phenylcarbamoyl]methylester |
379268-96-9 |
R53 |
|
|
|
613-295-00-1 |
11-amino-3-chloro-6,11-dihydro-5,5-dioxo-6-methyl-dibenzo[c,f][1,2]thiazepine hydrochloride |
363138-44-7 |
Xn; R22, Xi; R41, R52-53 |
|
|
|
613-296-00-7 |
pentapotassium 2-(4-(5-[1-(2,5-disulfonatophenyl)-4,5-dihydro-3-methylcarbamoyl-5-oxopyrazol-4-ylidene]-3-methyl-1,3-pentadienyl)-3-methylcarbamoyl-5-oxidopyrazol-1-yl)benzene-1,4-disulfonate |
- |
R43, R52-53 |
|
|
|
613-297-00-2 |
5-(2-bromophenyl)-2-tert-butyl-2H-tetrazole |
- |
R10, Xn; R22, N; R51-53 |
|
|
|
613-298-00-8 |
bis-(6-hydroxy-4-methyl-5-(3-methylimidazolium-1-yl)-3-(4-phenylazo)-1H-pyridin-2-one)ethylene dilactate |
- |
Xn; R48/22, Xi; R41, N; R51-53 |
|
|
|
613-299-00-3 |
main component 1 (isomer 1): 2-{6-fluoro-4-[3-(2,5-disulfo-phenylazo)-4-hydroxy-2-sulfonapht-7-ylamino]-1,3,5-triazin-2-ylamino}-3-{6-fluoro-4-[3-(1,5-disulfonaphth-2-ylazo)-4-hydroxy-2-sulfonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}-propane sodium salt; |
- |
Xi; R41 |
|
|
|
613-300-00-7 |
1-imidazol-1-yl-octadecan-2-ol |
- |
R43, R53 |
|
|
|
613-301-00-2 |
dimethyl-1-{[2-methoxy-5-(2-methyl-butoxycarbonyl)phenylcarbamoyl]-[2-octadecyl-1,1-dioxo-1,2,4-benzothiadiazin-3-yl]methyl} imidazole-4,5-dicarboxylate |
- |
R53 |
|
|
|
613-302-00-8 |
disodium 2-(5-carbamoyl-1-ethyl-2-hydroxy-4-methyl-6-oxo-1,6-dihydro-pyridine-3-ylazo)-4-(4-fluoro-6-(4-(2-sulfonyloxy-ethylsulfonyl)-phenylamino)-1,3,5-triazine-2-ylamino)benzene sulfonate |
243858-60-8 |
Xi; R41 |
|
|
|
613-303-00-3 |
2-(1-methyl-2-(4-phenoxyphenoxy)ethoxy)pyridine |
95737-68-1 |
N; R50-53 |
|
|
|
613-304-00-9 |
5,6-dihydroxy-2,3-dihydro-1H-indolium bromide |
138937-28-7 |
Xn; R22, Xi; R41 |
|
|
|
613-305-00-4 |
2-(2-hydroxy-4-octyloxyphenyl)-2H-benzotriazole |
3147-77-1 |
R53 |
|
|
|
613-306-00-X |
(2,5-dioxopyrrolidin-1-yl)-9H-fluoren-9-ylmethyl carbonate |
82911-69-1 |
Xn; R22, R43, N; R51-53 |
|
|
|
613-307-00-5 |
clothianidin (ISO); 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-1-nitroguanidine |
210880-92-5 |
Xn; R22, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
613-308-00-0 |
2-amino-5-methylthiazole |
7305-71-7 |
Xn; R22-48/22, N; R50-53 |
|
|
|
613-309-00-6 |
1-methyl-3-phenyl-1-piperazine |
5271-27-2 |
Xn; R21/22, Xi; R38-41, R52-53 |
|
|
|
613-310-00-1 |
(-)(3S,4R)-4-(4-fluorophenyl)-3-(3,4-methylenedioxy-phenoxymethyl)-N-benzylpiperidine hydrochloride |
105813-13-6 |
Xn; R22, R43, N; R50-53 |
|
|
|
613-311-00-7 |
methyl-5-nitrophenyl-guanidine |
152460-07-6 |
Xn; R22, Xi; R36, R43, R52-53 |
|
|
|
613-312-00-2 |
2-(4-methyl-2-phenyl-1-piperazinyl)benzenemethanol monohydrochloride |
- |
Xn; R22, Xi; R41, R43, R52-53 |
|
|
|
613-313-00-8 |
2-(4-(4-(3-pyridinyl)-1H-imidazol-1-yl)butyl)-1H-isoindole-1,3(2H)-dione |
173838-67-0 |
R52-53 |
|
|
|
613-314-00-3 |
4-decyloxazolidin-2-one; 4-decyl-1,3-oxazolidin-2-one |
7693-82-5 |
N; R50-53 |
|
|
|
613-315-00-9 |
tetrapotassium 4-[5-[3-carboxylato-4,5-dihydro-5-oxo-1-(4-sulfonatophenyl)pyrazol-4-ylidene]-3-(piperidinocarbonyl)penta-1,3-dienylidene]-5-hydroxy-1-(4-sulfonatophenyl)pyrazole-3-carboxylate |
- |
Xn; R20, R52-53 |
|
|
|
613-316-00-4 |
trimethylopropane tri(3-aziridinylpropanoate); (TAZ) |
52234-82-9 |
Muta. Cat. 3; R68, Xi; R41, R43 |
|
|
CLP00/ATP02 |
613-319-00-0 |
imidazole |
288-32-4 |
Repr. Cat 2; R61, Xn; R22, C; R34 |
|
|
ATP07 |
613-320-00-6 |
lenacil (ISO); 3-cyclohexyl-6,7-dihydro-1H-cyclopenta[d]pyrimidine-2,4(3H,5H)-dione |
2164-08-1 |
Carc. Cat. 3; R40, N; R50-53 |
N; R50-53: C >= 2,5 %, N; R51-53: 0,25 % <= C < 2,5 %, R52-53: 0,025 % <= C < 0,25 % |
|
ATP07 |
614-001-00-4 |
nicotine (ISO); 3-(N-methyl-2-pyrrolidinyl)pyridine |
54-11-5 |
T+; R27, T; R25, N; R51-53 |
|
|
|
614-002-00-X |
salts of nicotine |
- |
T+; R26/27/28, N; R51-53 |
|
A |
|
614-003-00-5 |
strychnine |
57-24-9 |
T+; R27/28, N; R50-53 |
|
|
|
614-004-00-0 |
salts of strychnine |
- |
T+; R26/28, N; R50-53 |
|
A |
|
614-005-00-6 |
colchicine |
64-86-8 |
Muta. Cat. 2; R46, T+; R28 |
|
E |
|
614-006-00-1 |
brucine; 2,3-dimethoxystrychnine |
357-57-3 |
T+; R26/28, R52-53 |
|
|
|
614-007-00-7 |
brucine sulphate; [1] brucine nitrate; [2] Strychnidin-10-one, 2,3-dimethoxy-, mono[(R)-1-methylheptyl 1,2-benzenedicarboxylate]; [3] Strychnidin-10-one, 2,3-dimethoxy-, compd. with (S)mono(1-methylheptyl)-1,2-benzenedicarboxylate (1:1) [4] |
4845-99-2 [1], 5786-97-0 [2], 68239-26-9 [3], 68310-42-9 [4] |
T+; R26/28, R52-53 |
|
A |
|
614-008-00-2 |
aconitine |
302-27-2 |
T+; R26/28 |
|
|
|
614-009-00-8 |
salts of aconitine |
- |
T+; R26/28 |
|
A |
|
614-010-00-3 |
atropine |
51-55-8 |
T+; R26/28 |
|
|
|
614-011-00-9 |
salts of atropine |
- |
T+; R26/28 |
|
A |
|
614-012-00-4 |
hyoscyamine |
101-31-5 |
T+; R26/28 |
|
|
|
614-013-00-X |
salts of hyoscyamine |
- |
T+; R26/28 |
|
A |
|
614-014-00-5 |
hyoscine |
51-34-3 |
T+; R26/27/28 |
|
|
|
614-015-00-0 |
salts of hyoscine |
- |
T+; R26/27/28 |
|
A |
|
614-016-00-6 |
pilocarpine |
92-13-7 |
T+; R26/28 |
|
|
|
614-017-00-1 |
salts of pilocarpine |
- |
T+; R26/28 |
|
A |
|
614-018-00-7 |
papaverine |
58-74-2 |
Xn; R22 |
|
|
|
614-019-00-2 |
salts of papaverine |
- |
Xn; R22 |
|
A |
|
614-020-00-8 |
physostigmine |
57-47-6 |
T+; R26/28 |
|
|
|
614-021-00-3 |
salts of physostigmine |
- |
T+; R26/28 |
|
A |
|
614-022-00-9 |
digitoxin |
71-63-6 |
T; R23/25, R33 |
|
|
|
614-023-00-4 |
ephedrine |
299-42-3 |
Xn; R22 |
|
|
|
614-024-00-X |
salts of ephedrine |
- |
Xn; R22 |
|
A |
|
614-025-00-5 |
ouabain |
630-60-4 |
T; R23/25, R33 |
|
|
|
614-026-00-0 |
strophantin-K |
11005-63-3 |
T; R23/25, R33 |
|
|
|
614-027-00-6 |
bufa-4,20,22-trienolide, 6-(acetyloxy)-3-(β-D-glucopyranosyloxy)-8,14-dihydroxy-, (3β, 6β)-; red squill; scilliroside |
507-60-8 |
T+; R28 |
|
|
|
614-028-00-1 |
reaction mass of: 2-ethylhexyl mono-D-glucopyranoside; 2-ethylhexyl di-D-glucopyranoside |
- |
Xi; R41 |
|
|
|
614-029-00-7 |
constitutional isomers of penta-O-allyl-β-D-fructofuranosyl-α-D-glucopyranoside; constitutional isomers of hexa-O-allyl-β-D-fructofuranosyl-α-D-glucopyranoside; constitutional isomers of hepta-O-allyl-β-D-fructofuransoyl-α-D-glucopyranoside |
68784-14-5 |
Xn; R22 |
|
|
|
615-001-00-7 |
methyl isocyanate |
624-83-9 |
F; R11, Repr. Cat. 3; R63, T+; R26, T; R24/25, R42/43, Xi; R37/38-41 |
|
|
|
615-002-00-2 |
methyl isothiocyanate |
556-61-6 |
T; R23/25, C; R34, R43, N; R50-53 |
|
|
|
615-003-00-8 |
thiocyanic acid |
463-56-9 |
Xn; R20/21/22, R32, R52-53 |
|
|
|
615-004-00-3 |
salts of thiocyanic acid, with the exception of those specified elsewhere in this Annex |
- |
Xn; R20/21/22, R32, R52-53 |
|
A |
|
615-005-00-9 |
4,4'-methylenediphenyl diisocyanate; diphenylmethane-4,4'-diisocyanate; [1] 2,2'-methylenediphenyl diisocyanate; diphenylmethane-2,2'-diisocyanate; [2] o-(p-isocyanatobenzyl)phenyl isocyanate; diphenylmethane-2,4'-diisocyanate; [3] methylenediphenyl |
101-68-8 [1], 2536-05-2 [2], 5873-54-1 [3], 26447-40-5 [4] |
Carc. Cat. 3; R40, Xn; R20-48/20, Xi; R36/37/38, R42/43 |
C ≥ 5 %: Xi; R36/37/38, C ≥ 0,1 %: R42 |
C2 |
|
615-006-00-4 |
2-methyl-m-phenylene diisocyanate; toluene-2,4-di-isocyanate; [1] 4-methyl-m-phenylene diisocyanate; toluene-2,6-di-isocyanate; [2] m-tolylidene diisocyanate; toluene-diisocyanate [3] |
91-08-7 [1], 584-84-9 [2], 26471-62-5 [3] |
Carc. Cat. 3; R40, T+; R26, Xi; R36/37/38, R42/43, R52-53 |
C ≥ 0,1 %: R42 |
C2 |
|
615-007-00-X |
1,5-naphthylene diisocyanate |
3173-72-6 |
Xn; R20, Xi; R36/37/38, R42, R52-53 |
|
|
|
615-008-00-5 |
3-isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate; isophorone di-isocyanate |
4098-71-9 |
T; R23, Xi; R36/37/38, R42/43, N; R51-53 |
C ≥ 2 %: T; R23, 0,5 % ≤ C < 2 %: Xn; R20, C ≥ 0,5 %: R42/43 |
2 |
|
615-009-00-0 |
4,4'-methylenedi(cyclohexyl isocyanate); dicyclohexylmethane-4,4'-di-isocyanate |
5124-30-1 |
T; R23, Xi; R36/37/38, R42/43 |
C ≥ 2 %: T; R23, 0,5 % ≤ C < 2 %: Xn; R20, C ≥ 0,5 %: R42/43 |
2 |
|
615-010-00-6 |
2,2,4-trimethylhexamethylene-1,6-di-isocyanate; [1] 2,4,4-trimethylhexamethylene-1,6-di-isocyanate [2] |
16938-22-0 [1], 15646-96-5 [2] |
T; R23, Xi; R36/37/38, R42 |
C ≥ 2 %: T; R23, 0,5 % ≤ C < 2 %: Xn; R20, C ≥ 0,5 %: R42 |
C2 |
|
615-011-00-1 |
hexamethylene-di-isocyanate |
822-06-0 |
T; R23, Xi; R36/37/38, R42/43 |
C ≥ 2 %: T; R23, 0,5 % ≤ C < 2 %: Xn; R20, C ≥ 0,5 %: R42/43 |
2 |
|
615-012-00-7 |
4-isocyanatosulphonyltoluene; tosyl isocyanate |
4083-64-1 |
R14, Xi; R36/37/38, R42 |
C ≥ 5 %: Xi; R36/37/38 |
|
|
615-013-00-2 |
cyanamide; carbanonitril |
420-04-2 |
T; R25, Xn; R21, Xi; R36/38, R43 |
|
|
|
615-014-00-8 |
tris(1-dodecyl-3-methyl-2-phenylbenzimidazolium)hexacyanoferrate |
7276-58-6 |
Xn; R22 |
|
|
|
615-015-00-3 |
1,7,7-trimethylbicyclo(2,2,1)hept-2-yl thiocyanatoacetate; isobornyl thiocyanoacetate |
115-31-1 |
Xn; R22, N; R50-53 |
|
|
|
615-016-00-9 |
potassium cyanate |
590-28-3 |
Xn; R22 |
|
|
|
615-017-00-4 |
calcium cyanamide |
156-62-7 |
Xn; R22, Xi; R37-41 |
|
|
|
615-018-00-X |
2-(2-butoxyethoxy)ethyl thiocyanate |
112-56-1 |
R10, T; R24/25 |
|
|
|
615-019-00-5 |
dicyclohexylcarbodiimide |
538-75-0 |
T; R24, Xn; R22, Xi; R41, R43 |
|
|
|
615-020-00-0 |
methylene dithiocyanate |
6317-18-6 |
T+; R26, T; R25, C; R34, R43, N; R50 |
|
|
|
615-021-00-6 |
1,3,5-tris(oxiranylmethyl)-1,3,5-triazine-2,4,6(1H,3H,5H)-trione; TGIC |
2451-62-9 |
Muta. Cat. 2; R46, T; R23/25, Xn; R48/22, Xi; R41, R43, R52-53 |
|
E |
|
615-022-00-1 |
methyl 3-isocyanatosulfonyl-2-thiophene-carboxylate |
79277-18-2 |
R14, Xn; R48/22, R42/43 |
|
|
|
615-023-00-7 |
2-(isocyanatosulfonylmethyl)benzoic acid methyl ester; (alt.):methyl 2-(isocyanatosulfonylmethyl)benzoate |
83056-32-0 |
R10, R14, Muta. Cat. 3; R68, Xn; R20-48/22, Xi; R41, R42 |
|
|
|
615-024-00-2 |
2-phenylethylisocyanate |
1943-82-4 |
T; R23, Xn; R22, C; R35, R42/43, N; R51-53 |
|
|
|
615-025-00-8 |
4,4'-ethylidenediphenyl dicyanate |
47073-92-7 |
Xn; R20/22-48/22, Xi; R41, N; R50-53 |
|
|
|
615-026-00-3 |
4,4'-methylenebis(2,6-dimethylphenyl cyanate) |
101657-77-6 |
R43, R52-53 |
|
|
|
615-028-00-4 |
ethyl 2-(isocyanatosulfonyl)benzoate |
77375-79-2 |
R14, Xn; R22-48/22, Xi; R41, R42/43 |
|
|
|
615-029-00-X |
2,5-bis-isocyanatomethyl-bicyclo[2.2.1]heptane |
- |
T+; R26, Xn; R22, C; R34, R42/43, R52-53 |
|
|
|
615-030-00-5 |
alkali salts and alkali earth salts of thiocyanic acid, with the exception of those specified elsewhere in this Annex |
- |
Xn; R20/21/22, R32, R52-53 |
|
A |
|
615-031-00-0 |
thallium thiocyanate |
3535-84-0 |
T+; R26/28, Xn; R21, R32, R33, N; R51-53 |
|
|
|
615-032-00-6 |
metal salts of thiocyanic acid, with the exception of those specified elsewhere in this Annex |
- |
Xn; R20/21/22, R32, N; R50-53 |
|
A |
|
615-033-00-1 |
reaction product of diphenylmethanediisocyanate, octylamine, oleylamine and cyclohexylamine (1:1.58:0.32:0.097) |
- |
R53 |
|
|
|
615-034-00-7 |
reaction product of diphenylmethanediisocyanate, octylamine, 4-ethoxyaniline and ethylenediamine (1:0,37:1,53:0,05) |
- |
R53 |
|
|
|
615-035-00-2 |
reaction product of diphenylmethanediisocyanate, octylamine and oleylamine (molar ratio 1:1.86:0.14) |
122886-55-9 |
R53 |
|
|
|
615-036-00-8 |
reaction product of diphenylmethanediisocyanate, toluenediisocyanate ( reaction mass of isomers: 65 % 2,4- and 35 % 2,6-diisocyanate), octylamine, oleylamine and 4-ethoxyaniline (molar ratio 4:1:7:1:2) |
- |
R53 |
|
|
|
615-037-00-3 |
reaction product of diphenylmethanediisocyanate, toluenediisocyanate ( reaction mass of isomers: 65 % 2,4- and 35 % 2,6-diisocyanate), octylamine and oleylamine (molar ratio 4:1:9:1) |
- |
R53 |
|
|
|
615-038-00-9 |
reaction product of toluenediisocyanate ( reaction mass of isomers: 65 % 2,4- and 35 % 2,6-diisocyanate) and aniline (molarratio 1:2) |
- |
R53 |
|
|
|
615-039-00-4 |
reaction product of diphenylmethanediisocyanate, toluenediisocyanate ( reaction mass of isomers: 65 % 2,4- and 35 % 2,6-diisocyanate), octylamine, oleylamine and 4-ethoxyaniline (molar ratio 3.88:1:6.38:0.47:2.91) |
- |
R53 |
|
|
|
615-044-00-1 |
4-chlorophenylisocyanate |
104-12-1 |
T+; R26, Xn; R22, Xi; R37/38-41, R42, N; R50-53 |
|
|
|
615-045-00-7 |
4,4'-methylene bis(3-chloro-2,6-di-ethylphenylisocyanate) |
- |
R42/43, R53 |
|
|
|
616-001-00-X |
N,N-dimethylformamide; dimethyl formamide |
68-12-2 |
Repr. Cat. 2; R61, Xn; R20/21, Xi; R36 |
|
E |
|
616-002-00-5 |
2-fluoroacetamide |
640-19-7 |
T+; R28, T; R24 |
|
|
|
616-003-00-0 |
acrylamide; prop-2-enamide |
79-06-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Repr. Cat. 3; R62, T; R25-48/23/24/25, Xn; R20/21, Xi; R36/38, R43 |
|
D E |
|
616-004-00-6 |
allidochlor (ISO); N,N-diallylchloroacetamide |
93-71-0 |
Xn; R21/22, Xi; R36/38, N; R51-53 |
|
|
|
616-005-00-1 |
chlorthiamid (ISO); 2,6-dichloro (thiobenzamide) |
1918-13-4 |
Xn; R22 |
|
|
|
616-006-00-7 |
dichlofluanid (ISO); N-dichlorofluoromethylthio-N',N'-dimethyl-N-phenylsulfamide |
1085-98-9 |
Xn; R20, Xi; R36, R43, N; R50 |
C ≥ 2,5 %: N; R50 |
|
|
616-007-00-2 |
diphenamid (ISO); N,N-dimethyl-2,2-diphenylacetamide |
957-51-7 |
Xn; R22, R52-53 |
|
|
|
616-008-00-8 |
propachlor (ISO); 2-chloro-N-isopropylacetanilide; α-chloro-N-isopropylacetanilide |
1918-16-7 |
Xn; R22, Xi; R36, R43, N; R50-53 |
|
|
|
616-009-00-3 |
propanil (ISO); 3',4'-dichloropropionanilide |
709-98-8 |
Xn; R22, N; R50 |
C ≥ 2,5 %: N; R50 |
|
|
616-010-00-9 |
tosylchloramide sodium |
127-65-1 |
Xn; R22, R31, C; R34, R42 |
|
|
|
616-011-00-4 |
N,N-dimethylacetamide |
127-19-5 |
Repr. Cat. 2; R61, Xn; R20/21 |
C ≥ 5 %: Repr. Cat. 2; R61 |
E |
|
616-012-00-X |
N-(dichlorofluoromethylthio)phthalimide; N-(fluorodichloromethylthio)phthalimide |
719-96-0 |
Xi; R38 |
|
|
|
616-013-00-5 |
butyraldehyde oxime |
110-69-0 |
T; R24, Xn; R22, Xi; R36 |
|
|
|
616-014-00-0 |
2-butanone oxime; ethyl methyl ketoxime; ethyl methyl ketone oxime |
96-29-7 |
Carc. Cat. 3; R40, Xn; R21, Xi; R41, R43 |
|
|
|
616-015-00-6 |
alachlor (ISO); 2-chloro-2',6'-diethyl-N-(methoxymethyl)acetanilide |
15972-60-8 |
Carc. Cat. 3; R40, Xn; R22, R43, N; R50-53 |
C ≥ 0,2,5 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
616-016-00-1 |
1-(3,4-dichlorophenylimino) thiosemicarbazide |
5836-73-7 |
T+; R28 |
|
|
|
616-017-00-7 |
cartap hydrochloride |
15263-52-2 |
Xn; R21/22, N; R50-53 |
|
|
|
616-018-00-2 |
N,N-diethyl-m-toluamide; deet |
134-62-3 |
Xn; R22, Xi; R36/38, R52-53 |
|
|
|
616-019-00-8 |
perfluidone (ISO); 1,1,1-trifluoro-N-(4-phenylsulphonyl-o-tolyl)methanesulphonamide |
37924-13-3 |
Xn; R22, Xi; R36 |
|
|
|
616-020-00-3 |
tebuthiuron (ISO); 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea |
34014-18-1 |
Xn; R22, N; R50-53 |
|
|
|
616-021-00-9 |
thiazafluron (ISO); 1,3-dimethyl-1-(5-trifluoromethyl-1,3,4-thiadiazol-2-yl)urea |
25366-23-8 |
Xn; R22, N; R50-53 |
|
|
|
616-022-00-4 |
acetamide |
60-35-5 |
Carc. Cat. 3; R40 |
|
|
|
616-023-00-X |
N-hexadecyl(or octadecyl)-N-hexadecyl(or octadecyl)benzamide |
- |
Xi; R38, R43 |
|
|
|
616-024-00-5 |
2-(4,4-dimethyl-2,5-dioxooxazolidin-1-yl)-2-chloro-5-(2-(2,4-di-tert-pentylphenoxy)butyramido)-4,4-dimethyl-3-oxovaleranilide |
54942-74-4 |
R53 |
|
|
|
616-025-00-0 |
valinamide |
20108-78-5 |
Repr. Cat. 3; R62, Xi; R36, R43 |
|
|
|
616-026-00-6 |
thioacetamide |
62-55-5 |
Carc. Cat. 2; R45, Xn; R22, Xi; R36/38, R52-53 |
|
E |
|
616-027-00-1 |
tris(2-(2-hydroxyethoxy)ethyl)ammonium 3-acetoacetamido-4-methoxybenzenesulfonate |
- |
R43 |
|
|
|
616-028-00-7 |
N-(4-(3-(4-cyanophenyl)ureido)-3-hydroxyphenyl)-2-(2,4-di-tert-pentylphenoxy)octanamide |
108673-51-4 |
R43, R53 |
|
|
|
616-029-00-2 |
N,N'-ethylenebis(vinylsulfonylacetamide) |
66710-66-5 |
Xi; R41, R43 |
|
|
|
616-030-00-8 |
ethidimuron (ISO); 1-(5-ethylsulphonyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea |
30043-49-3 |
R43, N; R50-53 |
|
|
|
616-031-00-3 |
dimethachlor (ISO); 2-chloro-N-(2,6-dimethylphenyl)-N-(2-methoxyethyl)acetamide |
50563-36-5 |
Xn; R22, R43, N; R50-53 |
|
|
|
616-032-00-9 |
diflufenican (ISO); N-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]-3-pyridinecarboxamide |
83164-33-4 |
R52-53 |
|
|
|
616-033-00-4 |
cyprofuram (ISO); N-(3-chlorophenyl)-N-(tetrahydro-2-oxo-3-furyl)cyclopropanecarboxamide |
69581-33-5 |
T; R25, Xn; R21, N; R50-53 |
|
|
|
616-034-00-X |
pyracarbolid (ISO); 3,4-dihydro-6-methyl-2H-pyran-5-carboxanilide |
24691-76-7 |
R52-53 |
|
|
|
616-035-00-5 |
cymoxanil (ISO); 2-cyano-N-[(ethylamino)carbonyl]-2-(methoxyimino)acetamide |
57966-95-7 |
Xn; R22, R43, N; R50-53 |
|
|
|
616-036-00-0 |
2-chloracetamide |
79-07-2 |
Repr. Cat. 3; R62, T; R25, R43 |
C ≥ 0,1 %: R43 |
|
|
616-037-00-6 |
acetochlor (ISO); 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide |
34256-82-1 |
Xn; R20, Xi; R37/38, R43, N; R50-53 |
|
|
|
616-038-00-1 |
(4-aminophenyl)-N-methylmethylensulfonamide hydrochloride |
88918-84-7 |
Xi; R41, R43, N; R51-53 |
|
|
|
616-039-00-7 |
3',5'-dichloro-4'-ethyl-2'-hydroxypalmitanilide |
117827-06-2 |
R43 |
|
|
|
616-040-00-2 |
potassium N-(4-toluenesulfonyl)-4-toluenesulfonamide |
97888-41-0 |
Xi; R41 |
|
|
|
616-041-00-8 |
3',5'-dichloro-2-(2,4-di-tert-pentylphenoxy)-4'-ethyl-2'-hydroxyhexananilide |
101664-25-9 |
R53 |
|
|
|
616-042-00-3 |
N-(2-(6-ethyl-7-(4-methylphenoxy)-1H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propyl)-2-octadecyloxybenzamide |
142859-67-4 |
R43, R53 |
|
|
|
616-043-00-9 |
isoxaben (ISO); N-[3-(1-ethyl-1-methylpropyl)-1,2-oxazol-5-yl]-2,6-dimethoxybenzamide |
82558-50-7 |
R53 |
|
|
|
616-044-00-4 |
N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)-2-(3-pentadecylphenoxy)-butanamide |
- |
N; R51-53 |
|
|
|
616-045-00-X |
2'-(4-chloro-3-cyano-5-formyl-2-thienylazo)-5'-diethylamino-2-methoxyacetanilide |
122371-93-1 |
R43, R53 |
|
|
|
616-046-00-5 |
N-(2-(6-chloro-7-methylpyrazolo(1,5-b)-1,2,4-triazol-4-yl)propyl)-2-(2,4-di-tert-pentylphenoxy)octanamide |
- |
N; R50-53 |
|
|
|
616-047-00-0 |
reaction mass of: 2,2',2'',2'''-(ethylenedinitrilotetrakis-N,N-di(C16)alkylacetamide; 2,2',2'',2'''-(ethylenedinitrilotetrakis-N,N-di(C18)alkylacetamide |
- |
R43 |
|
|
|
616-048-00-6 |
3'-trifluoromethylisobutyranilide |
1939-27-1 |
Xn; R48/22, N; R51-53 |
|
|
|
616-049-00-1 |
2-(2,4-bis(1,1-dimethylethyl)phenoxy)-N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)-hexanamide |
99141-89-6 |
R53 |
|
|
|
616-050-00-7 |
lufenuron (ISO); N-[2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)-phenyl-aminocarbonyl]-2,6-difluorobenzamide |
103055-07-8 |
R43, N; R50-53 |
|
|
|
616-051-00-2 |
reaction mass of: 2,4 -bis(N'-(4-methylphenyl)-ureido)-toluene; 2,6 -bis(N'-(4-methylphenyl)-ureido)-toluene |
- |
R53 |
|
|
|
616-052-00-8 |
formamide |
75-12-7 |
Repr. Cat. 2; R61 |
|
|
|
616-053-00-3 |
N-methylacetamide |
79-16-3 |
Repr. Cat. 2; R61 |
|
|
|
616-054-00-9 |
iprodione (ISO); 3-(3,5-dichlorophenyl)-2,4-dioxo-N-isopropylimidazolidine-1-carboxamide |
36734-19-7 |
Carc. Cat. 3; R40, N; R50-53 |
|
|
|
616-055-00-4 |
propyzamide (ISO); 3,5-dichloro-N-(1,1-dimethylprop-2-ynyl)benzamide |
23950-58-5 |
Carc. Cat. 3; R40, N; R50-53 |
|
|
|
616-056-00-X |
N-methylformamide |
123-39-7 |
Repr. Cat. 2; R61, Xn; R21 |
|
E |
|
616-057-00-5 |
reaction mass of: N-[3-hydroxy-2-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide; N-[2,3-bis-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide; methacrylamide; 2-methyl-N-(2-methylacryloylaminomethoxymethyl)-acrylamide; N |
- |
Carc. Cat. 2; R45, Muta. Cat. 3; R68, Xn; R48/22 |
|
E |
|
616-058-00-0 |
1,3-bis(3-methyl-2,5-dioxo-1H-pyrrolinylmethyl)benzene |
119462-56-5 |
Xn; R48/22, Xi; R41, R43, N; R50-53 |
|
|
|
616-059-00-6 |
4-((4-(diethylamino)-2-ethoxyphenyl)imino)-1,4-dihydro-1-oxo-N-propyl-2-naphthalenecarboxamide |
121487-83-0 |
R53 |
|
|
|
616-060-00-1 |
Condensation product of: 3-(7-carboxyhept-1-yl)-6-hexyl-4-cyclohexene-1,2-dicarboxylic acid with polyamines (primarily amino-ethyl-piperazine and triethylenetetramine) |
- |
Xn; R22, C; R34, R43, N; R50-53 |
|
|
|
616-061-00-7 |
N,N'-1,6-hexanediylbis(N-(2,2,6,6-tetramethyl-piperidin-4-yl)-formamide |
124172-53-8 |
Xi; R36, R52-53 |
|
|
|
616-062-00-2 |
N-[3-[(2-acetyloxy)ethyl](phenyl-methyl)amino]-4-methoxyphenylacetamide |
70693-57-1 |
C; R34, R52-53 |
|
|
|
616-063-00-8 |
3-dodecyl-(1-(1,2,2,6,6-pentamethyl-4-piperidin)-yl)-2,5-pyrrolidindione |
106917-30-0 |
T; R23, Xn; R22-48/22, C; R35, N; R50-53 |
|
|
|
616-064-00-3 |
N-tert-butyl-3-methylpicolinamide |
32998-95-1 |
R52-53 |
|
|
|
616-065-00-9 |
3'-(3-acetyl-4-hydroxyphenyl)-1,1-diethylurea |
79881-89-3 |
Xn; R22-48/22 |
|
|
|
616-066-00-4 |
5,6,12,13-tetrachloroanthra(2,1,9-def:6,5,10-d'e'f')diisoquinoline-1,3,8,10(2H,9H)-tetrone |
115662-06-1 |
Repr. Cat. 3; R62 |
|
|
|
616-067-00-X |
dodecyl 3-(2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-4,4-dimethyl-3-oxovaleramido)-4-chlorobenzoate |
92683-20-0 |
R53 |
|
|
|
616-068-00-5 |
potassium 4-(11-methacrylamidoundecanamido)benzenesulfonate |
174393-75-0 |
R43 |
|
|
|
616-069-00-0 |
1-hydroxy-5-(2-methylpropyloxycarbonylamino)-N-(3-dodecyloxypropyl)-2-naphthoamide |
110560-22-0 |
R53 |
|
|
|
616-070-00-6 |
reaction mass of: 3,3'-dicyclohexyl-1,1'-methylenebis(4,1-phenylene)diurea; 3-cyclohexyl-1-(4-(4-(3-octadecylureido)benzyl)phenyl)urea; 3,3'-dioctadecyl-1,1'-methylenebis(4,1-phenylene)diurea |
- |
R53 |
|
|
|
616-071-00-1 |
reaction mass of: bis(N-cyclohexyl-N'-phenyleneureido)methylene; bis(N-octadecyl-N'-phenyleneureido)methylene; bis(N-dicyclohexyl-N'-phenyleneureido)methylene (1:2:1) |
- |
R43, R53 |
|
|
|
616-072-00-7 |
1-(2-deoxy-5-O-trityl-β-D-threopentofuranosyl)thymine |
55612-11-8 |
R53 |
|
|
|
616-073-00-2 |
4'-ethoxy-2-benzimidazoleanilide |
120187-29-3 |
Muta. Cat. 3; R68, R53 |
|
|
|
616-074-00-8 |
N-butyl-2-(4-morpholinylcarbonyl)benzamide |
104958-67-0 |
Xi; R36, R43, R52-53 |
|
|
|
616-075-00-3 |
D,L-(N,N-diethyl-2-hydroxy-2-phenylacetamide) |
65197-96-8 |
Xn; R22, Xi; R41 |
|
|
|
616-076-00-9 |
tebufenozide (ISO); N-tert-butyl-N'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazide |
112410-23-8 |
N; R51-53 |
|
|
|
616-077-00-4 |
reaction mass of: 2-(9-methyl-1,3,8,10-tetraoxo-2,3,9,10-tetrahydro-(1H,8H)-anthra[2,1,9-def: 6,5,10-d'e'f']diisoquinolin-2-ylethansulfonic acid; potassium 2-(9-methyl-1,3,8,10-tetraoxo-2,3,9,10-tetrahydro-(1H,8H)-anthra[2,1,9-def: 6,5,10-d'e'f']diisoqui |
- |
Xi; R41 |
|
|
|
616-078-00-X |
2-[2,4-bis(1,1-dimethyl-ethyl)phenoxy]-N-(2-hydroxy-5-methyl-phenyl)hexanamide |
104541-33-5 |
R53 |
|
|
|
616-079-00-5 |
1,6-hexanediyl-bis(2-(2-(1-ethylpentyl)-3-oxazolidinyl)ethyl)carbamate |
140921-24-0 |
R43 |
|
|
|
616-080-00-0 |
4-(2-((3-ethyl-4-methyl-2-oxo-pyrrolin-1-yl)carboxamido)ethyl)benzenesulfonamide) |
119018-29-0 |
R52-53 |
|
|
|
616-081-00-6 |
5-bromo-8-naphtholactam |
24856-00-6 |
Xn; R22, R43, N; R50-53 |
|
|
|
616-082-00-1 |
N-(5-chloro-3-((4-(diethylamino)-2-methylphenyl)imino-4-methyl-6-oxo-1,4-cyclohexadien-1-yl)benzamide |
129604-78-0 |
R43 |
|
|
|
616-083-00-7 |
[2-[(4-nitrophenyl)amino]ethyl]urea |
27080-42-8 |
R43, R52-53 |
|
|
|
616-084-00-2 |
2,4-bis[N'-(4-methylphenyl)ureido]toluene |
- |
N; R50-53 |
|
|
|
616-085-00-8 |
3-(2,4-dichlorophenyl)-6-fluoro-quinazoline-2,4(1H,3H)-dione |
168900-02-5 |
N; R50-53 |
|
|
|
616-086-00-3 |
2-acetylamino-6-chloro-4-[(4-diethylamino)2-methylphenyl-imino]-5-methyl-1-oxo-2,5-cyclohexadiene |
102387-48-4 |
R53 |
|
|
|
616-087-00-9 |
reaction mass of: 7,9,9-trimethyl-3,14-dioxa-4,13-dioxo-5,12-diazahexadecane-1,16-diyl-prop-2-enoate; 7,7,9-trimethyl-3,14-dioxa-4,13-dioxo-5,12-diazahexadecan-1,16-diyl-prop-2-enoate |
52658-19-2 |
Xi; R36, R43, N; R51-53 |
|
|
|
616-088-00-4 |
2-aminosulfonyl-N,N-dimethylnicotinamide |
112006-75-4 |
R43, R52-53 |
|
|
|
616-089-00-X |
5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidine)-3-fluoro-2-hydroxymethyltetrahydrofuran |
41107-56-6 |
Muta. Cat. 3; R68 |
|
|
|
616-090-00-5 |
1-(1,4-benzodioxan-2-ylcarbonyl)piperazine hydrochloride |
70918-74-0 |
T; R23/24/25, Xn; R48/22, N; R51-53 |
|
|
|
616-091-00-0 |
1,3,5-tris-[(2S and 2R)-2,3-epoxypropyl]-1,3,5-triazine-2,4,6-(1H,3H,5H)-trione |
59653-74-6 |
Muta. Cat. 2; R46, T; R23, Xn; R22-48/22, Xi; R41, R43 |
|
E |
|
616-092-00-6 |
Polymeric reaction product of bicyclo[2.2.1]hepta-2,5-diene, ethene, 1,4-hexadiene, 1-propene with N,N-di-2-propenylformamide |
- |
R43, R53 |
|
|
|
616-093-00-1 |
Reaction products of: aniline-terephthalaldehyde-o-toluidine condensate with maleic anhydride |
129217-90-9 |
R43, N; R51-53 |
|
|
|
616-094-00-7 |
3,3'-dicyclohexyl-1,1'-methylenebis(4,1-phenylene)diurea |
58890-25-8 |
R43, R53 |
|
|
|
616-095-00-2 |
3,3'-dioctadecyl-1,1'-methylenebis(4,1-phenylene)diurea |
43136-14-7 |
R53 |
|
|
|
616-096-00-8 |
N-(3-hexadecyloxy-2-hydroxyprop-1-yl)-N-(2-hydroxyethyl)palmitamide |
110483-07-3 |
R53 |
|
|
|
616-097-00-3 |
N,N'-1,4-phenylenebis(2-((2-methoxy-4-nitrophenyl)azo)-3-oxobutanamide |
83372-55-8 |
R53 |
|
|
|
616-098-00-9 |
1-[4-chloro-3-((2,2,3,3,3-pentafluoropropoxy)methyl)phenyl]-5-phenyl-1H-1,2,4-triazole-3-carboxamide |
119126-15-7 |
N; R51-53 |
|
|
|
616-099-00-4 |
2-[4-[(4-hydroxyphenyl)sulfonyl]phenoxy]-4,4-dimethyl-N-[5-[(methylsulfonyl)amino]-2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]phenyl]-3-oxopentanamide |
135937-20-1 |
R53 |
|
|
|
616-100-00-8 |
1,3-dimethyl-1,3-bis(trimethylsilyl)urea |
10218-17-4 |
Xn; R22, Xi; R38 |
|
|
|
616-101-00-3 |
(S)-N-tert-butyl-1,2,3,4-tetrahydro-3-isoquinolinecarboxamide |
149182-72-9 |
Xn; R22, R52-53 |
|
|
|
616-102-00-9 |
reaction mass of: α-[3-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyl]-ω-[3-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyloxy]-poly-(oxyethylene-co-oxypropylene); 1,2-(or 1,3-)bis[α-(3-mercaptopropanoxycarbonylamino)methylphenyl |
- |
R43, N; R51-53 |
|
|
|
616-103-00-4 |
(S,S)-trans-4-(acetylamino)-5,6-dihydro-6-methyl-7,7-dioxo-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
120298-38-6 |
R43, N; R50-53 |
|
|
|
616-104-00-X |
benalaxyl (ISO); methyl N-(2,6-dimethylphenyl)-N-(phenylacetyl)-DL-alaninate |
71626-11-4 |
N; R50-53 |
|
|
|
616-105-00-5 |
chlorotoluron (ISO); 3-(3-chloro-p-tolyl)-1,1-dimethylurea |
15545-48-9 |
Carc. Cat. 3; R40, Repr. Cat. 3; R63, N; R50-53 |
|
|
|
616-106-00-0 |
phenmedipham (ISO); methyl 3-(3-methylcarbaniloyloxy)carbanilate |
13684-63-4 |
N; R50-53 |
|
|
|
616-107-00-6 |
cinidon ethyl (ISO); ethyl (Z)-2-chloro-3-[2-chloro-5-(cyclohex-1-ene-1,2-dicarboximido)phenyl]acrylate |
142891-20-1 |
Carc. Cat. 3; R40, R43, N; R50-53 |
|
|
|
616-108-00-1 |
iodosulfuron-methyl-sodium; sodium ({}{[5-iodo-2-(methoxycarbonyl)phenyl]sulfonyl}}carbamoyl)(4-methoxy-6-methyl-1,3,5-triazin-2-yl)azanide |
144550-36-7 |
N; R50-53 |
|
|
|
616-109-00-7 |
sulfosulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea |
141776-32-1 |
N; R50-53 |
|
|
|
616-110-00-2 |
cyclanilide (ISO); 1-(2,4-dichloroanilinocarbonyl)cyclopropanecarboxylic acid |
113136-77-9 |
Xn; R22, N; R51-53 |
|
|
|
616-111-00-8 |
fenhexamid (ISO); N-(2,3-dichlor-4-hydroxyphenyl)-1-methylcyclohexancarboxamid |
126833-17-8 |
N; R51-53 |
|
|
|
616-112-00-3 |
oxasulfuron (ISO); oxetan-3-yl 2-[(4,6-dimethylpyrimidin-2-yl)-carbamoylsulfamoyl]benzoate |
144651-06-9 |
Xn; R48/22, N; R50-53 |
|
|
|
616-113-00-9 |
desmedipham (ISO); ethyl 3-phenylcarbamoyloxyphenylcarbamate |
13684-56-5 |
N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
616-114-00-4 |
dodecanamide, N,N'-(9,9',10,10'-tetrahydro-9,9',10,10'-tetraoxo(1,1'-bianthracene)-4,4'-diyl)bis- |
136897-58-0 |
R53 |
|
|
|
616-115-00-X |
N-(3-acetyl-2-hydroxyphenyl)-4-(4-phenylbutoxy)benzamide |
136450-06-1 |
R53 |
|
|
|
616-116-00-5 |
N-(4-dimethylaminopyridinium)-3-methoxy-4-(1-methyl-5-nitroindol-3-ylmethyl)-N-(o-tolylsulfonyl)benzamidate |
143052-96-4 |
R53 |
|
|
|
616-117-00-0 |
N-[2-(3-acetyl-5-nitrothiophen-2-ylazo)-5-diethylaminophenyl]acetamide |
777891-21-1 |
Repr. Cat. 3; R62, R43, N; R50-53 |
|
|
|
616-118-00-6 |
N-(2',6'-dimethylphenyl)-2-piperidinecarboxamide hydrochloride |
65797-42-4 |
Xn; R22, R52-53 |
|
|
|
616-119-00-1 |
2-(1-butyl-3,5-dioxo-2-phenyl-(1,2,4)-triazolidin-4-yl)-4,4-dimethyl-3-oxo-N-(2-methoxy-5-(2-(dodecyl-1-sulfonyl))propionylamino)-phenyl)-pentanamide |
118020-93-2 |
R53 |
|
|
|
616-120-00-7 |
reaction mass of: N-(3-dimethylamino-4-methyl-phenyl)-benzamide; N-(3-dimethylamino-2-methyl-phenyl)-benzamide; N-(3-dimethylamino-3-methyl-phenyl)-benzamide |
- |
Xn; R48/22, N; R51-53 |
|
|
|
616-121-00-2 |
2,4-dihydroxy-N-(2-methoxyphenyl)benzamide |
129205-19-2 |
R43, N; R51-53 |
|
|
|
616-122-00-8 |
methyl neodecanamide |
105726-67-8 |
Xn; R22 |
|
|
|
616-123-00-3 |
N-[3-[[4-(diethylamino)-2-methylphenyl]imino]-6-oxo-1,4-cyclohexadienyl]acetamide |
96141-86-5 |
N; R50-53 |
|
|
|
616-124-00-9 |
lithium bis(trifluoromethylsulfonyl)imide |
90076-65-6 |
T; R24/25, Xn; R48/22, C; R34, R52-53 |
|
|
|
616-125-00-4 |
3-cyano-N-(1,1-dimethylethyl)androsta-3,5-diene-17-β-carboxamide |
151338-11-3 |
N; R50-53 |
|
|
|
616-126-00-X |
1-methyl-4-nitro-3-propyl-1H-pyrazole-5-carboxamide |
139756-01-7 |
Xn; R22-48/22, R52-53 |
|
|
|
616-127-00-5 |
reaction mass of: N,N'-Ethane-1,2-diylbis(decanamide); 12-Hydroxy-N-[2-[1-oxydecyl)amino]ethyl]octadecanamide; N,N'-Ethane-1,2-diylbis(12-hydroxyoctadecanamide) |
- |
R43, N; R51-53 |
|
|
|
616-128-00-0 |
N-(2-(1-allyl-4,5-dicyanoimidazol-2-ylazo)-5-(dipropylamino)phenyl)-acetamide |
123590-00-1 |
R53 |
|
|
|
616-129-00-6 |
N,N'-bis(2,2,6,6-tetramethyl-4-piperidyl)isophthalamide |
42774-15-2 |
Xn; R22, Xi; R36 |
|
|
|
616-130-00-1 |
N-(3-(2-(4,4-dimethyl-2,5-dioxo-imidazolin-1-yl)-4,4-dimethyl-3-oxo-pentanoylamino)-4-methoxy-phenyl)-octadecanamide |
150919-56-5 |
R53 |
|
|
|
616-131-00-7 |
1-aminocyclopentanecarboxamide |
17193-28-1 |
T; R48/25, Xn; R22, Xi; R41 |
|
|
|
616-132-00-2 |
N-[4-(4-cyano-2-furfurylidene-2,5-dihydro-5-oxo-3-furyl)phenyl]butane-1-sulfonamide |
130016-98-7 |
N; R50-53 |
|
|
|
616-133-00-8 |
N-cyclohexyl-S,S-dioxobenzo[b]tiophene-2-carboxamide |
149118-66-1 |
Xn; R22, Xi; R41, N; R50-53 |
|
|
|
616-134-00-3 |
3,3'-bis(dioctyloxyphosphinothioylthio)-N,N'-oxybis(methylene)dipropionamide |
793710-14-2 |
R52-53 |
|
|
|
616-135-00-9 |
(3S,4aS,8aS)-2-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-tert-butyldecahydroisoquinoline-3-carboxamide |
136522-17-3 |
Xn; R22, R52-53 |
|
|
|
616-136-00-4 |
reaction product of cocoalkyldiethanolamides and cocoalkylmonoglycerides and molybdenumtrioxide (1.75-2.2: 0.75-1.0:0.1-1.1) |
- |
N; R51-53 |
|
|
|
616-137-00-X |
4-dichloroacetyl-1-oxa-4-azaspiro[4.5]decane |
71526-07-3 |
R43, N; R51-53 |
|
|
|
616-138-00-5 |
benzoic acid, N-tert-butyl-N'-(4-chlorobenzoyl)hydrazide |
112226-61-6 |
R43, N; R51-53 |
|
|
|
616-139-00-0 |
(3S,4aS,8aS)-N-tert-butyldecahydro-3-isoquinolinecarboxamide |
136465-81-1 |
Xn; R22, Xi; R41, R52-53 |
|
|
|
616-140-00-6 |
N,N''-(methylenedi-4,1-phenylene)bis[N'-(4-methylphenyl)urea] |
133336-92-2 |
R43, R53 |
|
|
|
616-141-00-1 |
zoxamide (ISO); (RS)-3,5-dichloro-N-(3-chloro-1-ethyl-1-methyl-2-oxopropyl)-p-toluamide |
156052-68-5 |
R43, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
616-142-00-7 |
1,3-Bis(vinylsulfonylacetamido)propane |
93629-90-4 |
Muta. Cat. 3; R68, Xi; R41, R43, R52-53 |
|
|
|
616-143-00-2 |
N,N'-dihexadecyl-N,N'-bis(2-hydroxyethyl)propanediamide |
149591-38-8 |
Repr. Cat. 3; R62, Xi; R36, R53 |
|
|
|
616-144-00-8 |
3,4-dichloro-N-[5-chloro-4-[2-[4-dodecyloxyphenylsulfonyl]butyramido]-2-hydroxyphenyl]benzamide |
- |
R53 |
|
|
|
616-145-00-3 |
pethoxamide (ISO); 2-chloro-N-(2-ethoxyethyl)-N-(2-methyl-1-phenylprop-1-enyl)acetamide |
106700-29-2 |
Xn; R22, R43, N; R50-53 |
C ≥ 0, 25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
616-146-00-9 |
N-(2-methoxy-5-octadecanoylaminophenyl)-2-(3-benzyl-2,5-dioxoimidazolidin-1-yl)-4,4-dimethyl-3-oxopentanoic acidamide |
142776-95-2 |
R53 |
|
|
|
616-147-00-4 |
1-methyl-4-(2-methyl-2H-tetrazol-5-yl)-1H-pyrazole-5-sulfonamide |
139481-22-4 |
Xn; R22, R52-53 |
|
|
|
616-148-00-X |
N-[6,9-dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6-oxo-1H-purin-2-yl]acetamide |
84245-12-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Repr. Cat. 2; R60-61 |
|
|
|
616-150-00-0 |
(2R,3S)-N-(3-amino-2-hydroxy-4-phenylbutyl)-N-isobutyl-4-nitrobenzenesulfonamide hydrochloride |
- |
Xn; R48/22, Xi; R41, R43, N; R51-53 |
|
|
|
616-151-00-6 |
N-(2-amino-4,6-dichloropyrimidin-5-yl)formamide |
171887-03-9 |
Xn; R22, Xi; R41, R43, R52-53 |
|
|
|
616-152-00-1 |
4-(4-fluorophenyl)-2-(2-methyl-1-oxopropyl)-4-oxo-3,N-diphenylbutanamide |
125971-96-2 |
R53 |
|
|
|
616-153-00-7 |
4-methyl-3-oxo-N-phenyl-2-(phenylmethylene)pentanamide |
125971-57-5 |
R43, N; R51-53 |
|
|
|
616-154-00-2 |
3,4-dichloro-N-[5-chloro-4-[2-[4-(hexadecyloxy)phenylsulfonyl]butyramido]-2-hydroxyphenyl]benzamide |
- |
R53 |
|
|
|
616-155-00-8 |
N,N,N',N'-tetracyclohexyl-1,3-benzenedicarboxamide |
104560-40-9 |
N; R50-53 |
|
|
|
616-156-00-3 |
6-(2-chloro-6-cyano-4-nitrophenylazo)-4-methoxy-3-[N-(methoxycarbonylmethyl)-N-(1-methoxycarbonylethyl)amino]acetanilide |
204277-61-2 |
R53 |
|
|
|
616-157-00-9 |
3-amino-4-hydroxy-N-(3-isopropoxypropyl)benzenesulfonamide hydrochloride |
114565-70-7 |
Xn; R22, Xi; R41, N; R50-53 |
|
|
|
616-158-00-4 |
N-[4-cyano-3-trifluoromethylphenyl]methacrylamide |
90357-53-2 |
Xn; R48/22, N; R51-53 |
|
|
|
616-160-00-5 |
2,2'-azobis[N-(2-hydroxyethyl)-2-methylpropionamide] |
61551-69-7 |
R43, R52-53 |
|
|
|
616-161-00-0 |
2,4-dichloro-5-hydroxyacetanilide |
67669-19-6 |
R52-53 |
|
|
|
616-162-00-6 |
isostearic acid monoisopropanolamide |
- |
Xi; R38, N; R51-53 |
|
|
|
616-163-00-1 |
4,4'-methylenebis[N-(4-chlorophenyl)-3-hydroxynaphthalene-2-carboxamide] |
192463-88-0 |
R53 |
|
|
|
616-164-00-7 |
dimoxystrobin (ISO); (E)-2-(methoxyimino)-N-methyl-2-[α-(2,5-xylyloxy)-o-tolyl]acetamide |
149961-52-4 |
Carc. Cat. 3; R40, Repr. Cat. 3; R63, Xn; R20, N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
616-165-00-2 |
beflubutamid (ISO); (RS)-N-benzyl-2-(α,α,α,4-tetrafluoro-m-tolyoxy)butyramide |
113614-08-7 |
N; R50-53 |
C ≥ 0,25 %: N; R50-53, 0,025 % ≤ C < 0,25 %: N; R51-53, 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
616-166-00-8 |
cyazofamid (ISO); 4-chloro-2-cyano-N,N-dimethyl-5-p-tolylimidazole-1-sulfonamide |
120116-88-3 |
N; R50-53 |
C ≥ 2,5 %: N; R50-53, 0,25 % ≤ C < 2,5 %: N; R51-53, 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
616-167-00-3 |
N,N-dibutyl-(2,5-dihydro-5-thioxo-1H-tetrazol-1-yl)acetamide |
168612-06-4 |
Xi; R36, R43 |
|
|
|
616-168-00-9 |
1-dimethylcarbamoyl-4-(2-sulfonatoethyl)pyridinium |
136997-71-2 |
R43 |
|
|
|
616-169-00-4 |
4-[4-(2,2-dimethyl-propanamido)]phenylazo-3-(2-chloro-5-(2-(3-pentadecylphenoxy)butylamido)anilino)-1-(2,4,6-trichlorophenyl)-2-pyrazoline-5-one |
92771-56-7 |
R43, R53 |
|
|
|
616-170-00-X |
(2R)-2-amino-2-phenylacetamide |
6485-67-2 |
Xi; R36, R43 |
|
|
|
616-171-00-5 |
2-(para-chlorophenyl)glycineamide |
102333-75-5 |
Xi; R41, R43 |
|
|
|
616-172-00-0 |
N-(2,2,6,6-tetramethyl-1-oxylpiperidin-4-yl)acetamide; (4-acetamido-2,2,6,6-tetramethyl-1-piperidinyl)oxidanyl |
14691-89-5 |
Xn; R22 |
|
|
|
616-174-00-1 |
2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one hydrochloride |
151257-01-1 |
Xn; R22, Xi; R36 |
|
|
|
616-175-00-7 |
2-(2-hexyldecyloxy)benzamide |
202483-62-3 |
R53 |
|
|
|
616-176-00-2 |
3-N,N-bis(methoxyethyl)aminoacetanilide |
24294-01-7 |
Xn; R22, R52-53 |
|
|
|
616-177-00-8 |
(3-(4-(2-(butyl-(4-methylphenylsulfonyl)amino)phenylthio)-5-oxo-1-(2,4,6-trichlorophenyl)-4,5-dihydro-1H-pyrazole-3-ylamino)-4-chlorophenyl)tetradecanamide; N-[3-({4-[(2-{butyl[(4-methylphenyl)sulfonyl]amino}phenyl)thio]-5-oxo-1-(2,4,6-trichlorophenyl)-4 |
217324-98-6 |
R53 |
|
|
|
616-178-00-3 |
N-(5-(bis(2-methoxyethyl)amino)-2-((2-cyano-4,6-dinitrophenyl)-azo)phenyl)acetamide |
52583-35-4 |
R53 |
|
|
|
616-179-00-9 |
2-chloro-N-(4-methylphenyl)acetamide |
16634-82-5 |
Xi; R41, R43, N; R50-53 |
|
|
|
616-180-00-4 |
N,N-(dimethylamino)thioacetamide hydrochloride |
27366-72-9 |
Repr. Cat. 2; R61, N; R50-53 |
|
|
|
616-181-00-X |
4'-methyldodecane-1-sulfonanilide |
17417-32-2 |
N; R50-53 |
|
|
|
616-182-00-5 |
N'-(1,3-dimethylbutylidene)-3-hydroxy-2-naphthohydrazide |
214417-91-1 |
R43, N; R51-53 |
|
|
|
616-183-00-0 |
N-dodecyl-4-methoxybenzamide |
1854-15-5 |
R53 |
|
|
|
616-184-00-6 |
3-methyl-N-(5,8,13,14-tetrahydro-5,8,14-trioxonaphth[2,3-c]acridin-6-yl)benzamide |
105043-55-8 |
R53 |
|
|
|
616-186-00-7 |
N,N'-(2-chloro-1,4-phenylene)bis(3-oxobutaneamide) |
53641-10-4 |
R52-53 |
|
|
|
616-188-00-8 |
2-(5,5-dimethyl-2,4-dioxooxazolidin-3-yl)-4,4-dimethyl-3-oxo-N-(2-methoxy-5-octadecanoylaminophenyl)pentanoic acid amide |
221215-20-9 |
R43, R53 |
|
|
|
616-189-00-3 |
N-[5-(bis-(2-methoxy-ethyl)-amino]-2-(6-bromo-2-methyl-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)-phenyl]acetamide |
452962-97-9 |
R53 |
|
|
|
616-190-00-9 |
N-decyl-4-nitrobenzamide |
64026-19-3 |
R53 |
|
|
|
616-191-00-4 |
2-ethyl-N-methyl-N-(3-methylphenyl)butanamide |
406488-30-0 |
Xn; R22, Xi; R36/38, R43, N; R51-53 |
|
|
|
616-192-00-X |
2-[2-(3-butoxypropyl)-1,1-dioxo-1,2,4-benzothiadiazin-3-yl]-5'-tert-butyl-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2'-[(2-ethylhexyl)thio]acetanilide |
727678-39-9 |
R53 |
|
|
|
616-193-00-5 |
N-[2-(2-butyl-4,6-dicyano-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)-5-diethylamino-phenyl]acetamide |
368450-39-9 |
R53 |
|
|
|
616-194-00-0 |
2,2-diethoxy-N,N-dimethylacetamide |
34640-92-1 |
Xi; R36 |
|
|
|
616-196-00-1 |
disodium salt of 1-hydroxy-4-(β-(4-(1-hydroxy-3,6-disulfo-8-acetylamino-2-naphthylazo)phenoxy)ethoxy)-N-dodecyl-2-naphthamide |
- |
N; R50-53 |
|
|
|
616-197-00-7 |
reaction mass of: potassium N-[3-(dimethyloxidoamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane sulfonamidate; N-[3-(dimethyloxidoamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane sulfonamide |
- |
Xn; R48/22 |
|
|
|
616-198-00-2 |
1,3-bis[12-hydroxy-octadecamide-N-methylene]-benzene |
- |
R43, R53 |
|
|
|
616-200-00-1 |
reaction mass of: N,N'-ethane-1,2-diylbis(hexanamide); 12-hydroxy-N-[2-[(1-oxyhexyl)amino]ethyl]octadecanamide; N,N'-ethane-1,2-diylbis(12-hydroxyoctadecanamide) |
- |
R43, R53 |
|
|
|
616-201-00-7 |
12-hydroxyoctadecanoic acid, reaction products with 1,3-benzenedimethanamine and hexamethylenediamine |
220926-97-6 |
Xn; R20, R53 |
|
|
|
616-202-00-2 |
reaction mass of: 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[N-(2,4-dimethylphenyl)]-3-oxo-butanamide; 2-[[3,3'-dichloro-4'-[[1[[(2,4-dimethylphenyl)amino]carbonyl]-2-oxopropyl]azo][1,1'-biphenyl]-4-yl]azo]-N-(2-methylphenyl)-3-oxo-butana |
- |
Carc. Cat. 3; R40, R43, R53 |
|
|
|
616-203-00-8 |
reaction mass of: N-[5-[bis-(2-methoxyethyl)amino]-2-(2-butyl-4,6-dicyano-1,3-dioxo-2,3-dihydro-1H-isoindol-5-yl-azo)phenyl]acetamide; N-[2-(2-butyl-4,6-dicyano-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)5-diethylaminophenyl]acetamide |
- |
R53 |
|
|
|
616-204-00-3 |
N,N''-(methylenedi-4,1-phenylene)bis[N'-octylurea] |
122886-55-9 |
R53 |
|
|
|
616-213-00-2 |
mandipropamid (ISO); 2-(4-chlorophenyl)-N-{2-[3-methoxy-4-(prop-2-yn-1-yloxy)phenyl]ethyl}-2-(prop-2-yn-1-yloxy) acetamide |
374726-62-2 |
N; R50-53 |
N; R50-53: C >= 25 %, N; R51-53: 2,5 % <= C <25 %, R52-53: 0,25 % <= C < 2,5 % |
|
ATP07 |
616-214-00-8 |
metosulam (ISO); N-(2,6-dichloro-3-methylphenyl)-5,7-dimethoxy[1,2,4]triazolo[1,5-a] pyrimidine-2-sulfonamide |
139528-85-1 |
Carc. Cat. 3; R40, Xn; R48/22, N; R50-53 |
N; R50-53: C >= 0,025 %, N; R51-53: 0,0025 % <= C < 0,025 %, R52/53: 0,00025 % <= C < 0,0025 % |
|
ATP07 |
616-215-00-3 |
dimethenamid-P (ISO); 2-chloro-N-(2,4-dimethyl-3-thienyl)-N-[(2S)-1-methoxypropan-2-yl]acetamide |
163515-14-8 |
Xn; R22, R43, N; R50-53 |
N; R50-53: C >= 2,5 %, N; R51-53: 0,25 % <= C < 2,5 %, R52-53: 0,025 % <= C < 0,25 % |
|
ATP07 |
616-216-00-9 |
flonicamid (ISO); N-(cyanomethyl)-4-(trifluoromethyl)pyridine-3-carboxamide |
158062-67-0 |
Xn; R22 |
|
|
ATP07 |
616-217-00-4 |
sulfoxaflor (ISO); [methyl(oxo) {1-[6-(trifluoromethyl)-3-pyridyl]ethyl}-λ6-sulfanylidene]cyanamide |
946578-00-3 |
Xn; R22, N; R50-53 |
N; R50-53: C >= 25 %, N; R51-53: 2,5 % ≤<= C < 25 %, R52-53: 0,25 % <= C < 2,5 % |
|
ATP07 |
617-001-00-2 |
di-tert-butyl peroxide |
110-05-4 |
O; R7, F; R11 |
|
|
|
617-002-00-8 |
α,α-dimethylbenzyl hydroperoxide; cumene hydroperoxide |
80-15-9 |
O; R7, T; R23, Xn; R21/22-48/20/22, C; R34, N; R51-53 |
C ≥ 10 %: C; R34, 3 % ≤ C < 10 %: Xi; R37/38-41, 1 % ≤ C < 3 %: Xi; R36/37 |
|
|
617-003-00-3 |
dilauroyl peroxide |
105-74-8 |
O; R7 |
|
|
|
617-004-00-9 |
1,2,3,4-tetrahydro-1-naphthyl hydroperoxide |
771-29-9 |
O; R7, Xn; R22, C; R34, N; R50-53 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
617-006-00-X |
bis(α,α-dimethylbenzyl) peroxide |
80-43-3 |
O; R7, Xi; R36/38, N; R51-53 |
|
|
|
617-007-00-5 |
tert-butyl α,α-dimethylbenzyl peroxide |
3457-61-2 |
O; R7, Xi; R38, N; R51-53 |
|
|
|
617-008-00-0 |
dibenzoyl peroxide; benzoyl peroxide |
94-36-0 |
E; R3, O; R7, Xi; R36, R43 |
|
|
|
617-010-00-1 |
1-hydroperoxycyclohexyl 1-hydroxycyclohexyl peroxide; [1] 1,1'-dioxybiscyclohexan-1-ol; [2] cyclohexylidene hydroperoxide; [3] cyclohexanone, peroxide [4] |
78-18-2 [1], 2407-94-5 [2], 2699-11-8 [3], 12262-58-7 [4] |
E; R3, O; R7, C; R34, Xn; R22 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
C |
|
617-010-01-9 |
1-hydroperoxycyclohexyl 1-hydroxycyclohexyl peroxide; [1] 1,1'-dioxybiscyclohexan-1-ol; [2] cyclohexylidene hydroperoxide; [3] cyclohexanone, peroxide; [≤ 91 % solution] |
78-18-2 [1], 2407-94-5 [2], 2699-11-8 [3], 12262-58-7 [4], - |
|
|
|
|
617-012-00-2 |
8-p-menthyl hydroperoxide; p-menthane hydroperoxide |
80-47-7 |
O; R7, C; R34, Xn; R20 |
C ≥ 10 %: C; R34, 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
617-013-00-8 |
O,O-tert-butyl O-docosyl monoperoxyoxalate |
116753-76-5 |
O; R7, N; R50-53 |
|
|
|
617-014-00-3 |
6-(nonylamino)-6-oxo-peroxyhexanoic acid |
104788-63-8 |
O; R7, Xi; R41, R43, N; R50 |
|
|
|
617-015-00-9 |
bis(4-methylbenzoyl)peroxide |
895-85-2 |
E; R2, O; R7, N; R50-53 |
|
|
|
617-016-00-4 |
3-hydroxy-1,1-dimethylbutyl 2-ethyl-2-methylheptaneperoxoate |
- |
O; R7, R10, Xi; R38, N; R50-53 |
|
|
|
617-017-00-X |
reaction mass of: 2,2'-bis(tert-pentylperoxy)-p-diisopropylbenzene; 2,2'-bis(tert-pentylperoxy)-m-diisopropylbenzene |
32144-25-5 |
E; R2, O; R7, R53 |
|
T |
|
617-018-00-5 |
reaction mass of: 1-methyl-1-(3-(1-methylethyl)phenyl)ethyl-1-methyl-1-phenylethylperoxide, 63 % by weight; 1-methyl-1-(4-(1-methylethyl)phenyl)ethyl-1-methyl-1-phenylethylperoxide, 31 % by weight |
71566-50-2 |
O; R7, N; R51-53 |
|
|
|
617-019-00-0 |
6-(phthalimido)peroxyhexanoic acid |
128275-31-0 |
O; R7, Xi; R41, N; R50 |
|
|
|
617-020-00-6 |
1,3-di(prop-2,2-diyl)benzene bis(neodecanoylperoxide) |
117663-11-3 |
R10, O; R7, N; R51-53 |
|
|
|
617-021-00-1 |
methylethylketone peroxide trimer |
- |
E; R2, O; R7, Xn; R65, Xi; R38, R43 |
|
|
|
617-022-00-7 |
reaction mass of: 1,2-dimethylpropylidene dihydroperoxide; dimethyl 1,2-benzenedicarboxylate |
- |
O; R7, Xn; R22, C; R34, R43, N; R51-53 |
|
|
|
647-001-00-8 |
glucosidase, β- |
9001-22-3 |
R42 |
|
|
|
647-002-00-3 |
cellulase |
9012-54-8 |
R42 |
|
|
|
647-003-00-9 |
cellobiohydrolase, exo- |
37329-65-0 |
R42 |
|
|
|
647-004-00-4 |
cellulases with the exception of those specified elsewhere in this Annex |
- |
R42 |
|
A |
|
647-005-00-X |
bromelain, juice |
9001-00-7 |
Xi; R36/37/38, R42 |
|
|
|
647-006-00-5 |
ficin |
9001-33-6 |
Xi; R36/37/38, R42 |
|
|
|
647-007-00-0 |
papain |
9001-73-4 |
Xi; R36/37/38, R42 |
|
|
|
647-008-00-6 |
pepsin A |
9001-75-6 |
Xi; R36/37/38, R42 |
|
|
|
647-009-00-1 |
rennin |
9001-98-3 |
Xi; R36/37/38, R42 |
|
|
|
647-010-00-7 |
trypsin |
9002-07-7 |
Xi; R36/37/38, R42 |
|
|
|
647-011-00-2 |
chymotrypsin |
9004-07-3 |
Xi; R36/37/38, R42 |
|
|
|
647-012-00-8 |
subtilisin |
9014-01-1 |
Xi; R37/38-41, R42 |
|
|
|
647-013-00-3 |
proteinase, microbial neutral |
9068-59-1 |
Xi; R36/37/38, R42 |
|
|
|
647-014-00-9 |
proteases with the exception of those specified elsewhere in this Annex |
- |
Xi; R36/37/38, R42 |
|
|
|
647-015-00-4 |
amylase, α- |
9000-90-2 |
R42 |
|
|
|
647-016-00-X |
amylases with the exception of those specified elsewhere in this Annex |
- |
R42 |
|
|
|
647-017-00-5 |
laccase |
80498-15-3 |
R42 |
|
|
|
648-001-00-0 |
Distillates (coal tar), benzole fraction; Light Oil; [A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists of hydrocarbons having carbon numbers primarily in the range of C4 to C10 and distilling in the approximate |
84650-02-2 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
648-002-00-6 |
Tar oils, brown-coal; Light Oil; [The distillate from lignite tar boiling in the range of approximately 80°C to 250°C (176°F to 482°F). Composed primarily of aliphatic and aromatic hydrocarbons and monobasic phenols.] |
94114-40-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-003-00-1 |
Benzol forerunnings (coal); Light Oil Redistillate, low boiling; [The distillate from coke oven light oil having an approximate distillation range below 100°C (212°F). Composed primarily of C4 to C6 aliphatic hydrocarbons.] |
65996-88-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-004-00-7 |
Distillates (coal tar), benzole fraction, BTX-rich; Light Oil Redistillate, low boiling; [A residue from the distillation of crude benzole to remove benzole fronts. Composed primarily of benzene, toluene and xylenes boiling in the range of approximatel |
101896-26-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-005-00-2 |
Aromatic hydrocarbons, C6-10, C8-rich; Light Oil Redistillate, low boiling |
90989-41-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-006-00-8 |
Solvent naphtha (coal), light; Light Oil Redistillate, low boiling |
85536-17-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-007-00-3 |
Solvent naphtha (coal), xylene-styrene cut; Light Oil Redistillate, intermediate boiling |
85536-20-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-008-00-9 |
Solvent naphtha (coal), coumarone-styrene contg.; Light Oil Redistillate, intermediate boiling |
85536-19-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-009-00-4 |
Naphtha (coal), distn. residues; Light Oil Redistillate, high boiling; [The residue remaining from the distillation of recovered naphtha. Composed primarily of naphthalene and condensation products of indene and styrene.] |
90641-12-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-010-00-X |
Aromatic hydrocarbons, C8; Light Oil Redistillate, high boiling |
90989-38-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-012-00-0 |
Aromatic hydrocarbons, C8-9, hydrocarbon resin polymn. by-product; Light Oil Redistillate, high boiling; [A complex combination of hydrocarbons obtained from the evaporation of solvent under vacuum from polymerized hydrocarbon resin. It consists predom |
91995-20-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-013-00-6 |
Aromatic hydrocarbons, C9-12, benzene distn.; Light Oil Redistillate, high boiling |
92062-36-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-014-00-1 |
Extract residues (coal), benzole fraction alk., acid ext.; Light Oil Extract Residues, low boiling; [The redistillate from the distillate, freed of tar acids and tar bases, from bituminous coal high temperature tar boiling in the approximate range of 90 |
91995-61-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-015-00-7 |
Extract residues (coal tar), benzole fraction alk., acid ext.; Light Oil Extract Residues, low boiling; [A complex combination of hydrocarbons obtained by the redistillation of the distillate of high temperature coal tar (tar acid and tar base free). I |
101316-63-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-016-00-2 |
Extract residues (coal), benzole fraction acid; Light Oil Extract Residues, low boiling; [An acid sludge by-product of the sulfuric acid refining of crude high temperature coal. Composed primarily of sulfuric acid and organic compounds.] |
93821-38-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-017-00-8 |
Extract residues (coal), light oil alk., distn. overheads; Light Oil Extract Residues, low boiling; [The first fraction from the distillation of aromatic hydrocarbons, coumarone, naphthalene and indene rich prefractionator bottoms or washed carbolic oil |
90641-02-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-018-00-3 |
Extract residues (coal), light oil alk., acid ext., indene fraction; Light Oil Extract Residues, intermediate boiling |
101316-62-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-019-00-9 |
Extract residues (coal), light oil alk., indene naphtha fraction; Light Oil Extract Residues, high boiling; [The distillate from aromatic hydrocarbons, coumarone, naphthalene and indene rich prefractionator bottoms or washed carbolic oils, having an app |
90641-03-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-020-00-4 |
Solvent naphtha (coal); Light Oil Extract Residues, high boiling; [The distillate from either high temperature coal tar, coke oven light oil, or coal tar oil alkaline extract residue having an approximate distillation range of 130°C to 210°C (266°F to 4 |
65996-79-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-021-00-X |
Distillates (coal tar), light oils, neutral fraction; Light Oil Extract Residues, high boiling; [A distillate from the fractional distillation of high temperature coal tar. Composed primarily of alkyl-substituted one ring aromatic hydrocarbons boiling in |
101794-90-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-022-00-5 |
Distillates (coal tar), light oils, acid exts.; Light Oil Extract Residues, high boiling; [This oil is a complex reaction mass of aromatic hydrocarbons, primarily indene, naphthalene, coumarone, phenol, and o-, m- and p-cresol and boiling in the range of |
90640-87-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-023-00-0 |
Distillates (coal tar), light oils; Carbolic Oil; [A complex combination of hydrocarbons obtained by distillation of coal tar. It consists of aromatic and other hydrocarbons, phenolic compounds and aromatic nitrogen compounds and distills at the approxim |
84650-03-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-024-00-6 |
Tar oils, coal; Carbolic Oil; [The distillate from high temperature coal tar having an approximate distillation range of 130°C to 250°C (266°F to 410°F). Composed primarily of naphthalene, alkylnaphthalenes, phenolic compounds, and aromatic nitrogen bas |
65996-82-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-026-00-7 |
Extract residues (coal), light oil alk., acid ext.; Carbolic Oil Extract Residue; [The oil resulting from the acid washing of alkali-washed carbolic oil to remove the minor amounts of basic compounds (tar bases). Composed primarily of indene, indan and |
90641-01-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-027-00-2 |
Extract residues (coal), tar oil alk.; Carbolic Oil Extract Residue; [The residue obtained from coal tar oil by an alkaline wash such as aqueous sodium hydroxide after the removal of crude coal tar acids. Composed primarily of naphthalenes and aromatic |
65996-87-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-028-00-8 |
Extract oils (coal), light oil; Acid Extract; [The aqueous extract produced by an acidic wash of alkali-washed carbolic oil. Composed primarily of acid salts of various aromatic nitrogen bases including pyridine, quinoline and their alkyl derivatives.] |
90640-99-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-029-00-3 |
Pyridine, alkyl derivs.; Crude Tar Bases; [The complex combination of polyalkylated pyridines derived from coal tar distillation or as high-boiling distillates approximately above 150°C (302°F) from the reaction of ammonia with acetaldehyde, formaldehyd |
68391-11-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-030-00-9 |
Tar bases, coal, picoline fraction; Distillate Bases; [Pyridine bases boiling in the range of approximately 125°C to 160°C (257°F 320°F) obtained by distillation of neutralized acid extract of the base-containing tar fraction obtained by the distillatio |
92062-33-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-031-00-4 |
Tar bases, coal, lutidine fraction; Distillate Bases |
91082-52-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-032-00-X |
Extract oils (coal), tar base, collidine fraction; Distillate Bases; [The extract produced by the acidic extraction of bases from crude coal tar aromatic oils, neutralization, and distillation of the bases. Composed primarily of collidines, aniline, tol |
68937-63-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-033-00-5 |
Tar bases, coal, collidine fraction; Distillate Bases; [The distillation fraction boiling in the range of approximately 181 °C to 186 °C (356 °F to 367 °F) from the crude bases obtained from the neutralized, acid-extracted base-containing tar fractions |
92062-28-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-034-00-0 |
Tar bases, coal, aniline fraction; Distillate Bases; [The distillation fraction boiling in the range of approximately 180 °C to 200 °C (356 °F to 392 °F) from the crude bases obtained by dephenolating and debasing the carbolated oil from the distillatio |
92062-27-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-035-00-6 |
Tar bases, coal, toluidine fraction; Distillate Bases |
91082-53-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-036-00-1 |
Distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, mixed with high-temp. coal tar, indene fraction; Redistillates; [A complex combination of hydrocarbons obtained as a redistillate from the fractional distillation of bituminous coal high tempe |
91995-31-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-037-00-7 |
Distillates (coal), coal tar-residual pyrolysis oils, naphthalene oils; Redistillates; [The redistillate obtained from the fractional distillation of bituminous coal high temperature tar and pyrolysis residual oils and boiling in the range of approximat |
91995-35-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-038-00-2 |
Extract oils (coal), coal tar-residual pyrolysis oils, naphthalene oil, redistillate; Redistillates; [The redistillate from the fractional distillation of dephenolated and debased methylnaphthalene oil obtained from bituminous coal high temperature tar |
91995-66-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-039-00-8 |
Extract oils (coal), coal tar-residual pyrolysis oils, naphthalene oils; Redistillates; [A neutral oil obtained by debasing and dephenolating the oil obtained from the distillation of high temperature tar and pyrolysis residual oils which has a boiliing |
122070-79-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-040-00-3 |
Extract oils (coal), coal tar residual pyrolysis oils, naphthalene oil, distn. residues; Redistillates; [Residue from the distillation of dephenolated and debased methylnaphthalene oil (from bituminous coal tar and pyrolysis residual oils) with a boilin |
122070-80-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-041-00-9 |
Absorption oils, bicyclo arom. and heterocyclic hydrocarbon fraction; Wash Oil Redistillate; [A complex combination of hydrocarbons obtained as a redistillate from the distillation of wash oil. It consists predominantly of 2-ringed aromatic and heterocy |
101316-45-4 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-042-00-4 |
Distillates (coal tar), upper, fluorene-rich; Wash Oil Redistillate; [A complex combination of hydrocarbons obtained by the crystallization of tar oil. It consists af aromatic and polycyclic hydrocarbons primarily fluorene and some acenaphthene.] |
84989-11-7 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-043-00-X |
Creosote oil, acenaphthene fraction, acenaphthene-free; Wash Oil Redistillate; [The oil remaining after removal by a crystallization process of acenaphthene from acenaphthene oil from coal tar. Composed primarily of naphthalene and alkylnaphthalenes.] |
90640-85-0 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-044-00-5 |
Distillates (coal tar), heavy oils; Heavy Anthracene Oil; [Distillate from the fractional distillation of coal tar of bituminous coal, with boiling range of 240 °C to 400 °C (464 °F to 752 °F). Composed primarily of tri- and polynuclear hydrocarbons and |
90640-86-1 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
648-045-00-0 |
Distillates (coal tar), upper; Heavy Anthracene Oil; [The distillate from coal tar having an approximate distillation range of 220 °C to 450 °C (428 °F to 842 °F). Composed primarily of three to four membered condensed ring aromatic hydrocarbons and oth |
65996-91-0 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-046-00-6 |
Anthracene oil, acid ext.; Anthracene Oil Extract Residue; [A complex combination of hydrocarbons from the base-freed fraction obtained from the distillation of coal tar and boiling in the range of approximately 325 °C to 365 °C (617 °F to 689 °F). It c |
91995-14-1 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-047-00-1 |
Distillates (coal tar); Heavy Anthracene Oil; [The distillate from coal tar having an approximate distillation range of 100 °C to 450 °C (212 °F to 842 °F). Composed primarily of two to four membered condensed ring aromatic hydrocarbons, phenolic compou |
65996-92-1 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-048-00-7 |
Distillates (coal tar), pitch, heavy oils; Heavy Anthracene Oil; [The distillate from the distillation of the pitch obtained from bituminous high temperature tar. Composed primarily of tri- and polynuclear aromatic hydrocarbons and boiling in the range |
91995-51-6 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-049-00-2 |
Distillates (coal tar), pitch; Heavy Anthracene Oil; [The oil obtained from condensation of the vapors from the heat treatment of pitch. Composed primarily of two- to four-ring aromatic compounds boiling in the range of 200 °C to greater than 400 °C (39 |
101316-49-8 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-050-00-8 |
Distillates (coal tar), heavy oils, pyrene fraction; Heavy Anthracene Oil Redistillate; [The redistillate obtained from the fractional distillation of pitch distillate boiling in the range of approximately 350 °C to 400 °C (662 °F to 752 °F). Consists p |
91995-42-5 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-051-00-3 |
Distillates (coal tar), pitch, pyrene fraction; Heavy Anthracene Oil Redistillate; [The redistillate obtained from the fractional distillation of pitch distillate and boiling in the range of approximately 380 °C to 410 °C (7160 to 770 °F). Composed prim |
91995-52-7 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-052-00-9 |
Paraffin waxes (coal), brown-coal high-temp. tar, carbon-treated; Coal Tar Extract; [A complet combination of hydrocarbons obtained by the treatment of lignite carbonization tar with activated carbon for removal of trace constituents and impurities. It |
97926-76-6 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-053-00-4 |
Paraffin waxes (coal), brown-coal high-temp tar, clay-treated; Coal Tar Extract; [A complex combination of hydrocarbons obtained by the treatment of lignite carbonization tar with bentonite for removal of trace constituents and impurities. It consists p |
97926-77-7 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-054-00-X |
Pitch; Pitch |
61789-60-4 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-055-00-5 |
pitch, coal tar, high-temp.,; [The residue from the distillation of high temperature coal tar. A black solid with an approximate softening point from 30 °C to 180 °C (86 °F to 356 °F). Composed primarily of a complex mixture of three or more membered cond |
65996-93-2 |
Carc. 1A, Muta. 1B, Repr. 1B |
|
|
CLP00/ATP14 |
648-056-00-0 |
Pitch, coal tar, high-temp., heat-treated; Pitch; [The heat treated residue from the distillation of high temperature coal tar. A black solid with an approximate softening point from 80 °C to 180 °C (176 °F to 356 °F). Composed primarily of a complex mi |
121575-60-8 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-057-00-6 |
Pitch, coal tar, high-temp., secondary; Pitch Redistillate; [The residue obtained during the distillation of high boiling fractions from bituminous coal high temperature tar and/or pitch coke oil, with a softening point of 140 °C to 170 °C (284 °F to 39 |
94114-13-3 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-058-00-1 |
Residues (coal tar), pitch distn.; Pitch Redistillate; [Residue from the fractional distillation of pitch distillate boiling in the range of approximately 400 °C to 470 °C (752 °F to 846 °F). Composed primarily of polynuclear aromatic hydrocarbons, and |
92061-94-4 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-059-00-7 |
Tar, coal, high-temp., distn. and storage residues; Coal Tar Solids Residue; [Coke- and ash-containing solid residues that separate on distillation and thermal treatment of bituminous coal high temperature tar in distillation installations and storage v |
92062-20-9 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-060-00-2 |
Tar, coal, storage residues; Coal Tar Solids Residue; [The deposit removed from crude coal tar storages. Composed primarily of coal tar and carbonaceous particulate matter.] |
91082-50-7 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-061-00-8 |
Tar, coal, high-temp., residues; Coal Tar Solids Residue; [Solids formed during the coking of bituminous coal to produce crude bituminous coal high temperature tar. Composed primarily of coke and coal particles, highly aromatized compounds and mineral s |
100684-51-3 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-062-00-3 |
Tar, coal, high-temp., high-solids; Coal Tar Solids Residue; [The condensation product obtained by cooling, to approximately ambient temperature, the gas evolved in the high temperature (greater than 700 °C (1292 °F)) destructive distillation of coal. C |
68990-61-4 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-063-00-9 |
Waste solids, coal-tar pitch coking; Coal Tar Solids Residue; [The combination of wastes formed by the coking of bituminous coal tar pitch. It consists predominantly of carbon.] |
92062-34-5 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-064-00-4 |
Extract residues (coal), brown; Coal Tar Extract; [The residue from extraction of dried coal.] |
91697-23-3 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-065-00-X |
Paraffin waxes (coal), brown-coal-high-temp. tar; Coal Tar Extract; [A complex combination of hydrocarbons obtained from lignite carbonization tar by solvent crystallisation (solvent deoiling), by sweating or an adducting process. It consists predominan |
92045-71-1 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-066-00-5 |
Paraffin waxes (coal), brown-coal-high-temp. tar, hydrotreated; Coal Tar Extract; [A complex combination of hydrocarbons obtained from lignite carbonization tar by solvent crystallisation (solvent deoiling), by sweating or an adducting process treated w |
92045-72-2 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-067-00-0 |
Paraffin waxes (coal), brown-coal high-temp tar, silicic acid-treated; Coal Tar Extract; [A complex combination of hydrocarbons obtained by the treatment of lignite carbonization tar with silicic acid for removal of trace constituents and impurities. It |
97926-78-8 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-068-00-6 |
Tar, coal, low-temp., distn. residues; Tar Oil, intermediate boiling; [Residues from fractional distillation of low temperature coal tar to remove oils that boil in a range up to approximately 300 °C (572 °F). Composed primarily of aromatic compounds.] |
101316-85-2 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-069-00-1 |
Pitch, coal tar, low-temp; Pitch Residue; [A complex black solid or semi-solid obtained from the distillation of a low temperature coal tar. It has a softening point within the approximate range of 40 °C to 180 °C (104 °F to 356 °F). Composed primarily |
90669-57-1 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-070-00-7 |
Pitch, coal tar, low-temp., oxidized; Pitch Residue, oxidised; [The product obtained by air-blowing, at elevated temperature, low-temperature coal tar pitch. It has a softening-point within the approximate range of 70 °C to 180 °C (158 °F to 356 °F). Co |
90669-59-3 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-071-00-2 |
Pitch, coal tar, low-temp., heat-treated; Pitch Residue, oxidised; Pitch Residue, heat-treated; [A complex black solid obtained by the heat treatment of low temperature coal tar pitch. It has a softening point within the approximate range of 50 °C to 1 |
90669-58-2 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-072-00-8 |
Distillates (coal-petroleum), condensed-ring arom; Distillates; [The distillate from a mixture of coal and tar and aromatic petroleum streams having an approximate distillation range of 220 °C to 450 °C (428 °F to 842 °F). Composed primarily of 3- to 4- |
68188-48-7 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-073-00-3 |
Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene-polypropylene pyrolysis-derived; Pyrolysis Products; [A complex combination hydrocarbons obtained from mixed coal tar pitch-polyethylene-polypropylene pyrolysis. Composed prima |
101794-74-5 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-074-00-9 |
Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene pyrolysis-derived; Pyrolysis Products; [A complex combination of hydrocarbons obtained from mixed coal tar pitch-polyethylene pyrolysis. Composed primarily of polycyclic aromat |
101794-75-6 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-075-00-4 |
Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polystyrene pyrolysis-derived; Pyrolysis Products; [A complex combination of hydrocarbons obtained from mixed coal tar pitch-polystyrene pyrolysis. Composed primarily of polycyclic aromatic |
101794-76-7 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-076-00-X |
Pitch, coal tar-petroleum; Pitch Residues; [The residue from the distillation of a mixture of coal tar and aromatic petroleum streams. A solid with a softening point from 40 °C to 180 °C (140 °F to 356 °F). Composed primarily of a complex combination of |
68187-57-5 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-077-00-5 |
Phenanthrene, distn. residues; Heavy Anthracene Oil Redistillate; [Residue from the distillation of crude phenanthrene boiling in the approximate range of 340 °C to 420 °C (644 °F to 788 °F). It consists predominantly of phenanthrene, anthracene and car |
122070-78-4 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-078-00-0 |
Distillates (coal tar), upper, fluorene-free; Wash Oil Redistillate; [A complex combination of hydrocarbons obtained by the crystallization of tar oil. It consists of aromatic polycyclic hydrocarbons, primarily diphenyl, dibenzofuran and acenaphthene.] |
84989-10-6 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-079-00-6 |
Anthracene oil; Anthracene oil; [A complex combination of polycyclic aromatic hydrocarbons obtained from coal tar having an approximate distillation range of 300 °C ot 400 °C (572 °F to 752 °F). Composed primarily of phenanthrene, anthracene and carbazo |
90640-80-5 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-080-00-1 |
Residues (coal tar), creosote oil distn.; Wash Oil Redistillate; [The residue from the fractional distillation of wash oil boiling in the approximate range of 270°C to 330°C (518°F to 626°F). It consists predominantly of dinuclear aromatic and heterocyc |
92061-93-3 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-081-00-7 |
Tar, coal; Coal tar; [The by-product from the destructive distillation of coal. Almost black semisolid. A complex combination of aromatic hydro-carbons, phenolic compounds, nitrogen bases and thiophene.] |
8007-45-2 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
648-082-00-2 |
Tar, coal, high-temp.; Coal tar; [The condensation product obtained by cooling, to approximately ambient temperature, the gas evolved in the high temperature (greater than 700 °C (1292 °F)) destructive distillation of coal. A black viscous liquid denser |
65996-89-6 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
648-083-00-8 |
Tar, coal, low-temp.; Coal oil; [The condensation product obtained by cooling, to approximately ambient temperature, the gas evolved in low temperature (less than 700 °C (1292 °F)) destructive distillation of coal. A black viscous liquid denser than wat |
65996-90-9 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
648-084-00-3 |
Distillates (coal), coke-oven light oil, naphthalene cut; Naphthalene Oil; [The complex combination of hydrocarbons obtained from prefractionation (continuous distillation) of coke oven light oil. It consists predominantly of naphthalene, coumarone and |
85029-51-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-085-00-9 |
Distillates (coal tar), naphthalene oils; Naphthalene Oil; [A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists primarily of aromatic and other hydrocarbons, phenolic compounds and aromatic nitrogen compounds and |
84650-04-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-086-00-4 |
Distillates (coal tar), naphthalene oils, naphthalene-low; Naphthalene Oil Redistillate; [A complex combination of hydrocarbons obtained by crystallization of naphthalene oil. Composed primarily of naphthalene, alkyl naphthalenes and phenolic compounds |
84989-09-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-087-00-X |
Distillates (coal tar), naphthalene oil crystn. mother liquor; Naphthalene Oil Redistillate; [A complex combination of organic compounds obtained as a filtrate from the crystallization of the naphthalene fraction from coal tar and boiling in the range o |
91995-49-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-088-00-5 |
Extract residues (coal), naphthalene oil, alk.; Naphthalene Oil Extract Residue; [A complex combination of hydrocarbons obtained from the alkali washing of naphthalene oil to remove phenolic compounds (tar acids). It is composed of naphthalene and alky |
121620-47-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-089-00-0 |
Extract residues (coal), naphthalene oil, alk., naphthalene-low; Naphthalene Oil Extract Residue; [A complex combination of hydrocarbons remaining after the removal of naphthalene from alkali-washed naphthalene oil by a crystallization process. It is c |
121620-48-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-090-00-6 |
Distillates (coal tar), naphthalene oils, naphthalene-free, alk. exts.; Naphthalene Oil Extract Residue; [The oil remaining after the removal of phenolic compounds (tar acids) from drained naphthalene oil by an alkali wash. Composed primarily of naphth |
90640-90-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-091-00-1 |
Extract residues (coal), naphthalene oil alk., distn. overheads; Naphthalene Oil Extract Residue; [The distillate from alkali-washed naphthalene oil having an approximate distillation range of 180°C to 220°C (356°F to 428°F). Composed primarily of naph |
90641-04-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-092-00-7 |
Distillates (coal tar), naphthalene oils, methylnaphthalene fraction; Methylnaphthalene Oil; [A distillate from the fractional distillation of high temperature coal tar. Composed primarily of substituted two ring aromatic hydrocarbons and aromatic nitr |
101896-27-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-093-00-2 |
Distillates (coal tar), naphthalene oils, indole-methylnaphthalene fraction; Methylnaphthalene Oil; [A distillate from the fractional distillation of high temperature coal tar. Composed primarily of indole and methylnaphthalene boiling in the range of |
101794-91-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-094-00-8 |
Distillates (coal tar), naphthalene oils, acid exts.; Methylnaphthalene Oil Extract Residue; [A complex combination of hydrocarbons obtained by debasing the methylnaphthalene fraction obtained by the distillation of coal tar and boiling in the range of |
91995-48-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-095-00-3 |
Extract residues (coal), naphthalene oil alk., distn. residues; Methylnaphthalene Oil Extract Residue; [The residue from the distillation of alkali-washed naphthalene oil having an approximate distillation range of 220°C to 300°C (428°F to 572°F). Comp |
90641-05-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-096-00-9 |
Extract oils (coal), acidic, tar-base free; Methylnaphthalene Oil Extract Residue; [The extract oil boiling in the range of approximately 220°C to 265°C (428°F to 509°F) from coal tar alkaline extract residue produced by an acidic wash such as aqueous s |
84989-12-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-097-00-4 |
Distillates (coal tar), benzole fraction, distn. residues; Wash Oil; [A complex combination of hydrocarbons obtained from the distillation of crude benzole (high temperature coal tar). It may be a liquid with the approximate distillation range of 150°C |
121620-46-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-098-00-X |
Creosote oil, acenaphthene fraction; Wash Oil; [A complex combination of hydrocarbons produced by the distillation of coal tar and boiling in the range of approximately 240°C to 280°C (464°F to 536°F). Composed primarily of acenaphthene, naphthalene and |
90640-84-9 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-099-00-5 |
Creosote oil; [A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists primarily of aromatic hydrocarbons and may contain appreciable quantities of tar acids and tar bases. It distills at the approximate range of 200°C |
61789-28-4 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-100-00-9 |
Creosote oil, high-boiling distillate; Wash Oil; [The high-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal which is further refined to remove excess crystalline salts. It consists primarily of creosote o |
70321-79-8 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-101-00-4 |
Creosote; [The distillate of coal tar produced by the high temperature carbonization of bituminous coal. It consists primarily of aromatic hydrocarbons, tar acids and tar bases.] |
8001-58-9 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
648-102-00-X |
Extract residues (coal), creosote oil acid; Wash Oil Extract Residue; [A complex combination of hydrocarbons from the base-freed fraction from the distillation of coal tar, boiling in the range of approximately 250°C to 280°C (482°F to 536°F). It consis |
122384-77-4 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-103-00-5 |
Anthracene oil, anthracene paste; Anthracene Oil Fraction; [The anthracene-rich solid obtained by the crystallization and centrifuging of anthracene oil. It is composed primarily of anthracene, carbazole and phenanthrene.] |
90640-81-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-104-00-0 |
Anthracene oil, anthracene-low; Anthracene Oil Fraction; [The oil remaining after the removal, by a crystallization process, of an anthracene-rich solid (anthracene paste) from anthracene oil. It is composed primarily of two, three and four membered ar |
90640-82-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-105-00-6 |
Residues (coal tar), anthracene oil distn.; Anthracene Oil Fraction; [The residue from the fraction distillation of crude anthracene boiling in the approximate range of 340°C to 400°C (644°F to 752°F). It consists predominantly of tri- and polynuclear |
92061-92-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-106-00-1 |
Anthracene oil, anthracene paste, anthracene fraction; Anthracene Oil Fraction; [A complex combination of hydrocarbons from the distillation of anthracene obtained by the crystallization of anthracene oil from bituminous high temperature tar and boiling |
91995-15-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-107-00-7 |
Anthracene oil, anthracene paste, carbazole fraction; Anthracene Oil Fraction; [A complex combination of hydrocarbons from the distillation of anthracene obtained by crystallization of anthracene oil from bituminous coal high temperature tar and boiling |
91995-16-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-108-00-2 |
Anthracene oil, anthracene paste, distn. lights; Anthracene Oil Fraction; [A complex combination of hydrocarbons from the distillation of anthracene obtained by crystallization of anthracene oil from bituminous high temperature tar and boiling in the ra |
91995-17-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-109-00-8 |
Tar oils, coal, low-temp.; Tar Oil, high boiling; [A distillate from low-temperature coal tar. Composed primarily of hydrocarbons, phenolic compounds and aromatic nitrogen bases boiling in the range of approximately 160°C to 340°C (320°F to 644°F).] |
101316-87-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-110-00-3 |
Extract residues (coal), low temp. coal atar alk.; [The residue from low temperature coal tar oils after an alkaline wash, such as aqueous sodium hydroxide, to remove crude coal tar acids. Composed primarily of hydrocarbons and aromatic nitrogen bases.] |
122384-78-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-111-00-9 |
Phenols, ammonia liquor ext.; Alkaline Extract; [The combination of phenols extracted, using isobutyl acetate, from the ammonia liquor condensed from the gas evolved in low-temperature (less than 700°C (1292°F)) destructive distillation of coal. It con |
84988-93-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-112-00-4 |
Distillates (coal tar), light oils, alk. exts.; Alkaline Extract; [The aqueous extract from carbolic oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] |
90640-88-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-113-00-X |
Extracts, coal tar oil alk.; Alkaline Extract; [The extract from coal tar oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] |
65996-83-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-114-00-5 |
Distillates (coal tar), naphthalene oils, alk. exts.; Alkaline Extract; [The aqueous extract from naphthalene oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] |
90640-89-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-115-00-0 |
Extract residues (coal), tar oil alk., carbonated, limed; Crude Phenols; [The product obtained by treatment of coal tar oil alkaline extract with CO2 and CaO. Composed primarily of CaCO3, Ca(OH)2, Na2CO3 and other organic and inorganic impurities.] |
90641-06-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-116-00-6 |
Tar acids, coal, crude; Crude Phenols; [The reaction product obtained by neutralizing coal tar oil alkaline extract with an acidic solution, such as aqueous sulfuric acid, or gaseous carbon dioxide, to obtain the free acids. Composed primarily of tar a |
65996-85-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-117-00-1 |
Tar acids, brown-coal, crude; Crude Phenols; [An acidified alkaline extract of brown coal tar distillate. Composed primarily of phenol and phenol homologs.] |
101316-86-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-118-00-7 |
Tar acids, brown-coal gasification; Crude Phenols; [A complex combination of organic compounds obtained from brown coal gasification. Composed primarily of C6-10 hydroxy aromatic phenols and their homologs.] |
92062-22-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-119-00-2 |
Tar acids, distn. residues; Distillate Phenols; [A residue from the distillation of crude phenol from coal. It consists predominantly of phenols having carbon numbers in the range of C8 through C10 with a softening point of 60°C to 80°C (140°F to 176°F |
96690-55-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-120-00-8 |
Tar acids, methylphenol fraction; Distillate Phenols; [The fraction of tar acid rich in 3- and 4-methylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] |
84989-04-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-121-00-3 |
Tar acids, polyalkylphenol fraction; Distillate Phenols; [The fraction of tar acids, recovered by distillation of low-temperature coal tar crude tar acids, having an approximate boiling range of 225°C to 320°C (437°F to 608°F). Composed primarily of po |
84989-05-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-122-00-9 |
Tar acids, xylenol fraction; Distillate Phenols; [The fraction of tar acids, rich in 2,4- and 2,5-dimethylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] |
84989-06-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-123-00-4 |
Tar acids, ethylphenol fraction; Distillate Phenols; [The fraction of tar acids, rich in 3- and 4-ethylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] |
84989-03-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-124-00-X |
Tar acids, 3,5-xylenol fraction; Distillate Phenols; [The fraction of tar acids, rich in 3,5-dimethylphenol, recovered by distillation of low-temperature coal tar acids.] |
84989-07-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-125-00-5 |
Tar acids, residues, distillates, first-cut; Distillate Phenols; [The residue from the distillation in the range of 235°C to 355°C (481°F to 697°F) of light carbolic oil.] |
68477-23-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-126-00-0 |
Tar acids, cresylic, residues; Distillate Phenols; [The residue from crude coal tar acids after removal of phenol, cresols, xylenols and any higher boiling phenols. A black solid with a melting point approximately 80°C (176°F). Composed primarily of po |
68555-24-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-127-00-6 |
Phenols, C9-11; Distillate Phenols |
91079-47-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-128-00-1 |
Tar acids, cresylic; Distillate Phenols; [A complex combination of organic compounds obtained from brown coal and boiling in the range of approximately 200°C to 230°C (392°F to 446°F). It contains chiefly phenols and pyridine bases.] |
92062-26-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-129-00-7 |
Tar acids, brown-coal, C2-alkylphenol fraction; Distillate Phenols; [The distillate from the acidification of alkaline washed lignite tar distillate boiling in the range of approximately 200°C to 230°C (392°F to 446°F). Composed primarily of m- and p-e |
94114-29-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-130-00-2 |
Extract oils (coal), naphthalene oils; Acid Extract; [The aqueous extract produced by an acidic wash of alkali-washed naphthalene oil. Composed primarily of acid salts of various aromatic nitrogen bases including pyridine, quinoline and their alkyl der |
90641-00-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-131-00-8 |
Tar bases, quinoline derivs.; Distillate Bases |
68513-87-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-132-00-3 |
Tar bases, coal, quinoline derivs. fraction; Distillate Bases |
70321-67-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-133-00-9 |
Tar bases, coal, distn. residues; Distillate Bases; [The distillation residue remaining after the distillation of the neutralized, acid-extracted base-containing tar fractions obtained by the distillation of coal tars. It contains chiefly aniline, coll |
92062-29-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-134-00-4 |
Hydrocarbon oils, arom., mixed with polyethylene and polypropylene, pyrolyzed, light oil fraction; Heat Treatment Products; [The oil obtained from the heat treatment of a polyethylene/polypropylene reaction mass with coal tar pitch or aromatic oils. It |
100801-63-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-135-00-X |
Hydrocarbon oils, arom., mixed with polyethylene, pyrolyzed, light oil fraction; Heat Treatment Products; [The oil obtained from the heat treatment of polyethylene with coal tar pitch or aromatic oils. It consists predominantly of benzene and its homol |
100801-65-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-136-00-5 |
Hydrocarbon oils, arom., mixed with polystyrene, pyrolyzed, light oil fraction; Heat Treatment Products; [The oil obtained from the heat treatment of polystyrene with coal tar pitch or aromatic oils. It consists predominantly of benzene and its homolog |
100801-66-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-137-00-0 |
Extract residues (coal), tar oil alk., naphthalene distn. residues; Naphthalene Oil Extract Residue; [The residue obtained from chemical oil extracted after the removal of naphthalene by distillation composed primarily of two to four membered condensed |
73665-18-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-138-00-6 |
Creosote oil, low-boiling distillate; Wash Oil; [The low-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal, which is further refined to remove excess crystalline salts. It consists primarily of creosote oi |
70321-80-1 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-139-00-1 |
Tar acids, cresylic, sodium salts, caustic solns.; Alkaline Extract |
68815-21-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-140-00-7 |
Extract oils (coal), tar base; Acid Extract; [The extract from coal tar oil alkaline extract residue produced by an acidic wash such as aqueous sulfuric acid after distillation to remove naphthalene. Composed primarily of the acid salts of various arom |
65996-86-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-141-00-2 |
Tar bases, coal, crude; Crude Tar Bases; [The reaction product obtained by neutralizing coal tar base extract oil with an alkaline solution, such as aqueous sodium hydroxide, to obtain the free bases. Composed primarily of such organic bases as acridine |
65996-84-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J M |
CLP00/ATP02 |
648-142-00-8 |
Residues (coal), liq. solvent extn.; [A cohesive powder composed of coal mineral matter and undissolved coal remaining after extraction of coal by a liquid solvent.] |
94114-46-2 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-143-00-3 |
Coal liquids, liq. solvent extn. soln.; [The product obtained by filtration of coal mineral matter and undissolved coal from coal extract solution produced by digesting coal in a liquid solvent. A black, viscous, highly complex liquid combination compose |
94114-47-3 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-144-00-9 |
Coal liquids, liq. solvent extn.; [The substantially solvent-free product obtained by the distillation of the solvent from filtered coal extract solution produced by digesting coal in a liquid solvent. A black semi-solid, composed primarily of a complex |
94114-48-4 |
Carc. Cat. 2; R45 |
|
M |
CLP00/ATP02 |
648-145-00-4 |
Tar brown-coal; [An oil distilled from brown-coal tar. Composed primarily of aliphatic, naphthenic and one- to three-ring aromatic hydrocarbons, their alkyl derivates, heteroaromatics and one- and two-ring phenols boiling in the range of approximately 15 |
101316-83-0 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
648-146-00-X |
Tar, brown-coal, low-temp.; [A tar obtained from low temperature carbonization and low temperature gasification of brown coal. Composed primarily of aliphatic, naphthenic and cyclic aromatic hydrocarbons, heteroaromatic hydrocarbons and cyclic phenols.] |
101316-84-1 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
648-147-00-5 |
Light oil (coal), coke-oven; Crude benzole; [The volatile organic liquid extracted from the gas evolved in the high temperature (greater than 700°C (1292°F)) destructive distillation of coal. Composed primarily of benzene, toluene, and xylenes. May co |
65996-78-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-148-00-0 |
Distillates (coal), liq. solvent extn., primary; [The liquid product of condensation of vapors emitted during the digestion of coal in a liquid solvent and boiling in the range of approximately 30°C to 300°C (86°F to 572°F). Composed primarily of partly |
94114-52-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-149-00-6 |
Distillates (coal), solvent extn., hydrocracked; [Distillate obtained by hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 30°C to 300°C |
94114-53-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-150-00-1 |
Naphtha (coal), solvent extn., hydrocracked; [Fraction of the distillate obtained by hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 3 |
94114-54-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-151-00-7 |
Gasoline, coal solvent extn., hydrocracked naphtha; [Motor fuel produced by the reforming of the refined naphtha fraction of the products of hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extracti |
94114-55-3 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
648-152-00-2 |
Distillates (coal), solvent extn., hydrocracked middle; [Distillate obtained from the hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately |
94114-56-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-153-00-8 |
Distillates (coal), solvent extn., hydrocracked hydrogenated middle; [Distillate from the hydrogenation of hydrocracked middle distillate from coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes an |
94114-57-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
648-154-00-3 |
Fuels, jet aircraft, coal solvent extn., hydrocracked hydrogenated; [Jet engine fuel produced by hydrogenation of the middle distillate fraction of the products of hydrocracking of coal extract or solution produced by the liquid solvent extraction or sup |
94114-58-6 |
Carc. Cat. 3; R40 |
|
|
CLP00/ATP02 |
648-155-00-9 |
Fuels, diesel, coal solvent extn., hydrocracked hydrogenated; [Diesel engine fuel produced by the hydrogenation of the middle distillate fraction of the products of hydrocracking of coal extract or solution produced by the liquid solvent extraction or su |
94114-59-7 |
Carc. Cat. 3; R40 |
|
|
CLP00/ATP02 |
648-156-00-4 |
Light oil (coal), semi-coking process; Fresh oil; [The volatile organic liquid condensed from the gas evolved in the low-temperature (less than 700°C (1292°F)) destructive distillation of coal. Composed primarily of C6-10 hydrocarbons.] |
90641-11-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46 |
|
J |
CLP00/ATP02 |
649-001-00-3 |
Extracts (petroleum), light naphthenic distillate solvent |
64742-03-6 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-002-00-9 |
Extracts (petroleum), heavy paraffinic distillate solvent |
64742-04-7 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-003-00-4 |
Extracts (petroleum), light paraffinic distillate solvent |
64742-05-8 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-004-00-X |
Extracts (petroleum), heavy naphthenic distillate solvent |
64742-11-6 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-005-00-5 |
Extracts (petroleum), light vacuum gas oil solvent |
91995-78-7 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-006-00-0 |
hydrocarbons C26-55, arom-rich |
97722-04-8 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-007-00-6 |
fatty acids, tall-oil, reaction products with iminodiethanol and boric acid |
- |
Xi; R38, N; R51-53 |
|
|
|
649-008-00-1 |
Residues (petroleum), atm. tower; Heavy Fuel oil; [A complex residuum from the atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 °C (662 °F). This |
64741-45-3 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-009-00-7 |
Gas oils (petroleum), heavy vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in |
64741-57-7 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-010-00-2 |
Distillates (petroleum), heavy catalytic cracked; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the r |
64741-61-3 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-011-00-8 |
Clarified oils (petroleum), catalytic cracked; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from distillation of the products from a catalytic cracking process. It consists of hydrocarbons having carbon number |
64741-62-4 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-012-00-3 |
Residues (petroleum), hydrocracked; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from distillation of the products of a hydrocracking process. It consists of hydrocarbons having carbon numbers predominantly gr |
64741-75-9 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-013-00-9 |
Residues (petroleum), thermal cracked; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from distillation of the product from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons havin |
64741-80-6 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-014-00-4 |
Distillates (petroleum), heavy thermal cracked; Heavy Fuel oil; [A complex combination of hydrocarbons from the distillation of the products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers pre |
64741-81-7 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-015-00-X |
Gas oils (petroleum), hydrotreated vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in t |
64742-59-2 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-016-00-5 |
Residues (petroleum), hydrodesulfurized atmospheric tower; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating an atmospheric tower residuum with hydrogen in the presence of a catalyst under conditions primarily to remove organic |
64742-78-5 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-017-00-0 |
Gas oils (petroleum), hydrodesulfurized heavy vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 thro |
64742-86-5 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-018-00-6 |
Residues (petroleum), steam-cracked; Heavy Fuel oil; [A complex combination of hydrocarbons obtained as the residual fraction from the distillation of the products of a steam cracking process (including steam cracking to produce ethylene). It consists p |
64742-90-1 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-019-00-1 |
Residues (petroleum), atmospheric; Heavy Fuel oil; [A complex residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly greater than C11 and boiling above approximately 200 °C (392 °F). This str |
68333-22-2 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-020-00-7 |
Clarified oils (petroleum), hydrodesulfurized catalytic cracked; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating catalytic cracked clarified oil with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It |
68333-26-6 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-021-00-2 |
Distillates (petroleum), hydrodesulfurized intermediate catalytic cracked; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating intermediate catalytic cracked distillates with hydrogen to convert organic sulfur to hydrogen sulfide |
68333-27-7 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-022-00-8 |
Distillates (petroleum), hydrodesulfurized heavy catalytic cracked; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treatment of heavy catalytic cracked distillates with hydrogen to convert organic sulfur to hydrogen sulfide which is |
68333-28-8 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-023-00-3 |
Fuel oil, residues-straight-run gas oils, high-sulfur; Heavy Fuel oil |
68476-32-4 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-024-00-9 |
Fuel oil, residual; Heavy Fuel oil; [The liquid product from various refinery streams, usually residues. The composition is complex and varies with the source of the crude oil.] |
68476-33-5 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-025-00-4 |
Residues (petroleum), catalytic reformer fractionator residue distn.; Heavy Fuel oil; [A complex residuum from the distillation of catalytic reformer fractionator residue. It boils approximately above 399 °C (750 °F).] |
68478-13-7 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-026-00-X |
Residues (petroleum), heavy coker gas oil and vacuum gas oil; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from the distillation of heavy coker gas oil and vacuum gas oil. It predominantly consists of hydrocar |
68478-17-1 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-027-00-5 |
Residues (petroleum), heavy coker and light vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from the distillation of heavy coker gas oil and light vacuum gas oil. It consists predominantly of hydrocarbons |
68512-61-8 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-028-00-0 |
Residues (petroleum), light vacuum; Heavy Fuel oil; [A complex residuum from the vacuum distillation of the residuum from the atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly greater than C13 and boi |
68512-62-9 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-029-00-6 |
Residues (petroleum), steam-cracked light; Heavy Fuel oil; [A complex residuum from the distillation of the products from a steam-cracking process. It consists predominantly of aromatic and unsaturated hydrocarbons having carbon numbers greater than C7 |
68513-69-9 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-030-00-1 |
Fuel oil, No 6; Heavy Fuel oil; [A distillate oil having a minimum viscosity of 900 SUS at 37.7 °C (100 °F) to a maximum of 9000 SUS at 37.7 °C (100 °F).] |
68553-00-4 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-031-00-7 |
Residues (petroleum), topping plant, low-sulfur; Heavy Fuel oil; [A low-sulfur complex combination of hydrocarbons produced as the residual fraction from the topping plant distillation of crude oil. It is the residuum after the straight-run gasoline cut |
68607-30-7 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-032-00-2 |
Gas oils (petroleum), heavy atmospheric; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C7 through C35 and boiling in the |
68783-08-4 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-033-00-8 |
Residues (petroleum), coker scrubber, Condensed-ring-arom.-contg.; Heavy Fuel oil; [A very complex combination of hydrocarbons produced as the residual fraction from the distillation of vaccum residuum and the products from a thermal cracking process. I |
68783-13-1 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-034-00-3 |
Distillates (petroleum), petroleum residues vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from the atmospheric distillation of crude oil.] |
68955-27-1 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-035-00-9 |
Residues (petroleum), steam-cracked, resinous; Heavy Fuel oil; [A complex residuum from the distillation of steam-cracked petroleum residues.] |
68955-36-2 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-036-00-4 |
Distillates (petroleum), intermediate vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the vacuum, distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predo |
70592-76-6 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-037-00-X |
Distillates (petroleum), light vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly |
70592-77-7 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-038-00-5 |
Distillates (petroleum), vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having numbers predominantly in the range |
70592-78-8 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-039-00-0 |
Gas oils (petroleum), hydrodesulfurized coker heavy vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by hydrodesulfurization of heavy coker distillate stocks, It consists predominantly of hydrocarbons having carbon numbers predomi |
85117-03-9 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-040-00-6 |
Residues (petroleum), steam-cracked, distillates; Heavy Fuel oil; [A complex combination of hydrocarbons obtained during the production of refined petroleum tar by the distillation of steam cracked tar. It consists predominantly of aromatic and other hy |
90669-75-3 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-041-00-1 |
Residues (petroleum), vacuum, light; Heavy Fuel oil; [A complex residuum from the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than |
90669-76-4 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-042-00-7 |
Fuel oil, heavy, high-sulfur; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by the distillation of crude petroleum. It consists predominantly of aliphatic, aromatic and cycloaliphatic hydrocarbons having carbon numbers predominantly hi |
92045-14-2 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-043-00-2 |
Residues (petroleum), catalytic cracking; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from the distillation of the products from a catalytic cracking process. It consists predominantly of hydrocarbons having |
92061-97-7 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-044-00-8 |
Distillates (petroleum), intermediate catalytic cracked, thermally degraded; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process which has been used as a heat transfer fluid. |
92201-59-7 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-045-00-3 |
Residual oils (petroleum); Heavy Fuel oil; [A complex combination of hydrocarbons, sulfur compounds and metal-containing organic compounds obtained as the residue from refinery fractionation cracking processes. It produces a finished oil with a viscosit |
93821-66-0 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-046-00-9 |
Residues, steam cracked, thermally treated; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by the treatment and distillation of raw steam-cracked naphtha. It consists predominantly of unsaturated hydrocarbons boiling in the range above |
98219-64-8 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-047-00-4 |
Distillates (petroleum), hydrodesulfurized full-range middle; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating a petroleum stock with hydrogen. It consists predominantly of hydrocarbons having carbon numbers predominantly in t |
101316-57-8 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-048-00-X |
Residues (petroleum), catalytic reformer fractionator; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from distillation of the product from a catalytic reforming process. It consists of predominantly aromatic hy |
64741-67-9 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-049-00-5 |
Petroleum; Crude oil; [A complex combination of hydrocarbons, It consists predominantly of aliphatic, alicyclic and aromatic hydrocarbons. It may also contain small amounts of nitrogen, oxygen and sulfur compounds. This category encompasses light, mediu |
8002-05-9 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-050-00-0 |
Distillates (petroleum), light paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon |
64741-50-0 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
649-051-00-6 |
Distillates (petroleum), heavy paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon |
64741-51-1 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
649-052-00-1 |
Distillates (petroleum), light naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon |
64741-52-2 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
649-053-00-7 |
Distillates (petroleum), heavy naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon |
64741-53-3 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
649-054-00-2 |
Distillates (petroleum), acid-treated heavy naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predomin |
64742-18-3 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
649-055-00-8 |
Distillates (petroleum), acid-treated light naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predomin |
64742-19-4 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
649-056-00-3 |
Distillates (petroleum), acid-treated heavy paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid process. It consists predominantly of saturated hydrocarbons having carbon n |
64742-20-7 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
649-057-00-9 |
Distillates (petroleum), acid-treated light paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists predominantly of saturated hydrocarbons having |
64742-21-8 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
649-058-00-4 |
Distillates (petroleum), chemically neutralized heavy paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons obtained from a treating process to remove acidic materials. It consists predominantly of hydrocarbons having c |
64742-27-4 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
649-059-00-X |
Distillates (petroleum), chemically neutralized light paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers pr |
64742-28-5 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
649-060-00-5 |
Distillates (petroleum), chemically neutralized heavy naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers pr |
64742-34-3 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
649-061-00-0 |
Distillates (petroleum), chemically neutralized light naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers pr |
64742-35-4 |
Carc. Cat. 1; R45 |
|
|
CLP00/ATP02 |
649-062-00-6 |
Gases (petroleum), catalytic cracked naphtha depropanizer overhead, C3-rich acid-free; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked hydrocarbons and treated to remove acidic impurities. It consis |
68477-73-6 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-063-00-1 |
Gases (petroleum), catalytic cracker; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of the products from a catalytic cracking process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predomi |
68477-74-7 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-064-00-7 |
Gases (petroleum), catalytic cracker, C1-5-rich; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of aliphatic hydrocarbons having carbon numbers in the range o |
68477-75-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-065-00-2 |
Gases (petroleum), catalytic polymd. naphtha stabilizer overhead, C2-4-rich; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation stabilization of catalytic polymerized naphtha. It consists of aliphatic hydrocarbons havi |
68477-76-9 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-066-00-8 |
Gases (petroleum), catalytic reformer, C1-4-rich; Petroleum gas; [A complex combination of hydrocarbons produced by distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers in the range of C1 through |
68477-79-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-067-00-3 |
Gases (petroleum), C3-5 olefinic-paraffinic alkylation feed; Petroleum gas; [A complex combination of olefinic and paraffinic hydrocarbons having carbon numbers in the range of C3 through C5 which are used as alkylation feed. Ambient temperatures normal |
68477-83-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-068-00-9 |
Gases (petroleum), C4-rich; Petroleum gas; [A complex combination of hydrocarbons produced by distillation of products from a catalytic fractionation process. It consists of aliphatic hydrocarbons having carbon numbers in the range of C3 through C5, pre |
68477-85-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-069-00-4 |
Gases (petroleum), deethanizer overheads; Petroleum gas; [A complex combination of hydrocarbons produced from distillation of the gas and gasoline fractions from the catalytic cracking process. It contains predominantly ethane and ethylene.] |
68477-86-1 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-070-00-X |
Gases (petroleum), deisobutanizer tower overheads; Petroleum gas; [A complex combination of hydrocarbons produced by the atmospheric distillation of a butane-butylene stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in t |
68477-87-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-071-00-5 |
Gases (petroleum), depropanizer dry, propene-rich; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from the gas and gasoline fractions of a catalytic cracking process. It consists predominantly of propylene |
68477-90-7 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-072-00-0 |
Gases (petroleum), depropanizer overheads; Petroleum gas; [A complex combination of hydrocarbons produced by distillation of products from the gas and gasoline fractions of a catalytic cracking process. It consists of aliphatic hydrocarbons having carbo |
68477-91-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-073-00-6 |
Gases (petroleum), gas recovery plant depropanizer overheads; Petroleum gas; [A complex combination of hydrocarbons obtained by fractionation of miscellaneous hydrocarbon streams. It consists predominantly of hydrocarbons having carbon numbers in the ra |
68477-94-1 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-074-00-1 |
Gases (petroleum), Girbotol unit feed; Petroleum gas; [A complex combination of hydrocarbons that is used as the feed into the Girbatol unit to remove hydrogen sulfide. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the ran |
68477-95-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-075-00-7 |
Gases (petroleum), isomerized naphtha fractionator, C4-rich, hydrogen sulfide-free; Petroleum gas |
68477-99-6 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-076-00-2 |
Tail gas (petroleum), catalytic cracked clarified oil and thermal cracked vacuum residue fractionation reflux drum; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked clarified oil and thermal cracked |
68478-21-7 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-077-00-8 |
Tail gas (petroleum), catalytic cracked naphtha stabilization absorber; Petroleum gas; [A complex combination of hydrocarbons obtained from the stabilization of catalytic cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers p |
68478-22-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-078-00-3 |
Tail gas (petroleum), catalytic cracker, catalytic reformer and hydrodesulfurizer combined fractionater; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation of products from catalytic cracking, catalytic reforming and h |
68478-24-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-079-00-9 |
Tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation stabilization of catalytic reformed naphtha. It consists predominantly of hydrocarbons havin |
68478-26-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-080-00-4 |
Tail gas (petroleum), saturate gas plant mixed stream, C4-rich; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation stabilization of straight-run naphtha, distillation tail gas and catalytic reformed naphtha stabilizer |
68478-32-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-081-00-X |
Tail gas (petroleum), saturate gas recovery plant, C1-2-rich; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of distillate tail gas, straight-run naphtha, catalytic reformed naphtha stabilizer tail gas. It consists pre |
68478-33-1 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-082-00-5 |
Tail gas (petroleum), vacuum residues thermal cracker; Petroleum gas; [A complex combination of hydrocarbons obtained from the thermal cracking of vacuum residues. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 throug |
68478-34-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-083-00-0 |
Hydrocarbons, C3-4-rich, petroleum distillate; Petroleum gas; [A complex combination of hydrocarbons produced by distillation and condensation of crude oil. It consists of hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C |
68512-91-4 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-084-00-6 |
Gases (petroleum), full-range straight-run naphtha dehexanizer off; petroleum gas; [A complex combination of hydrocarbons obtained by the fractionation of the full-range straight-run naphtha. It consists of hydrocarbons having carbon numbers predominant |
68513-15-5 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-085-00-1 |
Gases (petroleum), hydrocracking depropanizer off, hydrocarbon-rich; Petroleum gas; [A complex combination of hydrocarbon produced by the distillation of products from a hydrocracking process. It consists predominantly of hydrocarbons having carbon numb |
68513-16-6 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-086-00-7 |
Gases (petroleum), light straight-run naphtha stabilizer off; Petroleum gas; [A complex combination of hydrocarbons obtained by the stabilization of light straight-run naphtha. It consists of saturated aliphatic hydrocarbons having carbon numbers predom |
68513-17-7 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-087-00-2 |
Residues (petroleum), alkylation splitter, C4-rich; Petroleum gas; [A complex residuum from the distillation of streams various refinery operations. It consists of hydrocarbons having carbon numbers in the range of C4 through C5, predominantly butane an |
68513-66-6 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-088-00-8 |
Hydrocarbons, C1-4; Petroleum gas; [A complex combination of hydrocarbons provided by thermal cracking and absorber operations and by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C |
68514-31-8 |
F+; R12, Carc. Cat 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-089-00-3 |
Hydrocarbons, C1-4, sweetened; Petroleum gas; [A complex combination of hydrocarbons obtained by subjecting hydrocarbon gases to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers |
68514-36-3 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-090-00-9 |
Hydrocarbons, C1-3; Petroleum gas; [A complex combination of hydrocarbons having carbon numbers predominantly in the range of C1 through C3 and boiling in the range of approximately minus 164°C to minus 42°C (-263°F to -44°F).] |
68527-16-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-091-00-4 |
Hydrocarbons, C1-4, debutanizer fraction; Petroleum gas |
68527-19-5 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-092-00-X |
Gases (petroleum), C1-5, wet; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of crude oil and/or the cracking of tower gas oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 throug |
68602-83-5 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-093-00-5 |
Hydrocarbons, C2-4; Petroleum gas |
68606-25-7 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-094-00-0 |
Hydrocarbons, C3; Petroleum gas |
68606-26-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-095-00-6 |
Gases (petroleum), alkylation feed; Petroleum gas; [A complex combination of hydrocarbons produced by the catalytic cracking of gas oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] |
68606-27-9 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-096-00-1 |
Gases (petroleum), depropanizer bottoms fractionation off; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation of depropanizer bottoms. It consists predominantly of butane, isobutane and butadiene.] |
68606-34-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-097-00-7 |
Gases (petroleum), refinery blend; Petroleum gas; [A complex combination obtained from various processes. It consists of hydrogen, hydrogen sulfide and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
68783-07-3 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-098-00-2 |
Gases (petroleum), catalytic cracking; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of the products from a catalytic cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in |
68783-64-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-099-00-8 |
Gases (petroleum), C2-4, sweetened; Petroleum gas; [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of saturated |
68783-65-3 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-100-00-1 |
Gases (petroleum), crude oil fractionation off; Petroleum gas; [A complex combination of hydrocarbons produced by the fractionation of crude oil. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 thro |
68918-99-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-101-00-7 |
Gases (petroleum), dehexanizer off; Petroleum gas; [A complex combination of hydrocarbons obtained by the fractionation of combined naphtha streams. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 t |
68919-00-6 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-102-00-2 |
Gases (petroleum), light straight run gasoline fractionation stabilizer off; Petroleum gas; [A complex combination of hydrocarbons obtained by the fractionation of light straight-run gasoline. It consists of saturated aliphatic hydrocarbons having carbo |
68919-05-1 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-103-00-8 |
Gases (petroleum), naphtha unifiner desulfurization stripper off; Petroleum gas; [A complex combination of hydrocarbons produced by a naphtha unifiner desulfurization process and stripped from the naphtha product. It consists of saturated aliphatic hydr |
68919-06-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-104-00-3 |
Gases (petroleum), straight-run naphtha catalytic reforming off; Petroleum gas; [A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha and fractionation of the total effluent. It consists of methane, ethane, a |
68919-09-5 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-105-00-9 |
Gases (petroleum), fluidized catalytic cracker splitter overheads; Petroleum gas; [A complex combination of hydrocarbons produced by the fractionation of the charge to the C3 -C4 splitter. It consists predominantly of C3 hydrocarbons.] |
68919-20-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-106-00-4 |
Gases (petroleum), straight-run stabilizer off; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation of the liquid from the first tower used in the distillation of crude oil. It consists of saturated aliphatic hydrocarbo |
68919-10-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-107-00-X |
Gases (petroleum), catalytic cracked naphtha debutanizer; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked naphtha. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 |
68952-76-1 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-108-00-5 |
Tail gas (petroleum), catalytic cracked distillate and naphtha stabilizer; Petroleum gas; [A complex combination of hydrocarbons obtained by the fractionation of catalytic cracked naphtha and distillate. It consists predominantly of hydrocarbons having |
68952-77-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-109-00-0 |
Tail gas (petroleum), thermal-cracked distillate, gas oil and naphtha absorber; petroleum gas; [A complex combination of hydrocarbons obtained from the separation of thermal-cracked distillates, naphtha and gas oil. It consists pedrominantly of hydrocar |
68952-81-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-110-00-6 |
Tail gas (petroleum), thermal cracked hydrocarbon fractionation stabilizer, petroleum coking; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation stabilization of thermal cracked hydrocarbons from petroleum coking proce |
68952-82-9 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-111-00-1 |
Gases (petroleum, light steam-cracked, butadiene conc.; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from a thermal cracking process. It consists of hydrocarbons having a carbon number predominantly of C |
68955-28-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-112-00-7 |
Gases (petroleum), straight-run naphtha catalytic reformer stabilizer overhead; Petroleum gas; [A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha and the fractionation of the total effluent. It consists of |
68955-34-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-113-00-2 |
Hydrocarbons, C4; Petroleum gas |
87741-01-3 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-114-00-8 |
Alkanes, C1-4, C3-rich; Petroleum gas |
90622-55-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-115-00-3 |
Gases (petroleum), steam-cracker C3-rich; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from a steam cracking process. It consists predominantly of propylene with some propane and boils in the range of ap |
92045-22-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-116-00-9 |
Hydrocarbons, C4, steam-cracker distillate; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of the products of a steam cracking process. It consists predominantly of hydrocarbons having a carbon number of C4, predomina |
92045-23-3 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-117-00-4 |
Petroleum gases, liquefied, sweetened, C4 fraction; Petroleum gas; [A complex combination of hydrocarbons obtained by subjecting a liquified petroleum gas mix to a sweetening process to oxidize mercaptans or to remove acidic impurities. It consists pred |
92045-80-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K S |
CLP00/ATP02 |
649-118-00-X |
Hydrocarbons, C4, 1,3-butadiene- and isobutene-free; Petroleum gas |
95465-89-7 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-119-00-5 |
Raffinates (petroleum), steam-cracked C4 fraction cuprous ammonium acetate extn., C3-5 and C3-5 unsatd., butadiene-free; Petroleum gas |
97722-19-5 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-120-00-0 |
Gases (petroleum), amine system feed; Refinery gas; [The feed gas to the amine system for removal of hydrogen sulfide. It consists of hydrogen. Carbon monoxide, carbon dioxide, hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominan |
68477-65-6 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-121-00-6 |
Gases (petroleum), benzene unit hydrodesulfurizer off; Refinery gas; [Off gases produced by the benzene unit. It consists primarily of hydrogen. Carbon monoxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6, includin |
68477-66-7 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-122-00-1 |
Gases (petroleum), benzene unit recycle, hydrogen-rich; Refinery gas; [A complex combination of hydrocarbons obtained by recycling the gases of the benzene unit. It consists primarily of hydrogen with various small amounts of carbon monoxide and hydroca |
68477-67-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-123-00-7 |
Gases (petroleum), blend oil, hydrogen-nitrogen-rich; Refinery gas; [A complex combination of hydrocarbons obtained by distillation of a blend oil. It consists primarily of hydrogen and nitrogen with various small amounts of carbon monoxide, carbon diox |
68477-68-9 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-124-00-2 |
Gases (petroleum), catalytic reformed naphtha stripper overheads; Refinery gas; [A complex combination of hydrocarbons obtained from stabilization of catalytic reformed naphtha. Its consists of hydrogen and saturated hydrocarbons having carbon numbers p |
68477-77-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-125-00-8 |
Gases (petroleum), C6-8 catalytic reformer recycle; Refinery gas; [A complex combination of hydrocarbons produced by distillation of products from catalytic reforming of C6-C8 feed and recycled to conserve hydrogen. It consists primarily of hydrogen. It |
68477-80-5 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-126-00-3 |
Gases (petroleum), C6-8 catalytic reformer; Refinery gas; [A complex combination of hydrocarbons produced by distillation of products from catalytic reforming of C6-C8feed. It consists of hydrocarbons having carbon numbers in the range of C1 through C5 |
68477-81-6 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-127-00-9 |
Gases (petroleum), C6-8 catalytic reformer recycle, hydrogen-rich; Refinery gas |
68477-82-7 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-128-00-4 |
Gases (petroleum), C2-return stream; Refinery gas; [A complex combination of hydrocarbons obtained by the extraction of hydrogen from a gas stream which consists primarily of hydrogen with small amounts of nitrogen, carbon monoxide, methane, ethane, and |
68477-84-9 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-129-00-X |
Gases (petroleum), dry sour, gas-concn.-unit-off; Refinery gas; [The complex combination of dry gases from a gas concentration unit. It consists of hydrogen, hydrogen sulfide and hydrocarbons having carbon numbers predominantly in the range of C1 throug |
68477-92-9 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-130-00-5 |
Gases (petroleum), gas concn. reabsorber distn.; Refinery gas; [A complex combination of hydrocarbons produced by distillation of products from combined gas streams in a gas concentration reabsorber. It consists predominantly of hydrogen, carbon monoxid |
68477-93-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-131-00-0 |
Gases (petroleum), hydrogen absorber off; Refinery gas; [A complex combination obtained by absorbing hydrogen from a hydrogen rich stream. It consists of hydrogen, carbon monoxide, nitrogen, and methane with small amounts of C2 hydrocarbons.] |
68477-96-3 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-132-00-6 |
Gases (petroleum), hydrogen-rich; Refinery gas; [A complex combination separated as a gas from hydrocarbon gases by chilling. It consists primarily of hydrogen with various small amounts of carbon monoxide, nitrogen, methane, and C2 hydrocarbons.] |
68477-97-4 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-133-00-1 |
Gases (petroleum), hydrotreater blend oil recycle, hydrogen-nitrogen-rich; Refinery gas; [A complex combination obtained from recycled hydrotreated blend oil. It consists primarily of hydrogen and nitrogen with various small amounts of carbon monoxide, |
68477-98-5 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-134-00-7 |
Gases (petroleum), recycle, hydrogen-rich; Refinery gas; [A complex combination obtained from recycled reactor gases. It consists primarily of hydrogen with various small amounts of carbon monoxide, carbon dioxide, nitrogen, hydrogen sulfide, and satura |
68478-00-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-135-00-2 |
Gases (petroleum), reformer make-up, hydrogen-rich; Refinery gas; [A complex combination obtained from the reformers. It consists primarily of hydrogen with various small amounts of carbon monoxide and aliphatic hydrocarbons having carbon numbers predom |
68478-01-3 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-136-00-8 |
Gases (petroleum), reforming hydrotreater; Refinery gas; [A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen, methane, and ethane with various small amounts of hydrogen sulfide and aliphatic hydroc |
68478-02-4 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-137-00-3 |
Gases (petroleum), reforming hydrotreater, hydrogen-methane-rich; Refinery gas; [A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen and methane with various small amounts of carbon monoxide, carbon |
68478-03-5 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-138-00-9 |
Gases (petroleum), reforming hydrotreater make-up, hydrogen-rich; Refinery gas; [A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen with various small amounts of carbon monoxide and aliphatic hydro |
68478-04-6 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-139-00-4 |
Gases (petroleum), thermal cracking distn.; Refinery gas; [A complex combination produced by distillation of products from a thermal cracking process. It consists of hydrogen, hydrogen sulfide, carbon monoxide, carbon dioxide and hydrocarbons having car |
68478-05-7 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-140-00-X |
Tail gas (petroleum), catalytic cracker refractionation absorber; Refinery gas; [A complex combination of hydrocarbons obtained from refractionation of products from a catalytic cracking process. It consists of hydrogen and hydrocarbons having carbon nu |
68478-25-1 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-141-00-5 |
Tail gas (petroleum), catalytic reformed naphtha separator; Refinery gas; [A complex combination of hydrocarbons obtained from the catalytic reforming of straight run naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly |
68478-27-3 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-142-00-0 |
Tail gas (petroleum), catalytic reformed naphtha stabilizer; Refinery gas; [A complex combination of hydrocarbons obtained from the stabilization of catalytic reformed naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly |
68478-28-4 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-143-00-6 |
Tail gas (petroleum), cracked distillate hydrotreater separator; Refinery gas; [A complex combination of hydrocarbons obtained by treating cracked distillates with hydrogen in the presence of a catalyst. It consists of hydrogen and saturated aliphatic h |
68478-29-5 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-144-00-1 |
Tail gas (petroleum), hydrodesulfurized straight-run naphtha separator; Refinery gas; [A complex combination of hydrocarbons obtained from hydrodesulfurization of straight-run naphtha. It consists of hydrogen and saturated aliphatic hydrocarbons having |
68478-30-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-145-00-7 |
Gases (petroleum), catalytic reformed straight-run naphtha stabilizer overheads; Refinery gas; [A complex combination of hydrocarbons obtained from the catalytic reforming of straight-run naphtha followed by fractionation of the total effluent. It consi |
68513-14-4 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-146-00-2 |
Gases (petroleum), reformer effluent high-pressure flash drum off; Refinery gas; [A complex combination produced by the high-pressure flashing of the effluent from the reforming reactor. It consists primarily of hydrogen with various small amounts of me |
68513-18-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-147-00-8 |
Gases (petroleum), reformer effluent low-pressure flash drum off; Refinery gas; [A complex combination produced by low-pressure flashing of the effluent from the reforming reactor. It consists primarily of hydrogen with various small amounts of methane, |
68513-19-9 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-148-00-3 |
Gases (petroleum), oil refinery gas distn. off; Refinery gas; [A complex combination separated by distillation of a gas stream containing hydrogen, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers in the range of C1 through C6 or o |
68527-15-1 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-149-00-9 |
Gases (petroleum), benzene unit hydrotreater depentanizer overheads; Refinery gas; [A complex combination produced by treating the feed from the benzene unit with hydrogen in the presence of a catalyst followed by depentanizing. It consists primarily of |
68602-82-4 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-150-00-4 |
Gases (petroleum), secondary absorber off, fluidized catalytic cracker overheads fractionator; Refinery gas; [A complex combination produced by the fractionation of the overhead products from the catalytic cracking process in the fluidized catalytic cra |
68602-84-6 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-151-00-X |
Petroleum products, refinery gases; Refinery gas; [A complex combination which consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] |
68607-11-4 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-152-00-5 |
Gases (petroleum), hydrocracking low-pressure separator; Refinery gas; [A complex combination obtained by the liquid-vapor separation of the hydrocracking process reactor effluent. It consists predominantly of hydrogen and saturated hydrocarbons having |
68783-06-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-153-00-0 |
Gases (petroleum), refinery; Refinery gas; [A complex combination obtained from various petroleum refining operations. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] |
68814-67-5 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-154-00-6 |
Gases (petroleum), platformer products separator off; Refinery gas; [A complex combination obtained from the chemical reforming of naphthenes to aromatics. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly |
68814-90-4 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-155-00-1 |
Gases (petroleum), hydrotreated sour kerosine depentanizer stabilizer off; Refinery gas; [The complex combination obtained from the depentanizer stabilization of hydrotreated kerosine. It consists primarily of hydrogen, methane, ethane, and propane with |
68911-58-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-156-00-7 |
Gases (petroleum), hydrotreated sour kerosine flash drum; Refinery gas; [A complex combination obtained from the flash drum of the unit treating sour kerosine with hydrogen in the presence of a catalyst. It consists primarily of hydrogen and methane wit |
68911-59-1 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-157-00-2 |
Gases (petroleum), distillate unifiner desulfurization stripper off; Refinery gas; [A complex combination stripped from the liquid product of the unifiner desulfurization process. It consists of hydrogen sulfide, methane, ethane, and propane.] |
68919-01-7 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-158-00-8 |
Gases (petroleum), fluidized catalytic cracker fractionation off; Refinery gas; [A complex combination produced by the fractionation of the overhead product of the fluidized catalytic cracking process. It consists of hydrogen, hydrogen sulfide, nitrogen |
68919-02-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-159-00-3 |
Gases (petroleum), fluidized catalytic cracker scrubbing secondary absorber off; Refinery gas; [A complex combination produced by scrubbing the overhead gas from the fluidized catalytic cracker. It consists of hydrogen, nitrogen, methane, ethane and pro |
68919-03-9 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-160-00-9 |
Gases (petroleum), heavy distillate hydrotreater desulfurization stripper off; Refinery gas; [A complex combination stripped from the liquid product of the heavy distillate hydrotreater desulfurization process. It consists of hydrogen, hydrogen sulfide, |
68919-04-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-161-00-4 |
Gases (petroleum), platformer stabilizer off, light ends fractionation; Refinery gas; [A complex combination obtained by the fractionation of the light ends of the platinum reactors of the platformer unit. It consists of hydrogen, methane, ethane and pr |
68919-07-3 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-162-00-X |
Gases (petroleum), preflash tower off, crude distn.; Refinery gas; [A complex combination produced from the first tower used in the distillation of crude oil. It consists of nitrogen and saturated aliphatic hydrocarbons having carbon numbers predominant |
68919-08-4 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-163-00-5 |
Gases (petroleum), tar stripper off; Refinery gas; [A complex combination obtained by the fractionation of reduced crude oil. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] |
68919-11-9 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-164-00-0 |
Gases (petroleum), unifiner stripper off; Refinery gas; [A combination of hydrogen and methane obtained by fractionation of the products from the unifiner unit.] |
68919-12-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-165-00-6 |
Tail gas (petroleum), catalytic hydrodesulfurized naphtha separator; Refinery gas; [A complex combination of hydrocarbons obtained from the hydrodesulfurization of naphtha. It consists of hydrogen, methane, ethane, and propane.] |
68952-79-4 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-166-00-1 |
Tail gas (petroleum), straight-run naphtha hydrodesulfurizer; Refinery gas; [A complex combination obtained from the hydrodesulfurization of straight-run naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range |
68952-80-7 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-167-00-7 |
Gases (petroleum), sponge absorber off, fluidized catalytic cracker and gas oil desulfurizer overhead fractionation; Refinery gas; [A complex combination obtained by the fractionation of products from the fluidized catalytic cracker and gas oil desulfur |
68955-33-9 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-168-00-2 |
Gases (petroleum), crude distn. and catalytic cracking; Refinery gas; [A complex combination produced by crude distillation and catalytic cracking processes. It consists of hydrogen, hydrogen sulfide, nitrogen, carbon monoxide and paraffinic and olefini |
68989-88-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-169-00-8 |
Gases (petroleum), gas oil diethanolamine scrubber off; Refinery gas; [A complex combination produced by desulfurization of gas oils with diethanolamine. It consists predominantly of hydrogen sulfide, hydrogen and aliphatic hydrocarbons having carbon nu |
92045-15-3 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-170-00-3 |
Gases (petroleum), gas oil hydrodesulfurization effluent; Refinery gas; [A complex combination obtained by separation of the liquid phase from the effluent from the hydrogenation reaction. It consists predominantly of hydrogen, hydrogen sulfide and alip |
92045-16-4 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-171-00-9 |
Gases (petroleum), gas oil hydrodesulfurization purge; Refinery gas; [A complex combination of gases obtained from the reformer and from the purges from the hydrogenation reactor. It consists predominantly of hydrogen and aliphatic hydrocarbons having c |
92045-17-5 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-172-00-4 |
Gases (petroleum), hydrogenator effluent flash drum off; Refinery gas; [A complex combination of gases obtained from flash of the effluents after the hydrogenation reaction. It consists predominantly of hydrogen and aliphatic hydrocarbons having carbon |
92045-18-6 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-173-00-X |
Gases (petroleum), naphtha steam cracking high-pressure residual; Refinery gas; [A complex combination obtained as a reaction mass of the non-condensable portions from the product of a naphtha steam cracking process as well as residual gases obtained du |
92045-19-7 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-174-00-5 |
Gases (petroleum), residue visbaking off; Refinery gas; [A complex combination obtained from viscosity reduction of residues in a furnace. It consists predominantly of hydrogen sulfide and paraffinic and olefinic hydrocarbons having carbon numbers predo |
92045-20-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-175-00-0 |
Foots oil (petroleum), acid-treated; Foots oil; [A complex combination of hydrocarbons obtained by treatment of Foot's oil with sulfuric acid. It consists predominantly of branched-chain hydrocarbons with carbon numbers predominantly in the range of C20 |
93924-31-3 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-176-00-6 |
Foots oil (petroleum), clay-treated; Foots oil; [A complex combination of hydrocarbons obtained by treatment of Foot's oil with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and imp |
93924-32-4 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-177-00-1 |
Gases (petroleum), C3-4; Petroleum gas; [A complex combination of hydrocarbons produced by distillation of products from the cracking of crude oil. It consists of hydrocarbons having carbon numbers in the range of C3 through C4, predominantly of propane |
68131-75-9 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-178-00-7 |
Tail gas (petroleum), catalytic cracked distillate and catalytic cracked naphtha fractionation absorber; Petroleum gas; [The complex combination of hydrocarbons from the distillation of the products from catalytic cracked distillates and catalytic crack |
68307-98-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-179-00-2 |
Tail gas (petroleum), catalytic polymn. naphtha fractionation stabilizer; Petroleum gas; [A complex combination of hydrocarbons from the fractionation stabilization products from polymerization of naphtha. It consists predominantly of hydrocarbons havin |
68307-99-3 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-180-00-8 |
Tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer, hydrogen sulfide-free; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation stabilization of catalytic reformed naphtha and from which hydrogen sulfi |
68308-00-9 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-181-00-3 |
Tail gas (petroleum), cracked distillate hydrotreater stripper; Petroleum gas; [A complex combination of hydrocarbons obtained by treating thermal cracked distillates with hydrogen in the presence of a catalyst. It consists predominantly of saturated hy |
68308-01-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-182-00-9 |
Tail gas (petroleum), straight-run distillate hydrodesulfurizer, hydrogen sulfide-free; Petroleum gas; [A complex combination of hydrocarbons obtained from catalytic hydrodesulfurization of straight run distillates and from which hydrogen sulfide has be |
68308-10-1 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-183-00-4 |
Tail gas (petroleum), gas oil catalytic cracking absorber; Petroleum gas; [A complex combination of hydrocarbons obtained from the distillation of products from the catalytic cracking of gas oil. It consists predominantly of hydrocarbons having carbon n |
68308-03-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-184-00-X |
Tail gas (petroleum), gas recovery plant; Petroleum gas; [A complex combination of hydrocarbons from the distillation of products from miscellaneous hydrocarbon streams. It consists predominantly of hydrocarbons having carbon numbers predominantly in th |
68308-04-3 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-185-00-5 |
Tail gas (petroleum), gas recovery plant deethanizer; Petroleum gas; [A complex combination of hydrocarbons from the distillation of products from miscellaneous hydrocarbon streams. It consists of hydrocarbons having carbon numbers predominantly in the |
68308-05-4 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-186-00-0 |
Tail gas (petroleum), hydrodesulfurized distillate and hydrodesulfurized naphtha fractionator, acid-free; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of hydrodesulfurized naphtha and distillate hydrocarbon streams a |
68308-06-5 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-187-00-6 |
Tail gas (petroleum), hydrodesulfurized vacuum gas oil stripper, hydrogen sulfide-free; Petroleum gas; [A complex combination of hydrocarbons obtained from stripping stabilization of catalytic hydrodesulfurized vacuum gas oil and from which hydrogen sul |
68308-07-6 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-188-00-1 |
Tail gas (petroleum), light straight-run naphtha stabilizer, hydrogen sulfide-free; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation stabilization of light straight run naphtha and from which hydrogen sulfide has been re |
68308-09-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-189-00-7 |
Tail gas (petroleum), propane-propylene alkylation feed prep deethanizer; Petroleum gas; [A complex combination of hydrocarbons obtained from the distillation of the reaction products of propane with propylene. It consists of hydrocarbons having carbon |
68308-11-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-190-00-2 |
Tail gas (petroleum), vacuum gas oil hydrodesulfurizer, hydrogen sulfide-free; Petroleum gas; [A complex combination of hydrocarbons obtained from catalytic hydrodesulfurization of vacuum gas oil and from which hydrogen sulfide has been removed by amine |
68308-12-3 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-191-00-8 |
Gases (petroleum), catalytic cracked overheads; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from the catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the ra |
68409-99-4 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-193-00-9 |
Alkanes, C1-2; Petroleum gas |
68475-57-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-194-00-4 |
Alkanes, C2-3; Petroleum gas |
68475-58-1 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-195-00-X |
Alkanes, C3-4; petroleum gas |
68475-59-2 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-196-00-5 |
Alkanes, C4-5; Petroleum gas |
68475-60-5 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-197-00-0 |
Fuel gases; Petroleum gas; [A combination of light gases. It consists predominantly of hydrogen and/or low molecular weight hydrocarbons.] |
68476-26-6 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-198-00-6 |
Fuel gases, crude oil of distillates; Petroleum gas; [A complex combination of light gases produced by distillation of crude oil and by catalytic reforming of naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the r |
68476-29-9 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-199-00-1 |
Hydrocarbons, C3-4; Petroleum gas |
68476-40-4 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-200-00-5 |
Hydrocarbons, C4-5; Petroleum gas |
68476-42-6 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-201-00-0 |
Hydrocarbons, C2-4, C3-rich; Petroleum gas |
68476-49-3 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-202-00-6 |
Petroleum gases, liquefied; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C7 and boiling in the range of approx |
68476-85-7 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K S |
CLP00/ATP02 |
649-203-00-1 |
Petroleum gases, liquefied, sweetened; Petroleum gas; [A complex combination of hydrocarbons obtained by subjecting liquefied petroleum gas mix to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons hav |
68476-86-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K S |
CLP00/ATP02 |
649-204-00-7 |
gases (petroleum), C3-4, isobutane-rich; Petroleum gas; [A complex combination of hydrocarbons from the distillation of saturated and unsaturated hydrocarbons usually ranging in carbon numbers from C3 through C6, predominantly butane and isobutane. It c |
68477-33-8 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-205-00-2 |
Distillates (petroleum), C3-6, piperylene-rich; Petroleum gas; [A complex combination of hydrocarbons from the distillation of saturated and unsaturated aliphatic hydrocarbons usually ranging in the carbon numbers C3 through C6. It consists of saturated |
68477-35-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-206-00-8 |
Gases (petroleum), butane splitter overheads; Petroleum gas; [A complex combination of hydrocarbons obtained from the distillation of the butane stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through |
68477-69-0 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-207-00-3 |
Gases (petroleum), C2-3-; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic fractionation process. It contains predominantly ethane, ethylene, propane, and propylene.] |
68477-70-3 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-208-00-9 |
Gases (petroleum), catalytic-cracked gas oil depropanizer bottoms, C4-rich acid-free; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked gas oil hydrocarbon stream and treated to remove hydrogen sulfid |
68477-71-4 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-209-00-4 |
Gases (petroleum), catalytic-cracked naphtha debutanizer bottoms, C3-5-rich; Petroleum gas; [A complex combination of hydrocarbons obtained from the stabilization of catalytic cracked naphtha. It consists of aliphatic hydrocarbons having carbon numbers |
68477-72-5 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-210-00-X |
Tail gas (petroleum), isomerized naphtha fractionation stabilizer; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation stabilization products from isomerized naphtha. It consists predominantly of hydrocarbons having car |
68308-08-7 |
F+; R12, Carc. Cat. 1; R45, Muta. Cat. 2; R46 |
|
K |
CLP00/ATP02 |
649-211-00-5 |
Foots oil (petroleum), carbon-treated; Foots oil; [A complex combination of hydrocarbons obtained by the treatment of Foots oil with activated carbon for the removal of trace constituents and impurities. It consists predominantly of saturated straight c |
97862-76-5 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-212-00-0 |
Distillates (petroleum), sweetened middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbo |
64741-86-2 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-213-00-6 |
Gas oils (petroleum), solvent-refined; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in t |
64741-90-8 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-214-00-1 |
Distillates (petroleum), solvent-refined middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predomin |
64741-91-9 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-215-00-7 |
Gas oils (petroleum), acid-treated; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C13 through C |
64742-12-7 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-216-00-2 |
Distillates (petroleum), acid-treated middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 |
64742-13-8 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-217-00-8 |
Distillates (petroleum), acid-treated light; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 t |
64742-14-9 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-218-00-3 |
Gas oils (petroleum), chemically neutralized; Gasoil - unspecified; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C13 thr |
64742-29-6 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-219-00-9 |
Distillates (petroleum), chemically neutralized middle; Gasoil - unspecified; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range |
64742-30-9 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-220-00-4 |
Distillates (petroleum), clay-treated middle; Gasoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay, usually in a percolation process to remove the trace amounts of po |
64742-38-7 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-221-00-X |
Distillates (petroleum), hydrotreated middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predomina |
64742-46-7 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-222-00-5 |
Gas oils (petroleum), hydrodesulfurized; Gasoil - unspecified; [A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists predominantly of |
64742-79-6 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-223-00-0 |
Distillates (petroleum), hydrodesulfurized middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydr |
64742-80-9 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-224-00-6 |
Fuels, diesel; Gasoil - unspecified; [A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C20 and boiling in the range of approximate |
68334-30-5 |
Carc. Cat. 3; R40 |
|
N |
CLP00/ATP02 |
649-225-00-1 |
Fuel oil, No 2; Gasoil - unspecified; [A distillate oil having a minimum viscosity of 32,6 SUS at 37,7 °C (100 °F) to a maximum of 37,9 SUS at 37,7 °C (100 °F).] |
68476-30-2 |
Carc. Cat. 3; R40 |
|
|
CLP00/ATP02 |
649-226-00-7 |
Fuel oil, No 4; Gasoil - unspecified; [A distillate oil having a minimum viscosity of 45 SUS at 37,7 °C (100 °F) to a maximum of 125 SUS at 37,7 °C (100 °F).] |
68476-31-3 |
Carc. Cat. 3; R40 |
|
|
CLP00/ATP02 |
649-227-00-2 |
Fuels, diesel, No 2; Gasoil - unspecified; [A distillate oil having a minimum viscosity of 32,6 SUS at 37,7 °C (100 °F).] |
68476-34-6 |
Carc. Cat. 3; R40 |
|
|
CLP00/ATP02 |
649-228-00-8 |
Distillates (petroleum), catalytic reformer fractionator residue, high-boiling; Gasoil - unspecified; [A complex combination of hydrocarbons from the distillation of catalytic reformer fracftionator residue. It boils in the range of approximately 343 °C |
68477-29-2 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-229-00-3 |
Distillates (petroleum), catalytic reformer fractionator residue, intermediate-boiling; Gasoil - unspecified; [A complex combination of hydrocarbons from the distillation of catalytic reformer fractionator residue. It boils in the range of approximately |
68477-30-5 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-230-00-9 |
Distillates (petroleum), catalytic reformer fractionator residue, low-boiling; Gasoil - unspecified; [The complex combination of hydrocarbons from the distillation of catalytic reformer fractionator residue. It boils approximately below 288 °C (550 °F). |
68477-31-6 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-231-00-4 |
Distillates (petroleum), highly refined middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by the subjection of a petroleum fraction to several of the following steps: filtration, centrifugation, atmospheric distillation, vacu |
90640-93-0 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-232-00-X |
Distillates (petroleum) catalytic reformer, heavy arom. conc.; Gasoil - unspecified; [A complex combination of hydrocarbons obtained from the distillation of a catalytically reformed petroleum cut. It consists predominantly of aromatic hydrocarbons havi |
91995-34-5 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-233-00-5 |
Gas oils, paraffinic; Gasoil - unspecified; [A distillate obtained from the redistillation of a complex combination of hydrocarbons obtained by the distillation of the effluents from a severe catalytic hydrotreatment of paraffins. It boils in the range |
93924-33-5 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-234-00-0 |
Naphtha (petroleum), solvent-refined hydrodesulfurized heavy; Gasoil - unspecified |
97488-96-5 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-235-00-6 |
Hydrocarbons, C16-20, hydrotreated middle distillate, distn. lights; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the treatment of a middle distillate with hydroge |
97675-85-9 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-236-00-1 |
Hydrocarbons, C12-20, hydrotreated paraffinic, distn. lights; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the treatment of heavy paraffins with hydrogen in the pr |
97675-86-0 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-237-00-7 |
Hydrocarbons, C11-17, solvent-extd. light naphthenic; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by extraction of the aromatics from a light naphthenic distillate having a visciosity of 2.2 cSt at 40 °C (104 °F). It consists p |
97722-08-2 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-238-00-2 |
Gas oils, hydrotreated; Gasoil - unspecified; [A complex combination of hydrocarbons obtained from the redistillation of the effluents from the treatment of paraffins with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons |
97862-78-7 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-239-00-8 |
Distillates (petroleum), carbon-treated light paraffinic; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by the treatment of a petroleum oil fraction with activated charcoal for the removal of traces of polar constituents and impu |
100683-97-4 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-240-00-3 |
Distillates (petroleum), intermediate paraffinic, carbon-treated; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by the treatment of petroleum with activated charcoal for the removal of trace polar constituents and impurities. It |
100683-98-5 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-241-00-9 |
Distillates (petroleum), intermediate paraffinic, clay-treated; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by the treatment of petroleum with bleaching earth for the removal of trace polar constituents and impurities. It consi |
100683-99-6 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-242-00-4 |
Alkanes, C12-26-branched and linear |
90622-53-0 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-243-00-X |
Lubricating greases; Grease; [A complex combination of hydrocarbons having carbon numbers predominantly in the range of C12 through C50. May contain organic salts of alkali metals, alkaline earth metals, and/or aluminium compounds.] |
74869-21-9 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-244-00-5 |
Slack wax (petroleum); Slack wax; [A complex combination of hydrocarbons obtained from a petroleum fraction by solvent crystallization (solvent dewaxing) or as a distillation fraction from a very waxy crude. It consists predominantly of saturated straig |
64742-61-6 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-245-00-0 |
Slack wax (petroleum), acid-treated; Slack wax; [A complex combination of hydrocarbons obtained as a raffinate by treatment of a petroleum slack wax fraction with sulfuric acid treating process. It consists predominantly of saturated straight and branch |
90669-77-5 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-246-00-6 |
Slack wax (petroleum), clay-treated; Slack wax; [A complex combination of hydrocarbons obtained by treatment of a petroleum slack wax fraction with natural or modified clay in either a contacting or percolation process. It consists predominantly of satu |
90669-78-6 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-247-00-1 |
Slack wax (petroleum), hydrotreated; Slack wax; [A complex combination of hydrocarbons obtained by treating slack wax with hydrogen in the presence of a catalyst. It consists predominantly of saturated straight and branched chain hydrocarbons having car |
92062-09-4 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-248-00-7 |
Slack wax (petroleum), low-melting; Slack wax; [A complex combination of hydrocarbons obtained from a petroleum fraction by solvent deparaffination. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers pr |
92062-10-7 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-249-00-2 |
Slack wax (petroleum), low-melting, hydrotreated; Slack wax; [A complex combination of hydrocarbons obtained by treatment of low-melting petroleum slack wax with hydrogen in the presence of a catalyst. It consists predominantly of saturated straight and |
92062-11-8 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-250-00-8 |
Slack wax (petroleum), low-melting, carbon-treated; Slack wax; [A complex combination of hydrocarbons obtained by the treatment of low-melting slack wax with activated carbon for the removal of trace polar constituents and impurities. It consists predom |
97863-04-2 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-251-00-3 |
Slack wax (petroleum), low-melting, clay-treated; Slack wax; [A complex combination of hydrocarbons obtained by the treatment of low-melting petroleum slack wax with bentonite for removal of trace polar constituents and impurities. It consists predomina |
97863-05-3 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-252-00-9 |
Slack wax (petroleum), low-melting, silicic acid-treated; Slack wax; [A complex combination of hydrocarbons obtained by the treatment of low-melting petroleum slack wax with silicic acid for the removal of trace polar constituents and impurities. It con |
97863-06-4 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-253-00-4 |
Slack wax (petroleum), carbon-treated; Slack wax; [A complex combination of hydrocarbons obtained by treatment of petroleum slack wax with activated charcoal for the removal of trace polar constituents and impurities.] |
100684-49-9 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-254-00-X |
Petrolatum; Petrolatum; [A complex combination of hydrocarbons obtained as a semi-solid from dewaxing paraffinic residual oil. It consists predominantly of saturated crystalline and liquid hydrocarbons having carbon numbers predominantly greater than C2 |
8009-03-8 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-255-00-5 |
Petrolatum (petroleum), oxidized; Petrolatum; [A complex combination of organic compounds, predominantly high molecular weight carboxylic acids, obtained by the air oxidation of petrolatum.] |
64743-01-7 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-256-00-0 |
Petrolatum (petroleum), alumina-treated; Petrolatum; [A complex combination of hydrocarbons obtained when petrolatum is treated with Al2O3 to remove polar components and impurities. It consists predominantly of saturated, crystalline, and liquid hydroca |
85029-74-9 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-257-00-6 |
Petrolatum (petroleum), hydrotreated; Petrolatum; [A complex combination of hydrocarbons obtained as a semi-solid from dewaxed paraffinic residual oil treated with hydrogen in the presence of a catalyst. It consists predominantly of saturated microcryst |
92045-77-7 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-258-00-1 |
Petrolatum (petroleum), carbon-treated; Petrolatum; [A complex combination of hydrocarbons obtained by the treatment of petroleum petrolatum with activated carbon for the removal of trace polar constituents and impurities. It consists predominantly of s |
97862-97-0 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-259-00-7 |
Petrolatum (petroleum), silicic acid-treated; Petrolatum; [A complex combination of hydrocarbons obtained by the treatment of petroleum petrolatum with silicic acid for the removal of trace polar constituents and impurities. It consists predominantly of |
97862-98-1 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-260-00-2 |
Petrolatum (petroleum), clay-treated; Petrolatum; [A complex combination of hydrocarbons obtained by treatment of petrolatum with bleaching earth for the removal of traces of polar constituents and impurities. It consists predominantly of hydrocarbons h |
100684-33-1 |
Carc. Cat. 2; R45 |
|
N |
CLP00/ATP02 |
649-261-00-8 |
Gasoline, natural; Low boiling point naphtha; [A complex combination of hydrocarbons separated from natural gas by processes such as refrigeration or absorption. It consists predominantly of saturated aliphatic hydrocarbons having carbon numbers predom |
8006-61-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-262-00-3 |
Naphtha; Low boiling point naphtha; [Refined, partly refined, or unrefined petroleum products produced by the distillation of natural gas. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C6 and boiling in the |
8030-30-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-263-00-9 |
Ligroine; Low boiling point naphtha; [A complex combination of hydrocarbons obtained by the fractional distillation of petroleum. This fraction boils in a range of approximately 20°C to 135°C (58°F to 275°F).] |
8032-32-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-264-00-4 |
Naphtha (petroleum), heavy straight-run; Low boiling point naphtha; [A complex combination of hydrocarbons produced by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling |
64741-41-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-265-00-X |
Naphtha (petroleum), full-range straight-run; Low boiling point naphtha; [A complex combination of hydrocarbons produced by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and bo |
64741-42-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-266-00-5 |
Naphtha (petroleum), light straight-run; Low boiling point naphtha; [A complex combination of hydrocarbons produced by distillation of crude oil. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 |
64741-46-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-267-00-0 |
Solvent naphtha (petroleum), light aliph.; Low boiling point naphtha; [A complex combination of hydrocarbons obtained from the distillation of crude oil or natural gasoline. It consists predominantly of saturated hydrocarbons having carbon numbers pred |
64742-89-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-268-00-6 |
Distillates (petroleum), straight-run light; Low boiling point naphtha; [A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C2 through C7 and |
68410-05-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-269-00-1 |
Gasoline, vapor-recovery; Low boiling point naphtha; [A complex combination of hydrocarbons separated from the gases from vapor recovery systems by cooling. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 |
68514-15-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-270-00-7 |
Gasoline, straight-run, topping-plant; Low boiling point naphtha; [A complex combination of hydrocarbons produced from the topping plant by the distillation of crude oil. It boils in the range of approximately 36.1°C to 193.3°C (97°F to 380°F).] |
68606-11-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-271-00-2 |
Naphtha (petroleum), unsweetened; Low boiling point naphtha; [A complex combination of hydrocarbons produced from the distillation of naphtha streams from various refinery processes. It consists of hydrocarbons having carbon numbers predominantly in th |
68783-12-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-272-00-8 |
Distillates (petroleum), light straight-run gasoline fractionation stabilizer overheads; Low boiling point naphtha; [A complex combination of hydrocarbons obtained by the fractionation of light straight-run gasoline. It consists of saturated aliphatic |
68921-08-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-273-00-3 |
Naphtha (petroleum), heavy straight run, arom.-contg.; Low boiling point naphtha; [A complex combination of hydrocarbons obtained from a distillation process of crude petroleum. It consists predominantly of hydrocarbons having carbon numbers in the ran |
101631-20-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-274-00-9 |
Naphtha (petroleum), full-range alkylate; Low boiling point modified naphtha; [A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 |
64741-64-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-275-00-4 |
Naphtha (petroleum), heavy alkylate; Low boiling point modified naphtha; [A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 to C5 |
64741-65-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-276-00-X |
Naphtha (petroleum), light alkylate; Low boiling point modified naphtha; [A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 throu |
64741-66-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-277-00-5 |
Naphtha (petroleum), isomerization; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained from catalytic isomerization of straight chain paraffinic C4 through C6 hydrocarbons. It consists predominantly of saturated hydroca |
64741-70-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-278-00-0 |
Naphtha (petroleum), solvent-refined light; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon number |
64741-84-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-279-00-6 |
Naphtha (petroleum), solvent-refined heavy; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon number |
64741-92-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-280-00-1 |
Raffinates (petroleum), catalytic reformer ethylene glycol-water countercurrent exts.; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained as the raffinate from the UDEX extraction process on the catalytic reformer stream |
68410-71-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-281-00-7 |
Raffinates (petroleum), reformer, Lurgi unit-sepd.; Low boiling point modified naphtha; [The complex combination of hydrocarbons obtained as a raffinate from a Lurgi separation unit. It consists predominantly of non-aromatic hydrocarbons with various s |
68425-35-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-282-00-2 |
Naphtha (petroleum), full-range alkylate, butane-contg.; Low boiling point modified naphta; [A complex combination of hydrocarbons produced by the distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbo |
68527-27-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-283-00-8 |
Distillates (petroleum), naphtha steam cracking-derived, solvent-refined light hydrotreated; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained as the raffinates from a solvent extraction process of hydrotreated light di |
91995-53-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-284-00-3 |
Naphtha (petroleum), C4-12, butane-alkylate, isooctane-rich; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained by alkylation of butanes. It consists predominantly of hydrocarbons having carbon numbers predominantly in |
92045-49-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-285-00-9 |
Hydrocarbons, hydrotreated light naphtha distillates, solvent-refined; Low boiling point modified naphtha; [A combination of hydrocarbons obtained from the distillation of hydrotreated naphtha followed by a solvent extraction and distillation process. |
92045-55-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-286-00-4 |
Naphtha (petroleum), isomerization, C6-fraction; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained by distillation of a gasoline which has been catalytically isomerized. It consists predominantly of hexane isomers boil |
92045-58-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-287-00-X |
Hydrocarbons, C6-7, naphtha-cracking, solvent-refined; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained by the sorption of benzene from a catalytically fully hydrogenated benzene-rich hydrocarbon cut that was distillat |
92045-64-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-288-00-5 |
Hydrocarbons, C6-rich, hydrotreated light naphtha distillates, solvent-refined; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained by distillation of hydrotreated naphtha followed by solvent extraction. It consists pred |
101316-67-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-289-00-0 |
Naphtha (petroleum), heavy catalytic cracked; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons produced by a distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers pred |
64741-54-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-290-00-6 |
Naphtha (petroleum), light catalytic cracked; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers pr |
64741-55-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-291-00-1 |
Hydrocarbons, C3-11, catalytic cracker distillates; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons produced by the distillations of products from a catalytic cracking process. It consists of hydrocarbons having carbon num |
68476-46-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-292-00-7 |
Naphtha (petroleum), catalytic cracked light distd.; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon num |
68783-09-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-293-00-2 |
Distillates (petroleum), naphtha steam cracking-derived, hydrotreated light arom.; Low boiling point cat-cracked naphtha.; [A complex combination of hydrocarbons obtained by treating a light distillate from steam-cracked naphtha. It consists predominan |
91995-50-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-294-00-8 |
Naphtha (petroleum), heavy catalytic cracked, sweetened; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons obtained by subjecting a catalytic cracked petroleum distillate to a sweetening process to convert mercaptans or to re |
92045-50-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-295-00-3 |
Naphtha (petroleum), light catalytic cracked sweetened; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons obtained by subjecting naphtha from a catalytic cracking process to a sweetening process to convert mercaptans or to re |
92045-59-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-296-00-9 |
Hydrocarbons, C8-12, catalytic-cracking, chem. neutralized; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons produced by the distillation of a cut from the catalytic cracking process, having undergone an alkaline washing. I |
92128-94-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-297-00-4 |
Hydrocarbons, C8-12, catalytic cracker distillates; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons obtained by distillation of products from a catalytic cracking process. It consists predominantly of hydrocarbons having ca |
101794-97-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-298-00-X |
Hydrocarbons, C8-12, catalytic cracking, chem. neutralized, sweetened; Low boiling point cat-cracked naphtha |
101896-28-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-299-00-5 |
Naphtha (petroleum), light catalytic reformed; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons produced from the distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbe |
64741-63-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-300-00-9 |
Naphtha (petroleum), heavy catalytic reformed; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons produced from the distillation of products from a catalytic reforming process. It consists of predominantly aromatic hydrocarb |
64741-68-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-301-00-4 |
Distillates (petroleum), catalytic reformed depentanizer; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons from the distillation of products from a catalytic reforming process. It consists predominantly of aliphatic hydroc |
68475-79-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-302-00-X |
Hydrocarbons, C2-6, C6-8 catalytic reformer; Low boiling point cat-reformed naphtha |
68476-47-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-303-00-5 |
Residues (petroleum), C6-8 catalytic reformer; Low boiling point cat-reformed naphtha; [A complex residuum from the catalytic reforming of C6-8 feed. It consists of hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] |
68478-15-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-304-00-0 |
Naphtha (petroleum), light catalytic reformed, arom.-free; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons obtained from distillation of products from a catalytic reforming process. It consists predominantly of hydrocarbo |
68513-03-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-305-00-6 |
Distillates (petroleum), catalytic reformed straight-run naphtha overheads; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha followed by the fractionation of the t |
68513-63-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-306-00-1 |
Petroleum products, hydrofiner-powerformer reformates; Low boiling point cat-reformed naphtha; [The complex combination of hydrocarbons obtained in a hydrofiner-powerformer process and boiling in a range of approximately 27°C to 210°C (80°F to 410°F).] |
68514-79-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-307-00-7 |
Naphtha (petroleum), full-range reformed; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons produced by the distillation of the products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers |
68919-37-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-308-00-2 |
Naphtha (petroleum), catalytic reformed; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers predo |
68955-35-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-309-00-8 |
Distillates (petroleum), catalytic reformed hydrotreated light, C8-12 arom. fraction; Low boiling point cat-reformed naphtha; [A complex combination of alkylbenzenes obtained by the catalytic reforming of petroleum naphtha. It consists predominantly of |
85116-58-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-310-00-3 |
Aromatic hydrocarbons, C8, catalytic reforming-derived; Low boiling point cat-reformed naphtha |
91995-18-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-311-00-9 |
Aromatic hydrocarbons, C7-12, C8-rich; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons obtained by separation from the platformate-containing fraction. It consists predominantly of aromatic hydrocarbons having carbon numb |
93571-75-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-312-00-4 |
Gasoline, C5-11, high-octane stabilised reformed; Low boiling point cat-reformed naphtha; [A complex high octane combination of hydrocarbons obtained by the catalytic dehydrogenation of a predominantly naphthenic naphtha. It consists predominantly of a |
93572-29-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-313-00-X |
Hydrocarbons, C7-12, C≥9-arom.-rich, reforming heavy fraction; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons obtained by separation from the platformate-containing fraction. It consists predominantly of nonaromatic hydr |
93572-35-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-314-00-5 |
Hydrocarbons, C5-11, nonaroms.-rich, reforming light fraction; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons obtained by separation from the platformate-containing fraction. It consists predominantly of nonaromatic hydr |
93572-36-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-315-00-0 |
Foots oil (petroleum), silicic acid-treated; Foots oil; [A complex combination of hydrocarbons obtained by the treatment of Foots oil with silicic acid for removal of trace constituents and impurities. It consists predominantly of straight chain hydroca |
97862-77-6 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-316-00-6 |
Naphtha (petroleum), light thermal cracked; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons from distillation of products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having |
64741-74-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-317-00-1 |
Naphtha (petroleum), heavy thermal cracked; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons from distillation of the products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons hav |
64741-83-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-318-00-7 |
Distillates (petroleum), heavy arom.; Low boiling point thermally cracked naphtha; [The complex combination of hydrocarbons from the distillation of the products from the thermal cracking of ethane and propane. This higher boiling fraction consists pre |
67891-79-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-319-00-2 |
Distillates (petroleum), light arom.; Low boiling point thermally cracked naphtha; [The complex combination of hydrocarbons from the distillation of the products from the thermal cracking of ethane and propane. This lower boiling fraction consists pred |
67891-80-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-320-00-8 |
Distillates (petroleum), naphtha-raffinate pyrolyzate-derived, gasoline-blending; Low boiling point thermally cracked naphtha; [The complex combination of hydrocarbons obtained by the pyrolysis fractionation at 816°C (1500°F) of naphtha and raffinate. |
68425-29-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-321-00-3 |
Aromatic hydrocarbons, C6-8, naphtha-raffinate pyrolyzate-derived; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons obtained by the fractionation pyrolysis at 816°C (1500°F) of naphtha and raffinate. It consists predo |
68475-70-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-322-00-9 |
Distillates (petroleum), thermal cracked naphtha and gas oil; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons produced by distillation of thermally cracked naphtha and/or gas oil. It consists predominantly of olefini |
68603-00-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-323-00-4 |
Distillates (petroleum), thermal cracked naphtha and gas oil, C5-dimer-contg.; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons produced by the extractive distillation of thermal cracked naphtha and/or gas oil. It con |
68603-01-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-324-00-X |
Distillates (petroleum), thermal cracked naphtha and gas oil, extractive; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons produced by the extractive distillation of thermal cracked naphtha and/or gas oil. It consists |
68603-03-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-325-00-5 |
Distillates (petroleum), light thermal cracked, debutanized arom.; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons produced by the distillation of products from a thermal cracking process. It consists predominantly o |
68955-29-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-326-00-0 |
Naphtha (petroleum), light thermal cracked, sweetened; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate from the high temperature thermal cracking of heavy oil fractions to |
92045-65-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-327-00-6 |
Naphtha (petroleum), hydrotreated heavy; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon |
64742-48-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-328-00-1 |
Naphtha (petroleum), hydrotreated light; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon |
64742-49-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-329-00-7 |
Naphtha (petroleum), hydrodesulfurized light; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists of hydrocarbons having carbon numbers predominantly in |
64742-73-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-330-00-2 |
Naphtha (petroleum), hydrodesulfurized heavy; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists of hydrocarbons having carbon numbers predominantly in |
64742-82-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-331-00-8 |
Distillates (petroleum), hydrotreated middle, intermediate boiling; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by the distillation of products from a middle distillate hydrotreating process. It consists |
68410-96-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-332-00-3 |
Distillates (petroleum), light distillate hydrotreating process, low-boiling; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by the distillation of products from the light distillate hydrotreating process. I |
68410-97-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-333-00-9 |
Distillates (petroleum), hydrotreated heavy naphtha, deisohexanizer overheads; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by distillation of the products from a heavy naphtha hydrotreating process. It co |
68410-98-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-334-00-4 |
Solvent naphtha (petroleum), light arom., hydrotreated; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists predominantly |
68512-78-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-335-00-X |
Naphtha (petroleum), hydrodesulfurized thermal cracked light; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by fractionation of hydrodesulfurized thermal cracker distillate. It consists predominantly of hyd |
85116-60-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-336-00-5 |
Naphtha (petroleum), hydrotreated light, cycloalkane-contg.; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained from the distillation of a petroleum fraction. It consists predominantly of alkanes and cycloalkane |
85116-61-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-337-00-0 |
Naphtha (petroleum), heavy steam-cracked, hydrogenated; Low boiling point hydrogen treated naphtha |
92045-51-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-338-00-6 |
Naphtha (petroleum), hydrodesulfurized full-range; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists predominantly of hydrocarbons having carbon number |
92045-52-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-339-00-1 |
Naphtha (petroleum), hydrotreated light steam-cracked; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by treating a petroleum fraction, derived from a pyrolysis process, with hydrogen in the presence of a cat |
92045-57-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-340-00-7 |
Hydrocarbons, C4-12, naphtha-cracking, hydrotreated; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by distillation from the product of a naphtha steam cracking process and subsequent catalytic selective hydr |
92045-61-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-341-00-2 |
Solvent naphtha (petroleum), hydrotreated light naphthenic; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists predominan |
92062-15-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-342-00-8 |
Naphtha (petroleum), light steam-cracked, hydrogenated; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons produced from the separation and subsequent hydrogenation of the products of a steam-cracking process to produce e |
93165-55-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-343-00-3 |
Hydrocarbons, C6-11, hydrotreated, dearomatized; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained as solvents which have been subjected to hydrotreatment in order to convert aromatics to naphthenes by catalytic |
93763-33-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-344-00-9 |
Hydrocarbons, C9-12, hydrotreated, dearomatized; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained as solvents which have been subjected to hydrotreatment in order to convert aromatics to naphthenes by catalytic |
93763-34-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-345-00-4 |
Stoddard solvent; Low boiling point naphtha - unspecified; [A colorless, refined petroleum distillate that is free from rancid or objectionable odors and that boils in a range of approximately 148.8°C to 204.4°C. (300°F to 400°F).] |
8052-41-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-346-00-X |
Natural gas condensates (petroleum); Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons separated as a liquid from natural gas in a surface separator by retrograde condensation. It consists mainly of hydrocarbons having car |
64741-47-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-347-00-5 |
Natural gas (petroleum), raw liq. mix; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons separated as a liquid from natural gas in a gas recycling plant by processes such as refrigeration or absorption. It consists mainly |
64741-48-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-348-00-0 |
Naphtha (petroleum), light hydrocracked; Low boiling naphtha - unspecified; [A complex combination of hydrocarbons from distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers |
64741-69-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-349-00-6 |
Naphtha (petroleum), heavy hydrocracked; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons from distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon n |
64741-78-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-350-00-1 |
Naphtha (petroleum), sweetened; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum naphtha to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydr |
64741-87-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-351-00-7 |
Naphtha (petroleum), acid-treated; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the ran |
64742-15-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-352-00-2 |
Naphtha (petroleum), chemically neutralized heavy; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantl |
64742-22-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-353-00-8 |
Naphtha (petroleum), chemically neutralized light; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantl |
64742-23-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-354-00-3 |
Naphtha (petroleum), catalytic dewaxed; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from the catalytic dewaxing of a petroleum fraction. It consists predominantly of hydrocarbons having carbon numbers predom |
64742-66-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-355-00-9 |
Naphtha (petroleum), light steam-cracked; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the distillation of the products from a steam cracking process. It consists predominantly of unsaturated hydrocarbons |
64742-83-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-356-00-4 |
Solvent naphtha (petroleum), light arom.; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from distillation of aromatic streams. It consists predominantly of aromatic hydrocarbons having carbon numbers predomina |
64742-95-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-357-00-X |
Aromatic hydrocarbons, C6-10, acid-treated, neutralized; Low boiling point naphtha - unspecified |
68131-49-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-358-00-5 |
Distillates (petroleum), C3-5, 2-methyl-2-butene-rich; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons from the distillation of hydrocarbons usually ranging in carbon numbers from C3 through C5, predominantly isopentane a |
68477-34-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-359-00-0 |
Distillates (petroleum), polymd. steam-cracked petroleum distillates, C5-12 fraction; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from the distillation of polymerized steam-cracked petroleum distillate. It c |
68477-50-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-360-00-6 |
Distillates (petroleum), steam-cracked, C5-12 fraction; Low boiling point naphtha - unspecified; [A complex combination of organic compounds obtained by the distillation of products from a steam cracking process. It consists of unsaturated hydrocarbons |
68477-53-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-361-00-1 |
Distillates (petroleum), steam-cracked, C5-10 fraction, mixed with light steam-cracked petroleum naphtha C5 fraction; Low boiling point naphtha - unspecified |
68477-55-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-362-00-7 |
Extracts (petroleum), cold-acid, C4-6; Low boiling point naphtha - unspecified; [A complex combination of organic compounds produced by cold acid unit extraction of saturated and unsaturated aliphatic hydrocarbons usually ranging in carbon numbers from |
68477-61-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-363-00-2 |
Distillates (petroleum), depentanizer overheads; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from a catalytic cracked gas stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in |
68477-89-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-364-00-8 |
Residues (petroleum), butane splitter bottoms; Low boiling point naphtha - unspecified; [A complex residuum from the distillation of butane stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 through C6. |
68478-12-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-365-00-3 |
Residual oils (petroleum), deisobutanizer tower; Low boiling point naphtha - unspecified; [A complex residuum from the atmospheric distillation of the butane-butylene stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in |
68478-16-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-366-00-9 |
Naphtha (petroleum), full-range coker; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by the distillation of products from a fluid coker. It consists predominantly of unsaturated hydrocarbons having carbon numb |
68513-02-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-367-00-4 |
Naphtha (petroleum), steam-cracked middle arom.; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by the distillation of products from a steam-cracking process. It consists predominantly of aromatic hydrocarbons |
68516-20-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-368-00-X |
Naphtha (petroleum), clay-treated full-range straight-run; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons resulting from treatment of full-range straight-run naphtha with natural or modified clay, usually in a percolatio |
68527-21-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-369-00-5 |
Naphtha (petroleum), clay-treated light straight-run; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons resulting from treatment of light straight-run naphtha with a natural or modified clay, usually in a percolation proces |
68527-22-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-370-00-0 |
Naphtha (petroleum), light steam-cracked arom.; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by distillation of products from a steam-cracking process. It consists predominantly of aromatic hydrocarbons havin |
68527-23-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-371-00-6 |
Naphtha (petroleum), light steam-cracked, debenzenized; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by distillation of products from a steam-cracking process. It consists predominantly of hydrocarbons having |
68527-26-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-372-00-1 |
Naphtha (petroleum), arom.-contg.; Low boiling point naphtha - unspecified |
68603-08-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-373-00-7 |
Gasoline, pyrolysis, debutanizer bottoms; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from the fractionation of depropanizer bottoms. It consists of hydrocarbons having carbon numbers predominantly greater t |
68606-10-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-374-00-2 |
Naphtha (petroleum), light, sweetened; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consis |
68783-66-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-375-00-8 |
Natural gas condensates; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons separated and/or condensed from natural gas during transportation and collected at the wellhead and/or from the production, gathering, transmission, |
68919-39-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-376-00-3 |
Distillates (petroleum), naphtha unifiner stripper; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by stripping the products from the naphtha unifiner. It consists of saturated aliphatic hydrocarbons having car |
68921-09-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-377-00-9 |
Naphtha (petroleum), catalytic reformed light, arom.-free fraction; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons remaining after removal of aromatic compounds from catalytic reformed light naphtha in a selective absorp |
85116-59-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-378-00-4 |
Gasoline; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons consisting primarily of paraffins, cycloparaffins, aromatic and olefinic hydrocarbons having carbon numbers predominantly greater than C3 and boiling in the range |
86290-81-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-379-00-X |
Aromatic hydrocarbons, C7-8, dealkylation products, distn. residues; Low boiling point naphtha - unspecified |
90989-42-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-380-00-5 |
Hydrocarbons, C4-6, depentanizer lights, arom. hydrotreater; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained as first runnings from the depentanizer column before hydrotreatment of the aromatic charges. It consi |
91995-38-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-381-00-0 |
Distillates (petroleum), heat-soaked steam-cracked naphtha, C5-rich; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation of heat-soaked steam-cracked naphtha. It consists predominantly of hydrocarbon |
91995-41-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-382-00-6 |
Extracts (petroleum), catalytic reformed light naphtha solvent; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained as the extract from the solvent extraction of a catalytically reformed petroleum cut. It consists p |
91995-68-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-383-00-1 |
Naphtha (petroleum), hydrodesulfurized light, dearomatized; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation of hydrodesulfurized and dearomatized light petroleum fractions. It consists predominan |
92045-53-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-384-00-7 |
Naphtha (petroleum), light, C5-rich, sweetened; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum naphtha to a sweetening process to convert mercaptans or to remove acidic impurities. It |
92045-60-8 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-385-00-2 |
Hydrocarbons, C8-11, naphtha-cracking, toluene cut; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation from prehydrogenated cracked naphtha. It consists predominantly of hydrocarbons having carbon n |
92045-62-0 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-386-00-8 |
Hydrocarbons, C4-11, naphtha-cracking, arom.-free; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from prehydrogenated cracked naphtha after distillative separation of benzene- and toluene-containing hydrocarbon |
92045-63-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-387-00-3 |
Naphtha (petroleum), light heat-soaked, steam-cracked; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the fractionation of steam cracked naphtha after recovery from a heat soaking process. It consists predom |
92201-97-3 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-388-00-9 |
Distillates (petroleum), C6-rich; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from the distillation of a petroleum feedstock. It consists predominantly of hydrocarbons having carbon numbers of C5 through C7, |
93165-19-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-389-00-4 |
Gasoline, pyrolysis, hydrogenated; Low boiling point naphtha-unspecified; [A distillation fraction from the hydrogenation of pyrolysis gasoline boiling in the range of approximately 20°C to 200°C (68°F to 392°F).] |
94114-03-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-390-00-X |
Distillates (petroleum), steam-cracked, C8-12 fraction, polymd., distn. lights; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation of the polymerized C8 through C12 fraction from steam-cracked petrol |
95009-23-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-391-00-5 |
Extracts (petroleum) heavy naphtha solvent, clay-treated; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the treatment of heavy naphthic solvent petroleum extract with bleaching earth. It consists predominan |
97926-43-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-392-00-0 |
Naphtha (petroleum), light steam-cracked, debenzenized, thermally treated; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the treatment and distillation of debenzenized light steam-cracked petroleum naphtha. |
98219-46-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-393-00-6 |
Naphtha (petroleum), light steam-cracked, thermally treated; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the treatment and distillation of light steam-cracked petroleum naphtha. It consists predominantly |
98219-47-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-394-00-1 |
Distillates (petroleum), C7-9, C8-rich, hydrodesulfurized dearomatized; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the distillation of petroleum light fraction, hydrodesulfurized and dearomatized. It con |
101316-56-7 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-395-00-7 |
Hydrocarbons, C6-8, hydrogenated sorption-dearomatized, toluene raffination; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained during the sorptions of toluene from a hydrocarbon fraction from cracked gasoline treat |
101316-66-9 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-396-00-2 |
Naphtha (petroleum), hydrodesulfurised full-range coker; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurised coker distillate. It consists predominantly of hydrocarbons having |
101316-76-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-397-00-8 |
Naphtha (petroleum), sweetened light; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum naphtha to a sweetening process to convert mercaptans or to remove acidic impurities. It consists p |
101795-01-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-398-00-3 |
Hydrocarbons, C3-6, C5-rich, steam-cracked naphtha; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation of steam-cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers in th |
102110-14-5 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-399-00-9 |
Hydrocarbons, C5-rich, dicyclopentadiene-contg.; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation of the products from a steam-cracking process. It consists predominantly of hydrocarbons having ca |
102110-15-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-400-00-2 |
Residues (petroleum), steam-cracked light, arom.; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the distillation of the products of steam cracking or similar processes after taking off the very light product |
102110-55-4 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-401-00-8 |
Hydrocarbons, C≥5, C5-6-rich; Low boiling point naphtha - unspecified |
68476-50-6 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-402-00-3 |
Hydrocarbons, C5-rich; Low boiling point naphtha - unspecified |
68476-55-1 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-403-00-9 |
Aromatic hydrocarbons, C8-10; Low boiling point naphtha - unspecified |
90989-39-2 |
Carc. Cat. 2; R45, Muta. Cat. 2; R46, Xn; R65 |
|
P |
CLP00/ATP02 |
649-404-00-4 |
Kerosine (petroleum); Straight run kerosine; [A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of app |
8008-20-6 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-405-00-X |
Solvent naphtha (petroleum), medium aliph.; Straight run kerosine; [A complex combination of hydrocarbons obtained from the distillation of crude oil or natural gasoline. It consists predominantly of saturated hydrocarbons having carbon numbers predomin |
64742-88-7 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-406-00-5 |
Solvent naphtha (petroleum) heavy aliph.; Straight run kerosine; [A complex combination of hydrocarbons obtained from the distillation of crude oil or natural gasoline. It consists predominantly of saturated hydrocarbons having carbon numbers predominan |
64742-96-7 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-407-00-0 |
Kerosine (petroleum), straight-run wide-cut; Straight run kerosine; [A complex combination of hydrocarbons obtained as a wide cut hydrocarbon fuel cut from atmospheric distillation and boiling in the range of approximately 70 °C to 220 °C (158 °F to 428 |
92045-37-9 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-408-00-6 |
Distillates (petroleum), steam-cracked; Cracked kerosine; [A complex combination of hydrocarbons obtained by the distillation of the products from a steam cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers pred |
64742-91-2 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-409-00-1 |
Distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C8-10 fraction; Cracked kerosine; [A complex combination of hydrocarbons obtained by distilling cracked stripped steam-cracked distillates. It consists of hydro-carbons havin |
68477-39-4 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-410-00-7 |
Distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C10-12 fraction; Cracked kerosine; [A complex combination of hydrocarbons obtained by distilling cracked stripped steam-cracked distillates. It consists predominantly of arom |
68477-40-7 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-411-00-2 |
Distillates (petroleum), steam-cracked, C8-12 fraction; Cracked kerosine; [A complex combination of organic compounds obtained by the distillation of products from a steam cracking process. It consists predominantly of unsaturated hydrocarbons having ca |
68477-54-3 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-412-00-8 |
Kerosine (petroleum), hydrodesulfurized thermal cracked; Cracked kerosine; [A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized thermal cracker distillate. It consists predominantly of hydrocarbons predominantly in the |
85116-55-8 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-413-00-3 |
Aromtic hydrocarbons, C≥10, steam-cracking, hydrotreated; Cracked kerosine; [A complex combination of hydrocarbons produced by the distillation of the products from a steam cracking process treated with hydrogen in the presence of a catalyst. It consist |
90640-98-5 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-414-00-9 |
Naphtha (petroleum), steam-cracked, hydrotreated, C9-10-arom.-rich; Cracked kerosine; [A complex combination of hydrocarbons produced by the distillation of the products from a steam cracking process thereafter treated with hydrogen in the presence of a |
90641-13-7 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-415-00-4 |
Distillates (petroleum), thermal-cracked, alkylarom. hydrocarbon-rich; Cracked kerosine; [A complex combination of hydrocarbons obtained by distillation of thermal-cracking heavy tars. It consists predominantly of highly alkylated aromatic hydrocarbons |
101316-61-4 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-416-00-X |
Distillates (petroleum), catalytic cracked heavy tar light; Cracked kerosine; [A complex combination of hydrocarbons obtained by distillation of catalytic cracking heavy tars. It consists predominantly of highly alkylated aromatic hydrocarbons boiling i |
101631-13-4 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-417-00-5 |
Solvent naphtha (petroleum), hydrocracked heavy arom.; Cracked kerosine; [A complex combination of hydrocarbons obtained by the distillation of hydrocracked petroleum distillate. It consists predominantly of hydrocarbons having carbon numbers predominan |
101316-80-7 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-418-00-0 |
Distillates (petroleum), steam-cracked heavy tar light; Cracked kerosine; [A complex combination of hydrocarbons obtained by distillation of steam cracking heavy tars. It consists predominantly of highly alkylated aromatic hydrocarbons boiling in the ra |
101631-15-6 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-419-00-6 |
Distillates (petroleum), alkylate; Kerosine - unspecified; [A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 through C5. It cons |
64741-73-7 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-420-00-1 |
Extracts (petroleum), heavy naphtha solvent; Kerosine - unspecified; [A complex combination of hydrocarbons obtained as the extract from a solvent extraction process. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly |
64741-98-6 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-421-00-7 |
Distillates (petroleum), chemically neutralized light; Kerosine - unspecified; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range |
64742-31-0 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-422-00-2 |
Distillates (petroleum), hydrotreated light; Kerosine - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predomin |
64742-47-8 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-423-00-8 |
Kerosine (petroleum), hydrodesulfurized; Kerosine - unspecified; [A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons |
64742-81-0 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-424-00-3 |
Solvent naphtha (petroleum), heavy arom.; Kerosine - unspecified; [A complex combination of hydrocarbons obtained from distillation of aromatic streams. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range o |
64742-94-5 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-425-00-9 |
Naphtha (petroleum), heavy coker; Kerosine - unspecified; [A complex combination of hydrocarbons from the distillation of products from a fluid coker. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range |
68333-23-3 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-426-00-4 |
Naphtha (petroleum), catalytic reformed hydrodesulfurized heavy, arom. fraction; Kerosine - unspecified; [A complex combination of hydrocarbons produced by fractionation from catalytically reformed hydrodesulfurized naphtha. It consists predominantly of |
85116-57-0 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-427-00-X |
Kerosine (petroleum), sweetened; Kerosine - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of hydr |
91770-15-9 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-428-00-5 |
Kerosine (petroleum), solvent-refined sweetened; Kerosine - unspecified; [A complex combination of hydrocarbons obtained from a petroleum stock by solvent refining and sweetening and boiling in the range of approximately 150 °C to 260 °C (302 °F to 500 |
92045-36-8 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-429-00-0 |
Hydrocarbons, C9-16, hydrotreated, dearomatized; Kerosine - unspecified; [A complex combination of hydrocarbons obtained as solvents which have been subjected to hydrotreatment in order to convert aromatics to naphthenes by catalytic hydrogenation.] |
93763-35-0 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-430-00-6 |
Kerosine (petroleum), solvent-refined hydrodesulfurized; Kerosine - unspecified |
97488-94-3 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-431-00-1 |
Distillates (petroleum), hydrodesulfurized full-range middle coker; Kerosine - unspecified; [A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized coker distillate. It consists predominantly of hydrocarbons having carbon |
101316-58-9 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-432-00-7 |
Solvent naphtha (petroleum), hydrodesulfurized heavy arom.; Kerosine - unspecified; [A complex combination of hydrocarbons obtained by the catalytic hydrodesulfurization of a petroleum fraction. It consists predominantly of hydrocarbons having carbon nu |
101316-81-8 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-433-00-2 |
Solvent naphtha (petroleum), hydrodesulfurized medium; Kerosine - unspecified; [A complex combination of hydrocarbons obtained by the catalytic hydrodesulfurization of a petroleum fraction. It consists predominantly of hydrocarbons having carbon numbers |
101316-82-9 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-434-00-8 |
Kerosine (petroleum), hydrotreated; Kerosine - unspecified; [A complex combination of hydrocarbons obtained from the distillation of petroleum and subsequent hydrotreatment. It consists predominantly of alkanes, cycloalkanes and alkylbenzenes having car |
101631-19-0 |
Xn; R65 |
|
|
CLP00/ATP02 |
649-435-00-3 |
Distillates (petroleum), light catalytic cracked; Cracked gasoil; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the r |
64741-59-9 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-436-00-9 |
Distillates (petroleum), intermediate catalytic cracked; Cracked gasoil; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly i |
64741-60-2 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-437-00-4 |
Distillates (petroleum), light hydrocracked; Cracked gasoil; [A complex combination of hydrocarbons from distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly i |
64741-77-1 |
Carc. Cat. 3; R40 |
|
|
CLP00/ATP02 |
649-438-00-X |
Distillates (petroleum), light thermal cracked; Cracked gasoil; [A complex combination of hydrocarbons from the distillation of the products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers pre |
64741-82-8 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-439-00-5 |
Distillates (petroleum), hydrodesulfurized light catalytic cracked; Cracked gasoil; [A complex combination of hydrocarbons obtained by treating light catalytic cracked distillates with hydrogen to convert organic sulfur to hydrogen sulfide which is remo |
68333-25-5 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-440-00-0 |
Distillates (petroleum), light steam-cracked naphtha; Cracked gasoil; [A complex combination of hydrocarbons from the multiple distillation of products from a steam cracking process. It consists of hydrocarbons having carbon numbers predominantly in the |
68475-80-9 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-441-00-6 |
Distillates (petroleum), cracked steam-cracked petroleum distillates; Cracked gasoil; [A complex combination of hydrocarbons produced by distilling cracked steam cracked distillate and/or its fractionation products. It consists of hydrocarbons having ca |
68477-38-3 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-442-00-1 |
Gas oils (petroleum), steam-cracked; Cracked gasoil; [A complex combination of hydrocarbons produced by distillation of the products from a steam cracking process. It consists of hydrocarbons having carbon numbers predominantly greater than C9 and boili |
68527-18-4 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-443-00-7 |
Distillates (petroleum), hydrodesulfurized thermal cracked middle; Cracked gasoil; [A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized themal cracker distillate stocks. It consists predominantly of hydrocarbons having |
85116-53-6 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-444-00-2 |
Gas oils (petroleum), thermal-cracked, hydrodesulfurized; Cracked gasoil |
92045-29-9 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-445-00-8 |
Residues (petroleum), hydrogenated steam-cracked naphtha; Cracked gasoil; [A complex combination of hydrocarbons obtained as a residual fraction from the distillation of hydrotreated steam-cracked naphtha. It consists predominantly of hydrocarbons boili |
92062-00-5 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-446-00-3 |
Residues (petroleum), steam-cracked naphtha distn.; Cracked gasoil; [A complex combination of hydrocarbons obtained as a column bottom from the separation of effluents from steam cracking naphtha at a high temperature. It boils in the range of approxima |
92062-04-9 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-447-00-9 |
Distillates (petroleum), light catalytic cracked, thermally degraded; Cracked gasoil; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process which has been used as a heat transfer fluid. It cons |
92201-60-0 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-448-00-4 |
Residues (petroleum), steam-cracked heat-soaked naphtha; Cracked gasoil; [A complex combination of hydrocarbons obtained as residue from the distillation of steam cracked heat soaked naphtha and boiling in the range of approximately 150 °C to 350 °C (30 |
93763-85-0 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-449-00-X |
Hydrocarbons, C16-20, solvent-dewaxed hydrocracked paraffinic distn. residue; Cracked gasoil; [A complex combination of hydrocarbons obtained by solvent dewaxing of a distillation residue from a hydrocracked paraffinic distillate. It consists predominan |
97675-88-2 |
Carc. Cat. 3; R40 |
|
|
CLP00/ATP02 |
649-450-00-5 |
Gas oils (petroleum), light vacuum, thermal-cracked hydrodesulfurized; Cracked gasoil; [A complex combination of hydrocarbons obtained by catalytic dehydrosulfurization of thermal-cracked light vacuum petroleum. It consists predominantly of hydrocarbons |
97926-59-5 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-451-00-0 |
Distillates (petroleum), hydrodesulfurized middle coker; Cracked gasoil; [A complex combination of hydrocarbons by fractionation from hydrodesulfurised coker distillate stocks. Is consists of hydro-carbons having carbon numbers predominantly in the rang |
101316-59-0 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-452-00-6 |
Distillates (petroleum), heavy steam-cracked; Cracked gasoil; [A complex combination of hydrocarbons obtained by distillation of steam cracking heavy residues. It consists predominantly of highly alkylated heavy aromatic hydrocarbons boiling in the rang |
101631-14-5 |
Carc. Cat. 2; R45 |
|
|
CLP00/ATP02 |
649-453-00-1 |
Distillates (petroleum), heavy hydrocracked; Baseoil - unspecified; [A complex combination of hydrocarbons from the distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers in t |
64741-76-0 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-454-00-7 |
Distillates (petroleum), solvent-refined heavy paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of saturated hydrocarbons having carbon numbe |
64741-88-4 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-455-00-2 |
Distillates (petroleum), solvent-refined light paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of saturated hydrocarbons having carbon numbe |
64741-89-5 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-456-00-8 |
Residual oils (petroleum), solvent deasphalted; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as the solvent soluble fraction from C3-C4 solvent deasphalting of a residuum. It consists of hydrocarbons having carbon numbers predo |
64741-95-3 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-457-00-3 |
Distillates (petroleum), solvent-refined heavy naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists of hydrocarbons having carbon numbers predominantly in the |
64741-96-4 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-458-00-9 |
Distillates (petroleum), solvent-refined light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists of hydrocarbons having carbon numbers predominantly in the |
64741-97-5 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-459-00-4 |
Residual oils (petroleum,) solvent-refined; Baseoil - unspecified; [A complex combination by hydrocarbons obtained as the solvent insoluble fraction from solvent refining of a residuum using a polar organic solvent such as phenol or furfural. It consist |
64742-01-4 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-460-00-X |
Distillates (petroleum), clay-treated paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove the tr |
64742-36-5 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-461-00-5 |
Distillates (petroleum), clay-treated light paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove |
64742-37-6 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-462-00-0 |
Residual oils (petroleum), clay-treated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treatment of a residual oil with a natural or modified clay in either a contacting or percolation process to remove the trace amounts of p |
64742-41-2 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-463-00-6 |
Distillates (petroleum), clay-treated heavy naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove |
64742-44-5 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-464-00-1 |
Distillates (petroleum), clay-treated light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove |
64742-45-6 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-465-00-7 |
Distillates (petroleum), hydrotreated heavy naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon number |
64742-52-5 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-466-00-2 |
Distillates (petroleum), hydrotreated light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon number |
64742-53-6 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-467-00-8 |
Distillates (petroleum), hydrotreated heavy paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon number |
64742-54-7 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-468-00-3 |
Distillates (petroleum), hydrotreated light paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon number |
64742-55-8 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-469-00-9 |
Distillates (petroleum), solvent-dewaxed light paraffinic; Baseoil - unspecified; [A complex comination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists predominantly of hydrocarbo |
64742-56-9 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-470-00-4 |
Residual oils (petroleum), hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly |
64742-57-0 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-471-00-X |
Residual oils (petroleum), solvent-dewaxed; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by removal of long, branched chain hydrocarbons from a residual oil by solvent crystallization. It consists of hydrocarbons having carbon |
64742-62-7 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-472-00-5 |
Distillates (petroleum), solvent-dewaxed heavy naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists of hydrocarbons having car |
64742-63-8 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-473-00-0 |
Distillates (petroleum), solvent-dewaxed light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists of hydrocarbons having car |
64742-64-9 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-474-00-6 |
Distillates (petroleum), solvent-dewaxed heavy paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists predominantly of hydrocarb |
64742-65-0 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-475-00-1 |
Naphthenic oils (petroleum), catalytic dewaxed heavy; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of |
64742-68-3 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-476-00-7 |
Naphthenic oils (petroleum), catalytic dewaxed light; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C |
64742-69-4 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-477-00-2 |
Paraffin oils (petroleum), catalytic dewaxed heavy; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C |
64742-70-7 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-478-00-8 |
Paraffin oils (petroleum), catalytic dewaxed light; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from a catalytic dewxing process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 |
64742-71-8 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-479-00-3 |
Naphthenic oils (petroleum), complex dewaxed heavy; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by removing straight chain paraffin hydrocarbons as a solid by treatment with an agent such as urea. It consists of hydrocarbons h |
64742-75-2 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-480-00-9 |
Naphthenic oils (petroleum), complex dewaxed light; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 |
64742-76-3 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-481-00-4 |
Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based, high-viscosity; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating light vacuum gas oil, heavy vacuum gas oil, and solvent deasphalted residual oil wit |
72623-85-9 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-482-00-X |
Lubricating oils (petroleum), C15-30, hydrotreated neutral oil-based; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating light vacuum gas oil and heavy vacuum gas oil with hydrogen in the presence of a catalyst in a two s |
72623-86-0 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-483-00-5 |
Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating light vacuum gas oil, heavy vacuum gas oil and solvent deasphalted residual oil with hydrogen in the |
72623-87-1 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-484-00-0 |
Lubricating oils; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from solvent extraction and dewaxing processes. It consists predominantly of saturated hydrocarbons having carbon numbers in the range C15 through C50.] |
74869-22-0 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-485-00-6 |
Distillates (petroleum), complex dewaxed heavy paraffinci; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by dewaxing heavy paraffinic distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in t |
90640-91-8 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-486-00-1 |
Distillates (petroleum), complex dewaxed light paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by dewaxing light paraffinic distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in t |
90640-92-9 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-487-00-7 |
Distillates (petroleum), solvent dewaxed heavy paraffinic, clay-treated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating dewaxed heavy paraffinic distillate with neutral or modified clay in either a contacting or perco |
90640-94-1 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-488-00-2 |
Hydrocarbons, C20-50, solvent dewaxed heavy paraffinic, hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons produced by treating dewaxed heavy paraffinic distillate with hydrogen in the presence of a catalyst. It consists predomi |
90640-95-2 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-489-00-8 |
Distillates (petroleum), solvent dewaxed light paraffinic, clay-treated; Baseoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of dewaxed light paraffinic distillate with natural or modified clay in either a contacting o |
90640-96-3 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-490-00-3 |
Distillates (petroleum), solvent dewaxed light paraffinic, hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons produced by treating a dewaxed light paraffinic distillate with hydrogen in the presence of a catalyst. It consists pr |
90640-97-4 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-491-00-9 |
Residual oils (petroleum), hydrotreated solvent dewaxed; Baseoil - unspecified |
90669-74-2 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-492-00-4 |
Residual oils (petroleum), catalytic dewaxed; Baseoil - unspecified |
91770-57-9 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-493-00-X |
Distillates (petroleum), dewaxed heavy paraffinic, hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from an intensive treatment of dewaxed distillate by hydrogenation in the presence of a catalyst. It consists predomi |
91995-39-0 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-494-00-5 |
Distillates (petroleum), dewaxed light paraffinic, hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from an intensive treatment of dewaxed distillate by hydrogenation in the presence of a catalyst. It consists predomi |
91995-40-3 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-495-00-0 |
Distillates (petroleum), hydrocracked solvent-refined, dewaxed; Baseoil - unspecified; [A complex combination of liquid hydrocarbons obtained by recrystallization of dewaxed hydrocracked solvent-refined petroleum distillates.] |
91995-45-8 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-496-00-6 |
Distillates (petroleum), solvent-refined light naphthenic, hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst and removing the aromatic hydroc |
91995-54-9 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-497-00-1 |
Lubricating oils (petroleum), C17-35, solvent-extd., dewaxed, hydrotreated; Baseoil - unspecified |
92045-42-6 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-498-00-7 |
Lubricating oils (petroleum), hydrocracked nonarom. solvent-deparaffined; Baseoil - unspecified |
92045-43-7 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-499-00-2 |
Residual oils (petroleum), hydrocracked acid-treated solvent-dewaxed; Baseoil - unspecified; [A complex combination of hydrocarbons produced by solvent removal of paraffins from the residue of the distillation of acid-treated, hydrocracked heavy paraffi |
92061-86-4 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-500-00-6 |
Paraffin oils (petroleum), solvent-refined dewaxed heavy; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from sulfur-containing paraffinic crude oil. It consists predominantly of a solvent refined deparaffinated lubricating oil w |
92129-09-4 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-501-00-1 |
Lubricating oils (petroleum), base oils, paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by refining of crude oil. It consists predominantly of aromatics, naphthenics and paraffinics and produces a finished oil with a |
93572-43-1 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-502-00-7 |
Hydrocarbons, hydrocracked paraffinic distn. residues, solvent-dewaxed; Baseoil - unspecified |
93763-38-3 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-503-00-2 |
Hydrocarbons, C20-50, residual oil hydrogenation vacuum distillate; Baseoil - unspecified |
93924-61-9 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-504-00-8 |
Distillates (petroleum), solvent-refined hydrotreated heavy, hydrogenated; Baseoil - unspecified |
94733-08-1 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-505-00-3 |
Distillates (petroleum), solvent-refined hydrocracked light; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent dearomatization of the residue of hydrocracked petroleum. It consists predominantly of hydrocarbons having car |
94733-09-2 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-506-00-9 |
Lubricating oils (petroleum), C18-40, solvent-dewaxed hydrocracked distillate-based; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent deparaffination of the distillation residue from hydrocracked petroleum. It consists p |
94733-15-0 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-507-00-4 |
Lubricating oils (petroleum), C18-40, solvent-dewaxed hydrogenated raffinate-based; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent deparaffination of the hydrogenated raffinate obtained by solvent extraction of a hydro |
94733-16-1 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-508-00-X |
Hydrocarbons, C13-30, arom.-rich, solvent-extd. naphthenic distillate; Baseoil - unspecified |
95371-04-3 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-509-00-5 |
Hydrocarbons, C16-32, arom. rich, solvent-extd. naphthenic distillate; Baseoil - unspecified |
95371-05-4 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-510-00-0 |
Hydrocarbons, C37-68, dewaxed deasphalted hydrotreated vacuum distn. residues; Baseoil - unspecified |
95371-07-6 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-511-00-6 |
Hydrocarbons, C37-65, hydrotreated deasphalted vacuum distn. residues; Baseoil - unspecified |
95371-08-7 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-512-00-1 |
Distillates (petroleum), hydrocracked solvent-refined light; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by the solvent treatment of a distillate from hydrocracked petroleum distillates. It consists predominantly of hydrocarbo |
97488-73-8 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-513-00-7 |
Distillates (petroleum), solvent-refined hydrogenated heavy; Baseoil - unspecified; [A complex combination of hydrocarbons, obtained by the treatment of a hydrogenated petroleum distillate with a solvent. It consists predominantly of hydrocarbons having |
97488-74-9 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-514-00-2 |
Lubricating oils (petroleum), C18-27, hydrocracked solvent-dewaxed; Baseoil - unspecified |
97488-95-4 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-515-00-8 |
Hydrocarbons, C17-30, hydrotreated solvent-deasphalted atm. distn. residue, distn. lights; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the treatment of a solvent |
97675-87-1 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-516-00-3 |
Hydrocarbons, C17-40, hydrotreated solvent-deasphalted distn. residue, vacuum distn. lights; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the catalytic hydrotreat |
97722-06-0 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-517-00-9 |
Hydrocarbons, C13-27, solvent-extd. light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by extraction of the aromatics from a light naphthenic distillate having a viscosity of 9.5cSt at 40 °C (104 °F). It consists pr |
97722-09-3 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-518-00-4 |
Hydrocarbons, C14-29, solvent-extd. light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by extraction of the aromatics from a light naphthenic distillate having a viscosity of 16cSt at 40 °C (104 °F). It consists pre |
97722-10-6 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-519-00-X |
Hydrocarbons, C27-42, dearomatized; Baseoil - unspecified |
97862-81-2 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-520-00-5 |
Hydrocarbons, C17-30, hydrotreated distillates, distn. lights; Baseoil - unspecified |
97862-82-3 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-521-00-0 |
Hydrocarbons, C27-45, naphthenic vacuum distn.; Baseoil - unspecified |
97862-83-4 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-522-00-6 |
Hydrocarbons, C27-45, dearomatized; Baseoil - unspecified |
97926-68-6 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-523-00-1 |
Hydrocarbons, C20-58, hydrotreated; Baseoil - unspecified |
97926-70-0 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-524-00-7 |
Hydrocarbons, C27-42, naphthenic; Baseoil - unspecified |
97926-71-1 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-525-00-2 |
Residual oils (petroleum), carbon-treated solvent-dewaxed; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by the treatment of solvent-dewaxed petroleum residual oils with activated charcoal for the removal of trace polar constitu |
100684-37-5 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-526-00-8 |
Residual oils (petroleum), clay-treated solvent-dewaxed; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treatment of solvent-dewaxed petroleum residual oils with bleaching earth for the removal of trace polar constituents and |
100684-38-6 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-527-00-3 |
Lubricating oils (petroleum), C >25, solvent-extd., deasphalted, dewaxed, hydrogenated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of vacuum distillation residues. It consists predomina |
101316-69-2 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-528-00-9 |
Lubricating oils (petroleum), C17-32, solvent-extd., dewaxed, hydrogenated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of atmospheric distillation residues. It consists predominantly of |
101316-70-5 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-529-00-4 |
Lubricating oils (petroleum), C20-35, solvent-extd., dewaxed, hydrogenated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of atmospheric distillation residues. It consists predominantly of |
101316-71-6 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-530-00-X |
Lubricating oils (petroleum), C24-50, solvent-extd., dewaxed, hydrogenated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of atmospheric distillation residues. It consists predominantly of |
101316-72-7 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-531-00-5 |
Extracts (petroleum), heavy naphthenic distillate solvent, arom. conc.; Distillate aromatic extract (treated); [An aromatic concentrate produced by adding water to heavy naphthenic distillate solvent extract and extraction solvent.] |
68783-00-6 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-532-00-0 |
Extracts (petroleum), solvent-refined heavy paraffinic distillate solvent; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as the extract from the re-extraction of solvent-refined heavy paraffinic distillate. It co |
68783-04-0 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-533-00-6 |
Extracts (petroleum), heavy paraffinic distillates, solvent-deasphalted; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as the extract from a solvent extraction of heavy paraffinic distillate.] |
68814-89-1 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-534-00-1 |
Extracts (petroleum), heavy naphthenic distillate solvent, hydrotreated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained by treating a heavy naphthenic distillate solvent extract with hydrogen in the presence of a |
90641-07-9 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-535-00-7 |
Extracts (petroleum), heavy paraffinic distillate solvent, hydrotreated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons produced by treating a heavy paraffinic distillate solvent extract with hydrogen in the presence of a |
90641-08-0 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-536-00-2 |
Extracts (petroleum), light paraffinic distillate solvent, hydrotreated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons produced by treating a light paraffinic distillate solvent extract with hydrogen in the presence of a |
90641-09-1 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-537-00-8 |
Extracts (petroleum), hydrotreated light paraffinic distillate solvent; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as the extract from solvent extraction of intermediate paraffinic top solvent distillate that |
91995-73-2 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-538-00-3 |
Extracts (petroleum), light naphthenic distillate solvent, hydrodesulfurized; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained by treating the extract, obtained from a solvent extraction process, with hydrogen in th |
91995-75-4 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-539-00-9 |
Extracts (petroleum), light paraffinic distillate solvent, acid-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as a fraction of the distillation of an extract from the solvent extraction of light paraffin |
91995-76-5 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-540-00-4 |
Extracts (petroleum), light paraffinic distillate solvent, hydrodesulfurized; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained by solvent extraction of a light paraffin distillate and treated with hydrogen to conver |
91995-77-6 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-541-00-X |
Extracts (petroleum), light vacuum gas oil solvent, hydrotreated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons, obtained by solvent extraction from light vacuum petroleum gas oils and treated with hydrogen in the presenc |
91995-79-8 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-542-00-5 |
Extracts (petroleum), heavy paraffinic distillate solvent, clay-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contact or |
92704-08-0 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-543-00-0 |
Extracts (petroleum), heavy naphthenic distillate solvent, hydrodesulfurized; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen s |
93763-10-1 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-544-00-6 |
Extracts (petroleum), solvent-dewaxed heavy paraffinic distillate solvent, hydrodesulfurized; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained from a solvent dewaxed petroleum stock by treating with hydrogen to conv |
93763-11-2 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-545-00-1 |
Extracts (petroleum), light paraffinic distillate solvent, carbon-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as a fraction from distillation of an extract recovered by solvent extraction of light para |
100684-02-4 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-546-00-7 |
Extracts (petroleum), light paraffinic distillate solvent, clay-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as a fraction from distillation of an extract recovered by solvent extraction of light paraff |
100684-03-5 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-547-00-2 |
Extracts (petroleum), light vacuum, gas oil solvent, carbon-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained by solvent extraction of light vacuum petroleum gas oil treated with activated charcoal for the r |
100684-04-6 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-548-00-8 |
Extracts (petroleum), light vacuum gas oil solvent, clay-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained by solvent extraction of light vacuum petroleum gas oils treated with bleaching earth for removal of |
100684-05-7 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-549-00-3 |
Foots oil (petroleum); Foots oil; [A complex combination of hydrocarbons obtained as the oil fraction from a solvent deoiling or a wax sweating process. It consists predominantly of branched chain hydrocarbons having carbon numbers predominantly in the |
64742-67-2 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
649-550-00-9 |
Foots oil (petroleum), hydrotreated; Foots oil |
92045-12-0 |
Carc. Cat. 2; R45 |
|
L |
CLP00/ATP02 |
650-002-00-6 |
turpentine, oil |
8006-64-2 |
R10, Xn; R20/21/22-65, Xi; R36/38, R43, N; R51-53 |
|
|
|
650-003-00-1 |
fenson (ISO); 4-chlorophenyl benzenesulphonate |
80-38-6 |
Xn; R22, Xi; R36, N; R51-53 |
|
|
|
650-004-00-7 |
norbormide (ISO); 5-(α-hydroxy-α-2-pyridylbenzyl)-7-(α-2-pyridylbenzylidene)bicyclo [2.2.1] hept-5-ene-2,3-dicarboximide |
991-42-4 |
Xn; R22 |
|
|
|
650-005-00-2 |
(2R,6aS,12aS)-1,2,6,6a,12,12a-hexahydro-2-isopropenyl-8,9-dimethoxychromeno[3,4-b]furo[2,3-h]chromen-6-one; rotenone |
83-79-4 |
T; R25, Xi; R36/37/38, N; R50-53 |
|
|
|
650-006-00-8 |
benquinox (ISO); p-benzoquinone 1-benzoylhydrazone 4-oxime |
495-73-8 |
T; R25, Xn; R21 |
|
|
|
650-007-00-3 |
chlordimeform (ISO); N2-(4-chloro-o-tolyl)-N1,N1-dimethylformamidine |
6164-98-3 |
Carc. Cat. 3; R40, Xn; R21/22, N; R50-53 |
|
|
|
650-008-00-9 |
drazoxolon (ISO); 4-(2-chlorophenylhydrazone)-3-methyl-5-isoxazolone |
5707-69-7 |
T; R25, N; R50-53 |
|
|
|
650-009-00-4 |
chlordimeform hydrochloride; N'-(4-chloro-o-tolyl)-N,N-dimethylformamidine monohydrochloride; N2-(4-chloro-o-tolyl)-N1,N1-dimethylformamidine hydorchloride |
19750-95-9 |
Carc. Cat. 3; R40, Xn; R22, N; R50-53 |
|
|
|
650-010-00-X |
benzyl violet 4B; α-[4-(4-dimethylamino-α-{}{4-[ethyl(3-sodiosulphonatobenzyl)amino] phenyl}}benzylidene)cyclohexa-2,5-dienylidene(ethyl)ammonio]toluene-3-sulphonate |
1694-09-3 |
Carc. Cat. 3; R40 |
|
|
|
650-012-00-0 |
erionite |
12510-42-8 |
Carc. Cat. 1; R45 |
|
|
|
650-013-00-6 |
asbestos |
12001-28-4, 132207-32-0, 12172-73-5, 77536-66-4, 77536-68-6, 77536-67-5, 12001-29-5 |
Carc. Cat. 1; R45, T; R48/23 |
|
E |
|
650-014-00-1 |
diethyl 2,4-dihydroxycyclodisiloxane-2,4-diylbis(trimethylene)diphosphonate, tetrasodium salt, reaction products with disodium metasilicate |
- |
C; R34, Xn; R22 |
|
|
|
650-015-00-7 |
rosin; colophony |
8050-09-7, 8052-10-6, 73138-82-6 |
R43 |
|
|
|
650-016-00-2 |
Mineral wool, with the exception of those specified elsewhere in this Annex; [Man-made vitreous (silicate) fibres with random orientation with alkaline oxide and alkali earth oxide (Na2O+K2O+CaO+MgO+BaO) content greater than 18 % by weight] |
- |
Carc. Cat. 3 ; R40 |
|
A Q R |
|
650-017-00-8 |
Refractory Ceramic Fibres, Special Purpose Fibres, with the exception of those specified elsewhere in this Annex; [Man-made vitreous (silicate) fibres with random orientation with alkaline oxide and alkali earth oxide (Na2O+K2O+CaO+ MgO+BaO) content less |
- |
Carc. Cat. 2; R49 |
|
A R |
|
650-018-00-3 |
reaction product of: acetophenone, formaldehyde, cyclohexylamine, methanol and acetic acid |
- |
R10, Carc. Cat. 3; R40, C; R34, Xn; R20, R43, N; R50-53 |
|
|
|
650-031-00-4 |
bis(4-hydroxy-N-methylanilinium) sulphate |
55-55-0 |
Xn; R22-48/22, R43, N; R50-53 |
|
|
|
650-032-00-X |
cyproconazole (ISO); (2RS,3RS;2RS,3SR)-2-(4-chlorophenyl)-3-cyclopropyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol |
94361-06-5 |
Repr. Cat. 3; R63, Xn; R22, N; R50-53 |
|
|
|
650-041-00-9 |
triasulfuron (ISO); 1-[2-(2-chloroethoxy)phenylsulfonyl]-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea |
82097-50-5 |
N; R50-53 |
|
|
|
650-042-00-4 |
reaction product of: polyethylene-polyamine-(C16-C18)-alkylamides with monothio-(C2)-alkyl phosphonates |
- |
Xi; R36/38, R43, R52-53 |
|
|
|
650-043-00-X |
reaction product of: 3,5-bis-tert-butylsalicylic acid and aluminiumsulfate |
- |
Xn; R22, N; R50-53 |
|
|
|
650-044-00-5 |
mixed linear and branched C14-15 alcohols ethoxylated, reaction product with epichlorohydrin |
158570-99-1 |
Xi; R38, R43, N; R50-53 |
|
|
|
650-045-00-0 |
reaction product of: 1,2,3-propanetricarboxylic acid, 2-hydroxy, diethyl ester, 1-propanol and zirconium tetra-n-propanolate |
- |
F; R11, Xi; R38-41, N; R51-53 |
|
|
|
650-046-00-6 |
di(tetramethylammonium)(29H,31H-phthalocyanin-N29,N30,N31,N32)disulfonamide disulfonate, cuprate(2-)complex, derivates |
12222-04-7 |
Xn; R22-48/22, N; R51-53 |
|
|
|
650-047-00-1 |
dibenzylphenylsulfonium hexafluoroantimonate |
134164-24-2 |
T; R48/25, Xn; R22, Xi; R41, R43, N; R51-53 |
|
|
|
650-048-00-7 |
reaction product of: borax, hydrogen peroxide, acetic acid anhydride and acetic acid |
- |
O; R7, Xn; R20/21/22, C; R35, N; R50 |
|
|
|
650-049-00-2 |
2-alkoyloxyethyl hydrogen maleate, where alkoyl represents (by weight) 70 to 85 % unsaturated octadecoyl, 0.5 to 10 % saturated octadecoyl, and 2 to 18 % saturated hexadecoyl |
- |
Xi; R38-41, R43, N; R50-53 |
|
|
|
650-050-00-8 |
reaction mass of: 1-methyl-3-hydroxypropyl 3,5-[1,1-dimethylethyl]-4-hydroxydihydro-cinnamate and/or 3-hydroxybutyl 3,5-[1,1-dimethylethyl]-4-hydroxydihydrocinnamate; 1,3-butanediol bis[3-(3'-(1,1-dimethylethyl)4'-hydroxy-phenyl)propionate] isomers; 1,3 |
- |
N; R51-53 |
|
|
|
650-055-00-5 |
silver sodium zirconium hydrogenphosphate |
155925-27-2 |
N; R50-53 |
|
|
|